Compare commits

...

415 Commits

Author SHA1 Message Date
Sébastien Bourdeauducq e1f493f3ca drtio: add InjectionRequest to expects_response 2024-11-26 14:58:24 +08:00
Sebastien Bourdeauducq 1f5ea41934 flake: update dependencies 2024-11-20 19:58:55 +08:00
Sebastien Bourdeauducq 7f83d56ef5 cargo fmt 2024-11-20 09:42:49 +08:00
Jonathan Coates 1d431456f4 Fix DWARF parser treating catch blocks as unconditional
Signed-off-by: Jonathan Coates <jonathan.coates@oxionics.com>
2024-11-20 09:32:38 +08:00
Sebastien Bourdeauducq b03e380c1e flake: update dependencies 2024-11-20 09:07:00 +08:00
occheung 47fc53c4bf drtio_tuple -> drtio_context 2024-11-18 13:13:10 +08:00
occheung 42eaecf9e1 remove debug message 2024-11-18 12:19:37 +08:00
occheung beb7e6f994 cargo fmt 2024-11-18 12:19:37 +08:00
occheung 4502a47aa6 drtio_proto: add allocate step for flashing
This avoids reallocation while transfering binaries.
2024-11-18 12:19:37 +08:00
occheung ac6b7d5cf0 satman: fix checksum error message 2024-11-18 12:19:37 +08:00
occheung 3019bc6123 runtime: check crc when flashing 2024-11-18 12:19:37 +08:00
occheung 95b8562812 cargo fmt 2024-11-18 12:19:37 +08:00
occheung a13f5d02fa mgmt: supplementary tuple -> tuple struct 2024-11-18 12:19:37 +08:00
occheung e52aa77068 cargo fmt 2024-11-18 12:19:37 +08:00
occheung 8e28d12ad0 runtime mgmt: avoid pull_log resource hog 2024-11-18 12:19:37 +08:00
occheung 47cddae04f runtime mgmt: avoid passing incomplete log to core_log 2024-11-18 12:19:37 +08:00
occheung 27a65df40e satman mgmt: fix uart log level change message 2024-11-18 12:19:37 +08:00
occheung 759cca3bfd satman mgmt: allow sliceable to consume log source 2024-11-18 12:19:37 +08:00
occheung aadb6fc22d satman mgmt: get logger unconditionally 2024-11-18 12:19:37 +08:00
occheung ae4d5a4228 mgmt: minor fix 2024-11-18 12:19:37 +08:00
occheung 6f1d727ca2 drtio-proto: avoid expecting response to drop link ack 2024-11-18 12:19:37 +08:00
occheung 7da5061f7e coremgmt: fix import/uses 2024-11-18 12:19:37 +08:00
occheung 47d418c69e coremgmt: remove unnecsaary cursors 2024-11-18 12:19:37 +08:00
occheung d2979e8894 runtime coremgmt: implement firmware rewrite 2024-11-18 12:19:37 +08:00
occheung 3884c14a19 satman coremgmt: code after reboot is unreachable 2024-11-18 12:19:37 +08:00
occheung c5b00d8e4e cargo fmt 2024-11-18 12:19:37 +08:00
occheung 2985875f9a satman: implement boot file rewrite sequence 2024-11-18 12:19:37 +08:00
occheung 5cb565a7e0 coremgr: current_payload -> config_payload 2024-11-18 12:19:37 +08:00
occheung 59954829a2 drtio-proto: (N)ACK -> Reply { succeeded } 2024-11-18 12:19:37 +08:00
occheung 960864c847 drtio-proto: add coremgmt-over-drtio messages 2024-11-18 12:19:37 +08:00
occheung bdc29e5709 runtime: support coremgmt on satellites 2024-11-18 12:19:37 +08:00
occheung 332732dc44 satman: implement cfg/mgmt operations 2024-11-18 12:19:37 +08:00
occheung 244c7396d9 runtime: handle drtio-eem satellite disconnection 2024-11-18 12:08:44 +08:00
newell 2c633409b8 Set FCLK0 for EBAZ4205
EBAZ4205 uses FCLK0 as the RTIO clock.

If the user modifies the gateware to use an external clock, FCLK0 is not used.
Co-authored-by: newell <newell.jensen@gmail.com>
Co-committed-by: newell <newell.jensen@gmail.com>
2024-11-17 10:08:43 +08:00
Sebastien Bourdeauducq 9774b39fd8 flake: update zynq-rs 2024-11-16 17:32:05 +08:00
Sebastien Bourdeauducq 9054e4a7cb flake: update zynq-rs, switch to oxalica rust overlay 2024-11-16 17:22:01 +08:00
newell d79bf8d54a gateware: Add default TTLs to EBAZ4205 (#335)
Co-authored-by: newell <newell.jensen@gmail.com>
Co-committed-by: newell <newell.jensen@gmail.com>
2024-11-16 10:40:45 +08:00
Sebastien Bourdeauducq 75e7fc55a3 flake: update dependencies 2024-11-16 10:39:39 +08:00
architeuthidae 24a4d79f0f README: general update 2024-11-07 19:07:38 +01:00
Sébastien Bourdeauducq 9ce3aadb15 cargo fmt 2024-10-18 17:43:39 +08:00
mwojcik 3390abd5a1 subkernels: pass now_mu when calling subkernels 2024-10-18 13:51:48 +08:00
newell a410c40b50 ADD SPI to EBAZ4205 for AD9834 (#331)
Co-authored-by: newell <newell.jensen@gmail.com>
Co-committed-by: newell <newell.jensen@gmail.com>
2024-10-17 15:06:11 +08:00
newell 030247be18 add pre-commit hooks for code formatting
Co-authored-by: newell <newell.jensen@gmail.com>
Co-committed-by: newell <newell.jensen@gmail.com>
2024-10-08 15:19:07 +08:00
newell 61df939c87 ebaz4205: add variant and hydra job
Co-authored-by: newell <newell.jensen@gmail.com>
Co-committed-by: newell <newell.jensen@gmail.com>
2024-10-08 11:35:31 +08:00
newell aba97175c6 Fix formatting 2024-10-05 16:30:45 -07:00
newell 81790257a5 Add ebaz4205 support (#327)
Co-authored-by: newell <newell.jensen@gmail.com>
Co-committed-by: newell <newell.jensen@gmail.com>
2024-10-05 15:05:49 +08:00
Sebastien Bourdeauducq 1f81d038e0 update dependencies 2024-10-05 14:50:13 +08:00
Sebastien Bourdeauducq 1e42228aac flake: remove deprecated pytest-runner 2024-09-30 16:19:56 +08:00
Sebastien Bourdeauducq c84653b500 flake: update dependencies 2024-09-30 16:01:11 +08:00
Sebastien Bourdeauducq 6585b9b441 flake: update dependencies 2024-09-30 14:17:25 +08:00
Simon Renblad 873dd86b4d runtime: cargo fmt (NFC) 2024-09-19 10:23:31 +08:00
Simon Renblad e7614d2e8e rerun idle kernel on finish 2024-09-13 09:35:38 +08:00
Simon Renblad 491e426222 run idle kernel on flash 2024-09-12 16:12:57 +08:00
Simon Renblad ccd3bf3003 runtime: fix drtio inject lock 2024-09-02 17:19:20 +08:00
Sebastien Bourdeauducq 3fdb7e80a8 flake: update dependencies 2024-08-23 19:14:08 +08:00
abdul124 bd1de933fb cargo fmt 2024-08-23 17:49:14 +08:00
abdul124 e8d77fca3e firmware: add UnwrapNoneError exception 2024-08-23 16:50:47 +08:00
abdul124 85e8a3fc44 firmware: add LinAlgError exception 2024-08-22 10:42:28 +08:00
Sebastien Bourdeauducq 04078b3d89 flake: update dependencies 2024-08-21 18:51:19 +08:00
abdul124 d508c5c6f8 firmware: add unit tests for exception sync 2024-08-21 16:35:03 +08:00
abdul124 bae41253e4 firmware: sync exception names and ids 2024-08-21 16:34:25 +08:00
abdul124 20181e9915 fix nalgebra url 2024-08-07 13:49:03 +08:00
abdul124 a835149619 kernel/linalg: remove redundant unsafe blocks 2024-08-07 13:48:21 +08:00
Sebastien Bourdeauducq 78d6b7ddcf cargo fmt 2024-08-05 19:37:55 +08:00
Simon Renblad fad1db9796 comms: remove idle kernel DRTIO error case 2024-08-05 19:28:09 +08:00
Simon Renblad fee30033ec comms: run idle kernel on start-up 2024-08-05 19:28:09 +08:00
abdul124 fe6f259d48 kernel: add linalg functions 2024-08-01 18:20:32 +08:00
Sebastien Bourdeauducq e4d7ce114f flake: update fastnumbers 2024-08-01 07:41:32 +08:00
mwojcik 63f4783687 subkernels: support exceptions from subkernels 2024-07-31 17:22:29 +08:00
mwojcik 69a0b1bfb7 subkernels: raise exceptions to kernel 2024-07-31 17:22:29 +08:00
Sebastien Bourdeauducq f6bff80105 flake: update dependencies 2024-07-31 17:20:54 +08:00
Sébastien Bourdeauducq 57fd327ecb rustfmt 2024-07-22 18:55:17 +08:00
abdul124 69d5b11ebf kernel/api: add nalgebra::linalg methods 2024-07-22 11:57:58 +08:00
abdul124 bab938c563 add nalgebra dependency
Co-authored-by: abdul124 <ar@m-labs.hk>
Co-committed-by: abdul124 <ar@m-labs.hk>
2024-07-22 11:13:45 +08:00
mwojcik d51e5e60c3 repeater: handle async messages 2024-07-09 23:04:34 +08:00
mwojcik 23857eef63 allow toggling SED spread with flash config key 2024-07-09 18:11:20 +08:00
Sebastien Bourdeauducq d0615bf965 flake: update dependencies 2024-07-09 10:37:37 +02:00
abdul124 3a789889cf kernel/api: add rint api 2024-07-05 14:53:09 +08:00
mwojcik 72b814f7fd repeater: clear buffer after ping 2024-07-04 17:30:04 +08:00
Sebastien Bourdeauducq ead20a66a5 flake: update dependencies 2024-06-06 10:05:55 +08:00
morgan 586fd2f17e Gateware: remove redundant si549.py & wrpll.py 2024-05-30 15:27:16 +08:00
morgan 377f8779a0 kasli soc: refactor to use wrpll from artiq 2024-05-30 15:25:33 +08:00
morgan 1fbaacfc43 flake: update artiq 2024-05-30 15:14:02 +08:00
Sebastien Bourdeauducq 127ea9ea4d flake: update dependencies 2024-05-28 17:30:49 +08:00
Simon Renblad 174c301d7d add llvmPackages_11 2024-05-24 15:29:29 +08:00
Sebastien Bourdeauducq 52defff000 flake: update dependencies 2024-05-24 15:29:19 +08:00
mwojcik 2b2ebb5354 aux: increase max payload size 2024-05-20 15:20:06 +08:00
Sebastien Bourdeauducq 4341d2d2a5 update to LLLVM 14 2024-05-09 10:05:33 +08:00
Sebastien Bourdeauducq 57b885ed99 flake: update dependencies 2024-05-09 10:03:57 +08:00
Sebastien Bourdeauducq e922543855 flake: update dependencies 2024-05-08 18:56:15 +08:00
morgan 35ea0ed2ca WRPLL: add filter for DRTIO 100MHz 2024-05-08 18:50:55 +08:00
morgan cdf4ff24c0 WRPLL: replace PI controller with new filter 2024-05-08 18:50:55 +08:00
morgan 285b02c4b1 WRPLL: remove anti-windup 2024-05-08 18:50:55 +08:00
morgan 53cb592d19 kasli soc: add rtio_frequency cfg for runtime 2024-05-08 16:14:56 +08:00
Florian Agbuya c261897658 rename `build` derivation to `board-package-set` 2024-04-29 13:05:49 +08:00
morgan 1d603c73b7 DDMTD: replace 1st edge to median edge deglitcher 2024-04-29 13:05:02 +08:00
morgan 61315c29b9 Si549: recalibrate TAG_OFFSET for ISERDESE2 2024-04-29 13:03:30 +08:00
morgan 3f57de6ec7 DDMTD: replace FD with ISERDESE2 2024-04-29 13:03:30 +08:00
morgan cca23aa2a5 wrpll runtime: reduce mmcm output jitter
rtio_clocking: update mmcm setting to use HIGH bandwidth
2024-04-29 11:20:50 +08:00
morgan 2bbaea3ad5 SMAFreqMulti: set mmcm bw to HIGH for lower jitter 2024-04-29 11:20:50 +08:00
Sébastien Bourdeauducq 5abd274060 update copyright year 2024-04-26 12:26:30 +08:00
mwojcik 3abe9caadb flake: update dependencies 2024-04-26 11:37:14 +08:00
mwojcik 0a19f8fb89 satman: revert async flag changes 2024-04-26 11:37:14 +08:00
mwojcik a30c7d1f3a runtime: drtio aux refactoring, revert async flag 2024-04-26 11:37:14 +08:00
mwojcik 2d10503c20 libboard_artiq: support multiple aux rx buffers 2024-04-24 17:12:57 +08:00
mwojcik 92a29051f7 drtio_aux_controller: support aux_buffer_count 2024-04-24 17:12:39 +08:00
morgan 14fa038118 Firmware: Runtime WRPLL
runtime: drive CLK_SEL to true when si549 is used
runtime & libboard_artiq: allow standalone to use io_expander
si549: add bit bang mmcm dynamic configuration
si549: add frequency counter for refclk
rtio_clocking & si549: add 125Mhz wrpll refclk setup
2024-04-12 16:38:46 +08:00
morgan b81323af30 Firmware: Satman skew calibration & tester
cargo template: add calibrate_wrpll_skew feature
tag collector: add TAG_OFFSET for Satman WRPLL
tag collector: add TAG_OFFSET getter & setter for calibration
wrpll: add skew tester and calibration
wrpll: gate calibration behind calibrate_wrpll_skew feature
2024-04-12 16:38:46 +08:00
morgan 291777f764 Firmware: Satman WRPLL
satman: drive CLK_SEL to true when si549 is used
satman : add main & helper si549 setup
satman : add WRPLL select_recovered_clock
si549: add tag collector to process gtx & main tags
si549: add frequency counter to set BASE_ADPLL
si549: add set_adpll for main & helper PLL
si549: add main & helper PLL
FIQ & si549: replace dummy with a custom handler for gtx & main tags ISR
2024-04-12 16:38:39 +08:00
morgan a1d80fb93b Firmware: Si549 and io_expander
io_expander: set CLK_SEL pin to output when si549 is used
io_expander: gate virtual leds for standalone
si549: add bit bang i2c
si549: add si549 programming
si549: add main & helper setup
2024-04-11 15:18:10 +08:00
morgan 7827c7b803 Gateware: kasli_soc WRPLL setup
kasli_soc: use enable_wrpll from json to switch from si5324 to si549
kasli_soc: add wrpll for all variants
kasli_soc: add gtx & main tag nFIQ for all variants
kasli_soc: add clk_synth_se for master & satellite
kasli_soc: add wrpll_refclk for runtime
kasli_soc: add skewtester for satman
kasli_soc: add WRPLL_REF_CLK config for firmware
2024-04-11 15:18:10 +08:00
morgan e4d8d44c7c Gateware: WRPLL
ddmtd: add DDMTD and deglitcher
wrpll: add helper clockdomain
wrpll: add frequency counter
wrpll: add skewtester
wrpll: add gtx & main tag collection
wrpll: add gtx & main tag eventmanager for shared peripheral interrupt
wrpll: add SMA frequency multiplier to generate 125Mhz refclk
si549: add i2c and adpll programmer
2024-04-11 15:18:04 +08:00
morgan 4f34a7c6d0 flake: update artiq 2024-03-15 12:11:32 +08:00
morgan 1f7c53b8d0 flake: update zynq-rs 2024-03-08 10:18:54 +08:00
morgan 4455f740d2 main: set exception vector table addr
linker: add exceptions start & end symbol
2024-03-07 15:37:42 +08:00
morgan 63bf1c81d4 fiq: use dummy handler to fix compilation error 2024-03-07 13:26:52 +08:00
Sebastien Bourdeauducq cf0b83c3f9 flake: update dependencies 2024-02-01 18:58:44 +08:00
mwojcik bfb582f99b cargo fmt 2024-02-01 14:43:41 +08:00
mwojcik 52e64fb2f9 subkernel: use negative ID for argument passing 2024-02-01 14:43:41 +08:00
mwojcik facc98058c subkernel: fix DMA return control to wrong master 2024-02-01 14:43:41 +08:00
mwojcik f0f81dbf8a subkernel: support no-timeout, message passing 2024-02-01 14:43:41 +08:00
mwojcik 30e6bf4a3a subkernel: add support for (d)dma 2024-01-11 12:33:02 +08:00
mwojcik 8f4e30dd9c satman: support sub-subkernels, routing 2024-01-11 12:33:02 +08:00
mwojcik e31a31c4ff master: drtioaux:
- support async flag
- source in packets
- rerouting packets
2024-01-11 12:33:02 +08:00
Sebastien Bourdeauducq d044bbd8bb flake: update dependencies 2024-01-11 12:32:42 +08:00
Sebastien Bourdeauducq 33cf924805 flake: update dependencies 2023-12-04 19:10:26 +08:00
Sebastien Bourdeauducq f7887b14f6 flake: update dependencies 2023-12-03 16:16:40 +08:00
Sebastien Bourdeauducq 3e3e23918e update dependencies 2023-12-03 11:51:12 +08:00
mwojcik 6ca1719033 comms: fix compilation on standalone 2023-11-14 14:08:31 +08:00
mwojcik aebc739c1e add support for tar flashable (sub)kernels 2023-11-13 11:24:23 +08:00
linuswck e1b2c45813 kasli_soc & zc706: Fix GTX Clock Path during INIT 2023-11-07 18:55:08 +08:00
linuswck e6372b9766 zynq_clocking: Allow ext signal to set cur_clk csr
- for example, current_clock csr can be connected to tx_init.done
2023-11-07 18:55:08 +08:00
linuswck 07044752b6 zynq_clocking: add ext_async_rst to AsyncRstSYNCR 2023-11-07 18:55:08 +08:00
linuswck 79fc5a7789 zynq_clocking: expose mmcm_locked for SYSCRG
- mmcm_locked -> self.mmcm_locked
2023-11-07 18:55:08 +08:00
Sebastien Bourdeauducq d3f4602361 flake: update dependencies 2023-11-07 18:54:31 +08:00
mwojcik 6c8346ca5f subkernel: improve stability,
fix exception on awaiting message
2023-11-02 16:58:34 +08:00
mwojcik b76f634686 drtio: increase robustness for longer payloads 2023-11-02 14:48:52 +08:00
morgan 4a34777b97 refactor i2c, io_expander, task under the same cfg 2023-10-25 11:52:04 +08:00
morgan 43e4527392 fix kasli-soc demo compilation warning 2023-10-25 11:45:13 +08:00
Sebastien Bourdeauducq a08a42c954 flake: update dependencies 2023-10-20 17:46:37 +08:00
mwojcik 0a3bfc9a61 subkernel: separate tags and data 2023-10-18 12:03:43 +08:00
Egor Savkin d3fbfd75b0 Fix grabber build and warning
Signed-off-by: Egor Savkin <es@m-labs.hk>
2023-10-18 11:24:43 +08:00
Egor Savkin b768d5648c Add grabber module
Signed-off-by: Egor Savkin <es@m-labs.hk>
2023-10-16 14:35:20 +08:00
Sebastien Bourdeauducq 812aea33b3 rustfmt 2023-10-11 17:56:30 +08:00
linuswck 136e24f597 kasli-soc: Add BUFG to the IBUFGDS for MMCM CLKIN1
- Fix Vivado Compilation Error [DRC REQP-119]
- MMCME2_ADV CLKIN1 and CLKIN2 are now driven from the same source type (BUFG)
2023-10-11 16:45:26 +08:00
Sebastien Bourdeauducq 0f050844cf flake: update dependencies 2023-10-11 16:41:54 +08:00
linuswck a4d1be00c0 Firmware: Add drtio_eem.rs support
- Port from Artiq repo
- Initialize the drtio_eem on main, rtio_clocking
- Driver for eem_transceiver
2023-10-10 11:22:05 +08:00
linuswck b15322b6ba kasli_soc: Add support for shuttler on gateware
- Port from artiq repo
- Add EEM_DRTIO gateware
2023-10-10 11:22:05 +08:00
linuswck 8fd1306145 zynq_clocking: Add sys5x, 208MHz CLK & IDELAYCTRL
- Port from artiq repo
- Generate sys5x for for EEM Serdes, 208MHz REF Clock for IDELAYCTRL
- Add IDELAYCTRL for IDEALYE2 in EEM Serdes
2023-10-10 11:21:34 +08:00
Sebastien Bourdeauducq a28a819b18 add manifests target to PHONY 2023-10-09 18:29:53 +08:00
Sebastien Bourdeauducq 3f414278e2 cleanup 2023-10-09 18:28:20 +08:00
Sebastien Bourdeauducq e5aafad60d force cargo to use our copy of zynq-rs 2023-10-09 18:27:58 +08:00
mwojcik b9a0bcabeb ksupport: fix build on acpki variants 2023-10-09 17:10:45 +08:00
mwojcik 8eb359ee42 cargo fmt 2023-10-09 11:50:47 +08:00
mwojcik 7263862fd8 satellite: support optional args 2023-10-09 11:42:51 +08:00
mwojcik 29cc0a6e28 ddma/subkernel: fix wrong destination reported 2023-10-09 11:42:51 +08:00
mwojcik 616c40429e satellite: process kernel requests more often 2023-10-09 11:42:51 +08:00
mwojcik 3ea8147966 subkernel: send async statuses when requested 2023-10-09 11:42:51 +08:00
mwojcik cb79c12284 satellite: support subkernels 2023-10-09 11:42:51 +08:00
mwojcik 623cc7b79e libkernel -> ksupport 2023-10-09 11:42:51 +08:00
mwojcik 49205eea17 satellite gateware: add kernel rtio to cri 2023-10-09 11:36:23 +08:00
mwojcik 6885c618b5 move kernel-related code to separate library 2023-10-09 11:36:23 +08:00
mwojcik c696fd826f master: support optional args 2023-10-09 10:35:47 +08:00
mwojcik 4b3c9a3d08 rtio_mgt: remove support for async messages 2023-10-09 10:35:47 +08:00
mwojcik 779aea7c6a check subkernel exceptions only when awaited 2023-10-09 10:35:03 +08:00
mwojcik 6785ca2c85 subkernel: port master support 2023-10-09 10:35:03 +08:00
Sebastien Bourdeauducq cded04e2d6 flake: update dependencies 2023-10-09 10:25:46 +08:00
sven-oxionics 656cbf4546 kasli_soc: use sed_lanes value from HW description
https://github.com/m-labs/artiq/pull/1745 added a field for setting the number of SED lanes to the HW description. This commit makes it so that the setting is used for Kasli Soc as well.
2023-10-06 15:37:56 +01:00
mwojcik ecd4ca333c rtio_clocking: inform the user if PLL is bypassed 2023-10-06 16:27:25 +08:00
mwojcik ae3099dd8e kasli_soc: support 100MHz clock 2023-10-06 16:27:25 +08:00
mwojcik 2b9542c80b flake: expose 100mhz for zc706 2023-10-06 15:26:05 +08:00
mwojcik 49810da188 runtime: wait longer for PLL lock 2023-10-05 12:17:43 +08:00
mwojcik e451598a06 satman: fix dma reporting wrong destination 2023-09-22 10:29:48 +08:00
mwojcik f4ceca464f drtio: change async messages to sync 2023-09-21 14:18:25 +08:00
morgan f3dcd53086 firmware: fix zc706 compilation warnings
Co-authored-by: morgan <mc@m-labs.hk>
Co-committed-by: morgan <mc@m-labs.hk>
2023-09-11 15:21:56 +08:00
morgan b3856e879b refactor `write_rustc_cfg_file()` 2023-09-11 11:48:19 +08:00
morgan 1ccae0d442 consolidate all `write..file()` into `config.py` 2023-09-11 11:48:19 +08:00
morgan 2c19f4ac31 replace rustc_cfg[ ] & change write_rustc_cfg_file 2023-09-11 11:48:19 +08:00
Sebastien Bourdeauducq b23c822ad2 flake: fix cargo hash 2023-09-07 19:04:44 +08:00
Sebastien Bourdeauducq 85ecff2cc1 cargo: update zynq-rs 2023-09-07 19:01:36 +08:00
Sebastien Bourdeauducq 3a305c8cac Revert "cargo: update dependencies"
This reverts commit 38b0799bb0.
2023-09-07 19:00:16 +08:00
Sebastien Bourdeauducq 38b0799bb0 cargo: update dependencies 2023-09-07 18:54:30 +08:00
Sebastien Bourdeauducq b87ec32438 cargo: update dependencies 2023-09-07 18:52:16 +08:00
morgan 615f2e3d37 remove misleading 'Actively' from docs at main.rs 2023-09-06 10:53:26 +08:00
Sebastien Bourdeauducq 37df7fd45b cargo fmt 2023-08-30 16:14:35 +08:00
Sebastien Bourdeauducq c9b574f5c7 flake: update dependencies 2023-08-30 15:43:04 +08:00
morgan 2ac7eedec1 firmware: fix compilation without virtual LEDs
Co-authored-by: morgan <mc@m-labs.hk>
Co-committed-by: morgan <mc@m-labs.hk>
2023-08-30 15:33:44 +08:00
MorganTL c61017fbe6 fix compiling error when cfg has has_rtio_moninj 2023-08-30 15:32:09 +08:00
MorganTL 0e6309b95e change write_rustc_cfg_file to follow artiq repo 2023-08-30 14:56:12 +08:00
morgan 1516327c26 firmware: fix zc706 compilation error
Co-authored-by: morgan <mc@m-labs.hk>
Co-committed-by: morgan <mc@m-labs.hk>
2023-08-29 11:25:28 +08:00
morgan 622d267d55 add virtual LEDs, improve IO expander setup, drive TX_DISABLE
Co-authored-by: morgan <mc@m-labs.hk>
Co-committed-by: morgan <mc@m-labs.hk>
2023-08-28 16:08:10 +08:00
linuswck 4ae8557018 drtio: remame drtio_transceiver to gt_drtio
Co-authored-by: linuswck <linuswck@m-labs.hk>
Co-committed-by: linuswck <linuswck@m-labs.hk>
2023-08-28 13:05:40 +08:00
Sebastien Bourdeauducq dc08c382a2 satman: wait longer for PLL lock (#246) 2023-08-13 13:52:12 +08:00
Sebastien Bourdeauducq 583b629b40 flake: update dependencies 2023-08-07 23:37:27 +08:00
Sebastien Bourdeauducq ca17cd419e Revert "kasli_soc: add SFP0..3 LED indication"
This reverts commit 5111778363.
2023-08-03 10:42:09 +08:00
Sebastien Bourdeauducq c5e21a573c flake: update dependencies 2023-07-25 11:18:59 +08:00
morgan 5111778363 kasli_soc: add SFP0..3 LED indication
Co-authored-by: morgan <mc@m-labs.hk>
Co-committed-by: morgan <mc@m-labs.hk>
2023-07-24 16:30:14 +08:00
Sebastien Bourdeauducq 3076a35796 flake: update dependencies 2023-07-10 11:38:08 +08:00
Sebastien Bourdeauducq ee438105b2 json: base -> drtio_role 2023-06-16 17:03:25 +08:00
Sebastien Bourdeauducq 339e824511 flake: update dependencies 2023-06-16 17:03:20 +08:00
Sebastien Bourdeauducq f52c155006 flake: fix and cleanup builds 2023-06-02 18:36:05 +08:00
Sebastien Bourdeauducq 4c605f21c9 flake: update dependencies 2023-06-02 17:22:27 +08:00
Sebastien Bourdeauducq f1ee3a7584 rustfmt 2023-05-30 12:22:46 +08:00
Sebastien Bourdeauducq 165b1400ab flake: update dependencies 2023-05-30 12:10:28 +08:00
Denis Ovchinnikov 63594d7e3d update configuration of IBUFDS_GTE2
Input clock is terminated internally with 50 Ohm on each leg and to 4/5 MGTAVCC.
2023-05-30 12:08:41 +08:00
mwojcik 5e6dca61a9 analyzer: fix overflow behavior 2023-05-29 13:53:28 +08:00
mwojcik b6247f409d analyzer: fix warnings on standalone 2023-05-29 10:03:44 +08:00
Sebastien Bourdeauducq ddb3703f50 flake: update dependencies, nixpkgs 23.05 2023-05-27 18:37:19 +08:00
mwojcik 6088e6bb6f fix cargo fmt 2023-05-24 10:00:48 +08:00
mwojcik ad076dd4e9 zc706: fix satellite analyzer target 2023-05-24 09:52:16 +08:00
Sebastien Bourdeauducq 9aabaacb21 flake: update dependencies 2023-05-23 11:30:18 +08:00
mwojcik a27b450def runtime: port drtio-enabled analyzer 2023-05-22 15:23:40 +08:00
mwojcik c536a70890 satellite gateware: add rtio analyzer 2023-05-22 15:23:24 +08:00
mwojcik 259b0ba1b7 satellite: port analyzer, drtio packets 2023-05-22 15:23:23 +08:00
Sebastien Bourdeauducq c5aac198f2 README: update copyright year 2023-05-09 16:28:12 +08:00
Sebastien Bourdeauducq 87615017fa README: update use instructions 2023-05-09 16:28:03 +08:00
Sebastien Bourdeauducq 731b6a89dd flake: update dependencies 2023-05-01 09:35:29 +08:00
mwojcik cbc660e740 ddma: pass "uses_ddma" flag 2023-04-18 12:36:07 +08:00
Sebastien Bourdeauducq 0046091605 flake: update dependencies 2023-04-18 12:35:56 +08:00
Jonathan Coates 8cb6cf6094 Fix mismatched signatures for the wide interface
Lists are passed by-reference from python code, and so should be
&CSlice<_> not CSlice<_>.
2023-04-17 09:24:30 +08:00
Egor Savkin c6fcc4e351 Add ext0_synth0_80to125 option to the clocker config
Signed-off-by: Egor Savkin <es@m-labs.hk>
2023-04-13 12:08:25 +08:00
Sebastien Bourdeauducq bf50a44f76 cargo fmt 2023-04-04 11:48:48 +08:00
Sebastien Bourdeauducq 64cadd90f5 fix imports 2023-04-04 11:23:11 +08:00
Sebastien Bourdeauducq 93423dd145 README: update instructions 2023-04-04 11:20:07 +08:00
Sebastien Bourdeauducq 2802938702 flake: update dependencies 2023-04-04 11:17:41 +08:00
Sebastien Bourdeauducq 271a1adb04 firmware: improve RTIO map error reporting 2023-04-04 11:17:26 +08:00
mwojcik b747abe83c qc2: add 4 edge counters to the end of rtio 2023-04-03 12:25:07 +08:00
mwojcik 48721ca9cb apply rustfmt policies to ddma code 2023-03-27 15:53:32 +08:00
mwojcik 90071f7620 Master: DDMA support
Co-authored-by: mwojcik <mw@m-labs.hk>
Co-committed-by: mwojcik <mw@m-labs.hk>
2023-03-27 15:47:54 +08:00
mwojcik 908dfc780e satman: add dma support 2023-03-23 11:04:26 +08:00
mwojcik 4b1ce1a6ff satellites: add rtio_dma, connect as cri master 2023-03-21 15:54:58 +08:00
Sebastien Bourdeauducq 4c87487fe1 flake: update dependencies 2023-02-22 11:03:17 +08:00
Egor Savkin a519d24074 firmware: create and apply rustfmt policy
Co-authored-by: Egor Savkin <es@m-labs.hk>
Co-committed-by: Egor Savkin <es@m-labs.hk>
2023-02-22 11:02:43 +08:00
mwojcik dce37a52aa KasliSoC satellite: fix serdes timing 2023-02-20 13:07:42 +08:00
Egor Savkin d72a2e7d07 fix previous commit
Co-authored-by: Egor Savkin <es@m-labs.hk>
Co-committed-by: Egor Savkin <es@m-labs.hk>
2023-02-17 17:49:36 +08:00
Egor Savkin 05c22792d6 satman: drive SFP TX_DISABLE
Co-authored-by: Egor Savkin <es@m-labs.hk>
Co-committed-by: Egor Savkin <es@m-labs.hk>
2023-02-17 17:19:30 +08:00
mwojcik dcc5cc7555 satellite: add Error LED on panic 2023-02-17 16:21:52 +08:00
mwojcik 46b2687d70 RTIO/SYS Clock merge
Co-authored-by: mwojcik <mw@m-labs.hk>
Co-committed-by: mwojcik <mw@m-labs.hk>
2023-02-17 15:52:43 +08:00
sb10q b85c870b82 runtime: drive SFP TX_DISABLE 2023-02-16 10:29:05 +08:00
Egor Savkin ca6e0d13ad Remove virtual LEDs from io_expander
Signed-off-by: Egor Savkin <es@m-labs.hk>
2023-02-15 18:14:05 +08:00
Egor Savkin b4b7912c40 Port tx_disable-related code from Kasli
Signed-off-by: Egor Savkin <es@m-labs.hk>
2023-02-15 17:44:01 +08:00
Egor Savkin 8230a01701 Build io_expander
Signed-off-by: Egor Savkin <es@m-labs.hk>
2023-02-15 15:31:22 +08:00
Egor Savkin 4bc936f071 Copy io expander from kasli
Signed-off-by: Egor Savkin <es@m-labs.hk>
2023-02-15 14:37:55 +08:00
David Nadlinger df4988c774 rpc: Port over size/alignment fix for structs (tuples) with tail padding
This ports over the following commits from the main ARTIQ repo:
 - 8740ec3dd52d85084237797881ea137492bfe070
 - dbbe8e8ed4f852e623775b7bd3aec818cdd03376
 - b9f13d48aa7e2c0652210152b971b21c3c419347
2023-01-28 16:15:28 +00:00
Sebastien Bourdeauducq 800c12e794 fix resolve_channel_name typing 2023-01-12 16:52:36 +08:00
Egor Savkin d36899b485 firmware: unify RTIO error message format
Co-authored-by: Egor Savkin <es@m-labs.hk>
Co-committed-by: Egor Savkin <es@m-labs.hk>
2023-01-09 16:13:42 +08:00
Egor Savkin 6b3fa98d70 add channel names to RTIO errors
Co-authored-by: Egor Savkin <es@m-labs.hk>
Co-committed-by: Egor Savkin <es@m-labs.hk>
2023-01-09 12:35:56 +08:00
Sebastien Bourdeauducq 4a522ecb3b update ramda and migen-axi 2023-01-06 09:57:56 +08:00
Sebastien Bourdeauducq 6be5ffe4e4 update flake dependencies 2023-01-06 09:34:15 +08:00
Egor Savkin 44ef13d1c0 Fix idle/startup_kernel typos in config
Signed-off-by: Egor Savkin <es@m-labs.hk>
2023-01-03 09:55:36 +08:00
David Nadlinger 8e0229d265 si5324: crystal_{ref -> as_ckin2} [nfc]
This makes it clear that by itself, the flag does not
cause the input mux to be changed.
2022-12-17 01:33:50 +00:00
David Nadlinger 2ddb4d259f Undo most of Si5324 unification (5c054cc901)
This reverts most of 5c054cc901, as it turns out that
si5324::setup is in fact also used to configure the
chip for operation as a DRTIO satellite.
2022-12-17 01:31:14 +00:00
David Nadlinger 5c054cc901 Unify Si5324 setup code with main ARTIQ repository [nfc]
I chose the version from the main repository for two
reasons:
 - Explicitly specifying si5324_ref_input every time would
   not work for the different Kasli/… hardware versions.
 - Having `crystal_ref` as a setting in the configuration
   is misleading if it does not actually activate the crystal
   for use as a reference (but rather does
   `route_crystal_to_ckin2`).

Related m-labs/artiq commits:
 - 740543d4e284245248e3ff838c46505938dcae7a
 - 3c7a394eff553ab75a7ea78bdd17830366504dc6
2022-12-12 23:22:01 +00:00
Sebastien Bourdeauducq c281505aa0 flake: fix cargo hash 2022-12-01 12:49:00 +08:00
Sebastien Bourdeauducq db0e41af6d update zynq-rs and some Rust deps 2022-11-30 22:49:10 +08:00
Sebastien Bourdeauducq a07ebb4dc0 flake: nixos 22.11 2022-11-30 22:32:35 +08:00
Sebastien Bourdeauducq d5402d899f flake: update dependencies 2022-10-21 18:57:48 +08:00
Sebastien Bourdeauducq bbecead9a3 examples: fix ref_multiplier 2022-10-21 18:53:59 +08:00
mwojcik c834e4f503 enable network and mgmt during Rust panic, make RTIO PLL lock failure a panic
Closes #198 #200

Making it a soft panic makes it more involved with a bit of code duplication - setting up mgmt requires setting up the interface and sockets. Maybe can be done a bit cleaner.

```
[spaqin@hera:~/m-labs/artiq-zynq]$ artiq_sinara_tester
****** Sinara system tester ******
[...]
ConnectionRefusedError: [Errno 111] Connection refused

[spaqin@hera:~/m-labs/artiq-zynq]$ artiq_coremgmt -D 192.168.1.56 log
[     0.000067s]  INFO(runtime): NAR3/Zynq7000 starting...
[     0.005238s]  INFO(runtime): detected gateware: GenericMaster
[     0.016152s]  INFO(libboard_zynq::i2c): PCA9548 detected
[     0.023004s]  WARN(runtime): config initialization failed: SD error: Card initialization error: No card inserted, check if the card is inserted properly.
[     0.036730s]  WARN(runtime::rtio_clocking): error reading configuration. Falling back to default.
[     0.213000s] ERROR(runtime::rtio_clocking): RTIO PLL failed to lock
[     0.224443s]  INFO(libboard_zynq::i2c): PCA9548 detected
[     0.256197s]  INFO(runtime::comms): network addresses: MAC=e8-eb-1b-13-49-8b IPv4=192.168.1.56 IPv6-LL=fe80::eaeb:1bff:fe13:498b IPv6: no configured address
[     0.270183s] ERROR(runtime::comms): There has been an error configuring the device: RTIO PLL failed to lock. Only mgmt interface will be available.
[     4.000095s]  INFO(libboard_zynq::eth): eth: got Link { speed: S1000, duplex: Full }
[    33.148521s]  INFO(runtime::mgmt): received connection
```

Reviewed-on: M-Labs/artiq-zynq#199
Co-authored-by: mwojcik <mw@m-labs.hk>
Co-committed-by: mwojcik <mw@m-labs.hk>
2022-10-21 17:56:34 +08:00
mwojcik dc862a9051 match ident message with mainline 2022-10-21 12:08:11 +08:00
mwojcik 19e60073de kasli_soc: ident = variant name 2022-10-21 11:55:24 +08:00
Egor Savkin a546d0f95b Implement reboot for artiq_coremgmt 2022-10-07 18:31:11 +08:00
Sebastien Bourdeauducq d6ae646790 update dependencies 2022-10-07 18:30:39 +08:00
Sebastien Bourdeauducq 38f4d6cd2e flake: export packages 2022-08-29 19:55:27 +08:00
Sebastien Bourdeauducq f3310324d7 update dependencies 2022-08-26 17:37:27 +08:00
Sebastien Bourdeauducq 4a4f7b0ddc flake: update dependencies 2022-08-01 10:24:27 +08:00
Sebastien Bourdeauducq 0812f22423 update dependencies 2022-07-20 17:34:26 +08:00
Sebastien Bourdeauducq 014ff23daf README: update required versions 2022-07-09 12:28:45 +08:00
kk105 b638fce069 update SEEN_ASYNC_ERRORS in destination_survey (#195)
Co-authored-by: kk105 <kkl@m-kabs.hk>
Reviewed-on: M-Labs/artiq-zynq#195
Co-authored-by: kk105 <kkl@m-labs.hk>
Co-committed-by: kk105 <kkl@m-labs.hk>
2022-06-20 17:41:08 +08:00
Sebastien Bourdeauducq ac4887ea33 flake: do not use __impure (breaks hydra) 2022-06-04 13:31:07 +08:00
Sebastien Bourdeauducq edf1999bb2 flake: update dependencies, rebuild with nix 2.8 2022-06-02 19:10:03 +08:00
occheung 9ec6a1feab dyld/rebind: support rela generation with nac3ld 2022-06-01 21:27:38 +08:00
occheung 8e144e41de reloc: impl ARM_PREL31 handling 2022-06-01 21:27:38 +08:00
occheung 512b6bac12 reloc: add PC-relative relocation support 2022-06-01 21:27:38 +08:00
occheung e3ed41ff32 fix index table reference type 2022-06-01 18:35:50 +08:00
occheung 97a63ca8d0 dyld: add EXIDX entry type
The type is just for aesthetic. The interpretation of an index table entry is not our concern.
2022-06-01 18:33:19 +08:00
Sebastien Bourdeauducq d652f01379 flake: update dependencies 2022-05-31 20:59:55 +08:00
Sebastien Bourdeauducq d6ef5fd064 flake: update dependencies 2022-05-31 18:27:59 +08:00
occheung f0febe0ee4 change catch type to single reference 2022-05-31 18:26:30 +08:00
mwojcik dce8c974eb flake: remove unnecessary output 2022-05-26 12:29:51 +08:00
mwojcik 01339c9e78 flake: expose build, allow selection of output 2022-05-26 12:29:51 +08:00
Sebastien Bourdeauducq fa1f300067 flake: support impure derivation for HITL tests 2022-05-26 12:07:35 +08:00
Sebastien Bourdeauducq 191a22f506 flake: update artiq/nixpkgs 2022-05-25 14:21:41 +08:00
mwojcik 3e3fb207a5 flake: update dependencies 2022-05-25 13:49:08 +08:00
mwojcik abeaf5aca7 Revert "flake: update dependencies"
This reverts commit e20c77650d.
2022-05-25 13:48:17 +08:00
mwojcik e20c77650d flake: update dependencies 2022-05-25 12:52:39 +08:00
mwojcik 7a8f96dbd9 rtio_mgt: use mutex's async_lock 2022-05-25 10:39:06 +08:00
mwojcik 596edb480c cargo: update zynq-rs 2022-05-25 10:37:38 +08:00
mwojcik 4f457d9c24 moninj: log link down at debug level 2022-05-25 10:37:38 +08:00
mwojcik 24df52268e moninj: restructure timeout
stop logging errors if satellite is unavailable
drtio: don't even send message if link is down
2022-05-25 10:37:38 +08:00
mwojcik 48c9b43171 moninj: make it use async drtioaux 2022-05-25 10:37:38 +08:00
mwojcik 57d7f01b04 drtio: port 64-bit padding from mainline 2022-05-24 15:43:01 +08:00
mwojcik efc432352e zc706: no syncrtio for master, fixes hangs (#188) 2022-05-03 14:36:10 +08:00
mwojcik 88ffd3b77b flake: fix artiq package in zc706-hitl-tests 2022-04-26 13:06:51 +08:00
mwojcik 07210c7b09 flake: fix szl for hitl tests 2022-04-26 12:43:28 +08:00
mwojcik 1cd704c390 flake: fix szl for hitl tests 2022-04-26 12:01:20 +08:00
mwojcik 715a2dd04c flake: move hitl tests from nix-scripts to flake 2022-04-25 19:58:16 +08:00
mwojcik def4d989cd kasli_soc: fix si5324 pins routed to GTX 2022-04-25 12:33:21 +08:00
Sebastien Bourdeauducq f9a8c76654 flake: update dependencies 2022-04-19 11:05:18 +08:00
mwojcik 1d731a3589 zc706 master: route sma clock to si5324 2022-04-13 16:35:52 +08:00
mwojcik 3cf86a6335 satellites: add rtio_crg cfg 2022-04-12 13:44:53 +08:00
mwojcik 78bc162749 rtio_clocking: remove loop 2022-04-12 13:33:52 +08:00
Sebastien Bourdeauducq b974d7ddee flake: update dependencies 2022-04-09 17:26:22 +08:00
mwojcik 2c5de32a4c flake: update libasync sha256 2022-04-08 15:50:24 +08:00
mwojcik 5a7dbb3f29 flake: update sypico dependency (fix duplicate) 2022-04-08 15:50:11 +08:00
Sebastien Bourdeauducq d27d06f960 flake: update dependencies 2022-04-08 10:48:24 +08:00
mwojcik 14f7778732 update libconfig features 2022-04-08 10:30:21 +08:00
mwojcik dcfb28ce61 fix drtioaux packet corruption
Co-authored-by: mwojcik <mw@m-labs.hk>
Co-committed-by: mwojcik <mw@m-labs.hk>
2022-04-01 14:15:14 +08:00
mwojcik 433a9cdaf1 runtime: fix warnings on nondrtio systems 2022-03-29 10:05:11 +08:00
Sebastien Bourdeauducq a79bef2243 runtime: provide/fix more libc mem functions 2022-03-28 13:24:01 +08:00
Sebastien Bourdeauducq 7b21889055 README: fix gateware build command 2022-03-28 13:19:59 +08:00
Sebastien Bourdeauducq c6ef9b117c fix previous commit 2022-03-26 20:08:11 +08:00
Sebastien Bourdeauducq dcfaf587ec firmware: add UnwrapNoneError exception 2022-03-26 15:29:40 +08:00
mwojcik a92561b9d3 implement rtio_get_destination_status (#177)
Co-authored-by: mwojcik <mw@m-labs.hk>
Co-committed-by: mwojcik <mw@m-labs.hk>
2022-03-25 18:20:05 +08:00
Sebastien Bourdeauducq dc54d5f9b6 update artiq/vivado 2022-03-20 16:15:47 +08:00
Sebastien Bourdeauducq 161044e78f drop support for big-endian moninj 2022-03-19 23:01:36 +08:00
Sebastien Bourdeauducq 32f3c636c5 update artiq, work around annoying nix2.5 bug 2022-03-17 21:11:31 +08:00
Sebastien Bourdeauducq 50cafad18b update artiq 2022-03-17 20:28:12 +08:00
Sebastien Bourdeauducq 426500d2f9 firmware: support 64-bit moninj probes 2022-03-17 20:26:44 +08:00
Sebastien Bourdeauducq ebdb08180d drtio: demote default routing table message to info 2022-03-16 21:04:12 +08:00
Sebastien Bourdeauducq 0530e596ba mgmt: remove spurious config write warning 2022-03-16 08:24:52 +08:00
Sebastien Bourdeauducq 7502f3a765 update dependencies 2022-03-10 17:25:40 +08:00
Sebastien Bourdeauducq fa237088a0 hydra/nixUnstable flake.lock annoyance (2) 2022-03-10 16:51:40 +08:00
Sebastien Bourdeauducq ad557edd58 hydra/nixUnstable flakes.lock annoyance 2022-03-10 16:48:58 +08:00
Sebastien Bourdeauducq f5fa5532b6 flake: update artiq 2022-03-10 16:31:23 +08:00
pca006132 ae0d724bf8 runtime: use &CSlice for lists 2022-03-10 16:30:34 +08:00
occheung 6c834899e9 si5324: fix clock source 2022-03-09 13:55:36 +08:00
occheung a22b13cc46 kasli_soc: forward SMA clkin 2022-03-09 12:43:47 +08:00
spaqin 85e5c08d7f kasli_soc: use si5324 in master 2022-03-04 13:17:53 +08:00
spaqin 3c17362fad satman: fix i2cswitch 2022-03-03 17:18:22 +08:00
spaqin 4f2a0986da rtio_clocking: fix wrong descriptions 2022-03-03 10:24:13 +08:00
spaqin 4a2218641f fix BorrowMutError in moninj 2022-03-02 15:45:17 +08:00
mwojcik 9a06cd9d27 expose pca954x_select api (#167)
PR accompanying to ARTIQ's PCA954X support (#1860).
Co-authored-by: mwojcik <mw@m-labs.hk>
Co-committed-by: mwojcik <mw@m-labs.hk>
2022-03-02 10:52:27 +08:00
Sebastien Bourdeauducq b56b50b147 add comment about EXCEPTION_ID_LOOKUP sync 2022-03-01 09:50:28 +08:00
pca006132 f38117774f runtime/eh_artiq: updated exception IDs
Fixes #166
2022-02-28 21:15:07 +08:00
Sebastien Bourdeauducq 880ba6b206 runtime: add nac3 exception symbols 2022-02-23 11:05:08 +08:00
mwojcik 90ef57f62c flake: update libasync hash 2022-02-11 13:58:04 +08:00
mwojcik accac99f48 updated zynq-rs with pca9547 support (#165)
Co-authored-by: mwojcik <mw@m-labs.hk>
Co-committed-by: mwojcik <mw@m-labs.hk>
2022-02-11 13:53:58 +08:00
mwojcik 412ae98266 flake: add hydraJobs 2022-02-07 09:55:46 +08:00
Sebastien Bourdeauducq 8a89f2b62c flake: sync nixpkgs, update description 2022-02-05 16:33:38 +08:00
mwojcik cc5fdb64c7 flakes support 2022-02-05 16:27:25 +08:00
Sebastien Bourdeauducq 663fdcbabf update copyright year 2022-01-27 18:58:50 +08:00
Sebastien Bourdeauducq f83ab5a662 local_run: fix artiq_netbook invokation 2022-01-27 18:58:26 +08:00
pca006132 6f5ba46e89 runtime/eh_artiq: support exception allocation
The backtrace is now nested, and should be used together with the stack
pointer array to construct the full backtrace for each exception.
We now allocate exception objects in a stack, but their names are still
not allocated. This is fine for exceptions raised in the driver or artiq
code, but we will have to implement allocation for names of exceptions
raised in RPC calls. The compiler should also emit code to store the
exception names once they catch it, to prepare for later reraising.
2022-01-23 21:31:22 +08:00
pca006132 8923feceac runtime/eh_artiq: use forced unwind
This patches ports the LLVM libunwind newly added forced unwinding
function. This enables us to run forced unwinding to obtain correct
backtrace when uncaught exceptions occur.

This patch also changes the exception handling scheme from the standard
two-phase unwinding to single phase using forced unwinding. This brings
some performance improvement and prepared for later nested exception
support. For nested exceptions, we will have to record the backtrace
regardless if the exception is an uncaught exception, as there can be
another exception being thrown while executing the finally block for
caught exceptions, and we will lose the backtrace if we don't store it
earlier before running the cleanup pads.
2022-01-14 13:35:24 +08:00
pca006132 97ca72f7f1 libunwind: enable lto 2022-01-06 14:04:04 +08:00
pca006132 acaf388dbb eh_artiq: handle catch clauses appropriately 2022-01-06 13:41:47 +08:00
pca006132 8788d6458e runtime/rpc: fixes alignment and size problem 2022-01-04 18:25:53 +08:00
pca006132 efe315c21d libdyld: accepts R_ARM_ABS32
Somehow this relocation type is emitted by nac3.
According to table 4-9 of ARM ELF ABI and discussion in ld bugzilla
(https://sourceware.org/bugzilla/show_bug.cgi?id=16163), this behaves
the same as R_ARM_GLOB_DAT and R_ARM_JUMP_SLOT.
2021-12-30 00:05:47 +08:00
stevefan1999 84becfe2c0 report async errors upon kernel termination
Port of 4a6bea479a

Co-authored-by: Steve Fan <sf@m-labs.hk>
Reviewed-on: M-Labs/artiq-zynq#156
Co-authored-by: stevefan1999 <sf@m-labs.hk>
Co-committed-by: stevefan1999 <sf@m-labs.hk>
2021-12-06 17:38:55 +08:00
stevefan1999 a4fbb96296 little fixes for README (#157)
Co-authored-by: Steve Fan <sf@m-labs.hk>
Reviewed-on: M-Labs/artiq-zynq#157
Co-authored-by: stevefan1999 <sf@m-labs.hk>
Co-committed-by: stevefan1999 <sf@m-labs.hk>
2021-12-06 15:20:55 +08:00
mwojcik 64fecf09b7 restore kasli-soc satellite variant check 2021-12-03 19:20:54 +08:00
mwojcik 31fb2b388a Support for DRTIO 100MHz (#155)
Co-authored-by: mwojcik <mw@m-labs.hk>
Co-committed-by: mwojcik <mw@m-labs.hk>
2021-12-03 17:19:42 +08:00
mwojcik e045837b67 zc706: not actually ultrascale 2021-11-29 12:48:45 +08:00
mwojcik ada3f2e704 drtio: reading still needs work buffer after all 2021-11-29 12:46:08 +08:00
mwojcik 8be5048cd3 upgrade to new clock configuration system (#152)
As mentioned in https://github.com/m-labs/artiq/issues/1735 - this is the Zynq version.

Reviewed-on: M-Labs/artiq-zynq#152
Co-authored-by: mwojcik <mw@m-labs.hk>
Co-committed-by: mwojcik <mw@m-labs.hk>
2021-11-29 11:17:59 +08:00
mwojcik e8db2a4b49 drtio: crc from mainline, removed byte swap 2021-11-24 12:12:40 +08:00
mwojcik 4218354e65 zc706: updated device_db for tests 2021-10-16 19:01:54 +08:00
mwojcik 2376f9ab5e Merge pull request 'zc706: added dummy spi' (#149) from mwojcik/artiq-zynq:zc706_dummy_spi into master
Reviewed-on: M-Labs/artiq-zynq#149
2021-10-14 16:38:06 +08:00
mwojcik 0b27349ec4 dummy_spi -> pmod_spi 2021-10-14 16:37:13 +08:00
mwojcik 21eb1cab1a zc706: added dummy spi in place of sdio 2021-10-14 15:43:51 +08:00
mwojcik 3096daaaee zc706: removed nist_clock sdcard, put pmod instead 2021-10-14 15:01:38 +08:00
mwojcik 4fbfccf575 zc706: fix nist_qc2 extension, ams101 iostandard 2021-10-14 12:39:09 +08:00
mwojcik 5c40115945 make ZC706 RTIO channels consistent with KC705
Reviewed-on: M-Labs/artiq-zynq#147
Co-authored-by: mwojcik <mw@m-labs.hk>
Co-committed-by: mwojcik <mw@m-labs.hk>
2021-10-13 17:20:25 +08:00
Sebastien Bourdeauducq a5e3580d18 Revert "runtime: expose rint from libm"
This reverts commit 3582af564d.
2021-10-11 08:13:26 +08:00
Sebastien Bourdeauducq 3582af564d runtime: expose rint from libm 2021-10-10 20:40:29 +08:00
mwojcik 742ce9fdde fix sd and acpki satellite builds 2021-10-08 15:18:23 +02:00
mwojcik c4de1c261a default.nix: restored proper satellite variants 2021-10-08 15:13:56 +02:00
mwojcik 219c075931 added explicit runtime/satman targets for makefile
Reviewed-on: M-Labs/artiq-zynq#144
Co-authored-by: mwojcik <mw@m-labs.hk>
Co-committed-by: mwojcik <mw@m-labs.hk>
2021-10-08 21:06:23 +08:00
mwojcik d04a7decfe removed simple variants from zc706 2021-10-08 11:07:12 +02:00
mwojcik 0efa83e956 update build scripts for DRTIO
Reviewed-on: M-Labs/artiq-zynq#135
Co-authored-by: mwojcik <mw@m-labs.hk>
Co-committed-by: mwojcik <mw@m-labs.hk>
2021-10-08 16:25:13 +08:00
Sebastien Bourdeauducq 4fa824f42b kasli-soc: remove irrelevant comment 2021-10-08 16:13:17 +08:00
mwojcik ab0c205dd2 gateware: add DRTIO
Reviewed-on: M-Labs/artiq-zynq#140
Co-authored-by: mwojcik <mw@m-labs.hk>
Co-committed-by: mwojcik <mw@m-labs.hk>
2021-10-08 16:12:30 +08:00
mwojcik 8d2bb09149 add satman firmware (#136)
Reviewed-on: M-Labs/artiq-zynq#136
Co-authored-by: mwojcik <mw@m-labs.hk>
Co-committed-by: mwojcik <mw@m-labs.hk>
2021-10-08 16:04:50 +08:00
Sebastien Bourdeauducq 41295b0e01 update cargoSha256 2021-10-06 19:43:01 +08:00
mwojcik aaec0abdf6 fix build/warnings before drtio is fully merged 2021-10-06 16:17:19 +08:00
mwojcik e241957419 add libbuild_zynq
Reviewed-on: M-Labs/artiq-zynq#141
Co-authored-by: mwojcik <mw@m-labs.hk>
Co-committed-by: mwojcik <mw@m-labs.hk>
2021-10-06 16:16:49 +08:00
mwojcik 50262b3f0c runtime: link_thread -> link_task 2021-10-06 07:59:55 +02:00
mwojcik 827c6c1306 runtime: switch to libio/libboard_artiq, add DRTIO mastering support
Reviewed-on: M-Labs/artiq-zynq#137
Co-authored-by: mwojcik <mw@m-labs.hk>
Co-committed-by: mwojcik <mw@m-labs.hk>
2021-10-06 13:05:45 +08:00
mwojcik e6863263b4 add libboard_artiq (to be shared between runtime and satman)
Reviewed-on: M-Labs/artiq-zynq#139
Co-authored-by: mwojcik <mw@m-labs.hk>
Co-committed-by: mwojcik <mw@m-labs.hk>
2021-10-06 13:02:28 +08:00
mwojcik d7f45d473e add libio (to be shared between runtime and satman)
Reviewed-on: M-Labs/artiq-zynq#138
Co-authored-by: mwojcik <mw@m-labs.hk>
Co-committed-by: mwojcik <mw@m-labs.hk>
2021-10-06 13:01:52 +08:00
pca006132 35250b3f56 libdyld: fixed symbol relocation
Note that in libdyld/src/lib.rs #117-118, image pointer is already added
to the symbol offset, so we do not need to add the pointer again
2021-09-25 11:30:45 +08:00
Sebastien Bourdeauducq 2ed2ffe417 update dependencies 2021-08-09 15:16:54 +08:00
Sebastien Bourdeauducq 18e05c91e1 zc706: si5324 is not needed for standalone target 2021-08-04 09:14:19 +08:00
mwojcik e3d3cb2311 si5324: bring on par with mainline ARTIQ (#132)
si5324 driver in runtime should be now equal in function to the one in artiq.

kasli-soc has no way of doing a hard reset on the peripheral, but zc706 does.

Reviewed-on: M-Labs/artiq-zynq#132
Co-authored-by: mwojcik <mw@m-labs.hk>
Co-committed-by: mwojcik <mw@m-labs.hk>
2021-08-04 09:12:38 +08:00
Sebastien Bourdeauducq f543501012 si5324: remove debug print 2021-08-02 14:14:59 +08:00
Sebastien Bourdeauducq 111ac0c716 runtime: clock Si5324 from its crystal 2021-07-30 17:07:58 +08:00
Sebastien Bourdeauducq 8128dc0b56 Revert "kasli-soc: work around I2C breakage (#130)"
This reverts commit f1fd55dee5.
2021-07-30 16:55:06 +08:00
Sebastien Bourdeauducq cbcda286dc Revert "README: stable ARTIQ channel"
This reverts commit 4f1689f254.
2021-07-07 18:07:49 +08:00
Sebastien Bourdeauducq dcb6129b0e update dependencies 2021-07-05 13:56:40 +08:00
Sebastien Bourdeauducq f5933092c9 nixpkgs 21.05 2021-06-29 15:07:26 +08:00
Sebastien Bourdeauducq f25e261bdd update dependencies 2021-06-25 17:12:47 +08:00
Sebastien Bourdeauducq 44c2c0fe4d support Kasli-SoC in run scripts 2021-06-25 17:03:55 +08:00
Sebastien Bourdeauducq 4c2c23fcdd shell.nix: install pyftdi (for POR GPIO) 2021-06-25 16:03:26 +08:00
Sebastien Bourdeauducq 480a80cab7 shell.nix: use kasli-soc SZL 2021-06-25 16:03:07 +08:00
Sebastien Bourdeauducq 2ba4d8935d fix compilation with nixpkgs 21.05
The environment variable is optional to keep compatibility with other build environments.

Closes #131
2021-06-25 15:57:39 +08:00
Sebastien Bourdeauducq 8c8a5d53b9 update dependencies 2021-06-19 22:51:25 +08:00
Sebastien Bourdeauducq 852123b42a kasli-soc: add RTIO LEDs 2021-05-30 20:40:53 +08:00
Sebastien Bourdeauducq f1fd55dee5 kasli-soc: work around I2C breakage (#130) 2021-05-29 17:13:41 +08:00
Sebastien Bourdeauducq 21d98711c1 use new smoltcp error code 2021-05-29 17:13:22 +08:00
Sebastien Bourdeauducq 0ae2138034 kasli-soc: preliminary si5324 support 2021-05-29 16:15:27 +08:00
Sebastien Bourdeauducq ce9d38827b update cargoSha256 2021-05-29 14:57:54 +08:00
Sebastien Bourdeauducq 1b474d2dd4 update dependencies 2021-05-29 14:20:23 +08:00
Sebastien Bourdeauducq 4f1689f254 README: stable ARTIQ channel
Hydra zc706-hitl-tests Hydra build #164082 of artiq:zynq:zc706-hitl-tests Details
2021-02-17 19:33:13 +08:00
Sebastien Bourdeauducq 506c741238 support absence of gateware RTIO clock selection mux
Hydra zc706-hitl-tests Hydra build #130237 of artiq:zynq:zc706-hitl-tests Details
2021-02-15 21:41:30 +08:00
Sebastien Bourdeauducq 8815f76114 kasli_soc: fix has_grabber 2021-02-15 21:41:02 +08:00
Sebastien Bourdeauducq ef18fa4c6d kasli_soc: add RTIO log channel
Hydra zc706-hitl-tests Hydra build #129170 of artiq:zynq:zc706-hitl-tests Details
2021-02-15 19:56:59 +08:00
Sebastien Bourdeauducq faf9714e10 add demo build for Kasli-SoC
Hydra zc706-hitl-tests Hydra build #129124 of artiq:zynq:zc706-hitl-tests Details
2021-02-15 19:52:13 +08:00
Sebastien Bourdeauducq c90cb7adad add Kasli-SoC demo JSON 2021-02-15 19:51:46 +08:00
Sebastien Bourdeauducq 8d4e42be32 remove redpitaya and coraz7 support 2021-02-15 19:30:13 +08:00
Sebastien Bourdeauducq dcd3cbc488 update copyright year 2021-02-15 19:16:22 +08:00
Astro fcb38fae6c runtime: disable TCP delayed ack
Hydra zc706-hitl-tests Hydra build #129074 of artiq:zynq:zc706-hitl-tests Details
2021-02-08 03:24:18 +01:00
Astro bfd8343876 update zynq-rs and dependencies (smoltcp 0.7.0) 2021-02-08 03:24:18 +01:00
Sebastien Bourdeauducq 4039431533 kasli_soc: fix eem iostandards
Hydra zc706-hitl-tests Hydra build #127430 of artiq:zynq:zc706-hitl-tests Details
2021-02-07 22:34:29 +08:00
Sebastien Bourdeauducq 3f9bd06468 add Kasli-SoC generic gateware builder (WIP)
Hydra zc706-hitl-tests Hydra build #127354 of artiq:zynq:zc706-hitl-tests Details
2021-02-07 14:44:32 +08:00
117 changed files with 19568 additions and 3393 deletions

8
.gitignore vendored
View File

@ -3,3 +3,11 @@ examples/*.elf
__pycache__ __pycache__
build build
src/libboard_artiq/Cargo.toml
src/libc/Cargo.toml
src/libdyld/Cargo.toml
src/libio/Cargo.toml
src/libksupport/Cargo.toml
src/runtime/Cargo.toml
src/satman/Cargo.toml

106
README.md
View File

@ -4,73 +4,107 @@ ARTIQ on Zynq
How to use How to use
---------- ----------
1. Install ARTIQ-6 or newer. 1. [Install ARTIQ](https://m-labs.hk/artiq/manual/installing.html). Get the corresponding version to the ``artiq-zynq`` version you are targeting.
2. Select the latest successful build on Hydra: https://nixbld.m-labs.hk/jobset/artiq/zynq 2. To obtain firmware binaries, use AFWS or build your own; see [the ARTIQ manual](https://m-labs.hk/artiq/manual/building_developing.html) for detailed instructions or skip to "Development" below. ZC706 variants only can also be downloaded from latest successful build on [Hydra](https://nixbld.m-labs.hk/).
3. Search for the job named ``<board>-<variant>-sd`` (for example: ``zc706-nist_clock-sd`` or ``zc706-nist_qc2-sd``). 3. Place ``boot.bin`` file at the root ``/`` of a FAT-formatted SD card.
4. Download the ``boot.bin`` "binary distribution" and place it at the root of a FAT-formatted SD card. 4. Optionally, create a ``config.txt`` configuration file containing ``key=value`` pairs on each line and place it at the root of the SD card. See below for valid keys. The ``ip``, ``ip6`` and ``mac`` keys can be used to set networking information. If these keys are not found, the firmware will use default values which may or may not be compatible with your network.
5. Optionally, create a ``config.txt`` configuration file at the root of the SD card containing ``key=value`` pairs on each line. Use the ``ip``, ``ip6`` and ``mac`` keys to respectively set the IPv4, IPv6 and MAC address of the board. Configuring an IPv6 address is entirely optional. If these keys are not found, the firmware will use default values that may or may not be compatible with your network. 5. Insert the SD card into the board and set the board to boot from the SD card. For ZC706, this is achieved by placing the large DIP switch SW11 into the 00110 position. On Kasli-SoC, place the BOOT MODE switches to SD.
6. Insert the SD card into the board and set up the board to boot from the SD card. For the ZC706, this is achieved by placing the large DIP switch SW11 in the 00110 position. 6. Power up the board. After successful boot the firmware should respond to ping at its IP addresses. Boot output can be observed from UART at 115200bps 8-N-1.
7. Power up the board. After the firmware starts successfully, it should respond to ping at its IP addresses, and boot messages can be observed from its UART at 115200bps. 7. Create and use an ARTIQ device database as usual.
8. Create and use an ARTIQ device database as usual, but set ``"target": "cortexa9"`` in the arguments of the core device.
Configuration Configuration
------------- -------------
Configuring the device is done using the ``config.txt`` text file at the root of the SD card, plus the contents of the ``config`` folder. When searching for a configuration key, the firmware first looks for a file named ``/config/[key].bin`` and, if it exists, returns the contents of that file. If not, it looks into ``/config.txt``, which contains a list of ``key=value`` pairs, one per line. The ``config`` folder allows configuration values that consist in binary data, such as the startup kernel. Configuring the device is done using the ``config.txt`` text file at the root of the SD card plus optionally a ``config`` folder. When searching for a configuration key, the firmware first looks for a file named ``/config/[key].bin`` and, if it exists, returns the contents of that file. If not, it looks into ``/config.txt``, which should contain a list of ``key=value`` pairs, one per line. ``config.txt`` should be used for most keys but the ``config`` folder allows for setting configuration values which consist of binary data, such as the startup kernel.
The following configuration keys are available: The following configuration keys are available among others:
- ``mac``: Ethernet MAC address. - ``mac``: Ethernet MAC address.
- ``ip``: IPv4 address. - ``ip``: IPv4 address.
- ``ip6``: IPv6 address. - ``ip6``: IPv6 address.
- ``startup``: startup kernel in ELF format (as produced by ``artiq_compile``). - ``idle_kernel``: idle kernel in ELF format (as produced by ``artiq_compile``).
- ``rtioclk``: source of RTIO clock; valid values are ``external`` and ``internal``. - ``startup_kernel``: startup kernel in ELF format (as produced by ``artiq_compile``).
- ``boot``: SD card "boot.bin" file, for replacing the boot firmware/gateware. Write only. - ``rtio_clock``: source of RTIO clock; valid values are ``ext0_bypass`` and ``int_125``.
Configurations can be read/written/removed via ``artiq_coremgmt``. Config erase is See [ARTIQ manual](https://m-labs.hk/artiq/manual-beta/core_device.html#configuration-storage) for full list. Configurations can be read/written/removed with ``artiq_coremgmt``. Config erase is not implemented, as it isn't particularly useful.
not implemented as it seems not very useful.
For convenience, the ``boot`` key can be used with ``artiq_coremgmt`` and a ``boot.bin`` file to replace firmware/gateware in a running system. This key is read-only. When loading ``boot.bin`` onto the SD card directly, place it at the root and not in the ``config`` folder.
Development instructions Development instructions
------------------------ ------------------------
Configure Nix channels: ARTIQ on Zynq is packaged using [Nix](https://nixos.org) Flakes. Install Nix 2.8+ and enable flakes by adding ``experimental-features = nix-command flakes`` to ``nix.conf`` (e.g. ``~/.config/nix/nix.conf``).
**Pure build with Nix:**
```shell ```shell
nix-channel --add https://nixbld.m-labs.hk/channel/custom/artiq/fast-beta/artiq-fast nix build .#zc706-nist_clock-jtag # or zc706-nist_qc2-jtag or zc706-nist_clock-sd or etc
nix-channel --update
``` ```
Note: if you are using Nix channels the first time, you need to be aware of this bug: https://github.com/NixOS/nix/issues/3831 Run ``nix flake show`` to see all valid build targets. Targets suffixed with ``-jtag`` produce separate firmware and gateware files, intended for use in booting via JTAG server/Ethernet, e.g. ``./remote_run.sh -i`` with a remote JTAG server. Targets suffixed with ``-sd`` will produce ``boot.bin`` file suitable for SD card boot. ``-firmware`` and ``-gateware`` respectively build firmware and gateware only.
Pure build with Nix and execution on a remote JTAG server: The Kasli-SoC target requires a system description file as input. See ARTIQ manual for exact instructions or use incremental build.
**Impure incremental build:**
For boards with fixed variants, i.e. ZC706, etc. :
```shell ```shell
nix-build -A zc706-simple-jtag # or zc706-nist_qc2-jtag or zc706-nist_clock-jtag nix develop
./remote_run.sh
```
Impure incremental build and execution on a remote JTAG server:
```shell
nix-shell
cd src cd src
gateware/zc706.py -g ../build/gateware # build gateware gateware/<board>.py -g ../build/gateware -V <variant> # gateware
make # build firmware make GWARGS="-V <variant>" <runtime/satman> # firmware
cd .. ```
./remote_run.sh -i
For boards with system descriptions, i.e. Kasli-SoC, etc. :
```shell
nix develop
cd src
gateware/<board>.py -g ../build/gateware <description.json> # gateware
make TARGET=<board> GWARGS="path/to/description.json" <runtime/satman> # firmware
```
``szl.elf`` can be obtained with:
```shell
nix build git+https://git.m-labs.hk/m-labs/zynq-rs#<board>-szl
```
To generate ``boot.bin`` use ``mkbootimage``, e.g.:
```shell
echo "the_ROM_image:
{
[bootloader]result/szl.elf
gateware/top.bit
firmware/armv7-none-eabihf/release/<runtime/satman>
}
EOF" >> boot.bif
mkbootimage boot.bif boot.bin
``` ```
Notes: Notes:
- This is developed with Nixpkgs 20.09, and the ``nixbld.m-labs.hk`` binary substituter can also be used here (see the ARTIQ manual for the public key and instructions).
- The impure build process is also compatible with non-Nix systems. - The impure build process is also compatible with non-Nix systems.
- If the board is connected to the local machine, use the ``local_run.sh`` script. - Firmware type must be either ``runtime`` for DRTIO-less or DRTIO master variants, or ``satman`` for DRTIO satellite.
- To update ``zynq-rs``, update the cargo files as per usual for Rust projects, but also keep ``zynq-rs.nix`` in sync. - If the board is connected to the local machine by JTAG, use the ``local_run.sh`` script.
- A known Xilinx hardware bug prevents repeatedly loading the bootloader over JTAG without a POR reset. If booting over JTAG, install a jumper on ``PS_POR_B`` and use the POR reset script [here](https://git.m-labs.hk/M-Labs/zynq-rs/src/branch/master/kasli_soc_por.py).
Pre-Commit Hooks
----------------
You are strongly recommended to use the provided pre-commit hooks to automatically reformat files and check for non-optimal Rust/C/C++ practices. Run `pre-commit install` to install the hook and `pre-commit` will automatically run `cargo fmt`, `cargo clippy`, and `clang-format` for you.
Several things to note:
- If `cargo fmt`, `cargo clippy`, or `clang-format` returns an error, the pre-commit hook will fail. You should fix all errors before trying to commit again.
- If `cargo fmt` or `clang-format` reformats some files, the pre-commit hook will also fail. You should review the changes and, if satisfied, try to commit again.
License License
------- -------
Copyright (C) 2019-2020 M-Labs Limited. Copyright (C) 2019-2024 M-Labs Limited.
ARTIQ is free software: you can redistribute it and/or modify ARTIQ is free software: you can redistribute it and/or modify
it under the terms of the GNU Lesser General Public License as published by it under the terms of the GNU Lesser General Public License as published by

View File

@ -1,146 +0,0 @@
let
zynq-rs = (import ./zynq-rs.nix);
pkgs = import <nixpkgs> { overlays = [ (import "${zynq-rs}/nix/mozilla-overlay.nix") ]; };
rustPlatform = (import "${zynq-rs}/nix/rust-platform.nix" { inherit pkgs; });
cargo-xbuild = (import zynq-rs).cargo-xbuild;
mkbootimage = import "${zynq-rs}/nix/mkbootimage.nix" { inherit pkgs; };
artiqpkgs = import <artiq-fast/default.nix> { inherit pkgs; };
vivado = import <artiq-fast/vivado.nix> { inherit pkgs; };
# FSBL configuration supplied by Vivado 2020.1 for these boards:
fsblTargets = ["zc702" "zc706" "zed"];
build = { target, variant }: let
szl = (import zynq-rs)."${target}-szl";
fsbl = import "${zynq-rs}/nix/fsbl.nix" {
inherit pkgs;
board = target;
};
firmware = rustPlatform.buildRustPackage rec {
# note: due to fetchCargoTarball, cargoSha256 depends on package name
name = "firmware";
src = ./src;
cargoSha256 = "1d84yknyizbxgsqj478339fxcyvxq9pzdv0ljrwrgmzgfynqmssj";
nativeBuildInputs = [
pkgs.gnumake
(pkgs.python3.withPackages(ps: (with artiqpkgs; [ migen migen-axi misoc artiq ])))
cargo-xbuild
pkgs.llvmPackages_9.llvm
pkgs.llvmPackages_9.clang-unwrapped
];
buildPhase = ''
export XARGO_RUST_SRC="${rustPlatform.rust.rustc}/lib/rustlib/src/rust/library"
export CARGO_HOME=$(mktemp -d cargo-home.XXX)
make TARGET=${target} VARIANT=${variant}
'';
installPhase = ''
mkdir -p $out $out/nix-support
cp ../build/runtime.bin $out/runtime.bin
cp ../build/firmware/armv7-none-eabihf/release/runtime $out/runtime.elf
echo file binary-dist $out/runtime.bin >> $out/nix-support/hydra-build-products
echo file binary-dist $out/runtime.elf >> $out/nix-support/hydra-build-products
'';
doCheck = false;
dontFixup = true;
};
gateware = pkgs.runCommand "${target}-${variant}-gateware"
{
nativeBuildInputs = [
(pkgs.python3.withPackages(ps: (with artiqpkgs; [ migen migen-axi misoc artiq ])))
vivado
];
}
''
python ${./src/gateware}/${target}.py -g build -V ${variant}
mkdir -p $out $out/nix-support
cp build/top.bit $out
echo file binary-dist $out/top.bit >> $out/nix-support/hydra-build-products
'';
# SZL startup
jtag = pkgs.runCommand "${target}-${variant}-jtag" {}
''
mkdir $out
ln -s ${szl}/szl.elf $out
ln -s ${firmware}/runtime.bin $out
ln -s ${gateware}/top.bit $out
'';
sd = pkgs.runCommand "${target}-${variant}-sd"
{
buildInputs = [ mkbootimage ];
}
''
# Do not use "long" paths in boot.bif, because embedded developers
# can't write software (mkbootimage will segfault).
bifdir=`mktemp -d`
cd $bifdir
ln -s ${szl}/szl.elf szl.elf
ln -s ${firmware}/runtime.elf runtime.elf
ln -s ${gateware}/top.bit top.bit
cat > boot.bif << EOF
the_ROM_image:
{
[bootloader]szl.elf
top.bit
runtime.elf
}
EOF
mkdir $out $out/nix-support
mkbootimage boot.bif $out/boot.bin
echo file binary-dist $out/boot.bin >> $out/nix-support/hydra-build-products
'';
# FSBL startup
fsbl-sd = pkgs.runCommand "${target}-${variant}-fsbl-sd"
{
buildInputs = [ mkbootimage ];
}
''
bifdir=`mktemp -d`
cd $bifdir
ln -s ${fsbl}/fsbl.elf fsbl.elf
ln -s ${gateware}/top.bit top.bit
ln -s ${firmware}/runtime.elf runtime.elf
cat > boot.bif << EOF
the_ROM_image:
{
[bootloader]fsbl.elf
top.bit
runtime.elf
}
EOF
mkdir $out $out/nix-support
mkbootimage boot.bif $out/boot.bin
echo file binary-dist $out/boot.bin >> $out/nix-support/hydra-build-products
'';
in {
"${target}-${variant}-firmware" = firmware;
"${target}-${variant}-gateware" = gateware;
"${target}-${variant}-jtag" = jtag;
"${target}-${variant}-sd" = sd;
} // (
if builtins.elem target fsblTargets
then {
"${target}-${variant}-fsbl-sd" = fsbl-sd;
}
else {}
);
in
(
(build { target = "zc706"; variant = "simple"; }) //
(build { target = "zc706"; variant = "nist_clock"; }) //
(build { target = "zc706"; variant = "nist_qc2"; }) //
(build { target = "zc706"; variant = "acpki_simple"; }) //
(build { target = "zc706"; variant = "acpki_nist_clock"; }) //
(build { target = "zc706"; variant = "acpki_nist_qc2"; }) //
(build { target = "coraz7"; variant = "10"; }) //
(build { target = "coraz7"; variant = "07s"; }) //
(build { target = "coraz7"; variant = "acpki_10"; }) //
(build { target = "coraz7"; variant = "acpki_07s"; }) //
(build { target = "redpitaya"; variant = "simple"; }) //
(build { target = "redpitaya"; variant = "acpki_simple"; }) //
{ inherit zynq-rs; }
)

60
demo.json Normal file
View File

@ -0,0 +1,60 @@
{
"target": "kasli_soc",
"variant": "demo",
"hw_rev": "v1.0",
"base": "standalone",
"peripherals": [
{
"type": "grabber",
"ports": [0]
},
{
"type": "dio",
"ports": [1],
"bank_direction_low": "input",
"bank_direction_high": "output"
},
{
"type": "dio",
"ports": [2],
"bank_direction_low": "output",
"bank_direction_high": "output"
},
{
"type": "urukul",
"dds": "ad9910",
"ports": [3, 4],
"clk_sel": 2
},
{
"type": "zotino",
"ports": [5]
},
{
"type": "sampler",
"ports": [6, 7]
},
{
"type": "mirny",
"ports": [8],
"clk_sel": 1,
"refclk": 125e6
},
{
"type": "fastino",
"ports": [9]
},
{
"type": "dio",
"ports": [10],
"bank_direction_low": "input",
"bank_direction_high": "input"
},
{
"type": "dio",
"ports": [11],
"bank_direction_low": "output",
"bank_direction_high": "input"
}
]
}

View File

@ -8,7 +8,7 @@ device_db = {
"arguments": { "arguments": {
"host": "192.168.1.52", "host": "192.168.1.52",
"ref_period": 1e-9, "ref_period": 1e-9,
"ref_multiplier": 1, "ref_multiplier": 8,
"target": "cortexa9" "target": "cortexa9"
} }
}, },
@ -29,30 +29,11 @@ device_db = {
"class": "PCA9548" "class": "PCA9548"
}, },
# led? are common to all variants
"led0": { "led0": {
"type": "local", "type": "local",
"module": "artiq.coredevice.ttl", "module": "artiq.coredevice.ttl",
"class": "TTLOut", "class": "TTLOut",
"arguments": {"channel": 0}, "arguments": {"channel": 41},
},
"led1": {
"type": "local",
"module": "artiq.coredevice.ttl",
"class": "TTLOut",
"arguments": {"channel": 1},
},
"led2": {
"type": "local",
"module": "artiq.coredevice.ttl",
"class": "TTLOut",
"arguments": {"channel": 2}
},
"led3": {
"type": "local",
"module": "artiq.coredevice.ttl",
"class": "TTLOut",
"arguments": {"channel": 3}
}, },
} }
@ -62,7 +43,7 @@ for i in range(40):
"type": "local", "type": "local",
"module": "artiq.coredevice.ttl", "module": "artiq.coredevice.ttl",
"class": "TTLInOut", "class": "TTLInOut",
"arguments": {"channel": 4+i} "arguments": {"channel": i}
} }
device_db["ad9914dds0"] = { device_db["ad9914dds0"] = {
@ -78,6 +59,14 @@ device_db["ad9914dds1"] = {
"arguments": {"sysclk": 3e9, "bus_channel": 50, "channel": 1}, "arguments": {"sysclk": 3e9, "bus_channel": 50, "channel": 1},
} }
for i in range(4):
device_db["ttl"+str(i)+"_counter"] = {
"type": "local",
"module": "artiq.coredevice.edge_counter",
"class": "EdgeCounter",
"arguments": {"channel": 52+i}
}
# for ARTIQ test suite # for ARTIQ test suite
device_db.update( device_db.update(
loop_out="ttl0", loop_out="ttl0",

View File

@ -0,0 +1,78 @@
core_addr = "192.168.1.57"
device_db = {
"core": {
"type": "local",
"module": "artiq.coredevice.core",
"class": "Core",
"arguments": {
"host": core_addr,
"ref_period": 1e-9,
"target": "cortexa9",
},
},
"core_log": {
"type": "controller",
"host": "::1",
"port": 1068,
"command": "aqctl_corelog -p {port} --bind {bind} " + core_addr,
},
"core_moninj": {
"type": "controller",
"host": "::1",
"port_proxy": 1383,
"port": 1384,
"command": "aqctl_moninj_proxy --port-proxy {port_proxy} --port-control {port} --bind {bind} "
+ core_addr,
},
"core_analyzer": {
"type": "controller",
"host": "::1",
"port_proxy": 1385,
"port": 1386,
"command": "aqctl_coreanalyzer_proxy --port-proxy {port_proxy} --port-control {port} --bind {bind} "
+ core_addr,
},
"core_cache": {
"type": "local",
"module": "artiq.coredevice.cache",
"class": "CoreCache",
},
"core_dma": {"type": "local", "module": "artiq.coredevice.dma", "class": "CoreDMA"},
"led0": {
"type": "local",
"module": "artiq.coredevice.ttl",
"class": "TTLOut",
"arguments": {"channel": 0},
},
"led1": {
"type": "local",
"module": "artiq.coredevice.ttl",
"class": "TTLOut",
"arguments": {"channel": 1},
},
}
# TTLs starting at RTIO channel 2, ending at RTIO channel 15
for i in range(2, 16):
device_db["ttl" + str(i)] = {
"type": "local",
"module": "artiq.coredevice.ttl",
"class": "TTLInOut",
"arguments": {"channel": i},
}
device_db.update(
spi0={
"type": "local",
"module": "artiq.coredevice.spi2",
"class": "SPIMaster",
"arguments": {"channel": 16},
},
dds0={
"type": "local",
"module": "artiq.coredevice.ad9834",
"class": "AD9834",
"arguments": {"spi_device": "spi0"},
},
)

248
flake.lock Normal file
View File

@ -0,0 +1,248 @@
{
"nodes": {
"artiq": {
"inputs": {
"artiq-comtools": "artiq-comtools",
"nixpkgs": "nixpkgs",
"rust-overlay": "rust-overlay",
"sipyco": "sipyco",
"src-migen": "src-migen",
"src-misoc": "src-misoc",
"src-pythonparser": "src-pythonparser"
},
"locked": {
"lastModified": 1732066716,
"narHash": "sha256-krjvt9+RccnAxSEZcFhRpjA2S3CoqE4MSa1JUg421b4=",
"ref": "refs/heads/master",
"rev": "270a417a28b516d36983779a1adb6d33a3c55a4a",
"revCount": 9102,
"type": "git",
"url": "https://github.com/m-labs/artiq.git"
},
"original": {
"type": "git",
"url": "https://github.com/m-labs/artiq.git"
}
},
"artiq-comtools": {
"inputs": {
"flake-utils": "flake-utils",
"nixpkgs": [
"artiq",
"nixpkgs"
],
"sipyco": [
"artiq",
"sipyco"
]
},
"locked": {
"lastModified": 1720768567,
"narHash": "sha256-3VoK7o5MtHtbHLrc6Pv+eQWFtaz5Gd/YWyV5TD3c5Ss=",
"owner": "m-labs",
"repo": "artiq-comtools",
"rev": "f93570d8f2ed5a3cfb3e1c16ab00f2540551e994",
"type": "github"
},
"original": {
"owner": "m-labs",
"repo": "artiq-comtools",
"type": "github"
}
},
"flake-utils": {
"inputs": {
"systems": "systems"
},
"locked": {
"lastModified": 1710146030,
"narHash": "sha256-SZ5L6eA7HJ/nmkzGG7/ISclqe6oZdOZTNoesiInkXPQ=",
"owner": "numtide",
"repo": "flake-utils",
"rev": "b1d9ab70662946ef0850d488da1c9019f3a9752a",
"type": "github"
},
"original": {
"owner": "numtide",
"repo": "flake-utils",
"type": "github"
}
},
"nixpkgs": {
"locked": {
"lastModified": 1731319897,
"narHash": "sha256-PbABj4tnbWFMfBp6OcUK5iGy1QY+/Z96ZcLpooIbuEI=",
"owner": "NixOS",
"repo": "nixpkgs",
"rev": "dc460ec76cbff0e66e269457d7b728432263166c",
"type": "github"
},
"original": {
"owner": "NixOS",
"ref": "nixos-unstable",
"repo": "nixpkgs",
"type": "github"
}
},
"root": {
"inputs": {
"artiq": "artiq",
"zynq-rs": "zynq-rs"
}
},
"rust-overlay": {
"inputs": {
"nixpkgs": [
"artiq",
"nixpkgs"
]
},
"locked": {
"lastModified": 1719454714,
"narHash": "sha256-MojqG0lyUINkEk0b3kM2drsU5vyaF8DFZe/FAlZVOGs=",
"owner": "oxalica",
"repo": "rust-overlay",
"rev": "d1c527659cf076ecc4b96a91c702d080b213801e",
"type": "github"
},
"original": {
"owner": "oxalica",
"ref": "snapshot/2024-08-01",
"repo": "rust-overlay",
"type": "github"
}
},
"rust-overlay_2": {
"inputs": {
"nixpkgs": [
"zynq-rs",
"nixpkgs"
]
},
"locked": {
"lastModified": 1719454714,
"narHash": "sha256-MojqG0lyUINkEk0b3kM2drsU5vyaF8DFZe/FAlZVOGs=",
"owner": "oxalica",
"repo": "rust-overlay",
"rev": "d1c527659cf076ecc4b96a91c702d080b213801e",
"type": "github"
},
"original": {
"owner": "oxalica",
"ref": "snapshot/2024-08-01",
"repo": "rust-overlay",
"type": "github"
}
},
"sipyco": {
"inputs": {
"nixpkgs": [
"artiq",
"nixpkgs"
]
},
"locked": {
"lastModified": 1728371104,
"narHash": "sha256-PPnAyDedUQ7Og/Cby9x5OT9wMkNGTP8GS53V6N/dk4w=",
"owner": "m-labs",
"repo": "sipyco",
"rev": "094a6cd63ffa980ef63698920170e50dc9ba77fd",
"type": "github"
},
"original": {
"owner": "m-labs",
"repo": "sipyco",
"type": "github"
}
},
"src-migen": {
"flake": false,
"locked": {
"lastModified": 1727677091,
"narHash": "sha256-Zg3SQnTwMM/VkOGKogbPyuCC2NhLy8HB2SPEUWWNgCU=",
"owner": "m-labs",
"repo": "migen",
"rev": "c19ae9f8ae162ffe2d310a92bfce53ac2a821bc8",
"type": "github"
},
"original": {
"owner": "m-labs",
"repo": "migen",
"type": "github"
}
},
"src-misoc": {
"flake": false,
"locked": {
"lastModified": 1729234629,
"narHash": "sha256-TLsTCXV5AC2xh+bS7EhBVBKqdqIU3eKrnlWcFF9LtAM=",
"ref": "refs/heads/master",
"rev": "6085a312bca26adeca6584e37d08c8ba2e1d6e38",
"revCount": 2460,
"submodules": true,
"type": "git",
"url": "https://github.com/m-labs/misoc.git"
},
"original": {
"submodules": true,
"type": "git",
"url": "https://github.com/m-labs/misoc.git"
}
},
"src-pythonparser": {
"flake": false,
"locked": {
"lastModified": 1628745371,
"narHash": "sha256-p6TgeeaK4NEmbhimEXp31W8hVRo4DgWmcCoqZ+UdN60=",
"owner": "m-labs",
"repo": "pythonparser",
"rev": "5413ee5c9f8760e95c6acd5d6e88dabb831ad201",
"type": "github"
},
"original": {
"owner": "m-labs",
"repo": "pythonparser",
"type": "github"
}
},
"systems": {
"locked": {
"lastModified": 1681028828,
"narHash": "sha256-Vy1rq5AaRuLzOxct8nz4T6wlgyUR7zLU309k9mBC768=",
"owner": "nix-systems",
"repo": "default",
"rev": "da67096a3b9bf56a91d16901293e51ba5b49a27e",
"type": "github"
},
"original": {
"owner": "nix-systems",
"repo": "default",
"type": "github"
}
},
"zynq-rs": {
"inputs": {
"nixpkgs": [
"artiq",
"nixpkgs"
],
"rust-overlay": "rust-overlay_2"
},
"locked": {
"lastModified": 1731749494,
"narHash": "sha256-WGigAhvVCGN5YZ1dHPyvoqAh47W1Gtph036O1aKFlLE=",
"ref": "refs/heads/master",
"rev": "12975de2e110d7948bf47b768559f727d0abc8fc",
"revCount": 655,
"type": "git",
"url": "https://git.m-labs.hk/m-labs/zynq-rs"
},
"original": {
"type": "git",
"url": "https://git.m-labs.hk/m-labs/zynq-rs"
}
}
},
"root": "root",
"version": 7
}

399
flake.nix Normal file
View File

@ -0,0 +1,399 @@
{
description = "ARTIQ port to the Zynq-7000 platform";
inputs.artiq.url = git+https://github.com/m-labs/artiq.git;
inputs.zynq-rs.url = git+https://git.m-labs.hk/m-labs/zynq-rs;
inputs.zynq-rs.inputs.nixpkgs.follows = "artiq/nixpkgs";
outputs = { self, zynq-rs, artiq }:
let
pkgs = import artiq.inputs.nixpkgs { system = "x86_64-linux"; overlays = [ (import zynq-rs.inputs.rust-overlay) ]; };
zynqpkgs = zynq-rs.packages.x86_64-linux;
artiqpkgs = artiq.packages.x86_64-linux;
llvmPackages_11 = zynq-rs.llvmPackages_11;
rust = zynq-rs.rust;
rustPlatform = zynq-rs.rustPlatform;
fastnumbers = pkgs.python3Packages.buildPythonPackage rec {
pname = "fastnumbers";
version = "5.1.0";
src = pkgs.python3Packages.fetchPypi {
inherit pname version;
sha256 = "sha256-4JLTP4uVwxcaL7NOV57+DFSwKQ3X+W/6onYkN2AdkKc=";
};
};
artiq-netboot = pkgs.python3Packages.buildPythonPackage rec {
pname = "artiq-netboot";
version = "unstable-2020-10-15";
src = pkgs.fetchgit {
url = "https://git.m-labs.hk/m-labs/artiq-netboot.git";
rev = "04f69eb07df73abe4b89fde2c24084f7664f2104";
sha256 = "0ql4fr8m8gpb2yql8aqsdqsssxb8zqd6l65kl1f6s9845zy7shs9";
};
};
ramda = pkgs.python3Packages.buildPythonPackage {
pname = "ramda";
version = "unstable-2020-04-11";
src = pkgs.fetchFromGitHub {
owner = "peteut";
repo = "ramda.py";
rev = "d315a9717ebd639366bf3fe26bad9e3d08ec3c49";
sha256 = "sha256-bmSt/IHDnULsZjsC6edELnNH7LoJSVF4L4XhwBAXRkY=";
};
nativeBuildInputs = with pkgs.python3Packages; [ pbr ];
propagatedBuildInputs = with pkgs.python3Packages; [ future fastnumbers ];
checkInputs = with pkgs.python3Packages; [ pytest ];
checkPhase = "pytest";
doCheck = false;
preBuild = ''
export PBR_VERSION=0.5.5
'';
};
migen-axi = pkgs.python3Packages.buildPythonPackage {
pname = "migen-axi";
version = "unstable-2023-01-06";
src = pkgs.fetchFromGitHub {
owner = "peteut";
repo = "migen-axi";
rev = "27eaa84a70a3abfe1930c86c36c4de2cd652da35";
sha256 = "sha256-3Y9W5ns+1wbVd14iePzgSBzE+LxnGMUDtUw3BccFt80=";
};
format = "pyproject";
propagatedBuildInputs = with pkgs.python3Packages; [ setuptools click numpy toolz jinja2 ramda artiqpkgs.migen artiqpkgs.misoc ];
checkInputs = with pkgs.python3Packages; [ pytestCheckHook pytest-timeout ];
# migen/misoc version checks are broken with pyproject for some reason
postPatch = ''
sed -i "1,4d" pyproject.toml
substituteInPlace pyproject.toml \
--replace '"migen@git+https://github.com/m-labs/migen",' ""
substituteInPlace pyproject.toml \
--replace '"misoc@git+https://github.com/m-labs/misoc.git",' ""
# pytest-flake8 is broken with recent flake8. Re-enable after fix.
substituteInPlace setup.cfg --replace '--flake8' ""
'';
};
binutils = { platform, target, zlib }: pkgs.stdenv.mkDerivation rec {
basename = "binutils";
version = "2.30";
name = "${basename}-${platform}-${version}";
src = pkgs.fetchurl {
url = "https://ftp.gnu.org/gnu/binutils/binutils-${version}.tar.bz2";
sha256 = "028cklfqaab24glva1ks2aqa1zxa6w6xmc8q34zs1sb7h22dxspg";
};
configureFlags =
[ "--enable-shared" "--enable-deterministic-archives" "--target=${target}"];
outputs = [ "out" "info" "man" ];
depsBuildBuild = [ pkgs.buildPackages.stdenv.cc ];
buildInputs = [ zlib ];
enableParallelBuilding = true;
};
binutils-arm = pkgs.callPackage binutils { platform = "arm"; target = "armv7-unknown-linux-gnueabihf"; };
# FSBL configuration supplied by Vivado 2020.1 for these boards:
fsblTargets = ["zc702" "zc706" "zed"];
sat_variants = [
# kasli-soc satellite variants
"satellite"
# zc706 satellite variants
"nist_clock_satellite" "nist_qc2_satellite" "acpki_nist_clock_satellite" "acpki_nist_qc2_satellite"
"nist_clock_satellite_100mhz" "nist_qc2_satellite_100mhz" "acpki_nist_clock_satellite_100mhz" "acpki_nist_qc2_satellite_100mhz"
];
board-package-set = { target, variant, json ? null }: let
szl = zynqpkgs."${target}-szl";
fsbl = zynqpkgs."${target}-fsbl";
fwtype = if builtins.elem variant sat_variants then "satman" else "runtime";
firmware = rustPlatform.buildRustPackage rec {
name = "firmware";
src = ./src;
cargoLock = {
lockFile = src/Cargo.lock;
outputHashes = {
"tar-no-std-0.1.8" = "sha256-xm17108v4smXOqxdLvHl9CxTCJslmeogjm4Y87IXFuM=";
"nalgebra-0.32.6" = "sha256-L/YudkVOtfGYoNQKBD7LMk/sMYgRDzPDdpGL5rO7G2I=";
};
};
nativeBuildInputs = [
pkgs.gnumake
(pkgs.python3.withPackages(ps: [ ps.jsonschema artiqpkgs.migen migen-axi artiqpkgs.misoc artiqpkgs.artiq ]))
zynqpkgs.cargo-xbuild
llvmPackages_11.llvm
llvmPackages_11.clang-unwrapped
];
buildPhase = ''
export XARGO_RUST_SRC="${rust}/lib/rustlib/src/rust/library"
export CLANG_EXTRA_INCLUDE_DIR="${llvmPackages_11.clang-unwrapped.lib}/lib/clang/11.1.0/include"
export CARGO_HOME=$(mktemp -d cargo-home.XXX)
export ZYNQ_RS=${zynq-rs}
make TARGET=${target} GWARGS="${if json == null then "-V ${variant}" else json}" ${fwtype}
'';
installPhase = ''
mkdir -p $out $out/nix-support
cp ../build/${fwtype}.bin $out/${fwtype}.bin
cp ../build/firmware/armv7-none-eabihf/release/${fwtype} $out/${fwtype}.elf
echo file binary-dist $out/${fwtype}.bin >> $out/nix-support/hydra-build-products
echo file binary-dist $out/${fwtype}.elf >> $out/nix-support/hydra-build-products
'';
doCheck = false;
dontFixup = true;
auditable = false;
};
gateware = pkgs.runCommand "${target}-${variant}-gateware"
{
nativeBuildInputs = [
(pkgs.python3.withPackages(ps: [ ps.jsonschema artiqpkgs.migen migen-axi artiqpkgs.misoc artiqpkgs.artiq ]))
artiqpkgs.vivado
];
}
''
python ${./src/gateware}/${target}.py -g build ${if json == null then "-V ${variant}" else json}
mkdir -p $out $out/nix-support
cp build/top.bit $out
echo file binary-dist $out/top.bit >> $out/nix-support/hydra-build-products
'';
# SZL startup
jtag = pkgs.runCommand "${target}-${variant}-jtag" {}
''
mkdir $out
ln -s ${szl}/szl.elf $out
ln -s ${firmware}/${fwtype}.bin $out
ln -s ${gateware}/top.bit $out
'';
sd = pkgs.runCommand "${target}-${variant}-sd"
{
buildInputs = [ zynqpkgs.mkbootimage ];
}
''
# Do not use "long" paths in boot.bif, because embedded developers
# can't write software (mkbootimage will segfault).
bifdir=`mktemp -d`
cd $bifdir
ln -s ${szl}/szl.elf szl.elf
ln -s ${firmware}/${fwtype}.elf ${fwtype}.elf
ln -s ${gateware}/top.bit top.bit
cat > boot.bif << EOF
the_ROM_image:
{
[bootloader]szl.elf
top.bit
${fwtype}.elf
}
EOF
mkdir $out $out/nix-support
mkbootimage boot.bif $out/boot.bin
echo file binary-dist $out/boot.bin >> $out/nix-support/hydra-build-products
'';
# FSBL startup
fsbl-sd = pkgs.runCommand "${target}-${variant}-fsbl-sd"
{
buildInputs = [ zynqpkgs.mkbootimage ];
}
''
bifdir=`mktemp -d`
cd $bifdir
ln -s ${fsbl}/fsbl.elf fsbl.elf
ln -s ${gateware}/top.bit top.bit
ln -s ${firmware}/${fwtype}.elf ${fwtype}.elf
cat > boot.bif << EOF
the_ROM_image:
{
[bootloader]fsbl.elf
top.bit
${fwtype}.elf
}
EOF
mkdir $out $out/nix-support
mkbootimage boot.bif $out/boot.bin
echo file binary-dist $out/boot.bin >> $out/nix-support/hydra-build-products
'';
in {
"${target}-${variant}-firmware" = firmware;
"${target}-${variant}-gateware" = gateware;
"${target}-${variant}-jtag" = jtag;
"${target}-${variant}-sd" = sd;
} // (
if builtins.elem target fsblTargets
then {
"${target}-${variant}-fsbl-sd" = fsbl-sd;
}
else {}
);
gateware-sim = pkgs.stdenv.mkDerivation {
name = "gateware-sim";
nativeBuildInputs = [
(pkgs.python3.withPackages(ps: [ artiqpkgs.migen migen-axi artiqpkgs.artiq ]))
];
phases = [ "buildPhase" ];
buildPhase =
''
python -m unittest discover ${self}/src/gateware -v
touch $out
'';
};
fmt-check = pkgs.stdenvNoCC.mkDerivation {
name = "fmt-check";
src = ./src;
nativeBuildInputs = [ rust pkgs.gnumake ];
phases = [ "unpackPhase" "buildPhase" ];
buildPhase =
''
export ZYNQ_RS=${zynq-rs}
make manifests
cargo fmt -- --check
touch $out
'';
};
# for hitl-tests
zc706-nist_qc2 = (board-package-set { target = "zc706"; variant = "nist_qc2"; });
zc706-hitl-tests = pkgs.stdenv.mkDerivation {
name = "zc706-hitl-tests";
__networked = true; # compatibility with old patched Nix
# breaks hydra, https://github.com/NixOS/hydra/issues/1216
#__impure = true; # Nix 2.8+
buildInputs = [
pkgs.netcat pkgs.openssh pkgs.rsync artiqpkgs.artiq artiq-netboot zynqpkgs.zc706-szl
];
phases = [ "buildPhase" ];
buildPhase =
''
export NIX_SSHOPTS="-F /dev/null -o StrictHostKeyChecking=no -o UserKnownHostsFile=/dev/null -o LogLevel=ERROR -i /opt/hydra_id_ed25519"
LOCKCTL=$(mktemp -d)
mkfifo $LOCKCTL/lockctl
cat $LOCKCTL/lockctl | ${pkgs.openssh}/bin/ssh \
$NIX_SSHOPTS \
rpi-4 \
'mkdir -p /tmp/board_lock && flock /tmp/board_lock/zc706-1 -c "echo Ok; cat"' \
| (
# End remote flock via FIFO
atexit_unlock() {
echo > $LOCKCTL/lockctl
}
trap atexit_unlock EXIT
# Read "Ok" line when remote successfully locked
read LOCK_OK
echo Power cycling board...
(echo b; sleep 5; echo B; sleep 5) | nc -N -w6 192.168.1.31 3131
echo Power cycle done.
export USER=hydra
export OPENOCD_ZYNQ=${zynq-rs}/openocd
export SZL=${zynqpkgs.szl}
bash ${self}/remote_run.sh -h rpi-4 -o "$NIX_SSHOPTS" -d ${zc706-nist_qc2.zc706-nist_qc2-jtag}
echo Waiting for the firmware to boot...
sleep 15
echo Running test kernel...
artiq_run --device-db ${self}/examples/device_db.py ${self}/examples/mandelbrot.py
echo Running ARTIQ unit tests...
export ARTIQ_ROOT=${self}/examples
export ARTIQ_LOW_LATENCY=1
python -m unittest discover artiq.test.coredevice -v
touch $out
echo Completed
(echo b; sleep 5) | nc -N -w6 192.168.1.31 3131
echo Board powered off
)
'';
};
in rec {
packages.x86_64-linux =
{
inherit fastnumbers artiq-netboot ramda migen-axi binutils-arm;
} //
(board-package-set { target = "zc706"; variant = "nist_clock"; }) //
(board-package-set { target = "zc706"; variant = "nist_clock_master"; }) //
(board-package-set { target = "zc706"; variant = "nist_clock_master_100mhz"; }) //
(board-package-set { target = "zc706"; variant = "nist_clock_satellite"; }) //
(board-package-set { target = "zc706"; variant = "nist_clock_satellite_100mhz"; }) //
(board-package-set { target = "zc706"; variant = "nist_qc2"; }) //
(board-package-set { target = "zc706"; variant = "nist_qc2_master"; }) //
(board-package-set { target = "zc706"; variant = "nist_qc2_master_100mhz"; }) //
(board-package-set { target = "zc706"; variant = "nist_qc2_satellite"; }) //
(board-package-set { target = "zc706"; variant = "nist_qc2_satellite_100mhz"; }) //
(board-package-set { target = "zc706"; variant = "acpki_nist_clock"; }) //
(board-package-set { target = "zc706"; variant = "acpki_nist_clock_master"; }) //
(board-package-set { target = "zc706"; variant = "acpki_nist_clock_master_100mhz"; }) //
(board-package-set { target = "zc706"; variant = "acpki_nist_clock_satellite"; }) //
(board-package-set { target = "zc706"; variant = "acpki_nist_clock_satellite_100mhz"; }) //
(board-package-set { target = "zc706"; variant = "acpki_nist_qc2"; }) //
(board-package-set { target = "zc706"; variant = "acpki_nist_qc2_master"; }) //
(board-package-set { target = "zc706"; variant = "acpki_nist_qc2_master_100mhz"; }) //
(board-package-set { target = "zc706"; variant = "acpki_nist_qc2_satellite"; }) //
(board-package-set { target = "zc706"; variant = "acpki_nist_qc2_satellite_100mhz"; }) //
(board-package-set { target = "kasli_soc"; variant = "demo"; json = ./demo.json; }) //
(board-package-set { target = "kasli_soc"; variant = "master"; json = ./kasli-soc-master.json; }) //
(board-package-set { target = "kasli_soc"; variant = "satellite"; json = ./kasli-soc-satellite.json; }) //
(board-package-set { target = "ebaz4205"; variant = "base"; });
hydraJobs = packages.x86_64-linux // { inherit zc706-hitl-tests; inherit gateware-sim; inherit fmt-check; };
devShell.x86_64-linux = pkgs.mkShell {
name = "artiq-zynq-dev-shell";
buildInputs = with pkgs; [
rust
llvmPackages_11.llvm
llvmPackages_11.clang-unwrapped
gnumake
cacert
zynqpkgs.cargo-xbuild
zynqpkgs.mkbootimage
openocd
openssh rsync
(python3.withPackages(ps: (with artiqpkgs; [ migen migen-axi misoc artiq artiq-netboot ps.jsonschema ps.pyftdi ])))
artiqpkgs.artiq
artiqpkgs.vivado
binutils-arm
pre-commit
];
XARGO_RUST_SRC = "${rust}/lib/rustlib/src/rust/library";
CLANG_EXTRA_INCLUDE_DIR = "${llvmPackages_11.clang-unwrapped.lib}/lib/clang/11.1.0/include";
ZYNQ_RS = "${zynq-rs}";
OPENOCD_ZYNQ = "${zynq-rs}/openocd";
SZL = "${zynqpkgs.szl}";
};
makeArtiqZynqPackage = board-package-set;
};
}

60
kasli-soc-master.json Normal file
View File

@ -0,0 +1,60 @@
{
"target": "kasli_soc",
"variant": "master",
"hw_rev": "v1.0",
"base": "master",
"peripherals": [
{
"type": "grabber",
"ports": [0]
},
{
"type": "dio",
"ports": [1],
"bank_direction_low": "input",
"bank_direction_high": "output"
},
{
"type": "dio",
"ports": [2],
"bank_direction_low": "output",
"bank_direction_high": "output"
},
{
"type": "urukul",
"dds": "ad9910",
"ports": [3, 4],
"clk_sel": 2
},
{
"type": "zotino",
"ports": [5]
},
{
"type": "sampler",
"ports": [6, 7]
},
{
"type": "mirny",
"ports": [8],
"clk_sel": 1,
"refclk": 125e6
},
{
"type": "fastino",
"ports": [9]
},
{
"type": "dio",
"ports": [10],
"bank_direction_low": "input",
"bank_direction_high": "input"
},
{
"type": "dio",
"ports": [11],
"bank_direction_low": "output",
"bank_direction_high": "input"
}
]
}

60
kasli-soc-satellite.json Normal file
View File

@ -0,0 +1,60 @@
{
"target": "kasli_soc",
"variant": "satellite",
"hw_rev": "v1.0",
"base": "satellite",
"peripherals": [
{
"type": "grabber",
"ports": [0]
},
{
"type": "dio",
"ports": [1],
"bank_direction_low": "input",
"bank_direction_high": "output"
},
{
"type": "dio",
"ports": [2],
"bank_direction_low": "output",
"bank_direction_high": "output"
},
{
"type": "urukul",
"dds": "ad9910",
"ports": [3, 4],
"clk_sel": 2
},
{
"type": "zotino",
"ports": [5]
},
{
"type": "sampler",
"ports": [6, 7]
},
{
"type": "mirny",
"ports": [8],
"clk_sel": 1,
"refclk": 125e6
},
{
"type": "fastino",
"ports": [9]
},
{
"type": "dio",
"ports": [10],
"bank_direction_low": "input",
"bank_direction_high": "input"
},
{
"type": "dio",
"ports": [11],
"bank_direction_low": "output",
"bank_direction_high": "input"
}
]
}

View File

@ -13,9 +13,10 @@ fi
impure=0 impure=0
load_bitstream=1 load_bitstream=1
board_host="192.168.1.52" board_type="kasli_soc"
fw_type="runtime"
while getopts "ilb:" opt; do while getopts "ilb:t:f:" opt; do
case "$opt" in case "$opt" in
\?) exit 1 \?) exit 1
;; ;;
@ -25,24 +26,36 @@ while getopts "ilb:" opt; do
;; ;;
b) board_host=$OPTARG b) board_host=$OPTARG
;; ;;
t) board_type=$OPTARG
;;
f) fw_type=$OPTARG
;;
esac esac
done done
if [ -z "$board_host" ]; then
case $board_type in
kasli_soc) board_host="192.168.1.56";;
zc706) board_host="192.168.1.52";;
*) echo "Unknown board type"; exit 1;;
esac
fi
load_bitstream_cmd="" load_bitstream_cmd=""
build_dir=`pwd`/build build_dir=`pwd`/build
result_dir=`pwd`/result result_dir=`pwd`/result
cd $OPENOCD_ZYNQ cd $OPENOCD_ZYNQ
openocd -f zc706.cfg -c "load_image $SZL; resume 0; exit" openocd -f $board_type.cfg -c "load_image $SZL/szl-$board_type.elf; resume 0; exit"
sleep 5 sleep 5
if [ $impure -eq 1 ]; then if [ $impure -eq 1 ]; then
if [ $load_bitstream -eq 1 ]; then if [ $load_bitstream -eq 1 ]; then
load_bitstream_cmd="-g $build_dir/gateware/top.bit" load_bitstream_cmd="-g $build_dir/gateware/top.bit"
fi fi
artiq_netboot $load_bitstream_cmd -f $build_dir/runtime.bin -b $board_host artiq_netboot $load_bitstream_cmd -f $build_dir/$fw_type.bin -b $board_host
else else
if [ $load_bitstream -eq 1 ]; then if [ $load_bitstream -eq 1 ]; then
load_bitstream_cmd="-g $result_dir/top.bit" load_bitstream_cmd="-g $result_dir/top.bit"
fi fi
artiq_netboot $load_bitstream_cmd -f $result_dir/runtime.bin -b $board_host artiq_netboot $load_bitstream_cmd -f $result_dir/$fw_type.bin -b $board_host
fi fi

View File

@ -1,5 +1,7 @@
#!/usr/bin/env bash #!/usr/bin/env bash
# Only ZC706 supported for now.
set -e set -e
if [ -z "$OPENOCD_ZYNQ" ]; then if [ -z "$OPENOCD_ZYNQ" ]; then
@ -18,8 +20,9 @@ impure_dir="build"
sshopts="" sshopts=""
load_bitstream=1 load_bitstream=1
board_host="192.168.1.52" board_host="192.168.1.52"
fw_type="runtime"
while getopts "h:id:o:l" opt; do while getopts "h:id:o:lt:" opt; do
case "$opt" in case "$opt" in
\?) exit 1 \?) exit 1
;; ;;
@ -36,6 +39,8 @@ while getopts "h:id:o:l" opt; do
;; ;;
b) board_host=$OPTARG b) board_host=$OPTARG
;; ;;
t) fw_type=$OPTARG
;;
esac esac
done done
@ -46,17 +51,17 @@ echo "Creating $target_folder..."
ssh $sshopts $target_host "mkdir -p $target_folder" ssh $sshopts $target_host "mkdir -p $target_folder"
echo "Copying files..." echo "Copying files..."
rsync -e "ssh $sshopts" -Lc $OPENOCD_ZYNQ/* $target_host:$target_folder rsync -e "ssh $sshopts" -Lc $OPENOCD_ZYNQ/* $target_host:$target_folder
rsync -e "ssh $sshopts" -Lc $SZL $target_host:$target_folder rsync -e "ssh $sshopts" -Lc $SZL/szl-zc706.elf $target_host:$target_folder/szl.elf
if [ $impure -eq 1 ]; then if [ $impure -eq 1 ]; then
if [ $load_bitstream -eq 1 ]; then if [ $load_bitstream -eq 1 ]; then
load_bitstream_cmd="-g build/gateware/top.bit" load_bitstream_cmd="-g build/gateware/top.bit"
fi fi
firmware="build/runtime.bin" firmware="build/$fw_type.bin"
else else
if [ $load_bitstream -eq 1 ]; then if [ $load_bitstream -eq 1 ]; then
load_bitstream_cmd="-g $pure_dir/top.bit" load_bitstream_cmd="-g $pure_dir/top.bit"
fi fi
firmware="$pure_dir/runtime.bin" firmware="$pure_dir/$fw_type.bin"
fi fi
echo "Programming board..." echo "Programming board..."
ssh $sshopts $target_host "cd $target_folder; openocd -f zc706.cfg -c'load_image szl.elf; resume 0; exit'" ssh $sshopts $target_host "cd $target_folder; openocd -f zc706.cfg -c'load_image szl.elf; resume 0; exit'"

View File

@ -1,35 +0,0 @@
let
zynq-rs = (import ./zynq-rs.nix);
pkgs = import <nixpkgs> { overlays = [ (import "${zynq-rs}/nix/mozilla-overlay.nix") ]; };
rustPlatform = (import "${zynq-rs}/nix/rust-platform.nix" { inherit pkgs; });
cargo-xbuild = (import zynq-rs).cargo-xbuild;
artiq-fast = <artiq-fast>;
artiqpkgs = import "${artiq-fast}/default.nix" { inherit pkgs; };
vivado = import "${artiq-fast}/vivado.nix" { inherit pkgs; };
zc706-szl = (import zynq-rs).zc706-szl;
in
pkgs.stdenv.mkDerivation {
name = "artiq-zynq-env";
buildInputs = [
pkgs.gnumake
rustPlatform.rust.rustc
rustPlatform.rust.cargo
pkgs.llvmPackages_9.llvm
pkgs.llvmPackages_9.clang-unwrapped
pkgs.cacert
cargo-xbuild
pkgs.openocd
pkgs.openssh pkgs.rsync
(pkgs.python3.withPackages(ps: (with artiqpkgs; [ migen migen-axi misoc artiq artiq-netboot ])))
vivado
artiqpkgs.binutils-arm
(import "${zynq-rs}/nix/mkbootimage.nix" { inherit pkgs; })
];
XARGO_RUST_SRC = "${rustPlatform.rust.rustc}/lib/rustlib/src/rust/library";
OPENOCD_ZYNQ = "${zynq-rs}/openocd";
SZL = "${zc706-szl}/szl.elf";
}

32
src/.clang-format Normal file
View File

@ -0,0 +1,32 @@
BasedOnStyle: LLVM
Language: Cpp
Standard: Cpp11
AccessModifierOffset: -1
AlignEscapedNewlines: Left
AlwaysBreakAfterReturnType: None
AlwaysBreakTemplateDeclarations: Yes
AllowAllParametersOfDeclarationOnNextLine: false
AllowShortFunctionsOnASingleLine: Inline
BinPackParameters: false
BreakBeforeBinaryOperators: NonAssignment
BreakBeforeTernaryOperators: true
BreakConstructorInitializers: AfterColon
BreakInheritanceList: AfterColon
ColumnLimit: 120
ConstructorInitializerAllOnOneLineOrOnePerLine: true
ContinuationIndentWidth: 4
DerivePointerAlignment: false
IndentCaseLabels: true
IndentPPDirectives: None
IndentWidth: 4
MaxEmptyLinesToKeep: 1
PointerAlignment: Left
ReflowComments: true
SortIncludes: false
SortUsingDeclarations: true
SpaceAfterTemplateKeyword: false
SpacesBeforeTrailingComments: 2
TabWidth: 4
UseTab: Never

1
src/.clippy.toml Normal file
View File

@ -0,0 +1 @@
doc-valid-idents = ["CPython", "NumPy", ".."]

View File

@ -0,0 +1,32 @@
# See https://pre-commit.com for more information
# See https://pre-commit.com/hooks.html for more hooks
default_stages: [commit]
repos:
- repo: local
hooks:
- id: cargo-fmt
name: artiq-zynq cargo format
entry: nix
language: system
types: [file, rust]
pass_filenames: false
description: Runs cargo fmt on the codebase.
args: [develop, -c, cargo, fmt, --manifest-path, src/Cargo.toml, --all]
- id: cargo-clippy
name: artiq-zynq cargo clippy
entry: nix
language: system
types: [file, rust]
pass_filenames: false
description: Runs cargo clippy on the codebase.
args: [develop, -c, cargo, clippy, --manifest-path, src/Cargo.toml, --tests]
- repo: https://github.com/pre-commit/mirrors-clang-format
rev: v19.1.0
hooks:
- id: clang-format
name: artiq-zynq clang-format
description: Runs clang-format on the codebase.
files: \.(cpp|h|hpp|c)$
args: [-style=file, -fallback-style=none, -assume-filename=src/.clang-format]

387
src/Cargo.lock generated
View File

@ -1,10 +1,27 @@
# This file is automatically @generated by Cargo. # This file is automatically @generated by Cargo.
# It is not intended for manual editing. # It is not intended for manual editing.
version = 3
[[package]]
name = "approx"
version = "0.5.1"
source = "registry+https://github.com/rust-lang/crates.io-index"
checksum = "cab112f0a86d568ea0e627cc1d6be74a1e9cd55214684db5561995f6dad897c6"
dependencies = [
"num-traits",
]
[[package]]
name = "arrayvec"
version = "0.7.4"
source = "registry+https://github.com/rust-lang/crates.io-index"
checksum = "96d30a06541fbafbc7f82ed10c06164cfbd2c401138f6addd8404629c4b16711"
[[package]] [[package]]
name = "async-recursion" name = "async-recursion"
version = "0.3.1" version = "0.3.2"
source = "registry+https://github.com/rust-lang/crates.io-index" source = "registry+https://github.com/rust-lang/crates.io-index"
checksum = "e5444eec77a9ec2bfe4524139e09195862e981400c4358d3b760cae634e4c4ee" checksum = "d7d78656ba01f1b93024b7c3a0467f1608e4be67d725749fdcd7d2c7678fd7a2"
dependencies = [ dependencies = [
"proc-macro2", "proc-macro2",
"quote", "quote",
@ -13,9 +30,9 @@ dependencies = [
[[package]] [[package]]
name = "autocfg" name = "autocfg"
version = "1.0.1" version = "1.1.0"
source = "registry+https://github.com/rust-lang/crates.io-index" source = "registry+https://github.com/rust-lang/crates.io-index"
checksum = "cdb031dd78e28731d87d56cc8ffef4a8f36ca26c38fe2de700543e627f8a464a" checksum = "d468802bab17cbc0cc575e9b053f41e72aa36bfa6b7f55e3529ffa43161b97fa"
[[package]] [[package]]
name = "bit_field" name = "bit_field"
@ -25,21 +42,31 @@ checksum = "dcb6dd1c2376d2e096796e234a70e17e94cc2d5d54ff8ce42b28cef1d0d359a4"
[[package]] [[package]]
name = "bitflags" name = "bitflags"
version = "1.2.1" version = "1.3.2"
source = "registry+https://github.com/rust-lang/crates.io-index" source = "registry+https://github.com/rust-lang/crates.io-index"
checksum = "cf1de2fe8c75bc145a2f577add951f8134889b4795d47466a54a5c846d691693" checksum = "bef38d45163c2f1dde094a7dfd33ccf595c92905c8f8f4fdc18d06fb1037718a"
[[package]]
name = "build_const"
version = "0.2.2"
source = "registry+https://github.com/rust-lang/crates.io-index"
checksum = "b4ae4235e6dac0694637c763029ecea1a2ec9e4e06ec2729bd21ba4d9c863eb7"
[[package]]
name = "build_zynq"
version = "0.0.0"
[[package]] [[package]]
name = "byteorder" name = "byteorder"
version = "1.3.4" version = "1.4.3"
source = "registry+https://github.com/rust-lang/crates.io-index" source = "registry+https://github.com/rust-lang/crates.io-index"
checksum = "08c48aae112d48ed9f069b33538ea9e3e90aa263cfa3d1c24309612b1f7472de" checksum = "14c189c53d098945499cdfa7ecc63567cf3886b3332b312a5b4585d8d3a6a610"
[[package]] [[package]]
name = "cc" name = "cc"
version = "1.0.66" version = "1.0.77"
source = "registry+https://github.com/rust-lang/crates.io-index" source = "registry+https://github.com/rust-lang/crates.io-index"
checksum = "4c0496836a84f8d0495758516b8621a622beb77c0fed418570e50764093ced48" checksum = "e9f73505338f7d905b19d18738976aae232eb46b8efc15554ffc56deb5d9ebe4"
[[package]] [[package]]
name = "cfg-if" name = "cfg-if"
@ -47,6 +74,12 @@ version = "0.1.10"
source = "registry+https://github.com/rust-lang/crates.io-index" source = "registry+https://github.com/rust-lang/crates.io-index"
checksum = "4785bdd1c96b2a846b2bd7cc02e86b6b3dbf14e7e53446c4f54c92a361040822" checksum = "4785bdd1c96b2a846b2bd7cc02e86b6b3dbf14e7e53446c4f54c92a361040822"
[[package]]
name = "cfg-if"
version = "1.0.0"
source = "registry+https://github.com/rust-lang/crates.io-index"
checksum = "baf1de4339761588bc0619e3cbc0120ee582ebb74b53b4efbf79117bd2da40fd"
[[package]] [[package]]
name = "compiler_builtins" name = "compiler_builtins"
version = "0.1.39" version = "0.1.39"
@ -55,10 +88,20 @@ checksum = "3748f82c7d366a0b4950257d19db685d4958d2fa27c6d164a3f069fec42b748b"
[[package]] [[package]]
name = "core_io" name = "core_io"
version = "0.1.20200410" version = "0.1.20210325"
source = "git+https://git.m-labs.hk/M-Labs/zynq-rs.git#78d58d17ec7906a6cadd1678576939d20612cf8f" source = "registry+https://github.com/rust-lang/crates.io-index"
checksum = "97f8932064288cc79feb4d343a399d353a6f6f001e586ece47fe518a9e8507df"
dependencies = [ dependencies = [
"memchr", "rustc_version",
]
[[package]]
name = "crc"
version = "1.8.1"
source = "registry+https://github.com/rust-lang/crates.io-index"
checksum = "d663548de7f5cca343f1e0a48d14dcfb0e9eb4e079ec58883b7251539fa10aeb"
dependencies = [
"build_const",
] ]
[[package]] [[package]]
@ -71,8 +114,9 @@ checksum = "0f8cb7306107e4b10e64994de6d3274bd08996a7c1322a27b86482392f96be0a"
name = "dwarf" name = "dwarf"
version = "0.0.0" version = "0.0.0"
dependencies = [ dependencies = [
"cfg-if", "cfg-if 0.1.10",
"compiler_builtins", "compiler_builtins",
"cslice",
"libc", "libc",
"unwind", "unwind",
] ]
@ -87,9 +131,9 @@ dependencies = [
[[package]] [[package]]
name = "embedded-hal" name = "embedded-hal"
version = "0.2.4" version = "0.2.7"
source = "registry+https://github.com/rust-lang/crates.io-index" source = "registry+https://github.com/rust-lang/crates.io-index"
checksum = "fa998ce59ec9765d15216393af37a58961ddcefb14c753b4816ba2191d865fcb" checksum = "35949884794ad573cf46071e41c9b60efb0cb311e3ca01f7af807af1debc66ff"
dependencies = [ dependencies = [
"nb 0.1.3", "nb 0.1.3",
"void", "void",
@ -97,9 +141,9 @@ dependencies = [
[[package]] [[package]]
name = "fatfs" name = "fatfs"
version = "0.3.4" version = "0.3.5"
source = "registry+https://github.com/rust-lang/crates.io-index" source = "registry+https://github.com/rust-lang/crates.io-index"
checksum = "93079df23039e52059e1f03b4c29fb0c72da2c792aad91bb2236c9fb81d3592e" checksum = "e18f80a87439240dac45d927fd8f8081b6f1e34c03e97271189fa8a8c2e96c8f"
dependencies = [ dependencies = [
"bitflags", "bitflags",
"byteorder", "byteorder",
@ -109,9 +153,9 @@ dependencies = [
[[package]] [[package]]
name = "futures" name = "futures"
version = "0.3.8" version = "0.3.25"
source = "registry+https://github.com/rust-lang/crates.io-index" source = "registry+https://github.com/rust-lang/crates.io-index"
checksum = "9b3b0c040a1fe6529d30b3c5944b280c7f0dcb2930d2c3062bca967b602583d0" checksum = "38390104763dc37a5145a53c29c63c1290b5d316d6086ec32c293f6736051bb0"
dependencies = [ dependencies = [
"futures-channel", "futures-channel",
"futures-core", "futures-core",
@ -123,9 +167,9 @@ dependencies = [
[[package]] [[package]]
name = "futures-channel" name = "futures-channel"
version = "0.3.8" version = "0.3.25"
source = "registry+https://github.com/rust-lang/crates.io-index" source = "registry+https://github.com/rust-lang/crates.io-index"
checksum = "4b7109687aa4e177ef6fe84553af6280ef2778bdb7783ba44c9dc3399110fe64" checksum = "52ba265a92256105f45b719605a571ffe2d1f0fea3807304b522c1d778f79eed"
dependencies = [ dependencies = [
"futures-core", "futures-core",
"futures-sink", "futures-sink",
@ -133,23 +177,22 @@ dependencies = [
[[package]] [[package]]
name = "futures-core" name = "futures-core"
version = "0.3.8" version = "0.3.25"
source = "registry+https://github.com/rust-lang/crates.io-index" source = "registry+https://github.com/rust-lang/crates.io-index"
checksum = "847ce131b72ffb13b6109a221da9ad97a64cbe48feb1028356b836b47b8f1748" checksum = "04909a7a7e4633ae6c4a9ab280aeb86da1236243a77b694a49eacd659a4bd3ac"
[[package]] [[package]]
name = "futures-io" name = "futures-io"
version = "0.3.8" version = "0.3.25"
source = "registry+https://github.com/rust-lang/crates.io-index" source = "registry+https://github.com/rust-lang/crates.io-index"
checksum = "611834ce18aaa1bd13c4b374f5d653e1027cf99b6b502584ff8c9a64413b30bb" checksum = "00f5fb52a06bdcadeb54e8d3671f8888a39697dcb0b81b23b55174030427f4eb"
[[package]] [[package]]
name = "futures-macro" name = "futures-macro"
version = "0.3.8" version = "0.3.25"
source = "registry+https://github.com/rust-lang/crates.io-index" source = "registry+https://github.com/rust-lang/crates.io-index"
checksum = "77408a692f1f97bcc61dc001d752e00643408fbc922e4d634c655df50d595556" checksum = "bdfb8ce053d86b91919aad980c220b1fb8401a9394410e1c289ed7e66b61835d"
dependencies = [ dependencies = [
"proc-macro-hack",
"proc-macro2", "proc-macro2",
"quote", "quote",
"syn", "syn",
@ -157,36 +200,71 @@ dependencies = [
[[package]] [[package]]
name = "futures-sink" name = "futures-sink"
version = "0.3.8" version = "0.3.25"
source = "registry+https://github.com/rust-lang/crates.io-index" source = "registry+https://github.com/rust-lang/crates.io-index"
checksum = "f878195a49cee50e006b02b93cf7e0a95a38ac7b776b4c4d9cc1207cd20fcb3d" checksum = "39c15cf1a4aa79df40f1bb462fb39676d0ad9e366c2a33b590d7c66f4f81fcf9"
[[package]] [[package]]
name = "futures-task" name = "futures-task"
version = "0.3.8" version = "0.3.25"
source = "registry+https://github.com/rust-lang/crates.io-index" source = "registry+https://github.com/rust-lang/crates.io-index"
checksum = "7c554eb5bf48b2426c4771ab68c6b14468b6e76cc90996f528c3338d761a4d0d" checksum = "2ffb393ac5d9a6eaa9d3fdf37ae2776656b706e200c8e16b1bdb227f5198e6ea"
[[package]] [[package]]
name = "futures-util" name = "futures-util"
version = "0.3.8" version = "0.3.25"
source = "registry+https://github.com/rust-lang/crates.io-index" source = "registry+https://github.com/rust-lang/crates.io-index"
checksum = "d304cff4a7b99cfb7986f7d43fbe93d175e72e704a8860787cc95e9ffd85cbd2" checksum = "197676987abd2f9cadff84926f410af1c183608d36641465df73ae8211dc65d6"
dependencies = [ dependencies = [
"futures-core", "futures-core",
"futures-macro", "futures-macro",
"futures-sink", "futures-sink",
"futures-task", "futures-task",
"pin-project", "pin-project-lite",
"pin-utils", "pin-utils",
"proc-macro-hack", ]
"proc-macro-nested",
[[package]]
name = "io"
version = "0.0.0"
dependencies = [
"byteorder",
"core_io",
"libsupport_zynq",
]
[[package]]
name = "ksupport"
version = "0.1.0"
dependencies = [
"build_zynq",
"byteorder",
"core_io",
"cslice",
"dwarf",
"dyld",
"io",
"libasync",
"libboard_artiq",
"libboard_zynq",
"libc",
"libconfig",
"libcortex_a9",
"libm",
"libregister",
"libsupport_zynq",
"log",
"log_buffer",
"nalgebra",
"nb 0.1.3",
"unwind",
"vcell",
"void",
] ]
[[package]] [[package]]
name = "libasync" name = "libasync"
version = "0.0.0" version = "0.0.0"
source = "git+https://git.m-labs.hk/M-Labs/zynq-rs.git#78d58d17ec7906a6cadd1678576939d20612cf8f"
dependencies = [ dependencies = [
"embedded-hal", "embedded-hal",
"libcortex_a9", "libcortex_a9",
@ -195,10 +273,30 @@ dependencies = [
"smoltcp", "smoltcp",
] ]
[[package]]
name = "libboard_artiq"
version = "0.0.0"
dependencies = [
"build_zynq",
"core_io",
"crc",
"embedded-hal",
"io",
"libasync",
"libboard_zynq",
"libconfig",
"libcortex_a9",
"libregister",
"libsupport_zynq",
"log",
"log_buffer",
"nb 1.0.0",
"void",
]
[[package]] [[package]]
name = "libboard_zynq" name = "libboard_zynq"
version = "0.0.0" version = "0.0.0"
source = "git+https://git.m-labs.hk/M-Labs/zynq-rs.git#78d58d17ec7906a6cadd1678576939d20612cf8f"
dependencies = [ dependencies = [
"bit_field", "bit_field",
"embedded-hal", "embedded-hal",
@ -223,7 +321,6 @@ dependencies = [
[[package]] [[package]]
name = "libconfig" name = "libconfig"
version = "0.1.0" version = "0.1.0"
source = "git+https://git.m-labs.hk/M-Labs/zynq-rs.git#78d58d17ec7906a6cadd1678576939d20612cf8f"
dependencies = [ dependencies = [
"core_io", "core_io",
"fatfs", "fatfs",
@ -234,7 +331,6 @@ dependencies = [
[[package]] [[package]]
name = "libcortex_a9" name = "libcortex_a9"
version = "0.0.0" version = "0.0.0"
source = "git+https://git.m-labs.hk/M-Labs/zynq-rs.git#78d58d17ec7906a6cadd1678576939d20612cf8f"
dependencies = [ dependencies = [
"bit_field", "bit_field",
"libregister", "libregister",
@ -243,14 +339,13 @@ dependencies = [
[[package]] [[package]]
name = "libm" name = "libm"
version = "0.2.1" version = "0.2.6"
source = "registry+https://github.com/rust-lang/crates.io-index" source = "registry+https://github.com/rust-lang/crates.io-index"
checksum = "c7d73b3f436185384286bd8098d17ec07c9a7d2388a6599f824d8502b529702a" checksum = "348108ab3fba42ec82ff6e9564fc4ca0247bdccdc68dd8af9764bbc79c3c8ffb"
[[package]] [[package]]
name = "libregister" name = "libregister"
version = "0.0.0" version = "0.0.0"
source = "git+https://git.m-labs.hk/M-Labs/zynq-rs.git#78d58d17ec7906a6cadd1678576939d20612cf8f"
dependencies = [ dependencies = [
"bit_field", "bit_field",
"vcell", "vcell",
@ -260,7 +355,6 @@ dependencies = [
[[package]] [[package]]
name = "libsupport_zynq" name = "libsupport_zynq"
version = "0.0.0" version = "0.0.0"
source = "git+https://git.m-labs.hk/M-Labs/zynq-rs.git#78d58d17ec7906a6cadd1678576939d20612cf8f"
dependencies = [ dependencies = [
"cc", "cc",
"compiler_builtins", "compiler_builtins",
@ -273,17 +367,17 @@ dependencies = [
[[package]] [[package]]
name = "linked_list_allocator" name = "linked_list_allocator"
version = "0.8.8" version = "0.8.11"
source = "registry+https://github.com/rust-lang/crates.io-index" source = "registry+https://github.com/rust-lang/crates.io-index"
checksum = "4e6766dff3bf932e0d1c7f1cf27c0a46008f7839f85b015a312c276a4570a399" checksum = "822add9edb1860698b79522510da17bef885171f75aa395cff099d770c609c24"
[[package]] [[package]]
name = "log" name = "log"
version = "0.4.11" version = "0.4.17"
source = "registry+https://github.com/rust-lang/crates.io-index" source = "registry+https://github.com/rust-lang/crates.io-index"
checksum = "4fabed175da42fed1fa0746b0ea71f412aa9d35e76e95e59b192c64b9dc2bf8b" checksum = "abb12e687cfb44aa40f41fc3978ef76448f9b6038cad6aef4259d3c095a2382e"
dependencies = [ dependencies = [
"cfg-if", "cfg-if 1.0.0",
] ]
[[package]] [[package]]
@ -299,10 +393,17 @@ source = "registry+https://github.com/rust-lang/crates.io-index"
checksum = "c75de51135344a4f8ed3cfe2720dc27736f7711989703a0b43aadf3753c55577" checksum = "c75de51135344a4f8ed3cfe2720dc27736f7711989703a0b43aadf3753c55577"
[[package]] [[package]]
name = "memchr" name = "nalgebra"
version = "2.3.4" version = "0.32.6"
source = "registry+https://github.com/rust-lang/crates.io-index" source = "git+https://git.m-labs.hk/M-Labs/nalgebra.git?rev=dd00f9b#dd00f9b46046e0b931d1b470166db02fd29591be"
checksum = "0ee1c47aaa256ecabcaea351eae4a9b01ef39ed810004e298d2511ed284b1525" dependencies = [
"approx",
"num-complex",
"num-rational",
"num-traits",
"simba",
"typenum",
]
[[package]] [[package]]
name = "nb" name = "nb"
@ -319,6 +420,15 @@ version = "1.0.0"
source = "registry+https://github.com/rust-lang/crates.io-index" source = "registry+https://github.com/rust-lang/crates.io-index"
checksum = "546c37ac5d9e56f55e73b677106873d9d9f5190605e41a856503623648488cae" checksum = "546c37ac5d9e56f55e73b677106873d9d9f5190605e41a856503623648488cae"
[[package]]
name = "num-complex"
version = "0.4.0"
source = "registry+https://github.com/rust-lang/crates.io-index"
checksum = "26873667bbbb7c5182d4a37c1add32cdf09f841af72da53318fdb81543c15085"
dependencies = [
"num-traits",
]
[[package]] [[package]]
name = "num-derive" name = "num-derive"
version = "0.3.3" version = "0.3.3"
@ -331,33 +441,46 @@ dependencies = [
] ]
[[package]] [[package]]
name = "num-traits" name = "num-integer"
version = "0.2.14" version = "0.1.46"
source = "registry+https://github.com/rust-lang/crates.io-index" source = "registry+https://github.com/rust-lang/crates.io-index"
checksum = "9a64b1ec5cda2586e284722486d802acf1f7dbdc623e2bfc57e65ca1cd099290" checksum = "7969661fd2958a5cb096e56c8e1ad0444ac2bbcd0061bd28660485a44879858f"
dependencies = [
"num-traits",
]
[[package]]
name = "num-rational"
version = "0.4.0"
source = "registry+https://github.com/rust-lang/crates.io-index"
checksum = "d41702bd167c2df5520b384281bc111a4b5efcf7fbc4c9c222c815b07e0a6a6a"
dependencies = [ dependencies = [
"autocfg", "autocfg",
"num-integer",
"num-traits",
] ]
[[package]] [[package]]
name = "pin-project" name = "num-traits"
version = "1.0.2" version = "0.2.15"
source = "registry+https://github.com/rust-lang/crates.io-index" source = "registry+https://github.com/rust-lang/crates.io-index"
checksum = "9ccc2237c2c489783abd8c4c80e5450fc0e98644555b1364da68cc29aa151ca7" checksum = "578ede34cf02f8924ab9447f50c28075b4d3e5b269972345e7e0372b38c6cdcd"
dependencies = [ dependencies = [
"pin-project-internal", "autocfg",
"libm",
] ]
[[package]] [[package]]
name = "pin-project-internal" name = "paste"
version = "1.0.2" version = "1.0.15"
source = "registry+https://github.com/rust-lang/crates.io-index" source = "registry+https://github.com/rust-lang/crates.io-index"
checksum = "f8e8d2bf0b23038a4424865103a4df472855692821aab4e4f5c3312d461d9e5f" checksum = "57c0d7b74b563b49d38dae00a0c37d4d6de9b432382b2892f0574ddcae73fd0a"
dependencies = [
"proc-macro2", [[package]]
"quote", name = "pin-project-lite"
"syn", version = "0.2.9"
] source = "registry+https://github.com/rust-lang/crates.io-index"
checksum = "e0a7ae3ac2f1173085d398531c705756c94a4c56843785df85a60c1a0afac116"
[[package]] [[package]]
name = "pin-utils" name = "pin-utils"
@ -365,32 +488,20 @@ version = "0.1.0"
source = "registry+https://github.com/rust-lang/crates.io-index" source = "registry+https://github.com/rust-lang/crates.io-index"
checksum = "8b870d8c151b6f2fb93e84a13146138f05d02ed11c7e7c54f8826aaaf7c9f184" checksum = "8b870d8c151b6f2fb93e84a13146138f05d02ed11c7e7c54f8826aaaf7c9f184"
[[package]]
name = "proc-macro-hack"
version = "0.5.19"
source = "registry+https://github.com/rust-lang/crates.io-index"
checksum = "dbf0c48bc1d91375ae5c3cd81e3722dff1abcf81a30960240640d223f59fe0e5"
[[package]]
name = "proc-macro-nested"
version = "0.1.6"
source = "registry+https://github.com/rust-lang/crates.io-index"
checksum = "eba180dafb9038b050a4c280019bbedf9f2467b61e5d892dcad585bb57aadc5a"
[[package]] [[package]]
name = "proc-macro2" name = "proc-macro2"
version = "1.0.24" version = "1.0.43"
source = "registry+https://github.com/rust-lang/crates.io-index" source = "registry+https://github.com/rust-lang/crates.io-index"
checksum = "1e0704ee1a7e00d7bb417d0770ea303c1bccbabf0ef1667dae92b5967f5f8a71" checksum = "0a2ca2c61bc9f3d74d2886294ab7b9853abd9c1ad903a3ac7815c58989bb7bab"
dependencies = [ dependencies = [
"unicode-xid", "unicode-ident",
] ]
[[package]] [[package]]
name = "quote" name = "quote"
version = "1.0.8" version = "1.0.21"
source = "registry+https://github.com/rust-lang/crates.io-index" source = "registry+https://github.com/rust-lang/crates.io-index"
checksum = "991431c3519a3f36861882da93630ce66b52918dcf1b8e2fd66b397fc96f28df" checksum = "bbe448f377a7d6961e30f5955f9b8d106c3f5e449d493ee1b125c1d43c2b5179"
dependencies = [ dependencies = [
"proc-macro2", "proc-macro2",
] ]
@ -406,6 +517,7 @@ name = "runtime"
version = "0.1.0" version = "0.1.0"
dependencies = [ dependencies = [
"async-recursion", "async-recursion",
"build_zynq",
"byteorder", "byteorder",
"core_io", "core_io",
"cslice", "cslice",
@ -413,29 +525,82 @@ dependencies = [
"dyld", "dyld",
"embedded-hal", "embedded-hal",
"futures", "futures",
"io",
"ksupport",
"libasync", "libasync",
"libboard_artiq",
"libboard_zynq", "libboard_zynq",
"libc", "libc",
"libconfig", "libconfig",
"libcortex_a9", "libcortex_a9",
"libm",
"libregister", "libregister",
"libsupport_zynq", "libsupport_zynq",
"log", "log",
"log_buffer", "log_buffer",
"nb 0.1.3",
"num-derive", "num-derive",
"num-traits", "num-traits",
"tar-no-std",
"unwind", "unwind",
"vcell", "vcell",
"void", "void",
] ]
[[package]] [[package]]
name = "smoltcp" name = "rustc_version"
version = "0.6.0" version = "0.1.7"
source = "registry+https://github.com/rust-lang/crates.io-index" source = "registry+https://github.com/rust-lang/crates.io-index"
checksum = "0fe46639fd2ec79eadf8fe719f237a7a0bd4dac5d957f1ca5bbdbc1c3c39e53a" checksum = "c5f5376ea5e30ce23c03eb77cbe4962b988deead10910c372b226388b594c084"
dependencies = [
"semver",
]
[[package]]
name = "satman"
version = "0.0.0"
dependencies = [
"build_zynq",
"byteorder",
"core_io",
"crc",
"cslice",
"embedded-hal",
"io",
"ksupport",
"libasync",
"libboard_artiq",
"libboard_zynq",
"libc",
"libconfig",
"libcortex_a9",
"libregister",
"libsupport_zynq",
"log",
"unwind",
]
[[package]]
name = "semver"
version = "0.1.20"
source = "registry+https://github.com/rust-lang/crates.io-index"
checksum = "d4f410fedcf71af0345d7607d246e7ad15faaadd49d240ee3b24e5dc21a820ac"
[[package]]
name = "simba"
version = "0.8.0"
source = "registry+https://github.com/rust-lang/crates.io-index"
checksum = "50582927ed6f77e4ac020c057f37a268fc6aebc29225050365aacbb9deeeddc4"
dependencies = [
"approx",
"num-complex",
"num-traits",
"paste",
]
[[package]]
name = "smoltcp"
version = "0.7.5"
source = "registry+https://github.com/rust-lang/crates.io-index"
checksum = "3e4a069bef843d170df47e7c0a8bf8d037f217d9f5b325865acc3e466ffe40d3"
dependencies = [ dependencies = [
"bitflags", "bitflags",
"byteorder", "byteorder",
@ -444,36 +609,52 @@ dependencies = [
[[package]] [[package]]
name = "syn" name = "syn"
version = "1.0.55" version = "1.0.101"
source = "registry+https://github.com/rust-lang/crates.io-index" source = "registry+https://github.com/rust-lang/crates.io-index"
checksum = "a571a711dddd09019ccc628e1b17fe87c59b09d513c06c026877aa708334f37a" checksum = "e90cde112c4b9690b8cbe810cba9ddd8bc1d7472e2cae317b69e9438c1cba7d2"
dependencies = [ dependencies = [
"proc-macro2", "proc-macro2",
"quote", "quote",
"unicode-xid", "unicode-ident",
] ]
[[package]] [[package]]
name = "unicode-xid" name = "tar-no-std"
version = "0.2.1" version = "0.1.8"
source = "git+https://git.m-labs.hk/M-Labs/tar-no-std?rev=2ab6dc5#2ab6dc58e5249c59c4eb03eaf3a119bcdd678d32"
dependencies = [
"arrayvec",
"bitflags",
"log",
]
[[package]]
name = "typenum"
version = "1.17.0"
source = "registry+https://github.com/rust-lang/crates.io-index" source = "registry+https://github.com/rust-lang/crates.io-index"
checksum = "f7fe0bb3479651439c9112f72b6c505038574c9fbb575ed1bf3b797fa39dd564" checksum = "42ff0bf0c66b8238c6f3b578df37d0b7848e55df8577b3f74f92a69acceeb825"
[[package]]
name = "unicode-ident"
version = "1.0.5"
source = "registry+https://github.com/rust-lang/crates.io-index"
checksum = "6ceab39d59e4c9499d4e5a8ee0e2735b891bb7308ac83dfb4e80cad195c9f6f3"
[[package]] [[package]]
name = "unwind" name = "unwind"
version = "0.0.0" version = "0.0.0"
dependencies = [ dependencies = [
"cc", "cc",
"cfg-if", "cfg-if 0.1.10",
"compiler_builtins", "compiler_builtins",
"libc", "libc",
] ]
[[package]] [[package]]
name = "vcell" name = "vcell"
version = "0.1.2" version = "0.1.3"
source = "registry+https://github.com/rust-lang/crates.io-index" source = "registry+https://github.com/rust-lang/crates.io-index"
checksum = "876e32dcadfe563a4289e994f7cb391197f362b6315dc45e8ba4aa6f564a4b3c" checksum = "77439c1b53d2303b20d9459b1ade71a83c716e3f9c34f3228c00e6f185d6c002"
[[package]] [[package]]
name = "void" name = "void"
@ -483,9 +664,9 @@ checksum = "6a02e4885ed3bc0f2de90ea6dd45ebcbb66dacffe03547fadbb0eeae2770887d"
[[package]] [[package]]
name = "volatile-register" name = "volatile-register"
version = "0.2.0" version = "0.2.1"
source = "registry+https://github.com/rust-lang/crates.io-index" source = "registry+https://github.com/rust-lang/crates.io-index"
checksum = "0d67cb4616d99b940db1d6bd28844ff97108b498a6ca850e5b6191a532063286" checksum = "9ee8f19f9d74293faf70901bc20ad067dc1ad390d2cbf1e3f75f721ffee908b6"
dependencies = [ dependencies = [
"vcell", "vcell",
] ]

View File

@ -3,8 +3,11 @@ members = [
"libc", "libc",
"libdyld", "libdyld",
"libdwarf", "libdwarf",
"libio",
"libunwind", "libunwind",
"libksupport",
"runtime", "runtime",
"satman"
] ]
[profile.release] [profile.release]
@ -13,6 +16,3 @@ debug = true
codegen-units = 1 codegen-units = 1
opt-level = 2 opt-level = 2
lto = true lto = true
[patch.crates-io]
core_io = { git = "https://git.m-labs.hk/M-Labs/zynq-rs.git" }

View File

@ -1,16 +1,26 @@
TARGET := zc706 TARGET := zc706
VARIANT := simple GWARGS := -V nist_clock
all: ../build/firmware/armv7-none-eabihf/release/runtime ../build/runtime.bin all: runtime
.PHONY: all runtime: ../build/runtime.bin
satman: ../build/satman.bin
../build/pl.rs ../build/rustc-cfg: gateware/* .PHONY: all manifests
manifests = libboard_artiq/Cargo.toml libc/Cargo.toml libdyld/Cargo.toml libio/Cargo.toml libksupport/Cargo.toml runtime/Cargo.toml satman/Cargo.toml
$(manifests): %.toml: %.toml.tpl
sed s+@@ZYNQ_RS@@+$(ZYNQ_RS)+g $< > $@
manifests: $(manifests)
../build/pl.rs ../build/rustc-cfg ../build/mem.rs: gateware/*
mkdir -p ../build mkdir -p ../build
python gateware/$(TARGET).py -r ../build/pl.rs -c ../build/rustc-cfg -V $(VARIANT) python gateware/$(TARGET).py -r ../build/pl.rs -c ../build/rustc-cfg -m ../build/mem.rs $(GWARGS)
../build/firmware/armv7-none-eabihf/release/runtime: ../build/pl.rs ../build/rustc-cfg $(shell find . -print) ../build/firmware/armv7-none-eabihf/release/runtime: ../build/pl.rs ../build/rustc-cfg ../build/mem.rs $(manifests) $(shell find . -type f -not -name Cargo.toml -print)
cd runtime && \ cd runtime && \
XBUILD_SYSROOT_PATH=`pwd`/../../build/sysroot \ XBUILD_SYSROOT_PATH=`pwd`/../../build/sysroot \
cargo xbuild --release \ cargo xbuild --release \
@ -19,3 +29,13 @@ all: ../build/firmware/armv7-none-eabihf/release/runtime ../build/runtime.bin
../build/runtime.bin: ../build/firmware/armv7-none-eabihf/release/runtime ../build/runtime.bin: ../build/firmware/armv7-none-eabihf/release/runtime
llvm-objcopy -O binary ../build/firmware/armv7-none-eabihf/release/runtime ../build/runtime.bin llvm-objcopy -O binary ../build/firmware/armv7-none-eabihf/release/runtime ../build/runtime.bin
../build/firmware/armv7-none-eabihf/release/satman: ../build/pl.rs ../build/rustc-cfg ../build/mem.rs $(manifests) $(shell find . -type f -not -name Cargo.toml -print)
cd satman && \
XBUILD_SYSROOT_PATH=`pwd`/../../build/sysroot \
cargo xbuild --release \
--target-dir ../../build/firmware \
--no-default-features --features=target_$(TARGET)
../build/satman.bin: ../build/firmware/armv7-none-eabihf/release/satman
llvm-objcopy -O binary ../build/firmware/armv7-none-eabihf/release/satman ../build/satman.bin

16
src/gateware/config.py Normal file
View File

@ -0,0 +1,16 @@
from misoc.integration import cpu_interface
def write_csr_file(soc, filename):
with open(filename, "w") as f:
f.write(cpu_interface.get_csr_rust(
soc.get_csr_regions(), soc.get_csr_groups(), soc.get_constants()))
def write_mem_file(soc, filename):
with open(filename, "w") as f:
f.write(cpu_interface.get_mem_rust(
soc.get_memory_regions(), soc.get_memory_groups(), None))
def write_rustc_cfg_file(soc, filename):
with open(filename, "w") as f:
f.write(cpu_interface.get_rust_cfg(
soc.get_csr_regions(), soc.get_constants()))

View File

@ -1,191 +0,0 @@
#!/usr/bin/env python
import argparse
from operator import itemgetter
from migen import *
from migen.build.generic_platform import *
from migen.genlib.resetsync import AsyncResetSynchronizer
from migen.genlib.cdc import MultiReg
from migen_axi.integration.soc_core import SoCCore
from migen_axi.platforms import coraz7
from misoc.interconnect.csr import *
from misoc.integration import cpu_interface
from artiq.gateware import rtio
from artiq.gateware.rtio.phy import ttl_simple, ttl_serdes_7series, dds, spi2
import dma
import analyzer
import acpki
class RTIOCRG(Module, AutoCSR):
def __init__(self, platform, rtio_internal_clk):
self.clock_sel = CSRStorage()
self.pll_reset = CSRStorage(reset=1)
self.pll_locked = CSRStatus()
self.clock_domains.cd_rtio = ClockDomain()
self.clock_domains.cd_rtiox4 = ClockDomain(reset_less=True)
rtio_external_clk = Signal()
# user_sma_clock = platform.request("user_sma_clock")
# platform.add_period_constraint(user_sma_clock.p, 8.0)
# self.specials += Instance("IBUFDS",
# i_I=user_sma_clock.p, i_IB=user_sma_clock.n,
# o_O=rtio_external_clk)
pll_locked = Signal()
rtio_clk = Signal()
rtiox4_clk = Signal()
self.specials += [
Instance("PLLE2_ADV",
p_STARTUP_WAIT="FALSE", o_LOCKED=pll_locked,
p_REF_JITTER1=0.01,
p_CLKIN1_PERIOD=8.0, p_CLKIN2_PERIOD=8.0,
i_CLKIN1=rtio_internal_clk, i_CLKIN2=rtio_external_clk,
# Warning: CLKINSEL=0 means CLKIN2 is selected
i_CLKINSEL=~self.clock_sel.storage,
# VCO @ 1GHz when using 125MHz input
p_CLKFBOUT_MULT=8, p_DIVCLK_DIVIDE=1,
i_CLKFBIN=self.cd_rtio.clk,
i_RST=self.pll_reset.storage,
o_CLKFBOUT=rtio_clk,
p_CLKOUT0_DIVIDE=2, p_CLKOUT0_PHASE=0.0,
o_CLKOUT0=rtiox4_clk),
Instance("BUFG", i_I=rtio_clk, o_O=self.cd_rtio.clk),
Instance("BUFG", i_I=rtiox4_clk, o_O=self.cd_rtiox4.clk),
AsyncResetSynchronizer(self.cd_rtio, ~pll_locked),
MultiReg(pll_locked, self.pll_locked.status)
]
class CoraZ7(SoCCore):
def __init__(self, device_variant="10", acpki=False):
self.acpki = acpki
self.rustc_cfg = dict()
platform = coraz7.Platform(device_variant=device_variant)
platform.toolchain.bitstream_commands.extend([
"set_property BITSTREAM.GENERAL.COMPRESS True [current_design]",
])
ident = self.__class__.__name__
if self.acpki:
ident = "acpki_" + ident
SoCCore.__init__(self, platform=platform, csr_data_width=32, ident=ident)
platform.add_platform_command("create_clock -name clk_fpga_0 -period 8 [get_pins \"PS7/FCLKCLK[0]\"]")
platform.add_platform_command("set_input_jitter clk_fpga_0 0.24")
self.submodules.rtio_crg = RTIOCRG(self.platform, self.ps7.cd_sys.clk)
self.csr_devices.append("rtio_crg")
self.platform.add_period_constraint(self.rtio_crg.cd_rtio.clk, 8.)
self.platform.add_false_path_constraints(
self.ps7.cd_sys.clk,
self.rtio_crg.cd_rtio.clk)
def add_rtio(self, rtio_channels):
self.submodules.rtio_tsc = rtio.TSC("async", glbl_fine_ts_width=3)
self.submodules.rtio_core = rtio.Core(self.rtio_tsc, rtio_channels)
self.csr_devices.append("rtio_core")
if self.acpki:
self.rustc_cfg["ki_impl"] = "acp"
self.submodules.rtio = acpki.KernelInitiator(self.rtio_tsc,
bus=self.ps7.s_axi_acp,
user=self.ps7.s_axi_acp_user,
evento=self.ps7.event.o)
self.csr_devices.append("rtio")
else:
self.rustc_cfg["ki_impl"] = "csr"
self.submodules.rtio = rtio.KernelInitiator(self.rtio_tsc, now64=True)
self.csr_devices.append("rtio")
self.submodules.rtio_dma = dma.DMA(self.ps7.s_axi_hp0)
self.csr_devices.append("rtio_dma")
self.submodules.cri_con = rtio.CRIInterconnectShared(
[self.rtio.cri, self.rtio_dma.cri],
[self.rtio_core.cri])
self.csr_devices.append("cri_con")
self.submodules.rtio_moninj = rtio.MonInj(rtio_channels)
self.csr_devices.append("rtio_moninj")
self.submodules.rtio_analyzer = analyzer.Analyzer(self.rtio_tsc, self.rtio_core.cri,
self.ps7.s_axi_hp1)
self.csr_devices.append("rtio_analyzer")
class Simple(CoraZ7):
def __init__(self, **kwargs):
CoraZ7.__init__(self, **kwargs)
platform = self.platform
rtio_channels = []
for i in range(2):
phy = ttl_simple.Output(platform.request("user_led", i))
self.submodules += phy
rtio_channels.append(rtio.Channel.from_phy(phy))
self.config["RTIO_LOG_CHANNEL"] = len(rtio_channels)
rtio_channels.append(rtio.LogChannel())
self.add_rtio(rtio_channels)
def write_csr_file(soc, filename):
with open(filename, "w") as f:
f.write(cpu_interface.get_csr_rust(
soc.get_csr_regions(), soc.get_csr_groups(), soc.get_constants()))
def write_rustc_cfg_file(soc, filename):
with open(filename, "w") as f:
for k, v in sorted(soc.rustc_cfg.items(), key=itemgetter(0)):
if v is None:
f.write("{}\n".format(k))
else:
f.write("{}=\"{}\"\n".format(k, v))
def main():
parser = argparse.ArgumentParser(
description="ARTIQ port to the Cora Z7 Zynq development kit")
parser.add_argument("-r", default=None,
help="build Rust interface into the specified file")
parser.add_argument("-c", default=None,
help="build Rust compiler configuration into the specified file")
parser.add_argument("-g", default=None,
help="build gateware into the specified directory")
parser.add_argument("-V", "--variant", default="10",
help="variant: "
"[acpki_]10/07s "
"(default: %(default)s)")
args = parser.parse_args()
variant = args.variant.lower()
acpki = variant.startswith("acpki_")
if acpki:
variant = variant[6:]
try:
soc = Simple(device_variant=variant, acpki=acpki)
except KeyError:
raise SystemExit("Invalid variant (-V/--variant)")
soc.finalize()
if args.r is not None:
write_csr_file(soc, args.r)
if args.c is not None:
write_rustc_cfg_file(soc, args.c)
if args.g is not None:
soc.build(build_dir=args.g)
if __name__ == "__main__":
main()

119
src/gateware/ddmtd.py Normal file
View File

@ -0,0 +1,119 @@
from migen import *
from migen.genlib.cdc import PulseSynchronizer, MultiReg
from misoc.interconnect.csr import *
class DDMTDSampler(Module):
def __init__(self, cd_ref, main_clk_se):
self.ref_beating = Signal()
self.main_beating = Signal()
# # #
ref_clk = Signal()
self.specials +=[
# ISERDESE2 can only be driven from fabric via IDELAYE2 (see UG471)
Instance("IDELAYE2",
p_DELAY_SRC="DATAIN",
p_HIGH_PERFORMANCE_MODE="TRUE",
p_REFCLK_FREQUENCY=208.3, # REFCLK frequency from IDELAYCTRL
p_IDELAY_VALUE=0,
i_DATAIN=cd_ref.clk,
o_DATAOUT=ref_clk
),
Instance("ISERDESE2",
p_IOBDELAY="IFD", # use DDLY as input
p_DATA_RATE="SDR",
p_DATA_WIDTH=2, # min is 2
p_NUM_CE=1,
i_DDLY=ref_clk,
i_CE1=1,
i_CLK=ClockSignal("helper"),
i_CLKDIV=ClockSignal("helper"),
o_Q1=self.ref_beating
),
Instance("ISERDESE2",
p_DATA_RATE="SDR",
p_DATA_WIDTH=2, # min is 2
p_NUM_CE=1,
i_D=main_clk_se,
i_CE1=1,
i_CLK=ClockSignal("helper"),
i_CLKDIV=ClockSignal("helper"),
o_Q1=self.main_beating,
),
]
class DDMTDDeglitcherMedianEdge(Module):
def __init__(self, counter, input_signal, stable_0_period=100, stable_1_period=100):
self.tag = Signal(len(counter))
self.detect = Signal()
stable_0_counter = Signal(reset=stable_0_period - 1, max=stable_0_period)
stable_1_counter = Signal(reset=stable_1_period - 1, max=stable_1_period)
# # #
# Based on CERN's median edge deglitcher FSM
# https://white-rabbit.web.cern.ch/documents/Precise_time_and_frequency_transfer_in_a_White_Rabbit_network.pdf (p.72)
fsm = ClockDomainsRenamer("helper")(FSM(reset_state="WAIT_STABLE_0"))
self.submodules += fsm
fsm.act("WAIT_STABLE_0",
If(stable_0_counter != 0,
NextValue(stable_0_counter, stable_0_counter - 1)
).Else(
NextValue(stable_0_counter, stable_0_period - 1),
NextState("WAIT_EDGE")
),
If(input_signal,
NextValue(stable_0_counter, stable_0_period - 1)
),
)
fsm.act("WAIT_EDGE",
If(input_signal,
NextValue(self.tag, counter),
NextState("GOT_EDGE")
)
)
fsm.act("GOT_EDGE",
If(stable_1_counter != 0,
NextValue(stable_1_counter, stable_1_counter - 1)
).Else(
NextValue(stable_1_counter, stable_1_period - 1),
self.detect.eq(1),
NextState("WAIT_STABLE_0")
),
If(~input_signal,
NextValue(self.tag, self.tag + 1),
NextValue(stable_1_counter, stable_1_period - 1)
),
)
class DDMTD(Module):
def __init__(self, counter, input_signal):
# in helper clock domain
self.h_tag = Signal(len(counter))
self.h_tag_update = Signal()
# # #
deglitcher = DDMTDDeglitcherMedianEdge(counter, input_signal)
self.submodules += deglitcher
self.sync.helper += [
self.h_tag_update.eq(0),
If(deglitcher.detect,
self.h_tag_update.eq(1),
self.h_tag.eq(deglitcher.tag)
)
]

View File

@ -0,0 +1,85 @@
"""Auxiliary controller, common to satellite and master"""
from artiq.gateware.drtio.aux_controller import (max_packet, aux_buffer_count,
Transmitter, Receiver)
from migen.fhdl.simplify import FullMemoryWE
from misoc.interconnect.csr import *
from migen_axi.interconnect.sram import SRAM
from migen_axi.interconnect import axi
class _DRTIOAuxControllerBase(Module):
def __init__(self, link_layer):
self.bus = axi.Interface()
self.submodules.transmitter = Transmitter(link_layer, len(self.bus.w.data))
self.submodules.receiver = Receiver(link_layer, len(self.bus.w.data))
def get_csrs(self):
return self.transmitter.get_csrs() + self.receiver.get_csrs()
# TODO: FullMemoryWE should be applied by migen.build
@FullMemoryWE()
class DRTIOAuxControllerAxi(_DRTIOAuxControllerBase):
def __init__(self, link_layer):
_DRTIOAuxControllerBase.__init__(self, link_layer)
tx_sdram_if = SRAM(self.transmitter.mem, read_only=False)
rx_sdram_if = SRAM(self.receiver.mem, read_only=True)
aw_decoder = axi.AddressDecoder(self.bus.aw,
[(lambda a: a[log2_int(max_packet*aux_buffer_count)] == 0, tx_sdram_if.bus.aw),
(lambda a: a[log2_int(max_packet*aux_buffer_count)] == 1, rx_sdram_if.bus.aw)],
register=True)
ar_decoder = axi.AddressDecoder(self.bus.ar,
[(lambda a: a[log2_int(max_packet*aux_buffer_count)] == 0, tx_sdram_if.bus.ar),
(lambda a: a[log2_int(max_packet*aux_buffer_count)] == 1, rx_sdram_if.bus.ar)],
register=True)
# unlike wb, axi address decoder only connects ar/aw lanes,
# the rest must also be connected!
# not quite unlike an address decoder itself.
# connect bus.b with tx.b
self.comb += [tx_sdram_if.bus.b.ready.eq(self.bus.b.ready),
self.bus.b.id.eq(tx_sdram_if.bus.b.id),
self.bus.b.resp.eq(tx_sdram_if.bus.b.resp),
self.bus.b.valid.eq(tx_sdram_if.bus.b.valid)]
# connect bus.w with tx.w
# no worries about w.valid and slave sel here, only tx will be written to
self.comb += [tx_sdram_if.bus.w.id.eq(self.bus.w.id),
tx_sdram_if.bus.w.data.eq(self.bus.w.data),
tx_sdram_if.bus.w.strb.eq(self.bus.w.strb),
tx_sdram_if.bus.w.last.eq(self.bus.w.last),
tx_sdram_if.bus.w.valid.eq(self.bus.w.valid),
self.bus.w.ready.eq(tx_sdram_if.bus.w.ready)]
# connect bus.r with rx.r and tx.r w/o data
self.comb += [self.bus.r.id.eq(rx_sdram_if.bus.r.id | tx_sdram_if.bus.r.id),
#self.bus.r.data.eq(rx_sdram_if.bus.r.data | tx_sdram_if.bus.r.data),
self.bus.r.resp.eq(rx_sdram_if.bus.r.resp | tx_sdram_if.bus.r.resp),
self.bus.r.last.eq(rx_sdram_if.bus.r.last | tx_sdram_if.bus.r.last),
self.bus.r.valid.eq(rx_sdram_if.bus.r.valid | tx_sdram_if.bus.r.valid),
rx_sdram_if.bus.r.ready.eq(self.bus.r.ready),
tx_sdram_if.bus.r.ready.eq(self.bus.r.ready)]
# connect read data after being masked
masked = [Replicate(rx_sdram_if.bus.r.valid,
len(self.bus.r.data)
) & rx_sdram_if.bus.r.data,
Replicate(tx_sdram_if.bus.r.valid,
len(self.bus.r.data)
) & tx_sdram_if.bus.r.data]
self.comb += self.bus.r.data.eq(reduce(or_, masked))
self.submodules += tx_sdram_if, rx_sdram_if, aw_decoder, ar_decoder
@FullMemoryWE()
class DRTIOAuxControllerBare(_DRTIOAuxControllerBase):
# Barebones version of the AuxController. No SRAM, no decoders.
# add memories manually from tx and rx in target code.
def get_tx_port(self):
return self.transmitter.mem.get_port(write_capable=True)
def get_rx_port(self):
return self.receiver.mem.get_port(write_capable=False)
def get_mem_size(self):
return max_packet*aux_buffer_count

307
src/gateware/ebaz4205.py Normal file
View File

@ -0,0 +1,307 @@
#!/usr/bin/env python
import argparse
import analyzer
import dma
from artiq.gateware import rtio
from artiq.gateware.rtio.phy import spi2, ttl_simple
from artiq.gateware.rtio.xilinx_clocking import fix_serdes_timing_path
from config import write_csr_file, write_mem_file, write_rustc_cfg_file
from migen import *
from migen.build.generic_platform import IOStandard, Misc, Pins, Subsignal
from migen.build.platforms import ebaz4205
from migen_axi.integration.soc_core import SoCCore
from misoc.interconnect.csr import *
_ps = [
(
"ps",
0,
Subsignal("clk", Pins("E7"), IOStandard("LVCMOS33"), Misc("SLEW=FAST")),
Subsignal("por_b", Pins("C7"), IOStandard("LVCMOS33"), Misc("SLEW=FAST")),
Subsignal("srst_b", Pins("B10"), IOStandard("LVCMOS18"), Misc("SLEW=FAST")),
)
]
_ddr = [
(
"ddr",
0,
Subsignal(
"a",
Pins("N2 K2 M3 K3 M4 L1 L4 K4 K1 J4 F5 G4 E4 D4 F4"),
IOStandard("SSTL15"),
),
Subsignal("ba", Pins("L5 R4 J5"), IOStandard("SSTL15")),
Subsignal("cas_n", Pins("P5"), IOStandard("SSTL15")),
Subsignal("cke", Pins("N3"), IOStandard("SSTL15")),
Subsignal("cs_n", Pins("N1"), IOStandard("SSTL15")),
Subsignal("ck_n", Pins("M2"), IOStandard("DIFF_SSTL15"), Misc("SLEW=FAST")),
Subsignal("ck_p", Pins("L2"), IOStandard("DIFF_SSTL15"), Misc("SLEW=FAST")),
# Pins "T1 Y1" not connected
Subsignal("dm", Pins("A1 F1"), IOStandard("SSTL15_T_DCI"), Misc("SLEW=FAST")),
Subsignal(
"dq",
Pins("C3 B3 A2 A4 D3 D1 C1 E1 E2 E3 G3 H3 J3 H2 H1 J1"),
# Pins "P1 P3 R3 R1 T4 U4 U2 U3 V1 Y3 W1 Y4 Y2 W3 V2 V3" not connected
IOStandard("SSTL15_T_DCI"),
Misc("SLEW=FAST"),
),
Subsignal(
"dqs_n",
Pins("B2 F2"), # Pins "T2 W4" not connected
IOStandard("DIFF_SSTL15_T_DCI"),
Misc("SLEW=FAST"),
),
Subsignal(
"dqs_p",
Pins("C2 G2"), # Pins "R2 W5" not connected
IOStandard("DIFF_SSTL15_T_DCI"),
Misc("SLEW=FAST"),
),
Subsignal("vrn", Pins("G5"), IOStandard("SSTL15_T_DCI"), Misc("SLEW=FAST")),
Subsignal("vrp", Pins("H5"), IOStandard("SSTL15_T_DCI"), Misc("SLEW=FAST")),
Subsignal("drst_n", Pins("B4"), IOStandard("SSTL15"), Misc("SLEW=FAST")),
Subsignal("odt", Pins("N5"), IOStandard("SSTL15")),
Subsignal("ras_n", Pins("P4"), IOStandard("SSTL15")),
Subsignal("we_n", Pins("M5"), IOStandard("SSTL15")),
)
]
# Connector J3
_i2c = [
(
"i2c",
0,
Subsignal("scl", Pins("U12"), IOStandard("LVCMOS33")),
Subsignal("sda", Pins("V13"), IOStandard("LVCMOS33")),
)
]
_spi = [
(
"spi",
0,
Subsignal("clk", Pins("V20")),
Subsignal("mosi", Pins("U20")),
Subsignal("cs_n", Pins("P19")),
IOStandard("LVCMOS33"),
)
]
# Connector DATA1
def _create_ttl():
_ttl = []
for idx, elem in enumerate([x for x in range(5, 21) if x not in (10, 12)]):
_ttl.append(
("ttl", idx, Pins("DATA1:DATA1-{}".format(elem)), IOStandard("LVCMOS33")),
)
return _ttl
class EBAZ4205(SoCCore):
def __init__(self, rtio_clk=125e6, acpki=False):
self.acpki = acpki
platform = ebaz4205.Platform()
platform.toolchain.bitstream_commands.extend(
[
"set_property BITSTREAM.GENERAL.COMPRESS True [current_design]",
]
)
platform.add_extension(_ps)
platform.add_extension(_ddr)
platform.add_extension(_i2c)
platform.add_extension(_spi)
platform.add_extension(_create_ttl())
gmii = platform.request("gmii")
platform.add_period_constraint(gmii.rx_clk, 10)
platform.add_period_constraint(gmii.tx_clk, 10)
platform.add_platform_command(
"set_property CLOCK_DEDICATED_ROUTE FALSE [get_nets gmii_tx_clk_IBUF]"
)
ident = self.__class__.__name__
if self.acpki:
ident = "acpki_" + ident
SoCCore.__init__(self, platform=platform, csr_data_width=32, ident=ident)
fix_serdes_timing_path(platform)
self.config["RTIO_FREQUENCY"] = str(rtio_clk / 1e6)
platform.add_period_constraint(self.ps7.cd_sys.clk, 10)
self.comb += [
self.ps7.enet0.enet.gmii.tx_clk.eq(gmii.tx_clk),
self.ps7.enet0.enet.gmii.rx_clk.eq(gmii.rx_clk),
]
self.clock_domains.cd_eth_rx = ClockDomain(reset_less=False)
self.clock_domains.cd_eth_tx = ClockDomain(reset_less=False)
self.comb += [
ClockSignal("eth_rx").eq(gmii.rx_clk),
ClockSignal("eth_tx").eq(gmii.tx_clk),
]
self.sync.eth_tx += [
gmii.txd.eq(self.ps7.enet0.enet.gmii.txd),
gmii.tx_en.eq(self.ps7.enet0.enet.gmii.tx_en),
]
self.sync.eth_rx += [
self.ps7.enet0.enet.gmii.rxd.eq(gmii.rxd),
self.ps7.enet0.enet.gmii.rx_dv.eq(gmii.rx_dv),
]
# MDIO
mdio = platform.request("mdio")
self.comb += mdio.mdc.eq(self.ps7.enet0.enet.mdio.mdc)
self.specials += Instance(
"IOBUF",
i_I=self.ps7.enet0.enet.mdio.o,
io_IO=mdio.mdio,
o_O=self.ps7.enet0.enet.mdio.i,
i_T=~self.ps7.enet0.enet.mdio.t_n,
)
# I2C
i2c = self.platform.request("i2c")
self.specials += [
# SCL
Instance(
"IOBUF",
i_I=self.ps7.i2c0.scl.o,
io_IO=i2c.scl,
o_O=self.ps7.i2c0.scl.i,
i_T=~self.ps7.i2c0.scl.t_n,
),
# SDA
Instance(
"IOBUF",
i_I=self.ps7.i2c0.sda.o,
io_IO=i2c.sda,
o_O=self.ps7.i2c0.sda.i,
i_T=~self.ps7.i2c0.sda.t_n,
),
]
self.rtio_channels = []
for i in (0, 1):
print("USER LED at RTIO channel 0x{:06x}".format(len(self.rtio_channels)))
user_led = self.platform.request("user_led", i)
phy = ttl_simple.Output(user_led)
self.submodules += phy
self.rtio_channels.append(rtio.Channel.from_phy(phy))
for i in range(14):
print("TTL at RTIO channel 0x{:06x}".format(len(self.rtio_channels)))
ttl = self.platform.request("ttl", i)
phy = ttl_simple.InOut(ttl)
self.submodules += phy
self.rtio_channels.append(rtio.Channel.from_phy(phy))
print("SPI at RTIO channel 0x{:06x}".format(len(self.rtio_channels)))
spi_phy = spi2.SPIMaster(platform.request("spi"))
self.submodules += spi_phy
self.rtio_channels.append(rtio.Channel.from_phy(spi_phy, ififo_depth=4))
self.config["RTIO_LOG_CHANNEL"] = len(self.rtio_channels)
self.rtio_channels.append(rtio.LogChannel())
self.submodules.rtio_tsc = rtio.TSC(glbl_fine_ts_width=3)
self.submodules.rtio_core = rtio.Core(self.rtio_tsc, self.rtio_channels)
self.csr_devices.append("rtio_core")
if self.acpki:
import acpki
self.config["KI_IMPL"] = "acp"
self.submodules.rtio = acpki.KernelInitiator(
self.rtio_tsc,
bus=self.ps7.s_axi_acp,
user=self.ps7.s_axi_acp_user,
evento=self.ps7.event.o,
)
self.csr_devices.append("rtio")
else:
self.config["KI_IMPL"] = "csr"
self.submodules.rtio = rtio.KernelInitiator(self.rtio_tsc, now64=True)
self.csr_devices.append("rtio")
self.submodules.rtio_dma = dma.DMA(self.ps7.s_axi_hp0)
self.csr_devices.append("rtio_dma")
self.submodules.cri_con = rtio.CRIInterconnectShared(
[self.rtio.cri, self.rtio_dma.cri],
[self.rtio_core.cri],
enable_routing=True,
)
self.csr_devices.append("cri_con")
self.submodules.rtio_moninj = rtio.MonInj(self.rtio_channels)
self.csr_devices.append("rtio_moninj")
self.submodules.rtio_analyzer = analyzer.Analyzer(
self.rtio_tsc, self.rtio_core.cri, self.ps7.s_axi_hp1
)
self.csr_devices.append("rtio_analyzer")
class BASE(EBAZ4205):
def __init__(self, rtio_clk, acpki):
EBAZ4205.__init__(self, rtio_clk, acpki)
VARIANTS = {cls.__name__.lower(): cls for cls in [BASE]}
def main():
parser = argparse.ArgumentParser(
description="ARTIQ port to the EBAZ4205 control card of Ebit E9+ BTC miner"
)
parser.add_argument(
"-r", default=None, help="build Rust interface into the specified file"
)
parser.add_argument(
"-m", default=None, help="build Rust memory interface into the specified file"
)
parser.add_argument(
"-c",
default=None,
help="build Rust compiler configuration into the specified file",
)
parser.add_argument(
"-g", default=None, help="build gateware into the specified directory"
)
parser.add_argument("--rtio-clk", default=125e6, help="RTIO Clock Frequency (Hz)")
parser.add_argument(
"-V",
"--variant",
default="base",
help="variant: " "[acpki_]base" "(default: %(default)s)",
)
args = parser.parse_args()
rtio_clk = int(args.rtio_clk)
variant = args.variant.lower()
acpki = variant.startswith("acpki_")
if acpki:
variant = variant[6:]
try:
cls = VARIANTS[variant]
except KeyError:
raise SystemExit("Invalid variant (-V/--variant)")
soc = cls(rtio_clk=rtio_clk, acpki=acpki)
soc.finalize()
if args.r is not None:
write_csr_file(soc, args.r)
if args.m is not None:
write_mem_file(soc, args.m)
if args.c is not None:
write_rustc_cfg_file(soc, args.c)
if args.g is not None:
soc.build(build_dir=args.g)
if __name__ == "__main__":
main()

672
src/gateware/kasli_soc.py Executable file
View File

@ -0,0 +1,672 @@
#!/usr/bin/env python
import argparse
from operator import itemgetter
from migen import *
from migen.build.generic_platform import *
from migen.genlib.resetsync import AsyncResetSynchronizer
from migen.genlib.cdc import MultiReg
from migen_axi.integration.soc_core import SoCCore
from migen_axi.platforms import kasli_soc
from misoc.interconnect.csr import *
from misoc.cores import virtual_leds
from artiq.coredevice import jsondesc
from artiq.gateware import rtio, eem_7series
from artiq.gateware.rtio.xilinx_clocking import fix_serdes_timing_path
from artiq.gateware.rtio.phy import ttl_simple
from artiq.gateware.drtio.transceiver import gtx_7series, eem_serdes
from artiq.gateware.drtio.siphaser import SiPhaser7Series
from artiq.gateware.drtio.rx_synchronizer import XilinxRXSynchronizer
from artiq.gateware.drtio import *
from artiq.gateware.wrpll import wrpll
import dma
import analyzer
import acpki
import drtio_aux_controller
import zynq_clocking
from config import write_csr_file, write_mem_file, write_rustc_cfg_file
eem_iostandard_dict = {
0: "LVDS_25",
1: "LVDS_25",
2: "LVDS",
3: "LVDS",
4: "LVDS",
5: "LVDS",
6: "LVDS",
7: "LVDS",
8: "LVDS_25",
9: "LVDS_25",
10: "LVDS",
11: "LVDS",
}
def eem_iostandard(eem):
return IOStandard(eem_iostandard_dict[eem])
class SMAClkinForward(Module):
def __init__(self, platform):
sma_clkin = platform.request("sma_clkin")
sma_clkin_se = Signal()
cdr_clk_se = Signal()
cdr_clk = platform.request("cdr_clk")
self.specials += [
Instance("IBUFDS", i_I=sma_clkin.p, i_IB=sma_clkin.n, o_O=sma_clkin_se),
Instance("ODDR", i_C=sma_clkin_se, i_CE=1, i_D1=1, i_D2=0, o_Q=cdr_clk_se),
Instance("OBUFDS", i_I=cdr_clk_se, o_O=cdr_clk.p, o_OB=cdr_clk.n)
]
class GTPBootstrapClock(Module):
def __init__(self, platform, freq=125e6):
self.clock_domains.cd_bootstrap = ClockDomain(reset_less=True)
self.cd_bootstrap.clk.attr.add("keep")
bootstrap_125 = platform.request("clk125_gtp")
bootstrap_se = Signal()
clk_out = Signal()
platform.add_period_constraint(bootstrap_125.p, 8.0)
self.specials += [
Instance("IBUFDS_GTE2",
i_CEB=0,
i_I=bootstrap_125.p, i_IB=bootstrap_125.n,
o_O=bootstrap_se,
p_CLKCM_CFG="TRUE",
p_CLKRCV_TRST="TRUE",
p_CLKSWING_CFG=3),
Instance("BUFG", i_I=bootstrap_se, o_O=clk_out)
]
if freq == 125e6:
self.comb += self.cd_bootstrap.clk.eq(clk_out)
elif freq == 100e6:
pll_fb = Signal()
pll_out = Signal()
self.specials += [
Instance("PLLE2_BASE",
p_CLKIN1_PERIOD=8.0,
i_CLKIN1=clk_out,
i_CLKFBIN=pll_fb,
o_CLKFBOUT=pll_fb,
# VCO @ 1GHz
p_CLKFBOUT_MULT=8, p_DIVCLK_DIVIDE=1,
# 100MHz for bootstrap
p_CLKOUT1_DIVIDE=10, p_CLKOUT1_PHASE=0.0, o_CLKOUT1=pll_out,
),
Instance("BUFG", i_I=pll_out, o_O=self.cd_bootstrap.clk)
]
else:
raise ValueError("Bootstrap frequency must be 100 or 125MHz")
class GenericStandalone(SoCCore):
def __init__(self, description, acpki=False):
self.acpki = acpki
clk_freq = description["rtio_frequency"]
with_wrpll = description["enable_wrpll"]
platform = kasli_soc.Platform()
platform.toolchain.bitstream_commands.extend([
"set_property BITSTREAM.GENERAL.COMPRESS True [current_design]",
])
ident = description["variant"]
if self.acpki:
ident = "acpki_" + ident
SoCCore.__init__(self, platform=platform, csr_data_width=32, ident=ident, ps_cd_sys=False)
self.config["HW_REV"] = description["hw_rev"]
clk_synth = platform.request("cdr_clk_clean_fabric")
clk_synth_se = Signal()
clk_synth_se_buf = Signal()
platform.add_period_constraint(clk_synth.p, 8.0)
self.specials += [
Instance("IBUFGDS",
p_DIFF_TERM="TRUE", p_IBUF_LOW_PWR="FALSE",
i_I=clk_synth.p, i_IB=clk_synth.n, o_O=clk_synth_se
),
Instance("BUFG", i_I=clk_synth_se, o_O=clk_synth_se_buf),
]
fix_serdes_timing_path(platform)
self.submodules.bootstrap = GTPBootstrapClock(self.platform, clk_freq)
self.config["RTIO_FREQUENCY"] = str(clk_freq/1e6)
self.config["CLOCK_FREQUENCY"] = int(clk_freq)
self.submodules.sys_crg = zynq_clocking.SYSCRG(self.platform, self.ps7, clk_synth_se_buf)
platform.add_false_path_constraints(
self.bootstrap.cd_bootstrap.clk, self.sys_crg.cd_sys.clk)
self.csr_devices.append("sys_crg")
self.crg = self.ps7 # HACK for eem_7series to find the clock
self.crg.cd_sys = self.sys_crg.cd_sys
if with_wrpll:
self.submodules.wrpll_refclk = wrpll.FrequencyMultiplier(platform.request("sma_clkin"))
self.submodules.wrpll = wrpll.WRPLL(
platform=self.platform,
cd_ref=self.wrpll_refclk.cd_ref,
main_clk_se=clk_synth_se)
self.csr_devices.append("wrpll_refclk")
self.csr_devices.append("wrpll")
self.comb += self.ps7.core.core0.nfiq.eq(self.wrpll.ev.irq)
self.config["HAS_SI549"] = None
self.config["WRPLL_REF_CLK"] = "SMA_CLKIN"
else:
self.submodules += SMAClkinForward(self.platform)
self.config["HAS_SI5324"] = None
self.config["SI5324_SOFT_RESET"] = None
self.rtio_channels = []
has_grabber = any(peripheral["type"] == "grabber" for peripheral in description["peripherals"])
if has_grabber:
self.grabber_csr_group = []
eem_7series.add_peripherals(self, description["peripherals"], iostandard=eem_iostandard)
for i in (0, 1):
print("USER LED at RTIO channel 0x{:06x}".format(len(self.rtio_channels)))
user_led = self.platform.request("user_led", i)
phy = ttl_simple.Output(user_led)
self.submodules += phy
self.rtio_channels.append(rtio.Channel.from_phy(phy))
self.config["RTIO_LOG_CHANNEL"] = len(self.rtio_channels)
self.rtio_channels.append(rtio.LogChannel())
self.submodules.rtio_tsc = rtio.TSC(glbl_fine_ts_width=3)
self.submodules.rtio_core = rtio.Core(
self.rtio_tsc, self.rtio_channels, lane_count=description["sed_lanes"]
)
self.csr_devices.append("rtio_core")
if self.acpki:
self.config["KI_IMPL"] = "acp"
self.submodules.rtio = acpki.KernelInitiator(self.rtio_tsc,
bus=self.ps7.s_axi_acp,
user=self.ps7.s_axi_acp_user,
evento=self.ps7.event.o)
self.csr_devices.append("rtio")
else:
self.config["KI_IMPL"] = "csr"
self.submodules.rtio = rtio.KernelInitiator(self.rtio_tsc, now64=True)
self.csr_devices.append("rtio")
self.submodules.rtio_dma = dma.DMA(self.ps7.s_axi_hp0)
self.csr_devices.append("rtio_dma")
self.submodules.cri_con = rtio.CRIInterconnectShared(
[self.rtio.cri, self.rtio_dma.cri],
[self.rtio_core.cri])
self.csr_devices.append("cri_con")
self.submodules.rtio_moninj = rtio.MonInj(self.rtio_channels)
self.csr_devices.append("rtio_moninj")
self.submodules.rtio_analyzer = analyzer.Analyzer(self.rtio_tsc, self.rtio_core.cri,
self.ps7.s_axi_hp1)
self.csr_devices.append("rtio_analyzer")
if has_grabber:
self.config["HAS_GRABBER"] = None
self.add_csr_group("grabber", self.grabber_csr_group)
for grabber in self.grabber_csr_group:
self.platform.add_false_path_constraints(
self.sys_crg.cd_sys.clk, getattr(self, grabber).deserializer.cd_cl.clk)
class GenericMaster(SoCCore):
def __init__(self, description, acpki=False):
clk_freq = description["rtio_frequency"]
with_wrpll = description["enable_wrpll"]
has_drtio_over_eem = any(peripheral["type"] == "shuttler" for peripheral in description["peripherals"])
self.acpki = acpki
platform = kasli_soc.Platform()
platform.toolchain.bitstream_commands.extend([
"set_property BITSTREAM.GENERAL.COMPRESS True [current_design]",
])
ident = description["variant"]
if self.acpki:
ident = "acpki_" + ident
SoCCore.__init__(self, platform=platform, csr_data_width=32, ident=ident, ps_cd_sys=False)
self.config["HW_REV"] = description["hw_rev"]
data_pads = [platform.request("sfp", i) for i in range(4)]
self.submodules.gt_drtio = gtx_7series.GTX(
clock_pads=platform.request("clk_gtp"),
pads=data_pads,
clk_freq=clk_freq)
self.csr_devices.append("gt_drtio")
self.config["RTIO_FREQUENCY"] = str(clk_freq/1e6)
self.config["CLOCK_FREQUENCY"] = int(clk_freq)
txout_buf = Signal()
gtx0 = self.gt_drtio.gtxs[0]
self.specials += Instance("BUFG", i_I=gtx0.txoutclk, o_O=txout_buf)
ext_async_rst = Signal()
self.submodules.bootstrap = GTPBootstrapClock(self.platform, clk_freq)
self.submodules.sys_crg = zynq_clocking.SYSCRG(
self.platform,
self.ps7,
txout_buf,
clk_sw=self.gt_drtio.stable_clkin.storage,
clk_sw_status=gtx0.tx_init.done,
ext_async_rst=ext_async_rst)
self.csr_devices.append("sys_crg")
self.crg = self.ps7 # HACK for eem_7series to find the clock
self.crg.cd_sys = self.sys_crg.cd_sys
platform.add_false_path_constraints(
self.bootstrap.cd_bootstrap.clk, self.sys_crg.cd_sys.clk)
fix_serdes_timing_path(platform)
self.comb += ext_async_rst.eq(self.sys_crg.clk_sw_fsm.o_clk_sw & ~gtx0.tx_init.done)
self.specials += MultiReg(self.sys_crg.clk_sw_fsm.o_clk_sw & self.sys_crg.mmcm_locked, self.gt_drtio.clk_path_ready, odomain="bootstrap")
if with_wrpll:
clk_synth = platform.request("cdr_clk_clean_fabric")
clk_synth_se = Signal()
platform.add_period_constraint(clk_synth.p, 8.0)
self.specials += Instance("IBUFGDS", p_DIFF_TERM="TRUE", p_IBUF_LOW_PWR="FALSE", i_I=clk_synth.p, i_IB=clk_synth.n, o_O=clk_synth_se)
self.submodules.wrpll_refclk = wrpll.FrequencyMultiplier(platform.request("sma_clkin"))
self.submodules.wrpll = wrpll.WRPLL(
platform=self.platform,
cd_ref=self.wrpll_refclk.cd_ref,
main_clk_se=clk_synth_se)
self.csr_devices.append("wrpll_refclk")
self.csr_devices.append("wrpll")
self.comb += self.ps7.core.core0.nfiq.eq(self.wrpll.ev.irq)
self.config["HAS_SI549"] = None
self.config["WRPLL_REF_CLK"] = "SMA_CLKIN"
else:
self.submodules += SMAClkinForward(self.platform)
self.config["HAS_SI5324"] = None
self.config["SI5324_SOFT_RESET"] = None
self.rtio_channels = []
has_grabber = any(peripheral["type"] == "grabber" for peripheral in description["peripherals"])
if has_drtio_over_eem:
self.eem_drtio_channels = []
if has_grabber:
self.grabber_csr_group = []
eem_7series.add_peripherals(self, description["peripherals"], iostandard=eem_iostandard)
for i in (0, 1):
print("USER LED at RTIO channel 0x{:06x}".format(len(self.rtio_channels)))
user_led = self.platform.request("user_led", i)
phy = ttl_simple.Output(user_led)
self.submodules += phy
self.rtio_channels.append(rtio.Channel.from_phy(phy))
self.config["RTIO_LOG_CHANNEL"] = len(self.rtio_channels)
self.rtio_channels.append(rtio.LogChannel())
self.submodules.rtio_tsc = rtio.TSC(glbl_fine_ts_width=3)
self.drtio_csr_group = []
self.drtioaux_csr_group = []
self.drtioaux_memory_group = []
self.drtio_cri = []
for i in range(len(self.gt_drtio.channels)):
core_name = "drtio" + str(i)
coreaux_name = "drtioaux" + str(i)
memory_name = "drtioaux" + str(i) + "_mem"
self.drtio_csr_group.append(core_name)
self.drtioaux_csr_group.append(coreaux_name)
self.drtioaux_memory_group.append(memory_name)
cdr = ClockDomainsRenamer({"rtio_rx": "rtio_rx" + str(i)})
core = cdr(DRTIOMaster(self.rtio_tsc, self.gt_drtio.channels[i]))
setattr(self.submodules, core_name, core)
self.drtio_cri.append(core.cri)
self.csr_devices.append(core_name)
coreaux = cdr(drtio_aux_controller.DRTIOAuxControllerBare(core.link_layer))
setattr(self.submodules, coreaux_name, coreaux)
self.csr_devices.append(coreaux_name)
size = coreaux.get_mem_size()
memory_address = self.axi2csr.register_port(coreaux.get_tx_port(), size)
self.axi2csr.register_port(coreaux.get_rx_port(), size)
self.add_memory_region(memory_name, self.mem_map["csr"] + memory_address, size * 2)
self.config["HAS_DRTIO"] = None
self.config["HAS_DRTIO_ROUTING"] = None
if has_drtio_over_eem:
self.add_eem_drtio(self.eem_drtio_channels)
self.add_drtio_cpuif_groups()
self.submodules.rtio_core = rtio.Core(
self.rtio_tsc, self.rtio_channels, lane_count=description["sed_lanes"]
)
self.csr_devices.append("rtio_core")
if self.acpki:
self.config["KI_IMPL"] = "acp"
self.submodules.rtio = acpki.KernelInitiator(self.rtio_tsc,
bus=self.ps7.s_axi_acp,
user=self.ps7.s_axi_acp_user,
evento=self.ps7.event.o)
self.csr_devices.append("rtio")
else:
self.config["KI_IMPL"] = "csr"
self.submodules.rtio = rtio.KernelInitiator(self.rtio_tsc, now64=True)
self.csr_devices.append("rtio")
self.submodules.rtio_dma = dma.DMA(self.ps7.s_axi_hp0)
self.csr_devices.append("rtio_dma")
self.submodules.cri_con = rtio.CRIInterconnectShared(
[self.rtio.cri, self.rtio_dma.cri],
[self.rtio_core.cri] + self.drtio_cri,
enable_routing=True)
self.csr_devices.append("cri_con")
self.submodules.rtio_moninj = rtio.MonInj(self.rtio_channels)
self.csr_devices.append("rtio_moninj")
self.submodules.routing_table = rtio.RoutingTableAccess(self.cri_con)
self.csr_devices.append("routing_table")
self.submodules.rtio_analyzer = analyzer.Analyzer(self.rtio_tsc, self.rtio_core.cri,
self.ps7.s_axi_hp1)
self.csr_devices.append("rtio_analyzer")
if has_grabber:
self.config["HAS_GRABBER"] = None
self.add_csr_group("grabber", self.grabber_csr_group)
self.submodules.virtual_leds = virtual_leds.VirtualLeds()
self.csr_devices.append("virtual_leds")
self.comb += [self.virtual_leds.get(i).eq(channel.rx_ready)
for i, channel in enumerate(self.gt_drtio.channels)]
def add_eem_drtio(self, eem_drtio_channels):
# Must be called before invoking add_rtio() to construct the CRI
# interconnect properly
self.submodules.eem_transceiver = eem_serdes.EEMSerdes(self.platform, eem_drtio_channels)
self.csr_devices.append("eem_transceiver")
self.config["HAS_DRTIO_EEM"] = None
self.config["EEM_DRTIO_COUNT"] = len(eem_drtio_channels)
cdr = ClockDomainsRenamer({"rtio_rx": "sys"})
for i in range(len(self.eem_transceiver.channels)):
channel = i + len(self.gt_drtio.channels)
core_name = "drtio" + str(channel)
coreaux_name = "drtioaux" + str(channel)
memory_name = "drtioaux" + str(channel) + "_mem"
self.drtio_csr_group.append(core_name)
self.drtioaux_csr_group.append(coreaux_name)
self.drtioaux_memory_group.append(memory_name)
core = cdr(DRTIOMaster(self.rtio_tsc, self.eem_transceiver.channels[i]))
setattr(self.submodules, core_name, core)
self.drtio_cri.append(core.cri)
self.csr_devices.append(core_name)
coreaux = cdr(drtio_aux_controller.DRTIOAuxControllerBare(core.link_layer))
setattr(self.submodules, coreaux_name, coreaux)
self.csr_devices.append(coreaux_name)
size = coreaux.get_mem_size()
memory_address = self.axi2csr.register_port(coreaux.get_tx_port(), size)
self.axi2csr.register_port(coreaux.get_rx_port(), size)
self.add_memory_region(memory_name, self.mem_map["csr"] + memory_address, size * 2)
def add_drtio_cpuif_groups(self):
self.add_csr_group("drtio", self.drtio_csr_group)
self.add_csr_group("drtioaux", self.drtioaux_csr_group)
self.add_memory_group("drtioaux_mem", self.drtioaux_memory_group)
class GenericSatellite(SoCCore):
def __init__(self, description, acpki=False):
clk_freq = description["rtio_frequency"]
with_wrpll = description["enable_wrpll"]
self.acpki = acpki
platform = kasli_soc.Platform()
platform.toolchain.bitstream_commands.extend([
"set_property BITSTREAM.GENERAL.COMPRESS True [current_design]",
])
ident = description["variant"]
if self.acpki:
ident = "acpki_" + ident
SoCCore.__init__(self, platform=platform, csr_data_width=32, ident=ident, ps_cd_sys=False)
self.config["HW_REV"] = description["hw_rev"]
data_pads = [platform.request("sfp", i) for i in range(4)]
self.submodules.gt_drtio = gtx_7series.GTX(
clock_pads=platform.request("clk_gtp"),
pads=data_pads,
clk_freq=clk_freq)
self.csr_devices.append("gt_drtio")
txout_buf = Signal()
gtx0 = self.gt_drtio.gtxs[0]
self.specials += Instance("BUFG", i_I=gtx0.txoutclk, o_O=txout_buf)
ext_async_rst = Signal()
self.submodules.bootstrap = GTPBootstrapClock(self.platform, clk_freq)
self.submodules.sys_crg = zynq_clocking.SYSCRG(
self.platform,
self.ps7,
txout_buf,
clk_sw=self.gt_drtio.stable_clkin.storage,
clk_sw_status=gtx0.tx_init.done,
ext_async_rst=ext_async_rst)
platform.add_false_path_constraints(
self.bootstrap.cd_bootstrap.clk, self.sys_crg.cd_sys.clk)
self.csr_devices.append("sys_crg")
self.crg = self.ps7 # HACK for eem_7series to find the clock
self.crg.cd_sys = self.sys_crg.cd_sys
fix_serdes_timing_path(platform)
self.comb += ext_async_rst.eq(self.sys_crg.clk_sw_fsm.o_clk_sw & ~gtx0.tx_init.done)
self.specials += MultiReg(self.sys_crg.clk_sw_fsm.o_clk_sw & self.sys_crg.mmcm_locked, self.gt_drtio.clk_path_ready, odomain="bootstrap")
self.rtio_channels = []
has_grabber = any(peripheral["type"] == "grabber" for peripheral in description["peripherals"])
if has_grabber:
self.grabber_csr_group = []
eem_7series.add_peripherals(self, description["peripherals"], iostandard=eem_iostandard)
for i in (0, 1):
print("USER LED at RTIO channel 0x{:06x}".format(len(self.rtio_channels)))
user_led = self.platform.request("user_led", i)
phy = ttl_simple.Output(user_led)
self.submodules += phy
self.rtio_channels.append(rtio.Channel.from_phy(phy))
self.config["RTIO_LOG_CHANNEL"] = len(self.rtio_channels)
self.rtio_channels.append(rtio.LogChannel())
self.submodules.rtio_tsc = rtio.TSC(glbl_fine_ts_width=3)
drtioaux_csr_group = []
drtioaux_memory_group = []
drtiorep_csr_group = []
self.drtio_cri = []
for i in range(len(self.gt_drtio.channels)):
coreaux_name = "drtioaux" + str(i)
memory_name = "drtioaux" + str(i) + "_mem"
drtioaux_csr_group.append(coreaux_name)
drtioaux_memory_group.append(memory_name)
cdr = ClockDomainsRenamer({"rtio_rx": "rtio_rx" + str(i)})
if i == 0:
self.submodules.rx_synchronizer = cdr(XilinxRXSynchronizer())
core = cdr(DRTIOSatellite(
self.rtio_tsc, self.gt_drtio.channels[i],
self.rx_synchronizer))
self.submodules.drtiosat = core
self.csr_devices.append("drtiosat")
else:
corerep_name = "drtiorep" + str(i-1)
drtiorep_csr_group.append(corerep_name)
core = cdr(DRTIORepeater(
self.rtio_tsc, self.gt_drtio.channels[i]))
setattr(self.submodules, corerep_name, core)
self.drtio_cri.append(core.cri)
self.csr_devices.append(corerep_name)
coreaux = cdr(drtio_aux_controller.DRTIOAuxControllerBare(core.link_layer))
setattr(self.submodules, coreaux_name, coreaux)
self.csr_devices.append(coreaux_name)
mem_size = coreaux.get_mem_size()
tx_port = coreaux.get_tx_port()
rx_port = coreaux.get_rx_port()
memory_address = self.axi2csr.register_port(tx_port, mem_size)
# rcv in upper half of the memory, thus added second
self.axi2csr.register_port(rx_port, mem_size)
# and registered in PS interface
# manually, because software refers to rx/tx by halves of entire memory block, not names
self.add_memory_region(memory_name, self.mem_map["csr"] + memory_address, mem_size * 2)
self.config["HAS_DRTIO"] = None
self.config["HAS_DRTIO_ROUTING"] = None
self.add_csr_group("drtioaux", drtioaux_csr_group)
self.add_memory_group("drtioaux_mem", drtioaux_memory_group)
self.add_csr_group("drtiorep", drtiorep_csr_group)
if self.acpki:
self.config["KI_IMPL"] = "acp"
self.submodules.rtio = acpki.KernelInitiator(self.rtio_tsc,
bus=self.ps7.s_axi_acp,
user=self.ps7.s_axi_acp_user,
evento=self.ps7.event.o)
self.csr_devices.append("rtio")
else:
self.config["KI_IMPL"] = "csr"
self.submodules.rtio = rtio.KernelInitiator(self.rtio_tsc, now64=True)
self.csr_devices.append("rtio")
self.submodules.rtio_dma = dma.DMA(self.ps7.s_axi_hp0)
self.csr_devices.append("rtio_dma")
self.submodules.local_io = SyncRTIO(
self.rtio_tsc, self.rtio_channels, lane_count=description["sed_lanes"]
)
self.comb += [
self.drtiosat.async_errors.eq(self.local_io.async_errors),
self.local_io.sed_spread_enable.eq(self.drtiosat.sed_spread_enable.storage)
]
self.submodules.cri_con = rtio.CRIInterconnectShared(
[self.drtiosat.cri, self.rtio_dma.cri, self.rtio.cri],
[self.local_io.cri] + self.drtio_cri,
enable_routing=True)
self.csr_devices.append("cri_con")
self.submodules.routing_table = rtio.RoutingTableAccess(self.cri_con)
self.csr_devices.append("routing_table")
self.submodules.rtio_moninj = rtio.MonInj(self.rtio_channels)
self.csr_devices.append("rtio_moninj")
self.submodules.rtio_analyzer = analyzer.Analyzer(self.rtio_tsc, self.local_io.cri,
self.ps7.s_axi_hp1)
self.csr_devices.append("rtio_analyzer")
rtio_clk_period = 1e9/clk_freq
self.config["RTIO_FREQUENCY"] = str(clk_freq/1e6)
self.config["CLOCK_FREQUENCY"] = int(clk_freq)
if with_wrpll:
clk_synth = platform.request("cdr_clk_clean_fabric")
clk_synth_se = Signal()
platform.add_period_constraint(clk_synth.p, 8.0)
self.specials += Instance("IBUFGDS", p_DIFF_TERM="TRUE", p_IBUF_LOW_PWR="FALSE", i_I=clk_synth.p, i_IB=clk_synth.n, o_O=clk_synth_se)
self.submodules.wrpll = wrpll.WRPLL(
platform=self.platform,
cd_ref=self.gt_drtio.cd_rtio_rx0,
main_clk_se=clk_synth_se)
self.submodules.wrpll_skewtester = wrpll.SkewTester(self.rx_synchronizer)
self.csr_devices.append("wrpll_skewtester")
self.csr_devices.append("wrpll")
self.comb += self.ps7.core.core0.nfiq.eq(self.wrpll.ev.irq)
self.config["HAS_SI549"] = None
self.config["WRPLL_REF_CLK"] = "GT_CDR"
else:
self.submodules.siphaser = SiPhaser7Series(
si5324_clkin=platform.request("cdr_clk"),
rx_synchronizer=self.rx_synchronizer,
ultrascale=False,
rtio_clk_freq=self.gt_drtio.rtio_clk_freq)
self.csr_devices.append("siphaser")
self.config["HAS_SI5324"] = None
self.config["SI5324_SOFT_RESET"] = None
gtx0 = self.gt_drtio.gtxs[0]
platform.add_false_path_constraints(
gtx0.txoutclk, gtx0.rxoutclk)
if has_grabber:
self.config["HAS_GRABBER"] = None
self.add_csr_group("grabber", self.grabber_csr_group)
# no RTIO CRG here
self.submodules.virtual_leds = virtual_leds.VirtualLeds()
self.csr_devices.append("virtual_leds")
self.comb += [self.virtual_leds.get(i).eq(channel.rx_ready)
for i, channel in enumerate(self.gt_drtio.channels)]
def main():
parser = argparse.ArgumentParser(
description="ARTIQ device binary builder for generic Kasli-SoC systems")
parser.add_argument("-r", default=None,
help="build Rust interface into the specified file")
parser.add_argument("-c", default=None,
help="build Rust compiler configuration into the specified file")
parser.add_argument("-m", default=None,
help="build Rust memory interface into the specified file")
parser.add_argument("-g", default=None,
help="build gateware into the specified directory")
parser.add_argument("--acpki", default=False, action="store_true",
help="enable ACPKI")
parser.add_argument("description", metavar="DESCRIPTION",
help="JSON system description file")
args = parser.parse_args()
description = jsondesc.load(args.description)
if description["target"] != "kasli_soc":
raise ValueError("Description is for a different target")
if description["drtio_role"] == "standalone":
cls = GenericStandalone
elif description["drtio_role"] == "master":
cls = GenericMaster
elif description["drtio_role"] == "satellite":
cls = GenericSatellite
else:
raise ValueError("Invalid DRTIO role")
soc = cls(description, acpki=args.acpki)
soc.finalize()
if args.r is not None:
write_csr_file(soc, args.r)
if args.m is not None:
write_mem_file(soc, args.m)
if args.c is not None:
write_rustc_cfg_file(soc, args.c)
if args.g is not None:
soc.build(build_dir=args.g)
if __name__ == "__main__":
main()

View File

@ -1,191 +0,0 @@
#!/usr/bin/env python
import argparse
from operator import itemgetter
from migen import *
from migen.build.generic_platform import *
from migen.genlib.resetsync import AsyncResetSynchronizer
from migen.genlib.cdc import MultiReg
from migen_axi.integration.soc_core import SoCCore
from migen_axi.platforms import redpitaya
from misoc.interconnect.csr import *
from misoc.integration import cpu_interface
from artiq.gateware import rtio
from artiq.gateware.rtio.phy import ttl_simple, ttl_serdes_7series, dds, spi2
import dma
import analyzer
import acpki
class RTIOCRG(Module, AutoCSR):
def __init__(self, platform, rtio_internal_clk):
self.clock_sel = CSRStorage()
self.pll_reset = CSRStorage(reset=1)
self.pll_locked = CSRStatus()
self.clock_domains.cd_rtio = ClockDomain()
self.clock_domains.cd_rtiox4 = ClockDomain(reset_less=True)
rtio_external_clk = Signal()
# user_sma_clock = platform.request("user_sma_clock")
# platform.add_period_constraint(user_sma_clock.p, 8.0)
# self.specials += Instance("IBUFDS",
# i_I=user_sma_clock.p, i_IB=user_sma_clock.n,
# o_O=rtio_external_clk)
pll_locked = Signal()
rtio_clk = Signal()
rtiox4_clk = Signal()
self.specials += [
Instance("PLLE2_ADV",
p_STARTUP_WAIT="FALSE", o_LOCKED=pll_locked,
p_REF_JITTER1=0.01,
p_CLKIN1_PERIOD=8.0, p_CLKIN2_PERIOD=8.0,
i_CLKIN1=rtio_internal_clk, i_CLKIN2=rtio_external_clk,
# Warning: CLKINSEL=0 means CLKIN2 is selected
i_CLKINSEL=~self.clock_sel.storage,
# VCO @ 1GHz when using 125MHz input
p_CLKFBOUT_MULT=8, p_DIVCLK_DIVIDE=1,
i_CLKFBIN=self.cd_rtio.clk,
i_RST=self.pll_reset.storage,
o_CLKFBOUT=rtio_clk,
p_CLKOUT0_DIVIDE=2, p_CLKOUT0_PHASE=0.0,
o_CLKOUT0=rtiox4_clk),
Instance("BUFG", i_I=rtio_clk, o_O=self.cd_rtio.clk),
Instance("BUFG", i_I=rtiox4_clk, o_O=self.cd_rtiox4.clk),
AsyncResetSynchronizer(self.cd_rtio, ~pll_locked),
MultiReg(pll_locked, self.pll_locked.status)
]
class Redpitaya(SoCCore):
def __init__(self, acpki=False):
self.acpki = acpki
self.rustc_cfg = dict()
platform = redpitaya.Platform()
platform.toolchain.bitstream_commands.extend([
"set_property BITSTREAM.GENERAL.COMPRESS True [current_design]",
])
ident = self.__class__.__name__
if self.acpki:
ident = "acpki_" + ident
SoCCore.__init__(self, platform=platform, csr_data_width=32, ident=ident)
platform.add_platform_command("create_clock -name clk_fpga_0 -period 8 [get_pins \"PS7/FCLKCLK[0]\"]")
platform.add_platform_command("set_input_jitter clk_fpga_0 0.24")
self.submodules.rtio_crg = RTIOCRG(self.platform, self.ps7.cd_sys.clk)
self.csr_devices.append("rtio_crg")
self.platform.add_period_constraint(self.rtio_crg.cd_rtio.clk, 8.)
self.platform.add_false_path_constraints(
self.ps7.cd_sys.clk,
self.rtio_crg.cd_rtio.clk)
def add_rtio(self, rtio_channels):
self.submodules.rtio_tsc = rtio.TSC("async", glbl_fine_ts_width=3)
self.submodules.rtio_core = rtio.Core(self.rtio_tsc, rtio_channels)
self.csr_devices.append("rtio_core")
if self.acpki:
self.rustc_cfg["ki_impl"] = "acp"
self.submodules.rtio = acpki.KernelInitiator(self.rtio_tsc,
bus=self.ps7.s_axi_acp,
user=self.ps7.s_axi_acp_user,
evento=self.ps7.event.o)
self.csr_devices.append("rtio")
else:
self.rustc_cfg["ki_impl"] = "csr"
self.submodules.rtio = rtio.KernelInitiator(self.rtio_tsc, now64=True)
self.csr_devices.append("rtio")
self.submodules.rtio_dma = dma.DMA(self.ps7.s_axi_hp0)
self.csr_devices.append("rtio_dma")
self.submodules.cri_con = rtio.CRIInterconnectShared(
[self.rtio.cri, self.rtio_dma.cri],
[self.rtio_core.cri])
self.csr_devices.append("cri_con")
self.submodules.rtio_moninj = rtio.MonInj(rtio_channels)
self.csr_devices.append("rtio_moninj")
self.submodules.rtio_analyzer = analyzer.Analyzer(self.rtio_tsc, self.rtio_core.cri,
self.ps7.s_axi_hp1)
self.csr_devices.append("rtio_analyzer")
class Simple(Redpitaya):
def __init__(self, **kwargs):
Redpitaya.__init__(self, **kwargs)
platform = self.platform
rtio_channels = []
for i in range(2):
phy = ttl_simple.Output(platform.request("user_led", i))
self.submodules += phy
rtio_channels.append(rtio.Channel.from_phy(phy))
self.config["RTIO_LOG_CHANNEL"] = len(rtio_channels)
rtio_channels.append(rtio.LogChannel())
self.add_rtio(rtio_channels)
VARIANTS = {cls.__name__.lower(): cls for cls in [Simple]}
def write_csr_file(soc, filename):
with open(filename, "w") as f:
f.write(cpu_interface.get_csr_rust(
soc.get_csr_regions(), soc.get_csr_groups(), soc.get_constants()))
def write_rustc_cfg_file(soc, filename):
with open(filename, "w") as f:
for k, v in sorted(soc.rustc_cfg.items(), key=itemgetter(0)):
if v is None:
f.write("{}\n".format(k))
else:
f.write("{}=\"{}\"\n".format(k, v))
def main():
parser = argparse.ArgumentParser(
description="ARTIQ port to the Redpitaya Zynq development kit")
parser.add_argument("-r", default=None,
help="build Rust interface into the specified file")
parser.add_argument("-c", default=None,
help="build Rust compiler configuration into the specified file")
parser.add_argument("-g", default=None,
help="build gateware into the specified directory")
parser.add_argument("-V", "--variant", default="10",
help="variant: "
"[acpki_]simple "
"(default: %(default)s)")
args = parser.parse_args()
variant = args.variant.lower()
acpki = variant.startswith("acpki_")
if acpki:
variant = variant[6:]
soc = Simple(acpki=acpki)
soc.finalize()
if args.r is not None:
write_csr_file(soc, args.r)
if args.c is not None:
write_rustc_cfg_file(soc, args.c)
if args.g is not None:
soc.build(build_dir=args.g)
if __name__ == "__main__":
main()

View File

@ -168,7 +168,7 @@ class FullStackTB(Module):
bus = axi.Interface(ws*8) bus = axi.Interface(ws*8)
self.memory = AXIMemorySim(bus, sequence) self.memory = AXIMemorySim(bus, sequence)
self.submodules.dut = dma.DMA(bus) self.submodules.dut = dma.DMA(bus)
self.submodules.tsc = rtio.TSC("async") self.submodules.tsc = rtio.TSC()
self.submodules.rtio = rtio.Core(self.tsc, rtio_channels) self.submodules.rtio = rtio.Core(self.tsc, rtio_channels)
self.comb += self.dut.cri.connect(self.rtio.cri) self.comb += self.dut.cri.connect(self.rtio.cri)
@ -229,7 +229,7 @@ class TestDMA(unittest.TestCase):
do_dma(tb.dut, 0), monitor(), do_dma(tb.dut, 0), monitor(),
(None for _ in range(70)), (None for _ in range(70)),
tb.memory.ar(), tb.memory.r() tb.memory.ar(), tb.memory.r()
]}, {"sys": 8, "rsys": 8, "rtio": 8, "rio": 8, "rio_phy": 8}) ]}, {"sys": 8, "rsys": 8, "rio": 8, "rio_phy": 8})
correct_changes = [(timestamp + 11, channel) correct_changes = [(timestamp + 11, channel)
for channel, timestamp, _, _ in test_writes_full_stack] for channel, timestamp, _, _ in test_writes_full_stack]

View File

@ -10,98 +10,172 @@ from migen.genlib.cdc import MultiReg
from migen_axi.integration.soc_core import SoCCore from migen_axi.integration.soc_core import SoCCore
from migen_axi.platforms import zc706 from migen_axi.platforms import zc706
from misoc.interconnect.csr import * from misoc.interconnect.csr import *
from misoc.integration import cpu_interface from misoc.cores import gpio
from artiq.gateware import rtio, nist_clock, nist_qc2 from artiq.gateware import rtio, nist_clock, nist_qc2
from artiq.gateware.rtio.phy import ttl_simple, ttl_serdes_7series, dds, spi2 from artiq.gateware.rtio.phy import ttl_simple, ttl_serdes_7series, dds, spi2, edge_counter
from artiq.gateware.rtio.xilinx_clocking import fix_serdes_timing_path
from artiq.gateware.drtio.transceiver import gtx_7series
from artiq.gateware.drtio.siphaser import SiPhaser7Series
from artiq.gateware.drtio.rx_synchronizer import XilinxRXSynchronizer
from artiq.gateware.drtio import *
import dma import dma
import analyzer import analyzer
import acpki import acpki
import drtio_aux_controller
import zynq_clocking
from config import write_csr_file, write_mem_file, write_rustc_cfg_file
class SMAClkinForward(Module):
class RTIOCRG(Module, AutoCSR): def __init__(self, platform):
def __init__(self, platform, rtio_internal_clk): sma_clkin = platform.request("user_sma_clock")
self.clock_sel = CSRStorage() sma_clkin_se = Signal()
self.pll_reset = CSRStorage(reset=1) si5324_clkin_se = Signal()
self.pll_locked = CSRStatus() si5324_clkin = platform.request("si5324_clkin")
self.clock_domains.cd_rtio = ClockDomain()
self.clock_domains.cd_rtiox4 = ClockDomain(reset_less=True)
rtio_external_clk = Signal()
user_sma_clock = platform.request("user_sma_clock")
platform.add_period_constraint(user_sma_clock.p, 8.0)
self.specials += Instance("IBUFDS",
i_I=user_sma_clock.p, i_IB=user_sma_clock.n,
o_O=rtio_external_clk)
pll_locked = Signal()
rtio_clk = Signal()
rtiox4_clk = Signal()
self.specials += [ self.specials += [
Instance("PLLE2_ADV", Instance("IBUFDS", i_I=sma_clkin.p, i_IB=sma_clkin.n, o_O=sma_clkin_se),
p_STARTUP_WAIT="FALSE", o_LOCKED=pll_locked, Instance("ODDR", i_C=sma_clkin_se, i_CE=1, i_D1=1, i_D2=0, o_Q=si5324_clkin_se),
Instance("OBUFDS", i_I=si5324_clkin_se, o_O=si5324_clkin.p, o_OB=si5324_clkin.n)
p_REF_JITTER1=0.01,
p_CLKIN1_PERIOD=8.0, p_CLKIN2_PERIOD=8.0,
i_CLKIN1=rtio_internal_clk, i_CLKIN2=rtio_external_clk,
# Warning: CLKINSEL=0 means CLKIN2 is selected
i_CLKINSEL=~self.clock_sel.storage,
# VCO @ 1GHz when using 125MHz input
p_CLKFBOUT_MULT=8, p_DIVCLK_DIVIDE=1,
i_CLKFBIN=self.cd_rtio.clk,
i_RST=self.pll_reset.storage,
o_CLKFBOUT=rtio_clk,
p_CLKOUT0_DIVIDE=2, p_CLKOUT0_PHASE=0.0,
o_CLKOUT0=rtiox4_clk),
Instance("BUFG", i_I=rtio_clk, o_O=self.cd_rtio.clk),
Instance("BUFG", i_I=rtiox4_clk, o_O=self.cd_rtiox4.clk),
AsyncResetSynchronizer(self.cd_rtio, ~pll_locked),
MultiReg(pll_locked, self.pll_locked.status)
] ]
class CLK200BootstrapClock(Module):
def __init__(self, platform, freq=125e6):
self.clock_domains.cd_bootstrap = ClockDomain(reset_less=True)
self.cd_bootstrap.clk.attr.add("keep")
clk200 = platform.request("clk200")
clk200_se = Signal()
pll_fb = Signal()
pll_clkout = Signal()
assert freq in [125e6, 100e6]
divide = int(1e9/freq)
self.specials += [
Instance("IBUFDS",
i_I=clk200.p, i_IB=clk200.n, o_O=clk200_se),
Instance("PLLE2_BASE",
p_CLKIN1_PERIOD=5.0,
i_CLKIN1=clk200_se,
i_CLKFBIN=pll_fb,
o_CLKFBOUT=pll_fb,
# VCO @ 1GHz
p_CLKFBOUT_MULT=5, p_DIVCLK_DIVIDE=1,
# 125MHz/100MHz for bootstrap
p_CLKOUT1_DIVIDE=divide, p_CLKOUT1_PHASE=0.0, o_CLKOUT1=pll_clkout,
),
Instance("BUFG", i_I=pll_clkout, o_O=self.cd_bootstrap.clk)
]
# The NIST backplanes require setting VADJ to 3.3V by reprogramming the power supply.
# This also changes the I/O standard for some on-board LEDs.
leds_fmc33 = [
("user_led_33", 0, Pins("Y21"), IOStandard("LVCMOS33")),
("user_led_33", 1, Pins("G2"), IOStandard("LVCMOS15")),
("user_led_33", 2, Pins("W21"), IOStandard("LVCMOS33")),
("user_led_33", 3, Pins("A17"), IOStandard("LVCMOS15")),
]
# same deal as with LEDs - changed I/O standard.
si5324_fmc33 = [
("si5324_33", 0,
Subsignal("rst_n", Pins("W23"), IOStandard("LVCMOS33")),
Subsignal("int", Pins("AJ25"), IOStandard("LVCMOS33"))
),
]
pmod1_33 = [
("pmod1_33", 0, Pins("AJ21"), IOStandard("LVCMOS33")),
("pmod1_33", 1, Pins("AK21"), IOStandard("LVCMOS33")),
("pmod1_33", 2, Pins("AB21"), IOStandard("LVCMOS33")),
("pmod1_33", 3, Pins("AB16"), IOStandard("LVCMOS33")),
# rest removed for use with dummy spi
]
_ams101_dac = [
("ams101_dac", 0,
Subsignal("ldac", Pins("XADC:GPIO0")),
Subsignal("clk", Pins("XADC:GPIO1")),
Subsignal("mosi", Pins("XADC:GPIO2")),
Subsignal("cs_n", Pins("XADC:GPIO3")),
IOStandard("LVCMOS15")
)
]
_pmod_spi = [
("pmod_spi", 0,
# PMOD_1 4-7 pins, same bank as sfp_tx_disable or user_sma_clock
Subsignal("miso", Pins("Y20"), IOStandard("LVCMOS25")),
Subsignal("clk", Pins("AA20"), IOStandard("LVCMOS25")),
Subsignal("mosi", Pins("AC18"), IOStandard("LVCMOS25")),
Subsignal("cs_n", Pins("AC19"), IOStandard("LVCMOS25")),
IOStandard("LVCMOS25")
)
]
def prepare_zc706_platform(platform):
platform.toolchain.bitstream_commands.extend([
"set_property BITSTREAM.GENERAL.COMPRESS True [current_design]",
])
class ZC706(SoCCore): class ZC706(SoCCore):
def __init__(self, acpki=False): def __init__(self, acpki=False):
self.acpki = acpki self.acpki = acpki
self.rustc_cfg = dict()
platform = zc706.Platform() platform = zc706.Platform()
platform.toolchain.bitstream_commands.extend([ prepare_zc706_platform(platform)
"set_property BITSTREAM.GENERAL.COMPRESS True [current_design]",
])
ident = self.__class__.__name__ ident = self.__class__.__name__
if self.acpki: if self.acpki:
ident = "acpki_" + ident ident = "acpki_" + ident
SoCCore.__init__(self, platform=platform, csr_data_width=32, ident=ident) SoCCore.__init__(self, platform=platform, csr_data_width=32, ident=ident, ps_cd_sys=False)
platform.add_platform_command("create_clock -name clk_fpga_0 -period 8 [get_pins \"PS7/FCLKCLK[0]\"]") platform.add_extension(si5324_fmc33)
platform.add_platform_command("set_input_jitter clk_fpga_0 0.24") self.comb += platform.request("si5324_33").rst_n.eq(1)
self.submodules.rtio_crg = RTIOCRG(self.platform, self.ps7.cd_sys.clk) cdr_clk = Signal()
self.csr_devices.append("rtio_crg") cdr_clk_buf = Signal()
self.platform.add_period_constraint(self.rtio_crg.cd_rtio.clk, 8.) si5324_out = platform.request("si5324_clkout")
self.platform.add_false_path_constraints( platform.add_period_constraint(si5324_out.p, 8.0)
self.ps7.cd_sys.clk, self.specials += [
self.rtio_crg.cd_rtio.clk) Instance("IBUFDS_GTE2",
i_CEB=0,
i_I=si5324_out.p, i_IB=si5324_out.n,
o_O=cdr_clk,
p_CLKCM_CFG="TRUE",
p_CLKRCV_TRST="TRUE",
p_CLKSWING_CFG=3),
Instance("BUFG", i_I=cdr_clk, o_O=cdr_clk_buf)
]
self.config["HAS_SI5324"] = None
self.config["SI5324_AS_SYNTHESIZER"] = None
self.config["SI5324_SOFT_RESET"] = None
self.submodules.bootstrap = CLK200BootstrapClock(platform)
self.submodules.sys_crg = zynq_clocking.SYSCRG(self.platform, self.ps7, cdr_clk_buf)
platform.add_false_path_constraints(
self.bootstrap.cd_bootstrap.clk, self.sys_crg.cd_sys.clk)
self.csr_devices.append("sys_crg")
def add_rtio(self, rtio_channels): def add_rtio(self, rtio_channels):
self.submodules.rtio_tsc = rtio.TSC("async", glbl_fine_ts_width=3) self.submodules.rtio_tsc = rtio.TSC(glbl_fine_ts_width=3)
self.submodules.rtio_core = rtio.Core(self.rtio_tsc, rtio_channels) self.submodules.rtio_core = rtio.Core(self.rtio_tsc, rtio_channels)
self.csr_devices.append("rtio_core") self.csr_devices.append("rtio_core")
if self.acpki: if self.acpki:
self.rustc_cfg["ki_impl"] = "acp" self.config["KI_IMPL"] = "acp"
self.submodules.rtio = acpki.KernelInitiator(self.rtio_tsc, self.submodules.rtio = acpki.KernelInitiator(self.rtio_tsc,
bus=self.ps7.s_axi_acp, bus=self.ps7.s_axi_acp,
user=self.ps7.s_axi_acp_user, user=self.ps7.s_axi_acp_user,
evento=self.ps7.event.o) evento=self.ps7.event.o)
self.csr_devices.append("rtio") self.csr_devices.append("rtio")
else: else:
self.rustc_cfg["ki_impl"] = "csr" self.config["KI_IMPL"] = "csr"
self.submodules.rtio = rtio.KernelInitiator(self.rtio_tsc, now64=True) self.submodules.rtio = rtio.KernelInitiator(self.rtio_tsc, now64=True)
self.csr_devices.append("rtio") self.csr_devices.append("rtio")
@ -121,52 +195,331 @@ class ZC706(SoCCore):
self.csr_devices.append("rtio_analyzer") self.csr_devices.append("rtio_analyzer")
class Simple(ZC706): class _MasterBase(SoCCore):
def __init__(self, **kwargs): def __init__(self, acpki=False, drtio100mhz=False):
ZC706.__init__(self, **kwargs) self.acpki = acpki
platform = self.platform clk_freq = 100e6 if drtio100mhz else 125e6
rtio_channels = [] platform = zc706.Platform()
for i in range(4): prepare_zc706_platform(platform)
phy = ttl_simple.Output(platform.request("user_led", i)) ident = self.__class__.__name__
self.submodules += phy if self.acpki:
rtio_channels.append(rtio.Channel.from_phy(phy)) ident = "acpki_" + ident
SoCCore.__init__(self, platform=platform, csr_data_width=32, ident=ident, ps_cd_sys=False)
self.config["RTIO_LOG_CHANNEL"] = len(rtio_channels) platform.add_extension(si5324_fmc33)
rtio_channels.append(rtio.LogChannel())
self.add_rtio(rtio_channels) self.comb += platform.request("sfp_tx_disable_n").eq(1)
data_pads = [
platform.request("sfp"),
platform.request("user_sma_mgt")
]
self.submodules += SMAClkinForward(self.platform)
# 1000BASE_BX10 Ethernet compatible, 125MHz RTIO clock
self.submodules.gt_drtio = gtx_7series.GTX(
clock_pads=platform.request("si5324_clkout"),
pads=data_pads,
clk_freq=clk_freq)
self.csr_devices.append("gt_drtio")
self.submodules.rtio_tsc = rtio.TSC(glbl_fine_ts_width=3)
ext_async_rst = Signal()
txout_buf = Signal()
gtx0 = self.gt_drtio.gtxs[0]
self.specials += Instance("BUFG", i_I=gtx0.txoutclk, o_O=txout_buf)
self.submodules.bootstrap = CLK200BootstrapClock(platform, clk_freq)
self.submodules.sys_crg = zynq_clocking.SYSCRG(
self.platform,
self.ps7,
txout_buf,
clk_sw=self.gt_drtio.stable_clkin.storage,
clk_sw_status=gtx0.tx_init.done,
ext_async_rst=ext_async_rst,
freq=clk_freq)
platform.add_false_path_constraints(
self.bootstrap.cd_bootstrap.clk, self.sys_crg.cd_sys.clk)
self.csr_devices.append("sys_crg")
self.comb += ext_async_rst.eq(self.sys_crg.clk_sw_fsm.o_clk_sw & ~gtx0.tx_init.done)
self.specials += MultiReg(self.sys_crg.clk_sw_fsm.o_clk_sw & self.sys_crg.mmcm_locked, self.gt_drtio.clk_path_ready, odomain="bootstrap")
drtio_csr_group = []
drtioaux_csr_group = []
drtioaux_memory_group = []
self.drtio_cri = []
for i in range(len(self.gt_drtio.channels)):
core_name = "drtio" + str(i)
coreaux_name = "drtioaux" + str(i)
memory_name = "drtioaux" + str(i) + "_mem"
drtio_csr_group.append(core_name)
drtioaux_csr_group.append(coreaux_name)
drtioaux_memory_group.append(memory_name)
cdr = ClockDomainsRenamer({"rtio_rx": "rtio_rx" + str(i)})
core = cdr(DRTIOMaster(
self.rtio_tsc, self.gt_drtio.channels[i]))
setattr(self.submodules, core_name, core)
self.drtio_cri.append(core.cri)
self.csr_devices.append(core_name)
coreaux = cdr(drtio_aux_controller.DRTIOAuxControllerBare(core.link_layer))
setattr(self.submodules, coreaux_name, coreaux)
self.csr_devices.append(coreaux_name)
mem_size = coreaux.get_mem_size()
memory_address = self.axi2csr.register_port(coreaux.get_tx_port(), mem_size)
self.axi2csr.register_port(coreaux.get_rx_port(), mem_size)
self.add_memory_region(memory_name, self.mem_map["csr"] + memory_address, mem_size * 2)
self.config["HAS_DRTIO"] = None
self.config["HAS_DRTIO_ROUTING"] = None
self.add_csr_group("drtio", drtio_csr_group)
self.add_csr_group("drtioaux", drtioaux_csr_group)
self.add_memory_group("drtioaux_mem", drtioaux_memory_group)
self.config["RTIO_FREQUENCY"] = str(self.gt_drtio.rtio_clk_freq/1e6)
self.submodules.si5324_rst_n = gpio.GPIOOut(platform.request("si5324_33").rst_n)
self.csr_devices.append("si5324_rst_n")
self.config["HAS_SI5324"] = None
self.config["SI5324_AS_SYNTHESIZER"] = None
# Constrain TX & RX timing for the first transceiver channel
# (First channel acts as master for phase alignment for all channels' TX)
platform.add_false_path_constraints(
gtx0.txoutclk, gtx0.rxoutclk)
# Constrain RX timing for the each transceiver channel
# (Each channel performs single-lane phase alignment for RX)
for gtx in self.gt_drtio.gtxs[1:]:
platform.add_false_path_constraints(
gtx0.txoutclk, gtx.rxoutclk)
fix_serdes_timing_path(platform)
def add_rtio(self, rtio_channels):
self.submodules.rtio_tsc = rtio.TSC(glbl_fine_ts_width=3)
self.submodules.rtio_core = rtio.Core(self.rtio_tsc, rtio_channels)
self.csr_devices.append("rtio_core")
if self.acpki:
self.config["KI_IMPL"] = "acp"
self.submodules.rtio = acpki.KernelInitiator(self.rtio_tsc,
bus=self.ps7.s_axi_acp,
user=self.ps7.s_axi_acp_user,
evento=self.ps7.event.o)
self.csr_devices.append("rtio")
else:
self.config["KI_IMPL"] = "csr"
self.submodules.rtio = rtio.KernelInitiator(self.rtio_tsc, now64=True)
self.csr_devices.append("rtio")
self.submodules.rtio_dma = dma.DMA(self.ps7.s_axi_hp0)
self.csr_devices.append("rtio_dma")
self.submodules.cri_con = rtio.CRIInterconnectShared(
[self.rtio.cri, self.rtio_dma.cri],
[self.rtio_core.cri] + self.drtio_cri,
enable_routing=True)
self.csr_devices.append("cri_con")
self.submodules.rtio_moninj = rtio.MonInj(rtio_channels)
self.csr_devices.append("rtio_moninj")
self.submodules.rtio_analyzer = analyzer.Analyzer(self.rtio_tsc, self.rtio_core.cri,
self.ps7.s_axi_hp1)
self.csr_devices.append("rtio_analyzer")
self.submodules.routing_table = rtio.RoutingTableAccess(self.cri_con)
self.csr_devices.append("routing_table")
# The NIST backplanes require setting VADJ to 3.3V by reprogramming the power supply. class _SatelliteBase(SoCCore):
# This also changes the I/O standard for some on-board LEDs. def __init__(self, acpki=False, drtio100mhz=False):
leds_fmc33 = [ self.acpki = acpki
("user_led_33", 0, Pins("Y21"), IOStandard("LVCMOS33")),
("user_led_33", 1, Pins("G2"), IOStandard("LVCMOS15")), clk_freq = 100e6 if drtio100mhz else 125e6
("user_led_33", 2, Pins("W21"), IOStandard("LVCMOS33")),
("user_led_33", 3, Pins("A17"), IOStandard("LVCMOS15")), platform = zc706.Platform()
] prepare_zc706_platform(platform)
ident = self.__class__.__name__
if self.acpki:
ident = "acpki_" + ident
SoCCore.__init__(self, platform=platform, csr_data_width=32, ident=ident, ps_cd_sys=False)
platform.add_extension(si5324_fmc33)
# SFP
self.comb += platform.request("sfp_tx_disable_n").eq(0)
data_pads = [
platform.request("sfp"),
platform.request("user_sma_mgt")
]
self.submodules.rtio_tsc = rtio.TSC(glbl_fine_ts_width=3)
# 1000BASE_BX10 Ethernet compatible, 125MHz RTIO clock
self.submodules.gt_drtio = gtx_7series.GTX(
clock_pads=platform.request("si5324_clkout"),
pads=data_pads,
clk_freq=clk_freq)
self.csr_devices.append("gt_drtio")
ext_async_rst = Signal()
txout_buf = Signal()
txout_buf.attr.add("keep")
gtx0 = self.gt_drtio.gtxs[0]
self.specials += Instance(
"BUFG",
i_I=gtx0.txoutclk,
o_O=txout_buf)
self.submodules.bootstrap = CLK200BootstrapClock(platform, clk_freq)
self.submodules.sys_crg = zynq_clocking.SYSCRG(
self.platform,
self.ps7,
txout_buf,
clk_sw=self.gt_drtio.stable_clkin.storage,
clk_sw_status=gtx0.tx_init.done,
ext_async_rst=ext_async_rst,
freq=clk_freq)
platform.add_false_path_constraints(
self.bootstrap.cd_bootstrap.clk, self.sys_crg.cd_sys.clk)
self.csr_devices.append("sys_crg")
self.comb += ext_async_rst.eq(self.sys_crg.clk_sw_fsm.o_clk_sw & ~gtx0.tx_init.done)
self.specials += MultiReg(self.sys_crg.clk_sw_fsm.o_clk_sw & self.sys_crg.mmcm_locked, self.gt_drtio.clk_path_ready, odomain="bootstrap")
drtioaux_csr_group = []
drtioaux_memory_group = []
drtiorep_csr_group = []
self.drtio_cri = []
for i in range(len(self.gt_drtio.channels)):
coreaux_name = "drtioaux" + str(i)
memory_name = "drtioaux" + str(i) + "_mem"
drtioaux_csr_group.append(coreaux_name)
drtioaux_memory_group.append(memory_name)
cdr = ClockDomainsRenamer({"rtio_rx": "rtio_rx" + str(i)})
# Satellite
if i == 0:
self.submodules.rx_synchronizer = cdr(XilinxRXSynchronizer())
core = cdr(DRTIOSatellite(
self.rtio_tsc, self.gt_drtio.channels[0], self.rx_synchronizer))
self.submodules.drtiosat = core
self.csr_devices.append("drtiosat")
# Repeaters
else:
corerep_name = "drtiorep" + str(i-1)
drtiorep_csr_group.append(corerep_name)
core = cdr(DRTIORepeater(
self.rtio_tsc, self.gt_drtio.channels[i]))
setattr(self.submodules, corerep_name, core)
self.drtio_cri.append(core.cri)
self.csr_devices.append(corerep_name)
coreaux = cdr(drtio_aux_controller.DRTIOAuxControllerBare(core.link_layer))
setattr(self.submodules, coreaux_name, coreaux)
self.csr_devices.append(coreaux_name)
mem_size = coreaux.get_mem_size()
tx_port = coreaux.get_tx_port()
rx_port = coreaux.get_rx_port()
memory_address = self.axi2csr.register_port(tx_port, mem_size)
# rcv in upper half of the memory, thus added second
self.axi2csr.register_port(rx_port, mem_size)
# and registered in PS interface
# manually, because software refers to rx/tx by halves of entire memory block, not names
self.add_memory_region(memory_name, self.mem_map["csr"] + memory_address, mem_size * 2)
self.config["HAS_DRTIO"] = None
self.config["HAS_DRTIO_ROUTING"] = None
self.add_csr_group("drtioaux", drtioaux_csr_group)
self.add_csr_group("drtiorep", drtiorep_csr_group)
self.add_memory_group("drtioaux_mem", drtioaux_memory_group)
self.config["RTIO_FREQUENCY"] = str(self.gt_drtio.rtio_clk_freq/1e6)
# Si5324 Phaser
self.submodules.siphaser = SiPhaser7Series(
si5324_clkin=platform.request("si5324_clkin"),
rx_synchronizer=self.rx_synchronizer,
ultrascale=False,
rtio_clk_freq=self.gt_drtio.rtio_clk_freq)
platform.add_false_path_constraints(
self.sys_crg.cd_sys.clk, self.siphaser.mmcm_freerun_output)
self.csr_devices.append("siphaser")
self.submodules.si5324_rst_n = gpio.GPIOOut(platform.request("si5324_33").rst_n)
self.csr_devices.append("si5324_rst_n")
self.config["HAS_SI5324"] = None
rtio_clk_period = 1e9/self.gt_drtio.rtio_clk_freq
# Constrain TX & RX timing for the first transceiver channel
# (First channel acts as master for phase alignment for all channels' TX)
platform.add_false_path_constraints(
gtx0.txoutclk, gtx0.rxoutclk)
# Constrain RX timing for the each transceiver channel
# (Each channel performs single-lane phase alignment for RX)
for gtx in self.gt_drtio.gtxs[1:]:
platform.add_false_path_constraints(
self.sys_crg.cd_sys.clk, gtx.rxoutclk)
fix_serdes_timing_path(platform)
def add_rtio(self, rtio_channels):
self.submodules.rtio_moninj = rtio.MonInj(rtio_channels)
self.csr_devices.append("rtio_moninj")
if self.acpki:
self.config["KI_IMPL"] = "acp"
self.submodules.rtio = acpki.KernelInitiator(self.rtio_tsc,
bus=self.ps7.s_axi_acp,
user=self.ps7.s_axi_acp_user,
evento=self.ps7.event.o)
self.csr_devices.append("rtio")
else:
self.config["KI_IMPL"] = "csr"
self.submodules.rtio = rtio.KernelInitiator(self.rtio_tsc, now64=True)
self.csr_devices.append("rtio")
self.submodules.rtio_dma = dma.DMA(self.ps7.s_axi_hp0)
self.csr_devices.append("rtio_dma")
self.submodules.local_io = SyncRTIO(self.rtio_tsc, rtio_channels)
self.comb += [
self.drtiosat.async_errors.eq(self.local_io.async_errors),
self.local_io.sed_spread_enable.eq(self.drtiosat.sed_spread_enable.storage)
]
self.submodules.cri_con = rtio.CRIInterconnectShared(
[self.drtiosat.cri, self.rtio_dma.cri, self.rtio.cri],
[self.local_io.cri] + self.drtio_cri,
enable_routing=True)
self.csr_devices.append("cri_con")
self.submodules.rtio_analyzer = analyzer.Analyzer(self.rtio_tsc, self.local_io.cri,
self.ps7.s_axi_hp1)
self.csr_devices.append("rtio_analyzer")
self.submodules.routing_table = rtio.RoutingTableAccess(self.cri_con)
self.csr_devices.append("routing_table")
class NIST_CLOCK(ZC706):
class _NIST_CLOCK_RTIO:
""" """
NIST clock hardware, with old backplane and 11 DDS channels NIST clock hardware, with old backplane and 11 DDS channels
""" """
def __init__(self, **kwargs): def __init__(self):
ZC706.__init__(self, **kwargs)
platform = self.platform platform = self.platform
platform.add_extension(nist_clock.fmc_adapter_io) platform.add_extension(nist_clock.fmc_adapter_io)
platform.add_extension(leds_fmc33) platform.add_extension(leds_fmc33)
platform.add_extension(pmod1_33)
platform.add_extension(_ams101_dac)
platform.add_extension(_pmod_spi)
rtio_channels = [] rtio_channels = []
for i in range(4):
phy = ttl_simple.Output(platform.request("user_led_33", i))
self.submodules += phy
rtio_channels.append(rtio.Channel.from_phy(phy))
for i in range(16): for i in range(16):
if i % 4 == 3: if i % 4 == 3:
phy = ttl_serdes_7series.InOut_8X(platform.request("ttl", i)) phy = ttl_serdes_7series.InOut_8X(platform.request("ttl", i))
@ -182,16 +535,40 @@ class NIST_CLOCK(ZC706):
self.submodules += phy self.submodules += phy
rtio_channels.append(rtio.Channel.from_phy(phy, ififo_depth=512)) rtio_channels.append(rtio.Channel.from_phy(phy, ififo_depth=512))
# no SMA GPIO, replaced with PMOD1_0
phy = ttl_serdes_7series.InOut_8X(platform.request("pmod1_33", 0))
self.submodules += phy
rtio_channels.append(rtio.Channel.from_phy(phy, ififo_depth=512))
phy = ttl_simple.Output(platform.request("user_led_33", 0))
self.submodules += phy
rtio_channels.append(rtio.Channel.from_phy(phy))
ams101_dac = self.platform.request("ams101_dac", 0)
phy = ttl_simple.Output(ams101_dac.ldac)
self.submodules += phy
rtio_channels.append(rtio.Channel.from_phy(phy))
phy = ttl_simple.ClockGen(platform.request("la32_p")) phy = ttl_simple.ClockGen(platform.request("la32_p"))
self.submodules += phy self.submodules += phy
rtio_channels.append(rtio.Channel.from_phy(phy)) rtio_channels.append(rtio.Channel.from_phy(phy))
phy = spi2.SPIMaster(ams101_dac)
self.submodules += phy
rtio_channels.append(rtio.Channel.from_phy(
phy, ififo_depth=4))
for i in range(3): for i in range(3):
phy = spi2.SPIMaster(self.platform.request("spi", i)) phy = spi2.SPIMaster(self.platform.request("spi", i))
self.submodules += phy self.submodules += phy
rtio_channels.append(rtio.Channel.from_phy( rtio_channels.append(rtio.Channel.from_phy(
phy, ififo_depth=128)) phy, ififo_depth=128))
# no SDIO on PL side, dummy SPI placeholder instead
phy = spi2.SPIMaster(platform.request("pmod_spi"))
self.submodules += phy
rtio_channels.append(rtio.Channel.from_phy(phy, ififo_depth=4))
phy = dds.AD9914(platform.request("dds"), 11, onehot=True) phy = dds.AD9914(platform.request("dds"), 11, onehot=True)
self.submodules += phy self.submodules += phy
rtio_channels.append(rtio.Channel.from_phy(phy, ififo_depth=4)) rtio_channels.append(rtio.Channel.from_phy(phy, ififo_depth=4))
@ -202,30 +579,43 @@ class NIST_CLOCK(ZC706):
self.add_rtio(rtio_channels) self.add_rtio(rtio_channels)
class NIST_QC2(ZC706): class _NIST_QC2_RTIO:
""" """
NIST QC2 hardware, as used in Quantum I and Quantum II, with new backplane NIST QC2 hardware, as used in Quantum I and Quantum II, with new backplane
and 24 DDS channels. Two backplanes are used. and 24 DDS channels. Two backplanes are used.
""" """
def __init__(self, **kwargs): def __init__(self):
ZC706.__init__(self, **kwargs)
platform = self.platform platform = self.platform
platform.add_extension(nist_qc2.fmc_adapter_io) platform.add_extension(nist_qc2.fmc_adapter_io)
platform.add_extension(leds_fmc33) platform.add_extension(leds_fmc33)
platform.add_extension(_ams101_dac)
platform.add_extension(pmod1_33)
rtio_channels = [] rtio_channels = []
edge_counter_phy = []
for i in range(4):
phy = ttl_simple.Output(platform.request("user_led_33", i))
self.submodules += phy
rtio_channels.append(rtio.Channel.from_phy(phy))
# All TTL channels are In+Out capable # All TTL channels are In+Out capable
for i in range(40): for i in range(40):
phy = ttl_serdes_7series.InOut_8X(platform.request("ttl", i)) phy = ttl_serdes_7series.InOut_8X(platform.request("ttl", i))
self.submodules += phy self.submodules += phy
rtio_channels.append(rtio.Channel.from_phy(phy, ififo_depth=512)) rtio_channels.append(rtio.Channel.from_phy(phy, ififo_depth=512))
# first four TTLs will also have edge counters
if i < 4:
edge_counter_phy.append(phy)
# no SMA GPIO, replaced with PMOD1_0
phy = ttl_serdes_7series.InOut_8X(platform.request("pmod1_33", 0))
self.submodules += phy
rtio_channels.append(rtio.Channel.from_phy(phy, ififo_depth=512))
phy = ttl_simple.Output(platform.request("user_led_33", 0))
self.submodules += phy
rtio_channels.append(rtio.Channel.from_phy(phy))
ams101_dac = self.platform.request("ams101_dac", 0)
phy = ttl_simple.Output(ams101_dac.ldac)
self.submodules += phy
rtio_channels.append(rtio.Channel.from_phy(phy))
# CLK0, CLK1 are for clock generators, on backplane SMP connectors # CLK0, CLK1 are for clock generators, on backplane SMP connectors
for i in range(2): for i in range(2):
@ -234,6 +624,11 @@ class NIST_QC2(ZC706):
self.submodules += phy self.submodules += phy
rtio_channels.append(rtio.Channel.from_phy(phy)) rtio_channels.append(rtio.Channel.from_phy(phy))
phy = spi2.SPIMaster(ams101_dac)
self.submodules += phy
rtio_channels.append(rtio.Channel.from_phy(
phy, ififo_depth=4))
for i in range(4): for i in range(4):
phy = spi2.SPIMaster(self.platform.request("spi", i)) phy = spi2.SPIMaster(self.platform.request("spi", i))
self.submodules += phy self.submodules += phy
@ -246,42 +641,66 @@ class NIST_QC2(ZC706):
self.submodules += phy self.submodules += phy
rtio_channels.append(rtio.Channel.from_phy(phy, ififo_depth=4)) rtio_channels.append(rtio.Channel.from_phy(phy, ififo_depth=4))
for phy in edge_counter_phy:
counter = edge_counter.SimpleEdgeCounter(phy.input_state)
self.submodules += counter
rtio_channels.append(rtio.Channel.from_phy(counter))
self.config["RTIO_LOG_CHANNEL"] = len(rtio_channels) self.config["RTIO_LOG_CHANNEL"] = len(rtio_channels)
rtio_channels.append(rtio.LogChannel()) rtio_channels.append(rtio.LogChannel())
self.add_rtio(rtio_channels) self.add_rtio(rtio_channels)
VARIANTS = {cls.__name__.lower(): cls for cls in [Simple, NIST_CLOCK, NIST_QC2]} class NIST_CLOCK(ZC706, _NIST_CLOCK_RTIO):
def __init__(self, acpki, drtio100mhz):
ZC706.__init__(self, acpki)
self.submodules += SMAClkinForward(self.platform)
_NIST_CLOCK_RTIO.__init__(self)
class NIST_CLOCK_Master(_MasterBase, _NIST_CLOCK_RTIO):
def __init__(self, acpki, drtio100mhz):
_MasterBase.__init__(self, acpki, drtio100mhz)
_NIST_CLOCK_RTIO.__init__(self)
def write_csr_file(soc, filename): class NIST_CLOCK_Satellite(_SatelliteBase, _NIST_CLOCK_RTIO):
with open(filename, "w") as f: def __init__(self, acpki, drtio100mhz):
f.write(cpu_interface.get_csr_rust( _SatelliteBase.__init__(self, acpki, drtio100mhz)
soc.get_csr_regions(), soc.get_csr_groups(), soc.get_constants())) _NIST_CLOCK_RTIO.__init__(self)
class NIST_QC2(ZC706, _NIST_QC2_RTIO):
def __init__(self, acpki, drtio100mhz):
ZC706.__init__(self, acpki)
self.submodules += SMAClkinForward(self.platform)
_NIST_QC2_RTIO.__init__(self)
def write_rustc_cfg_file(soc, filename): class NIST_QC2_Master(_MasterBase, _NIST_QC2_RTIO):
with open(filename, "w") as f: def __init__(self, acpki, drtio100mhz):
for k, v in sorted(soc.rustc_cfg.items(), key=itemgetter(0)): _MasterBase.__init__(self, acpki, drtio100mhz)
if v is None: _NIST_QC2_RTIO.__init__(self)
f.write("{}\n".format(k))
else:
f.write("{}=\"{}\"\n".format(k, v))
class NIST_QC2_Satellite(_SatelliteBase, _NIST_QC2_RTIO):
def __init__(self, acpki, drtio100mhz):
_SatelliteBase.__init__(self, acpki, drtio100mhz)
_NIST_QC2_RTIO.__init__(self)
VARIANTS = {cls.__name__.lower(): cls for cls in [NIST_CLOCK, NIST_CLOCK_Master, NIST_CLOCK_Satellite,
NIST_QC2, NIST_QC2_Master, NIST_QC2_Satellite]}
def main(): def main():
parser = argparse.ArgumentParser( parser = argparse.ArgumentParser(
description="ARTIQ port to the ZC706 Zynq development kit") description="ARTIQ port to the ZC706 Zynq development kit")
parser.add_argument("-r", default=None, parser.add_argument("-r", default=None,
help="build Rust interface into the specified file") help="build Rust interface into the specified file")
parser.add_argument("-m", default=None,
help="build Rust memory interface into the specified file")
parser.add_argument("-c", default=None, parser.add_argument("-c", default=None,
help="build Rust compiler configuration into the specified file") help="build Rust compiler configuration into the specified file")
parser.add_argument("-g", default=None, parser.add_argument("-g", default=None,
help="build gateware into the specified directory") help="build gateware into the specified directory")
parser.add_argument("-V", "--variant", default="simple", parser.add_argument("-V", "--variant", default="nist_clock",
help="variant: " help="variant: "
"[acpki_]simple/nist_clock/nist_qc2 " "[acpki_]nist_clock/nist_qc2[_master/_satellite][_100mhz]"
"(default: %(default)s)") "(default: %(default)s)")
args = parser.parse_args() args = parser.parse_args()
@ -289,21 +708,25 @@ def main():
acpki = variant.startswith("acpki_") acpki = variant.startswith("acpki_")
if acpki: if acpki:
variant = variant[6:] variant = variant[6:]
drtio100mhz = variant.endswith("_100mhz")
if drtio100mhz:
variant = variant[:-7]
try: try:
cls = VARIANTS[variant] cls = VARIANTS[variant]
except KeyError: except KeyError:
raise SystemExit("Invalid variant (-V/--variant)") raise SystemExit("Invalid variant (-V/--variant)")
soc = cls(acpki=acpki) soc = cls(acpki=acpki, drtio100mhz=drtio100mhz)
soc.finalize() soc.finalize()
if args.r is not None: if args.r is not None:
write_csr_file(soc, args.r) write_csr_file(soc, args.r)
if args.m is not None:
write_mem_file(soc, args.m)
if args.c is not None: if args.c is not None:
write_rustc_cfg_file(soc, args.c) write_rustc_cfg_file(soc, args.c)
if args.g is not None: if args.g is not None:
soc.build(build_dir=args.g) soc.build(build_dir=args.g)
if __name__ == "__main__": if __name__ == "__main__":
main() main()

View File

@ -0,0 +1,154 @@
from migen import *
from migen.genlib.cdc import MultiReg
from migen.genlib.resetsync import AsyncResetSynchronizer
from misoc.interconnect.csr import *
class ClockSwitchFSM(Module):
def __init__(self):
self.i_clk_sw = Signal()
self.o_clk_sw = Signal()
self.o_reset = Signal()
###
i_switch = Signal()
o_switch = Signal()
reset = Signal()
# at 125MHz bootstrap cd, will get around 0.5ms
delay_counter = Signal(16, reset=0xFFFF)
# register to prevent glitches
self.sync.bootstrap += [
self.o_clk_sw.eq(o_switch),
self.o_reset.eq(reset),
]
self.o_clk_sw.attr.add("no_retiming")
self.o_reset.attr.add("no_retiming")
self.i_clk_sw.attr.add("no_retiming")
i_switch.attr.add("no_retiming")
self.specials += MultiReg(self.i_clk_sw, i_switch, "bootstrap")
fsm = ClockDomainsRenamer("bootstrap")(FSM(reset_state="START"))
self.submodules += fsm
fsm.act("START",
If(i_switch & ~o_switch,
NextState("RESET_START"))
)
fsm.act("RESET_START",
reset.eq(1),
If(delay_counter == 0,
NextValue(delay_counter, 0xFFFF),
NextState("CLOCK_SWITCH")
).Else(
NextValue(delay_counter, delay_counter-1),
)
)
fsm.act("CLOCK_SWITCH",
reset.eq(1),
NextValue(o_switch, 1),
NextValue(delay_counter, delay_counter-1),
If(delay_counter == 0,
NextState("END"))
)
fsm.act("END",
NextValue(o_switch, 1),
reset.eq(0))
class SYSCRG(Module, AutoCSR):
def __init__(self, platform, ps7, main_clk, clk_sw=None, clk_sw_status=None, freq=125e6, ext_async_rst=None, ):
# assumes bootstrap clock is same freq as main and sys output
self.clock_domains.cd_sys = ClockDomain()
self.clock_domains.cd_sys4x = ClockDomain(reset_less=True)
self.clock_domains.cd_sys5x = ClockDomain(reset_less=True)
self.clock_domains.cd_clk200 = ClockDomain()
self.current_clock = CSRStatus()
self.cd_sys.clk.attr.add("keep")
bootstrap_clk = ClockSignal("bootstrap")
period = 1e9/freq
self.submodules.clk_sw_fsm = ClockSwitchFSM()
if clk_sw is None:
self.clock_switch = CSRStorage()
self.comb += self.clk_sw_fsm.i_clk_sw.eq(self.clock_switch.storage)
else:
self.comb += self.clk_sw_fsm.i_clk_sw.eq(clk_sw)
self.mmcm_locked = Signal()
mmcm_sys = Signal()
mmcm_sys4x = Signal()
mmcm_sys5x = Signal()
mmcm_clk208 = Signal()
mmcm_fb_clk = Signal()
self.specials += [
Instance("MMCME2_ADV",
p_STARTUP_WAIT="FALSE", o_LOCKED=self.mmcm_locked,
p_BANDWIDTH="HIGH",
p_REF_JITTER1=0.001,
p_CLKIN1_PERIOD=period, i_CLKIN1=main_clk,
p_CLKIN2_PERIOD=period, i_CLKIN2=bootstrap_clk,
i_CLKINSEL=self.clk_sw_fsm.o_clk_sw,
# VCO @ 1.25GHz
p_CLKFBOUT_MULT_F=10, p_DIVCLK_DIVIDE=1,
i_CLKFBIN=mmcm_fb_clk,
i_RST=self.clk_sw_fsm.o_reset,
o_CLKFBOUT=mmcm_fb_clk,
p_CLKOUT0_DIVIDE_F=2.5, p_CLKOUT0_PHASE=0.0, o_CLKOUT0=mmcm_sys4x,
# 125MHz
p_CLKOUT1_DIVIDE=10, p_CLKOUT1_PHASE=0.0, o_CLKOUT1=mmcm_sys,
# 625MHz
p_CLKOUT2_DIVIDE=2, p_CLKOUT2_PHASE=0.0, o_CLKOUT2=mmcm_sys5x,
# 208MHz
p_CLKOUT3_DIVIDE=6, p_CLKOUT3_PHASE=0.0, o_CLKOUT3=mmcm_clk208,
),
Instance("BUFG", i_I=mmcm_sys5x, o_O=self.cd_sys5x.clk),
Instance("BUFG", i_I=mmcm_sys, o_O=self.cd_sys.clk),
Instance("BUFG", i_I=mmcm_sys4x, o_O=self.cd_sys4x.clk),
Instance("BUFG", i_I=mmcm_clk208, o_O=self.cd_clk200.clk),
]
if ext_async_rst is not None:
self.specials += [
AsyncResetSynchronizer(self.cd_sys, ~self.mmcm_locked | ext_async_rst),
AsyncResetSynchronizer(self.cd_clk200, ~self.mmcm_locked | ext_async_rst),
]
else:
self.specials += [
AsyncResetSynchronizer(self.cd_sys, ~self.mmcm_locked),
AsyncResetSynchronizer(self.cd_clk200, ~self.mmcm_locked),
]
reset_counter = Signal(4, reset=15)
ic_reset = Signal(reset=1)
self.sync.clk200 += \
If(reset_counter != 0,
reset_counter.eq(reset_counter - 1)
).Else(
ic_reset.eq(0)
)
self.specials += Instance("IDELAYCTRL", i_REFCLK=ClockSignal("clk200"), i_RST=ic_reset)
if clk_sw_status is None:
self.comb += self.current_clock.status.eq(self.clk_sw_fsm.o_clk_sw)
else:
self.comb += self.current_clock.status.eq(clk_sw_status)

View File

@ -0,0 +1,34 @@
[package]
name = "libboard_artiq"
version = "0.0.0"
authors = ["M-Labs"]
edition = "2018"
[lib]
name = "libboard_artiq"
[features]
target_zc706 = ["libboard_zynq/target_zc706", "libconfig/target_zc706"]
target_kasli_soc = ["libboard_zynq/target_kasli_soc", "libconfig/target_kasli_soc"]
target_ebaz4205 = ["libboard_zynq/target_ebaz4205", "libconfig/target_ebaz4205"]
calibrate_wrpll_skew = []
[build-dependencies]
build_zynq = { path = "../libbuild_zynq" }
[dependencies]
log = "0.4"
log_buffer = { version = "1.2" }
crc = { version = "1.7", default-features = false }
core_io = { version = "0.1", features = ["collections"] }
embedded-hal = "0.2"
nb = "1.0"
void = { version = "1", default-features = false }
io = { path = "../libio", features = ["byteorder"] }
libboard_zynq = { path = "@@ZYNQ_RS@@/libboard_zynq" }
libsupport_zynq = { path = "@@ZYNQ_RS@@/libsupport_zynq", default-features = false, features = ["alloc_core"] }
libregister = { path = "@@ZYNQ_RS@@/libregister" }
libconfig = { path = "@@ZYNQ_RS@@/libconfig", features = ["fat_lfn"] }
libcortex_a9 = { path = "@@ZYNQ_RS@@/libcortex_a9" }
libasync = { path = "@@ZYNQ_RS@@/libasync" }

View File

@ -0,0 +1,5 @@
extern crate build_zynq;
fn main() {
build_zynq::cfg();
}

View File

@ -0,0 +1,245 @@
use embedded_hal::prelude::_embedded_hal_blocking_delay_DelayUs;
use libboard_zynq::timer::GlobalTimer;
use libconfig::Config;
use libsupport_zynq::alloc::format;
use log::{debug, error, info};
use crate::pl;
struct SerdesConfig {
pub delay: [u8; 4],
}
impl SerdesConfig {
pub fn as_bytes(&self) -> &[u8] {
unsafe {
core::slice::from_raw_parts(
(self as *const SerdesConfig) as *const u8,
core::mem::size_of::<SerdesConfig>(),
)
}
}
}
fn select_lane(lane_no: u8) {
unsafe {
pl::csr::eem_transceiver::lane_sel_write(lane_no);
}
}
fn apply_delay(tap: u8, timer: &mut GlobalTimer) {
unsafe {
pl::csr::eem_transceiver::dly_cnt_in_write(tap);
pl::csr::eem_transceiver::dly_ld_write(1);
timer.delay_us(1);
assert!(tap as u8 == pl::csr::eem_transceiver::dly_cnt_out_read());
}
}
fn apply_config(config: &SerdesConfig, timer: &mut GlobalTimer) {
for lane_no in 0..4 {
select_lane(lane_no as u8);
apply_delay(config.delay[lane_no], timer);
}
}
unsafe fn assign_delay(timer: &mut GlobalTimer) -> SerdesConfig {
// Select an appropriate delay for lane 0
select_lane(0);
//
let mut best_dly = None;
loop {
let mut prev = None;
for curr_dly in 0..32 {
//let read_align = read_align_fn(curr_dly, timer);
let curr_low_rate = read_align(curr_dly, timer);
if let Some(prev_low_rate) = prev {
// This is potentially a crossover position
if prev_low_rate <= curr_low_rate && curr_low_rate >= 0.5 {
let prev_dev = 0.5 - prev_low_rate;
let curr_dev = curr_low_rate - 0.5;
let selected_idx = if prev_dev < curr_dev { curr_dly - 1 } else { curr_dly };
// The setup setup/hold calibration timing (even with
// tolerance) might be invalid in other lanes due to skew.
// 5 taps is very conservative, generally it is 1 or 2
if selected_idx < 5 {
prev = None;
continue;
} else {
best_dly = Some(selected_idx);
break;
}
}
}
// Only rising slope from <= 0.5 can result in a rising low rate
// crossover at 50%.
if curr_low_rate <= 0.5 {
prev = Some(curr_low_rate);
}
}
if best_dly.is_none() {
error!("setup/hold timing calibration failed, retry in 1s...");
timer.delay_us(1_000_000);
} else {
break;
}
}
let best_dly = best_dly.unwrap();
apply_delay(best_dly, timer);
let mut delay_list = [best_dly; 4];
// Assign delay for other lanes
for lane_no in 1..=3 {
select_lane(lane_no as u8);
let mut min_deviation = 0.5;
let mut min_idx = 0;
for dly_delta in -3..=3 {
let index = (best_dly as isize + dly_delta) as u8;
let low_rate = read_align(index, timer);
// abs() from f32 is not available in core library
let deviation = if low_rate < 0.5 { 0.5 - low_rate } else { low_rate - 0.5 };
if deviation < min_deviation {
min_deviation = deviation;
min_idx = index;
}
}
apply_delay(min_idx, timer);
delay_list[lane_no] = min_idx;
}
debug!("setup/hold timing calibration: {:?}", delay_list);
SerdesConfig { delay: delay_list }
}
fn read_align(dly: u8, timer: &mut GlobalTimer) -> f32 {
unsafe {
apply_delay(dly, timer);
pl::csr::eem_transceiver::counter_reset_write(1);
pl::csr::eem_transceiver::counter_enable_write(1);
timer.delay_us(2000);
pl::csr::eem_transceiver::counter_enable_write(0);
let (high, low) = (
pl::csr::eem_transceiver::counter_high_count_read(),
pl::csr::eem_transceiver::counter_low_count_read(),
);
if pl::csr::eem_transceiver::counter_overflow_read() == 1 {
panic!("Unexpected phase detector counter overflow");
}
low as f32 / (low + high) as f32
}
}
unsafe fn align_comma(timer: &mut GlobalTimer) {
loop {
for slip in 1..=10 {
// The soft transceiver has 2 8b10b decoders, which receives lane
// 0/1 and lane 2/3 respectively. The decoder are time-multiplexed
// to decode exactly 1 lane each sysclk cycle.
//
// The decoder decodes lane 0/2 data on odd sysclk cycles, buffer
// on even cycles, and vice versa for lane 1/3. Data/Clock latency
// could change timing. The extend bit flips the decoding timing,
// so lane 0/2 data are decoded on even cycles, and lane 1/3 data
// are decoded on odd cycles.
//
// This is needed because transmitting/receiving a 8b10b character
// takes 2 sysclk cycles. Adjusting bitslip only via ISERDES
// limits the range to 1 cycle. The wordslip bit extends the range
// to 2 sysclk cycles.
pl::csr::eem_transceiver::wordslip_write((slip > 5) as u8);
// Apply a double bitslip since the ISERDES is 2x oversampled.
// Bitslip is used for comma alignment purposes once setup/hold
// timing is met.
pl::csr::eem_transceiver::bitslip_write(1);
pl::csr::eem_transceiver::bitslip_write(1);
timer.delay_us(1);
pl::csr::eem_transceiver::comma_align_reset_write(1);
timer.delay_us(100);
if pl::csr::eem_transceiver::comma_read() == 1 {
debug!("comma alignment completed after {} bitslips", slip);
return;
}
}
error!("comma alignment failed, retrying in 1s...");
timer.delay_us(1_000_000);
}
}
pub unsafe fn align_wordslip(timer: &mut GlobalTimer, trx_no: u8) -> bool {
pl::csr::eem_transceiver::transceiver_sel_write(trx_no);
for slip in 0..=1 {
pl::csr::eem_transceiver::wordslip_write(slip as u8);
timer.delay_us(1);
pl::csr::eem_transceiver::comma_align_reset_write(1);
timer.delay_us(100);
if pl::csr::eem_transceiver::comma_read() == 1 {
debug!("comma alignment completed with {} wordslip", slip);
return true;
}
}
false
}
pub fn init(timer: &mut GlobalTimer, cfg: &Config) {
for trx_no in 0..pl::csr::CONFIG_EEM_DRTIO_COUNT {
unsafe {
pl::csr::eem_transceiver::transceiver_sel_write(trx_no as u8);
}
let key = format!("eem_drtio_delay{}", trx_no);
let cfg_read = cfg.read(&key);
match cfg_read {
Ok(record) => {
info!("loading calibrated timing values from sd card");
unsafe {
apply_config(&*(record.as_ptr() as *const SerdesConfig), timer);
}
}
Err(_) => {
info!("calibrating...");
let config = unsafe { assign_delay(timer) };
match cfg.write(&key, config.as_bytes().to_vec()) {
Ok(()) => {
info!("storing calibration timing values into sd card");
}
Err(e) => {
error!(
"calibration successful but calibration timing values cannot be stored into sd card. \
Error:{}",
e
);
}
};
}
}
unsafe {
align_comma(timer);
}
}
}

View File

@ -0,0 +1,107 @@
use core::fmt;
use libconfig::Config;
use log::{info, warn};
#[cfg(has_drtio_routing)]
use crate::pl::csr;
#[cfg(has_drtio_routing)]
pub const DEST_COUNT: usize = 256;
#[cfg(not(has_drtio_routing))]
pub const DEST_COUNT: usize = 0;
pub const MAX_HOPS: usize = 32;
pub const INVALID_HOP: u8 = 0xff;
pub struct RoutingTable(pub [[u8; MAX_HOPS]; DEST_COUNT]);
impl RoutingTable {
// default routing table is for star topology with no repeaters
pub fn default_master(default_n_links: usize) -> RoutingTable {
let mut ret = RoutingTable([[INVALID_HOP; MAX_HOPS]; DEST_COUNT]);
let n_entries = default_n_links + 1; // include local RTIO
for i in 0..n_entries {
ret.0[i][0] = i as u8;
}
for i in 1..n_entries {
ret.0[i][1] = 0x00;
}
ret
}
// use this by default on satellite, as they receive
// the routing table from the master
pub fn default_empty() -> RoutingTable {
RoutingTable([[INVALID_HOP; MAX_HOPS]; DEST_COUNT])
}
}
impl fmt::Display for RoutingTable {
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
write!(f, "RoutingTable {{")?;
for i in 0..DEST_COUNT {
if self.0[i][0] != INVALID_HOP {
write!(f, " {}:", i)?;
for j in 0..MAX_HOPS {
if self.0[i][j] == INVALID_HOP {
break;
}
write!(f, " {}", self.0[i][j])?;
}
write!(f, ";")?;
}
}
write!(f, " }}")?;
Ok(())
}
}
pub fn config_routing_table(default_n_links: usize, cfg: &Config) -> RoutingTable {
let mut ret = RoutingTable::default_master(default_n_links);
if let Ok(data) = cfg.read("routing_table") {
if data.len() == DEST_COUNT * MAX_HOPS {
for i in 0..DEST_COUNT {
for j in 0..MAX_HOPS {
ret.0[i][j] = data[i * MAX_HOPS + j];
}
}
} else {
warn!("length of the configured routing table is incorrect, using default");
}
} else {
info!("could not read routing table from configuration, using default");
}
info!("routing table: {}", ret);
ret
}
#[cfg(has_drtio_routing)]
pub fn interconnect_enable(routing_table: &RoutingTable, rank: u8, destination: u8) {
let hop = routing_table.0[destination as usize][rank as usize];
unsafe {
csr::routing_table::destination_write(destination);
csr::routing_table::hop_write(hop);
}
}
#[cfg(has_drtio_routing)]
pub fn interconnect_disable(destination: u8) {
unsafe {
csr::routing_table::destination_write(destination);
csr::routing_table::hop_write(INVALID_HOP);
}
}
#[cfg(has_drtio_routing)]
pub fn interconnect_enable_all(routing_table: &RoutingTable, rank: u8) {
for i in 0..DEST_COUNT {
interconnect_enable(routing_table, rank, i as u8);
}
}
#[cfg(has_drtio_routing)]
pub fn interconnect_disable_all() {
for i in 0..DEST_COUNT {
interconnect_disable(i as u8);
}
}

View File

@ -0,0 +1,142 @@
use core::slice;
use core_io::{Error as IoError, ErrorKind as IoErrorKind};
use crc;
use io::{proto::{ProtoRead, ProtoWrite},
Cursor};
use libboard_zynq::{time::Milliseconds, timer::GlobalTimer};
pub use crate::drtioaux_proto::Packet;
use crate::{drtioaux_proto::Error as ProtocolError, mem::mem::DRTIOAUX_MEM, pl::csr::DRTIOAUX};
#[derive(Debug)]
pub enum Error {
GatewareError,
CorruptedPacket,
LinkDown,
TimedOut,
UnexpectedReply,
RoutingError,
Protocol(ProtocolError),
}
impl From<ProtocolError> for Error {
fn from(value: ProtocolError) -> Error {
Error::Protocol(value)
}
}
impl From<IoError> for Error {
fn from(value: IoError) -> Error {
Error::Protocol(ProtocolError::Io(value))
}
}
pub fn reset(linkno: u8) {
let linkno = linkno as usize;
unsafe {
// clear buffer first to limit race window with buffer overflow
// error. We assume the CPU is fast enough so that no two packets
// will be received between the buffer and the error flag are cleared.
(DRTIOAUX[linkno].aux_rx_present_write)(1);
(DRTIOAUX[linkno].aux_rx_error_write)(1);
}
}
pub fn has_rx_error(linkno: u8) -> bool {
let linkno = linkno as usize;
unsafe {
let error = (DRTIOAUX[linkno].aux_rx_error_read)() != 0;
if error {
(DRTIOAUX[linkno].aux_rx_error_write)(1)
}
error
}
}
fn receive<F, T>(linkno: u8, f: F) -> Result<Option<T>, Error>
where F: FnOnce(&[u8]) -> Result<T, Error> {
let linkidx = linkno as usize;
unsafe {
if (DRTIOAUX[linkidx].aux_rx_present_read)() == 1 {
let read_ptr = (DRTIOAUX[linkidx].aux_read_pointer_read)() as usize;
let ptr = (DRTIOAUX_MEM[linkidx].base + DRTIOAUX_MEM[linkidx].size / 2 + read_ptr * 0x400) as *mut u32;
let result = f(slice::from_raw_parts(ptr as *mut u8, 0x400 as usize));
(DRTIOAUX[linkidx].aux_rx_present_write)(1);
Ok(Some(result?))
} else {
Ok(None)
}
}
}
pub fn recv(linkno: u8) -> Result<Option<Packet>, Error> {
if has_rx_error(linkno) {
return Err(Error::GatewareError);
}
receive(linkno, |buffer| {
if buffer.len() < 8 {
return Err(IoError::new(IoErrorKind::UnexpectedEof, "Unexpected end").into());
}
let mut reader = Cursor::new(buffer);
let packet = Packet::read_from(&mut reader)?;
let padding = (12 - (reader.position() % 8)) % 8;
let checksum_at = reader.position() + padding;
let checksum = crc::crc32::checksum_ieee(&reader.get_ref()[0..checksum_at]);
reader.set_position(checksum_at);
if reader.read_u32()? != checksum {
return Err(Error::CorruptedPacket);
}
Ok(packet)
})
}
pub fn recv_timeout(linkno: u8, timeout_ms: Option<u64>, timer: GlobalTimer) -> Result<Packet, Error> {
let timeout_ms = Milliseconds(timeout_ms.unwrap_or(10));
let limit = timer.get_time() + timeout_ms;
while timer.get_time() < limit {
match recv(linkno)? {
None => (),
Some(packet) => return Ok(packet),
}
}
Err(Error::TimedOut)
}
fn transmit<F>(linkno: u8, f: F) -> Result<(), Error>
where F: FnOnce(&mut [u8]) -> Result<usize, Error> {
let linkno = linkno as usize;
unsafe {
while (DRTIOAUX[linkno].aux_tx_read)() != 0 {}
let ptr = DRTIOAUX_MEM[linkno].base as *mut u32;
let len = f(slice::from_raw_parts_mut(ptr as *mut u8, 0x400 as usize))?;
(DRTIOAUX[linkno].aux_tx_length_write)(len as u16);
(DRTIOAUX[linkno].aux_tx_write)(1);
Ok(())
}
}
pub fn send(linkno: u8, packet: &Packet) -> Result<(), Error> {
transmit(linkno, |buffer| {
let mut writer = Cursor::new(buffer);
packet.write_to(&mut writer)?;
// Pad till offset 4, insert checksum there
let padding = (12 - (writer.position() % 8)) % 8;
for _ in 0..padding {
writer.write_u8(0)?;
}
let checksum = crc::crc32::checksum_ieee(&writer.get_ref()[0..writer.position()]);
writer.write_u32(checksum)?;
Ok(writer.position())
})
}

View File

@ -0,0 +1,130 @@
use core::slice;
use core_io::{Error as IoError, ErrorKind as IoErrorKind};
use crc;
use io::{proto::{ProtoRead, ProtoWrite},
Cursor};
use libasync::{block_async, task};
use libboard_zynq::{time::Milliseconds, timer::GlobalTimer};
use nb;
use void::Void;
pub use crate::drtioaux_proto::Packet;
use crate::{drtioaux::{has_rx_error, Error},
mem::mem::DRTIOAUX_MEM,
pl::csr::DRTIOAUX};
pub async fn reset(linkno: u8) {
let linkno = linkno as usize;
unsafe {
// clear buffer first to limit race window with buffer overflow
// error. We assume the CPU is fast enough so that no two packets
// will be received between the buffer and the error flag are cleared.
(DRTIOAUX[linkno].aux_rx_present_write)(1);
(DRTIOAUX[linkno].aux_rx_error_write)(1);
}
}
fn tx_ready(linkno: usize) -> nb::Result<(), Void> {
unsafe {
if (DRTIOAUX[linkno].aux_tx_read)() != 0 {
Err(nb::Error::WouldBlock)
} else {
Ok(())
}
}
}
async fn receive<F, T>(linkno: u8, f: F) -> Result<Option<T>, Error>
where F: FnOnce(&[u8]) -> Result<T, Error> {
let linkidx = linkno as usize;
unsafe {
if (DRTIOAUX[linkidx].aux_rx_present_read)() == 1 {
let read_ptr = (DRTIOAUX[linkidx].aux_read_pointer_read)() as usize;
let ptr = (DRTIOAUX_MEM[linkidx].base + DRTIOAUX_MEM[linkidx].size / 2 + read_ptr * 0x400) as *mut u32;
let result = f(slice::from_raw_parts(ptr as *mut u8, 0x400 as usize));
(DRTIOAUX[linkidx].aux_rx_present_write)(1);
Ok(Some(result?))
} else {
Ok(None)
}
}
}
pub async fn recv(linkno: u8) -> Result<Option<Packet>, Error> {
if has_rx_error(linkno) {
return Err(Error::GatewareError);
}
receive(linkno, |buffer| {
if buffer.len() < 8 {
return Err(IoError::new(IoErrorKind::UnexpectedEof, "Unexpected end").into());
}
let mut reader = Cursor::new(buffer);
let packet = Packet::read_from(&mut reader)?;
let padding = (12 - (reader.position() % 8)) % 8;
let checksum_at = reader.position() + padding;
let checksum = crc::crc32::checksum_ieee(&reader.get_ref()[0..checksum_at]);
reader.set_position(checksum_at);
if reader.read_u32()? != checksum {
return Err(Error::CorruptedPacket);
}
Ok(packet)
})
.await
}
pub async fn recv_timeout(linkno: u8, timeout_ms: Option<u64>, timer: GlobalTimer) -> Result<Packet, Error> {
let timeout_ms = Milliseconds(timeout_ms.unwrap_or(10));
let limit = timer.get_time() + timeout_ms;
let mut would_block = false;
while timer.get_time() < limit {
// to ensure one last time recv would run one last time
// in case async would return after timeout
if would_block {
task::r#yield().await;
}
match recv(linkno).await? {
None => {
would_block = true;
}
Some(packet) => return Ok(packet),
}
}
Err(Error::TimedOut)
}
async fn transmit<F>(linkno: u8, f: F) -> Result<(), Error>
where F: FnOnce(&mut [u8]) -> Result<usize, Error> {
let linkno = linkno as usize;
unsafe {
let _ = block_async!(tx_ready(linkno)).await;
let ptr = DRTIOAUX_MEM[linkno].base as *mut u32;
let len = f(slice::from_raw_parts_mut(ptr as *mut u8, 0x400 as usize))?;
(DRTIOAUX[linkno].aux_tx_length_write)(len as u16);
(DRTIOAUX[linkno].aux_tx_write)(1);
Ok(())
}
}
pub async fn send(linkno: u8, packet: &Packet) -> Result<(), Error> {
transmit(linkno, |buffer| {
let mut writer = Cursor::new(buffer);
packet.write_to(&mut writer)?;
// Pad till offset 4, insert checksum there
let padding = (12 - (writer.position() % 8)) % 8;
for _ in 0..padding {
writer.write_u8(0)?;
}
let checksum = crc::crc32::checksum_ieee(&writer.get_ref()[0..writer.position()]);
writer.write_u32(checksum)?;
Ok(writer.position())
})
.await
}

File diff suppressed because it is too large Load Diff

View File

@ -0,0 +1,22 @@
use libboard_zynq::{println, stdio};
use libcortex_a9::{interrupt_handler, regs::MPIDR};
use libregister::RegisterR;
#[cfg(has_si549)]
use crate::si549;
interrupt_handler!(FIQ, fiq, __irq_stack0_start, __irq_stack1_start, {
match MPIDR.read().cpu_id() {
0 => {
// nFIQ is driven directly and bypass GIC
#[cfg(has_si549)]
si549::wrpll::interrupt_handler();
return;
}
_ => {}
};
stdio::drop_uart();
println!("FIQ");
loop {}
});

View File

@ -0,0 +1,163 @@
use log::info;
use crate::pl::csr;
#[derive(PartialEq, Clone, Copy)]
enum State {
Reset,
ExitReset,
Lock,
Align,
Watch,
}
#[derive(Clone, Copy)]
struct Info {
state: State,
frame_size: (u16, u16),
}
static mut INFO: [Info; csr::GRABBER_LEN] = [Info {
state: State::Reset,
frame_size: (0, 0),
}; csr::GRABBER_LEN];
fn get_pll_reset(g: usize) -> bool {
unsafe { (csr::GRABBER[g].pll_reset_read)() != 0 }
}
fn set_pll_reset(g: usize, reset: bool) {
let val = if reset { 1 } else { 0 };
unsafe { (csr::GRABBER[g].pll_reset_write)(val) }
}
fn pll_locked(g: usize) -> bool {
unsafe { (csr::GRABBER[g].pll_locked_read)() != 0 }
}
fn clock_pattern_ok(g: usize) -> bool {
unsafe { (csr::GRABBER[g].clk_sampled_read)() == 0b1100011 }
}
fn clock_pattern_ok_filter(g: usize) -> bool {
for _ in 0..128 {
if !clock_pattern_ok(g) {
return false;
}
}
true
}
fn phase_shift(g: usize, direction: u8) {
unsafe {
(csr::GRABBER[g].phase_shift_write)(direction);
while (csr::GRABBER[g].phase_shift_done_read)() == 0 {}
}
}
fn clock_align(g: usize) -> bool {
while clock_pattern_ok_filter(g) {
phase_shift(g, 1);
}
phase_shift(g, 1);
let mut count = 0;
while !clock_pattern_ok_filter(g) {
phase_shift(g, 1);
count += 1;
if count > 1024 {
return false;
}
}
let mut window = 1;
phase_shift(g, 1);
while clock_pattern_ok_filter(g) {
phase_shift(g, 1);
window += 1;
}
for _ in 0..window / 2 {
phase_shift(g, 0);
}
true
}
fn get_last_pixels(g: usize) -> (u16, u16) {
unsafe { ((csr::GRABBER[g].last_x_read)(), (csr::GRABBER[g].last_y_read)()) }
}
fn get_video_clock(g: usize) -> u32 {
let freq_count = unsafe { (csr::GRABBER[g].freq_count_read)() } as u32;
2 * freq_count * (csr::CONFIG_CLOCK_FREQUENCY / 1000) / (511 * 1000)
}
pub fn tick() {
for g in 0..csr::GRABBER.len() {
let next = match unsafe { INFO[g].state } {
State::Reset => {
set_pll_reset(g, true);
unsafe {
INFO[g].frame_size = (0, 0);
}
State::ExitReset
}
State::ExitReset => {
if get_pll_reset(g) {
set_pll_reset(g, false);
State::Lock
} else {
State::ExitReset
}
}
State::Lock => {
if pll_locked(g) {
info!("grabber{} locked: {}MHz", g, get_video_clock(g));
State::Align
} else {
State::Lock
}
}
State::Align => {
if pll_locked(g) {
if clock_align(g) {
info!("grabber{} alignment success", g);
State::Watch
} else {
info!("grabber{} alignment failure", g);
State::Reset
}
} else {
info!("grabber{} lock lost", g);
State::Reset
}
}
State::Watch => {
if pll_locked(g) {
if clock_pattern_ok(g) {
let last_xy = get_last_pixels(g);
if last_xy != unsafe { INFO[g].frame_size } {
// x capture is on ~LVAL which is after
// the last increment on DVAL
// y capture is on ~FVAL which coincides with the
// last increment on ~LVAL
info!("grabber{} frame size: {}x{}", g, last_xy.0, last_xy.1 + 1);
unsafe { INFO[g].frame_size = last_xy }
}
State::Watch
} else {
info!("grabber{} alignment lost", g);
State::Reset
}
} else {
info!("grabber{} lock lost", g);
State::Reset
}
}
};
unsafe {
INFO[g].state = next;
}
}
}

View File

@ -0,0 +1,183 @@
use libboard_zynq::i2c;
use log::info;
#[cfg(has_virtual_leds)]
use crate::pl::csr;
// Only the bare minimum registers. Bits/IO connections equivalent between IC types.
struct Registers {
// PCA9539 equivalent register names in comments
iodira: u8, // Configuration Port 0
iodirb: u8, // Configuration Port 1
gpioa: u8, // Output Port 0
gpiob: u8, // Output Port 1
}
//IO expanders pins
const IODIR_OUT_SFP_TX_DISABLE: u8 = 0x02;
const IODIR_OUT_SFP_LED: u8 = 0x40;
#[cfg(hw_rev = "v1.0")]
const IODIR_OUT_SFP0_LED: u8 = 0x40;
#[cfg(hw_rev = "v1.1")]
const IODIR_OUT_SFP0_LED: u8 = 0x80;
#[cfg(has_si549)]
const IODIR_CLK_SEL: u8 = 0x80; // out
#[cfg(has_si5324)]
const IODIR_CLK_SEL: u8 = 0x00; // in
//IO expander port direction
const IODIR0: [u8; 2] = [
0xFF & !IODIR_OUT_SFP_TX_DISABLE & !IODIR_OUT_SFP0_LED,
0xFF & !IODIR_OUT_SFP_TX_DISABLE & !IODIR_OUT_SFP_LED & !IODIR_CLK_SEL,
];
const IODIR1: [u8; 2] = [
0xFF & !IODIR_OUT_SFP_TX_DISABLE & !IODIR_OUT_SFP_LED,
0xFF & !IODIR_OUT_SFP_TX_DISABLE & !IODIR_OUT_SFP_LED,
];
pub struct IoExpander {
address: u8,
#[cfg(has_virtual_leds)]
virtual_led_mapping: &'static [(u8, u8, u8)],
iodir: [u8; 2],
out_current: [u8; 2],
out_target: [u8; 2],
registers: Registers,
}
impl IoExpander {
pub fn new(i2c: &mut i2c::I2c, index: u8) -> Result<Self, &'static str> {
#[cfg(all(hw_rev = "v1.0", has_virtual_leds))]
const VIRTUAL_LED_MAPPING0: [(u8, u8, u8); 2] = [(0, 0, 6), (1, 1, 6)];
#[cfg(all(hw_rev = "v1.1", has_virtual_leds))]
const VIRTUAL_LED_MAPPING0: [(u8, u8, u8); 2] = [(0, 0, 7), (1, 1, 6)];
#[cfg(has_virtual_leds)]
const VIRTUAL_LED_MAPPING1: [(u8, u8, u8); 2] = [(2, 0, 6), (3, 1, 6)];
// Both expanders on SHARED I2C bus
let mut io_expander = match index {
0 => IoExpander {
address: 0x40,
#[cfg(has_virtual_leds)]
virtual_led_mapping: &VIRTUAL_LED_MAPPING0,
iodir: IODIR0,
out_current: [0; 2],
out_target: [0; 2],
registers: Registers {
iodira: 0x00,
iodirb: 0x01,
gpioa: 0x12,
gpiob: 0x13,
},
},
1 => IoExpander {
address: 0x42,
#[cfg(has_virtual_leds)]
virtual_led_mapping: &VIRTUAL_LED_MAPPING1,
iodir: IODIR1,
out_current: [0; 2],
out_target: [0; 2],
registers: Registers {
iodira: 0x00,
iodirb: 0x01,
gpioa: 0x12,
gpiob: 0x13,
},
},
_ => return Err("incorrect I/O expander index"),
};
if !io_expander.check_ack(i2c)? {
info!("MCP23017 io expander {} not found. Checking for PCA9539.", index);
io_expander.address += 0xa8; // translate to PCA9539 addresses (see schematic)
io_expander.registers = Registers {
iodira: 0x06,
iodirb: 0x07,
gpioa: 0x02,
gpiob: 0x03,
};
if !io_expander.check_ack(i2c)? {
return Err("Neither MCP23017 nor PCA9539 io expander found.");
};
}
Ok(io_expander)
}
fn select(&self, i2c: &mut i2c::I2c) -> Result<(), &'static str> {
i2c.pca954x_select(0x70, None)?;
i2c.pca954x_select(0x71, Some(3))?;
Ok(())
}
fn write(&self, i2c: &mut i2c::I2c, addr: u8, value: u8) -> Result<(), &'static str> {
i2c.start()?;
i2c.write(self.address)?;
i2c.write(addr)?;
i2c.write(value)?;
i2c.stop()?;
Ok(())
}
fn check_ack(&self, i2c: &mut i2c::I2c) -> Result<bool, &'static str> {
// Check for ack from io expander
self.select(i2c)?;
i2c.start()?;
let ack = i2c.write(self.address)?;
i2c.stop()?;
Ok(ack)
}
fn update_iodir(&self, i2c: &mut i2c::I2c) -> Result<(), &'static str> {
self.write(i2c, self.registers.iodira, self.iodir[0])?;
self.write(i2c, self.registers.iodirb, self.iodir[1])?;
Ok(())
}
pub fn init(&mut self, i2c: &mut i2c::I2c) -> Result<(), &'static str> {
self.select(i2c)?;
self.update_iodir(i2c)?;
self.out_current[0] = 0x00;
self.write(i2c, self.registers.gpioa, 0x00)?;
self.out_current[1] = 0x00;
self.write(i2c, self.registers.gpiob, 0x00)?;
Ok(())
}
pub fn set_oe(&mut self, i2c: &mut i2c::I2c, port: u8, outputs: u8) -> Result<(), &'static str> {
self.iodir[port as usize] &= !outputs;
self.update_iodir(i2c)?;
Ok(())
}
pub fn set(&mut self, port: u8, bit: u8, high: bool) {
if high {
self.out_target[port as usize] |= 1 << bit;
} else {
self.out_target[port as usize] &= !(1 << bit);
}
}
pub fn service(&mut self, i2c: &mut i2c::I2c) -> Result<(), &'static str> {
#[cfg(has_virtual_leds)]
for (led, port, bit) in self.virtual_led_mapping.iter() {
let level = unsafe { csr::virtual_leds::status_read() >> led & 1 };
self.set(*port, *bit, level != 0);
}
if self.out_target != self.out_current {
self.select(i2c)?;
if self.out_target[0] != self.out_current[0] {
self.write(i2c, self.registers.gpioa, self.out_target[0])?;
self.out_current[0] = self.out_target[0];
}
if self.out_target[1] != self.out_current[1] {
self.write(i2c, self.registers.gpiob, self.out_target[1])?;
self.out_current[1] = self.out_target[1];
}
}
Ok(())
}
}

View File

@ -0,0 +1,56 @@
#![no_std]
#![feature(never_type)]
#![feature(naked_functions)]
#![feature(asm)]
extern crate core_io;
extern crate crc;
extern crate embedded_hal;
extern crate io;
extern crate libasync;
extern crate libboard_zynq;
extern crate libconfig;
extern crate libcortex_a9;
extern crate libregister;
extern crate log;
extern crate log_buffer;
pub mod drtio_routing;
#[cfg(has_drtio)]
pub mod drtioaux;
#[cfg(has_drtio)]
pub mod drtioaux_async;
pub mod drtioaux_proto;
pub mod fiq;
#[cfg(feature = "target_kasli_soc")]
pub mod io_expander;
pub mod logger;
#[cfg(has_drtio)]
#[rustfmt::skip]
#[path = "../../../build/mem.rs"]
pub mod mem;
#[rustfmt::skip]
#[path = "../../../build/pl.rs"]
pub mod pl;
#[cfg(has_drtio_eem)]
pub mod drtio_eem;
#[cfg(has_grabber)]
pub mod grabber;
#[cfg(has_si5324)]
pub mod si5324;
#[cfg(has_si549)]
pub mod si549;
use core::{cmp, str};
pub fn identifier_read(buf: &mut [u8]) -> &str {
unsafe {
pl::csr::identifier::address_write(0);
let len = pl::csr::identifier::data_read();
let len = cmp::min(len, buf.len() as u8);
for i in 0..len {
pl::csr::identifier::address_write(1 + i);
buf[i as usize] = pl::csr::identifier::data_read();
}
str::from_utf8_unchecked(&buf[..len as usize])
}
}

View File

@ -1,13 +1,13 @@
use core::cell::Cell; use core::{cell::Cell, fmt::Write};
use core::fmt::Write;
use log::{Log, LevelFilter};
use log_buffer::LogBuffer;
use libcortex_a9::mutex::{Mutex, MutexGuard};
use libboard_zynq::{println, timer::GlobalTimer}; use libboard_zynq::{println, timer::GlobalTimer};
use libcortex_a9::mutex::{Mutex, MutexGuard};
use log::{LevelFilter, Log};
use log_buffer::LogBuffer;
pub struct LogBufferRef<'a> { pub struct LogBufferRef<'a> {
buffer: MutexGuard<'a, LogBuffer<&'static mut [u8]>>, buffer: MutexGuard<'a, LogBuffer<&'static mut [u8]>>,
old_log_level: LevelFilter old_log_level: LevelFilter,
} }
impl<'a> LogBufferRef<'a> { impl<'a> LogBufferRef<'a> {
@ -56,8 +56,7 @@ impl BufferLogger {
pub fn register(self) { pub fn register(self) {
unsafe { unsafe {
LOGGER = Some(self); LOGGER = Some(self);
log::set_logger(LOGGER.as_ref().unwrap()) log::set_logger(LOGGER.as_ref().unwrap()).expect("global logger can only be initialized once");
.expect("global logger can only be initialized once");
} }
} }
@ -66,9 +65,7 @@ impl BufferLogger {
} }
pub fn buffer<'a>(&'a self) -> Option<LogBufferRef<'a>> { pub fn buffer<'a>(&'a self) -> Option<LogBufferRef<'a>> {
self.buffer self.buffer.try_lock().map(LogBufferRef::new)
.try_lock()
.map(LogBufferRef::new)
} }
pub fn uart_log_level(&self) -> LevelFilter { pub fn uart_log_level(&self) -> LevelFilter {
@ -99,25 +96,36 @@ impl Log for BufferLogger {
fn log(&self, record: &log::Record) { fn log(&self, record: &log::Record) {
if self.enabled(record.metadata()) { if self.enabled(record.metadata()) {
let timestamp = unsafe { let timestamp = unsafe { GlobalTimer::get() }.get_us().0;
GlobalTimer::get()
}.get_us().0;
let seconds = timestamp / 1_000_000; let seconds = timestamp / 1_000_000;
let micros = timestamp % 1_000_000; let micros = timestamp % 1_000_000;
if record.level() <= self.buffer_log_level() { if record.level() <= self.buffer_log_level() {
let mut buffer = self.buffer.lock(); let mut buffer = self.buffer.lock();
writeln!(buffer, "[{:6}.{:06}s] {:>5}({}): {}", seconds, micros, writeln!(
record.level(), record.target(), record.args()).unwrap(); buffer,
"[{:6}.{:06}s] {:>5}({}): {}",
seconds,
micros,
record.level(),
record.target(),
record.args()
)
.unwrap();
} }
if record.level() <= self.uart_log_level() { if record.level() <= self.uart_log_level() {
println!("[{:6}.{:06}s] {:>5}({}): {}", seconds, micros, println!(
record.level(), record.target(), record.args()); "[{:6}.{:06}s] {:>5}({}): {}",
seconds,
micros,
record.level(),
record.target(),
record.args()
);
} }
} }
} }
fn flush(&self) { fn flush(&self) {}
}
} }

View File

@ -0,0 +1,362 @@
use core::result;
use embedded_hal::blocking::delay::DelayUs;
use libboard_zynq::{i2c::I2c, time::Milliseconds, timer::GlobalTimer};
use log::info;
#[cfg(not(si5324_soft_reset))]
use crate::pl::csr;
type Result<T> = result::Result<T, &'static str>;
const ADDRESS: u8 = 0x68;
#[cfg(not(si5324_soft_reset))]
fn hard_reset(timer: &mut GlobalTimer) {
unsafe {
csr::si5324_rst_n::out_write(0);
}
timer.delay_us(1_000);
unsafe {
csr::si5324_rst_n::out_write(1);
}
timer.delay_us(10_000);
}
// NOTE: the logical parameters DO NOT MAP to physical values written
// into registers. They have to be mapped; see the datasheet.
// DSPLLsim reports the logical parameters in the design summary, not
// the physical register values.
pub struct FrequencySettings {
pub n1_hs: u8,
pub nc1_ls: u32,
pub n2_hs: u8,
pub n2_ls: u32,
pub n31: u32,
pub n32: u32,
pub bwsel: u8,
pub crystal_as_ckin2: bool,
}
pub enum Input {
Ckin1,
Ckin2,
}
fn map_frequency_settings(settings: &FrequencySettings) -> Result<FrequencySettings> {
if settings.nc1_ls != 0 && (settings.nc1_ls % 2) == 1 {
return Err("NC1_LS must be 0 or even");
}
if settings.nc1_ls > (1 << 20) {
return Err("NC1_LS is too high");
}
if (settings.n2_ls % 2) == 1 {
return Err("N2_LS must be even");
}
if settings.n2_ls > (1 << 20) {
return Err("N2_LS is too high");
}
if settings.n31 > (1 << 19) {
return Err("N31 is too high");
}
if settings.n32 > (1 << 19) {
return Err("N32 is too high");
}
let r = FrequencySettings {
n1_hs: match settings.n1_hs {
4 => 0b000,
5 => 0b001,
6 => 0b010,
7 => 0b011,
8 => 0b100,
9 => 0b101,
10 => 0b110,
11 => 0b111,
_ => return Err("N1_HS has an invalid value"),
},
nc1_ls: settings.nc1_ls - 1,
n2_hs: match settings.n2_hs {
4 => 0b000,
5 => 0b001,
6 => 0b010,
7 => 0b011,
8 => 0b100,
9 => 0b101,
10 => 0b110,
11 => 0b111,
_ => return Err("N2_HS has an invalid value"),
},
n2_ls: settings.n2_ls - 1,
n31: settings.n31 - 1,
n32: settings.n32 - 1,
bwsel: settings.bwsel,
crystal_as_ckin2: settings.crystal_as_ckin2,
};
Ok(r)
}
fn write(i2c: &mut I2c, reg: u8, val: u8) -> Result<()> {
i2c.start().unwrap();
if !i2c.write(ADDRESS << 1).unwrap() {
return Err("Si5324 failed to ack write address");
}
if !i2c.write(reg).unwrap() {
return Err("Si5324 failed to ack register");
}
if !i2c.write(val).unwrap() {
return Err("Si5324 failed to ack value");
}
i2c.stop().unwrap();
Ok(())
}
#[allow(dead_code)]
fn write_no_ack_value(i2c: &mut I2c, reg: u8, val: u8) -> Result<()> {
i2c.start().unwrap();
if !i2c.write(ADDRESS << 1).unwrap() {
return Err("Si5324 failed to ack write address");
}
if !i2c.write(reg).unwrap() {
return Err("Si5324 failed to ack register");
}
i2c.write(val).unwrap();
i2c.stop().unwrap();
Ok(())
}
fn read(i2c: &mut I2c, reg: u8) -> Result<u8> {
i2c.start().unwrap();
if !i2c.write(ADDRESS << 1).unwrap() {
return Err("Si5324 failed to ack write address");
}
if !i2c.write(reg).unwrap() {
return Err("Si5324 failed to ack register");
}
i2c.restart().unwrap();
if !i2c.write((ADDRESS << 1) | 1).unwrap() {
return Err("Si5324 failed to ack read address");
}
let val = i2c.read(false).unwrap();
i2c.stop().unwrap();
Ok(val)
}
fn rmw<F>(i2c: &mut I2c, reg: u8, f: F) -> Result<()>
where F: Fn(u8) -> u8 {
let value = read(i2c, reg)?;
write(i2c, reg, f(value))?;
Ok(())
}
fn ident(i2c: &mut I2c) -> Result<u16> {
Ok(((read(i2c, 134)? as u16) << 8) | (read(i2c, 135)? as u16))
}
#[cfg(si5324_soft_reset)]
fn soft_reset(i2c: &mut I2c, timer: &mut GlobalTimer) -> Result<()> {
let val = read(i2c, 136)?;
write_no_ack_value(i2c, 136, val | 0x80)?;
timer.delay_us(10_000);
Ok(())
}
fn has_xtal(i2c: &mut I2c) -> Result<bool> {
Ok((read(i2c, 129)? & 0x01) == 0) // LOSX_INT=0
}
fn has_ckin(i2c: &mut I2c, input: Input) -> Result<bool> {
match input {
Input::Ckin1 => Ok((read(i2c, 129)? & 0x02) == 0), // LOS1_INT=0
Input::Ckin2 => Ok((read(i2c, 129)? & 0x04) == 0), // LOS2_INT=0
}
}
fn locked(i2c: &mut I2c) -> Result<bool> {
Ok((read(i2c, 130)? & 0x01) == 0) // LOL_INT=0
}
fn monitor_lock(i2c: &mut I2c, timer: &mut GlobalTimer) -> Result<()> {
info!("waiting for Si5324 lock...");
let timeout = timer.get_time() + Milliseconds(20_000);
while !locked(i2c)? {
// Yes, lock can be really slow.
if timer.get_time() > timeout {
return Err("Si5324 lock timeout");
}
}
info!(" ...locked");
Ok(())
}
fn init(i2c: &mut I2c, timer: &mut GlobalTimer) -> Result<()> {
#[cfg(not(si5324_soft_reset))]
hard_reset(timer);
#[cfg(feature = "target_kasli_soc")]
{
i2c.pca954x_select(0x70, None)?;
i2c.pca954x_select(0x71, Some(3))?;
}
#[cfg(feature = "target_zc706")]
{
i2c.pca954x_select(0x74, Some(4))?;
}
if ident(i2c)? != 0x0182 {
return Err("Si5324 does not have expected product number");
}
#[cfg(si5324_soft_reset)]
soft_reset(i2c, timer)?;
Ok(())
}
pub fn bypass(i2c: &mut I2c, input: Input, timer: &mut GlobalTimer) -> Result<()> {
let cksel_reg = match input {
Input::Ckin1 => 0b00,
Input::Ckin2 => 0b01,
};
init(i2c, timer)?;
rmw(i2c, 21, |v| v & 0xfe)?; // CKSEL_PIN=0
rmw(i2c, 3, |v| (v & 0x3f) | (cksel_reg << 6))?; // CKSEL_REG
rmw(i2c, 4, |v| (v & 0x3f) | (0b00 << 6))?; // AUTOSEL_REG=b00
rmw(i2c, 6, |v| (v & 0xc0) | 0b111111)?; // SFOUT2_REG=b111 SFOUT1_REG=b111
rmw(i2c, 0, |v| (v & 0xfd) | 0x02)?; // BYPASS_REG=1
Ok(())
}
pub fn setup(i2c: &mut I2c, settings: &FrequencySettings, input: Input, timer: &mut GlobalTimer) -> Result<()> {
let s = map_frequency_settings(settings)?;
let cksel_reg = match input {
Input::Ckin1 => 0b00,
Input::Ckin2 => 0b01,
};
init(i2c, timer)?;
if settings.crystal_as_ckin2 {
rmw(i2c, 0, |v| v | 0x40)?; // FREE_RUN=1
}
rmw(i2c, 2, |v| (v & 0x0f) | (s.bwsel << 4))?;
rmw(i2c, 21, |v| v & 0xfe)?; // CKSEL_PIN=0
rmw(i2c, 3, |v| (v & 0x2f) | (cksel_reg << 6) | 0x10)?; // CKSEL_REG, SQ_ICAL=1
rmw(i2c, 4, |v| (v & 0x3f) | (0b00 << 6))?; // AUTOSEL_REG=b00
rmw(i2c, 6, |v| (v & 0xc0) | 0b111111)?; // SFOUT2_REG=b111 SFOUT1_REG=b111
write(i2c, 25, (s.n1_hs << 5) as u8)?;
write(i2c, 31, (s.nc1_ls >> 16) as u8)?;
write(i2c, 32, (s.nc1_ls >> 8) as u8)?;
write(i2c, 33, (s.nc1_ls) as u8)?;
write(i2c, 34, (s.nc1_ls >> 16) as u8)?; // write to NC2_LS as well
write(i2c, 35, (s.nc1_ls >> 8) as u8)?;
write(i2c, 36, (s.nc1_ls) as u8)?;
write(i2c, 40, (s.n2_hs << 5) as u8 | (s.n2_ls >> 16) as u8)?;
write(i2c, 41, (s.n2_ls >> 8) as u8)?;
write(i2c, 42, (s.n2_ls) as u8)?;
write(i2c, 43, (s.n31 >> 16) as u8)?;
write(i2c, 44, (s.n31 >> 8) as u8)?;
write(i2c, 45, (s.n31) as u8)?;
write(i2c, 46, (s.n32 >> 16) as u8)?;
write(i2c, 47, (s.n32 >> 8) as u8)?;
write(i2c, 48, (s.n32) as u8)?;
rmw(i2c, 137, |v| v | 0x01)?; // FASTLOCK=1
rmw(i2c, 136, |v| v | 0x40)?; // ICAL=1
if !has_xtal(i2c)? {
return Err("Si5324 misses XA/XB signal");
}
if !has_ckin(i2c, input)? {
return Err("Si5324 misses clock input signal");
}
monitor_lock(i2c, timer)?;
Ok(())
}
pub fn select_input(i2c: &mut I2c, input: Input, timer: &mut GlobalTimer) -> Result<()> {
let cksel_reg = match input {
Input::Ckin1 => 0b00,
Input::Ckin2 => 0b01,
};
rmw(i2c, 3, |v| (v & 0x3f) | (cksel_reg << 6))?;
if !has_ckin(i2c, input)? {
return Err("Si5324 misses clock input signal");
}
monitor_lock(i2c, timer)?;
Ok(())
}
#[cfg(has_siphaser)]
pub mod siphaser {
use super::*;
use crate::pl::csr;
pub fn select_recovered_clock(i2c: &mut I2c, rc: bool, timer: &mut GlobalTimer) -> Result<()> {
let val = read(i2c, 3)?;
write(i2c, 3, (val & 0xdf) | (1 << 5))?; // DHOLD=1
unsafe {
csr::siphaser::switch_clocks_write(if rc { 1 } else { 0 });
}
let val = read(i2c, 3)?;
write(i2c, 3, (val & 0xdf) | (0 << 5))?; // DHOLD=0
monitor_lock(i2c, timer)?;
Ok(())
}
fn phase_shift(direction: u8, timer: &mut GlobalTimer) {
unsafe {
csr::siphaser::phase_shift_write(direction);
while csr::siphaser::phase_shift_done_read() == 0 {}
}
// wait for the Si5324 loop to stabilize
timer.delay_us(500);
}
fn has_error(timer: &mut GlobalTimer) -> bool {
unsafe {
csr::siphaser::error_write(1);
}
timer.delay_us(5_000);
unsafe { csr::siphaser::error_read() != 0 }
}
fn find_edge(target: bool, timer: &mut GlobalTimer) -> Result<u32> {
let mut nshifts = 0;
let mut previous = has_error(timer);
loop {
phase_shift(1, timer);
nshifts += 1;
let current = has_error(timer);
if previous != target && current == target {
return Ok(nshifts);
}
if nshifts > 5000 {
return Err("failed to find timing error edge");
}
previous = current;
}
}
pub fn calibrate_skew(timer: &mut GlobalTimer) -> Result<()> {
let jitter_margin = 32;
let lead = find_edge(false, timer)?;
for _ in 0..jitter_margin {
phase_shift(1, timer);
}
let width = find_edge(true, timer)? + jitter_margin;
// width is 360 degrees (one full rotation of the phase between s/h limits) minus jitter
info!(
"calibration successful, lead: {}, width: {} ({}deg)",
lead,
width,
width * 360 / (56 * 8)
);
// Apply reverse phase shift for half the width to get into the
// middle of the working region.
for _ in 0..width / 2 {
phase_shift(0, timer);
}
Ok(())
}
}

View File

@ -0,0 +1,854 @@
use embedded_hal::prelude::_embedded_hal_blocking_delay_DelayUs;
use libboard_zynq::timer::GlobalTimer;
use log::info;
use crate::pl::csr;
#[cfg(feature = "target_kasli_soc")]
const ADDRESS: u8 = 0x67;
const ADPLL_MAX: i32 = (950.0 / 0.0001164) as i32;
pub struct DividerConfig {
pub hsdiv: u16,
pub lsdiv: u8,
pub fbdiv: u64,
}
pub struct FrequencySetting {
pub main: DividerConfig,
pub helper: DividerConfig,
}
mod i2c {
use super::*;
#[derive(Clone, Copy)]
pub enum DCXO {
Main,
Helper,
}
fn half_period(timer: &mut GlobalTimer) {
timer.delay_us(1)
}
fn sda_i(dcxo: DCXO) -> bool {
match dcxo {
DCXO::Main => unsafe { csr::wrpll::main_dcxo_sda_in_read() == 1 },
DCXO::Helper => unsafe { csr::wrpll::helper_dcxo_sda_in_read() == 1 },
}
}
fn sda_oe(dcxo: DCXO, oe: bool) {
let val = if oe { 1 } else { 0 };
match dcxo {
DCXO::Main => unsafe { csr::wrpll::main_dcxo_sda_oe_write(val) },
DCXO::Helper => unsafe { csr::wrpll::helper_dcxo_sda_oe_write(val) },
};
}
fn sda_o(dcxo: DCXO, o: bool) {
let val = if o { 1 } else { 0 };
match dcxo {
DCXO::Main => unsafe { csr::wrpll::main_dcxo_sda_out_write(val) },
DCXO::Helper => unsafe { csr::wrpll::helper_dcxo_sda_out_write(val) },
};
}
fn scl_oe(dcxo: DCXO, oe: bool) {
let val = if oe { 1 } else { 0 };
match dcxo {
DCXO::Main => unsafe { csr::wrpll::main_dcxo_scl_oe_write(val) },
DCXO::Helper => unsafe { csr::wrpll::helper_dcxo_scl_oe_write(val) },
};
}
fn scl_o(dcxo: DCXO, o: bool) {
let val = if o { 1 } else { 0 };
match dcxo {
DCXO::Main => unsafe { csr::wrpll::main_dcxo_scl_out_write(val) },
DCXO::Helper => unsafe { csr::wrpll::helper_dcxo_scl_out_write(val) },
};
}
pub fn init(dcxo: DCXO, timer: &mut GlobalTimer) -> Result<(), &'static str> {
// Set SCL as output, and high level
scl_o(dcxo, true);
scl_oe(dcxo, true);
// Prepare a zero level on SDA so that sda_oe pulls it down
sda_o(dcxo, false);
// Release SDA
sda_oe(dcxo, false);
// Check the I2C bus is ready
half_period(timer);
half_period(timer);
if !sda_i(dcxo) {
// Try toggling SCL a few times
for _bit in 0..8 {
scl_o(dcxo, false);
half_period(timer);
scl_o(dcxo, true);
half_period(timer);
}
}
if !sda_i(dcxo) {
return Err("SDA is stuck low and doesn't get unstuck");
}
Ok(())
}
pub fn start(dcxo: DCXO, timer: &mut GlobalTimer) {
// Set SCL high then SDA low
scl_o(dcxo, true);
half_period(timer);
sda_oe(dcxo, true);
half_period(timer);
}
pub fn stop(dcxo: DCXO, timer: &mut GlobalTimer) {
// First, make sure SCL is low, so that the target releases the SDA line
scl_o(dcxo, false);
half_period(timer);
// Set SCL high then SDA high
sda_oe(dcxo, true);
scl_o(dcxo, true);
half_period(timer);
sda_oe(dcxo, false);
half_period(timer);
}
pub fn write(dcxo: DCXO, data: u8, timer: &mut GlobalTimer) -> bool {
// MSB first
for bit in (0..8).rev() {
// Set SCL low and set our bit on SDA
scl_o(dcxo, false);
sda_oe(dcxo, data & (1 << bit) == 0);
half_period(timer);
// Set SCL high ; data is shifted on the rising edge of SCL
scl_o(dcxo, true);
half_period(timer);
}
// Check ack
// Set SCL low, then release SDA so that the I2C target can respond
scl_o(dcxo, false);
half_period(timer);
sda_oe(dcxo, false);
// Set SCL high and check for ack
scl_o(dcxo, true);
half_period(timer);
// returns true if acked (I2C target pulled SDA low)
!sda_i(dcxo)
}
pub fn read(dcxo: DCXO, ack: bool, timer: &mut GlobalTimer) -> u8 {
// Set SCL low first, otherwise setting SDA as input may cause a transition
// on SDA with SCL high which will be interpreted as START/STOP condition.
scl_o(dcxo, false);
half_period(timer); // make sure SCL has settled low
sda_oe(dcxo, false);
let mut data: u8 = 0;
// MSB first
for bit in (0..8).rev() {
scl_o(dcxo, false);
half_period(timer);
// Set SCL high and shift data
scl_o(dcxo, true);
half_period(timer);
if sda_i(dcxo) {
data |= 1 << bit
}
}
// Send ack
// Set SCL low and pull SDA low when acking
scl_o(dcxo, false);
if ack {
sda_oe(dcxo, true)
}
half_period(timer);
// then set SCL high
scl_o(dcxo, true);
half_period(timer);
data
}
}
fn write(dcxo: i2c::DCXO, reg: u8, val: u8, timer: &mut GlobalTimer) -> Result<(), &'static str> {
i2c::start(dcxo, timer);
if !i2c::write(dcxo, ADDRESS << 1, timer) {
return Err("Si549 failed to ack write address");
}
if !i2c::write(dcxo, reg, timer) {
return Err("Si549 failed to ack register");
}
if !i2c::write(dcxo, val, timer) {
return Err("Si549 failed to ack value");
}
i2c::stop(dcxo, timer);
Ok(())
}
fn read(dcxo: i2c::DCXO, reg: u8, timer: &mut GlobalTimer) -> Result<u8, &'static str> {
i2c::start(dcxo, timer);
if !i2c::write(dcxo, ADDRESS << 1, timer) {
return Err("Si549 failed to ack write address");
}
if !i2c::write(dcxo, reg, timer) {
return Err("Si549 failed to ack register");
}
i2c::stop(dcxo, timer);
i2c::start(dcxo, timer);
if !i2c::write(dcxo, (ADDRESS << 1) | 1, timer) {
return Err("Si549 failed to ack read address");
}
let val = i2c::read(dcxo, false, timer);
i2c::stop(dcxo, timer);
Ok(val)
}
fn setup(dcxo: i2c::DCXO, config: &DividerConfig, timer: &mut GlobalTimer) -> Result<(), &'static str> {
i2c::init(dcxo, timer)?;
write(dcxo, 255, 0x00, timer)?; // PAGE
write(dcxo, 69, 0x00, timer)?; // Disable FCAL override.
write(dcxo, 17, 0x00, timer)?; // Synchronously disable output
// The Si549 has no ID register, so we check that it responds correctly
// by writing values to a RAM-like register and reading them back.
for test_value in 0..255 {
write(dcxo, 23, test_value, timer)?;
let readback = read(dcxo, 23, timer)?;
if readback != test_value {
return Err("Si549 detection failed");
}
}
write(dcxo, 23, config.hsdiv as u8, timer)?;
write(dcxo, 24, (config.hsdiv >> 8) as u8 | (config.lsdiv << 4), timer)?;
write(dcxo, 26, config.fbdiv as u8, timer)?;
write(dcxo, 27, (config.fbdiv >> 8) as u8, timer)?;
write(dcxo, 28, (config.fbdiv >> 16) as u8, timer)?;
write(dcxo, 29, (config.fbdiv >> 24) as u8, timer)?;
write(dcxo, 30, (config.fbdiv >> 32) as u8, timer)?;
write(dcxo, 31, (config.fbdiv >> 40) as u8, timer)?;
write(dcxo, 7, 0x08, timer)?; // Start FCAL
timer.delay_us(30_000); // Internal FCAL VCO calibration
write(dcxo, 17, 0x01, timer)?; // Synchronously enable output
Ok(())
}
pub fn main_setup(timer: &mut GlobalTimer, settings: &FrequencySetting) -> Result<(), &'static str> {
unsafe {
csr::wrpll::main_dcxo_bitbang_enable_write(1);
csr::wrpll::main_dcxo_i2c_address_write(ADDRESS);
}
setup(i2c::DCXO::Main, &settings.main, timer)?;
// Si549 maximum settling time for large frequency change.
timer.delay_us(40_000);
unsafe {
csr::wrpll::main_dcxo_bitbang_enable_write(0);
}
info!("Main Si549 started");
Ok(())
}
pub fn helper_setup(timer: &mut GlobalTimer, settings: &FrequencySetting) -> Result<(), &'static str> {
unsafe {
csr::wrpll::helper_reset_write(1);
csr::wrpll::helper_dcxo_bitbang_enable_write(1);
csr::wrpll::helper_dcxo_i2c_address_write(ADDRESS);
}
setup(i2c::DCXO::Helper, &settings.helper, timer)?;
// Si549 maximum settling time for large frequency change.
timer.delay_us(40_000);
unsafe {
csr::wrpll::helper_reset_write(0);
csr::wrpll::helper_dcxo_bitbang_enable_write(0);
}
info!("Helper Si549 started");
Ok(())
}
fn set_adpll(dcxo: i2c::DCXO, adpll: i32) -> Result<(), &'static str> {
if adpll.abs() > ADPLL_MAX {
return Err("adpll is too large");
}
match dcxo {
i2c::DCXO::Main => unsafe {
if csr::wrpll::main_dcxo_bitbang_enable_read() == 1 {
return Err("Main si549 bitbang mode is active when using gateware i2c");
}
while csr::wrpll::main_dcxo_adpll_busy_read() == 1 {}
if csr::wrpll::main_dcxo_nack_read() == 1 {
return Err("Main si549 failed to ack adpll write");
}
csr::wrpll::main_dcxo_i2c_address_write(ADDRESS);
csr::wrpll::main_dcxo_adpll_write(adpll as u32);
csr::wrpll::main_dcxo_adpll_stb_write(1);
},
i2c::DCXO::Helper => unsafe {
if csr::wrpll::helper_dcxo_bitbang_enable_read() == 1 {
return Err("Helper si549 bitbang mode is active when using gateware i2c");
}
while csr::wrpll::helper_dcxo_adpll_busy_read() == 1 {}
if csr::wrpll::helper_dcxo_nack_read() == 1 {
return Err("Helper si549 failed to ack adpll write");
}
csr::wrpll::helper_dcxo_i2c_address_write(ADDRESS);
csr::wrpll::helper_dcxo_adpll_write(adpll as u32);
csr::wrpll::helper_dcxo_adpll_stb_write(1);
},
};
Ok(())
}
#[cfg(has_wrpll)]
pub mod wrpll {
use super::*;
const BEATING_PERIOD: i32 = 0x8000;
const BEATING_HALFPERIOD: i32 = 0x4000;
const COUNTER_WIDTH: u32 = 24;
const DIV_WIDTH: u32 = 2;
// y[n] = b0*x[n] + b1*x[n-1] + b2*x[n-2] - a1*y[n-1] - a2*y[n-2]
struct FilterParameters {
pub b0: f64,
pub b1: f64,
pub b2: f64,
pub a1: f64,
pub a2: f64,
}
#[cfg(rtio_frequency = "100.0")]
const LPF: FilterParameters = FilterParameters {
b0: 0.03967479060647884,
b1: 0.07934958121295768,
b2: 0.03967479060647884,
a1: -1.3865593741228928,
a2: 0.5452585365488082,
};
#[cfg(rtio_frequency = "125.0")]
const LPF: FilterParameters = FilterParameters {
b0: 0.07209205036273991,
b1: 0.14418410072547982,
b2: 0.07209205036273991,
a1: -0.6114078511562919,
a2: -0.10022394739274834,
};
static mut H_ADPLL1: i32 = 0;
static mut H_ADPLL2: i32 = 0;
static mut PERIOD_ERR1: i32 = 0;
static mut PERIOD_ERR2: i32 = 0;
static mut M_ADPLL1: i32 = 0;
static mut M_ADPLL2: i32 = 0;
static mut PHASE_ERR1: i32 = 0;
static mut PHASE_ERR2: i32 = 0;
static mut BASE_ADPLL: i32 = 0;
#[derive(Clone, Copy)]
pub enum ISR {
RefTag,
MainTag,
}
mod tag_collector {
use super::*;
#[cfg(wrpll_ref_clk = "GT_CDR")]
static mut TAG_OFFSET: u32 = 8382;
#[cfg(wrpll_ref_clk = "SMA_CLKIN")]
static mut TAG_OFFSET: u32 = 0;
static mut REF_TAG: u32 = 0;
static mut REF_TAG_READY: bool = false;
static mut MAIN_TAG: u32 = 0;
static mut MAIN_TAG_READY: bool = false;
pub fn reset() {
clear_phase_diff_ready();
unsafe {
REF_TAG = 0;
MAIN_TAG = 0;
}
}
pub fn clear_phase_diff_ready() {
unsafe {
REF_TAG_READY = false;
MAIN_TAG_READY = false;
}
}
pub fn collect_tags(interrupt: ISR) {
match interrupt {
ISR::RefTag => unsafe {
REF_TAG = csr::wrpll::ref_tag_read();
REF_TAG_READY = true;
},
ISR::MainTag => unsafe {
MAIN_TAG = csr::wrpll::main_tag_read();
MAIN_TAG_READY = true;
},
}
}
pub fn phase_diff_ready() -> bool {
unsafe { REF_TAG_READY && MAIN_TAG_READY }
}
#[cfg(feature = "calibrate_wrpll_skew")]
pub fn set_tag_offset(offset: u32) {
unsafe {
TAG_OFFSET = offset;
}
}
#[cfg(feature = "calibrate_wrpll_skew")]
pub fn get_tag_offset() -> u32 {
unsafe { TAG_OFFSET }
}
pub fn get_period_error() -> i32 {
// n * BEATING_PERIOD - REF_TAG(n) mod BEATING_PERIOD
let mut period_error = unsafe { REF_TAG.overflowing_neg().0.rem_euclid(BEATING_PERIOD as u32) as i32 };
// mapping tags from [0, 2π] -> [-π, π]
if period_error > BEATING_HALFPERIOD {
period_error -= BEATING_PERIOD
}
period_error
}
pub fn get_phase_error() -> i32 {
// MAIN_TAG(n) - REF_TAG(n) - TAG_OFFSET mod BEATING_PERIOD
let mut phase_error = unsafe {
MAIN_TAG
.overflowing_sub(REF_TAG + TAG_OFFSET)
.0
.rem_euclid(BEATING_PERIOD as u32) as i32
};
// mapping tags from [0, 2π] -> [-π, π]
if phase_error > BEATING_HALFPERIOD {
phase_error -= BEATING_PERIOD
}
phase_error
}
}
fn set_isr(en: bool) {
let val = if en { 1 } else { 0 };
unsafe {
csr::wrpll::ref_tag_ev_enable_write(val);
csr::wrpll::main_tag_ev_enable_write(val);
}
}
fn set_base_adpll() -> Result<(), &'static str> {
let count2adpll =
|error: i32| ((error as f64 * 1e6) / (0.0001164 * (1 << (COUNTER_WIDTH - DIV_WIDTH)) as f64)) as i32;
let (ref_count, main_count) = get_freq_counts();
unsafe {
BASE_ADPLL = count2adpll(ref_count as i32 - main_count as i32);
set_adpll(i2c::DCXO::Main, BASE_ADPLL)?;
set_adpll(i2c::DCXO::Helper, BASE_ADPLL)?;
}
Ok(())
}
fn get_freq_counts() -> (u32, u32) {
unsafe {
csr::wrpll::frequency_counter_update_write(1);
while csr::wrpll::frequency_counter_busy_read() == 1 {}
#[cfg(wrpll_ref_clk = "GT_CDR")]
let ref_count = csr::wrpll::frequency_counter_counter_rtio_rx0_read();
#[cfg(wrpll_ref_clk = "SMA_CLKIN")]
let ref_count = csr::wrpll::frequency_counter_counter_ref_read();
let main_count = csr::wrpll::frequency_counter_counter_sys_read();
(ref_count, main_count)
}
}
fn reset_plls(timer: &mut GlobalTimer) -> Result<(), &'static str> {
unsafe {
H_ADPLL1 = 0;
H_ADPLL2 = 0;
PERIOD_ERR1 = 0;
PERIOD_ERR2 = 0;
M_ADPLL1 = 0;
M_ADPLL2 = 0;
PHASE_ERR1 = 0;
PHASE_ERR2 = 0;
}
set_adpll(i2c::DCXO::Main, 0)?;
set_adpll(i2c::DCXO::Helper, 0)?;
// wait for adpll to transfer and DCXO to settle
timer.delay_us(200);
Ok(())
}
fn clear_pending(interrupt: ISR) {
match interrupt {
ISR::RefTag => unsafe { csr::wrpll::ref_tag_ev_pending_write(1) },
ISR::MainTag => unsafe { csr::wrpll::main_tag_ev_pending_write(1) },
};
}
fn is_pending(interrupt: ISR) -> bool {
match interrupt {
ISR::RefTag => unsafe { csr::wrpll::ref_tag_ev_pending_read() == 1 },
ISR::MainTag => unsafe { csr::wrpll::main_tag_ev_pending_read() == 1 },
}
}
pub fn interrupt_handler() {
if is_pending(ISR::RefTag) {
tag_collector::collect_tags(ISR::RefTag);
clear_pending(ISR::RefTag);
helper_pll().expect("failed to run helper DCXO PLL");
}
if is_pending(ISR::MainTag) {
tag_collector::collect_tags(ISR::MainTag);
clear_pending(ISR::MainTag);
}
if tag_collector::phase_diff_ready() {
main_pll().expect("failed to run main DCXO PLL");
tag_collector::clear_phase_diff_ready();
}
}
fn helper_pll() -> Result<(), &'static str> {
let period_err = tag_collector::get_period_error();
unsafe {
let adpll = ((LPF.b0 * period_err as f64) + (LPF.b1 * PERIOD_ERR1 as f64) + (LPF.b2 * PERIOD_ERR2 as f64)
- (LPF.a1 * H_ADPLL1 as f64)
- (LPF.a2 * H_ADPLL2 as f64)) as i32;
set_adpll(i2c::DCXO::Helper, BASE_ADPLL + adpll)?;
H_ADPLL2 = H_ADPLL1;
PERIOD_ERR2 = PERIOD_ERR1;
H_ADPLL1 = adpll;
PERIOD_ERR1 = period_err;
};
Ok(())
}
fn main_pll() -> Result<(), &'static str> {
let phase_err = tag_collector::get_phase_error();
unsafe {
let adpll = ((LPF.b0 * phase_err as f64) + (LPF.b1 * PHASE_ERR1 as f64) + (LPF.b2 * PHASE_ERR2 as f64)
- (LPF.a1 * M_ADPLL1 as f64)
- (LPF.a2 * M_ADPLL2 as f64)) as i32;
set_adpll(i2c::DCXO::Main, BASE_ADPLL + adpll)?;
M_ADPLL2 = M_ADPLL1;
PHASE_ERR2 = PHASE_ERR1;
M_ADPLL1 = adpll;
PHASE_ERR1 = phase_err;
};
Ok(())
}
#[cfg(wrpll_ref_clk = "GT_CDR")]
fn test_skew(timer: &mut GlobalTimer) -> Result<(), &'static str> {
// wait for PLL to stabilize
timer.delay_us(20_000);
info!("testing the skew of SYS CLK...");
if has_timing_error(timer) {
return Err("the skew cannot satisfy setup/hold time constraint of RX synchronizer");
}
info!("the skew of SYS CLK met the timing constraint");
Ok(())
}
#[cfg(wrpll_ref_clk = "GT_CDR")]
fn has_timing_error(timer: &mut GlobalTimer) -> bool {
unsafe {
csr::wrpll_skewtester::error_write(1);
}
timer.delay_us(5_000);
unsafe { csr::wrpll_skewtester::error_read() == 1 }
}
#[cfg(feature = "calibrate_wrpll_skew")]
fn find_edge(target: bool, timer: &mut GlobalTimer) -> Result<u32, &'static str> {
const STEP: u32 = 8;
const STABLE_THRESHOLD: u32 = 10;
enum FSM {
Init,
WaitEdge,
GotEdge,
}
let mut state: FSM = FSM::Init;
let mut offset: u32 = tag_collector::get_tag_offset();
let mut median_edge: u32 = 0;
let mut stable_counter: u32 = 0;
for _ in 0..(BEATING_PERIOD as u32 / STEP) as usize {
tag_collector::set_tag_offset(offset);
offset += STEP;
// wait for PLL to stabilize
timer.delay_us(20_000);
let error = has_timing_error(timer);
// A median edge deglitcher
match state {
FSM::Init => {
if error != target {
stable_counter += 1;
} else {
stable_counter = 0;
}
if stable_counter >= STABLE_THRESHOLD {
state = FSM::WaitEdge;
stable_counter = 0;
}
}
FSM::WaitEdge => {
if error == target {
state = FSM::GotEdge;
median_edge = offset;
}
}
FSM::GotEdge => {
if error != target {
median_edge += STEP;
stable_counter = 0;
} else {
stable_counter += 1;
}
if stable_counter >= STABLE_THRESHOLD {
return Ok(median_edge);
}
}
}
}
return Err("failed to find timing error edge");
}
#[cfg(feature = "calibrate_wrpll_skew")]
fn calibrate_skew(timer: &mut GlobalTimer) -> Result<(), &'static str> {
info!("calibrating skew to meet timing constraint...");
// clear calibrated value
tag_collector::set_tag_offset(0);
let rising = find_edge(true, timer)? as i32;
let falling = find_edge(false, timer)? as i32;
let width = BEATING_PERIOD - (falling - rising);
let result = falling + width / 2;
tag_collector::set_tag_offset(result as u32);
info!(
"calibration successful, error zone: {} -> {}, width: {} ({}deg), middle of working region: {}",
rising,
falling,
width,
360 * width / BEATING_PERIOD,
result,
);
Ok(())
}
pub fn select_recovered_clock(rc: bool, timer: &mut GlobalTimer) {
set_isr(false);
if rc {
tag_collector::reset();
reset_plls(timer).expect("failed to reset main and helper PLL");
// get within capture range
set_base_adpll().expect("failed to set base adpll");
// clear gateware pending flag
clear_pending(ISR::RefTag);
clear_pending(ISR::MainTag);
// use nFIQ to avoid IRQ being disabled by mutex lock and mess up PLL
set_isr(true);
info!("WRPLL interrupt enabled");
#[cfg(feature = "calibrate_wrpll_skew")]
calibrate_skew(timer).expect("failed to set the correct skew");
#[cfg(wrpll_ref_clk = "GT_CDR")]
test_skew(timer).expect("skew test failed");
}
}
}
#[cfg(has_wrpll_refclk)]
pub mod wrpll_refclk {
use super::*;
pub struct MmcmSetting {
pub clkout0_reg1: u16, //0x08
pub clkout0_reg2: u16, //0x09
pub clkfbout_reg1: u16, //0x14
pub clkfbout_reg2: u16, //0x15
pub div_reg: u16, //0x16
pub lock_reg1: u16, //0x18
pub lock_reg2: u16, //0x19
pub lock_reg3: u16, //0x1A
pub power_reg: u16, //0x28
pub filt_reg1: u16, //0x4E
pub filt_reg2: u16, //0x4F
}
fn one_clock_cycle() {
unsafe {
csr::wrpll_refclk::mmcm_dclk_write(1);
csr::wrpll_refclk::mmcm_dclk_write(0);
}
}
fn set_addr(address: u8) {
unsafe {
csr::wrpll_refclk::mmcm_daddr_write(address);
}
}
fn set_data(value: u16) {
unsafe {
csr::wrpll_refclk::mmcm_din_write(value);
}
}
fn set_enable(en: bool) {
unsafe {
let val = if en { 1 } else { 0 };
csr::wrpll_refclk::mmcm_den_write(val);
}
}
fn set_write_enable(en: bool) {
unsafe {
let val = if en { 1 } else { 0 };
csr::wrpll_refclk::mmcm_dwen_write(val);
}
}
fn get_data() -> u16 {
unsafe { csr::wrpll_refclk::mmcm_dout_read() }
}
fn drp_ready() -> bool {
unsafe { csr::wrpll_refclk::mmcm_dready_read() == 1 }
}
#[allow(dead_code)]
fn read(address: u8) -> u16 {
set_addr(address);
set_enable(true);
// Set DADDR on the mmcm and assert DEN for one clock cycle
one_clock_cycle();
set_enable(false);
while !drp_ready() {
// keep the clock signal until data is ready
one_clock_cycle();
}
get_data()
}
fn write(address: u8, value: u16) {
set_addr(address);
set_data(value);
set_write_enable(true);
set_enable(true);
// Set DADDR, DI on the mmcm and assert DWE, DEN for one clock cycle
one_clock_cycle();
set_write_enable(false);
set_enable(false);
while !drp_ready() {
// keep the clock signal until write is finished
one_clock_cycle();
}
}
fn reset(rst: bool) {
unsafe {
let val = if rst { 1 } else { 0 };
csr::wrpll_refclk::mmcm_reset_write(val)
}
}
pub fn setup(timer: &mut GlobalTimer, settings: MmcmSetting, mmcm_bypass: bool) -> Result<(), &'static str> {
unsafe {
csr::wrpll_refclk::refclk_reset_write(1);
}
if mmcm_bypass {
info!("Bypassing mmcm");
unsafe {
csr::wrpll_refclk::mmcm_bypass_write(1);
}
} else {
// Based on "DRP State Machine" from XAPP888
// hold reset HIGH during mmcm config
reset(true);
write(0x08, settings.clkout0_reg1);
write(0x09, settings.clkout0_reg2);
write(0x14, settings.clkfbout_reg1);
write(0x15, settings.clkfbout_reg2);
write(0x16, settings.div_reg);
write(0x18, settings.lock_reg1);
write(0x19, settings.lock_reg2);
write(0x1A, settings.lock_reg3);
write(0x28, settings.power_reg);
write(0x4E, settings.filt_reg1);
write(0x4F, settings.filt_reg2);
reset(false);
// wait for the mmcm to lock
timer.delay_us(100);
let locked = unsafe { csr::wrpll_refclk::mmcm_locked_read() == 1 };
if !locked {
return Err("mmcm failed to generate 125MHz ref clock from SMA CLKIN");
}
}
unsafe {
csr::wrpll_refclk::refclk_reset_write(0);
}
Ok(())
}
}

View File

@ -0,0 +1,8 @@
[package]
authors = ["M-Labs"]
name = "build_zynq"
version = "0.0.0"
[lib]
name = "build_zynq"
path = "lib.rs"

29
src/libbuild_zynq/lib.rs Normal file
View File

@ -0,0 +1,29 @@
use std::{env,
fs::File,
io::{BufRead, BufReader, Write},
path::PathBuf};
pub fn add_linker_script() {
// Put the linker script somewhere the linker can find it
let out = &PathBuf::from(env::var_os("OUT_DIR").unwrap());
File::create(out.join("link.x"))
.unwrap()
.write_all(include_bytes!("link.x"))
.unwrap();
println!("cargo:rustc-link-search={}", out.display());
// Only re-run the build script when link.x is changed,
// instead of when any part of the source code changes.
println!("cargo:rerun-if-changed=link.x");
}
pub fn cfg() {
// Handle rustc-cfg file
let cfg_path = "../../build/rustc-cfg";
println!("cargo:rerun-if-changed={}", cfg_path);
let f = BufReader::new(File::open(cfg_path).unwrap());
for line in f.lines() {
println!("cargo:rustc-cfg={}", line.unwrap());
}
}

View File

@ -10,7 +10,9 @@ SECTIONS
__text_start = .; __text_start = .;
.text : .text :
{ {
__exceptions_start = .;
KEEP(*(.text.exceptions)); KEEP(*(.text.exceptions));
__exceptions_end = .;
*(.text.boot); *(.text.boot);
*(.text .text.*); *(.text .text.*);
} > SDRAM } > SDRAM

View File

@ -6,7 +6,7 @@ edition = "2018"
build = "build.rs" build = "build.rs"
[dependencies] [dependencies]
libboard_zynq = { git = "https://git.m-labs.hk/M-Labs/zynq-rs.git" } libboard_zynq = { path = "@@ZYNQ_RS@@/libboard_zynq" }
[build-dependencies] [build-dependencies]
cc = { version = "1.0.1" } cc = { version = "1.0.1" }

View File

@ -4,7 +4,8 @@ fn main() {
} }
mod libc { mod libc {
use std::path::Path; use std::{env, path::Path};
pub fn compile() { pub fn compile() {
let cfg = &mut cc::Build::new(); let cfg = &mut cc::Build::new();
cfg.no_default_flags(true); cfg.no_default_flags(true);
@ -16,6 +17,9 @@ mod libc {
cfg.flag("-ffreestanding"); cfg.flag("-ffreestanding");
cfg.flag("-fno-PIC"); cfg.flag("-fno-PIC");
cfg.flag("-isystem../include"); cfg.flag("-isystem../include");
if let Ok(extra_include) = env::var("CLANG_EXTRA_INCLUDE_DIR") {
cfg.flag(&("-isystem".to_owned() + &extra_include));
}
cfg.flag("-fno-stack-protector"); cfg.flag("-fno-stack-protector");
cfg.flag("--target=armv7-none-eabihf"); cfg.flag("--target=armv7-none-eabihf");
cfg.flag("-O2"); cfg.flag("-O2");
@ -27,9 +31,7 @@ mod libc {
cfg.flag("-U_FORTIFY_SOURCE"); cfg.flag("-U_FORTIFY_SOURCE");
cfg.define("_FORTIFY_SOURCE", Some("0")); cfg.define("_FORTIFY_SOURCE", Some("0"));
let sources = vec![ let sources = vec!["printf.c"];
"printf.c"
];
let root = Path::new("./"); let root = Path::new("./");
for src in sources { for src in sources {

View File

@ -15,3 +15,4 @@ libc = { path = "../libc" }
unwind = { path = "../libunwind" } unwind = { path = "../libunwind" }
compiler_builtins = "0.1.0" compiler_builtins = "0.1.0"
cfg-if = "0.1.8" cfg-if = "0.1.8"
cslice = "0.3"

View File

@ -11,9 +11,12 @@
#![allow(non_upper_case_globals)] #![allow(non_upper_case_globals)]
#![allow(unused)] #![allow(unused)]
use crate::DwarfReader;
use core::mem; use core::mem;
use cslice::CSlice;
use crate::DwarfReader;
pub const DW_EH_PE_omit: u8 = 0xFF; pub const DW_EH_PE_omit: u8 = 0xFF;
pub const DW_EH_PE_absptr: u8 = 0x00; pub const DW_EH_PE_absptr: u8 = 0x00;
@ -51,10 +54,45 @@ pub enum EHAction {
pub const USING_SJLJ_EXCEPTIONS: bool = cfg!(all(target_os = "ios", target_arch = "arm")); pub const USING_SJLJ_EXCEPTIONS: bool = cfg!(all(target_os = "ios", target_arch = "arm"));
fn size_of_encoded_value(encoding: u8) -> usize {
if encoding == DW_EH_PE_omit {
0
} else {
let encoding = encoding & 0x07;
match encoding {
DW_EH_PE_absptr => core::mem::size_of::<*const ()>(),
DW_EH_PE_udata2 => 2,
DW_EH_PE_udata4 => 4,
DW_EH_PE_udata8 => 8,
_ => unreachable!(),
}
}
}
unsafe fn get_ttype_entry(
offset: usize,
encoding: u8,
ttype_base: usize,
ttype: *const u8,
) -> Result<Option<*const u8>, ()> {
let i = (offset * size_of_encoded_value(encoding)) as isize;
read_encoded_pointer_with_base(
&mut DwarfReader::new(ttype.offset(-i)),
// the DW_EH_PE_pcrel is a hack.
// It seems that the default encoding is absolute, but we have to take reallocation into
// account. Unsure if we can fix this in the compiler setting or if this would be affected
// by updating the compiler
encoding | DW_EH_PE_pcrel,
ttype_base,
)
.map(|v| (v != ttype_base).then(|| v as *const u8))
}
pub unsafe fn find_eh_action( pub unsafe fn find_eh_action(
lsda: *const u8, lsda: *const u8,
context: &EHContext<'_>, context: &EHContext<'_>,
foreign_exception: bool, foreign_exception: bool,
id: u32,
) -> Result<EHAction, ()> { ) -> Result<EHAction, ()> {
if lsda.is_null() { if lsda.is_null() {
return Ok(EHAction::None); return Ok(EHAction::None);
@ -72,10 +110,17 @@ pub unsafe fn find_eh_action(
}; };
let ttype_encoding = reader.read::<u8>(); let ttype_encoding = reader.read::<u8>();
if ttype_encoding != DW_EH_PE_omit { // we do care about the type table
// Rust doesn't analyze exception types, so we don't care about the type table let ttype_offset = if ttype_encoding != DW_EH_PE_omit {
reader.read_uleb128(); reader.read_uleb128()
} } else {
0
};
// for rust functions, it seems that there is no type table, so I just put whatever value here.
// we should not return an error, otherwise we would abort unwinding and cannot unwind through
// rust functions
let ttype_base = get_base(ttype_encoding, context).unwrap_or(1);
let ttype_table = reader.ptr.offset(ttype_offset as isize);
let call_site_encoding = reader.read::<u8>(); let call_site_encoding = reader.read::<u8>();
let call_site_table_length = reader.read_uleb128(); let call_site_table_length = reader.read_uleb128();
@ -94,11 +139,49 @@ pub unsafe fn find_eh_action(
break; break;
} }
if ip < func_start + cs_start + cs_len { if ip < func_start + cs_start + cs_len {
// https://github.com/gcc-mirror/gcc/blob/master/libstdc%2B%2B-v3/libsupc%2B%2B/eh_personality.cc#L528
let lpad = lpad_base + cs_lpad;
if cs_lpad == 0 { if cs_lpad == 0 {
// no cleanups/handler
return Ok(EHAction::None);
} else if cs_action == 0 {
return Ok(EHAction::Cleanup(lpad));
} else if foreign_exception {
return Ok(EHAction::None); return Ok(EHAction::None);
} else { } else {
let lpad = lpad_base + cs_lpad; let mut saw_cleanup = false;
return Ok(interpret_cs_action(cs_action, lpad, foreign_exception)); let mut action_record = action_table.offset(cs_action as isize - 1);
loop {
let mut reader = DwarfReader::new(action_record);
let ar_filter = reader.read_sleb128();
action_record = reader.ptr;
let ar_disp = reader.read_sleb128();
if ar_filter == 0 {
saw_cleanup = true;
} else if ar_filter > 0 {
let catch_type =
get_ttype_entry(ar_filter as usize, ttype_encoding, ttype_base, ttype_table)?;
match catch_type {
Some(clause_ptr) if *(clause_ptr as *const u32) == id => {
return Ok(EHAction::Catch(lpad));
}
None => return Ok(EHAction::Catch(lpad)),
_ => {}
}
} else if ar_filter < 0 {
// FIXME: how to handle this?
break;
}
if ar_disp == 0 {
break;
}
action_record = action_record.offset((ar_disp as usize) as isize);
}
if saw_cleanup {
return Ok(EHAction::Cleanup(lpad));
} else {
return Ok(EHAction::None);
}
} }
} }
} }
@ -106,7 +189,7 @@ pub unsafe fn find_eh_action(
// So rather than returning EHAction::Terminate, we do this. // So rather than returning EHAction::Terminate, we do this.
Ok(EHAction::None) Ok(EHAction::None)
} else { } else {
// SjLj version: // SjLj version: (not yet modified)
// The "IP" is an index into the call-site table, with two exceptions: // The "IP" is an index into the call-site table, with two exceptions:
// -1 means 'no-action', and 0 means 'terminate'. // -1 means 'no-action', and 0 means 'terminate'.
match ip as isize { match ip as isize {
@ -146,18 +229,33 @@ fn interpret_cs_action(cs_action: u64, lpad: usize, foreign_exception: bool) ->
#[inline] #[inline]
fn round_up(unrounded: usize, align: usize) -> Result<usize, ()> { fn round_up(unrounded: usize, align: usize) -> Result<usize, ()> {
if align.is_power_of_two() { Ok((unrounded + align - 1) & !(align - 1)) } else { Err(()) } if align.is_power_of_two() {
Ok((unrounded + align - 1) & !(align - 1))
} else {
Err(())
}
} }
unsafe fn read_encoded_pointer( fn get_base(encoding: u8, context: &EHContext<'_>) -> Result<usize, ()> {
reader: &mut DwarfReader, match encoding & 0x70 {
context: &EHContext<'_>, DW_EH_PE_absptr | DW_EH_PE_pcrel | DW_EH_PE_aligned => Ok(0),
encoding: u8, DW_EH_PE_textrel => Ok((*context.get_text_start)()),
) -> Result<usize, ()> { DW_EH_PE_datarel => Ok((*context.get_data_start)()),
DW_EH_PE_funcrel if context.func_start != 0 => Ok(context.func_start),
_ => return Err(()),
}
}
unsafe fn read_encoded_pointer(reader: &mut DwarfReader, context: &EHContext<'_>, encoding: u8) -> Result<usize, ()> {
read_encoded_pointer_with_base(reader, encoding, get_base(encoding, context)?)
}
unsafe fn read_encoded_pointer_with_base(reader: &mut DwarfReader, encoding: u8, base: usize) -> Result<usize, ()> {
if encoding == DW_EH_PE_omit { if encoding == DW_EH_PE_omit {
return Err(()); return Err(());
} }
let original_ptr = reader.ptr;
// DW_EH_PE_aligned implies it's an absolute pointer value // DW_EH_PE_aligned implies it's an absolute pointer value
if encoding == DW_EH_PE_aligned { if encoding == DW_EH_PE_aligned {
reader.ptr = round_up(reader.ptr as usize, mem::size_of::<usize>())? as *const u8; reader.ptr = round_up(reader.ptr as usize, mem::size_of::<usize>())? as *const u8;
@ -177,19 +275,10 @@ unsafe fn read_encoded_pointer(
_ => return Err(()), _ => return Err(()),
}; };
result += match encoding & 0x70 { result += if (encoding & 0x70) == DW_EH_PE_pcrel {
DW_EH_PE_absptr => 0, original_ptr as usize
// relative to address of the encoded value, despite the name } else {
DW_EH_PE_pcrel => reader.ptr as usize, base
DW_EH_PE_funcrel => {
if context.func_start == 0 {
return Err(());
}
context.func_start
}
DW_EH_PE_textrel => (*context.get_text_start)(),
DW_EH_PE_datarel => (*context.get_data_start)(),
_ => return Err(()),
}; };
if encoding & DW_EH_PE_indirect != 0 { if encoding & DW_EH_PE_indirect != 0 {

View File

@ -26,6 +26,10 @@ impl DwarfReader {
DwarfReader { ptr } DwarfReader { ptr }
} }
pub unsafe fn offset(&mut self, offset: isize) {
self.ptr = self.ptr.offset(offset);
}
// DWARF streams are packed, so e.g., a u32 would not necessarily be aligned // DWARF streams are packed, so e.g., a u32 would not necessarily be aligned
// on a 4-byte boundary. This may cause problems on platforms with strict // on a 4-byte boundary. This may cause problems on platforms with strict
// alignment requirements. By wrapping data in a "packed" struct, we are // alignment requirements. By wrapping data in a "packed" struct, we are

View File

@ -8,4 +8,4 @@ name = "dyld"
[dependencies] [dependencies]
log = "0.4" log = "0.4"
libcortex_a9 = { git = "https://git.m-labs.hk/M-Labs/zynq-rs.git" } libcortex_a9 = { path = "@@ZYNQ_RS@@/libcortex_a9" }

View File

@ -1451,8 +1451,7 @@ pub const R_AARCH64_TLSDESC_CALL: usize = 569;
pub const R_AARCH64_TLSLE_LDST128_TPREL_LO12: usize = 570; pub const R_AARCH64_TLSLE_LDST128_TPREL_LO12: usize = 570;
pub const R_AARCH64_TLSLE_LDST128_TPREL_LO12_NC: usize = 571; pub const R_AARCH64_TLSLE_LDST128_TPREL_LO12_NC: usize = 571;
pub const R_AARCH64_TLSLD_LDST128_DTPREL_LO12: usize = 572; pub const R_AARCH64_TLSLD_LDST128_DTPREL_LO12: usize = 572;
pub const R_AARCH64_TLSLD_LDST128_DTPREL_LO12_NC: usize = pub const R_AARCH64_TLSLD_LDST128_DTPREL_LO12_NC: usize = 573;
573;
pub const R_AARCH64_COPY: usize = 1024; pub const R_AARCH64_COPY: usize = 1024;
pub const R_AARCH64_GLOB_DAT: usize = 1025; pub const R_AARCH64_GLOB_DAT: usize = 1025;
pub const R_AARCH64_JUMP_SLOT: usize = 1026; pub const R_AARCH64_JUMP_SLOT: usize = 1026;
@ -2267,7 +2266,9 @@ pub struct Elf32_Ehdr {
pub e_shstrndx: Elf32_Half, pub e_shstrndx: Elf32_Half,
} }
impl Clone for Elf32_Ehdr { impl Clone for Elf32_Ehdr {
fn clone(&self) -> Self { *self } fn clone(&self) -> Self {
*self
}
} }
#[repr(C)] #[repr(C)]
#[derive(Debug, Copy)] #[derive(Debug, Copy)]
@ -2288,7 +2289,9 @@ pub struct Elf64_Ehdr {
pub e_shstrndx: Elf64_Half, pub e_shstrndx: Elf64_Half,
} }
impl Clone for Elf64_Ehdr { impl Clone for Elf64_Ehdr {
fn clone(&self) -> Self { *self } fn clone(&self) -> Self {
*self
}
} }
#[repr(C)] #[repr(C)]
#[derive(Debug, Copy)] #[derive(Debug, Copy)]
@ -2305,7 +2308,9 @@ pub struct Elf32_Shdr {
pub sh_entsize: Elf32_Word, pub sh_entsize: Elf32_Word,
} }
impl Clone for Elf32_Shdr { impl Clone for Elf32_Shdr {
fn clone(&self) -> Self { *self } fn clone(&self) -> Self {
*self
}
} }
#[repr(C)] #[repr(C)]
#[derive(Debug, Copy)] #[derive(Debug, Copy)]
@ -2322,7 +2327,9 @@ pub struct Elf64_Shdr {
pub sh_entsize: Elf64_Xword, pub sh_entsize: Elf64_Xword,
} }
impl Clone for Elf64_Shdr { impl Clone for Elf64_Shdr {
fn clone(&self) -> Self { *self } fn clone(&self) -> Self {
*self
}
} }
#[repr(C)] #[repr(C)]
#[derive(Debug, Copy)] #[derive(Debug, Copy)]
@ -2335,7 +2342,9 @@ pub struct Elf32_Sym {
pub st_shndx: Elf32_Section, pub st_shndx: Elf32_Section,
} }
impl Clone for Elf32_Sym { impl Clone for Elf32_Sym {
fn clone(&self) -> Self { *self } fn clone(&self) -> Self {
*self
}
} }
#[repr(C)] #[repr(C)]
#[derive(Debug, Copy)] #[derive(Debug, Copy)]
@ -2348,7 +2357,9 @@ pub struct Elf64_Sym {
pub st_size: Elf64_Xword, pub st_size: Elf64_Xword,
} }
impl Clone for Elf64_Sym { impl Clone for Elf64_Sym {
fn clone(&self) -> Self { *self } fn clone(&self) -> Self {
*self
}
} }
#[repr(C)] #[repr(C)]
#[derive(Debug, Copy)] #[derive(Debug, Copy)]
@ -2357,7 +2368,9 @@ pub struct Elf32_Syminfo {
pub si_flags: Elf32_Half, pub si_flags: Elf32_Half,
} }
impl Clone for Elf32_Syminfo { impl Clone for Elf32_Syminfo {
fn clone(&self) -> Self { *self } fn clone(&self) -> Self {
*self
}
} }
#[repr(C)] #[repr(C)]
#[derive(Debug, Copy)] #[derive(Debug, Copy)]
@ -2366,7 +2379,9 @@ pub struct Elf64_Syminfo {
pub si_flags: Elf64_Half, pub si_flags: Elf64_Half,
} }
impl Clone for Elf64_Syminfo { impl Clone for Elf64_Syminfo {
fn clone(&self) -> Self { *self } fn clone(&self) -> Self {
*self
}
} }
#[repr(C)] #[repr(C)]
#[derive(Debug, Copy)] #[derive(Debug, Copy)]
@ -2375,7 +2390,9 @@ pub struct Elf32_Rel {
pub r_info: Elf32_Word, pub r_info: Elf32_Word,
} }
impl Clone for Elf32_Rel { impl Clone for Elf32_Rel {
fn clone(&self) -> Self { *self } fn clone(&self) -> Self {
*self
}
} }
#[repr(C)] #[repr(C)]
#[derive(Debug, Copy)] #[derive(Debug, Copy)]
@ -2384,7 +2401,9 @@ pub struct Elf64_Rel {
pub r_info: Elf64_Xword, pub r_info: Elf64_Xword,
} }
impl Clone for Elf64_Rel { impl Clone for Elf64_Rel {
fn clone(&self) -> Self { *self } fn clone(&self) -> Self {
*self
}
} }
#[repr(C)] #[repr(C)]
#[derive(Debug, Copy)] #[derive(Debug, Copy)]
@ -2394,7 +2413,9 @@ pub struct Elf32_Rela {
pub r_addend: Elf32_Sword, pub r_addend: Elf32_Sword,
} }
impl Clone for Elf32_Rela { impl Clone for Elf32_Rela {
fn clone(&self) -> Self { *self } fn clone(&self) -> Self {
*self
}
} }
#[repr(C)] #[repr(C)]
#[derive(Debug, Copy)] #[derive(Debug, Copy)]
@ -2404,7 +2425,9 @@ pub struct Elf64_Rela {
pub r_addend: Elf64_Sxword, pub r_addend: Elf64_Sxword,
} }
impl Clone for Elf64_Rela { impl Clone for Elf64_Rela {
fn clone(&self) -> Self { *self } fn clone(&self) -> Self {
*self
}
} }
#[repr(C)] #[repr(C)]
#[derive(Debug, Copy)] #[derive(Debug, Copy)]
@ -2419,7 +2442,9 @@ pub struct Elf32_Phdr {
pub p_align: Elf32_Word, pub p_align: Elf32_Word,
} }
impl Clone for Elf32_Phdr { impl Clone for Elf32_Phdr {
fn clone(&self) -> Self { *self } fn clone(&self) -> Self {
*self
}
} }
#[repr(C)] #[repr(C)]
#[derive(Debug, Copy)] #[derive(Debug, Copy)]
@ -2434,7 +2459,9 @@ pub struct Elf64_Phdr {
pub p_align: Elf64_Xword, pub p_align: Elf64_Xword,
} }
impl Clone for Elf64_Phdr { impl Clone for Elf64_Phdr {
fn clone(&self) -> Self { *self } fn clone(&self) -> Self {
*self
}
} }
#[repr(C)] #[repr(C)]
#[derive(Copy)] #[derive(Copy)]
@ -2449,10 +2476,14 @@ pub union Elf32_Dyn__bindgen_ty_1 {
pub d_ptr: Elf32_Addr, pub d_ptr: Elf32_Addr,
} }
impl Clone for Elf32_Dyn__bindgen_ty_1 { impl Clone for Elf32_Dyn__bindgen_ty_1 {
fn clone(&self) -> Self { *self } fn clone(&self) -> Self {
*self
}
} }
impl Clone for Elf32_Dyn { impl Clone for Elf32_Dyn {
fn clone(&self) -> Self { *self } fn clone(&self) -> Self {
*self
}
} }
#[repr(C)] #[repr(C)]
#[derive(Copy)] #[derive(Copy)]
@ -2467,10 +2498,14 @@ pub union Elf64_Dyn__bindgen_ty_1 {
pub d_ptr: Elf64_Addr, pub d_ptr: Elf64_Addr,
} }
impl Clone for Elf64_Dyn__bindgen_ty_1 { impl Clone for Elf64_Dyn__bindgen_ty_1 {
fn clone(&self) -> Self { *self } fn clone(&self) -> Self {
*self
}
} }
impl Clone for Elf64_Dyn { impl Clone for Elf64_Dyn {
fn clone(&self) -> Self { *self } fn clone(&self) -> Self {
*self
}
} }
#[repr(C)] #[repr(C)]
#[derive(Debug, Copy)] #[derive(Debug, Copy)]
@ -2484,7 +2519,9 @@ pub struct Elf32_Verdef {
pub vd_next: Elf32_Word, pub vd_next: Elf32_Word,
} }
impl Clone for Elf32_Verdef { impl Clone for Elf32_Verdef {
fn clone(&self) -> Self { *self } fn clone(&self) -> Self {
*self
}
} }
#[repr(C)] #[repr(C)]
#[derive(Debug, Copy)] #[derive(Debug, Copy)]
@ -2498,7 +2535,9 @@ pub struct Elf64_Verdef {
pub vd_next: Elf64_Word, pub vd_next: Elf64_Word,
} }
impl Clone for Elf64_Verdef { impl Clone for Elf64_Verdef {
fn clone(&self) -> Self { *self } fn clone(&self) -> Self {
*self
}
} }
#[repr(C)] #[repr(C)]
#[derive(Debug, Copy)] #[derive(Debug, Copy)]
@ -2507,7 +2546,9 @@ pub struct Elf32_Verdaux {
pub vda_next: Elf32_Word, pub vda_next: Elf32_Word,
} }
impl Clone for Elf32_Verdaux { impl Clone for Elf32_Verdaux {
fn clone(&self) -> Self { *self } fn clone(&self) -> Self {
*self
}
} }
#[repr(C)] #[repr(C)]
#[derive(Debug, Copy)] #[derive(Debug, Copy)]
@ -2516,7 +2557,9 @@ pub struct Elf64_Verdaux {
pub vda_next: Elf64_Word, pub vda_next: Elf64_Word,
} }
impl Clone for Elf64_Verdaux { impl Clone for Elf64_Verdaux {
fn clone(&self) -> Self { *self } fn clone(&self) -> Self {
*self
}
} }
#[repr(C)] #[repr(C)]
#[derive(Debug, Copy)] #[derive(Debug, Copy)]
@ -2528,7 +2571,9 @@ pub struct Elf32_Verneed {
pub vn_next: Elf32_Word, pub vn_next: Elf32_Word,
} }
impl Clone for Elf32_Verneed { impl Clone for Elf32_Verneed {
fn clone(&self) -> Self { *self } fn clone(&self) -> Self {
*self
}
} }
#[repr(C)] #[repr(C)]
#[derive(Debug, Copy)] #[derive(Debug, Copy)]
@ -2540,7 +2585,9 @@ pub struct Elf64_Verneed {
pub vn_next: Elf64_Word, pub vn_next: Elf64_Word,
} }
impl Clone for Elf64_Verneed { impl Clone for Elf64_Verneed {
fn clone(&self) -> Self { *self } fn clone(&self) -> Self {
*self
}
} }
#[repr(C)] #[repr(C)]
#[derive(Debug, Copy)] #[derive(Debug, Copy)]
@ -2552,7 +2599,9 @@ pub struct Elf32_Vernaux {
pub vna_next: Elf32_Word, pub vna_next: Elf32_Word,
} }
impl Clone for Elf32_Vernaux { impl Clone for Elf32_Vernaux {
fn clone(&self) -> Self { *self } fn clone(&self) -> Self {
*self
}
} }
#[repr(C)] #[repr(C)]
#[derive(Debug, Copy)] #[derive(Debug, Copy)]
@ -2564,7 +2613,9 @@ pub struct Elf64_Vernaux {
pub vna_next: Elf64_Word, pub vna_next: Elf64_Word,
} }
impl Clone for Elf64_Vernaux { impl Clone for Elf64_Vernaux {
fn clone(&self) -> Self { *self } fn clone(&self) -> Self {
*self
}
} }
#[repr(C)] #[repr(C)]
#[derive(Copy)] #[derive(Copy)]
@ -2578,10 +2629,14 @@ pub union Elf32_auxv_t__bindgen_ty_1 {
pub a_val: u32, pub a_val: u32,
} }
impl Clone for Elf32_auxv_t__bindgen_ty_1 { impl Clone for Elf32_auxv_t__bindgen_ty_1 {
fn clone(&self) -> Self { *self } fn clone(&self) -> Self {
*self
}
} }
impl Clone for Elf32_auxv_t { impl Clone for Elf32_auxv_t {
fn clone(&self) -> Self { *self } fn clone(&self) -> Self {
*self
}
} }
#[repr(C)] #[repr(C)]
#[derive(Copy)] #[derive(Copy)]
@ -2595,10 +2650,14 @@ pub union Elf64_auxv_t__bindgen_ty_1 {
pub a_val: u64, pub a_val: u64,
} }
impl Clone for Elf64_auxv_t__bindgen_ty_1 { impl Clone for Elf64_auxv_t__bindgen_ty_1 {
fn clone(&self) -> Self { *self } fn clone(&self) -> Self {
*self
}
} }
impl Clone for Elf64_auxv_t { impl Clone for Elf64_auxv_t {
fn clone(&self) -> Self { *self } fn clone(&self) -> Self {
*self
}
} }
#[repr(C)] #[repr(C)]
#[derive(Debug, Copy)] #[derive(Debug, Copy)]
@ -2608,7 +2667,9 @@ pub struct Elf32_Nhdr {
pub n_type: Elf32_Word, pub n_type: Elf32_Word,
} }
impl Clone for Elf32_Nhdr { impl Clone for Elf32_Nhdr {
fn clone(&self) -> Self { *self } fn clone(&self) -> Self {
*self
}
} }
#[repr(C)] #[repr(C)]
#[derive(Debug, Copy)] #[derive(Debug, Copy)]
@ -2618,7 +2679,9 @@ pub struct Elf64_Nhdr {
pub n_type: Elf64_Word, pub n_type: Elf64_Word,
} }
impl Clone for Elf64_Nhdr { impl Clone for Elf64_Nhdr {
fn clone(&self) -> Self { *self } fn clone(&self) -> Self {
*self
}
} }
#[repr(C)] #[repr(C)]
#[derive(Debug, Copy)] #[derive(Debug, Copy)]
@ -2630,7 +2693,9 @@ pub struct Elf32_Move {
pub m_stride: Elf32_Half, pub m_stride: Elf32_Half,
} }
impl Clone for Elf32_Move { impl Clone for Elf32_Move {
fn clone(&self) -> Self { *self } fn clone(&self) -> Self {
*self
}
} }
#[repr(C)] #[repr(C)]
#[derive(Debug, Copy)] #[derive(Debug, Copy)]
@ -2642,7 +2707,9 @@ pub struct Elf64_Move {
pub m_stride: Elf64_Half, pub m_stride: Elf64_Half,
} }
impl Clone for Elf64_Move { impl Clone for Elf64_Move {
fn clone(&self) -> Self { *self } fn clone(&self) -> Self {
*self
}
} }
#[repr(C)] #[repr(C)]
#[derive(Copy)] #[derive(Copy)]
@ -2657,7 +2724,9 @@ pub struct Elf32_gptab__bindgen_ty_1 {
pub gt_unused: Elf32_Word, pub gt_unused: Elf32_Word,
} }
impl Clone for Elf32_gptab__bindgen_ty_1 { impl Clone for Elf32_gptab__bindgen_ty_1 {
fn clone(&self) -> Self { *self } fn clone(&self) -> Self {
*self
}
} }
#[repr(C)] #[repr(C)]
#[derive(Debug, Copy)] #[derive(Debug, Copy)]
@ -2666,10 +2735,14 @@ pub struct Elf32_gptab__bindgen_ty_2 {
pub gt_bytes: Elf32_Word, pub gt_bytes: Elf32_Word,
} }
impl Clone for Elf32_gptab__bindgen_ty_2 { impl Clone for Elf32_gptab__bindgen_ty_2 {
fn clone(&self) -> Self { *self } fn clone(&self) -> Self {
*self
}
} }
impl Clone for Elf32_gptab { impl Clone for Elf32_gptab {
fn clone(&self) -> Self { *self } fn clone(&self) -> Self {
*self
}
} }
#[repr(C)] #[repr(C)]
#[derive(Debug, Copy)] #[derive(Debug, Copy)]
@ -2679,7 +2752,9 @@ pub struct Elf32_RegInfo {
pub ri_gp_value: Elf32_Sword, pub ri_gp_value: Elf32_Sword,
} }
impl Clone for Elf32_RegInfo { impl Clone for Elf32_RegInfo {
fn clone(&self) -> Self { *self } fn clone(&self) -> Self {
*self
}
} }
#[repr(C)] #[repr(C)]
#[derive(Debug, Copy)] #[derive(Debug, Copy)]
@ -2690,7 +2765,9 @@ pub struct Elf_Options {
pub info: Elf32_Word, pub info: Elf32_Word,
} }
impl Clone for Elf_Options { impl Clone for Elf_Options {
fn clone(&self) -> Self { *self } fn clone(&self) -> Self {
*self
}
} }
#[repr(C)] #[repr(C)]
#[derive(Debug, Copy)] #[derive(Debug, Copy)]
@ -2699,7 +2776,9 @@ pub struct Elf_Options_Hw {
pub hwp_flags2: Elf32_Word, pub hwp_flags2: Elf32_Word,
} }
impl Clone for Elf_Options_Hw { impl Clone for Elf_Options_Hw {
fn clone(&self) -> Self { *self } fn clone(&self) -> Self {
*self
}
} }
#[repr(C)] #[repr(C)]
#[derive(Debug, Copy)] #[derive(Debug, Copy)]
@ -2711,7 +2790,9 @@ pub struct Elf32_Lib {
pub l_flags: Elf32_Word, pub l_flags: Elf32_Word,
} }
impl Clone for Elf32_Lib { impl Clone for Elf32_Lib {
fn clone(&self) -> Self { *self } fn clone(&self) -> Self {
*self
}
} }
#[repr(C)] #[repr(C)]
#[derive(Debug, Copy)] #[derive(Debug, Copy)]
@ -2723,14 +2804,31 @@ pub struct Elf64_Lib {
pub l_flags: Elf64_Word, pub l_flags: Elf64_Word,
} }
impl Clone for Elf64_Lib { impl Clone for Elf64_Lib {
fn clone(&self) -> Self { *self } fn clone(&self) -> Self {
*self
}
} }
pub type Elf32_Conflict = Elf32_Addr; pub type Elf32_Conflict = Elf32_Addr;
#[repr(C)]
#[derive(Clone, Copy)]
pub struct EXIDX_Entry(u32, u32);
pub fn ELF32_R_SYM(info: Elf32_Word) -> Elf32_Word { info >> 8 } pub fn ELF32_R_SYM(info: Elf32_Word) -> Elf32_Word {
pub fn ELF32_R_TYPE(info: Elf32_Word) -> u8 { info as u8 } info >> 8
pub fn ELF32_R_INFO(sym: Elf32_Word, ty: u8) -> Elf32_Word { sym << 8 | ty as Elf32_Word } }
pub fn ELF32_R_TYPE(info: Elf32_Word) -> u8 {
info as u8
}
pub fn ELF32_R_INFO(sym: Elf32_Word, ty: u8) -> Elf32_Word {
sym << 8 | ty as Elf32_Word
}
pub fn ELF32_ST_BIND(info: u8) -> u8 { info >> 4 } pub fn ELF32_ST_BIND(info: u8) -> u8 {
pub fn ELF32_ST_TYPE(info: u8) -> u8 { info & 0xf } info >> 4
pub fn ELF32_ST_INFO(bind: u8, ty: u8) -> u8 { (bind << 4) | (ty & 0xf) } }
pub fn ELF32_ST_TYPE(info: u8) -> u8 {
info & 0xf
}
pub fn ELF32_ST_INFO(bind: u8, ty: u8) -> u8 {
(bind << 4) | (ty & 0xf)
}

View File

@ -1,8 +1,8 @@
use core::{mem, ptr, ops::{Deref, Range}}; use core::{mem,
use super::{ ops::{Deref, Range},
Arch, ptr};
elf::*,
}; use super::{elf::*, Arch};
fn read_unaligned<T: Copy>(data: &[u8], offset: usize) -> Option<T> { fn read_unaligned<T: Copy>(data: &[u8], offset: usize) -> Option<T> {
if data.len() < offset + mem::size_of::<T>() { if data.len() < offset + mem::size_of::<T>() {
@ -31,14 +31,40 @@ impl<'a> File<'a> {
pub fn arch(&self) -> Option<Arch> { pub fn arch(&self) -> Option<Arch> {
const IDENT_OPENRISC: [u8; EI_NIDENT] = [ const IDENT_OPENRISC: [u8; EI_NIDENT] = [
ELFMAG0, ELFMAG1, ELFMAG2, ELFMAG3, ELFMAG0,
ELFCLASS32, ELFDATA2MSB, EV_CURRENT, ELFOSABI_NONE, ELFMAG1,
/* ABI version */ 0, /* padding */ 0, 0, 0, 0, 0, 0, 0 ELFMAG2,
ELFMAG3,
ELFCLASS32,
ELFDATA2MSB,
EV_CURRENT,
ELFOSABI_NONE,
/* ABI version */ 0,
/* padding */ 0,
0,
0,
0,
0,
0,
0,
]; ];
const IDENT_ARM: [u8; EI_NIDENT] = [ const IDENT_ARM: [u8; EI_NIDENT] = [
ELFMAG0, ELFMAG1, ELFMAG2, ELFMAG3, ELFMAG0,
ELFCLASS32, ELFDATA2LSB, EV_CURRENT, ELFOSABI_NONE, ELFMAG1,
/* ABI version */ 0, /* padding */ 0, 0, 0, 0, 0, 0, 0 ELFMAG2,
ELFMAG3,
ELFCLASS32,
ELFDATA2LSB,
EV_CURRENT,
ELFOSABI_NONE,
/* ABI version */ 0,
/* padding */ 0,
0,
0,
0,
0,
0,
0,
]; ];
match (self.ehdr.e_ident, self.ehdr.e_machine) { match (self.ehdr.e_ident, self.ehdr.e_machine) {
@ -48,16 +74,14 @@ impl<'a> File<'a> {
} }
} }
pub fn program_headers<'b>(&'b self) -> impl Iterator<Item = Option<Elf32_Phdr>> + 'b pub fn program_headers<'b>(&'b self) -> impl Iterator<Item = Option<Elf32_Phdr>> + 'b {
{
(0..self.ehdr.e_phnum).map(move |i| { (0..self.ehdr.e_phnum).map(move |i| {
let phdr_off = self.ehdr.e_phoff as usize + mem::size_of::<Elf32_Phdr>() * i as usize; let phdr_off = self.ehdr.e_phoff as usize + mem::size_of::<Elf32_Phdr>() * i as usize;
self.read_unaligned::<Elf32_Phdr>(phdr_off) self.read_unaligned::<Elf32_Phdr>(phdr_off)
}) })
} }
pub fn section_headers<'b>(&'b self) -> impl Iterator<Item = Option<Elf32_Shdr>> + 'b pub fn section_headers<'b>(&'b self) -> impl Iterator<Item = Option<Elf32_Shdr>> + 'b {
{
(0..self.ehdr.e_shnum).map(move |i| { (0..self.ehdr.e_shnum).map(move |i| {
let shdr_off = self.ehdr.e_shoff as usize + mem::size_of::<Elf32_Shdr>() * i as usize; let shdr_off = self.ehdr.e_shoff as usize + mem::size_of::<Elf32_Shdr>() * i as usize;
self.read_unaligned::<Elf32_Shdr>(shdr_off) self.read_unaligned::<Elf32_Shdr>(shdr_off)

View File

@ -1,13 +1,9 @@
use core::{
ops::{Deref, DerefMut, Range},
mem,
slice,
};
use alloc::alloc::{alloc_zeroed, dealloc, Layout, LayoutError}; use alloc::alloc::{alloc_zeroed, dealloc, Layout, LayoutError};
use super::{ use core::{mem,
elf::*, ops::{Deref, DerefMut, Range},
Error, slice};
};
use super::{elf::*, Error};
pub struct DynamicSection { pub struct DynamicSection {
pub strtab: Range<usize>, pub strtab: Range<usize>,
@ -34,17 +30,12 @@ impl Image {
slice::from_raw_parts_mut(ptr, size) slice::from_raw_parts_mut(ptr, size)
}; };
Ok(Image { Ok(Image { layout, data })
layout,
data,
})
} }
/// assumes that self.data is properly aligned /// assumes that self.data is properly aligned
pub(crate) fn get_ref<T>(&self, offset: usize) -> Option<&T> pub(crate) fn get_ref<T>(&self, offset: usize) -> Option<&T>
where where T: Copy {
T: Copy,
{
if self.data.len() < offset + mem::size_of::<T>() { if self.data.len() < offset + mem::size_of::<T>() {
None None
} else if (self.data.as_ptr() as usize + offset) & (mem::align_of::<T>() - 1) != 0 { } else if (self.data.as_ptr() as usize + offset) & (mem::align_of::<T>() - 1) != 0 {
@ -66,14 +57,10 @@ impl Image {
unsafe { slice::from_raw_parts(ptr, len) } unsafe { slice::from_raw_parts(ptr, len) }
} }
fn dyn_headers<'a>(&'a self, range: Range<usize>) -> fn dyn_headers<'a>(&'a self, range: Range<usize>) -> impl Iterator<Item = &'a Elf32_Dyn> + 'a {
impl Iterator<Item = &'a Elf32_Dyn> + 'a
{
range range
.step_by(mem::size_of::<Elf32_Dyn>()) .step_by(mem::size_of::<Elf32_Dyn>())
.filter_map(move |offset| { .filter_map(move |offset| self.get_ref::<Elf32_Dyn>(offset))
self.get_ref::<Elf32_Dyn>(offset)
})
.take_while(|d| unsafe { d.d_un.d_val } as i32 != DT_NULL) .take_while(|d| unsafe { d.d_un.d_val } as i32 != DT_NULL)
} }
@ -107,14 +94,16 @@ impl Image {
DT_JMPREL => pltrel_off = val, DT_JMPREL => pltrel_off = val,
DT_PLTRELSZ => pltrel_sz = val, DT_PLTRELSZ => pltrel_sz = val,
DT_HASH => { DT_HASH => {
nbucket = *self.get_ref::<Elf32_Word>(val + 0) nbucket = *self
.get_ref::<Elf32_Word>(val + 0)
.ok_or("cannot read hash bucket count")? as usize; .ok_or("cannot read hash bucket count")? as usize;
nchain = *self.get_ref::<Elf32_Word>(val + 4) nchain = *self
.get_ref::<Elf32_Word>(val + 4)
.ok_or("cannot read hash chain count")? as usize; .ok_or("cannot read hash chain count")? as usize;
hash_off = val + 8; hash_off = val + 8;
hash_sz = (nbucket + nchain) * mem::size_of::<Elf32_Word>(); hash_sz = (nbucket + nchain) * mem::size_of::<Elf32_Word>();
} }
_ => () _ => (),
} }
} }
@ -123,28 +112,28 @@ impl Image {
let symtab_sz = nchain * mem::size_of::<Elf32_Sym>(); let symtab_sz = nchain * mem::size_of::<Elf32_Sym>();
if strtab_off + strtab_sz > self.data.len() { if strtab_off + strtab_sz > self.data.len() {
return Err("invalid strtab offset/size")? return Err("invalid strtab offset/size")?;
} }
if symtab_off + symtab_sz > self.data.len() { if symtab_off + symtab_sz > self.data.len() {
return Err("invalid symtab offset/size")? return Err("invalid symtab offset/size")?;
} }
if sym_ent != mem::size_of::<Elf32_Sym>() { if sym_ent != mem::size_of::<Elf32_Sym>() {
return Err("incorrect symbol entry size")? return Err("incorrect symbol entry size")?;
} }
if rel_off + rel_sz > self.data.len() { if rel_off + rel_sz > self.data.len() {
return Err("invalid rel offset/size")? return Err("invalid rel offset/size")?;
} }
if rel_ent != 0 && rel_ent != mem::size_of::<Elf32_Rel>() { if rel_ent != 0 && rel_ent != mem::size_of::<Elf32_Rel>() {
return Err("incorrect relocation entry size")? return Err("incorrect relocation entry size")?;
} }
if rela_off + rela_sz > self.data.len() { if rela_off + rela_sz > self.data.len() {
return Err("invalid rela offset/size")? return Err("invalid rela offset/size")?;
} }
if rela_ent != 0 && rela_ent != mem::size_of::<Elf32_Rela>() { if rela_ent != 0 && rela_ent != mem::size_of::<Elf32_Rela>() {
return Err("incorrect relocation entry size")? return Err("incorrect relocation entry size")?;
} }
if pltrel_off + pltrel_sz > self.data.len() { if pltrel_off + pltrel_sz > self.data.len() {
return Err("invalid pltrel offset/size")? return Err("invalid pltrel offset/size")?;
} }
Ok(DynamicSection { Ok(DynamicSection {
@ -165,7 +154,7 @@ impl Image {
pub fn write(&self, offset: usize, value: Elf32_Word) -> Result<(), Error> { pub fn write(&self, offset: usize, value: Elf32_Word) -> Result<(), Error> {
if offset + mem::size_of::<Elf32_Addr>() > self.data.len() { if offset + mem::size_of::<Elf32_Addr>() > self.data.len() {
return Err("relocation out of image bounds")? return Err("relocation out of image bounds")?;
} }
let ptr = (self.data.as_ptr() as usize + offset) as *mut Elf32_Addr; let ptr = (self.data.as_ptr() as usize + offset) as *mut Elf32_Addr;

View File

@ -1,13 +1,14 @@
#![no_std] #![no_std]
extern crate alloc; extern crate alloc;
extern crate log;
extern crate libcortex_a9; extern crate libcortex_a9;
extern crate log;
use core::{convert, fmt, ops::Range, str};
use alloc::string::String; use alloc::string::String;
use log::{debug, trace}; use core::{convert, fmt, ops::Range, str};
use elf::*; use elf::*;
use log::{debug, trace};
pub mod elf; pub mod elf;
mod file; mod file;
@ -21,11 +22,10 @@ pub enum Arch {
OpenRisc, OpenRisc,
} }
#[derive(Debug)] #[derive(Debug)]
pub enum Error { pub enum Error {
Parsing(&'static str), Parsing(&'static str),
Lookup(String) Lookup(String),
} }
impl convert::From<&'static str> for Error { impl convert::From<&'static str> for Error {
@ -37,10 +37,8 @@ impl convert::From<&'static str> for Error {
impl fmt::Display for Error { impl fmt::Display for Error {
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result { fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
match self { match self {
&Error::Parsing(desc) => &Error::Parsing(desc) => write!(f, "parse error: {}", desc),
write!(f, "parse error: {}", desc), &Error::Lookup(ref sym) => write!(f, "symbol lookup error: {}", sym),
&Error::Lookup(ref sym) =>
write!(f, "symbol lookup error: {}", sym),
} }
} }
} }
@ -103,20 +101,22 @@ impl Library {
let mut index = self.hash_bucket()[hash as usize % self.hash_bucket().len()] as usize; let mut index = self.hash_bucket()[hash as usize % self.hash_bucket().len()] as usize;
loop { loop {
if index == STN_UNDEF { return None } if index == STN_UNDEF {
return None;
}
let sym = &self.symtab()[index]; let sym = &self.symtab()[index];
let sym_name_off = sym.st_name as usize; let sym_name_off = sym.st_name as usize;
match self.strtab().get(sym_name_off..sym_name_off + name.len()) { match self.strtab().get(sym_name_off..sym_name_off + name.len()) {
Some(sym_name) if sym_name == name => { Some(sym_name) if sym_name == name => {
if ELF32_ST_BIND(sym.st_info) & STB_GLOBAL == 0 { if ELF32_ST_BIND(sym.st_info) & STB_GLOBAL == 0 {
return None return None;
} }
match sym.st_shndx { match sym.st_shndx {
SHN_UNDEF => return None, SHN_UNDEF => return None,
SHN_ABS => return Some(self.image.ptr() as u32 + sym.st_value), SHN_ABS => return Some(self.image.ptr() as u32 + sym.st_value),
_ => return Some(self.image.ptr() as u32 + sym.st_value) _ => return Some(self.image.ptr() as u32 + sym.st_value),
} }
} }
_ => (), _ => (),
@ -127,9 +127,15 @@ impl Library {
} }
pub fn name_starting_at(&self, offset: usize) -> Result<&[u8], Error> { pub fn name_starting_at(&self, offset: usize) -> Result<&[u8], Error> {
let size = self.strtab().iter().skip(offset).position(|&x| x == 0) let size = self
.strtab()
.iter()
.skip(offset)
.position(|&x| x == 0)
.ok_or("symbol in symbol table not null-terminated")?; .ok_or("symbol in symbol table not null-terminated")?;
Ok(self.strtab().get(offset..offset + size) Ok(self
.strtab()
.get(offset..offset + size)
.ok_or("cannot read symbol name")?) .ok_or("cannot read symbol name")?)
} }
@ -138,58 +144,64 @@ impl Library {
reloc::rebind(self.arch, self, name, addr as Elf32_Word) reloc::rebind(self.arch, self, name, addr as Elf32_Word)
} }
pub fn exidx(&self) -> &[u32] { pub fn exidx(&self) -> &[EXIDX_Entry] {
self.image.get_ref_slice_unchecked(&self.exidx) self.image.get_ref_slice_unchecked(&self.exidx)
} }
} }
pub fn load( pub fn load(data: &[u8], resolve: &dyn Fn(&[u8]) -> Option<Elf32_Word>) -> Result<Library, Error> {
data: &[u8],
resolve: &dyn Fn(&[u8]) -> Option<Elf32_Word>
) -> Result<Library, Error> {
// validate ELF file // validate ELF file
let file = file::File::new(data) let file = file::File::new(data).ok_or("cannot read ELF header")?;
.ok_or("cannot read ELF header")?;
if file.ehdr.e_type != ET_DYN { if file.ehdr.e_type != ET_DYN {
return Err("not a shared library")? return Err("not a shared library")?;
} }
let arch = file.arch() let arch = file.arch().ok_or("not for a supported architecture")?;
.ok_or("not for a supported architecture")?;
// prepare target memory // prepare target memory
let image_size = file.program_headers() let image_size = file
.program_headers()
.filter_map(|phdr| phdr.map(|phdr| phdr.p_vaddr + phdr.p_memsz)) .filter_map(|phdr| phdr.map(|phdr| phdr.p_vaddr + phdr.p_memsz))
.max() .max()
.unwrap_or(0) as usize; .unwrap_or(0) as usize;
let image_align = file.program_headers() let image_align = file
.filter_map(|phdr| phdr.and_then(|phdr| { .program_headers()
.filter_map(|phdr| {
phdr.and_then(|phdr| {
if phdr.p_type == PT_LOAD { if phdr.p_type == PT_LOAD {
Some(phdr.p_align) Some(phdr.p_align)
} else { } else {
None None
} }
})) })
})
.max() .max()
.unwrap_or(4) as usize; .unwrap_or(4) as usize;
// 1 image for all segments // 1 image for all segments
let mut image = image::Image::new(image_size, image_align) let mut image = image::Image::new(image_size, image_align).map_err(|_| "cannot allocate target image")?;
.map_err(|_| "cannot allocate target image")?; debug!(
debug!("ELF target: {} bytes, align to {:X}, allocated at {:08X}", image_size, image_align, image.ptr() as usize); "ELF target: {} bytes, align to {:X}, allocated at {:08X}",
image_size,
image_align,
image.ptr() as usize
);
// LOAD // LOAD
for phdr in file.program_headers() { for phdr in file.program_headers() {
let phdr = phdr.ok_or("cannot read program header")?; let phdr = phdr.ok_or("cannot read program header")?;
trace!("Program header: {:08X}+{:08X} to {:08X}", trace!(
phdr.p_offset, phdr.p_filesz, "Program header: {:08X}+{:08X} to {:08X}",
phdr.p_offset,
phdr.p_filesz,
image.ptr() as u32 image.ptr() as u32
); );
let file_range = phdr.p_offset as usize..(phdr.p_offset + phdr.p_filesz) as usize; let file_range = phdr.p_offset as usize..(phdr.p_offset + phdr.p_filesz) as usize;
match phdr.p_type { match phdr.p_type {
PT_LOAD => { PT_LOAD => {
let src = file.get(file_range) let src = file
.get(file_range)
.ok_or("program header requests an out of bounds load (in file)")?; .ok_or("program header requests an out of bounds load (in file)")?;
let dst = image.get_mut(phdr.p_vaddr as usize.. let dst = image
(phdr.p_vaddr + phdr.p_filesz) as usize) .get_mut(phdr.p_vaddr as usize..(phdr.p_vaddr + phdr.p_filesz) as usize)
.ok_or("program header requests an out of bounds load (in target)")?; .ok_or("program header requests an out of bounds load (in target)")?;
dst.copy_from_slice(src); dst.copy_from_slice(src);
} }
@ -203,9 +215,9 @@ pub fn load(
let shdr = shdr.ok_or("cannot read section header")?; let shdr = shdr.ok_or("cannot read section header")?;
match shdr.sh_type as usize { match shdr.sh_type as usize {
SHT_ARM_EXIDX => { SHT_ARM_EXIDX => {
let range = shdr.sh_addr as usize.. let range = shdr.sh_addr as usize..(shdr.sh_addr + shdr.sh_size) as usize;
(shdr.sh_addr + shdr.sh_size) as usize; let _ = image
let _ = image.get(range.clone()) .get(range.clone())
.ok_or("section header specifies EXIDX outside of image (in target)")?; .ok_or("section header specifies EXIDX outside of image (in target)")?;
exidx = Some(range); exidx = Some(range);
} }
@ -214,11 +226,14 @@ pub fn load(
} }
// relocate DYNAMIC // relocate DYNAMIC
let dyn_range = file.dyn_header_vaddr() let dyn_range = file.dyn_header_vaddr().ok_or("cannot find a dynamic header")?;
.ok_or("cannot find a dynamic header")?;
let dyn_section = image.dyn_section(dyn_range.clone())?; let dyn_section = image.dyn_section(dyn_range.clone())?;
debug!("Relocating {} rela, {} rel, {} pltrel", debug!(
dyn_section.rela.len(), dyn_section.rel.len(), dyn_section.pltrel.len()); "Relocating {} rela, {} rel, {} pltrel",
dyn_section.rela.len(),
dyn_section.rel.len(),
dyn_section.pltrel.len()
);
let lib = Library { let lib = Library {
arch, arch,
image, image,

View File

@ -1,16 +1,10 @@
use alloc::string::String; use alloc::string::String;
use libcortex_a9::{asm::{dsb, isb},
cache::{bpiall, dcci_slice, iciallu}};
use log::trace; use log::trace;
use super::{
Arch, use super::{elf::*, image::Image, Arch, Error, Library};
elf::*,
Error,
image::Image,
Library,
};
use libcortex_a9::{
cache::{dcci_slice, iciallu, bpiall},
asm::{dsb, isb},
};
pub trait Relocatable { pub trait Relocatable {
fn offset(&self) -> usize; fn offset(&self) -> usize;
@ -59,29 +53,25 @@ impl Relocatable for Elf32_Rela {
enum RelType { enum RelType {
None, None,
Relative, Relative,
Lookup, LookupAbs,
LookupRel,
} }
impl RelType { impl RelType {
pub fn new(arch: Arch, type_info: u8) -> Option<Self> { pub fn new(arch: Arch, type_info: u8) -> Option<Self> {
match type_info { match type_info {
R_OR1K_NONE if arch == Arch::OpenRisc => R_OR1K_NONE if arch == Arch::OpenRisc => Some(RelType::None),
Some(RelType::None), R_ARM_NONE if arch == Arch::Arm => Some(RelType::None),
R_ARM_NONE if arch == Arch::Arm =>
Some(RelType::None),
R_OR1K_RELATIVE if arch == Arch::OpenRisc => R_OR1K_RELATIVE if arch == Arch::OpenRisc => Some(RelType::Relative),
Some(RelType::Relative), R_ARM_RELATIVE if arch == Arch::Arm => Some(RelType::Relative),
R_ARM_RELATIVE if arch == Arch::Arm =>
Some(RelType::Relative),
R_OR1K_32 | R_OR1K_GLOB_DAT | R_OR1K_JMP_SLOT R_OR1K_32 | R_OR1K_GLOB_DAT | R_OR1K_JMP_SLOT if arch == Arch::OpenRisc => Some(RelType::LookupAbs),
if arch == Arch::OpenRisc => Some(RelType::Lookup), R_ARM_GLOB_DAT | R_ARM_JUMP_SLOT | R_ARM_ABS32 if arch == Arch::Arm => Some(RelType::LookupAbs),
R_ARM_GLOB_DAT | R_ARM_JUMP_SLOT
if arch == Arch::Arm => Some(RelType::Lookup),
_ => R_ARM_PREL31 if arch == Arch::Arm => Some(RelType::LookupRel),
None
_ => None,
} }
} }
} }
@ -93,71 +83,108 @@ fn format_sym_name(sym_name: &[u8]) -> String {
} }
pub fn relocate<R: Relocatable>( pub fn relocate<R: Relocatable>(
arch: Arch, lib: &Library, arch: Arch,
rel: &R, resolve: &dyn Fn(&[u8]) -> Option<Elf32_Word> lib: &Library,
rel: &R,
resolve: &dyn Fn(&[u8]) -> Option<Elf32_Word>,
) -> Result<(), Error> { ) -> Result<(), Error> {
let sym; let sym;
if rel.sym_info() == 0 { if rel.sym_info() == 0 {
sym = None; sym = None;
} else { } else {
sym = Some(lib.symtab().get(rel.sym_info() as usize) sym = Some(
.ok_or("symbol out of bounds of symbol table")?) lib.symtab()
.get(rel.sym_info() as usize)
.ok_or("symbol out of bounds of symbol table")?,
)
} }
let rel_type = RelType::new(arch, rel.type_info()) let rel_type = RelType::new(arch, rel.type_info()).ok_or("unsupported relocation type")?;
.ok_or("unsupported relocation type")?; let value = match rel_type {
let value; RelType::None => return Ok(()),
match rel_type {
RelType::None =>
return Ok(()),
RelType::Relative => { RelType::Relative => {
let addend = rel.addend(&lib.image); let addend = rel.addend(&lib.image);
value = lib.image.ptr().wrapping_offset(addend as isize) as Elf32_Word; lib.image.ptr().wrapping_offset(addend as isize) as Elf32_Word
} }
RelType::Lookup => { RelType::LookupAbs | RelType::LookupRel => {
let sym = sym.ok_or("relocation requires an associated symbol")?; let sym = sym.ok_or("relocation requires an associated symbol")?;
let sym_name = lib.name_starting_at(sym.st_name as usize)?; let sym_name = lib.name_starting_at(sym.st_name as usize)?;
if let Some(addr) = lib.lookup(sym_name) { let sym_addr = if let Some(addr) = lib.lookup(sym_name) {
// First, try to resolve against itself. // First, try to resolve against itself.
trace!("looked up symbol {} in image", format_sym_name(sym_name)); trace!("looked up symbol {} in image", format_sym_name(sym_name));
value = lib.image.ptr() as u32 + addr; addr
} else if let Some(addr) = resolve(sym_name) { } else if let Some(addr) = resolve(sym_name) {
// Second, call the user-provided function. // Second, call the user-provided function.
trace!("resolved symbol {:?}", format_sym_name(sym_name)); trace!("resolved symbol {:?}", format_sym_name(sym_name));
value = addr; addr
} else { } else {
// We couldn't find it anywhere. // We couldn't find it anywhere.
return Err(Error::Lookup(format_sym_name(sym_name))) return Err(Error::Lookup(format_sym_name(sym_name)));
};
match rel_type {
RelType::LookupAbs => sym_addr,
RelType::LookupRel => {
sym_addr.wrapping_sub(lib.image.ptr().wrapping_offset(rel.offset() as isize) as Elf32_Addr)
}
_ => unreachable!(),
} }
} }
};
match rel.type_info() {
R_ARM_PREL31 => {
let reloc_word = lib
.image
.get_ref::<Elf32_Word>(rel.offset())
.ok_or("relocation offset cannot be read")?;
lib.image
.write(rel.offset(), (reloc_word & 0x80000000) | (value & 0x7FFFFFFF))
} }
lib.image.write(rel.offset(), value) _ => lib.image.write(rel.offset(), value),
}
} }
pub fn rebind( pub fn rebind(arch: Arch, lib: &Library, name: &[u8], value: Elf32_Word) -> Result<(), Error> {
arch: Arch, lib: &Library, name: &[u8], value: Elf32_Word fn rebind_symbol_to_value<R: Relocatable>(
) -> Result<(), Error> { arch: Arch,
for rela in lib.pltrel() { lib: &Library,
let rel_type = RelType::new(arch, rela.type_info()) name: &[u8],
.ok_or("unsupported relocation type")?; value: Elf32_Word,
relocs: &[R],
) -> Result<(), Error> {
for reloc in relocs {
let rel_type = RelType::new(arch, reloc.type_info()).ok_or("unsupported relocation type")?;
match rel_type { match rel_type {
RelType::Lookup => { RelType::LookupAbs => {
let sym = lib.symtab().get(ELF32_R_SYM(rela.r_info) as usize) let sym = lib
.symtab()
.get(reloc.sym_info() as usize)
.ok_or("symbol out of bounds of symbol table")?; .ok_or("symbol out of bounds of symbol table")?;
let sym_name = lib.name_starting_at(sym.st_name as usize)?; let sym_name = lib.name_starting_at(sym.st_name as usize)?;
if sym_name == name { if sym_name == name {
lib.image.write(rela.offset(), value)? lib.image.write(reloc.offset(), value)?
} }
} }
// No associated symbols for other relocation types. // No associated symbols for other relocation types.
_ => {} _ => {}
} }
} }
Ok(())
}
if lib.pltrel().is_empty() {
rebind_symbol_to_value(arch, lib, name, value, lib.rela())?;
} else {
rebind_symbol_to_value(arch, lib, name, value, lib.pltrel())?;
}
// FIXME: the cache maintainance operations may be more than enough, // FIXME: the cache maintainance operations may be more than enough,
// may cause performance degradation. // may cause performance degradation.
dcci_slice(lib.image.data); dcci_slice(lib.image.data);

17
src/libio/Cargo.toml.tpl Normal file
View File

@ -0,0 +1,17 @@
[package]
authors = ["M-Labs"]
name = "io"
version = "0.0.0"
[lib]
name = "io"
path = "lib.rs"
[dependencies]
core_io = { version = "0.1", features = ["collections"] }
byteorder = { version = "1.0", default-features = false, optional = true }
libsupport_zynq = { path = "@@ZYNQ_RS@@/libsupport_zynq", default-features = false, features = ["alloc_core"] }
[features]
alloc = []

85
src/libio/cursor.rs Normal file
View File

@ -0,0 +1,85 @@
#[cfg(feature = "alloc")]
use alloc::vec::Vec;
use core_io::{Error as IoError, Read, Write};
#[derive(Debug, Clone)]
pub struct Cursor<T> {
inner: T,
pos: usize,
}
impl<T> Cursor<T> {
#[inline]
pub fn new(inner: T) -> Cursor<T> {
Cursor { inner, pos: 0 }
}
#[inline]
pub fn into_inner(self) -> T {
self.inner
}
#[inline]
pub fn get_ref(&self) -> &T {
&self.inner
}
#[inline]
pub fn get_mut(&mut self) -> &mut T {
&mut self.inner
}
#[inline]
pub fn position(&self) -> usize {
self.pos
}
#[inline]
pub fn set_position(&mut self, pos: usize) {
self.pos = pos
}
}
impl<T: AsRef<[u8]>> Read for Cursor<T> {
fn read(&mut self, buf: &mut [u8]) -> Result<usize, IoError> {
let data = &self.inner.as_ref()[self.pos..];
let len = buf.len().min(data.len());
// ``copy_from_slice`` generates AXI bursts, use a regular loop instead
for i in 0..len {
buf[i] = data[i];
}
self.pos += len;
Ok(len)
}
}
impl Write for Cursor<&mut [u8]> {
fn write(&mut self, buf: &[u8]) -> Result<usize, IoError> {
let data = &mut self.inner[self.pos..];
let len = buf.len().min(data.len());
for i in 0..len {
data[i] = buf[i];
}
self.pos += len;
Ok(len)
}
#[inline]
fn flush(&mut self) -> Result<(), IoError> {
Ok(())
}
}
#[cfg(feature = "alloc")]
impl Write for Cursor<Vec<u8>> {
fn write(&mut self, buf: &[u8]) -> Result<usize, IoError> {
self.inner.extend_from_slice(buf);
Ok(buf.len())
}
#[inline]
fn flush(&mut self) -> Result<(), IoError> {
Ok(())
}
}

19
src/libio/lib.rs Normal file
View File

@ -0,0 +1,19 @@
#![no_std]
#![feature(never_type)]
#[cfg(feature = "alloc")]
extern crate alloc;
extern crate core_io;
#[cfg(feature = "byteorder")]
extern crate byteorder;
pub mod cursor;
#[cfg(feature = "byteorder")]
pub mod proto;
pub use cursor::Cursor;
#[cfg(all(feature = "byteorder", feature = "alloc"))]
pub use proto::ReadStringError;
#[cfg(feature = "byteorder")]
pub use proto::{ProtoRead, ProtoWrite};

View File

@ -1,15 +1,15 @@
#[cfg(feature = "alloc")]
use alloc::{string::String, vec};
use core::str::Utf8Error; use core::str::Utf8Error;
use byteorder::{ByteOrder, NativeEndian};
use alloc::vec;
use alloc::string::String;
use core_io::{Read, Write, Error as IoError}; use byteorder::{ByteOrder, NativeEndian};
use core_io::{Error as IoError, Read, Write};
#[allow(dead_code)] #[allow(dead_code)]
#[derive(Debug, Clone, PartialEq)] #[derive(Debug, Clone, PartialEq)]
pub enum ReadStringError<T> { pub enum ReadStringError<T> {
Utf8(Utf8Error), Utf8(Utf8Error),
Other(T) Other(T),
} }
pub trait ProtoRead { pub trait ProtoRead {
@ -51,7 +51,8 @@ pub trait ProtoRead {
} }
#[inline] #[inline]
fn read_bytes(&mut self) -> Result<::alloc::vec::Vec<u8>, Self::ReadError> { #[cfg(feature = "alloc")]
fn read_bytes(&mut self) -> Result<vec::Vec<u8>, Self::ReadError> {
let length = self.read_u32()?; let length = self.read_u32()?;
let mut value = vec![0; length as usize]; let mut value = vec![0; length as usize];
self.read_exact(&mut value)?; self.read_exact(&mut value)?;
@ -59,7 +60,8 @@ pub trait ProtoRead {
} }
#[inline] #[inline]
fn read_string(&mut self) -> Result<::alloc::string::String, ReadStringError<Self::ReadError>> { #[cfg(feature = "alloc")]
fn read_string(&mut self) -> Result<String, ReadStringError<Self::ReadError>> {
let bytes = self.read_bytes().map_err(ReadStringError::Other)?; let bytes = self.read_bytes().map_err(ReadStringError::Other)?;
String::from_utf8(bytes).map_err(|err| ReadStringError::Utf8(err.utf8_error())) String::from_utf8(bytes).map_err(|err| ReadStringError::Utf8(err.utf8_error()))
} }
@ -136,12 +138,15 @@ pub trait ProtoWrite {
} }
#[inline] #[inline]
#[cfg(feature = "alloc")]
fn write_string(&mut self, value: &str) -> Result<(), Self::WriteError> { fn write_string(&mut self, value: &str) -> Result<(), Self::WriteError> {
self.write_bytes(value.as_bytes()) self.write_bytes(value.as_bytes())
} }
} }
impl<T> ProtoRead for T where T: Read + ?Sized { impl<T> ProtoRead for T
where T: Read + ?Sized
{
type ReadError = IoError; type ReadError = IoError;
fn read_exact(&mut self, buf: &mut [u8]) -> Result<(), Self::ReadError> { fn read_exact(&mut self, buf: &mut [u8]) -> Result<(), Self::ReadError> {
@ -149,7 +154,9 @@ impl<T> ProtoRead for T where T: Read + ?Sized {
} }
} }
impl<T> ProtoWrite for T where T: Write + ?Sized { impl<T> ProtoWrite for T
where T: Write + ?Sized
{
type WriteError = IoError; type WriteError = IoError;
fn write_all(&mut self, buf: &[u8]) -> Result<(), Self::WriteError> { fn write_all(&mut self, buf: &[u8]) -> Result<(), Self::WriteError> {

View File

@ -0,0 +1,40 @@
[package]
name = "ksupport"
description = "Kernel support for Zynq-based platforms"
version = "0.1.0"
authors = ["M-Labs"]
edition = "2018"
[build-dependencies]
build_zynq = { path = "../libbuild_zynq" }
[dependencies]
cslice = "0.3"
log = "0.4"
nb = "0.1"
core_io = { version = "0.1", features = ["collections"] }
byteorder = { version = "1.3", default-features = false }
void = { version = "1", default-features = false }
log_buffer = { version = "1.2" }
libm = { version = "0.2", features = ["unstable"] }
vcell = "0.1"
libboard_zynq = { path = "@@ZYNQ_RS@@/libboard_zynq", features = ["ipv6"]}
libsupport_zynq = { path = "@@ZYNQ_RS@@/libsupport_zynq", default-features = false, features = ["alloc_core"] }
libcortex_a9 = { path = "@@ZYNQ_RS@@/libcortex_a9" }
libasync = { path = "@@ZYNQ_RS@@/libasync" }
libregister = { path = "@@ZYNQ_RS@@/libregister" }
libconfig = { path = "@@ZYNQ_RS@@/libconfig", features = ["fat_lfn", "ipv6"] }
dyld = { path = "../libdyld" }
dwarf = { path = "../libdwarf" }
unwind = { path = "../libunwind" }
libc = { path = "../libc" }
io = { path = "../libio" }
libboard_artiq = { path = "../libboard_artiq" }
[dependencies.nalgebra]
git = "https://git.m-labs.hk/M-Labs/nalgebra.git"
rev = "dd00f9b"
default-features = false
features = ["libm", "alloc"]

5
src/libksupport/build.rs Normal file
View File

@ -0,0 +1,5 @@
extern crate build_zynq;
fn main() {
build_zynq::cfg();
}

View File

@ -0,0 +1,561 @@
// From Current artiq firmware ksupport implementation.
// Modified to suit the case of artiq-zynq port, for ARM EHABI.
// Portions of the code in this file are derived from code by:
//
// Copyright 2015 The Rust Project Developers. See the COPYRIGHT
// file at http://rust-lang.org/COPYRIGHT.
//
// Licensed under the Apache License, Version 2.0 <LICENSE-APACHE or
// http://www.apache.org/licenses/LICENSE-2.0> or the MIT license
// <LICENSE-MIT or http://opensource.org/licenses/MIT>, at your
// option. This file may not be copied, modified, or distributed
// except according to those terms.
#![allow(non_camel_case_types)]
use core::mem;
use core_io::Error as ReadError;
use cslice::{AsCSlice, CSlice};
use dwarf::eh::{self, EHAction, EHContext};
use io::{Cursor, ProtoRead};
use libc::{c_int, c_void, uintptr_t};
use log::{error, trace};
use unwind as uw;
use crate::kernel::KERNEL_IMAGE;
const EXCEPTION_CLASS: uw::_Unwind_Exception_Class = 0x4d_4c_42_53_41_52_54_51; /* 'MLBSARTQ' */
#[cfg(target_arch = "arm")]
const UNWIND_DATA_REG: (i32, i32) = (0, 1); // R0, R1
// Note: CSlice within an exception may not be actual cslice, they may be strings that exist only
// in the host. If the length == usize:MAX, the pointer is actually a string key in the host.
#[repr(C)]
#[derive(Clone, Copy)]
pub struct Exception<'a> {
pub id: u32,
pub file: CSlice<'a, u8>,
pub line: u32,
pub column: u32,
pub function: CSlice<'a, u8>,
pub message: CSlice<'a, u8>,
pub param: [i64; 3],
}
fn str_err(_: core::str::Utf8Error) -> core::fmt::Error {
core::fmt::Error
}
fn exception_str<'a>(s: &'a CSlice<'a, u8>) -> Result<&'a str, core::str::Utf8Error> {
if s.len() == usize::MAX {
Ok("<host string>")
} else {
core::str::from_utf8(s.as_ref())
}
}
impl<'a> core::fmt::Debug for Exception<'a> {
fn fmt(&self, f: &mut core::fmt::Formatter<'_>) -> core::fmt::Result {
write!(
f,
"Exception {} from {} in {}:{}:{}, message: {}",
self.id,
exception_str(&self.function).map_err(str_err)?,
exception_str(&self.file).map_err(str_err)?,
self.line,
self.column,
exception_str(&self.message).map_err(str_err)?
)
}
}
const MAX_INFLIGHT_EXCEPTIONS: usize = 10;
const MAX_BACKTRACE_SIZE: usize = 128;
#[derive(Debug, Default)]
pub struct StackPointerBacktrace {
pub stack_pointer: usize,
pub initial_backtrace_size: usize,
pub current_backtrace_size: usize,
}
struct ExceptionBuffer {
// we need n _Unwind_Exception, because each will have their own private data
uw_exceptions: [uw::_Unwind_Exception; MAX_INFLIGHT_EXCEPTIONS],
exceptions: [Option<Exception<'static>>; MAX_INFLIGHT_EXCEPTIONS + 1],
exception_stack: [isize; MAX_INFLIGHT_EXCEPTIONS + 1],
// nested exceptions will share the backtrace buffer, treated as a tree
// backtrace contains a tuple of IP and SP
backtrace: [(usize, usize); MAX_BACKTRACE_SIZE],
backtrace_size: usize,
// stack pointers are stored to reconstruct backtrace for each exception
stack_pointers: [StackPointerBacktrace; MAX_INFLIGHT_EXCEPTIONS + 1],
// current allocated nested exceptions
exception_count: usize,
}
static mut EXCEPTION_BUFFER: ExceptionBuffer = ExceptionBuffer {
uw_exceptions: [uw::_Unwind_Exception {
exception_class: EXCEPTION_CLASS,
exception_cleanup: cleanup,
private: [0; uw::unwinder_private_data_size],
}; MAX_INFLIGHT_EXCEPTIONS],
exceptions: [None; MAX_INFLIGHT_EXCEPTIONS + 1],
exception_stack: [-1; MAX_INFLIGHT_EXCEPTIONS + 1],
backtrace: [(0, 0); MAX_BACKTRACE_SIZE],
backtrace_size: 0,
stack_pointers: [StackPointerBacktrace {
stack_pointer: 0,
initial_backtrace_size: 0,
current_backtrace_size: 0,
}; MAX_INFLIGHT_EXCEPTIONS + 1],
exception_count: 0,
};
pub unsafe extern "C" fn reset_exception_buffer() {
trace!("reset exception buffer");
EXCEPTION_BUFFER.uw_exceptions = [uw::_Unwind_Exception {
exception_class: EXCEPTION_CLASS,
exception_cleanup: cleanup,
private: [0; uw::unwinder_private_data_size],
}; MAX_INFLIGHT_EXCEPTIONS];
EXCEPTION_BUFFER.exceptions = [None; MAX_INFLIGHT_EXCEPTIONS + 1];
EXCEPTION_BUFFER.exception_stack = [-1; MAX_INFLIGHT_EXCEPTIONS + 1];
EXCEPTION_BUFFER.backtrace_size = 0;
EXCEPTION_BUFFER.exception_count = 0;
}
type _Unwind_Stop_Fn = extern "C" fn(
version: c_int,
actions: i32,
exception_class: uw::_Unwind_Exception_Class,
exception_object: *mut uw::_Unwind_Exception,
context: *mut uw::_Unwind_Context,
stop_parameter: *mut c_void,
) -> uw::_Unwind_Reason_Code;
extern "C" {
// not defined in EHABI, but LLVM added it and is useful to us
fn _Unwind_ForcedUnwind(
exception: *mut uw::_Unwind_Exception,
stop_fn: _Unwind_Stop_Fn,
stop_parameter: *mut c_void,
) -> uw::_Unwind_Reason_Code;
}
unsafe fn find_eh_action(context: *mut uw::_Unwind_Context, foreign_exception: bool, id: u32) -> Result<EHAction, ()> {
let lsda = uw::_Unwind_GetLanguageSpecificData(context) as *const u8;
let mut ip_before_instr: c_int = 0;
let ip = uw::_Unwind_GetIPInfo(context, &mut ip_before_instr);
let eh_context = EHContext {
// The return address points 1 byte past the call instruction,
// which could be in the next IP range in LSDA range table.
ip: if ip_before_instr != 0 { ip } else { ip - 1 },
func_start: uw::_Unwind_GetRegionStart(context),
get_text_start: &|| uw::_Unwind_GetTextRelBase(context),
get_data_start: &|| uw::_Unwind_GetDataRelBase(context),
};
eh::find_eh_action(lsda, &eh_context, foreign_exception, id)
}
pub unsafe fn artiq_personality(
_state: uw::_Unwind_State,
exception_object: *mut uw::_Unwind_Exception,
context: *mut uw::_Unwind_Context,
) -> uw::_Unwind_Reason_Code {
// we will only do phase 2 forced unwinding now
// The DWARF unwinder assumes that _Unwind_Context holds things like the function
// and LSDA pointers, however ARM EHABI places them into the exception object.
// To preserve signatures of functions like _Unwind_GetLanguageSpecificData(), which
// take only the context pointer, GCC personality routines stash a pointer to
// exception_object in the context, using location reserved for ARM's
// "scratch register" (r12).
uw::_Unwind_SetGR(context, uw::UNWIND_POINTER_REG, exception_object as uw::_Unwind_Ptr);
// ...A more principled approach would be to provide the full definition of ARM's
// _Unwind_Context in our libunwind bindings and fetch the required data from there
// directly, bypassing DWARF compatibility functions.
let exception_class = (*exception_object).exception_class;
let foreign_exception = exception_class != EXCEPTION_CLASS;
assert!(!foreign_exception, "we do not expect foreign exceptions");
let index = EXCEPTION_BUFFER.exception_stack[EXCEPTION_BUFFER.exception_count - 1];
assert!(index != -1);
let exception = EXCEPTION_BUFFER.exceptions[index as usize].as_ref().unwrap();
let id = exception.id;
let eh_action = match find_eh_action(context, foreign_exception, id) {
Ok(action) => action,
Err(_) => return uw::_URC_FAILURE,
};
match eh_action {
EHAction::None => return continue_unwind(exception_object, context),
EHAction::Cleanup(lpad) | EHAction::Catch(lpad) => {
uw::_Unwind_SetGR(context, UNWIND_DATA_REG.0, exception_object as uintptr_t);
uw::_Unwind_SetGR(context, UNWIND_DATA_REG.1, exception as *const _ as uw::_Unwind_Word);
uw::_Unwind_SetIP(context, lpad);
return uw::_URC_INSTALL_CONTEXT;
}
EHAction::Terminate => return uw::_URC_FAILURE,
}
// On ARM EHABI the personality routine is responsible for actually
// unwinding a single stack frame before returning (ARM EHABI Sec. 6.1).
unsafe fn continue_unwind(
exception_object: *mut uw::_Unwind_Exception,
context: *mut uw::_Unwind_Context,
) -> uw::_Unwind_Reason_Code {
let reason = __gnu_unwind_frame(exception_object, context);
if reason == uw::_URC_NO_REASON {
uw::_URC_CONTINUE_UNWIND
} else {
reason
}
}
// defined in libgcc
extern "C" {
fn __gnu_unwind_frame(
exception_object: *mut uw::_Unwind_Exception,
context: *mut uw::_Unwind_Context,
) -> uw::_Unwind_Reason_Code;
}
}
pub unsafe extern "C" fn raise(exception: *const Exception) -> ! {
let count = EXCEPTION_BUFFER.exception_count;
let stack = &mut EXCEPTION_BUFFER.exception_stack;
let diff = exception as isize - EXCEPTION_BUFFER.exceptions.as_ptr() as isize;
if 0 <= diff && diff <= (mem::size_of::<Option<Exception>>() * MAX_INFLIGHT_EXCEPTIONS) as isize {
let index = diff / (mem::size_of::<Option<Exception>>() as isize);
trace!("reraise at {}", index);
let mut found = false;
for i in 0..=MAX_INFLIGHT_EXCEPTIONS + 1 {
if found {
if stack[i] == -1 {
stack[i - 1] = index;
assert!(i == count);
break;
} else {
stack[i - 1] = stack[i];
}
} else {
if stack[i] == index {
found = true;
}
}
}
assert!(found);
let _result = _Unwind_ForcedUnwind(
&mut EXCEPTION_BUFFER.uw_exceptions[stack[count - 1] as usize],
stop_fn,
core::ptr::null_mut(),
);
} else {
if count < MAX_INFLIGHT_EXCEPTIONS {
trace!("raising exception at level {}", count);
let exception = &*exception;
for (i, slot) in EXCEPTION_BUFFER.exceptions.iter_mut().enumerate() {
// we should always be able to find a slot
if slot.is_none() {
*slot = Some(*mem::transmute::<*const Exception, *const Exception<'static>>(
exception,
));
EXCEPTION_BUFFER.exception_stack[count] = i as isize;
EXCEPTION_BUFFER.uw_exceptions[i].private = [0; uw::unwinder_private_data_size];
EXCEPTION_BUFFER.stack_pointers[i] = StackPointerBacktrace {
stack_pointer: 0,
initial_backtrace_size: EXCEPTION_BUFFER.backtrace_size,
current_backtrace_size: 0,
};
EXCEPTION_BUFFER.exception_count += 1;
let _result =
_Unwind_ForcedUnwind(&mut EXCEPTION_BUFFER.uw_exceptions[i], stop_fn, core::ptr::null_mut());
}
}
} else {
error!("too many nested exceptions");
// TODO: better reporting?
let exception = Exception {
id: get_exception_id("RuntimeError"),
file: file!().as_c_slice(),
line: line!(),
column: column!(),
// https://github.com/rust-lang/rfcs/pull/1719
function: "__artiq_raise".as_c_slice(),
message: "too many nested exceptions".as_c_slice(),
param: [0, 0, 0],
};
EXCEPTION_BUFFER.exceptions[MAX_INFLIGHT_EXCEPTIONS] = Some(mem::transmute(exception));
EXCEPTION_BUFFER.stack_pointers[MAX_INFLIGHT_EXCEPTIONS] = Default::default();
EXCEPTION_BUFFER.exception_count += 1;
uncaught_exception()
}
}
unreachable!();
}
fn read_exception_string<'a>(reader: &mut Cursor<&[u8]>) -> Result<CSlice<'a, u8>, ReadError> {
let len = reader.read_u32()? as usize;
if len == usize::MAX {
let data = reader.read_u32()?;
Ok(unsafe { CSlice::new(data as *const u8, len) })
} else {
let pos = reader.position();
let slice = unsafe {
let ptr = reader.get_ref().as_ptr().offset(pos as isize);
CSlice::new(ptr, len)
};
reader.set_position(pos + len);
Ok(slice)
}
}
fn read_exception(raw_exception: &[u8]) -> Result<Exception, ReadError> {
let mut reader = Cursor::new(raw_exception);
let mut byte = reader.read_u8()?;
// to sync
while byte != 0x5a {
byte = reader.read_u8()?;
}
// skip sync bytes, 0x09 indicates exception
while byte != 0x09 {
byte = reader.read_u8()?;
}
let _len = reader.read_u32()?;
// ignore the remaining exceptions, stack traces etc. - unwinding from another device would be unwise anyway
Ok(Exception {
id: reader.read_u32()?,
message: read_exception_string(&mut reader)?,
param: [
reader.read_u64()? as i64,
reader.read_u64()? as i64,
reader.read_u64()? as i64,
],
file: read_exception_string(&mut reader)?,
line: reader.read_u32()?,
column: reader.read_u32()?,
function: read_exception_string(&mut reader)?,
})
}
pub fn raise_raw(raw_exception: &[u8]) -> ! {
use crate::artiq_raise;
if let Ok(exception) = read_exception(raw_exception) {
unsafe { raise(&exception) };
} else {
artiq_raise!("SubkernelError", "Error passing exception");
}
}
pub unsafe extern "C" fn resume() -> ! {
trace!("resume");
assert!(EXCEPTION_BUFFER.exception_count != 0);
let i = EXCEPTION_BUFFER.exception_stack[EXCEPTION_BUFFER.exception_count - 1];
assert!(i != -1);
let _result = _Unwind_ForcedUnwind(
&mut EXCEPTION_BUFFER.uw_exceptions[i as usize],
stop_fn,
core::ptr::null_mut(),
);
unreachable!()
}
pub unsafe extern "C" fn end_catch() {
let mut count = EXCEPTION_BUFFER.exception_count;
assert!(count != 0);
// we remove all exceptions with SP <= current exception SP
// i.e. the outer exception escapes the finally block
let index = EXCEPTION_BUFFER.exception_stack[count - 1] as usize;
EXCEPTION_BUFFER.exception_stack[count - 1] = -1;
EXCEPTION_BUFFER.exceptions[index] = None;
let outer_sp = EXCEPTION_BUFFER.stack_pointers[index].stack_pointer;
count -= 1;
for i in (0..count).rev() {
let index = EXCEPTION_BUFFER.exception_stack[i];
assert!(index != -1);
let index = index as usize;
let sp = EXCEPTION_BUFFER.stack_pointers[index].stack_pointer;
if sp >= outer_sp {
break;
}
EXCEPTION_BUFFER.exceptions[index] = None;
EXCEPTION_BUFFER.exception_stack[i] = -1;
count -= 1;
}
EXCEPTION_BUFFER.exception_count = count;
EXCEPTION_BUFFER.backtrace_size = if count > 0 {
let index = EXCEPTION_BUFFER.exception_stack[count - 1];
assert!(index != -1);
EXCEPTION_BUFFER.stack_pointers[index as usize].current_backtrace_size
} else {
0
};
}
extern "C" fn cleanup(_unwind_code: uw::_Unwind_Reason_Code, _uw_exception: *mut uw::_Unwind_Exception) {
unimplemented!()
}
fn uncaught_exception() -> ! {
unsafe {
// dump way to reorder the stack
for i in 0..EXCEPTION_BUFFER.exception_count {
if EXCEPTION_BUFFER.exception_stack[i] != i as isize {
// find the correct index
let index = EXCEPTION_BUFFER
.exception_stack
.iter()
.position(|v| *v == i as isize)
.unwrap();
let a = EXCEPTION_BUFFER.exception_stack[index];
let b = EXCEPTION_BUFFER.exception_stack[i];
assert!(a != -1 && b != -1);
core::mem::swap(
&mut EXCEPTION_BUFFER.exception_stack[index],
&mut EXCEPTION_BUFFER.exception_stack[i],
);
core::mem::swap(
&mut EXCEPTION_BUFFER.exceptions[a as usize],
&mut EXCEPTION_BUFFER.exceptions[b as usize],
);
core::mem::swap(
&mut EXCEPTION_BUFFER.stack_pointers[a as usize],
&mut EXCEPTION_BUFFER.stack_pointers[b as usize],
);
}
}
}
unsafe {
crate::kernel::core1::terminate(
EXCEPTION_BUFFER.exceptions[..EXCEPTION_BUFFER.exception_count].as_ref(),
EXCEPTION_BUFFER.stack_pointers[..EXCEPTION_BUFFER.exception_count].as_ref(),
EXCEPTION_BUFFER.backtrace[..EXCEPTION_BUFFER.backtrace_size].as_mut(),
)
}
}
// stop function which would be executed when we unwind each frame
extern "C" fn stop_fn(
_version: c_int,
actions: i32,
_uw_exception_class: uw::_Unwind_Exception_Class,
_uw_exception: *mut uw::_Unwind_Exception,
context: *mut uw::_Unwind_Context,
_stop_parameter: *mut c_void,
) -> uw::_Unwind_Reason_Code {
unsafe {
let load_addr = KERNEL_IMAGE.as_ref().unwrap().get_load_addr();
let backtrace_size = EXCEPTION_BUFFER.backtrace_size;
// we try to remove unrelated backtrace here to save some buffer size
if backtrace_size < MAX_BACKTRACE_SIZE {
let ip = uw::_Unwind_GetIP(context);
if ip >= load_addr {
let ip = ip - load_addr;
let sp = uw::_Unwind_GetGR(context, uw::UNWIND_SP_REG);
trace!("SP: {:X}, backtrace_size: {}", sp, backtrace_size);
EXCEPTION_BUFFER.backtrace[backtrace_size] = (ip, sp);
EXCEPTION_BUFFER.backtrace_size += 1;
let last_index = EXCEPTION_BUFFER.exception_stack[EXCEPTION_BUFFER.exception_count - 1];
assert!(last_index != -1);
let sp_info = &mut EXCEPTION_BUFFER.stack_pointers[last_index as usize];
sp_info.stack_pointer = sp;
sp_info.current_backtrace_size = backtrace_size + 1;
}
} else {
trace!("backtrace size exceeded");
}
if actions as u32 & uw::_US_END_OF_STACK as u32 != 0 {
uncaught_exception()
} else {
uw::_URC_NO_REASON
}
}
}
// Must be kept in sync with preallocate_runtime_exception_names() in `artiq.compiler.embedding`
static EXCEPTION_ID_LOOKUP: [(&str, u32); 22] = [
("RTIOUnderflow", 0),
("RTIOOverflow", 1),
("RTIODestinationUnreachable", 2),
("DMAError", 3),
("I2CError", 4),
("CacheError", 5),
("SPIError", 6),
("SubkernelError", 7),
("AssertionError", 8),
("AttributeError", 9),
("IndexError", 10),
("IOError", 11),
("KeyError", 12),
("NotImplementedError", 13),
("OverflowError", 14),
("RuntimeError", 15),
("TimeoutError", 16),
("TypeError", 17),
("ValueError", 18),
("ZeroDivisionError", 19),
("LinAlgError", 20),
("UnwrapNoneError", 21),
];
pub fn get_exception_id(name: &str) -> u32 {
for (n, id) in EXCEPTION_ID_LOOKUP.iter() {
if *n == name {
return *id;
}
}
unimplemented!("unallocated internal exception id")
}
#[macro_export]
macro_rules! artiq_raise {
($name:expr, $message:expr, $param0:expr, $param1:expr, $param2:expr) => {{
use cslice::AsCSlice;
let name_id = $crate::eh_artiq::get_exception_id($name);
let message_cl = $message.clone();
let exn = $crate::eh_artiq::Exception {
id: name_id,
file: file!().as_c_slice(),
line: line!(),
column: column!(),
// https://github.com/rust-lang/rfcs/pull/1719
function: "(Rust function)".as_c_slice(),
message: message_cl.as_c_slice(),
param: [$param0, $param1, $param2],
};
#[allow(unused_unsafe)]
unsafe {
$crate::eh_artiq::raise(&exn)
}
}};
($name:expr, $message:expr) => {{ artiq_raise!($name, $message, 0, 0, 0) }};
}
/// Takes as input exception id from host
/// Generates a new exception with:
/// * `id` set to `exn_id`
/// * `message` set to corresponding exception name from `EXCEPTION_ID_LOOKUP`
///
/// The message is matched on host to ensure correct exception is being referred
/// This test checks the synchronization of exception ids for runtime errors
#[no_mangle]
pub extern "C" fn test_exception_id_sync(exn_id: u32) {
let message = EXCEPTION_ID_LOOKUP
.iter()
.find_map(|&(name, id)| if id == exn_id { Some(name) } else { None })
.unwrap_or("unallocated internal exception id");
let exn = Exception {
id: exn_id,
file: file!().as_c_slice(),
line: 0,
column: 0,
function: "test_exception_id_sync".as_c_slice(),
message: message.as_c_slice(),
param: [0, 0, 0],
};
unsafe { raise(&exn) };
}

View File

@ -0,0 +1,97 @@
use libboard_zynq;
use crate::artiq_raise;
pub static mut I2C_BUS: Option<libboard_zynq::i2c::I2c> = None;
pub extern "C" fn start(busno: i32) {
if busno > 0 {
artiq_raise!("I2CError", "I2C bus could not be accessed");
}
unsafe {
if (&mut I2C_BUS).as_mut().unwrap().start().is_err() {
artiq_raise!("I2CError", "I2C start failed");
}
}
}
pub extern "C" fn restart(busno: i32) {
if busno > 0 {
artiq_raise!("I2CError", "I2C bus could not be accessed");
}
unsafe {
if (&mut I2C_BUS).as_mut().unwrap().restart().is_err() {
artiq_raise!("I2CError", "I2C restart failed");
}
}
}
pub extern "C" fn stop(busno: i32) {
if busno > 0 {
artiq_raise!("I2CError", "I2C bus could not be accessed");
}
unsafe {
if (&mut I2C_BUS).as_mut().unwrap().stop().is_err() {
artiq_raise!("I2CError", "I2C stop failed");
}
}
}
pub extern "C" fn write(busno: i32, data: i32) -> bool {
if busno > 0 {
artiq_raise!("I2CError", "I2C bus could not be accessed");
}
unsafe {
match (&mut I2C_BUS).as_mut().unwrap().write(data as u8) {
Ok(r) => r,
Err(_) => artiq_raise!("I2CError", "I2C write failed"),
}
}
}
pub extern "C" fn read(busno: i32, ack: bool) -> i32 {
if busno > 0 {
artiq_raise!("I2CError", "I2C bus could not be accessed");
}
unsafe {
match (&mut I2C_BUS).as_mut().unwrap().read(ack) {
Ok(r) => r as i32,
Err(_) => artiq_raise!("I2CError", "I2C read failed"),
}
}
}
pub extern "C" fn switch_select(busno: i32, address: i32, mask: i32) {
if busno > 0 {
artiq_raise!("I2CError", "I2C bus could not be accessed");
}
let ch = match mask {
//decode from mainline, PCA9548-centric API
0x00 => None,
0x01 => Some(0),
0x02 => Some(1),
0x04 => Some(2),
0x08 => Some(3),
0x10 => Some(4),
0x20 => Some(5),
0x40 => Some(6),
0x80 => Some(7),
_ => artiq_raise!("I2CError", "switch select supports only one channel"),
};
unsafe {
if (&mut I2C_BUS)
.as_mut()
.unwrap()
.pca954x_select(address as u8, ch)
.is_err()
{
artiq_raise!("I2CError", "switch select failed");
}
}
}
pub fn init() {
let mut i2c = libboard_zynq::i2c::I2c::i2c0();
i2c.init().expect("I2C bus initialization failed");
unsafe { I2C_BUS = Some(i2c) };
}

View File

@ -1,12 +1,9 @@
use libboard_zynq::{gic, mpcore, println, stdio};
use libcortex_a9::{
asm, interrupt_handler,
regs::MPIDR,
spin_lock_yield, notify_spin_lock
};
use libregister::RegisterR;
use core::sync::atomic::{AtomicBool, Ordering}; use core::sync::atomic::{AtomicBool, Ordering};
use libboard_zynq::{gic, mpcore, println, stdio};
use libcortex_a9::{asm, interrupt_handler, notify_spin_lock, regs::MPIDR, spin_lock_yield};
use libregister::RegisterR;
extern "C" { extern "C" {
static mut __stack1_start: u32; static mut __stack1_start: u32;
fn main_core1() -> !; fn main_core1() -> !;

View File

@ -1,29 +1,27 @@
use core::ffi::VaList; use alloc::vec;
use core::ptr; use core::{ffi::VaList, ptr, str};
use core::str;
use libc::{c_char, c_int, size_t}; use libc::{c_char, c_int, size_t};
use libm; use libm;
use log::{info, warn}; use log::{info, warn};
use alloc::vec; #[cfg(has_drtio)]
use super::subkernel;
use crate::eh_artiq; use super::{cache,
use crate::rtio; core1::rtio_get_destination_status,
use crate::i2c; dma, linalg,
use super::rpc::{rpc_send, rpc_send_async, rpc_recv}; rpc::{rpc_recv, rpc_send, rpc_send_async}};
use super::dma; use crate::{eh_artiq, i2c, rtio};
use super::cache;
extern "C" { extern "C" {
fn vsnprintf_(buffer: *mut c_char, count: size_t, format: *const c_char, va: VaList) -> c_int; fn vsnprintf_(buffer: *mut c_char, count: size_t, format: *const c_char, va: VaList) -> c_int;
} }
unsafe extern fn core_log(fmt: *const c_char, mut args: ...) { unsafe extern "C" fn core_log(fmt: *const c_char, mut args: ...) {
let size = vsnprintf_(ptr::null_mut(), 0, fmt, args.as_va_list()) as usize; let size = vsnprintf_(ptr::null_mut(), 0, fmt, args.as_va_list()) as usize;
let mut buf = vec![0; size + 1]; let mut buf = vec![0; size + 1];
vsnprintf_(buf.as_mut_ptr() as *mut i8, size + 1, fmt, args.as_va_list()); vsnprintf_(buf.as_mut_ptr() as *mut i8, size + 1, fmt, args.as_va_list());
let buf: &[u8] = &buf.as_slice()[..size-1]; // strip \n and NUL let buf: &[u8] = &buf.as_slice()[..size - 1]; // strip \n and NUL
match str::from_utf8(buf) { match str::from_utf8(buf) {
Ok(s) => info!("kernel: {}", s), Ok(s) => info!("kernel: {}", s),
Err(e) => { Err(e) => {
@ -33,14 +31,13 @@ unsafe extern fn core_log(fmt: *const c_char, mut args: ...) {
} }
} }
unsafe extern fn rtio_log(fmt: *const c_char, mut args: ...) { unsafe extern "C" fn rtio_log(fmt: *const c_char, mut args: ...) {
let size = vsnprintf_(ptr::null_mut(), 0, fmt, args.as_va_list()) as usize; let size = vsnprintf_(ptr::null_mut(), 0, fmt, args.as_va_list()) as usize;
let mut buf = vec![0; size + 1]; let mut buf = vec![0; size + 1];
vsnprintf_(buf.as_mut_ptr(), size + 1, fmt, args.as_va_list()); vsnprintf_(buf.as_mut_ptr(), size + 1, fmt, args.as_va_list());
rtio::write_log(buf.as_slice()); rtio::write_log(buf.as_slice());
} }
macro_rules! api { macro_rules! api {
($i:ident) => ({ ($i:ident) => ({
extern { static $i: u8; } extern { static $i: u8; }
@ -56,24 +53,25 @@ macro_rules! api {
} }
macro_rules! api_libm_f64f64 { macro_rules! api_libm_f64f64 {
($i:ident) => ({ ($i:ident) => {{
extern fn $i(x: f64) -> f64 { extern "C" fn $i(x: f64) -> f64 {
libm::$i(x) libm::$i(x)
} }
api!($i = $i) api!($i = $i)
}) }};
} }
macro_rules! api_libm_f64f64f64 { macro_rules! api_libm_f64f64f64 {
($i:ident) => ({ ($i:ident) => {{
extern fn $i(x: f64, y: f64) -> f64 { extern "C" fn $i(x: f64, y: f64) -> f64 {
libm::$i(x, y) libm::$i(x, y)
} }
api!($i = $i) api!($i = $i)
}) }};
} }
pub fn resolve(required: &[u8]) -> Option<u32> { pub fn resolve(required: &[u8]) -> Option<u32> {
#[rustfmt::skip]
let api = &[ let api = &[
// timing // timing
api!(now_mu = rtio::now_mu), api!(now_mu = rtio::now_mu),
@ -87,7 +85,7 @@ pub fn resolve(required: &[u8]) -> Option<u32> {
// rtio // rtio
api!(rtio_init = rtio::init), api!(rtio_init = rtio::init),
api!(rtio_get_destination_status = rtio::get_destination_status), api!(rtio_get_destination_status = rtio_get_destination_status),
api!(rtio_get_counter = rtio::get_counter), api!(rtio_get_counter = rtio::get_counter),
api!(rtio_output = rtio::output), api!(rtio_output = rtio::output),
api!(rtio_output_wide = rtio::output_wide), api!(rtio_output_wide = rtio::output_wide),
@ -116,6 +114,17 @@ pub fn resolve(required: &[u8]) -> Option<u32> {
api!(i2c_stop = i2c::stop), api!(i2c_stop = i2c::stop),
api!(i2c_write = i2c::write), api!(i2c_write = i2c::write),
api!(i2c_read = i2c::read), api!(i2c_read = i2c::read),
api!(i2c_switch_select = i2c::switch_select),
// subkernel
#[cfg(has_drtio)]
api!(subkernel_load_run = subkernel::load_run),
#[cfg(has_drtio)]
api!(subkernel_await_finish = subkernel::await_finish),
#[cfg(has_drtio)]
api!(subkernel_send_message = subkernel::send_message),
#[cfg(has_drtio)]
api!(subkernel_await_message = subkernel::await_message),
// Double-precision floating-point arithmetic helper functions // Double-precision floating-point arithmetic helper functions
// RTABI chapter 4.1.2, Table 2 // RTABI chapter 4.1.2, Table 2
@ -123,6 +132,7 @@ pub fn resolve(required: &[u8]) -> Option<u32> {
api!(__aeabi_ddiv), api!(__aeabi_ddiv),
api!(__aeabi_dmul), api!(__aeabi_dmul),
api!(__aeabi_dsub), api!(__aeabi_dsub),
// Double-precision floating-point comparison helper functions // Double-precision floating-point comparison helper functions
// RTABI chapter 4.1.2, Table 3 // RTABI chapter 4.1.2, Table 3
api!(__aeabi_dcmpeq), api!(__aeabi_dcmpeq),
@ -132,12 +142,14 @@ pub fn resolve(required: &[u8]) -> Option<u32> {
api!(__aeabi_dcmpge), api!(__aeabi_dcmpge),
api!(__aeabi_dcmpgt), api!(__aeabi_dcmpgt),
api!(__aeabi_dcmpun), api!(__aeabi_dcmpun),
// Single-precision floating-point arithmetic helper functions // Single-precision floating-point arithmetic helper functions
// RTABI chapter 4.1.2, Table 4 // RTABI chapter 4.1.2, Table 4
api!(__aeabi_fadd), api!(__aeabi_fadd),
api!(__aeabi_fdiv), api!(__aeabi_fdiv),
api!(__aeabi_fmul), api!(__aeabi_fmul),
api!(__aeabi_fsub), api!(__aeabi_fsub),
// Single-precision floating-point comparison helper functions // Single-precision floating-point comparison helper functions
// RTABI chapter 4.1.2, Table 5 // RTABI chapter 4.1.2, Table 5
api!(__aeabi_fcmpeq), api!(__aeabi_fcmpeq),
@ -147,6 +159,7 @@ pub fn resolve(required: &[u8]) -> Option<u32> {
api!(__aeabi_fcmpge), api!(__aeabi_fcmpge),
api!(__aeabi_fcmpgt), api!(__aeabi_fcmpgt),
api!(__aeabi_fcmpun), api!(__aeabi_fcmpun),
// Floating-point to integer conversions. // Floating-point to integer conversions.
// RTABI chapter 4.1.2, Table 6 // RTABI chapter 4.1.2, Table 6
api!(__aeabi_d2iz), api!(__aeabi_d2iz),
@ -157,9 +170,11 @@ pub fn resolve(required: &[u8]) -> Option<u32> {
api!(__aeabi_f2uiz), api!(__aeabi_f2uiz),
api!(__aeabi_f2lz), api!(__aeabi_f2lz),
api!(__aeabi_f2ulz), api!(__aeabi_f2ulz),
// Conversions between floating types. // Conversions between floating types.
// RTABI chapter 4.1.2, Table 7 // RTABI chapter 4.1.2, Table 7
api!(__aeabi_f2d), api!(__aeabi_f2d),
// Integer to floating-point conversions. // Integer to floating-point conversions.
// RTABI chapter 4.1.2, Table 8 // RTABI chapter 4.1.2, Table 8
api!(__aeabi_i2d), api!(__aeabi_i2d),
@ -170,12 +185,14 @@ pub fn resolve(required: &[u8]) -> Option<u32> {
api!(__aeabi_ui2f), api!(__aeabi_ui2f),
api!(__aeabi_l2f), api!(__aeabi_l2f),
api!(__aeabi_ul2f), api!(__aeabi_ul2f),
// Long long helper functions // Long long helper functions
// RTABI chapter 4.2, Table 9 // RTABI chapter 4.2, Table 9
api!(__aeabi_lmul), api!(__aeabi_lmul),
api!(__aeabi_llsl), api!(__aeabi_llsl),
api!(__aeabi_llsr), api!(__aeabi_llsr),
api!(__aeabi_lasr), api!(__aeabi_lasr),
// Integer division functions // Integer division functions
// RTABI chapter 4.3.1 // RTABI chapter 4.3.1
api!(__aeabi_idiv), api!(__aeabi_idiv),
@ -183,6 +200,7 @@ pub fn resolve(required: &[u8]) -> Option<u32> {
api!(__aeabi_idivmod), api!(__aeabi_idivmod),
api!(__aeabi_uidiv), api!(__aeabi_uidiv),
api!(__aeabi_uldivmod), api!(__aeabi_uldivmod),
// 4.3.4 Memory copying, clearing, and setting // 4.3.4 Memory copying, clearing, and setting
api!(__aeabi_memcpy8), api!(__aeabi_memcpy8),
api!(__aeabi_memcpy4), api!(__aeabi_memcpy4),
@ -198,13 +216,43 @@ pub fn resolve(required: &[u8]) -> Option<u32> {
api!(__aeabi_memclr), api!(__aeabi_memclr),
// libc // libc
api!(memcmp, extern { fn memcmp(a: *const u8, b: *mut u8, size: usize); }), api!(
memcpy,
extern "C" {
fn memcpy(dest: *mut u8, src: *const u8, n: usize) -> *mut u8;
}
),
api!(
memmove,
extern "C" {
fn memmove(dest: *mut u8, src: *const u8, n: usize) -> *mut u8;
}
),
api!(
memset,
extern "C" {
fn memset(s: *mut u8, c: i32, n: usize) -> *mut u8;
}
),
api!(
memcmp,
extern "C" {
fn memcmp(s1: *const u8, s2: *const u8, n: usize) -> i32;
}
),
// exceptions // exceptions
api!(_Unwind_Resume = unwind::_Unwind_Resume), api!(_Unwind_Resume = unwind::_Unwind_Resume),
api!(__nac3_personality = eh_artiq::artiq_personality),
api!(__nac3_raise = eh_artiq::raise),
api!(__nac3_resume = eh_artiq::resume),
api!(__nac3_end_catch = eh_artiq::end_catch),
// legacy exception symbols
api!(__artiq_personality = eh_artiq::artiq_personality), api!(__artiq_personality = eh_artiq::artiq_personality),
api!(__artiq_raise = eh_artiq::raise), api!(__artiq_raise = eh_artiq::raise),
api!(__artiq_reraise = eh_artiq::reraise), api!(__artiq_resume = eh_artiq::resume),
api!(__artiq_end_catch = eh_artiq::end_catch),
// Implementations for LLVM math intrinsics // Implementations for LLVM math intrinsics
api!(__powidf2), api!(__powidf2),
@ -231,7 +279,7 @@ pub fn resolve(required: &[u8]) -> Option<u32> {
api_libm_f64f64!(fabs), api_libm_f64f64!(fabs),
api_libm_f64f64!(floor), api_libm_f64f64!(floor),
{ {
extern fn fma(x: f64, y: f64, z: f64) -> f64 { extern "C" fn fma(x: f64, y: f64, z: f64) -> f64 {
libm::fma(x, y, z) libm::fma(x, y, z)
} }
api!(fma = fma) api!(fma = fma)
@ -243,7 +291,7 @@ pub fn resolve(required: &[u8]) -> Option<u32> {
api_libm_f64f64!(j0), api_libm_f64f64!(j0),
api_libm_f64f64!(j1), api_libm_f64f64!(j1),
{ {
extern fn jn(n: i32, x: f64) -> f64 { extern "C" fn jn(n: i32, x: f64) -> f64 {
libm::jn(n, x) libm::jn(n, x)
} }
api!(jn = jn) api!(jn = jn)
@ -255,6 +303,7 @@ pub fn resolve(required: &[u8]) -> Option<u32> {
api_libm_f64f64f64!(nextafter), api_libm_f64f64f64!(nextafter),
api_libm_f64f64f64!(pow), api_libm_f64f64f64!(pow),
api_libm_f64f64!(round), api_libm_f64f64!(round),
api_libm_f64f64!(rint),
api_libm_f64f64!(sin), api_libm_f64f64!(sin),
api_libm_f64f64!(sinh), api_libm_f64f64!(sinh),
api_libm_f64f64!(sqrt), api_libm_f64f64!(sqrt),
@ -265,11 +314,31 @@ pub fn resolve(required: &[u8]) -> Option<u32> {
api_libm_f64f64!(y0), api_libm_f64f64!(y0),
api_libm_f64f64!(y1), api_libm_f64f64!(y1),
{ {
extern fn yn(n: i32, x: f64) -> f64 { extern "C" fn yn(n: i32, x: f64) -> f64 {
libm::yn(n, x) libm::yn(n, x)
} }
api!(yn = yn) api!(yn = yn)
}, },
// linalg
api!(np_linalg_cholesky = linalg::np_linalg_cholesky),
api!(np_linalg_qr = linalg::np_linalg_qr),
api!(np_linalg_svd = linalg::np_linalg_svd),
api!(np_linalg_inv = linalg::np_linalg_inv),
api!(np_linalg_pinv = linalg::np_linalg_pinv),
api!(np_linalg_matrix_power = linalg::np_linalg_matrix_power),
api!(np_linalg_det = linalg::np_linalg_det),
api!(sp_linalg_lu = linalg::sp_linalg_lu),
api!(sp_linalg_schur = linalg::sp_linalg_schur),
api!(sp_linalg_hessenberg = linalg::sp_linalg_hessenberg),
/*
* syscall for unit tests
* Used in `artiq.tests.coredevice.test_exceptions.ExceptionTest.test_raise_exceptions_kernel`
* This syscall checks that the exception IDs used in the Python `EmbeddingMap` (in `artiq.language.embedding`)
* match the `EXCEPTION_ID_LOOKUP` defined in the firmware (`libksupport::src::eh_artiq`)
*/
api!(test_exception_id_sync = eh_artiq::test_exception_id_sync)
]; ];
api.iter() api.iter()
.find(|&&(exported, _)| exported.as_bytes() == required) .find(|&&(exported, _)| exported.as_bytes() == required)

View File

@ -0,0 +1,37 @@
use alloc::{boxed::Box, string::String};
use core::mem::{forget, transmute};
use cslice::{AsCSlice, CSlice};
use super::{Message, KERNEL_CHANNEL_0TO1, KERNEL_CHANNEL_1TO0};
pub extern "C" fn get(key: CSlice<u8>) -> &CSlice<'static, i32> {
let key = String::from_utf8(key.as_ref().to_vec()).unwrap();
unsafe {
KERNEL_CHANNEL_1TO0
.as_mut()
.unwrap()
.send(Message::CacheGetRequest(key));
let msg = KERNEL_CHANNEL_0TO1.as_mut().unwrap().recv();
if let Message::CacheGetReply(v) = msg {
let leaked = Box::new(v.as_c_slice());
let reference = transmute(leaked.as_ref());
forget(leaked);
forget(v);
reference
} else {
panic!("Expected CacheGetReply for CacheGetRequest");
}
}
}
pub extern "C" fn put(key: CSlice<u8>, list: &CSlice<i32>) {
let key = String::from_utf8(key.as_ref().to_vec()).unwrap();
let value = list.as_ref().to_vec();
unsafe {
KERNEL_CHANNEL_1TO0
.as_mut()
.unwrap()
.send(Message::CachePutRequest(key, value));
}
}

View File

@ -1,11 +1,11 @@
use libcortex_a9::sync_channel::{Sender, Receiver}; use core::mem::{forget, replace};
use libcortex_a9::sync_channel::{Receiver, Sender};
use libsupport_zynq::boot::Core1; use libsupport_zynq::boot::Core1;
use super::{CHANNEL_0TO1, CHANNEL_1TO0, CHANNEL_SEM, INIT_LOCK, Message}; use super::{Message, CHANNEL_0TO1, CHANNEL_1TO0, CHANNEL_SEM, INIT_LOCK};
use crate::irq::restart_core1; use crate::irq::restart_core1;
use core::mem::{forget, replace};
pub struct Control { pub struct Control {
pub tx: Sender<'static, Message>, pub tx: Sender<'static, Message>,
pub rx: Receiver<'static, Message>, pub rx: Receiver<'static, Message>,
@ -53,4 +53,3 @@ impl Control {
forget(replace(&mut self.rx, core0_rx)); forget(replace(&mut self.rx, core0_rx));
} }
} }

View File

@ -1,50 +1,39 @@
//! Kernel prologue/epilogue that runs on the 2nd CPU core //! Kernel prologue/epilogue that runs on the 2nd CPU core
use core::{mem, ptr, cell::UnsafeCell};
use alloc::borrow::ToOwned; use alloc::borrow::ToOwned;
use log::{debug, info, error}; use core::{cell::UnsafeCell, mem, ptr};
use cslice::CSlice;
use libcortex_a9::{ use cslice::CSlice;
enable_fpu, use dyld::{self, elf::EXIDX_Entry, Library};
cache::{dcci_slice, iciallu, bpiall}, use libboard_zynq::{gic, mpcore};
asm::{dsb, isb}, use libcortex_a9::{asm::{dsb, isb},
sync_channel, cache::{bpiall, dcci_slice, iciallu},
}; enable_fpu, sync_channel};
use libboard_zynq::{mpcore, gic};
use libsupport_zynq::ram; use libsupport_zynq::ram;
use dyld::{self, Library}; use log::{debug, error, info};
use crate::{eh_artiq, rtio};
use super::{ use super::{api::resolve, dma, rpc::rpc_send_async, Message, CHANNEL_0TO1, CHANNEL_1TO0, CHANNEL_SEM, INIT_LOCK,
api::resolve, KERNEL_CHANNEL_0TO1, KERNEL_CHANNEL_1TO0, KERNEL_IMAGE};
rpc::rpc_send_async, use crate::{eh_artiq, get_async_errors, rtio};
INIT_LOCK,
CHANNEL_0TO1, CHANNEL_1TO0,
CHANNEL_SEM,
KERNEL_CHANNEL_0TO1, KERNEL_CHANNEL_1TO0,
KERNEL_IMAGE,
Message,
dma,
};
// linker symbols // linker symbols
extern "C" { extern "C" {
static __text_start: u32; static __text_start: u32;
static __text_end: u32; static __text_end: u32;
static __exidx_start: u32; static __exidx_start: EXIDX_Entry;
static __exidx_end: u32; static __exidx_end: EXIDX_Entry;
} }
unsafe fn attribute_writeback(typeinfo: *const ()) { unsafe fn attribute_writeback(typeinfo: *const ()) {
struct Attr { struct Attr {
offset: usize, offset: usize,
tag: CSlice<'static, u8>, tag: CSlice<'static, u8>,
name: CSlice<'static, u8> name: CSlice<'static, u8>,
} }
struct Type { struct Type {
attributes: *const *const Attr, attributes: *const *const Attr,
objects: *const *const () objects: *const *const (),
} }
let mut tys = typeinfo as *const *const Type; let mut tys = typeinfo as *const *const Type;
@ -63,11 +52,16 @@ unsafe fn attribute_writeback(typeinfo: *const ()) {
attributes = attributes.offset(1); attributes = attributes.offset(1);
if (*attribute).tag.len() > 0 { if (*attribute).tag.len() > 0 {
rpc_send_async(0, &(*attribute).tag, [ rpc_send_async(
0,
&(*attribute).tag,
[
&object as *const _ as *const (), &object as *const _ as *const (),
&(*attribute).name as *const _ as *const (), &(*attribute).name as *const _ as *const (),
(object as usize + (*attribute).offset) as *const () (object as usize + (*attribute).offset) as *const (),
].as_ptr()); ]
.as_ptr(),
);
} }
} }
} }
@ -82,7 +76,8 @@ pub struct KernelImage {
impl KernelImage { impl KernelImage {
pub fn new(library: Library) -> Result<Self, dyld::Error> { pub fn new(library: Library) -> Result<Self, dyld::Error> {
let __modinit__ = library.lookup(b"__modinit__") let __modinit__ = library
.lookup(b"__modinit__")
.ok_or(dyld::Error::Lookup("__modinit__".to_owned()))?; .ok_or(dyld::Error::Lookup("__modinit__".to_owned()))?;
let typeinfo = library.lookup(b"typeinfo"); let typeinfo = library.lookup(b"typeinfo");
@ -90,8 +85,7 @@ impl KernelImage {
let bss_start = library.lookup(b"__bss_start"); let bss_start = library.lookup(b"__bss_start");
let end = library.lookup(b"_end"); let end = library.lookup(b"_end");
if let Some(bss_start) = bss_start { if let Some(bss_start) = bss_start {
let end = end let end = end.ok_or(dyld::Error::Lookup("_end".to_owned()))?;
.ok_or(dyld::Error::Lookup("_end".to_owned()))?;
unsafe { unsafe {
ptr::write_bytes(bss_start as *mut u8, 0, (end - bss_start) as usize); ptr::write_bytes(bss_start as *mut u8, 0, (end - bss_start) as usize);
} }
@ -126,9 +120,7 @@ impl KernelImage {
} }
pub fn get_load_addr(&self) -> usize { pub fn get_load_addr(&self) -> usize {
unsafe { unsafe { self.library.get().as_ref().unwrap().image.as_ptr() as usize }
self.library.get().as_ref().unwrap().image.as_ptr() as usize
}
} }
} }
@ -164,24 +156,24 @@ pub extern "C" fn main_core1() {
let message = core1_rx.recv(); let message = core1_rx.recv();
match message { match message {
Message::LoadRequest(data) => { Message::LoadRequest(data) => {
let result = dyld::load(&data, &resolve) let result = dyld::load(&data, &resolve).and_then(KernelImage::new);
.and_then(KernelImage::new);
match result { match result {
Ok(kernel) => { Ok(kernel) => {
loaded_kernel = Some(kernel); loaded_kernel = Some(kernel);
debug!("kernel loaded"); debug!("kernel loaded");
core1_tx.send(Message::LoadCompleted); core1_tx.send(Message::LoadCompleted);
}, }
Err(error) => { Err(error) => {
error!("failed to load shared library: {}", error); error!("failed to load shared library: {}", error);
core1_tx.send(Message::LoadFailed); core1_tx.send(Message::LoadFailed);
} }
} }
}, }
Message::StartRequest => { Message::StartRequest => {
info!("kernel starting"); info!("kernel starting");
if let Some(kernel) = loaded_kernel.take() { if let Some(kernel) = loaded_kernel.take() {
unsafe { unsafe {
eh_artiq::reset_exception_buffer();
KERNEL_CHANNEL_0TO1 = Some(core1_rx); KERNEL_CHANNEL_0TO1 = Some(core1_rx);
KERNEL_CHANNEL_1TO0 = Some(core1_tx); KERNEL_CHANNEL_1TO0 = Some(core1_tx);
KERNEL_IMAGE = &kernel as *const KernelImage; KERNEL_IMAGE = &kernel as *const KernelImage;
@ -192,7 +184,8 @@ pub extern "C" fn main_core1() {
} }
} }
info!("kernel finished"); info!("kernel finished");
core1_tx.send(Message::KernelFinished); let async_errors = unsafe { get_async_errors() };
core1_tx.send(Message::KernelFinished(async_errors));
} }
_ => error!("Core1 received unexpected message: {:?}", message), _ => error!("Core1 received unexpected message: {:?}", message),
} }
@ -200,44 +193,62 @@ pub extern "C" fn main_core1() {
} }
/// Called by eh_artiq /// Called by eh_artiq
pub fn terminate(exception: &'static eh_artiq::Exception<'static>, backtrace: &'static mut [usize]) -> ! { pub fn terminate(
let load_addr = unsafe { exceptions: &'static [Option<eh_artiq::Exception<'static>>],
KERNEL_IMAGE.as_ref().unwrap().get_load_addr() stack_pointers: &'static [eh_artiq::StackPointerBacktrace],
}; backtrace: &'static mut [(usize, usize)],
let mut cursor = 0; ) -> ! {
// The address in the backtrace is relocated, so we have to convert it back to the address in
// the original python script, and remove those Rust function backtrace.
for i in 0..backtrace.len() {
if backtrace[i] >= load_addr {
backtrace[cursor] = backtrace[i] - load_addr;
cursor += 1;
}
}
{ {
let core1_tx = unsafe { KERNEL_CHANNEL_1TO0.as_mut().unwrap() }; let core1_tx = unsafe { KERNEL_CHANNEL_1TO0.as_mut().unwrap() };
core1_tx.send(Message::KernelException(exception, &backtrace[..cursor])); let errors = unsafe { get_async_errors() };
core1_tx.send(Message::KernelException(exceptions, stack_pointers, backtrace, errors));
} }
loop {} loop {}
} }
/// Called by llvm_libunwind /// Called by llvm_libunwind
#[no_mangle] #[no_mangle]
extern fn dl_unwind_find_exidx(pc: *const u32, len_ptr: *mut u32) -> *const u32 { extern "C" fn dl_unwind_find_exidx(pc: *const u32, len_ptr: *mut u32) -> *const u32 {
let length; let length;
let start: *const u32; let start: *const EXIDX_Entry;
unsafe { unsafe {
if &__text_start as *const u32 <= pc && pc < &__text_end as *const u32 { if &__text_start as *const u32 <= pc && pc < &__text_end as *const u32 {
length = (&__exidx_end as *const u32).offset_from(&__exidx_start) as u32; length = (&__exidx_end as *const EXIDX_Entry).offset_from(&__exidx_start) as u32;
start = &__exidx_start; start = &__exidx_start;
} else { } else if KERNEL_IMAGE != ptr::null() {
let exidx = KERNEL_IMAGE.as_ref() let exidx = KERNEL_IMAGE
.as_ref()
.expect("dl_unwind_find_exidx kernel image") .expect("dl_unwind_find_exidx kernel image")
.library.get().as_ref().unwrap().exidx(); .library
.get()
.as_ref()
.unwrap()
.exidx();
length = exidx.len() as u32; length = exidx.len() as u32;
start = exidx.as_ptr(); start = exidx.as_ptr();
} else {
length = 0;
start = ptr::null();
} }
*len_ptr = length; *len_ptr = length;
} }
start start as *const u32
}
pub extern "C" fn rtio_get_destination_status(destination: i32) -> bool {
#[cfg(has_drtio)]
if destination > 0 && destination < 255 {
let reply = unsafe {
let core1_rx = KERNEL_CHANNEL_0TO1.as_mut().unwrap();
let core1_tx = KERNEL_CHANNEL_1TO0.as_mut().unwrap();
core1_tx.send(Message::UpDestinationsRequest(destination));
core1_rx.recv()
};
return match reply {
Message::UpDestinationsReply(x) => x,
_ => panic!("received unexpected reply to UpDestinationsRequest: {:?}", reply),
};
}
destination == 0
} }

View File

@ -0,0 +1,255 @@
use alloc::{string::String, vec::Vec};
use core::mem;
use cslice::CSlice;
use super::{Message, KERNEL_CHANNEL_0TO1, KERNEL_CHANNEL_1TO0, KERNEL_IMAGE};
use crate::{artiq_raise, pl::csr, rtio};
#[repr(C)]
pub struct DmaTrace {
duration: i64,
address: i32,
uses_ddma: bool,
}
#[derive(Clone, Debug)]
pub struct DmaRecorder {
pub name: String,
pub buffer: Vec<u8>,
pub duration: i64,
pub enable_ddma: bool,
}
static mut RECORDER: Option<DmaRecorder> = None;
pub unsafe fn init_dma_recorder() {
// as static would remain after restart, we have to reset it,
// without running its destructor.
mem::forget(mem::replace(&mut RECORDER, None));
}
pub extern "C" fn dma_record_start(name: CSlice<u8>) {
let name = String::from_utf8(name.as_ref().to_vec()).unwrap();
unsafe {
KERNEL_CHANNEL_1TO0
.as_mut()
.unwrap()
.send(Message::DmaEraseRequest(name.clone()));
}
unsafe {
if RECORDER.is_some() {
artiq_raise!("DMAError", "DMA is already recording")
}
let library = KERNEL_IMAGE.as_ref().unwrap();
library.rebind(b"rtio_output", dma_record_output as *const ()).unwrap();
library
.rebind(b"rtio_output_wide", dma_record_output_wide as *const ())
.unwrap();
RECORDER = Some(DmaRecorder {
name,
buffer: Vec::new(),
duration: 0,
enable_ddma: false,
});
}
}
pub extern "C" fn dma_record_stop(duration: i64, enable_ddma: bool) {
unsafe {
if RECORDER.is_none() {
artiq_raise!("DMAError", "DMA is not recording")
}
let library = KERNEL_IMAGE.as_ref().unwrap();
library.rebind(b"rtio_output", rtio::output as *const ()).unwrap();
library
.rebind(b"rtio_output_wide", rtio::output_wide as *const ())
.unwrap();
let mut recorder = RECORDER.take().unwrap();
recorder.duration = duration;
recorder.enable_ddma = enable_ddma;
KERNEL_CHANNEL_1TO0
.as_mut()
.unwrap()
.send(Message::DmaPutRequest(recorder));
}
}
#[inline(always)]
unsafe fn dma_record_output_prepare(timestamp: i64, target: i32, words: usize) {
// See gateware/rtio/dma.py.
const HEADER_LENGTH: usize = /*length*/1 + /*channel*/3 + /*timestamp*/8 + /*address*/1;
let length = HEADER_LENGTH + /*data*/words * 4;
let buffer = &mut RECORDER.as_mut().unwrap().buffer;
buffer.reserve(length);
buffer.extend_from_slice(&[
(length >> 0) as u8,
(target >> 8) as u8,
(target >> 16) as u8,
(target >> 24) as u8,
(timestamp >> 0) as u8,
(timestamp >> 8) as u8,
(timestamp >> 16) as u8,
(timestamp >> 24) as u8,
(timestamp >> 32) as u8,
(timestamp >> 40) as u8,
(timestamp >> 48) as u8,
(timestamp >> 56) as u8,
(target >> 0) as u8,
]);
}
pub extern "C" fn dma_record_output(target: i32, word: i32) {
unsafe {
let timestamp = rtio::now_mu();
dma_record_output_prepare(timestamp, target, 1);
RECORDER.as_mut().unwrap().buffer.extend_from_slice(&[
(word >> 0) as u8,
(word >> 8) as u8,
(word >> 16) as u8,
(word >> 24) as u8,
]);
}
}
pub extern "C" fn dma_record_output_wide(target: i32, words: &CSlice<i32>) {
assert!(words.len() <= 16); // enforce the hardware limit
unsafe {
let timestamp = rtio::now_mu();
dma_record_output_prepare(timestamp, target, words.len());
let buffer = &mut RECORDER.as_mut().unwrap().buffer;
for word in words.as_ref().iter() {
buffer.extend_from_slice(&[
(word >> 0) as u8,
(word >> 8) as u8,
(word >> 16) as u8,
(word >> 24) as u8,
]);
}
}
}
pub extern "C" fn dma_erase(name: CSlice<u8>) {
let name = String::from_utf8(name.as_ref().to_vec()).unwrap();
unsafe {
KERNEL_CHANNEL_1TO0
.as_mut()
.unwrap()
.send(Message::DmaEraseRequest(name));
}
}
pub extern "C" fn dma_retrieve(name: CSlice<u8>) -> DmaTrace {
let name = String::from_utf8(name.as_ref().to_vec()).unwrap();
unsafe {
KERNEL_CHANNEL_1TO0.as_mut().unwrap().send(Message::DmaGetRequest(name));
}
match unsafe { KERNEL_CHANNEL_0TO1.as_mut().unwrap() }.recv() {
Message::DmaGetReply(None) => (),
Message::DmaGetReply(Some((address, duration, uses_ddma))) => {
return DmaTrace {
address,
duration,
uses_ddma,
};
}
_ => panic!("Expected DmaGetReply after DmaGetRequest!"),
}
// we have to defer raising error as we have to drop the message first...
artiq_raise!("DMAError", "DMA trace not found");
}
pub extern "C" fn dma_playback(timestamp: i64, ptr: i32, _uses_ddma: bool) {
unsafe {
csr::rtio_dma::base_address_write(ptr as u32);
csr::rtio_dma::time_offset_write(timestamp as u64);
let old_cri_master = csr::cri_con::selected_read();
csr::cri_con::selected_write(1);
csr::rtio_dma::enable_write(1);
#[cfg(has_drtio)]
if _uses_ddma {
KERNEL_CHANNEL_1TO0
.as_mut()
.unwrap()
.send(Message::DmaStartRemoteRequest {
id: ptr,
timestamp: timestamp,
});
}
while csr::rtio_dma::enable_read() != 0 {}
csr::cri_con::selected_write(old_cri_master);
let error = csr::rtio_dma::error_read();
if error != 0 {
let timestamp = csr::rtio_dma::error_timestamp_read();
let channel = csr::rtio_dma::error_channel_read();
csr::rtio_dma::error_write(1);
if error & 1 != 0 {
artiq_raise!(
"RTIOUnderflow",
"RTIO underflow at {1} mu, channel {rtio_channel_info:0}",
channel as i64,
timestamp as i64,
0
);
}
if error & 2 != 0 {
artiq_raise!(
"RTIODestinationUnreachable",
"RTIO destination unreachable, output, at {1} mu, channel {rtio_channel_info:0}",
channel as i64,
timestamp as i64,
0
);
}
}
#[cfg(has_drtio)]
if _uses_ddma {
KERNEL_CHANNEL_1TO0
.as_mut()
.unwrap()
.send(Message::DmaAwaitRemoteRequest(ptr));
match KERNEL_CHANNEL_0TO1.as_mut().unwrap().recv() {
Message::DmaAwaitRemoteReply {
timeout,
error,
channel,
timestamp,
} => {
if timeout {
artiq_raise!(
"DMAError",
"Error running DMA on satellite device, timed out waiting for results"
);
}
if error & 1 != 0 {
artiq_raise!(
"RTIOUnderflow",
"RTIO underflow at {1} mu, channel {rtio_channel_info:0}",
channel as i64,
timestamp as i64,
0
);
}
if error & 2 != 0 {
artiq_raise!(
"RTIODestinationUnreachable",
"RTIO destination unreachable, output, at {1} mu, channel {rtio_channel_info:0}",
channel as i64,
timestamp as i64,
0
);
}
}
_ => panic!("Expected DmaAwaitRemoteReply after DmaAwaitRemoteRequest!"),
}
}
}
}

View File

@ -0,0 +1,440 @@
// Uses `nalgebra` crate to invoke `np_linalg` and `sp_linalg` functions
// When converting between `nalgebra::Matrix` and `NDArray` following considerations are necessary
//
// * Both `nalgebra::Matrix` and `NDArray` require their content to be stored in row-major order
// * `NDArray` data pointer can be directly read and converted to `nalgebra::Matrix` (row and column number must be known)
// * `nalgebra::Matrix::as_slice` returns the content of matrix in column-major order and initial data needs to be transposed before storing it in `NDArray` data pointer
use alloc::vec::Vec;
use core::slice;
use nalgebra::DMatrix;
use crate::artiq_raise;
pub struct InputMatrix {
pub ndims: usize,
pub dims: *const usize,
pub data: *mut f64,
}
impl InputMatrix {
fn get_dims(&mut self) -> Vec<usize> {
let dims = unsafe { slice::from_raw_parts(self.dims, self.ndims) };
dims.to_vec()
}
}
/// # Safety
///
/// `mat1` should point to a valid 2DArray of `f64` floats in row-major order
#[no_mangle]
pub unsafe extern "C" fn np_linalg_cholesky(mat1: *mut InputMatrix, out: *mut InputMatrix) {
let mat1 = mat1.as_mut().unwrap();
let out = out.as_mut().unwrap();
if mat1.ndims != 2 {
artiq_raise!(
"ValueError",
"expected 2D Vector Input, but received {1}D input)",
0,
mat1.ndims as i64,
0
);
}
let dim1 = (*mat1).get_dims();
if dim1[0] != dim1[1] {
artiq_raise!(
"ValueError",
"last 2 dimensions of the array must be square: {1} != {2}",
0,
dim1[0] as i64,
dim1[1] as i64
);
}
let outdim = out.get_dims();
let out_slice = slice::from_raw_parts_mut(out.data, outdim[0] * outdim[1]);
let data_slice1 = slice::from_raw_parts_mut(mat1.data, dim1[0] * dim1[1]);
let matrix1 = DMatrix::from_row_slice(dim1[0], dim1[1], data_slice1);
let result = matrix1.cholesky();
match result {
Some(res) => {
out_slice.copy_from_slice(res.unpack().transpose().as_slice());
}
None => {
artiq_raise!("LinAlgError", "Matrix is not positive definite");
}
};
}
/// # Safety
///
/// `mat1` should point to a valid 2DArray of `f64` floats in row-major order
#[no_mangle]
pub unsafe extern "C" fn np_linalg_qr(mat1: *mut InputMatrix, out_q: *mut InputMatrix, out_r: *mut InputMatrix) {
let mat1 = mat1.as_mut().unwrap();
let out_q = out_q.as_mut().unwrap();
let out_r = out_r.as_mut().unwrap();
if mat1.ndims != 2 {
artiq_raise!(
"ValueError",
"expected 2D Vector Input, but received {1}D input)",
0,
mat1.ndims as i64,
0
);
}
let dim1 = (*mat1).get_dims();
let outq_dim = (*out_q).get_dims();
let outr_dim = (*out_r).get_dims();
let data_slice1 = slice::from_raw_parts_mut(mat1.data, dim1[0] * dim1[1]);
let out_q_slice = slice::from_raw_parts_mut(out_q.data, outq_dim[0] * outq_dim[1]);
let out_r_slice = slice::from_raw_parts_mut(out_r.data, outr_dim[0] * outr_dim[1]);
// Refer to https://github.com/dimforge/nalgebra/issues/735
let matrix1 = DMatrix::from_row_slice(dim1[0], dim1[1], data_slice1);
let res = matrix1.qr();
let (q, r) = res.unpack();
// Uses different algo need to match numpy
out_q_slice.copy_from_slice(q.transpose().as_slice());
out_r_slice.copy_from_slice(r.transpose().as_slice());
}
/// # Safety
///
/// `mat1` should point to a valid 2DArray of `f64` floats in row-major order
#[no_mangle]
pub unsafe extern "C" fn np_linalg_svd(
mat1: *mut InputMatrix,
outu: *mut InputMatrix,
outs: *mut InputMatrix,
outvh: *mut InputMatrix,
) {
let mat1 = mat1.as_mut().unwrap();
let outu = outu.as_mut().unwrap();
let outs = outs.as_mut().unwrap();
let outvh = outvh.as_mut().unwrap();
if mat1.ndims != 2 {
artiq_raise!(
"ValueError",
"expected 2D Vector Input, but received {1}D input)",
0,
mat1.ndims as i64,
0
);
}
let dim1 = (*mat1).get_dims();
let outu_dim = (*outu).get_dims();
let outs_dim = (*outs).get_dims();
let outvh_dim = (*outvh).get_dims();
let data_slice1 = slice::from_raw_parts_mut(mat1.data, dim1[0] * dim1[1]);
let out_u_slice = slice::from_raw_parts_mut(outu.data, outu_dim[0] * outu_dim[1]);
let out_s_slice = slice::from_raw_parts_mut(outs.data, outs_dim[0]);
let out_vh_slice = slice::from_raw_parts_mut(outvh.data, outvh_dim[0] * outvh_dim[1]);
let matrix = DMatrix::from_row_slice(dim1[0], dim1[1], data_slice1);
let result = matrix.svd(true, true);
out_u_slice.copy_from_slice(result.u.unwrap().transpose().as_slice());
out_s_slice.copy_from_slice(result.singular_values.as_slice());
out_vh_slice.copy_from_slice(result.v_t.unwrap().transpose().as_slice());
}
/// # Safety
///
/// `mat1` should point to a valid 2DArray of `f64` floats in row-major order
#[no_mangle]
pub unsafe extern "C" fn np_linalg_inv(mat1: *mut InputMatrix, out: *mut InputMatrix) {
let mat1 = mat1.as_mut().unwrap();
let out = out.as_mut().unwrap();
if mat1.ndims != 2 {
artiq_raise!(
"ValueError",
"expected 2D Vector Input, but received {1}D input)",
0,
mat1.ndims as i64,
0
);
}
let dim1 = (*mat1).get_dims();
if dim1[0] != dim1[1] {
artiq_raise!(
"ValueError",
"last 2 dimensions of the array must be square: {1} != {2}",
0,
dim1[0] as i64,
dim1[1] as i64
);
}
let outdim = out.get_dims();
let out_slice = slice::from_raw_parts_mut(out.data, outdim[0] * outdim[1]);
let data_slice1 = slice::from_raw_parts_mut(mat1.data, dim1[0] * dim1[1]);
let matrix = DMatrix::from_row_slice(dim1[0], dim1[1], data_slice1);
if !matrix.is_invertible() {
artiq_raise!("LinAlgError", "no inverse for Singular Matrix");
}
let inv = matrix.try_inverse().unwrap();
out_slice.copy_from_slice(inv.transpose().as_slice());
}
/// # Safety
///
/// `mat1` should point to a valid 2DArray of `f64` floats in row-major order
#[no_mangle]
pub unsafe extern "C" fn np_linalg_pinv(mat1: *mut InputMatrix, out: *mut InputMatrix) {
let mat1 = mat1.as_mut().unwrap();
let out = out.as_mut().unwrap();
if mat1.ndims != 2 {
artiq_raise!(
"ValueError",
"expected 2D Vector Input, but received {1}D input)",
0,
mat1.ndims as i64,
0
);
}
let dim1 = (*mat1).get_dims();
let outdim = out.get_dims();
let out_slice = slice::from_raw_parts_mut(out.data, outdim[0] * outdim[1]);
let data_slice1 = slice::from_raw_parts_mut(mat1.data, dim1[0] * dim1[1]);
let matrix = DMatrix::from_row_slice(dim1[0], dim1[1], data_slice1);
let svd = matrix.svd(true, true);
let inv = svd.pseudo_inverse(1e-15);
match inv {
Ok(m) => {
out_slice.copy_from_slice(m.transpose().as_slice());
}
Err(_) => {
artiq_raise!("LinAlgError", "SVD computation does not converge");
}
}
}
/// # Safety
///
/// `mat1` should point to a valid 2DArray of `f64` floats in row-major order
#[no_mangle]
pub unsafe extern "C" fn np_linalg_matrix_power(mat1: *mut InputMatrix, mat2: *mut InputMatrix, out: *mut InputMatrix) {
let mat1 = mat1.as_mut().unwrap();
let mat2 = mat2.as_mut().unwrap();
let out = out.as_mut().unwrap();
if mat1.ndims != 2 {
artiq_raise!(
"ValueError",
"expected 2D Vector Input, but received {1}D input)",
0,
mat1.ndims as i64,
0
);
}
let dim1 = (*mat1).get_dims();
let power = slice::from_raw_parts_mut(mat2.data, 1);
let power = power[0];
let outdim = out.get_dims();
let out_slice = slice::from_raw_parts_mut(out.data, outdim[0] * outdim[1]);
let data_slice1 = slice::from_raw_parts_mut(mat1.data, dim1[0] * dim1[1]);
let mut abs_power = power;
if abs_power < 0.0 {
abs_power = abs_power * -1.0;
}
let matrix1 = DMatrix::from_row_slice(dim1[0], dim1[1], data_slice1);
if !matrix1.is_square() {
artiq_raise!(
"ValueError",
"last 2 dimensions of the array must be square: {1} != {2}",
0,
dim1[0] as i64,
dim1[1] as i64
);
}
let mut result = matrix1.pow(abs_power as u32);
if power < 0.0 {
if !matrix1.is_invertible() {
artiq_raise!("LinAlgError", "no inverse for Singular Matrix");
}
result = result.try_inverse().unwrap();
}
out_slice.copy_from_slice(result.transpose().as_slice());
}
/// # Safety
///
/// `mat1` should point to a valid 2DArray of `f64` floats in row-major order
#[no_mangle]
pub unsafe extern "C" fn np_linalg_det(mat1: *mut InputMatrix, out: *mut InputMatrix) {
let mat1 = mat1.as_mut().unwrap();
let out = out.as_mut().unwrap();
if mat1.ndims != 2 {
artiq_raise!(
"ValueError",
"expected 2D Vector Input, but received {1}D input)",
0,
mat1.ndims as i64,
0
);
}
let dim1 = (*mat1).get_dims();
let out_slice = slice::from_raw_parts_mut(out.data, 1);
let data_slice1 = slice::from_raw_parts_mut(mat1.data, dim1[0] * dim1[1]);
let matrix = DMatrix::from_row_slice(dim1[0], dim1[1], data_slice1);
if !matrix.is_square() {
artiq_raise!(
"ValueError",
"last 2 dimensions of the array must be square: {1} != {2}",
0,
dim1[0] as i64,
dim1[1] as i64
);
}
out_slice[0] = matrix.determinant();
}
/// # Safety
///
/// `mat1` should point to a valid 2DArray of `f64` floats in row-major order
#[no_mangle]
pub unsafe extern "C" fn sp_linalg_lu(mat1: *mut InputMatrix, out_l: *mut InputMatrix, out_u: *mut InputMatrix) {
let mat1 = mat1.as_mut().unwrap();
let out_l = out_l.as_mut().unwrap();
let out_u = out_u.as_mut().unwrap();
if mat1.ndims != 2 {
artiq_raise!(
"ValueError",
"expected 2D Vector Input, but received {1}D input)",
0,
mat1.ndims as i64,
0
);
}
let dim1 = (*mat1).get_dims();
let outl_dim = (*out_l).get_dims();
let outu_dim = (*out_u).get_dims();
let data_slice1 = slice::from_raw_parts_mut(mat1.data, dim1[0] * dim1[1]);
let out_l_slice = slice::from_raw_parts_mut(out_l.data, outl_dim[0] * outl_dim[1]);
let out_u_slice = slice::from_raw_parts_mut(out_u.data, outu_dim[0] * outu_dim[1]);
let matrix = DMatrix::from_row_slice(dim1[0], dim1[1], data_slice1);
let (_, l, u) = matrix.lu().unpack();
out_l_slice.copy_from_slice(l.transpose().as_slice());
out_u_slice.copy_from_slice(u.transpose().as_slice());
}
/// # Safety
///
/// `mat1` should point to a valid 2DArray of `f64` floats in row-major order
#[no_mangle]
pub unsafe extern "C" fn sp_linalg_schur(mat1: *mut InputMatrix, out_t: *mut InputMatrix, out_z: *mut InputMatrix) {
let mat1 = mat1.as_mut().unwrap();
let out_t = out_t.as_mut().unwrap();
let out_z = out_z.as_mut().unwrap();
if mat1.ndims != 2 {
artiq_raise!(
"ValueError",
"expected 2D Vector Input, but received {1}D input)",
0,
mat1.ndims as i64,
0
);
}
let dim1 = (*mat1).get_dims();
if dim1[0] != dim1[1] {
artiq_raise!(
"ValueError",
"last 2 dimensions of the array must be square: {1} != {2}",
0,
dim1[0] as i64,
dim1[1] as i64
);
}
let out_t_dim = (*out_t).get_dims();
let out_z_dim = (*out_z).get_dims();
let data_slice1 = slice::from_raw_parts_mut(mat1.data, dim1[0] * dim1[1]);
let out_t_slice = slice::from_raw_parts_mut(out_t.data, out_t_dim[0] * out_t_dim[1]);
let out_z_slice = slice::from_raw_parts_mut(out_z.data, out_z_dim[0] * out_z_dim[1]);
let matrix = DMatrix::from_row_slice(dim1[0], dim1[1], data_slice1);
let (z, t) = matrix.schur().unpack();
out_t_slice.copy_from_slice(t.transpose().as_slice());
out_z_slice.copy_from_slice(z.transpose().as_slice());
}
/// # Safety
///
/// `mat1` should point to a valid 2DArray of `f64` floats in row-major order
#[no_mangle]
pub unsafe extern "C" fn sp_linalg_hessenberg(
mat1: *mut InputMatrix,
out_h: *mut InputMatrix,
out_q: *mut InputMatrix,
) {
let mat1 = mat1.as_mut().unwrap();
let out_h = out_h.as_mut().unwrap();
let out_q = out_q.as_mut().unwrap();
if mat1.ndims != 2 {
artiq_raise!(
"ValueError",
"expected 2D Vector Input, but received {1}D input)",
0,
mat1.ndims as i64,
0
);
}
let dim1 = (*mat1).get_dims();
if dim1[0] != dim1[1] {
artiq_raise!(
"ValueError",
"last 2 dimensions of the array must be square: {1} != {2}",
0,
dim1[0] as i64,
dim1[1] as i64
);
}
let out_h_dim = (*out_h).get_dims();
let out_q_dim = (*out_q).get_dims();
let data_slice1 = slice::from_raw_parts_mut(mat1.data, dim1[0] * dim1[1]);
let out_h_slice = slice::from_raw_parts_mut(out_h.data, out_h_dim[0] * out_h_dim[1]);
let out_q_slice = slice::from_raw_parts_mut(out_q.data, out_q_dim[0] * out_q_dim[1]);
let matrix = DMatrix::from_row_slice(dim1[0], dim1[1], data_slice1);
let (q, h) = matrix.hessenberg().unpack();
out_h_slice.copy_from_slice(h.transpose().as_slice());
out_q_slice.copy_from_slice(q.transpose().as_slice());
}

View File

@ -0,0 +1,128 @@
use alloc::{string::String, vec::Vec};
use core::ptr;
use libcortex_a9::{mutex::Mutex, semaphore::Semaphore, sync_channel};
use crate::{eh_artiq, RPCException};
mod control;
pub use control::Control;
mod api;
pub mod core1;
mod dma;
mod rpc;
pub use dma::DmaRecorder;
mod cache;
mod linalg;
#[cfg(has_drtio)]
mod subkernel;
#[cfg(has_drtio)]
#[derive(Debug, Clone)]
pub enum SubkernelStatus {
NoError,
Timeout,
IncorrectState,
CommLost,
Exception(Vec<u8>),
OtherError,
}
#[derive(Debug, Clone)]
pub enum Message {
LoadRequest(Vec<u8>),
LoadCompleted,
LoadFailed,
StartRequest,
KernelFinished(u8),
KernelException(
&'static [Option<eh_artiq::Exception<'static>>],
&'static [eh_artiq::StackPointerBacktrace],
&'static [(usize, usize)],
u8,
),
RpcSend {
is_async: bool,
data: Vec<u8>,
},
RpcRecvRequest(*mut ()),
RpcRecvReply(Result<usize, RPCException>),
CacheGetRequest(String),
CacheGetReply(Vec<i32>),
CachePutRequest(String, Vec<i32>),
DmaPutRequest(DmaRecorder),
DmaEraseRequest(String),
DmaGetRequest(String),
DmaGetReply(Option<(i32, i64, bool)>),
#[cfg(has_drtio)]
DmaStartRemoteRequest {
id: i32,
timestamp: i64,
},
#[cfg(has_drtio)]
DmaAwaitRemoteRequest(i32),
#[cfg(has_drtio)]
DmaAwaitRemoteReply {
timeout: bool,
error: u8,
channel: u32,
timestamp: u64,
},
#[cfg(has_drtio)]
UpDestinationsRequest(i32),
#[cfg(has_drtio)]
UpDestinationsReply(bool),
#[cfg(has_drtio)]
SubkernelLoadRunRequest {
id: u32,
destination: u8,
run: bool,
timestamp: u64,
},
#[cfg(has_drtio)]
SubkernelLoadRunReply {
succeeded: bool,
},
#[cfg(has_drtio)]
SubkernelAwaitFinishRequest {
id: u32,
timeout: i64,
},
#[cfg(has_drtio)]
SubkernelAwaitFinishReply,
#[cfg(has_drtio)]
SubkernelMsgSend {
id: u32,
destination: Option<u8>,
data: Vec<u8>,
},
#[cfg(has_drtio)]
SubkernelMsgSent,
#[cfg(has_drtio)]
SubkernelMsgRecvRequest {
id: i32,
timeout: i64,
tags: Vec<u8>,
},
#[cfg(has_drtio)]
SubkernelMsgRecvReply {
count: u8,
},
#[cfg(has_drtio)]
SubkernelError(SubkernelStatus),
}
static CHANNEL_0TO1: Mutex<Option<sync_channel::Sender<'static, Message>>> = Mutex::new(None);
static CHANNEL_1TO0: Mutex<Option<sync_channel::Receiver<'static, Message>>> = Mutex::new(None);
static CHANNEL_SEM: Semaphore = Semaphore::new(0, 1);
static mut KERNEL_CHANNEL_0TO1: Option<sync_channel::Receiver<'static, Message>> = None;
static mut KERNEL_CHANNEL_1TO0: Option<sync_channel::Sender<'static, Message>> = None;
pub static mut KERNEL_IMAGE: *const core1::KernelImage = ptr::null();
static INIT_LOCK: Mutex<()> = Mutex::new(());

View File

@ -1,31 +1,28 @@
//! Kernel-side RPC API //! Kernel-side RPC API
use alloc::vec::Vec; use alloc::vec::Vec;
use cslice::{CSlice, AsCSlice};
use crate::eh_artiq; use cslice::CSlice;
use crate::rpc::send_args;
use super::{ use super::{Message, KERNEL_CHANNEL_0TO1, KERNEL_CHANNEL_1TO0};
KERNEL_CHANNEL_0TO1, KERNEL_CHANNEL_1TO0, use crate::{eh_artiq, rpc::send_args};
Message,
};
fn rpc_send_common(is_async: bool, service: u32, tag: &CSlice<u8>, data: *const *const ()) { fn rpc_send_common(is_async: bool, service: u32, tag: &CSlice<u8>, data: *const *const ()) {
let core1_tx = unsafe { KERNEL_CHANNEL_1TO0.as_mut().unwrap() }; let core1_tx = unsafe { KERNEL_CHANNEL_1TO0.as_mut().unwrap() };
let mut buffer = Vec::<u8>::new(); let mut buffer = Vec::<u8>::new();
send_args(&mut buffer, service, tag.as_ref(), data).expect("RPC encoding failed"); send_args(&mut buffer, service, tag.as_ref(), data, true).expect("RPC encoding failed");
core1_tx.send(Message::RpcSend { is_async, data: buffer }); core1_tx.send(Message::RpcSend { is_async, data: buffer });
} }
pub extern fn rpc_send(service: u32, tag: &CSlice<u8>, data: *const *const ()) { pub extern "C" fn rpc_send(service: u32, tag: &CSlice<u8>, data: *const *const ()) {
rpc_send_common(false, service, tag, data); rpc_send_common(false, service, tag, data);
} }
pub extern fn rpc_send_async(service: u32, tag: &CSlice<u8>, data: *const *const ()) { pub extern "C" fn rpc_send_async(service: u32, tag: &CSlice<u8>, data: *const *const ()) {
rpc_send_common(true, service, tag, data); rpc_send_common(true, service, tag, data);
} }
pub extern fn rpc_recv(slot: *mut ()) -> usize { pub extern "C" fn rpc_recv(slot: *mut ()) -> usize {
let reply = unsafe { let reply = unsafe {
let core1_rx = KERNEL_CHANNEL_0TO1.as_mut().unwrap(); let core1_rx = KERNEL_CHANNEL_0TO1.as_mut().unwrap();
let core1_tx = KERNEL_CHANNEL_1TO0.as_mut().unwrap(); let core1_tx = KERNEL_CHANNEL_1TO0.as_mut().unwrap();
@ -36,15 +33,15 @@ pub extern fn rpc_recv(slot: *mut ()) -> usize {
Message::RpcRecvReply(Ok(alloc_size)) => alloc_size, Message::RpcRecvReply(Ok(alloc_size)) => alloc_size,
Message::RpcRecvReply(Err(exception)) => unsafe { Message::RpcRecvReply(Err(exception)) => unsafe {
eh_artiq::raise(&eh_artiq::Exception { eh_artiq::raise(&eh_artiq::Exception {
name: exception.name.as_bytes().as_c_slice(), id: exception.id,
file: exception.file.as_bytes().as_c_slice(), file: CSlice::new(exception.file as *const u8, usize::MAX),
line: exception.line as u32, line: exception.line as u32,
column: exception.column as u32, column: exception.column as u32,
function: exception.function.as_bytes().as_c_slice(), function: CSlice::new(exception.function as *const u8, usize::MAX),
message: exception.message.as_bytes().as_c_slice(), message: CSlice::new(exception.message as *const u8, usize::MAX),
param: exception.param param: exception.param,
}) })
}, },
_ => panic!("received unexpected reply to RpcRecvRequest: {:?}", reply) _ => panic!("received unexpected reply to RpcRecvRequest: {:?}", reply),
} }
} }

View File

@ -0,0 +1,112 @@
use alloc::vec::Vec;
use cslice::CSlice;
use super::{Message, SubkernelStatus, KERNEL_CHANNEL_0TO1, KERNEL_CHANNEL_1TO0};
use crate::{artiq_raise, eh_artiq, rpc::send_args, rtio::now_mu};
pub extern "C" fn load_run(id: u32, destination: u8, run: bool) {
unsafe {
KERNEL_CHANNEL_1TO0
.as_mut()
.unwrap()
.send(Message::SubkernelLoadRunRequest {
id: id,
destination: destination,
run: run,
timestamp: now_mu() as u64,
});
}
match unsafe { KERNEL_CHANNEL_0TO1.as_mut().unwrap() }.recv() {
Message::SubkernelLoadRunReply { succeeded: true } => (),
Message::SubkernelLoadRunReply { succeeded: false } => {
artiq_raise!("SubkernelError", "Error loading or running the subkernel")
}
_ => panic!("Expected SubkernelLoadRunReply after SubkernelLoadRunRequest!"),
}
}
pub extern "C" fn await_finish(id: u32, timeout: i64) {
unsafe {
KERNEL_CHANNEL_1TO0
.as_mut()
.unwrap()
.send(Message::SubkernelAwaitFinishRequest {
id: id,
timeout: timeout,
});
}
match unsafe { KERNEL_CHANNEL_0TO1.as_mut().unwrap() }.recv() {
Message::SubkernelAwaitFinishReply => (),
Message::SubkernelError(SubkernelStatus::IncorrectState) => {
artiq_raise!("SubkernelError", "Subkernel not running")
}
Message::SubkernelError(SubkernelStatus::Timeout) => artiq_raise!("SubkernelError", "Subkernel timed out"),
Message::SubkernelError(SubkernelStatus::CommLost) => {
artiq_raise!("SubkernelError", "Lost communication with satellite")
}
Message::SubkernelError(SubkernelStatus::OtherError) => {
artiq_raise!("SubkernelError", "An error occurred during subkernel operation")
}
Message::SubkernelError(SubkernelStatus::Exception(raw_exception)) => eh_artiq::raise_raw(&raw_exception),
_ => panic!("expected SubkernelAwaitFinishReply after SubkernelAwaitFinishRequest"),
}
}
pub extern "C" fn send_message(
id: u32,
is_return: bool,
destination: u8,
count: u8,
tag: &CSlice<u8>,
data: *const *const (),
) {
let mut buffer = Vec::<u8>::new();
send_args(&mut buffer, 0, tag.as_ref(), data, false).expect("RPC encoding failed");
// overwrite service tag, include how many tags are in the message
buffer[3] = count;
unsafe {
KERNEL_CHANNEL_1TO0.as_mut().unwrap().send(Message::SubkernelMsgSend {
id: id,
destination: if is_return { None } else { Some(destination) },
data: buffer[3..].to_vec(),
});
}
match unsafe { KERNEL_CHANNEL_0TO1.as_mut().unwrap() }.recv() {
Message::SubkernelMsgSent => (),
_ => panic!("expected SubkernelMsgSent after SubkernelMsgSend"),
}
}
pub extern "C" fn await_message(id: i32, timeout: i64, tags: &CSlice<u8>, min: u8, max: u8) {
unsafe {
KERNEL_CHANNEL_1TO0
.as_mut()
.unwrap()
.send(Message::SubkernelMsgRecvRequest {
id: id,
timeout: timeout,
tags: tags.as_ref().to_vec(),
});
}
match unsafe { KERNEL_CHANNEL_0TO1.as_mut().unwrap() }.recv() {
Message::SubkernelMsgRecvReply { count } => {
if min > count || count > max {
artiq_raise!("SubkernelError", "Received more or less arguments than required")
}
}
Message::SubkernelError(SubkernelStatus::IncorrectState) => {
artiq_raise!("SubkernelError", "Subkernel not running")
}
Message::SubkernelError(SubkernelStatus::Timeout) => artiq_raise!("SubkernelError", "Subkernel timed out"),
Message::SubkernelError(SubkernelStatus::CommLost) => {
artiq_raise!("SubkernelError", "Lost communication with satellite")
}
Message::SubkernelError(SubkernelStatus::OtherError) => {
artiq_raise!("SubkernelError", "An error occurred during subkernel operation")
}
Message::SubkernelError(SubkernelStatus::Exception(raw_exception)) => eh_artiq::raise_raw(&raw_exception),
_ => panic!("expected SubkernelMsgRecvReply after SubkernelMsgRecvRequest"),
}
// RpcRecvRequest should be called after this to receive message data
}

163
src/libksupport/src/lib.rs Normal file
View File

@ -0,0 +1,163 @@
#![no_std]
#![feature(c_variadic)]
#![feature(const_btree_new)]
#![feature(const_in_array_repeat_expressions)]
#![feature(naked_functions)]
#![feature(asm)]
#[macro_use]
extern crate alloc;
use alloc::{collections::BTreeMap, string::String};
use io::{Cursor, ProtoRead};
use libasync::block_async;
use libconfig::Config;
use log::{error, warn};
#[cfg(has_drtiosat)]
pub use pl::csr::drtiosat as rtio_core;
#[cfg(has_rtio_core)]
pub use pl::csr::rtio_core;
use void::Void;
pub mod eh_artiq;
pub mod i2c;
pub mod irq;
pub mod kernel;
pub mod rpc;
#[cfg(ki_impl = "csr")]
#[path = "rtio_csr.rs"]
pub mod rtio;
#[cfg(ki_impl = "acp")]
#[path = "rtio_acp.rs"]
pub mod rtio;
#[rustfmt::skip]
#[path = "../../../build/pl.rs"]
pub mod pl;
#[derive(Debug, Clone)]
pub struct RPCException {
pub id: u32,
pub message: u32,
pub param: [i64; 3],
pub file: u32,
pub line: i32,
pub column: i32,
pub function: u32,
}
pub static mut SEEN_ASYNC_ERRORS: u8 = 0;
pub const ASYNC_ERROR_COLLISION: u8 = 1 << 0;
pub const ASYNC_ERROR_BUSY: u8 = 1 << 1;
pub const ASYNC_ERROR_SEQUENCE_ERROR: u8 = 1 << 2;
pub unsafe fn get_async_errors() -> u8 {
let errors = SEEN_ASYNC_ERRORS;
SEEN_ASYNC_ERRORS = 0;
errors
}
fn wait_for_async_rtio_error() -> nb::Result<(), Void> {
unsafe {
#[cfg(has_rtio_core)]
let errors = rtio_core::async_error_read();
#[cfg(has_drtiosat)]
let errors = rtio_core::protocol_error_read();
if errors != 0 {
Ok(())
} else {
Err(nb::Error::WouldBlock)
}
}
}
pub async fn report_async_rtio_errors() {
loop {
let _ = block_async!(wait_for_async_rtio_error()).await;
unsafe {
#[cfg(has_rtio_core)]
let errors = rtio_core::async_error_read();
#[cfg(has_drtiosat)]
let errors = rtio_core::protocol_error_read();
if errors & ASYNC_ERROR_COLLISION != 0 {
let channel = rtio_core::collision_channel_read();
error!(
"RTIO collision involving channel 0x{:04x}:{}",
channel,
resolve_channel_name(channel as u32)
);
}
if errors & ASYNC_ERROR_BUSY != 0 {
let channel = rtio_core::busy_channel_read();
error!(
"RTIO busy error involving channel 0x{:04x}:{}",
channel,
resolve_channel_name(channel as u32)
);
}
if errors & ASYNC_ERROR_SEQUENCE_ERROR != 0 {
let channel = rtio_core::sequence_error_channel_read();
error!(
"RTIO sequence error involving channel 0x{:04x}:{}",
channel,
resolve_channel_name(channel as u32)
);
}
SEEN_ASYNC_ERRORS = errors;
#[cfg(has_rtio_core)]
rtio_core::async_error_write(errors);
#[cfg(has_drtiosat)]
rtio_core::protocol_error_write(errors);
}
}
}
static mut RTIO_DEVICE_MAP: BTreeMap<u32, String> = BTreeMap::new();
fn read_device_map(cfg: &Config) -> BTreeMap<u32, String> {
let mut device_map: BTreeMap<u32, String> = BTreeMap::new();
let _ = cfg
.read("device_map")
.and_then(|raw_bytes| {
let mut bytes_cr = Cursor::new(raw_bytes);
let size = bytes_cr.read_u32().unwrap();
for _ in 0..size {
let channel = bytes_cr.read_u32().unwrap();
let device_name = bytes_cr.read_string().unwrap();
if let Some(old_entry) = device_map.insert(channel, device_name.clone()) {
warn!(
"conflicting device map entries for RTIO channel {}: '{}' and '{}'",
channel, old_entry, device_name
);
}
}
Ok(())
})
.or_else(|err| {
warn!(
"error reading device map ({}), device names will not be available in RTIO error messages",
err
);
Err(err)
});
device_map
}
fn _resolve_channel_name(channel: u32, device_map: &BTreeMap<u32, String>) -> String {
match device_map.get(&channel) {
Some(val) => val.clone(),
None => String::from("unknown"),
}
}
pub fn resolve_channel_name(channel: u32) -> String {
_resolve_channel_name(channel, unsafe { &RTIO_DEVICE_MAP })
}
pub fn setup_device_map(cfg: &Config) {
unsafe {
RTIO_DEVICE_MAP = read_device_map(cfg);
}
}

591
src/libksupport/src/rpc.rs Normal file
View File

@ -0,0 +1,591 @@
use core::str;
use byteorder::{ByteOrder, NativeEndian};
use core_io::{Error, Read, Write};
use cslice::{CMutSlice, CSlice};
use io::{ProtoRead, ProtoWrite};
use log::trace;
use self::tag::{split_tag, Tag, TagIterator};
#[inline]
pub fn round_up(val: usize, power_of_two: usize) -> usize {
assert!(power_of_two.is_power_of_two());
let max_rem = power_of_two - 1;
(val + max_rem) & (!max_rem)
}
#[inline]
pub unsafe fn round_up_mut<T>(ptr: *mut T, power_of_two: usize) -> *mut T {
round_up(ptr as usize, power_of_two) as *mut T
}
#[inline]
pub unsafe fn round_up_const<T>(ptr: *const T, power_of_two: usize) -> *const T {
round_up(ptr as usize, power_of_two) as *const T
}
#[inline]
pub unsafe fn align_ptr<T>(ptr: *const ()) -> *const T {
round_up_const(ptr, core::mem::align_of::<T>()) as *const T
}
#[inline]
pub unsafe fn align_ptr_mut<T>(ptr: *mut ()) -> *mut T {
round_up_mut(ptr, core::mem::align_of::<T>()) as *mut T
}
// versions for reader rather than TcpStream
// they will be made into sync for satellite subkernels later
unsafe fn recv_elements<F, R>(
reader: &mut R,
elt_tag: Tag,
length: usize,
storage: *mut (),
alloc: &mut F,
) -> Result<(), Error>
where
F: FnMut(usize) -> *mut (),
R: Read + ?Sized,
{
match elt_tag {
Tag::Bool => {
let dest = core::slice::from_raw_parts_mut(storage as *mut u8, length);
reader.read_exact(dest)?;
}
Tag::Int32 => {
let ptr = storage as *mut u32;
let dest = core::slice::from_raw_parts_mut(ptr as *mut u8, length * 4);
reader.read_exact(dest)?;
drop(dest);
let dest = core::slice::from_raw_parts_mut(ptr, length);
NativeEndian::from_slice_u32(dest);
}
Tag::Int64 | Tag::Float64 => {
let ptr = storage as *mut u64;
let dest = core::slice::from_raw_parts_mut(ptr as *mut u8, length * 8);
reader.read_exact(dest)?;
drop(dest);
let dest = core::slice::from_raw_parts_mut(ptr, length);
NativeEndian::from_slice_u64(dest);
}
_ => {
let mut data = storage;
for _ in 0..length {
recv_value(reader, elt_tag, &mut data, alloc)?
}
}
}
Ok(())
}
unsafe fn recv_value<F, R>(reader: &mut R, tag: Tag, data: &mut *mut (), alloc: &mut F) -> Result<(), Error>
where
F: FnMut(usize) -> *mut (),
R: Read + ?Sized,
{
macro_rules! consume_value {
($ty:ty, | $ptr:ident | $map:expr) => {{
let $ptr = align_ptr_mut::<$ty>(*data);
*data = $ptr.offset(1) as *mut ();
$map
}};
}
match tag {
Tag::None => Ok(()),
Tag::Bool => consume_value!(i8, |ptr| {
*ptr = reader.read_u8()? as i8;
Ok(())
}),
Tag::Int32 => consume_value!(i32, |ptr| {
*ptr = reader.read_u32()? as i32;
Ok(())
}),
Tag::Int64 | Tag::Float64 => consume_value!(i64, |ptr| {
*ptr = reader.read_u64()? as i64;
Ok(())
}),
Tag::String | Tag::Bytes | Tag::ByteArray => {
consume_value!(CMutSlice<u8>, |ptr| {
let length = reader.read_u32()? as usize;
*ptr = CMutSlice::new(alloc(length) as *mut u8, length);
reader.read_exact((*ptr).as_mut())?;
Ok(())
})
}
Tag::Tuple(it, arity) => {
let alignment = tag.alignment();
*data = round_up_mut(*data, alignment);
let mut it = it.clone();
for _ in 0..arity {
let tag = it.next().expect("truncated tag");
recv_value(reader, tag, data, alloc)?
}
*data = round_up_mut(*data, alignment);
Ok(())
}
Tag::List(it) => {
#[repr(C)]
struct List {
elements: *mut (),
length: usize,
}
consume_value!(*mut List, |ptr_to_list| {
let tag = it.clone().next().expect("truncated tag");
let length = reader.read_u32()? as usize;
let list_size = 4 + 4;
let storage_offset = round_up(list_size, tag.alignment());
let storage_size = tag.size() * length;
let allocation = alloc(storage_offset + storage_size) as *mut u8;
*ptr_to_list = allocation as *mut List;
let storage = allocation.offset(storage_offset as isize) as *mut ();
(**ptr_to_list).length = length;
(**ptr_to_list).elements = storage;
recv_elements(reader, tag, length, storage, alloc)
})
}
Tag::Array(it, num_dims) => {
consume_value!(*mut (), |buffer| {
let mut total_len: usize = 1;
for _ in 0..num_dims {
let len = reader.read_u32()? as usize;
total_len *= len;
consume_value!(usize, |ptr| *ptr = len)
}
let elt_tag = it.clone().next().expect("truncated tag");
*buffer = alloc(elt_tag.size() * total_len);
recv_elements(reader, elt_tag, total_len, *buffer, alloc)
})
}
Tag::Range(it) => {
*data = round_up_mut(*data, tag.alignment());
let tag = it.clone().next().expect("truncated tag");
recv_value(reader, tag, data, alloc)?;
recv_value(reader, tag, data, alloc)?;
recv_value(reader, tag, data, alloc)?;
Ok(())
}
Tag::Keyword(_) => unreachable!(),
Tag::Object => unreachable!(),
}
}
pub fn recv_return<'a, F, R>(
reader: &mut R,
tag_bytes: &'a [u8],
data: *mut (),
alloc: &mut F,
) -> Result<&'a [u8], Error>
where
F: FnMut(usize) -> *mut (),
R: Read + ?Sized,
{
let mut it = TagIterator::new(tag_bytes);
trace!("recv ...->{}", it);
let tag = it.next().expect("truncated tag");
let mut data = data;
unsafe { recv_value(reader, tag, &mut data, alloc)? };
Ok(it.data)
}
unsafe fn send_elements<W>(
writer: &mut W,
elt_tag: Tag,
length: usize,
data: *const (),
write_tags: bool,
) -> Result<(), Error>
where
W: Write + ?Sized,
{
if write_tags {
writer.write_u8(elt_tag.as_u8())?;
}
match elt_tag {
// we cannot use NativeEndian::from_slice_i32 as the data is not mutable,
// and that is not needed as the data is already in native endian
Tag::Bool => {
let slice = core::slice::from_raw_parts(data as *const u8, length);
writer.write_all(slice)?;
}
Tag::Int32 => {
let slice = core::slice::from_raw_parts(data as *const u8, length * 4);
writer.write_all(slice)?;
}
Tag::Int64 | Tag::Float64 => {
let slice = core::slice::from_raw_parts(data as *const u8, length * 8);
writer.write_all(slice)?;
}
_ => {
let mut data = data;
for _ in 0..length {
send_value(writer, elt_tag, &mut data, write_tags)?;
}
}
}
Ok(())
}
unsafe fn send_value<W>(writer: &mut W, tag: Tag, data: &mut *const (), write_tags: bool) -> Result<(), Error>
where W: Write + ?Sized {
macro_rules! consume_value {
($ty:ty, | $ptr:ident | $map:expr) => {{
let $ptr = align_ptr::<$ty>(*data);
*data = $ptr.offset(1) as *const ();
$map
}};
}
if write_tags {
writer.write_u8(tag.as_u8())?;
}
match tag {
Tag::None => Ok(()),
Tag::Bool => consume_value!(u8, |ptr| writer.write_u8(*ptr)),
Tag::Int32 => consume_value!(u32, |ptr| writer.write_u32(*ptr)),
Tag::Int64 | Tag::Float64 => consume_value!(u64, |ptr| writer.write_u64(*ptr)),
Tag::String => consume_value!(CSlice<u8>, |ptr| {
writer.write_string(str::from_utf8((*ptr).as_ref()).unwrap())
}),
Tag::Bytes | Tag::ByteArray => consume_value!(CSlice<u8>, |ptr| writer.write_bytes((*ptr).as_ref())),
Tag::Tuple(it, arity) => {
let mut it = it.clone();
if write_tags {
writer.write_u8(arity)?;
}
let mut max_alignment = 0;
for _ in 0..arity {
let tag = it.next().expect("truncated tag");
max_alignment = core::cmp::max(max_alignment, tag.alignment());
send_value(writer, tag, data, write_tags)?
}
*data = round_up_const(*data, max_alignment);
Ok(())
}
Tag::List(it) => {
#[repr(C)]
struct List {
elements: *const (),
length: u32,
}
consume_value!(&List, |ptr| {
let length = (**ptr).length as usize;
writer.write_u32((*ptr).length)?;
let tag = it.clone().next().expect("truncated tag");
send_elements(writer, tag, length, (**ptr).elements, write_tags)
})
}
Tag::Array(it, num_dims) => {
if write_tags {
writer.write_u8(num_dims)?;
}
consume_value!(*const (), |buffer| {
let elt_tag = it.clone().next().expect("truncated tag");
let mut total_len = 1;
for _ in 0..num_dims {
consume_value!(u32, |len| {
writer.write_u32(*len)?;
total_len *= *len;
})
}
let length = total_len as usize;
send_elements(writer, elt_tag, length, *buffer, write_tags)
})
}
Tag::Range(it) => {
let tag = it.clone().next().expect("truncated tag");
send_value(writer, tag, data, write_tags)?;
send_value(writer, tag, data, write_tags)?;
send_value(writer, tag, data, write_tags)?;
Ok(())
}
Tag::Keyword(it) => {
#[repr(C)]
struct Keyword<'a> {
name: CSlice<'a, u8>,
}
consume_value!(Keyword, |ptr| {
writer.write_string(str::from_utf8((*ptr).name.as_ref()).unwrap())?;
let tag = it.clone().next().expect("truncated tag");
let mut data = ptr.offset(1) as *const ();
send_value(writer, tag, &mut data, write_tags)
})
// Tag::Keyword never appears in composite types, so we don't have
// to accurately advance data.
}
Tag::Object => {
#[repr(C)]
struct Object {
id: u32,
}
consume_value!(*const Object, |ptr| writer.write_u32((**ptr).id))
}
}
}
pub fn send_args<W>(
writer: &mut W,
service: u32,
tag_bytes: &[u8],
data: *const *const (),
write_tags: bool,
) -> Result<(), Error>
where
W: Write + ?Sized,
{
let (arg_tags_bytes, return_tag_bytes) = split_tag(tag_bytes);
let mut args_it = TagIterator::new(arg_tags_bytes);
let return_it = TagIterator::new(return_tag_bytes);
trace!("send<{}>({})->{}", service, args_it, return_it);
writer.write_u32(service)?;
for index in 0.. {
if let Some(arg_tag) = args_it.next() {
let mut data = unsafe { *data.offset(index) };
unsafe { send_value(writer, arg_tag, &mut data, write_tags)? };
} else {
break;
}
}
writer.write_u8(0)?;
writer.write_bytes(return_tag_bytes)?;
Ok(())
}
pub mod tag {
use core::fmt;
pub fn split_tag(tag_bytes: &[u8]) -> (&[u8], &[u8]) {
let tag_separator = tag_bytes
.iter()
.position(|&b| b == b':')
.expect("tag without a return separator");
let (arg_tags_bytes, rest) = tag_bytes.split_at(tag_separator);
let return_tag_bytes = &rest[1..];
(arg_tags_bytes, return_tag_bytes)
}
#[derive(Debug, Clone, Copy)]
pub enum Tag<'a> {
None,
Bool,
Int32,
Int64,
Float64,
String,
Bytes,
ByteArray,
Tuple(TagIterator<'a>, u8),
List(TagIterator<'a>),
Array(TagIterator<'a>, u8),
Range(TagIterator<'a>),
Keyword(TagIterator<'a>),
Object,
}
impl<'a> Tag<'a> {
pub fn as_u8(self) -> u8 {
match self {
Tag::None => b'n',
Tag::Bool => b'b',
Tag::Int32 => b'i',
Tag::Int64 => b'I',
Tag::Float64 => b'f',
Tag::String => b's',
Tag::Bytes => b'B',
Tag::ByteArray => b'A',
Tag::Tuple(_, _) => b't',
Tag::List(_) => b'l',
Tag::Array(_, _) => b'a',
Tag::Range(_) => b'r',
Tag::Keyword(_) => b'k',
Tag::Object => b'O',
}
}
pub fn alignment(self) -> usize {
use cslice::CSlice;
match self {
Tag::None => 1,
Tag::Bool => core::mem::align_of::<u8>(),
Tag::Int32 => core::mem::align_of::<i32>(),
Tag::Int64 => core::mem::align_of::<i64>(),
Tag::Float64 => core::mem::align_of::<f64>(),
// struct type: align to largest element
Tag::Tuple(it, arity) => {
let it = it.clone();
it.take(arity.into()).map(|t| t.alignment()).max().unwrap()
}
Tag::Range(it) => {
let it = it.clone();
it.take(3).map(|t| t.alignment()).max().unwrap()
}
// the ptr/length(s) pair is basically CSlice
Tag::Bytes | Tag::String | Tag::ByteArray | Tag::List(_) | Tag::Array(_, _) => {
core::mem::align_of::<CSlice<()>>()
}
Tag::Keyword(_) => unreachable!("Tag::Keyword should not appear in composite types"),
Tag::Object => core::mem::align_of::<u32>(),
}
}
pub fn size(self) -> usize {
match self {
Tag::None => 0,
Tag::Bool => 1,
Tag::Int32 => 4,
Tag::Int64 => 8,
Tag::Float64 => 8,
Tag::String => 8,
Tag::Bytes => 8,
Tag::ByteArray => 8,
Tag::Tuple(it, arity) => {
let mut size = 0;
let mut max_alignment = 0;
let mut it = it.clone();
for _ in 0..arity {
let tag = it.next().expect("truncated tag");
let alignment = tag.alignment();
max_alignment = core::cmp::max(max_alignment, alignment);
size = super::round_up(size, alignment);
size += tag.size();
}
// Take into account any tail padding (if element(s) with largest
// alignment are not at the end).
size = super::round_up(size, max_alignment);
size
}
Tag::List(_) => 4,
Tag::Array(_, num_dims) => 4 * (1 + num_dims as usize),
Tag::Range(it) => {
let tag = it.clone().next().expect("truncated tag");
tag.size() * 3
}
Tag::Keyword(_) => unreachable!(),
Tag::Object => unreachable!(),
}
}
}
#[derive(Debug, Clone, Copy)]
pub struct TagIterator<'a> {
pub data: &'a [u8],
}
impl<'a> TagIterator<'a> {
pub fn new(data: &'a [u8]) -> TagIterator<'a> {
TagIterator { data }
}
fn sub(&mut self, count: u8) -> TagIterator<'a> {
let data = self.data;
for _ in 0..count {
self.next().expect("truncated tag");
}
TagIterator {
data: &data[..(data.len() - self.data.len())],
}
}
}
impl<'a> core::iter::Iterator for TagIterator<'a> {
type Item = Tag<'a>;
fn next(&mut self) -> Option<Tag<'a>> {
if self.data.len() == 0 {
return None;
}
let tag_byte = self.data[0];
self.data = &self.data[1..];
Some(match tag_byte {
b'n' => Tag::None,
b'b' => Tag::Bool,
b'i' => Tag::Int32,
b'I' => Tag::Int64,
b'f' => Tag::Float64,
b's' => Tag::String,
b'B' => Tag::Bytes,
b'A' => Tag::ByteArray,
b't' => {
let count = self.data[0];
self.data = &self.data[1..];
Tag::Tuple(self.sub(count), count)
}
b'l' => Tag::List(self.sub(1)),
b'a' => {
let count = self.data[0];
self.data = &self.data[1..];
Tag::Array(self.sub(1), count)
}
b'r' => Tag::Range(self.sub(1)),
b'k' => Tag::Keyword(self.sub(1)),
b'O' => Tag::Object,
_ => unreachable!(),
})
}
}
impl<'a> fmt::Display for TagIterator<'a> {
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
let mut it = self.clone();
let mut first = true;
while let Some(tag) = it.next() {
if first {
first = false
} else {
write!(f, ", ")?
}
match tag {
Tag::None => write!(f, "None")?,
Tag::Bool => write!(f, "Bool")?,
Tag::Int32 => write!(f, "Int32")?,
Tag::Int64 => write!(f, "Int64")?,
Tag::Float64 => write!(f, "Float64")?,
Tag::String => write!(f, "String")?,
Tag::Bytes => write!(f, "Bytes")?,
Tag::ByteArray => write!(f, "ByteArray")?,
Tag::Tuple(it, _) => {
write!(f, "Tuple(")?;
it.fmt(f)?;
write!(f, ")")?;
}
Tag::List(it) => {
write!(f, "List(")?;
it.fmt(f)?;
write!(f, ")")?;
}
Tag::Array(it, num_dims) => {
write!(f, "Array(")?;
it.fmt(f)?;
write!(f, ", {})", num_dims)?;
}
Tag::Range(it) => {
write!(f, "Range(")?;
it.fmt(f)?;
write!(f, ")")?;
}
Tag::Keyword(it) => {
write!(f, "Keyword(")?;
it.fmt(f)?;
write!(f, ")")?;
}
Tag::Object => write!(f, "Object")?,
}
}
Ok(())
}
}
}

View File

@ -1,16 +1,17 @@
use cslice::CSlice;
use vcell::VolatileCell;
use libcortex_a9::asm;
use crate::artiq_raise;
use core::sync::atomic::{fence, Ordering}; use core::sync::atomic::{fence, Ordering};
use crate::pl::csr; use cslice::CSlice;
use libcortex_a9::asm;
use vcell::VolatileCell;
use crate::{artiq_raise, pl::csr, resolve_channel_name, rtio_core};
pub const RTIO_O_STATUS_WAIT: i32 = 1; pub const RTIO_O_STATUS_WAIT: i32 = 1;
pub const RTIO_O_STATUS_UNDERFLOW: i32 = 2; pub const RTIO_O_STATUS_UNDERFLOW: i32 = 2;
pub const RTIO_O_STATUS_DESTINATION_UNREACHABLE: i32 = 4; pub const RTIO_O_STATUS_DESTINATION_UNREACHABLE: i32 = 4;
pub const RTIO_I_STATUS_WAIT_EVENT: i32 = 1; pub const RTIO_I_STATUS_WAIT_EVENT: i32 = 1;
pub const RTIO_I_STATUS_OVERFLOW: i32 = 2; pub const RTIO_I_STATUS_OVERFLOW: i32 = 2;
#[allow(unused)]
pub const RTIO_I_STATUS_WAIT_STATUS: i32 = 4; // TODO pub const RTIO_I_STATUS_WAIT_STATUS: i32 = 4; // TODO
pub const RTIO_I_STATUS_DESTINATION_UNREACHABLE: i32 = 8; pub const RTIO_I_STATUS_DESTINATION_UNREACHABLE: i32 = 8;
@ -46,23 +47,18 @@ static mut TRANSACTION_BUFFER: Transaction = Transaction {
reply_timestamp: VolatileCell::new(0), reply_timestamp: VolatileCell::new(0),
padding0: [0; 2], padding0: [0; 2],
padding1: [0; 2], padding1: [0; 2],
padding2: [0; 2] padding2: [0; 2],
}; };
pub extern fn init() { pub extern "C" fn init() {
unsafe { unsafe {
csr::rtio_core::reset_write(1); rtio_core::reset_write(1);
csr::rtio::engine_addr_base_write(&TRANSACTION_BUFFER as *const Transaction as u32); csr::rtio::engine_addr_base_write(&TRANSACTION_BUFFER as *const Transaction as u32);
csr::rtio::enable_write(1); csr::rtio::enable_write(1);
} }
} }
pub extern fn get_destination_status(destination: i32) -> bool { pub extern "C" fn get_counter() -> i64 {
// TODO
destination == 0
}
pub extern fn get_counter() -> i64 {
unsafe { unsafe {
csr::rtio::counter_update_write(1); csr::rtio::counter_update_write(1);
csr::rtio::counter_read() as i64 csr::rtio::counter_read() as i64
@ -71,15 +67,15 @@ pub extern fn get_counter() -> i64 {
static mut NOW: i64 = 0; static mut NOW: i64 = 0;
pub extern fn now_mu() -> i64 { pub extern "C" fn now_mu() -> i64 {
unsafe { NOW } unsafe { NOW }
} }
pub extern fn at_mu(t: i64) { pub extern "C" fn at_mu(t: i64) {
unsafe { NOW = t } unsafe { NOW = t }
} }
pub extern fn delay_mu(dt: i64) { pub extern "C" fn delay_mu(dt: i64) {
unsafe { NOW += dt } unsafe { NOW += dt }
} }
@ -91,18 +87,34 @@ unsafe fn process_exceptional_status(channel: i32, status: i32) {
while csr::rtio::o_status_read() as i32 & RTIO_O_STATUS_WAIT != 0 {} while csr::rtio::o_status_read() as i32 & RTIO_O_STATUS_WAIT != 0 {}
} }
if status & RTIO_O_STATUS_UNDERFLOW != 0 { if status & RTIO_O_STATUS_UNDERFLOW != 0 {
artiq_raise!("RTIOUnderflow", artiq_raise!(
"RTIO underflow at {0} mu, channel {1}, slack {2} mu", "RTIOUnderflow",
timestamp, channel as i64, timestamp - get_counter()); format!(
"RTIO underflow at {{1}} mu, channel 0x{:04x}:{}, slack {{2}} mu",
channel,
resolve_channel_name(channel as u32)
),
channel as i64,
timestamp,
timestamp - get_counter()
);
} }
if status & RTIO_O_STATUS_DESTINATION_UNREACHABLE != 0 { if status & RTIO_O_STATUS_DESTINATION_UNREACHABLE != 0 {
artiq_raise!("RTIODestinationUnreachable", artiq_raise!(
"RTIO destination unreachable, output, at {0} mu, channel {1}", "RTIODestinationUnreachable",
timestamp, channel as i64, 0); format!(
"RTIO destination unreachable, output, at {{0}} mu, channel 0x{:04x}:{}",
channel,
resolve_channel_name(channel as u32)
),
timestamp,
channel as i64,
0
);
} }
} }
pub extern fn output(target: i32, data: i32) { pub extern "C" fn output(target: i32, data: i32) {
unsafe { unsafe {
// Clear status so we can observe response // Clear status so we can observe response
TRANSACTION_BUFFER.reply_status.set(0); TRANSACTION_BUFFER.reply_status.set(0);
@ -130,7 +142,7 @@ pub extern fn output(target: i32, data: i32) {
} }
} }
pub extern fn output_wide(target: i32, data: CSlice<i32>) { pub extern "C" fn output_wide(target: i32, data: CSlice<i32>) {
unsafe { unsafe {
// Clear status so we can observe response // Clear status so we can observe response
TRANSACTION_BUFFER.reply_status.set(0); TRANSACTION_BUFFER.reply_status.set(0);
@ -147,7 +159,7 @@ pub extern fn output_wide(target: i32, data: CSlice<i32>) {
loop { loop {
status = TRANSACTION_BUFFER.reply_status.get(); status = TRANSACTION_BUFFER.reply_status.get();
if status != 0 { if status != 0 {
break break;
} }
} }
@ -158,7 +170,7 @@ pub extern fn output_wide(target: i32, data: CSlice<i32>) {
} }
} }
pub extern fn input_timestamp(timeout: i64, channel: i32) -> i64 { pub extern "C" fn input_timestamp(timeout: i64, channel: i32) -> i64 {
unsafe { unsafe {
// Clear status so we can observe response // Clear status so we can observe response
TRANSACTION_BUFFER.reply_status.set(0); TRANSACTION_BUFFER.reply_status.set(0);
@ -175,29 +187,45 @@ pub extern fn input_timestamp(timeout: i64, channel: i32) -> i64 {
loop { loop {
status = TRANSACTION_BUFFER.reply_status.get(); status = TRANSACTION_BUFFER.reply_status.get();
if status != 0 { if status != 0 {
break break;
} }
} }
if status & RTIO_I_STATUS_OVERFLOW != 0 { if status & RTIO_I_STATUS_OVERFLOW != 0 {
artiq_raise!("RTIOOverflow", artiq_raise!(
"RTIO input overflow on channel {0}", "RTIOOverflow",
channel as i64, 0, 0); format!(
"RTIO input overflow on channel 0x{:04x}:{}",
channel,
resolve_channel_name(channel as u32)
),
channel as i64,
0,
0
);
} }
if status & RTIO_I_STATUS_WAIT_EVENT != 0 { if status & RTIO_I_STATUS_WAIT_EVENT != 0 {
return -1 return -1;
} }
if status & RTIO_I_STATUS_DESTINATION_UNREACHABLE != 0 { if status & RTIO_I_STATUS_DESTINATION_UNREACHABLE != 0 {
artiq_raise!("RTIODestinationUnreachable", artiq_raise!(
"RTIO destination unreachable, input, on channel {0}", "RTIODestinationUnreachable",
channel as i64, 0, 0); format!(
"RTIO destination unreachable, input, on channel 0x{:04x}:{}",
channel,
resolve_channel_name(channel as u32)
),
channel as i64,
0,
0
);
} }
TRANSACTION_BUFFER.reply_timestamp.get() TRANSACTION_BUFFER.reply_timestamp.get()
} }
} }
pub extern fn input_data(channel: i32) -> i32 { pub extern "C" fn input_data(channel: i32) -> i32 {
unsafe { unsafe {
TRANSACTION_BUFFER.reply_status.set(0); TRANSACTION_BUFFER.reply_status.set(0);
@ -213,26 +241,42 @@ pub extern fn input_data(channel: i32) -> i32 {
loop { loop {
status = TRANSACTION_BUFFER.reply_status.get(); status = TRANSACTION_BUFFER.reply_status.get();
if status != 0 { if status != 0 {
break break;
} }
} }
if status & RTIO_I_STATUS_OVERFLOW != 0 { if status & RTIO_I_STATUS_OVERFLOW != 0 {
artiq_raise!("RTIOOverflow", artiq_raise!(
"RTIO input overflow on channel {0}", "RTIOOverflow",
channel as i64, 0, 0); format!(
"RTIO input overflow on channel 0x{:04x}:{}",
channel,
resolve_channel_name(channel as u32)
),
channel as i64,
0,
0
);
} }
if status & RTIO_I_STATUS_DESTINATION_UNREACHABLE != 0 { if status & RTIO_I_STATUS_DESTINATION_UNREACHABLE != 0 {
artiq_raise!("RTIODestinationUnreachable", artiq_raise!(
"RTIO destination unreachable, input, on channel {0}", "RTIODestinationUnreachable",
channel as i64, 0, 0); format!(
"RTIO destination unreachable, input, on channel 0x{:04x}:{}",
channel,
resolve_channel_name(channel as u32)
),
channel as i64,
0,
0
);
} }
TRANSACTION_BUFFER.reply_data.get() TRANSACTION_BUFFER.reply_data.get()
} }
} }
pub extern fn input_timestamped_data(timeout: i64, channel: i32) -> TimestampedData { pub extern "C" fn input_timestamped_data(timeout: i64, channel: i32) -> TimestampedData {
unsafe { unsafe {
TRANSACTION_BUFFER.reply_status.set(0); TRANSACTION_BUFFER.reply_status.set(0);
@ -248,19 +292,35 @@ pub extern fn input_timestamped_data(timeout: i64, channel: i32) -> TimestampedD
loop { loop {
status = TRANSACTION_BUFFER.reply_status.get(); status = TRANSACTION_BUFFER.reply_status.get();
if status != 0 { if status != 0 {
break break;
} }
} }
if status & RTIO_I_STATUS_OVERFLOW != 0 { if status & RTIO_I_STATUS_OVERFLOW != 0 {
artiq_raise!("RTIOOverflow", artiq_raise!(
"RTIO input overflow on channel {0}", "RTIOOverflow",
channel as i64, 0, 0); format!(
"RTIO input overflow on channel 0x{:04x}:{}",
channel,
resolve_channel_name(channel as u32)
),
channel as i64,
0,
0
);
} }
if status & RTIO_I_STATUS_DESTINATION_UNREACHABLE != 0 { if status & RTIO_I_STATUS_DESTINATION_UNREACHABLE != 0 {
artiq_raise!("RTIODestinationUnreachable", artiq_raise!(
"RTIO destination unreachable, input, on channel {0}", "RTIODestinationUnreachable",
channel as i64, 0, 0); format!(
"RTIO destination unreachable, input, on channel 0x{:04x}:{}",
channel,
resolve_channel_name(channel as u32)
),
channel as i64,
0,
0
);
} }
TimestampedData { TimestampedData {

View File

@ -0,0 +1,274 @@
use core::ptr::{read_volatile, write_volatile};
use cslice::CSlice;
use crate::{artiq_raise, pl::csr, resolve_channel_name, rtio_core};
pub const RTIO_O_STATUS_WAIT: u8 = 1;
pub const RTIO_O_STATUS_UNDERFLOW: u8 = 2;
pub const RTIO_O_STATUS_DESTINATION_UNREACHABLE: u8 = 4;
pub const RTIO_I_STATUS_WAIT_EVENT: u8 = 1;
pub const RTIO_I_STATUS_OVERFLOW: u8 = 2;
pub const RTIO_I_STATUS_WAIT_STATUS: u8 = 4;
pub const RTIO_I_STATUS_DESTINATION_UNREACHABLE: u8 = 8;
#[repr(C)]
pub struct TimestampedData {
timestamp: i64,
data: i32,
}
pub extern "C" fn init() {
unsafe {
rtio_core::reset_write(1);
}
}
pub extern "C" fn get_counter() -> i64 {
unsafe {
csr::rtio::counter_update_write(1);
csr::rtio::counter_read() as i64
}
}
pub extern "C" fn now_mu() -> i64 {
unsafe { csr::rtio::now_read() as i64 }
}
pub extern "C" fn at_mu(t: i64) {
unsafe {
csr::rtio::now_write(t as u64);
}
}
pub extern "C" fn delay_mu(dt: i64) {
unsafe {
csr::rtio::now_write(csr::rtio::now_read() + dt as u64);
}
}
// writing the LSB of o_data (offset=0) triggers the RTIO write
#[inline(always)]
pub unsafe fn rtio_o_data_write(offset: usize, data: u32) {
write_volatile(
csr::rtio::O_DATA_ADDR.offset((csr::rtio::O_DATA_SIZE - 1 - offset) as isize),
data,
);
}
#[inline(always)]
pub unsafe fn rtio_i_data_read(offset: usize) -> u32 {
read_volatile(csr::rtio::I_DATA_ADDR.offset((csr::rtio::I_DATA_SIZE - 1 - offset) as isize))
}
#[inline(never)]
unsafe fn process_exceptional_status(channel: i32, status: u8) {
let timestamp = csr::rtio::now_read() as i64;
if status & RTIO_O_STATUS_WAIT != 0 {
while csr::rtio::o_status_read() & RTIO_O_STATUS_WAIT != 0 {}
}
if status & RTIO_O_STATUS_UNDERFLOW != 0 {
artiq_raise!(
"RTIOUnderflow",
format!(
"RTIO underflow at {{1}} mu, channel 0x{:04x}:{}, slack {{2}} mu",
channel,
resolve_channel_name(channel as u32)
),
channel as i64,
timestamp,
timestamp - get_counter()
);
}
if status & RTIO_O_STATUS_DESTINATION_UNREACHABLE != 0 {
artiq_raise!(
"RTIODestinationUnreachable",
format!(
"RTIO destination unreachable, output, at {{0}} mu, channel 0x{:04x}:{}",
channel,
resolve_channel_name(channel as u32)
),
timestamp,
channel as i64,
0
);
}
}
pub extern "C" fn output(target: i32, data: i32) {
unsafe {
csr::rtio::target_write(target as u32);
// writing target clears o_data
rtio_o_data_write(0, data as _);
let status = csr::rtio::o_status_read();
if status != 0 {
process_exceptional_status(target >> 8, status);
}
}
}
pub extern "C" fn output_wide(target: i32, data: &CSlice<i32>) {
unsafe {
csr::rtio::target_write(target as u32);
// writing target clears o_data
for i in (0..data.len()).rev() {
rtio_o_data_write(i, data[i] as _)
}
let status = csr::rtio::o_status_read();
if status != 0 {
process_exceptional_status(target >> 8, status);
}
}
}
pub extern "C" fn input_timestamp(timeout: i64, channel: i32) -> i64 {
unsafe {
csr::rtio::target_write((channel as u32) << 8);
csr::rtio::i_timeout_write(timeout as u64);
let mut status = RTIO_I_STATUS_WAIT_STATUS;
while status & RTIO_I_STATUS_WAIT_STATUS != 0 {
status = csr::rtio::i_status_read();
}
if status & RTIO_I_STATUS_OVERFLOW != 0 {
artiq_raise!(
"RTIOOverflow",
format!(
"RTIO input overflow on channel 0x{:04x}:{}",
channel,
resolve_channel_name(channel as u32)
),
channel as i64,
0,
0
);
}
if status & RTIO_I_STATUS_WAIT_EVENT != 0 {
return -1;
}
if status & RTIO_I_STATUS_DESTINATION_UNREACHABLE != 0 {
artiq_raise!(
"RTIODestinationUnreachable",
format!(
"RTIO destination unreachable, input, on channel 0x{:04x}:{}",
channel,
resolve_channel_name(channel as u32)
),
channel as i64,
0,
0
);
}
csr::rtio::i_timestamp_read() as i64
}
}
pub extern "C" fn input_data(channel: i32) -> i32 {
unsafe {
csr::rtio::target_write((channel as u32) << 8);
csr::rtio::i_timeout_write(0xffffffff_ffffffff);
let mut status = RTIO_I_STATUS_WAIT_STATUS;
while status & RTIO_I_STATUS_WAIT_STATUS != 0 {
status = csr::rtio::i_status_read();
}
if status & RTIO_I_STATUS_OVERFLOW != 0 {
artiq_raise!(
"RTIOOverflow",
format!(
"RTIO input overflow on channel 0x{:04x}:{}",
channel,
resolve_channel_name(channel as u32)
),
channel as i64,
0,
0
);
}
if status & RTIO_I_STATUS_DESTINATION_UNREACHABLE != 0 {
artiq_raise!(
"RTIODestinationUnreachable",
format!(
"RTIO destination unreachable, input, on channel 0x{:04x}:{}",
channel,
resolve_channel_name(channel as u32)
),
channel as i64,
0,
0
);
}
rtio_i_data_read(0) as i32
}
}
pub extern "C" fn input_timestamped_data(timeout: i64, channel: i32) -> TimestampedData {
unsafe {
csr::rtio::target_write((channel as u32) << 8);
csr::rtio::i_timeout_write(timeout as u64);
let mut status = RTIO_I_STATUS_WAIT_STATUS;
while status & RTIO_I_STATUS_WAIT_STATUS != 0 {
status = csr::rtio::i_status_read();
}
if status & RTIO_I_STATUS_OVERFLOW != 0 {
artiq_raise!(
"RTIOOverflow",
format!(
"RTIO input overflow on channel 0x{:04x}:{}",
channel,
resolve_channel_name(channel as u32)
),
channel as i64,
0,
0
);
}
if status & RTIO_I_STATUS_WAIT_EVENT != 0 {
return TimestampedData { timestamp: -1, data: 0 };
}
if status & RTIO_I_STATUS_DESTINATION_UNREACHABLE != 0 {
artiq_raise!(
"RTIODestinationUnreachable",
format!(
"RTIO destination unreachable, input, on channel 0x{:04x}:{}",
channel,
resolve_channel_name(channel as u32)
),
channel as i64,
0,
0
);
}
TimestampedData {
timestamp: csr::rtio::i_timestamp_read() as i64,
data: rtio_i_data_read(0) as i32,
}
}
}
pub fn write_log(data: &[i8]) {
unsafe {
csr::rtio::target_write(csr::CONFIG_RTIO_LOG_CHANNEL << 8);
let mut word: u32 = 0;
for i in 0..data.len() {
word <<= 8;
word |= data[i] as u32;
if i % 4 == 3 {
rtio_o_data_write(0, word);
word = 0;
}
}
if word != 0 {
rtio_o_data_write(0, word);
}
}
}

View File

@ -1,27 +1,25 @@
use libc::{c_void, c_int}; use libc::{c_int, c_void};
use crate::libunwind as uw; use crate::libunwind as uw;
const UW_REG_SP: c_int = 13; const UW_REG_SP: c_int = 13;
pub fn backtrace<F>(f: F) -> Result<(), uw::_Unwind_Reason_Code> pub fn backtrace<F>(f: F) -> Result<(), uw::_Unwind_Reason_Code>
where F: FnMut(usize) -> () where F: FnMut(usize) -> () {
{
struct TraceContext<F> { struct TraceContext<F> {
step_fn: F, step_fn: F,
prev_sp: uw::_Unwind_Word prev_sp: uw::_Unwind_Word,
} }
extern fn trace<F>(context: *mut uw::_Unwind_Context, arg: *mut c_void) extern "C" fn trace<F>(context: *mut uw::_Unwind_Context, arg: *mut c_void) -> uw::_Unwind_Reason_Code
-> uw::_Unwind_Reason_Code where F: FnMut(usize) -> () {
where F: FnMut(usize) -> ()
{
unsafe { unsafe {
let trace_context = &mut *(arg as *mut TraceContext<F>); let trace_context = &mut *(arg as *mut TraceContext<F>);
// Detect the root of a libfringe thread // Detect the root of a libfringe thread
let cur_sp = uw::_Unwind_GetGR(context, UW_REG_SP); let cur_sp = uw::_Unwind_GetGR(context, UW_REG_SP);
if cur_sp == trace_context.prev_sp { if cur_sp == trace_context.prev_sp {
return uw::_URC_END_OF_STACK return uw::_URC_END_OF_STACK;
} else { } else {
trace_context.prev_sp = cur_sp; trace_context.prev_sp = cur_sp;
} }
@ -35,7 +33,7 @@ pub fn backtrace<F>(f: F) -> Result<(), uw::_Unwind_Reason_Code>
let mut trace_context = TraceContext { step_fn: f, prev_sp: 0 }; let mut trace_context = TraceContext { step_fn: f, prev_sp: 0 };
match uw::_Unwind_Backtrace(trace::<F>, &mut trace_context as *mut _ as *mut c_void) { match uw::_Unwind_Backtrace(trace::<F>, &mut trace_context as *mut _ as *mut c_void) {
uw::_URC_NO_REASON => Ok(()), uw::_URC_NO_REASON => Ok(()),
err => Err(err) err => Err(err),
} }
} }
} }

View File

@ -5,7 +5,7 @@ fn main() {
} }
mod llvm_libunwind { mod llvm_libunwind {
use std::path::Path; use std::{env, path::Path};
fn setup_options(cfg: &mut cc::Build) { fn setup_options(cfg: &mut cc::Build) {
cfg.no_default_flags(true); cfg.no_default_flags(true);
@ -16,9 +16,13 @@ mod llvm_libunwind {
cfg.flag("-fno-PIC"); cfg.flag("-fno-PIC");
cfg.flag("-Isrc"); cfg.flag("-Isrc");
cfg.flag("-isystem../include"); cfg.flag("-isystem../include");
if let Ok(extra_include) = env::var("CLANG_EXTRA_INCLUDE_DIR") {
cfg.flag(&("-isystem".to_owned() + &extra_include));
}
cfg.flag("-fno-stack-protector"); cfg.flag("-fno-stack-protector");
cfg.flag("--target=armv7-none-eabihf"); cfg.flag("--target=armv7-none-eabihf");
cfg.flag("-O2"); cfg.flag("-O2");
cfg.flag("-flto");
cfg.flag("-std=c99"); cfg.flag("-std=c99");
cfg.flag("-fstrict-aliasing"); cfg.flag("-fstrict-aliasing");
@ -77,11 +81,7 @@ mod llvm_libunwind {
cfg.flag("-fvisibility=hidden"); cfg.flag("-fvisibility=hidden");
cfg.flag_if_supported("-fvisibility-global-new-delete-hidden"); cfg.flag_if_supported("-fvisibility-global-new-delete-hidden");
let unwind_sources = vec![ let unwind_sources = vec!["Unwind-EHABI.cpp", "Unwind-seh.cpp", "libunwind.cpp"];
"Unwind-EHABI.cpp",
"Unwind-seh.cpp",
"libunwind.cpp"
];
let root = Path::new("../llvm_libunwind"); let root = Path::new("../llvm_libunwind");
cfg.include(root.join("include")); cfg.include(root.join("include"));

View File

@ -21,8 +21,7 @@ pub use _Unwind_Reason_Code::*;
pub type _Unwind_Exception_Class = u64; pub type _Unwind_Exception_Class = u64;
pub type _Unwind_Word = uintptr_t; pub type _Unwind_Word = uintptr_t;
pub type _Unwind_Ptr = uintptr_t; pub type _Unwind_Ptr = uintptr_t;
pub type _Unwind_Trace_Fn = pub type _Unwind_Trace_Fn = extern "C" fn(ctx: *mut _Unwind_Context, arg: *mut c_void) -> _Unwind_Reason_Code;
extern "C" fn(ctx: *mut _Unwind_Context, arg: *mut c_void) -> _Unwind_Reason_Code;
#[cfg(target_arch = "x86")] #[cfg(target_arch = "x86")]
pub const unwinder_private_data_size: usize = 5; pub const unwinder_private_data_size: usize = 5;
@ -279,7 +278,6 @@ if #[cfg(all(windows, target_arch = "x86_64", target_env = "gnu"))] {
} // cfg_if! } // cfg_if!
#[no_mangle] #[no_mangle]
extern fn abort() { extern "C" fn abort() {
panic!("Abort!"); panic!("Abort!");
} }

View File

@ -107,9 +107,12 @@ struct _Unwind_Control_Block {
} __attribute__((__aligned__(8))); } __attribute__((__aligned__(8)));
typedef _Unwind_Reason_Code (*_Unwind_Stop_Fn) typedef _Unwind_Reason_Code (*_Unwind_Stop_Fn)
(_Unwind_State state, (int version,
_Unwind_Action actions,
uint64_t exceptionClass,
_Unwind_Exception* exceptionObject, _Unwind_Exception* exceptionObject,
struct _Unwind_Context* context); struct _Unwind_Context* context,
void* stop_parameter);
typedef _Unwind_Reason_Code (*__personality_routine) typedef _Unwind_Reason_Code (*__personality_routine)
(_Unwind_State state, (_Unwind_State state,

View File

@ -95,9 +95,11 @@ _Unwind_Reason_Code ProcessDescriptors(
case Descriptor::LU32: case Descriptor::LU32:
descriptor = getNextWord(descriptor, &length); descriptor = getNextWord(descriptor, &length);
descriptor = getNextWord(descriptor, &offset); descriptor = getNextWord(descriptor, &offset);
break;
case Descriptor::LU16: case Descriptor::LU16:
descriptor = getNextNibble(descriptor, &length); descriptor = getNextNibble(descriptor, &length);
descriptor = getNextNibble(descriptor, &offset); descriptor = getNextNibble(descriptor, &offset);
break;
default: default:
assert(false); assert(false);
return _URC_FAILURE; return _URC_FAILURE;
@ -183,8 +185,14 @@ static _Unwind_Reason_Code unwindOneFrame(_Unwind_State state,
if (result != _URC_CONTINUE_UNWIND) if (result != _URC_CONTINUE_UNWIND)
return result; return result;
if (__unw_step(reinterpret_cast<unw_cursor_t *>(context)) != UNW_STEP_SUCCESS) switch (__unw_step(reinterpret_cast<unw_cursor_t *>(context))) {
case UNW_STEP_SUCCESS:
return _URC_CONTINUE_UNWIND;
case UNW_STEP_END:
return _URC_END_OF_STACK;
default:
return _URC_FAILURE; return _URC_FAILURE;
}
return _URC_CONTINUE_UNWIND; return _URC_CONTINUE_UNWIND;
} }
@ -677,6 +685,128 @@ static _Unwind_Reason_Code unwind_phase2(unw_context_t *uc, unw_cursor_t *cursor
return _URC_FATAL_PHASE2_ERROR; return _URC_FATAL_PHASE2_ERROR;
} }
static _Unwind_Reason_Code
unwind_phase2_forced(unw_context_t *uc, unw_cursor_t *cursor,
_Unwind_Exception *exception_object, _Unwind_Stop_Fn stop,
void *stop_parameter) {
// See comment at the start of unwind_phase1 regarding VRS integrity.
__unw_init_local(cursor, uc);
_LIBUNWIND_TRACE_UNWINDING("unwind_phase2_forced(ex_ojb=%p)",
static_cast<void *>(exception_object));
// Walk each frame until we reach where search phase said to stop.
bool end_of_stack = false;
// TODO: why can't libunwind handle end of stack properly?
// We should fix this kind of hack.
unw_word_t forced_phase2_prev_sp = 0x0;
while (!end_of_stack) {
// Get info about this frame.
unw_word_t sp;
unw_proc_info_t frameInfo;
__unw_get_reg(cursor, UNW_REG_SP, &sp);
if (sp == forced_phase2_prev_sp) {
break;
}
forced_phase2_prev_sp = sp;
if (__unw_get_proc_info(cursor, &frameInfo) != UNW_ESUCCESS) {
_LIBUNWIND_TRACE_UNWINDING(
"unwind_phase2_forced(ex_ojb=%p): __unw_get_proc_info "
"failed => _URC_FATAL_PHASE2_ERROR",
static_cast<void *>(exception_object));
return _URC_FATAL_PHASE2_ERROR;
}
// When tracing, print state information.
if (_LIBUNWIND_TRACING_UNWINDING) {
char functionBuf[512];
const char *functionName = functionBuf;
unw_word_t offset;
if ((__unw_get_proc_name(cursor, functionBuf, sizeof(functionBuf),
&offset) != UNW_ESUCCESS) ||
(frameInfo.start_ip + offset > frameInfo.end_ip))
functionName = ".anonymous.";
_LIBUNWIND_TRACE_UNWINDING(
"unwind_phase2_forced(ex_ojb=%p): start_ip=0x%" PRIxPTR ", func=%s, sp=0x%" PRIxPTR ", "
"lsda=0x%" PRIxPTR ", personality=0x%" PRIxPTR "",
static_cast<void *>(exception_object), frameInfo.start_ip,
functionName, sp, frameInfo.lsda,
frameInfo.handler);
}
_Unwind_Action action =
(_Unwind_Action)(_UA_FORCE_UNWIND | _UA_CLEANUP_PHASE);
_Unwind_Reason_Code stopResult =
(*stop)(1, action, exception_object->exception_class, exception_object,
(_Unwind_Context *)(cursor), stop_parameter);
_LIBUNWIND_TRACE_UNWINDING(
"unwind_phase2_forced(ex_ojb=%p): stop function returned %d",
(void *)exception_object, stopResult);
if (stopResult != _URC_NO_REASON) {
_LIBUNWIND_TRACE_UNWINDING(
"unwind_phase2_forced(ex_ojb=%p): stopped by stop function",
(void *)exception_object);
return _URC_FATAL_PHASE2_ERROR;
}
// If there is a personality routine, tell it we are unwinding.
if (frameInfo.handler != 0) {
__personality_routine p =
(__personality_routine)(long)(frameInfo.handler);
struct _Unwind_Context *context = (struct _Unwind_Context *)(cursor);
// EHABI #7.2
exception_object->pr_cache.fnstart = frameInfo.start_ip;
exception_object->pr_cache.ehtp =
(_Unwind_EHT_Header *)frameInfo.unwind_info;
exception_object->pr_cache.additional = frameInfo.flags;
_Unwind_Reason_Code personalityResult =
(*p)(_US_FORCE_UNWIND | _US_UNWIND_FRAME_STARTING, exception_object,
context);
switch (personalityResult) {
case _URC_CONTINUE_UNWIND:
// Continue unwinding
_LIBUNWIND_TRACE_UNWINDING(
"unwind_phase2_forced(ex_ojb=%p): _URC_CONTINUE_UNWIND",
static_cast<void *>(exception_object));
break;
case _URC_INSTALL_CONTEXT:
_LIBUNWIND_TRACE_UNWINDING(
"unwind_phase2_forced(ex_ojb=%p): _URC_INSTALL_CONTEXT",
static_cast<void *>(exception_object));
{
// EHABI #7.4.1 says we need to preserve pc for when _Unwind_Resume
// is called back, to find this same frame.
unw_word_t pc;
__unw_get_reg(cursor, UNW_REG_IP, &pc);
exception_object->unwinder_cache.reserved2 = (uint32_t)pc;
}
// We may get control back if landing pad calls _Unwind_Resume().
__unw_resume(cursor);
break;
case _URC_END_OF_STACK:
end_of_stack = true;
break;
default:
// Personality routine returned an unknown result code.
_LIBUNWIND_DEBUG_LOG("personality function returned unknown result %d",
personalityResult);
return _URC_FATAL_PHASE2_ERROR;
}
}
}
_LIBUNWIND_TRACE_UNWINDING("unwind_phase2_forced(ex_ojb=%p): calling stop "
"function with _UA_END_OF_STACK",
(void *)exception_object);
_Unwind_Action lastAction =
(_Unwind_Action)(_UA_FORCE_UNWIND | _UA_CLEANUP_PHASE | _UA_END_OF_STACK);
(*stop)(1, lastAction, exception_object->exception_class, exception_object,
(struct _Unwind_Context *)(cursor), stop_parameter);
return _URC_FATAL_PHASE2_ERROR;
}
/// Called by __cxa_throw. Only returns if there is a fatal error. /// Called by __cxa_throw. Only returns if there is a fatal error.
_LIBUNWIND_EXPORT _Unwind_Reason_Code _LIBUNWIND_EXPORT _Unwind_Reason_Code
_Unwind_RaiseException(_Unwind_Exception *exception_object) { _Unwind_RaiseException(_Unwind_Exception *exception_object) {
@ -724,15 +854,36 @@ _Unwind_Resume(_Unwind_Exception *exception_object) {
unw_cursor_t cursor; unw_cursor_t cursor;
__unw_getcontext(&uc); __unw_getcontext(&uc);
// _Unwind_RaiseException on EHABI will always set the reserved1 field to 0, if (exception_object->unwinder_cache.reserved1)
// which is in the same position as private_1 below. unwind_phase2_forced(
// TODO(ajwong): Who wronte the above? Why is it true? &uc, &cursor, exception_object,
(_Unwind_Stop_Fn)exception_object->unwinder_cache.reserved1,
(void *)exception_object->unwinder_cache.reserved3);
else
unwind_phase2(&uc, &cursor, exception_object, true); unwind_phase2(&uc, &cursor, exception_object, true);
// Clients assume _Unwind_Resume() does not return, so all we can do is abort. // Clients assume _Unwind_Resume() does not return, so all we can do is abort.
_LIBUNWIND_ABORT("_Unwind_Resume() can't return"); _LIBUNWIND_ABORT("_Unwind_Resume() can't return");
} }
_LIBUNWIND_EXPORT _Unwind_Reason_Code
_Unwind_ForcedUnwind(_Unwind_Exception *exception_object, _Unwind_Stop_Fn stop,
void *stop_parameter) {
_LIBUNWIND_TRACE_API("_Unwind_ForcedUnwind(ex_obj=%p, stop=%p)",
(void *)exception_object, (void *)(uintptr_t)stop);
unw_context_t uc;
unw_cursor_t cursor;
__unw_getcontext(&uc);
// Mark that this is a forced unwind, so _Unwind_Resume() can do
// the right thing.
exception_object->unwinder_cache.reserved1 = (uintptr_t)stop;
exception_object->unwinder_cache.reserved3 = (uintptr_t)stop_parameter;
return unwind_phase2_forced(&uc, &cursor, exception_object, stop,
stop_parameter);
}
/// Called by personality handler during phase 2 to get LSDA for current frame. /// Called by personality handler during phase 2 to get LSDA for current frame.
_LIBUNWIND_EXPORT uintptr_t _LIBUNWIND_EXPORT uintptr_t
_Unwind_GetLanguageSpecificData(struct _Unwind_Context *context) { _Unwind_GetLanguageSpecificData(struct _Unwind_Context *context) {
@ -1002,9 +1153,14 @@ extern "C" _LIBUNWIND_EXPORT _Unwind_Reason_Code
__gnu_unwind_frame(_Unwind_Exception *exception_object, __gnu_unwind_frame(_Unwind_Exception *exception_object,
struct _Unwind_Context *context) { struct _Unwind_Context *context) {
unw_cursor_t *cursor = (unw_cursor_t *)context; unw_cursor_t *cursor = (unw_cursor_t *)context;
if (__unw_step(cursor) != UNW_STEP_SUCCESS) switch (__unw_step(cursor)) {
return _URC_FAILURE; case UNW_STEP_SUCCESS:
return _URC_OK; return _URC_OK;
case UNW_STEP_END:
return _URC_END_OF_STACK;
default:
return _URC_FAILURE;
}
} }
#endif // defined(_LIBUNWIND_ARM_EHABI) #endif // defined(_LIBUNWIND_ARM_EHABI)

View File

@ -1,41 +0,0 @@
[package]
name = "runtime"
description = "ARTIQ runtime on Zynq"
version = "0.1.0"
authors = ["M-Labs"]
edition = "2018"
[features]
target_zc706 = ["libboard_zynq/target_zc706", "libsupport_zynq/target_zc706", "libconfig/target_zc706"]
target_coraz7 = ["libboard_zynq/target_coraz7", "libsupport_zynq/target_coraz7", "libconfig/target_coraz7"]
target_redpitaya = ["libboard_zynq/target_redpitaya", "libsupport_zynq/target_redpitaya", "libconfig/target_redpitaya"]
target_kasli_soc = ["libboard_zynq/target_kasli_soc", "libsupport_zynq/target_kasli_soc", "libconfig/target_kasli_soc"]
default = ["target_zc706"]
[dependencies]
num-traits = { version = "0.2", default-features = false }
num-derive = "0.3"
cslice = "0.3"
log = "0.4"
nb = "0.1"
embedded-hal = "0.2"
core_io = { version = "0.1", features = ["collections"] }
byteorder = { version = "1.3", default-features = false }
void = { version = "1", default-features = false }
futures = { version = "0.3", default-features = false, features = ["async-await"] }
async-recursion = "0.3"
log_buffer = { version = "1.2" }
libm = { version = "0.2", features = ["unstable"] }
vcell = "0.1"
libboard_zynq = { git = "https://git.m-labs.hk/M-Labs/zynq-rs.git", features = ["ipv6"]}
libsupport_zynq = { default-features = false, features = ["alloc_core"], git = "https://git.m-labs.hk/M-Labs/zynq-rs.git" }
libcortex_a9 = { git = "https://git.m-labs.hk/M-Labs/zynq-rs.git" }
libasync = { git = "https://git.m-labs.hk/M-Labs/zynq-rs.git" }
libregister = { git = "https://git.m-labs.hk/M-Labs/zynq-rs.git" }
libconfig = { git = "https://git.m-labs.hk/M-Labs/zynq-rs.git", features = ["ipv6"] }
dyld = { path = "../libdyld" }
dwarf = { path = "../libdwarf" }
unwind = { path = "../libunwind" }
libc = { path = "../libc" }

View File

@ -0,0 +1,49 @@
[package]
name = "runtime"
description = "ARTIQ runtime on Zynq"
version = "0.1.0"
authors = ["M-Labs"]
edition = "2018"
[features]
target_zc706 = ["libboard_zynq/target_zc706", "libsupport_zynq/target_zc706", "libconfig/target_zc706", "libboard_artiq/target_zc706"]
target_kasli_soc = ["libboard_zynq/target_kasli_soc", "libsupport_zynq/target_kasli_soc", "libconfig/target_kasli_soc", "libboard_artiq/target_kasli_soc"]
target_ebaz4205 = ["libboard_zynq/target_ebaz4205", "libsupport_zynq/target_ebaz4205", "libconfig/target_ebaz4205", "libboard_artiq/target_ebaz4205"]
default = ["target_zc706"]
[build-dependencies]
build_zynq = { path = "../libbuild_zynq" }
[dependencies]
num-traits = { version = "0.2", default-features = false }
num-derive = "0.3"
cslice = "0.3"
log = "0.4"
embedded-hal = "0.2"
core_io = { version = "0.1", features = ["collections"] }
crc = { version = "1.7", default-features = false }
byteorder = { version = "1.3", default-features = false }
void = { version = "1", default-features = false }
futures = { version = "0.3", default-features = false, features = ["async-await"] }
async-recursion = "0.3"
log_buffer = { version = "1.2" }
vcell = "0.1"
libboard_zynq = { path = "@@ZYNQ_RS@@/libboard_zynq", features = ["ipv6"]}
libsupport_zynq = { path = "@@ZYNQ_RS@@/libsupport_zynq", default-features = false, features = ["alloc_core"] }
libcortex_a9 = { path = "@@ZYNQ_RS@@/libcortex_a9" }
libasync = { path = "@@ZYNQ_RS@@/libasync" }
libregister = { path = "@@ZYNQ_RS@@/libregister" }
libconfig = { path = "@@ZYNQ_RS@@/libconfig", features = ["fat_lfn", "ipv6"] }
dyld = { path = "../libdyld" }
dwarf = { path = "../libdwarf" }
unwind = { path = "../libunwind" }
libc = { path = "../libc" }
io = { path = "../libio", features = ["alloc"] }
ksupport = { path = "../libksupport" }
libboard_artiq = { path = "../libboard_artiq" }
[dependencies.tar-no-std]
git = "https://git.m-labs.hk/M-Labs/tar-no-std"
rev = "2ab6dc5"

View File

@ -1,28 +1,6 @@
use std::env; extern crate build_zynq;
use std::fs::File;
use std::io::Write;
use std::io::{BufRead, BufReader};
use std::path::PathBuf;
fn main() { fn main() {
// Put the linker script somewhere the linker can find it build_zynq::add_linker_script();
let out = &PathBuf::from(env::var_os("OUT_DIR").unwrap()); build_zynq::cfg();
File::create(out.join("link.x"))
.unwrap()
.write_all(include_bytes!("link.x"))
.unwrap();
println!("cargo:rustc-link-search={}", out.display());
// Only re-run the build script when link.x is changed,
// instead of when any part of the source code changes.
println!("cargo:rerun-if-changed=link.x");
// Handle rustc-cfg file
let cfg_path = "../../build/rustc-cfg";
println!("cargo:rerun-if-changed={}", cfg_path);
let f = BufReader::new(File::open(cfg_path).unwrap());
for line in f.lines() {
println!("cargo:rustc-cfg={}", line.unwrap());
}
} }

View File

@ -1,10 +1,15 @@
use alloc::rc::Rc;
#[cfg(has_drtio)]
use alloc::vec::Vec;
use core::cell::RefCell;
use libasync::{smoltcp::TcpStream, task}; use libasync::{smoltcp::TcpStream, task};
use libboard_zynq::smoltcp::Error; use libboard_artiq::drtio_routing;
use libcortex_a9::cache; use libboard_zynq::{smoltcp::Error, timer::GlobalTimer};
use libcortex_a9::{cache, mutex::Mutex};
use log::{debug, info, warn}; use log::{debug, info, warn};
use crate::proto_async::*; use crate::{pl, proto_async::*};
use crate::pl;
const BUFFER_SIZE: usize = 512 * 1024; const BUFFER_SIZE: usize = 512 * 1024;
@ -13,9 +18,7 @@ struct Buffer {
data: [u8; BUFFER_SIZE], data: [u8; BUFFER_SIZE],
} }
static mut BUFFER: Buffer = Buffer { static mut BUFFER: Buffer = Buffer { data: [0; BUFFER_SIZE] };
data: [0; BUFFER_SIZE]
};
fn arm() { fn arm() {
debug!("arming RTIO analyzer"); debug!("arming RTIO analyzer");
@ -40,13 +43,57 @@ fn disarm() {
debug!("RTIO analyzer disarmed"); debug!("RTIO analyzer disarmed");
} }
#[cfg(has_drtio)]
pub mod remote_analyzer {
use super::*;
use crate::rtio_mgt::drtio;
pub struct RemoteBuffer {
pub total_byte_count: u64,
pub sent_bytes: u32,
pub error: bool,
pub data: Vec<u8>,
}
pub async fn get_data(
aux_mutex: &Rc<Mutex<bool>>,
routing_table: &drtio_routing::RoutingTable,
up_destinations: &Rc<RefCell<[bool; drtio_routing::DEST_COUNT]>>,
timer: GlobalTimer,
) -> Result<RemoteBuffer, drtio::Error> {
// gets data from satellites and returns consolidated data
let mut remote_data: Vec<u8> = Vec::new();
let mut remote_error = false;
let mut remote_sent_bytes = 0;
let mut remote_total_bytes = 0;
let data_vec = match drtio::analyzer_query(aux_mutex, routing_table, up_destinations, timer).await {
Ok(data_vec) => data_vec,
Err(e) => return Err(e),
};
for data in data_vec {
remote_total_bytes += data.total_byte_count;
remote_sent_bytes += data.sent_bytes;
remote_error |= data.error;
remote_data.extend(data.data);
}
Ok(RemoteBuffer {
total_byte_count: remote_total_bytes,
sent_bytes: remote_sent_bytes,
error: remote_error,
data: remote_data,
})
}
}
#[derive(Debug)] #[derive(Debug)]
struct Header { struct Header {
sent_bytes: u32, sent_bytes: u32,
total_byte_count: u64, total_byte_count: u64,
error_occurred: bool, error_occurred: bool,
log_channel: u8, log_channel: u8,
dds_onehot_sel: bool dds_onehot_sel: bool,
} }
async fn write_header(stream: &mut TcpStream, header: &Header) -> Result<(), Error> { async fn write_header(stream: &mut TcpStream, header: &Header) -> Result<(), Error> {
@ -59,7 +106,13 @@ async fn write_header(stream: &mut TcpStream, header: &Header) -> Result<(), Err
Ok(()) Ok(())
} }
async fn handle_connection(stream: &mut TcpStream) -> Result<(), Error> { async fn handle_connection(
stream: &mut TcpStream,
_aux_mutex: &Rc<Mutex<bool>>,
_routing_table: &drtio_routing::RoutingTable,
_up_destinations: &Rc<RefCell<[bool; drtio_routing::DEST_COUNT]>>,
_timer: GlobalTimer,
) -> Result<(), Error> {
info!("received connection"); info!("received connection");
let data = unsafe { &BUFFER.data[..] }; let data = unsafe { &BUFFER.data[..] };
@ -68,6 +121,11 @@ async fn handle_connection(stream: &mut TcpStream) -> Result<(), Error> {
let total_byte_count = unsafe { pl::csr::rtio_analyzer::dma_byte_count_read() as u64 }; let total_byte_count = unsafe { pl::csr::rtio_analyzer::dma_byte_count_read() as u64 };
let pointer = (total_byte_count % BUFFER_SIZE as u64) as usize; let pointer = (total_byte_count % BUFFER_SIZE as u64) as usize;
let wraparound = total_byte_count >= BUFFER_SIZE as u64; let wraparound = total_byte_count >= BUFFER_SIZE as u64;
let sent_bytes = if wraparound {
BUFFER_SIZE as u32
} else {
total_byte_count as u32
};
if overflow_occurred { if overflow_occurred {
warn!("overflow occured"); warn!("overflow occured");
@ -76,12 +134,42 @@ async fn handle_connection(stream: &mut TcpStream) -> Result<(), Error> {
warn!("bus error occured"); warn!("bus error occured");
} }
#[cfg(has_drtio)]
let remote = remote_analyzer::get_data(_aux_mutex, _routing_table, _up_destinations, _timer).await;
#[cfg(has_drtio)]
let (header, remote_data) = match remote {
Ok(remote) => (
Header {
total_byte_count: total_byte_count + remote.total_byte_count,
sent_bytes: sent_bytes + remote.sent_bytes,
error_occurred: overflow_occurred | bus_error_occurred | remote.error,
log_channel: pl::csr::CONFIG_RTIO_LOG_CHANNEL as u8,
dds_onehot_sel: true,
},
remote.data,
),
Err(e) => {
warn!("Error getting remote analyzer data: {}", e);
(
Header {
total_byte_count: total_byte_count,
sent_bytes: sent_bytes,
error_occurred: true,
log_channel: pl::csr::CONFIG_RTIO_LOG_CHANNEL as u8,
dds_onehot_sel: true,
},
Vec::new(),
)
}
};
#[cfg(not(has_drtio))]
let header = Header { let header = Header {
total_byte_count: total_byte_count, total_byte_count: total_byte_count,
sent_bytes: if wraparound { BUFFER_SIZE as u32 } else { total_byte_count as u32 }, sent_bytes: sent_bytes,
error_occurred: overflow_occurred | bus_error_occurred, error_occurred: overflow_occurred | bus_error_occurred,
log_channel: pl::csr::CONFIG_RTIO_LOG_CHANNEL as u8, log_channel: pl::csr::CONFIG_RTIO_LOG_CHANNEL as u8,
dds_onehot_sel: true // kept for backward compatibility of analyzer dumps dds_onehot_sel: true, // kept for backward compatibility of analyzer dumps
}; };
debug!("{:?}", header); debug!("{:?}", header);
@ -92,17 +180,28 @@ async fn handle_connection(stream: &mut TcpStream) -> Result<(), Error> {
} else { } else {
stream.send(data[..pointer].iter().copied()).await?; stream.send(data[..pointer].iter().copied()).await?;
} }
#[cfg(has_drtio)]
stream.send(remote_data.iter().copied()).await?;
Ok(()) Ok(())
} }
pub fn start() { pub fn start(
aux_mutex: &Rc<Mutex<bool>>,
routing_table: &Rc<RefCell<drtio_routing::RoutingTable>>,
up_destinations: &Rc<RefCell<[bool; drtio_routing::DEST_COUNT]>>,
timer: GlobalTimer,
) {
let aux_mutex = aux_mutex.clone();
let routing_table = routing_table.clone();
let up_destinations = up_destinations.clone();
task::spawn(async move { task::spawn(async move {
loop { loop {
arm(); arm();
let mut stream = TcpStream::accept(1382, 2048, 2048).await.unwrap(); let mut stream = TcpStream::accept(1382, 2048, 2048).await.unwrap();
disarm(); disarm();
let _ = handle_connection(&mut stream) let routing_table = routing_table.borrow();
let _ = handle_connection(&mut stream, &aux_mutex, &routing_table, &up_destinations, timer)
.await .await
.map_err(|e| warn!("connection terminated: {:?}", e)); .map_err(|e| warn!("connection terminated: {:?}", e));
let _ = stream.flush().await; let _ = stream.flush().await;

View File

@ -1,42 +1,57 @@
use core::fmt; use alloc::{collections::BTreeMap, rc::Rc, string::String, vec, vec::Vec};
use core::cell::RefCell; use core::{cell::RefCell, fmt, slice, str};
use core::str::Utf8Error;
use alloc::{vec, vec::Vec, string::String, collections::BTreeMap, rc::Rc};
use log::{info, warn, error};
use core_io::Error as IoError;
use cslice::CSlice;
use dyld::elf;
use futures::{future::FutureExt, select_biased};
#[cfg(has_drtio)]
use io::Cursor;
#[cfg(has_drtio)]
use ksupport::rpc;
use ksupport::{kernel, resolve_channel_name};
#[cfg(has_drtio)]
use libasync::delay;
use libasync::{smoltcp::{Sockets, TcpStream},
task};
use libboard_artiq::drtio_routing;
#[cfg(feature = "target_kasli_soc")]
use libboard_zynq::error_led::ErrorLED;
#[cfg(has_drtio)]
use libboard_zynq::time::Milliseconds;
use libboard_zynq::{self as zynq,
smoltcp::{self,
iface::{EthernetInterfaceBuilder, NeighborCache},
time::Instant,
wire::IpCidr},
timer::GlobalTimer};
use libconfig::{net_settings, Config};
use libcortex_a9::{mutex::Mutex,
semaphore::Semaphore,
sync_channel::{Receiver, Sender}};
use log::{error, info, warn};
use num_derive::{FromPrimitive, ToPrimitive}; use num_derive::{FromPrimitive, ToPrimitive};
use num_traits::{FromPrimitive, ToPrimitive}; use num_traits::{FromPrimitive, ToPrimitive};
#[cfg(has_drtio)]
use tar_no_std::TarArchiveRef;
use libboard_zynq::{ #[cfg(has_drtio)]
self as zynq, use crate::pl;
smoltcp::{ use crate::{analyzer, mgmt, moninj, proto_async::*, rpc_async, rtio_dma, rtio_mgt};
self, #[cfg(has_drtio)]
wire::IpCidr, use crate::{subkernel, subkernel::Error as SubkernelError};
iface::{NeighborCache, EthernetInterfaceBuilder},
time::Instant,
},
timer::GlobalTimer,
};
use libcortex_a9::{semaphore::Semaphore, mutex::Mutex, sync_channel::{Sender, Receiver}};
use futures::{select_biased, future::FutureExt};
use libasync::{smoltcp::{Sockets, TcpStream}, task};
use libconfig::{Config, net_settings};
use crate::proto_async::*;
use crate::kernel;
use crate::rpc;
use crate::moninj;
use crate::mgmt;
use crate::analyzer;
#[derive(Debug, Clone, Copy, PartialEq, Eq)] #[derive(Debug, Clone, Copy, PartialEq, Eq)]
pub enum Error { pub enum Error {
NetworkError(smoltcp::Error), NetworkError(smoltcp::Error),
IoError,
UnexpectedPattern, UnexpectedPattern,
UnrecognizedPacket, UnrecognizedPacket,
BufferExhausted, BufferExhausted,
Utf8Error(Utf8Error), #[cfg(has_drtio)]
SubkernelError(subkernel::Error),
#[cfg(has_drtio)]
DestinationDown,
} }
pub type Result<T> = core::result::Result<T, Error>; pub type Result<T> = core::result::Result<T, Error>;
@ -45,10 +60,14 @@ impl fmt::Display for Error {
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result { fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
match self { match self {
Error::NetworkError(error) => write!(f, "network error: {}", error), Error::NetworkError(error) => write!(f, "network error: {}", error),
Error::IoError => write!(f, "io error"),
Error::UnexpectedPattern => write!(f, "unexpected pattern"), Error::UnexpectedPattern => write!(f, "unexpected pattern"),
Error::UnrecognizedPacket => write!(f, "unrecognized packet"), Error::UnrecognizedPacket => write!(f, "unrecognized packet"),
Error::BufferExhausted => write!(f, "buffer exhausted"), Error::BufferExhausted => write!(f, "buffer exhausted"),
Error::Utf8Error(error) => write!(f, "UTF-8 error: {}", error), #[cfg(has_drtio)]
Error::SubkernelError(error) => write!(f, "subkernel error: {:?}", error),
#[cfg(has_drtio)]
Error::DestinationDown => write!(f, "subkernel destination down"),
} }
} }
} }
@ -59,6 +78,19 @@ impl From<smoltcp::Error> for Error {
} }
} }
impl From<IoError> for Error {
fn from(_error: IoError) -> Self {
Error::IoError
}
}
#[cfg(has_drtio)]
impl From<subkernel::Error> for Error {
fn from(error: subkernel::Error) -> Self {
Error::SubkernelError(error)
}
}
#[derive(Debug, FromPrimitive, ToPrimitive)] #[derive(Debug, FromPrimitive, ToPrimitive)]
enum Request { enum Request {
SystemInfo = 3, SystemInfo = 3,
@ -66,6 +98,7 @@ enum Request {
RunKernel = 6, RunKernel = 6,
RPCReply = 7, RPCReply = 7,
RPCException = 8, RPCException = 8,
UploadSubkernel = 9,
} }
#[derive(Debug, FromPrimitive, ToPrimitive)] #[derive(Debug, FromPrimitive, ToPrimitive)]
@ -82,31 +115,32 @@ enum Reply {
} }
static CACHE_STORE: Mutex<BTreeMap<String, Vec<i32>>> = Mutex::new(BTreeMap::new()); static CACHE_STORE: Mutex<BTreeMap<String, Vec<i32>>> = Mutex::new(BTreeMap::new());
static DMA_RECORD_STORE: Mutex<BTreeMap<String, (Vec<u8>, i64)>> = Mutex::new(BTreeMap::new());
async fn write_header(stream: &TcpStream, reply: Reply) -> Result<()> { async fn write_header(stream: &TcpStream, reply: Reply) -> Result<()> {
stream.send_slice(&[0x5a, 0x5a, 0x5a, 0x5a, reply.to_u8().unwrap()]).await?; stream
.send_slice(&[0x5a, 0x5a, 0x5a, 0x5a, reply.to_u8().unwrap()])
.await?;
Ok(()) Ok(())
} }
async fn read_request(stream: &TcpStream, allow_close: bool) -> Result<Option<Request>> { async fn read_request(stream: &TcpStream, allow_close: bool) -> Result<Option<Request>> {
match expect(stream, &[0x5a, 0x5a, 0x5a, 0x5a]).await { match expect(stream, &[0x5a, 0x5a, 0x5a, 0x5a]).await {
Ok(true) => {} Ok(true) => {}
Ok(false) => Ok(false) => return Err(Error::UnexpectedPattern),
return Err(Error::UnexpectedPattern), Err(smoltcp::Error::Finished) => {
Err(smoltcp::Error::Illegal) => {
if allow_close { if allow_close {
info!("peer closed connection"); info!("peer closed connection");
return Ok(None); return Ok(None);
} else { } else {
error!("peer unexpectedly closed connection"); error!("peer unexpectedly closed connection");
return Err(smoltcp::Error::Illegal)?; return Err(smoltcp::Error::Finished)?;
} }
},
Err(e) =>
return Err(e)?,
} }
Ok(Some(FromPrimitive::from_i8(read_i8(&stream).await?).ok_or(Error::UnrecognizedPacket)?)) Err(e) => return Err(e)?,
}
Ok(Some(
FromPrimitive::from_i8(read_i8(&stream).await?).ok_or(Error::UnrecognizedPacket)?,
))
} }
async fn read_bytes(stream: &TcpStream, max_length: usize) -> Result<Vec<u8>> { async fn read_bytes(stream: &TcpStream, max_length: usize) -> Result<Vec<u8>> {
@ -119,20 +153,13 @@ async fn read_bytes(stream: &TcpStream, max_length: usize) -> Result<Vec<u8>> {
Ok(buffer) Ok(buffer)
} }
async fn read_string(stream: &TcpStream, max_length: usize) -> Result<String> {
let bytes = read_bytes(stream, max_length).await?;
Ok(String::from_utf8(bytes).map_err(|err| Error::Utf8Error(err.utf8_error()))?)
}
const RETRY_LIMIT: usize = 100; const RETRY_LIMIT: usize = 100;
async fn fast_send(sender: &mut Sender<'_, kernel::Message>, content: kernel::Message) { async fn fast_send(sender: &mut Sender<'_, kernel::Message>, content: kernel::Message) {
let mut content = content; let mut content = content;
for _ in 0..RETRY_LIMIT { for _ in 0..RETRY_LIMIT {
match sender.try_send(content) { match sender.try_send(content) {
Ok(()) => { Ok(()) => return,
return
},
Err(v) => { Err(v) => {
content = v; content = v;
} }
@ -144,16 +171,31 @@ async fn fast_send(sender: &mut Sender<'_, kernel::Message>, content: kernel::Me
async fn fast_recv(receiver: &mut Receiver<'_, kernel::Message>) -> kernel::Message { async fn fast_recv(receiver: &mut Receiver<'_, kernel::Message>) -> kernel::Message {
for _ in 0..RETRY_LIMIT { for _ in 0..RETRY_LIMIT {
match receiver.try_recv() { match receiver.try_recv() {
Ok(v) => { Ok(v) => return v,
return v; Err(()) => (),
},
Err(()) => ()
} }
} }
receiver.async_recv().await receiver.async_recv().await
} }
async fn handle_run_kernel(stream: Option<&TcpStream>, control: &Rc<RefCell<kernel::Control>>) -> Result<()> { async fn write_exception_string(stream: &TcpStream, s: CSlice<'static, u8>) -> Result<()> {
if s.len() == usize::MAX {
write_i32(stream, -1).await?;
write_i32(stream, s.as_ptr() as i32).await?
} else {
write_chunk(stream, s.as_ref()).await?;
};
Ok(())
}
async fn handle_run_kernel(
stream: Option<&TcpStream>,
control: &Rc<RefCell<kernel::Control>>,
_up_destinations: &Rc<RefCell<[bool; drtio_routing::DEST_COUNT]>>,
aux_mutex: &Rc<Mutex<bool>>,
routing_table: &drtio_routing::RoutingTable,
timer: GlobalTimer,
) -> Result<()> {
control.borrow_mut().tx.async_send(kernel::Message::StartRequest).await; control.borrow_mut().tx.async_send(kernel::Message::StartRequest).await;
loop { loop {
let reply = control.borrow_mut().rx.async_recv().await; let reply = control.borrow_mut().rx.async_recv().await;
@ -161,7 +203,7 @@ async fn handle_run_kernel(stream: Option<&TcpStream>, control: &Rc<RefCell<kern
kernel::Message::RpcSend { is_async, data } => { kernel::Message::RpcSend { is_async, data } => {
if stream.is_none() { if stream.is_none() {
error!("Unexpected RPC from startup/idle kernel!"); error!("Unexpected RPC from startup/idle kernel!");
break break;
} }
let stream = stream.unwrap(); let stream = stream.unwrap();
write_header(stream, Reply::RPCRequest).await?; write_header(stream, Reply::RPCRequest).await?;
@ -176,7 +218,7 @@ async fn handle_run_kernel(stream: Option<&TcpStream>, control: &Rc<RefCell<kern
kernel::Message::RpcRecvRequest(slot) => slot, kernel::Message::RpcRecvRequest(slot) => slot,
other => panic!("expected root value slot from core1, not {:?}", other), other => panic!("expected root value slot from core1, not {:?}", other),
}; };
rpc::recv_return(stream, &tag, slot, &|size| { rpc_async::recv_return(stream, &tag, slot, &|size| {
let control = control.clone(); let control = control.clone();
async move { async move {
if size == 0 { if size == 0 {
@ -188,90 +230,301 @@ async fn handle_run_kernel(stream: Option<&TcpStream>, control: &Rc<RefCell<kern
fast_send(&mut control.tx, kernel::Message::RpcRecvReply(Ok(size))).await; fast_send(&mut control.tx, kernel::Message::RpcRecvReply(Ok(size))).await;
match fast_recv(&mut control.rx).await { match fast_recv(&mut control.rx).await {
kernel::Message::RpcRecvRequest(slot) => slot, kernel::Message::RpcRecvRequest(slot) => slot,
other => panic!("expected nested value slot from kernel CPU, not {:?}", other), other => {
panic!("expected nested value slot from kernel CPU, not {:?}", other)
} }
} }
} }
}).await?; }
control.borrow_mut().tx.async_send(kernel::Message::RpcRecvReply(Ok(0))).await; })
}, .await?;
control
.borrow_mut()
.tx
.async_send(kernel::Message::RpcRecvReply(Ok(0)))
.await;
}
Request::RPCException => { Request::RPCException => {
let mut control = control.borrow_mut(); let mut control = control.borrow_mut();
match control.rx.async_recv().await { match control.rx.async_recv().await {
kernel::Message::RpcRecvRequest(_) => (), kernel::Message::RpcRecvRequest(_) => (),
other => panic!("expected (ignored) root value slot from kernel CPU, not {:?}", other), other => panic!("expected (ignored) root value slot from kernel CPU, not {:?}", other),
} }
let name = read_string(stream, 16384).await?; let id = read_i32(stream).await? as u32;
let message = read_string(stream, 16384).await?; let message = read_i32(stream).await? as u32;
let param = [read_i64(stream).await?, let param = [
read_i64(stream).await?, read_i64(stream).await?,
read_i64(stream).await?]; read_i64(stream).await?,
let file = read_string(stream, 16384).await?; read_i64(stream).await?,
];
let file = read_i32(stream).await? as u32;
let line = read_i32(stream).await?; let line = read_i32(stream).await?;
let column = read_i32(stream).await?; let column = read_i32(stream).await?;
let function = read_string(stream, 16384).await?; let function = read_i32(stream).await? as u32;
control.tx.async_send(kernel::Message::RpcRecvReply(Err(kernel::RPCException { control
name, message, param, file, line, column, function .tx
}))).await; .async_send(kernel::Message::RpcRecvReply(Err(ksupport::RPCException {
}, id,
message,
param,
file,
line,
column,
function,
})))
.await;
}
_ => { _ => {
error!("unexpected RPC request from host: {:?}", host_request); error!("unexpected RPC request from host: {:?}", host_request);
return Err(Error::UnrecognizedPacket) return Err(Error::UnrecognizedPacket);
} }
} }
} }
}, }
kernel::Message::KernelFinished => { kernel::Message::KernelFinished(async_errors) => {
if let Some(stream) = stream { if let Some(stream) = stream {
write_header(stream, Reply::KernelFinished).await?; write_header(stream, Reply::KernelFinished).await?;
write_i8(stream, async_errors as i8).await?;
} }
break; break;
}, }
kernel::Message::KernelException(exception, backtrace) => { kernel::Message::KernelException(exceptions, stack_pointers, backtrace, async_errors) => {
match stream { match stream {
Some(stream) => { Some(stream) => {
// only send the exception data to host if there is host, // only send the exception data to host if there is host,
// i.e. not idle/startup kernel. // i.e. not idle/startup kernel.
write_header(stream, Reply::KernelException).await?; write_header(stream, Reply::KernelException).await?;
write_chunk(stream, exception.name.as_ref()).await?; write_i32(stream, exceptions.len() as i32).await?;
write_chunk(stream, exception.message.as_ref()).await?; for exception in exceptions.iter() {
let exception = exception.as_ref().unwrap();
write_i32(stream, exception.id as i32).await?;
if exception.message.len() == usize::MAX {
// exception with host string
write_exception_string(stream, exception.message).await?;
} else {
let msg = str::from_utf8(unsafe {
slice::from_raw_parts(exception.message.as_ptr(), exception.message.len())
})
.unwrap()
.replace(
"{rtio_channel_info:0}",
&format!(
"0x{:04x}:{}",
exception.param[0],
resolve_channel_name(exception.param[0] as u32)
),
);
write_exception_string(stream, unsafe { CSlice::new(msg.as_ptr(), msg.len()) }).await?;
}
write_i64(stream, exception.param[0] as i64).await?; write_i64(stream, exception.param[0] as i64).await?;
write_i64(stream, exception.param[1] as i64).await?; write_i64(stream, exception.param[1] as i64).await?;
write_i64(stream, exception.param[2] as i64).await?; write_i64(stream, exception.param[2] as i64).await?;
write_chunk(stream, exception.file.as_ref()).await?; write_exception_string(stream, exception.file).await?;
write_i32(stream, exception.line as i32).await?; write_i32(stream, exception.line as i32).await?;
write_i32(stream, exception.column as i32).await?; write_i32(stream, exception.column as i32).await?;
write_chunk(stream, exception.function.as_ref()).await?; write_exception_string(stream, exception.function).await?;
write_i32(stream, backtrace.len() as i32).await?; }
for &addr in backtrace { for sp in stack_pointers.iter() {
write_i32(stream, addr as i32).await?; write_i32(stream, sp.stack_pointer as i32).await?;
write_i32(stream, sp.initial_backtrace_size as i32).await?;
write_i32(stream, sp.current_backtrace_size as i32).await?;
}
write_i32(stream, backtrace.len() as i32).await?;
for &(addr, sp) in backtrace {
write_i32(stream, addr as i32).await?;
write_i32(stream, sp as i32).await?;
}
write_i8(stream, async_errors as i8).await?;
} }
},
None => { None => {
error!("Uncaught kernel exception: {:?}", exception); error!("Uncaught kernel exceptions: {:?}", exceptions);
} }
} }
break; break;
} }
kernel::Message::CachePutRequest(key, value) => { kernel::Message::CachePutRequest(key, value) => {
CACHE_STORE.lock().insert(key, value); CACHE_STORE.lock().insert(key, value);
}, }
kernel::Message::CacheGetRequest(key) => { kernel::Message::CacheGetRequest(key) => {
const DEFAULT: Vec<i32> = Vec::new(); const DEFAULT: Vec<i32> = Vec::new();
let value = CACHE_STORE.lock().get(&key).unwrap_or(&DEFAULT).clone(); let value = CACHE_STORE.lock().get(&key).unwrap_or(&DEFAULT).clone();
control.borrow_mut().tx.async_send(kernel::Message::CacheGetReply(value)).await; control
}, .borrow_mut()
.tx
.async_send(kernel::Message::CacheGetReply(value))
.await;
}
kernel::Message::DmaPutRequest(recorder) => { kernel::Message::DmaPutRequest(recorder) => {
DMA_RECORD_STORE.lock().insert(recorder.name, (recorder.buffer, recorder.duration)); let _id = rtio_dma::put_record(aux_mutex, routing_table, timer, recorder).await;
}, #[cfg(has_drtio)]
rtio_dma::remote_dma::upload_traces(aux_mutex, routing_table, timer, _id).await;
}
kernel::Message::DmaEraseRequest(name) => { kernel::Message::DmaEraseRequest(name) => {
// prevent possible OOM when we have large DMA record replacement. // prevent possible OOM when we have large DMA record replacement.
DMA_RECORD_STORE.lock().remove(&name); rtio_dma::erase(name, aux_mutex, routing_table, timer).await;
}, }
kernel::Message::DmaGetRequest(name) => { kernel::Message::DmaGetRequest(name) => {
let result = DMA_RECORD_STORE.lock().get(&name).map(|v| v.clone()); let result = rtio_dma::retrieve(name).await;
control.borrow_mut().tx.async_send(kernel::Message::DmaGetReply(result)).await; control
.borrow_mut()
.tx
.async_send(kernel::Message::DmaGetReply(result))
.await;
}
#[cfg(has_drtio)]
kernel::Message::DmaStartRemoteRequest { id, timestamp } => {
rtio_dma::remote_dma::playback(aux_mutex, routing_table, timer, id as u32, timestamp as u64).await;
}
#[cfg(has_drtio)]
kernel::Message::DmaAwaitRemoteRequest(id) => {
let result = rtio_dma::remote_dma::await_done(id as u32, Some(10_000), timer).await;
let reply = match result {
Ok(rtio_dma::remote_dma::RemoteState::PlaybackEnded {
error,
channel,
timestamp,
}) => kernel::Message::DmaAwaitRemoteReply {
timeout: false,
error: error,
channel: channel,
timestamp: timestamp,
}, },
_ => kernel::Message::DmaAwaitRemoteReply {
timeout: true,
error: 0,
channel: 0,
timestamp: 0,
},
};
control.borrow_mut().tx.async_send(reply).await;
}
#[cfg(has_drtio)]
kernel::Message::SubkernelLoadRunRequest {
id,
destination: _,
run,
timestamp,
} => {
let succeeded = match subkernel::load(aux_mutex, routing_table, timer, id, run, timestamp).await {
Ok(()) => true,
Err(e) => {
error!("Error loading subkernel: {:?}", e);
false
}
};
control
.borrow_mut()
.tx
.async_send(kernel::Message::SubkernelLoadRunReply { succeeded: succeeded })
.await;
}
#[cfg(has_drtio)]
kernel::Message::SubkernelAwaitFinishRequest { id, timeout } => {
let res = subkernel::await_finish(aux_mutex, routing_table, timer, id, timeout).await;
let response = match res {
Ok(res) => {
if res.status == subkernel::FinishStatus::CommLost {
kernel::Message::SubkernelError(kernel::SubkernelStatus::CommLost)
} else if let Some(exception) = res.exception {
kernel::Message::SubkernelError(kernel::SubkernelStatus::Exception(exception))
} else {
kernel::Message::SubkernelAwaitFinishReply
}
}
Err(SubkernelError::Timeout) => kernel::Message::SubkernelError(kernel::SubkernelStatus::Timeout),
Err(SubkernelError::IncorrectState) => {
kernel::Message::SubkernelError(kernel::SubkernelStatus::IncorrectState)
}
Err(_) => kernel::Message::SubkernelError(kernel::SubkernelStatus::OtherError),
};
control.borrow_mut().tx.async_send(response).await;
}
#[cfg(has_drtio)]
kernel::Message::SubkernelMsgSend { id, destination, data } => {
let res =
subkernel::message_send(aux_mutex, routing_table, timer, id, destination.unwrap(), data).await;
match res {
Ok(_) => (),
Err(e) => {
error!("error sending subkernel message: {:?}", e)
}
};
control
.borrow_mut()
.tx
.async_send(kernel::Message::SubkernelMsgSent)
.await;
}
#[cfg(has_drtio)]
kernel::Message::SubkernelMsgRecvRequest { id, timeout, tags } => {
let message_received = subkernel::message_await(id as u32, timeout, timer).await;
let response = match message_received {
Ok(ref message) => kernel::Message::SubkernelMsgRecvReply { count: message.count },
Err(SubkernelError::Timeout) => kernel::Message::SubkernelError(kernel::SubkernelStatus::Timeout),
Err(SubkernelError::IncorrectState) => {
kernel::Message::SubkernelError(kernel::SubkernelStatus::IncorrectState)
}
Err(SubkernelError::CommLost) => kernel::Message::SubkernelError(kernel::SubkernelStatus::CommLost),
Err(SubkernelError::SubkernelException) => {
// just retrieve the exception
let status = subkernel::await_finish(aux_mutex, routing_table, timer, id as u32, timeout)
.await
.unwrap();
kernel::Message::SubkernelError(kernel::SubkernelStatus::Exception(status.exception.unwrap()))
}
Err(_) => kernel::Message::SubkernelError(kernel::SubkernelStatus::OtherError),
};
control.borrow_mut().tx.async_send(response).await;
if let Ok(message) = message_received {
// receive code almost identical to RPC recv, except we are not reading from a stream
let mut reader = Cursor::new(message.data);
let mut current_tags: &[u8] = &tags;
let mut i = 0;
loop {
// kernel has to consume all arguments in the whole message
let slot = match fast_recv(&mut control.borrow_mut().rx).await {
kernel::Message::RpcRecvRequest(slot) => slot,
other => panic!("expected root value slot from core1, not {:?}", other),
};
let remaining_tags = rpc::recv_return(&mut reader, &current_tags, slot, &mut |size| {
if size == 0 {
0 as *mut ()
} else {
let mut control = control.borrow_mut();
control.tx.send(kernel::Message::RpcRecvReply(Ok(size)));
match control.rx.recv() {
kernel::Message::RpcRecvRequest(slot) => slot,
other => {
panic!("expected nested value slot from kernel CPU, not {:?}", other)
}
}
}
})?;
control
.borrow_mut()
.tx
.async_send(kernel::Message::RpcRecvReply(Ok(0)))
.await;
i += 1;
if i < message.count {
current_tags = remaining_tags;
} else {
break;
}
}
}
}
#[cfg(has_drtio)]
kernel::Message::UpDestinationsRequest(destination) => {
let result = _up_destinations.borrow()[destination as usize];
control
.borrow_mut()
.tx
.async_send(kernel::Message::UpDestinationsReply(result))
.await;
}
_ => { _ => {
panic!("unexpected message from core1 while kernel was running: {:?}", reply); panic!("unexpected message from core1 while kernel was running: {:?}", reply);
} }
@ -280,11 +533,67 @@ async fn handle_run_kernel(stream: Option<&TcpStream>, control: &Rc<RefCell<kern
Ok(()) Ok(())
} }
async fn handle_flash_kernel(
buffer: &Vec<u8>,
control: &Rc<RefCell<kernel::Control>>,
_up_destinations: &Rc<RefCell<[bool; drtio_routing::DEST_COUNT]>>,
_aux_mutex: &Rc<Mutex<bool>>,
_routing_table: &drtio_routing::RoutingTable,
_timer: GlobalTimer,
) -> Result<()> {
if buffer[0] == elf::ELFMAG0 && buffer[1] == elf::ELFMAG1 && buffer[2] == elf::ELFMAG2 && buffer[3] == elf::ELFMAG3
{
// assume ELF file, proceed as before
load_kernel(buffer, control, None).await
} else {
#[cfg(has_drtio)]
{
let archive = TarArchiveRef::new(buffer.as_ref());
let entries = archive.entries();
let mut main_lib: Vec<u8> = Vec::new();
for entry in entries {
if entry.filename().as_str() == "main.elf" {
main_lib = entry.data().to_vec();
} else {
// subkernel filename must be in format:
// "<subkernel id> <destination>.elf"
let filename = entry.filename();
let mut iter = filename.as_str().split_whitespace();
let sid: u32 = iter.next().unwrap().parse().unwrap();
let dest: u8 = iter.next().unwrap().strip_suffix(".elf").unwrap().parse().unwrap();
let up = _up_destinations.borrow()[dest as usize];
if up {
let subkernel_lib = entry.data().to_vec();
subkernel::add_subkernel(sid, dest, subkernel_lib).await;
match subkernel::upload(_aux_mutex, _routing_table, _timer, sid).await {
Ok(_) => (),
Err(_) => return Err(Error::UnexpectedPattern),
}
} else {
return Err(Error::DestinationDown);
}
}
}
load_kernel(&main_lib, control, None).await
}
#[cfg(not(has_drtio))]
{
panic!("multi-kernel libraries are not supported in standalone systems");
}
}
}
async fn load_kernel(buffer: &Vec<u8>, control: &Rc<RefCell<kernel::Control>>, stream: Option<&TcpStream>) -> Result<()> { async fn load_kernel(
buffer: &Vec<u8>,
control: &Rc<RefCell<kernel::Control>>,
stream: Option<&TcpStream>,
) -> Result<()> {
let mut control = control.borrow_mut(); let mut control = control.borrow_mut();
control.restart(); control.restart();
control.tx.async_send(kernel::Message::LoadRequest(buffer.to_vec())).await; control
.tx
.async_send(kernel::Message::LoadRequest(buffer.to_vec()))
.await;
let reply = control.rx.async_recv().await; let reply = control.rx.async_recv().await;
match reply { match reply {
kernel::Message::LoadCompleted => { kernel::Message::LoadCompleted => {
@ -292,7 +601,7 @@ async fn load_kernel(buffer: &Vec<u8>, control: &Rc<RefCell<kernel::Control>>, s
write_header(stream, Reply::LoadCompleted).await?; write_header(stream, Reply::LoadCompleted).await?;
} }
Ok(()) Ok(())
}, }
kernel::Message::LoadFailed => { kernel::Message::LoadFailed => {
if let Some(stream) = stream { if let Some(stream) = stream {
write_header(stream, Reply::LoadFailed).await?; write_header(stream, Reply::LoadFailed).await?;
@ -301,7 +610,7 @@ async fn load_kernel(buffer: &Vec<u8>, control: &Rc<RefCell<kernel::Control>>, s
error!("Kernel load failed"); error!("Kernel load failed");
} }
Err(Error::UnexpectedPattern) Err(Error::UnexpectedPattern)
}, }
_ => { _ => {
error!("unexpected message from core1: {:?}", reply); error!("unexpected message from core1: {:?}", reply);
if let Some(stream) = stream { if let Some(stream) = stream {
@ -313,14 +622,27 @@ async fn load_kernel(buffer: &Vec<u8>, control: &Rc<RefCell<kernel::Control>>, s
} }
} }
async fn handle_connection(stream: &TcpStream, control: Rc<RefCell<kernel::Control>>) -> Result<()> { async fn handle_connection(
stream: &mut TcpStream,
control: Rc<RefCell<kernel::Control>>,
up_destinations: &Rc<RefCell<[bool; drtio_routing::DEST_COUNT]>>,
aux_mutex: &Rc<Mutex<bool>>,
routing_table: &drtio_routing::RoutingTable,
timer: GlobalTimer,
) -> Result<()> {
stream.set_ack_delay(None);
if !expect(stream, b"ARTIQ coredev\n").await? { if !expect(stream, b"ARTIQ coredev\n").await? {
return Err(Error::UnexpectedPattern); return Err(Error::UnexpectedPattern);
} }
stream.send_slice("e".as_bytes()).await?; stream.send_slice("e".as_bytes()).await?;
#[cfg(has_drtio)]
subkernel::clear_subkernels().await;
loop { loop {
let request = read_request(stream, true).await?; let request = read_request(stream, true).await?;
if request.is_none() { if request.is_none() {
#[cfg(has_drtio)]
subkernel::clear_subkernels().await;
return Ok(()); return Ok(());
} }
let request = request.unwrap(); let request = request.unwrap();
@ -328,24 +650,55 @@ async fn handle_connection(stream: &TcpStream, control: Rc<RefCell<kernel::Contr
Request::SystemInfo => { Request::SystemInfo => {
write_header(stream, Reply::SystemInfo).await?; write_header(stream, Reply::SystemInfo).await?;
stream.send_slice("ARZQ".as_bytes()).await?; stream.send_slice("ARZQ".as_bytes()).await?;
}, }
Request::LoadKernel => { Request::LoadKernel => {
let buffer = read_bytes(stream, 1024*1024).await?; let buffer = read_bytes(stream, 1024 * 1024).await?;
load_kernel(&buffer, &control, Some(stream)).await?; load_kernel(&buffer, &control, Some(stream)).await?;
}, }
Request::RunKernel => { Request::RunKernel => {
handle_run_kernel(Some(stream), &control).await?; handle_run_kernel(
}, Some(stream),
&control,
&up_destinations,
aux_mutex,
routing_table,
timer,
)
.await?;
}
Request::UploadSubkernel => {
#[cfg(has_drtio)]
{
let id = read_i32(stream).await? as u32;
let destination = read_i8(stream).await? as u8;
let buffer = read_bytes(stream, 1024 * 1024).await?;
subkernel::add_subkernel(id, destination, buffer).await;
match subkernel::upload(aux_mutex, routing_table, timer, id).await {
Ok(_) => write_header(stream, Reply::LoadCompleted).await?,
Err(_) => {
write_header(stream, Reply::LoadFailed).await?;
write_chunk(stream, b"subkernel failed to load").await?;
return Err(Error::UnexpectedPattern);
}
}
}
#[cfg(not(has_drtio))]
{
write_header(stream, Reply::LoadFailed).await?;
write_chunk(stream, b"No DRTIO on this system, subkernels are not supported").await?;
return Err(Error::UnexpectedPattern);
}
}
_ => { _ => {
error!("unexpected request from host: {:?}", request); error!("unexpected request from host: {:?}", request);
return Err(Error::UnrecognizedPacket) return Err(Error::UnrecognizedPacket);
} }
} }
} }
} }
pub fn main(timer: GlobalTimer, cfg: Config) { pub fn main(timer: GlobalTimer, cfg: Config) {
let net_addresses = net_settings::get_adresses(&cfg); let net_addresses = net_settings::get_addresses(&cfg);
info!("network addresses: {}", net_addresses); info!("network addresses: {}", net_addresses);
let eth = zynq::eth::Eth::eth0(net_addresses.hardware_addr.0.clone()); let eth = zynq::eth::Eth::eth0(net_addresses.hardware_addr.0.clone());
@ -362,7 +715,7 @@ pub fn main(timer: GlobalTimer, cfg: Config) {
let ip_addrs = [ let ip_addrs = [
IpCidr::new(net_addresses.ipv4_addr, 0), IpCidr::new(net_addresses.ipv4_addr, 0),
IpCidr::new(net_addresses.ipv6_ll_addr, 0), IpCidr::new(net_addresses.ipv6_ll_addr, 0),
IpCidr::new(addr, 0) IpCidr::new(addr, 0),
]; ];
EthernetInterfaceBuilder::new(&mut eth) EthernetInterfaceBuilder::new(&mut eth)
.ethernet_addr(net_addresses.hardware_addr) .ethernet_addr(net_addresses.hardware_addr)
@ -373,7 +726,7 @@ pub fn main(timer: GlobalTimer, cfg: Config) {
None => { None => {
let ip_addrs = [ let ip_addrs = [
IpCidr::new(net_addresses.ipv4_addr, 0), IpCidr::new(net_addresses.ipv4_addr, 0),
IpCidr::new(net_addresses.ipv6_ll_addr, 0) IpCidr::new(net_addresses.ipv6_ll_addr, 0),
]; ];
EthernetInterfaceBuilder::new(&mut eth) EthernetInterfaceBuilder::new(&mut eth)
.ethernet_addr(net_addresses.hardware_addr) .ethernet_addr(net_addresses.hardware_addr)
@ -385,29 +738,79 @@ pub fn main(timer: GlobalTimer, cfg: Config) {
Sockets::init(32); Sockets::init(32);
analyzer::start(); let aux_mutex: Rc<Mutex<bool>> = Rc::new(Mutex::new(false));
moninj::start(timer); #[cfg(has_drtio)]
let drtio_routing_table = Rc::new(RefCell::new(drtio_routing::config_routing_table(
pl::csr::DRTIO.len(),
&cfg,
)));
#[cfg(not(has_drtio))]
let drtio_routing_table = Rc::new(RefCell::new(drtio_routing::RoutingTable::default_empty()));
let up_destinations = Rc::new(RefCell::new([false; drtio_routing::DEST_COUNT]));
#[cfg(has_drtio_routing)]
drtio_routing::interconnect_disable_all();
rtio_mgt::startup(&aux_mutex, &drtio_routing_table, &up_destinations, &cfg, timer);
ksupport::setup_device_map(&cfg);
analyzer::start(&aux_mutex, &drtio_routing_table, &up_destinations, timer);
moninj::start(timer, &aux_mutex, &drtio_routing_table);
let control: Rc<RefCell<kernel::Control>> = Rc::new(RefCell::new(kernel::Control::start())); let control: Rc<RefCell<kernel::Control>> = Rc::new(RefCell::new(kernel::Control::start()));
let idle_kernel = Rc::new(cfg.read("idle").ok()); if let Ok(buffer) = cfg.read("startup_kernel") {
if let Ok(buffer) = cfg.read("startup") {
info!("Loading startup kernel..."); info!("Loading startup kernel...");
if let Ok(()) = task::block_on(load_kernel(&buffer, &control, None)) { let routing_table = drtio_routing_table.borrow();
if let Ok(()) = task::block_on(handle_flash_kernel(
&buffer,
&control,
&up_destinations,
&aux_mutex,
&routing_table,
timer,
)) {
info!("Starting startup kernel..."); info!("Starting startup kernel...");
let _ = task::block_on(handle_run_kernel(None, &control)); let _ = task::block_on(handle_run_kernel(
None,
&control,
&up_destinations,
&aux_mutex,
&routing_table,
timer,
));
info!("Startup kernel finished!"); info!("Startup kernel finished!");
} else { } else {
error!("Error loading startup kernel!"); error!("Error loading startup kernel!");
} }
} }
mgmt::start(cfg); let cfg = Rc::new(cfg);
let restart_idle = Rc::new(Semaphore::new(1, 1));
mgmt::start(
cfg.clone(),
restart_idle.clone(),
Some(mgmt::DrtioContext(
aux_mutex.clone(),
drtio_routing_table.clone(),
timer,
)),
);
task::spawn(async move { task::spawn(async move {
let connection = Rc::new(Semaphore::new(1, 1)); let connection = Rc::new(Semaphore::new(1, 1));
let terminate = Rc::new(Semaphore::new(0, 1)); let terminate = Rc::new(Semaphore::new(0, 1));
let can_restart_idle = Rc::new(Semaphore::new(1, 1));
let restart_idle = restart_idle.clone();
loop { loop {
let stream = TcpStream::accept(1381, 0x10_000, 0x10_000).await.unwrap(); let control = control.clone();
let mut maybe_stream = select_biased! {
s = (async {
TcpStream::accept(1381, 0x10_000, 0x10_000).await.unwrap()
}).fuse() => Some(s),
_ = (async {
restart_idle.async_wait().await;
can_restart_idle.async_wait().await;
}).fuse() => None
};
if connection.try_wait().is_none() { if connection.try_wait().is_none() {
// there is an existing connection // there is an existing connection
@ -415,39 +818,116 @@ pub fn main(timer: GlobalTimer, cfg: Config) {
connection.async_wait().await; connection.async_wait().await;
} }
let maybe_idle_kernel = cfg.read("idle_kernel").ok();
if maybe_idle_kernel.is_none() && maybe_stream.is_none() {
control.borrow_mut().restart(); // terminate idle kernel if running
}
let control = control.clone(); let control = control.clone();
let idle_kernel = idle_kernel.clone();
let connection = connection.clone(); let connection = connection.clone();
let terminate = terminate.clone(); let terminate = terminate.clone();
let can_restart_idle = can_restart_idle.clone();
let up_destinations = up_destinations.clone();
let aux_mutex = aux_mutex.clone();
let routing_table = drtio_routing_table.clone();
// we make sure the value of terminate is 0 before we start // we make sure the value of terminate is 0 before we start
let _ = terminate.try_wait(); let _ = terminate.try_wait();
let _ = can_restart_idle.try_wait();
task::spawn(async move { task::spawn(async move {
let routing_table = routing_table.borrow();
select_biased! { select_biased! {
_ = (async { _ = (async {
let _ = handle_connection(&stream, control.clone()) if let Some(stream) = &mut maybe_stream {
let _ = handle_connection(stream, control.clone(), &up_destinations, &aux_mutex, &routing_table, timer)
.await .await
.map_err(|e| warn!("connection terminated: {}", e)); .map_err(|e| warn!("connection terminated: {}", e));
if let Some(buffer) = &*idle_kernel { }
info!("Loading idle kernel"); can_restart_idle.signal();
let _ = load_kernel(&buffer, &control, None) match maybe_idle_kernel {
.await.map_err(|_| warn!("error loading idle kernel")); Some(buffer) => {
info!("Running idle kernel"); loop {
let _ = handle_run_kernel(None, &control) info!("loading idle kernel");
.await.map_err(|_| warn!("error running idle kernel")); match handle_flash_kernel(&buffer, &control, &up_destinations, &aux_mutex, &routing_table, timer).await {
info!("Idle kernel terminated"); Ok(_) => {
info!("running idle kernel");
match handle_run_kernel(None, &control, &up_destinations, &aux_mutex, &routing_table, timer).await {
Ok(_) => info!("idle kernel finished"),
Err(_) => warn!("idle kernel running error")
}
},
Err(_) => warn!("idle kernel loading error")
}
}
},
None => info!("no idle kernel found")
} }
}).fuse() => (), }).fuse() => (),
_ = terminate.async_wait().fuse() => () _ = terminate.async_wait().fuse() => ()
} }
connection.signal(); connection.signal();
if let Some(stream) = maybe_stream {
let _ = stream.flush().await; let _ = stream.flush().await;
let _ = stream.abort().await; let _ = stream.abort().await;
}
}); });
} }
}); });
Sockets::run(&mut iface, || { Sockets::run(&mut iface, || Instant::from_millis(timer.get_time().0 as i32));
Instant::from_millis(timer.get_time().0 as i32) }
});
pub fn soft_panic_main(timer: GlobalTimer, cfg: Config) -> ! {
let net_addresses = net_settings::get_addresses(&cfg);
info!("network addresses: {}", net_addresses);
let eth = zynq::eth::Eth::eth0(net_addresses.hardware_addr.0.clone());
const RX_LEN: usize = 64;
// Number of transmission buffers (minimum is two because with
// one, duplicate packet transmission occurs)
const TX_LEN: usize = 64;
let eth = eth.start_rx(RX_LEN);
let mut eth = eth.start_tx(TX_LEN);
let neighbor_cache = NeighborCache::new(alloc::collections::BTreeMap::new());
let mut iface = match net_addresses.ipv6_addr {
Some(addr) => {
let ip_addrs = [
IpCidr::new(net_addresses.ipv4_addr, 0),
IpCidr::new(net_addresses.ipv6_ll_addr, 0),
IpCidr::new(addr, 0),
];
EthernetInterfaceBuilder::new(&mut eth)
.ethernet_addr(net_addresses.hardware_addr)
.ip_addrs(ip_addrs)
.neighbor_cache(neighbor_cache)
.finalize()
}
None => {
let ip_addrs = [
IpCidr::new(net_addresses.ipv4_addr, 0),
IpCidr::new(net_addresses.ipv6_ll_addr, 0),
];
EthernetInterfaceBuilder::new(&mut eth)
.ethernet_addr(net_addresses.hardware_addr)
.ip_addrs(ip_addrs)
.neighbor_cache(neighbor_cache)
.finalize()
}
};
Sockets::init(32);
let dummy = Rc::new(Semaphore::new(0, 1));
mgmt::start(Rc::new(cfg), dummy, None);
// getting eth settings disables the LED as it resets GPIO
// need to re-enable it here
#[cfg(feature = "target_kasli_soc")]
{
let mut err_led = ErrorLED::error_led();
err_led.toggle(true);
}
Sockets::run(&mut iface, || Instant::from_millis(timer.get_time().0 as i32));
} }

View File

@ -1,265 +0,0 @@
// From Current artiq firmware ksupport implementation.
// Modified to suit the case of artiq-zynq port, for ARM EHABI.
// Portions of the code in this file are derived from code by:
//
// Copyright 2015 The Rust Project Developers. See the COPYRIGHT
// file at http://rust-lang.org/COPYRIGHT.
//
// Licensed under the Apache License, Version 2.0 <LICENSE-APACHE or
// http://www.apache.org/licenses/LICENSE-2.0> or the MIT license
// <LICENSE-MIT or http://opensource.org/licenses/MIT>, at your
// option. This file may not be copied, modified, or distributed
// except according to those terms.
#![allow(non_camel_case_types)]
use core::mem;
use cslice::CSlice;
use unwind as uw;
use libc::{c_int, uintptr_t};
use log::trace;
use dwarf::eh::{self, EHAction, EHContext};
const EXCEPTION_CLASS: uw::_Unwind_Exception_Class = 0x4d_4c_42_53_41_52_54_51; /* 'MLBSARTQ' */
#[cfg(target_arch = "arm")]
const UNWIND_DATA_REG: (i32, i32) = (0, 1); // R0, R1
#[repr(C)]
#[derive(Clone, Copy)]
pub struct Exception<'a> {
pub name: CSlice<'a, u8>,
pub file: CSlice<'a, u8>,
pub line: u32,
pub column: u32,
pub function: CSlice<'a, u8>,
pub message: CSlice<'a, u8>,
pub param: [i64; 3]
}
fn str_err(_: core::str::Utf8Error) -> core::fmt::Error {
core::fmt::Error
}
impl<'a> core::fmt::Debug for Exception<'a> {
fn fmt(&self, f: &mut core::fmt::Formatter<'_>) -> core::fmt::Result {
write!(f, "Exception {} from {} in {}:{}:{}, message: {}",
core::str::from_utf8(self.name.as_ref()).map_err(str_err)?,
core::str::from_utf8(self.function.as_ref()).map_err(str_err)?,
core::str::from_utf8(self.file.as_ref()).map_err(str_err)?,
self.line, self.column,
core::str::from_utf8(self.message.as_ref()).map_err(str_err)?)
}
}
const MAX_BACKTRACE_SIZE: usize = 128;
#[repr(C)]
struct ExceptionInfo {
uw_exception: uw::_Unwind_Exception,
exception: Option<Exception<'static>>,
handled: bool,
backtrace: [usize; MAX_BACKTRACE_SIZE],
backtrace_size: usize
}
unsafe fn find_eh_action(
context: *mut uw::_Unwind_Context,
foreign_exception: bool,
) -> Result<EHAction, ()> {
let lsda = uw::_Unwind_GetLanguageSpecificData(context) as *const u8;
let mut ip_before_instr: c_int = 0;
let ip = uw::_Unwind_GetIPInfo(context, &mut ip_before_instr);
let eh_context = EHContext {
// The return address points 1 byte past the call instruction,
// which could be in the next IP range in LSDA range table.
ip: if ip_before_instr != 0 { ip } else { ip - 1 },
func_start: uw::_Unwind_GetRegionStart(context),
get_text_start: &|| uw::_Unwind_GetTextRelBase(context),
get_data_start: &|| uw::_Unwind_GetDataRelBase(context),
};
eh::find_eh_action(lsda, &eh_context, foreign_exception)
}
pub unsafe fn artiq_personality(state: uw::_Unwind_State,
exception_object: *mut uw::_Unwind_Exception,
context: *mut uw::_Unwind_Context)
-> uw::_Unwind_Reason_Code {
let state = state as c_int;
let action = state & uw::_US_ACTION_MASK as c_int;
let search_phase = if action == uw::_US_VIRTUAL_UNWIND_FRAME as c_int {
// Backtraces on ARM will call the personality routine with
// state == _US_VIRTUAL_UNWIND_FRAME | _US_FORCE_UNWIND. In those cases
// we want to continue unwinding the stack, otherwise all our backtraces
// would end at __rust_try
if state & uw::_US_FORCE_UNWIND as c_int != 0 {
return continue_unwind(exception_object, context);
}
true
} else if action == uw::_US_UNWIND_FRAME_STARTING as c_int {
false
} else if action == uw::_US_UNWIND_FRAME_RESUME as c_int {
return continue_unwind(exception_object, context);
} else {
return uw::_URC_FAILURE;
};
// The DWARF unwinder assumes that _Unwind_Context holds things like the function
// and LSDA pointers, however ARM EHABI places them into the exception object.
// To preserve signatures of functions like _Unwind_GetLanguageSpecificData(), which
// take only the context pointer, GCC personality routines stash a pointer to
// exception_object in the context, using location reserved for ARM's
// "scratch register" (r12).
uw::_Unwind_SetGR(context,
uw::UNWIND_POINTER_REG,
exception_object as uw::_Unwind_Ptr);
// ...A more principled approach would be to provide the full definition of ARM's
// _Unwind_Context in our libunwind bindings and fetch the required data from there
// directly, bypassing DWARF compatibility functions.
let exception_class = (*exception_object).exception_class;
let foreign_exception = exception_class != EXCEPTION_CLASS;
let eh_action = match find_eh_action(context, foreign_exception) {
Ok(action) => action,
Err(_) => return uw::_URC_FAILURE,
};
let exception_info = &mut *(exception_object as *mut ExceptionInfo);
let exception = &exception_info.exception.unwrap();
if search_phase {
match eh_action {
EHAction::None => return continue_unwind(exception_object, context),
// Actually, cleanup should not return handler found, this is to workaround
// the issue of terminating directly when no catch cause is found while
// having some cleanup routines defined by finally.
// The best way to handle this is to force unwind the stack in the raise
// function when end of stack is reached, and call terminate at the end of
// the unwind. Unfortunately, there is no forced unwind function defined
// for EHABI, and I have no idea how to implement that, so this is a hack.
EHAction::Cleanup(_) => return uw::_URC_HANDLER_FOUND,
EHAction::Catch(_) => {
// EHABI requires the personality routine to update the
// SP value in the barrier cache of the exception object.
(*exception_object).private[5] =
uw::_Unwind_GetGR(context, uw::UNWIND_SP_REG);
return uw::_URC_HANDLER_FOUND;
}
EHAction::Terminate => return uw::_URC_FAILURE,
}
} else {
match eh_action {
EHAction::None => return continue_unwind(exception_object, context),
EHAction::Cleanup(lpad) |
EHAction::Catch(lpad) => {
uw::_Unwind_SetGR(context, UNWIND_DATA_REG.0,
exception_object as uintptr_t);
uw::_Unwind_SetGR(context, UNWIND_DATA_REG.1, exception as *const _ as uw::_Unwind_Word);
uw::_Unwind_SetIP(context, lpad);
return uw::_URC_INSTALL_CONTEXT;
}
EHAction::Terminate => return uw::_URC_FAILURE,
}
}
// On ARM EHABI the personality routine is responsible for actually
// unwinding a single stack frame before returning (ARM EHABI Sec. 6.1).
unsafe fn continue_unwind(exception_object: *mut uw::_Unwind_Exception,
context: *mut uw::_Unwind_Context)
-> uw::_Unwind_Reason_Code {
if __gnu_unwind_frame(exception_object, context) == uw::_URC_NO_REASON {
uw::_URC_CONTINUE_UNWIND
} else {
uw::_URC_FAILURE
}
}
// defined in libgcc
extern "C" {
fn __gnu_unwind_frame(exception_object: *mut uw::_Unwind_Exception,
context: *mut uw::_Unwind_Context)
-> uw::_Unwind_Reason_Code;
}
}
extern fn cleanup(_unwind_code: uw::_Unwind_Reason_Code,
uw_exception: *mut uw::_Unwind_Exception) {
unsafe {
let exception_info = &mut *(uw_exception as *mut ExceptionInfo);
exception_info.exception = None;
}
}
static mut INFLIGHT: ExceptionInfo = ExceptionInfo {
uw_exception: uw::_Unwind_Exception {
exception_class: EXCEPTION_CLASS,
exception_cleanup: cleanup,
private: [0; uw::unwinder_private_data_size],
},
exception: None,
handled: true,
backtrace: [0; MAX_BACKTRACE_SIZE],
backtrace_size: 0
};
pub unsafe extern fn raise(exception: *const Exception) -> ! {
trace!("Trying to raise exception");
// FIXME: unsound transmute
// This would cause stack memory corruption.
INFLIGHT.exception = Some(mem::transmute::<Exception, Exception<'static>>(*exception));
INFLIGHT.handled = false;
let result = uw::_Unwind_RaiseException(&mut INFLIGHT.uw_exception);
assert!(result == uw::_URC_END_OF_STACK);
INFLIGHT.backtrace_size = 0;
// read backtrace
let _ = uw::backtrace(|ip| {
if INFLIGHT.backtrace_size < MAX_BACKTRACE_SIZE {
INFLIGHT.backtrace[INFLIGHT.backtrace_size] = ip;
INFLIGHT.backtrace_size += 1;
}
});
crate::kernel::core1::terminate(INFLIGHT.exception.as_ref().unwrap(), INFLIGHT.backtrace[..INFLIGHT.backtrace_size].as_mut());
}
pub unsafe extern fn reraise() -> ! {
use cslice::AsCSlice;
// Reraise is basically cxa_rethrow, which calls _Unwind_Resume_or_Rethrow,
// which for EHABI would always call _Unwind_RaiseException.
match INFLIGHT.exception {
Some(ref exception) => raise(exception),
None => raise(&Exception {
name: "0:artiq.coredevice.exceptions.RuntimeError".as_c_slice(),
file: file!().as_c_slice(),
line: line!(),
column: column!(),
// https://github.com/rust-lang/rfcs/pull/1719
function: "__artiq_reraise".as_c_slice(),
message: "No active exception to reraise".as_c_slice(),
param: [0, 0, 0]
})
}
}
#[macro_export]
macro_rules! artiq_raise {
($name:expr, $message:expr, $param0:expr, $param1:expr, $param2:expr) => ({
use cslice::AsCSlice;
let exn = $crate::eh_artiq::Exception {
name: concat!("0:artiq.coredevice.exceptions.", $name).as_c_slice(),
file: file!().as_c_slice(),
line: line!(),
column: column!(),
// https://github.com/rust-lang/rfcs/pull/1719
function: "(Rust function)".as_c_slice(),
message: $message.as_c_slice(),
param: [$param0, $param1, $param2]
};
#[allow(unused_unsafe)]
unsafe { $crate::eh_artiq::raise(&exn) }
});
($name:expr, $message:expr) => ({
artiq_raise!($name, $message, 0, 0, 0)
});
}

View File

@ -1,100 +0,0 @@
#[cfg(feature = "target_zc706")]
mod i2c {
use libboard_zynq;
use crate::artiq_raise;
static mut I2C_BUS: Option<libboard_zynq::i2c::I2c> = None;
pub extern fn start(busno: i32) {
if busno > 0 {
artiq_raise!("I2CError", "I2C bus could not be accessed");
}
unsafe {
if (&mut I2C_BUS).as_mut().unwrap().start().is_err() {
artiq_raise!("I2CError", "I2C start failed");
}
}
}
pub extern fn restart(busno: i32) {
if busno > 0 {
artiq_raise!("I2CError", "I2C bus could not be accessed");
}
unsafe {
if (&mut I2C_BUS).as_mut().unwrap().restart().is_err() {
artiq_raise!("I2CError", "I2C restart failed");
}
}
}
pub extern fn stop(busno: i32) {
if busno > 0 {
artiq_raise!("I2CError", "I2C bus could not be accessed");
}
unsafe {
if (&mut I2C_BUS).as_mut().unwrap().stop().is_err() {
artiq_raise!("I2CError", "I2C stop failed");
}
}
}
pub extern fn write(busno: i32, data: i32) -> bool {
if busno > 0 {
artiq_raise!("I2CError", "I2C bus could not be accessed");
}
unsafe {
match (&mut I2C_BUS).as_mut().unwrap().write(data as u8) {
Ok(r) => r,
Err(_) => artiq_raise!("I2CError", "I2C write failed"),
}
}
}
pub extern fn read(busno: i32, ack: bool) -> i32 {
if busno > 0 {
artiq_raise!("I2CError", "I2C bus could not be accessed");
}
unsafe {
match (&mut I2C_BUS).as_mut().unwrap().read(ack) {
Ok(r) => r as i32,
Err(_) => artiq_raise!("I2CError", "I2C read failed"),
}
}
}
pub fn init() {
let mut i2c = libboard_zynq::i2c::I2c::i2c0();
i2c.init().expect("I2C bus initialization failed");
unsafe { I2C_BUS = Some(i2c) };
}
}
#[cfg(not(feature = "target_zc706"))]
mod i2c {
use crate::artiq_raise;
pub extern fn start(_busno: i32) {
artiq_raise!("I2CError", "No I2C bus");
}
pub extern fn restart(_busno: i32) {
artiq_raise!("I2CError", "No I2C bus");
}
pub extern fn stop(_busno: i32) {
artiq_raise!("I2CError", "No I2C bus");
}
pub extern fn write(_busno: i32, _data: i32) -> bool {
artiq_raise!("I2CError", "No I2C bus");
}
pub extern fn read(_busno: i32, _ack: bool) -> i32 {
artiq_raise!("I2CError", "No I2C bus");
}
pub fn init() {
}
}
pub use i2c::*;

View File

@ -1,30 +0,0 @@
use alloc::string::String;
use cslice::{CSlice, AsCSlice};
use core::mem::{transmute, forget};
use super::{KERNEL_CHANNEL_0TO1, KERNEL_CHANNEL_1TO0, Message};
pub extern fn get(key: CSlice<u8>) -> CSlice<'static, i32> {
let key = String::from_utf8(key.as_ref().to_vec()).unwrap();
unsafe {
KERNEL_CHANNEL_1TO0.as_mut().unwrap().send(Message::CacheGetRequest(key));
let msg = KERNEL_CHANNEL_0TO1.as_mut().unwrap().recv();
if let Message::CacheGetReply(v) = msg {
let slice = transmute(v.as_c_slice());
// we intentionally leak the memory here,
// which does not matter as core1 would restart
forget(v);
slice
} else {
panic!("Expected CacheGetReply for CacheGetRequest");
}
}
}
pub extern fn put(key: CSlice<u8>, list: CSlice<i32>) {
let key = String::from_utf8(key.as_ref().to_vec()).unwrap();
let value = list.as_ref().to_vec();
unsafe {
KERNEL_CHANNEL_1TO0.as_mut().unwrap().send(Message::CachePutRequest(key, value));
}
}

View File

@ -1,212 +0,0 @@
use crate::{
pl::csr,
artiq_raise,
rtio,
};
use alloc::{vec::Vec, string::String, boxed::Box};
use cslice::CSlice;
use super::{KERNEL_IMAGE, KERNEL_CHANNEL_0TO1, KERNEL_CHANNEL_1TO0, Message};
use core::mem;
use libcortex_a9::cache::dcci_slice;
const ALIGNMENT: usize = 16 * 8;
#[repr(C)]
pub struct DmaTrace {
duration: i64,
address: i32,
}
#[derive(Clone, Debug)]
pub struct DmaRecorder {
pub name: String,
pub buffer: Vec<u8>,
pub duration: i64,
}
static mut RECORDER: Option<DmaRecorder> = None;
pub unsafe fn init_dma_recorder() {
// as static would remain after restart, we have to reset it,
// without running its destructor.
mem::forget(mem::replace(&mut RECORDER, None));
}
pub extern fn dma_record_start(name: CSlice<u8>) {
let name = String::from_utf8(name.as_ref().to_vec()).unwrap();
unsafe {
KERNEL_CHANNEL_1TO0.as_mut().unwrap().send(Message::DmaEraseRequest(name.clone()));
}
unsafe {
if RECORDER.is_some() {
artiq_raise!("DMAError", "DMA is already recording")
}
let library = KERNEL_IMAGE.as_ref().unwrap();
library.rebind(b"rtio_output",
dma_record_output as *const ()).unwrap();
library.rebind(b"rtio_output_wide",
dma_record_output_wide as *const ()).unwrap();
RECORDER = Some(DmaRecorder {
name,
buffer: Vec::new(),
duration: 0,
});
}
}
pub extern fn dma_record_stop(duration: i64) {
unsafe {
if RECORDER.is_none() {
artiq_raise!("DMAError", "DMA is not recording")
}
let library = KERNEL_IMAGE.as_ref().unwrap();
library.rebind(b"rtio_output",
rtio::output as *const ()).unwrap();
library.rebind(b"rtio_output_wide",
rtio::output_wide as *const ()).unwrap();
let mut recorder = RECORDER.take().unwrap();
recorder.duration = duration;
KERNEL_CHANNEL_1TO0.as_mut().unwrap().send(
Message::DmaPutRequest(recorder)
);
}
}
#[inline(always)]
unsafe fn dma_record_output_prepare(timestamp: i64, target: i32,
words: usize) {
// See gateware/rtio/dma.py.
const HEADER_LENGTH: usize = /*length*/1 + /*channel*/3 + /*timestamp*/8 + /*address*/1;
let length = HEADER_LENGTH + /*data*/words * 4;
let buffer = &mut RECORDER.as_mut().unwrap().buffer;
buffer.reserve(length);
buffer.extend_from_slice(&[
(length >> 0) as u8,
(target >> 8) as u8,
(target >> 16) as u8,
(target >> 24) as u8,
(timestamp >> 0) as u8,
(timestamp >> 8) as u8,
(timestamp >> 16) as u8,
(timestamp >> 24) as u8,
(timestamp >> 32) as u8,
(timestamp >> 40) as u8,
(timestamp >> 48) as u8,
(timestamp >> 56) as u8,
(target >> 0) as u8,
]);
}
pub extern fn dma_record_output(target: i32, word: i32) {
unsafe {
let timestamp = rtio::now_mu();
dma_record_output_prepare(timestamp, target, 1);
RECORDER.as_mut().unwrap().buffer.extend_from_slice(&[
(word >> 0) as u8,
(word >> 8) as u8,
(word >> 16) as u8,
(word >> 24) as u8,
]);
}
}
pub extern fn dma_record_output_wide(target: i32, words: CSlice<i32>) {
assert!(words.len() <= 16); // enforce the hardware limit
unsafe {
let timestamp = rtio::now_mu();
dma_record_output_prepare(timestamp, target, words.len());
let buffer = &mut RECORDER.as_mut().unwrap().buffer;
for word in words.as_ref().iter() {
buffer.extend_from_slice(&[
(word >> 0) as u8,
(word >> 8) as u8,
(word >> 16) as u8,
(word >> 24) as u8,
]);
}
}
}
pub extern fn dma_erase(name: CSlice<u8>) {
let name = String::from_utf8(name.as_ref().to_vec()).unwrap();
unsafe {
KERNEL_CHANNEL_1TO0.as_mut().unwrap().send(Message::DmaEraseRequest(name));
}
}
pub extern fn dma_retrieve(name: CSlice<u8>) -> DmaTrace {
let name = String::from_utf8(name.as_ref().to_vec()).unwrap();
unsafe {
KERNEL_CHANNEL_1TO0.as_mut().unwrap().send(Message::DmaGetRequest(name));
}
match unsafe {KERNEL_CHANNEL_0TO1.as_mut().unwrap()}.recv() {
Message::DmaGetReply(None) => (),
Message::DmaGetReply(Some((mut v, duration))) => {
v.reserve(ALIGNMENT - 1);
let original_length = v.len();
let padding = ALIGNMENT - v.as_ptr() as usize % ALIGNMENT;
let padding = if padding == ALIGNMENT { 0 } else { padding };
for _ in 0..padding {
v.push(0);
}
// trailing zero to indicate end of buffer
v.push(0);
v.copy_within(0..original_length, padding);
dcci_slice(&v);
let v = Box::new(v);
let address = Box::into_raw(v) as *mut Vec<u8> as i32;
return DmaTrace {
address,
duration,
};
},
_ => panic!("Expected DmaGetReply after DmaGetRequest!"),
}
// we have to defer raising error as we have to drop the message first...
artiq_raise!("DMAError", "DMA trace not found");
}
pub extern fn dma_playback(timestamp: i64, ptr: i32) {
unsafe {
let v = Box::from_raw(ptr as *mut Vec<u8>);
let padding = ALIGNMENT - v.as_ptr() as usize % ALIGNMENT;
let padding = if padding == ALIGNMENT { 0 } else { padding };
let ptr = v.as_ptr().add(padding) as i32;
csr::rtio_dma::base_address_write(ptr as u32);
csr::rtio_dma::time_offset_write(timestamp as u64);
csr::cri_con::selected_write(1);
csr::rtio_dma::enable_write(1);
while csr::rtio_dma::enable_read() != 0 {}
csr::cri_con::selected_write(0);
// leave the handle as we may try to do playback for another time.
mem::forget(v);
let error = csr::rtio_dma::error_read();
if error != 0 {
let timestamp = csr::rtio_dma::error_timestamp_read();
let channel = csr::rtio_dma::error_channel_read();
csr::rtio_dma::error_write(1);
if error & 1 != 0 {
artiq_raise!("RTIOUnderflow",
"RTIO underflow at {0} mu, channel {1}",
timestamp as i64, channel as i64, 0);
}
if error & 2 != 0 {
artiq_raise!("RTIODestinationUnreachable",
"RTIO destination unreachable, output, at {0} mu, channel {1}",
timestamp as i64, channel as i64, 0);
}
}
}
}

View File

@ -1,59 +0,0 @@
use core::ptr;
use alloc::{vec::Vec, string::String};
use libcortex_a9::{mutex::Mutex, sync_channel, semaphore::Semaphore};
use crate::eh_artiq;
mod control;
pub use control::Control;
pub mod core1;
mod api;
mod rpc;
mod dma;
pub use dma::DmaRecorder;
mod cache;
#[derive(Debug, Clone)]
pub struct RPCException {
pub name: String,
pub message: String,
pub param: [i64; 3],
pub file: String,
pub line: i32,
pub column: i32,
pub function: String
}
#[derive(Debug, Clone)]
pub enum Message {
LoadRequest(Vec<u8>),
LoadCompleted,
LoadFailed,
StartRequest,
KernelFinished,
KernelException(&'static eh_artiq::Exception<'static>, &'static [usize]),
RpcSend { is_async: bool, data: Vec<u8> },
RpcRecvRequest(*mut ()),
RpcRecvReply(Result<usize, RPCException>),
CacheGetRequest(String),
CacheGetReply(Vec<i32>),
CachePutRequest(String, Vec<i32>),
DmaPutRequest(DmaRecorder),
DmaEraseRequest(String),
DmaGetRequest(String),
DmaGetReply(Option<(Vec<u8>, i64)>),
}
static CHANNEL_0TO1: Mutex<Option<sync_channel::Sender<'static, Message>>> = Mutex::new(None);
static CHANNEL_1TO0: Mutex<Option<sync_channel::Receiver<'static, Message>>> = Mutex::new(None);
static CHANNEL_SEM: Semaphore = Semaphore::new(0, 1);
static mut KERNEL_CHANNEL_0TO1: Option<sync_channel::Receiver<'static, Message>> = None;
static mut KERNEL_CHANNEL_1TO0: Option<sync_channel::Sender<'static, Message>> = None;
static mut KERNEL_IMAGE: *const core1::KernelImage = ptr::null();
static INIT_LOCK: Mutex<()> = Mutex::new(());

View File

@ -1,174 +1,94 @@
#![no_std] #![no_std]
#![no_main] #![no_main]
#![recursion_limit="1024"] // for futures_util::select! #![recursion_limit = "1024"] // for futures_util::select!
#![feature(alloc_error_handler)] #![feature(alloc_error_handler)]
#![feature(panic_info_message)]
#![feature(c_variadic)]
#![feature(const_btree_new)] #![feature(const_btree_new)]
#![feature(const_in_array_repeat_expressions)] #![feature(panic_info_message)]
#![feature(naked_functions)]
#![feature(asm)]
#[macro_use]
extern crate alloc; extern crate alloc;
use core::{cmp, str}; #[cfg(all(feature = "target_kasli_soc", has_virtual_leds))]
use log::{info, warn, error}; use core::cell::RefCell;
use libboard_zynq::{timer::GlobalTimer, mpcore, gic, slcr}; use ksupport;
use libasync::{task, block_async}; use libasync::task;
use libsupport_zynq::ram; #[cfg(has_drtio_eem)]
use nb; use libboard_artiq::drtio_eem;
use void::Void; #[cfg(feature = "target_kasli_soc")]
use embedded_hal::blocking::delay::DelayMs; use libboard_artiq::io_expander;
use libboard_artiq::{identifier_read, logger, pl};
use libboard_zynq::{gic, mpcore, timer::GlobalTimer};
use libconfig::Config; use libconfig::Config;
use libregister::RegisterW;
use libcortex_a9::l2c::enable_l2_cache; use libcortex_a9::l2c::enable_l2_cache;
use libsupport_zynq::{exception_vectors, ram};
use log::{info, warn};
mod proto_core_io;
mod proto_async;
mod comms;
mod rpc;
#[path = "../../../build/pl.rs"]
mod pl;
#[cfg(ki_impl = "csr")]
#[path = "rtio_csr.rs"]
mod rtio;
#[cfg(ki_impl = "acp")]
#[path = "rtio_acp.rs"]
mod rtio;
mod kernel;
mod moninj;
mod eh_artiq;
mod panic;
mod logger;
mod mgmt;
mod analyzer; mod analyzer;
mod irq; mod comms;
mod i2c;
fn init_gateware() { mod mgmt;
// Set up PS->PL clocks mod moninj;
slcr::RegisterBlock::unlocked(|slcr| { mod panic;
// As we are touching the mux, the clock may glitch, so reset the PL. mod proto_async;
slcr.fpga_rst_ctrl.write( mod rpc_async;
slcr::FpgaRstCtrl::zeroed() mod rtio_clocking;
.fpga0_out_rst(true) mod rtio_dma;
.fpga1_out_rst(true) mod rtio_mgt;
.fpga2_out_rst(true) #[cfg(has_drtio)]
.fpga3_out_rst(true) mod subkernel;
);
slcr.fpga0_clk_ctrl.write( // linker symbols
slcr::Fpga0ClkCtrl::zeroed() extern "C" {
.src_sel(slcr::PllSource::IoPll) static __exceptions_start: u32;
.divisor0(8)
.divisor1(1)
);
slcr.fpga_rst_ctrl.write(
slcr::FpgaRstCtrl::zeroed()
);
});
} }
fn identifier_read(buf: &mut [u8]) -> &str { #[cfg(all(feature = "target_kasli_soc", has_virtual_leds))]
unsafe { async fn io_expanders_service(
pl::csr::identifier::address_write(0); i2c_bus: RefCell<&mut libboard_zynq::i2c::I2c>,
let len = pl::csr::identifier::data_read(); io_expander0: RefCell<io_expander::IoExpander>,
let len = cmp::min(len, buf.len() as u8); io_expander1: RefCell<io_expander::IoExpander>,
for i in 0..len { ) {
pl::csr::identifier::address_write(1 + i);
buf[i as usize] = pl::csr::identifier::data_read();
}
str::from_utf8_unchecked(&buf[..len as usize])
}
}
fn init_rtio(timer: &mut GlobalTimer, cfg: &Config) {
let clock_sel =
if let Ok(rtioclk) = cfg.read_str("rtioclk") {
match rtioclk.as_ref() {
"internal" => {
info!("using internal RTIO clock");
0
},
"external" => {
info!("using external RTIO clock");
1
},
other => {
warn!("RTIO clock specification '{}' not recognized", other);
info!("using internal RTIO clock");
0
},
}
} else {
info!("using internal RTIO clock (default)");
0
};
loop { loop {
unsafe { task::r#yield().await;
pl::csr::rtio_crg::pll_reset_write(1); io_expander0
pl::csr::rtio_crg::clock_sel_write(clock_sel); .borrow_mut()
pl::csr::rtio_crg::pll_reset_write(0); .service(&mut i2c_bus.borrow_mut())
} .expect("I2C I/O expander #0 service failed");
timer.delay_ms(1); io_expander1
let locked = unsafe { pl::csr::rtio_crg::pll_locked_read() != 0 }; .borrow_mut()
if locked { .service(&mut i2c_bus.borrow_mut())
info!("RTIO PLL locked"); .expect("I2C I/O expander #1 service failed");
break;
} else {
warn!("RTIO PLL failed to lock, retrying...");
timer.delay_ms(500);
}
}
unsafe {
pl::csr::rtio_core::reset_phy_write(1);
} }
} }
fn wait_for_async_rtio_error() -> nb::Result<(), Void> { #[cfg(has_grabber)]
unsafe { mod grabber {
if pl::csr::rtio_core::async_error_read() != 0 { use libasync::delay;
Ok(()) use libboard_artiq::grabber;
} else { use libboard_zynq::time::Milliseconds;
Err(nb::Error::WouldBlock)
}
}
}
async fn report_async_rtio_errors() { use crate::GlobalTimer;
pub async fn grabber_thread(timer: GlobalTimer) {
let mut countdown = timer.countdown();
loop { loop {
let _ = block_async!(wait_for_async_rtio_error()).await; grabber::tick();
unsafe { delay(&mut countdown, Milliseconds(200)).await;
let errors = pl::csr::rtio_core::async_error_read();
if errors & 1 != 0 {
error!("RTIO collision involving channel {}",
pl::csr::rtio_core::collision_channel_read());
}
if errors & 2 != 0 {
error!("RTIO busy error involving channel {}",
pl::csr::rtio_core::busy_channel_read());
}
if errors & 4 != 0 {
error!("RTIO sequence error involving channel {}",
pl::csr::rtio_core::sequence_error_channel_read());
}
pl::csr::rtio_core::async_error_write(errors);
} }
} }
} }
static mut LOG_BUFFER: [u8; 1<<17] = [0; 1<<17]; static mut LOG_BUFFER: [u8; 1 << 17] = [0; 1 << 17];
#[no_mangle] #[no_mangle]
pub fn main_core0() { pub fn main_core0() {
unsafe {
exception_vectors::set_vector_table(&__exceptions_start as *const u32 as u32);
}
enable_l2_cache(0x8); enable_l2_cache(0x8);
let mut timer = GlobalTimer::start(); let mut timer = GlobalTimer::start();
let buffer_logger = unsafe { let buffer_logger = unsafe { logger::BufferLogger::new(&mut LOG_BUFFER[..]) };
logger::BufferLogger::new(&mut LOG_BUFFER[..])
};
buffer_logger.set_uart_log_level(log::LevelFilter::Info); buffer_logger.set_uart_log_level(log::LevelFilter::Info);
buffer_logger.register(); buffer_logger.register();
log::set_max_level(log::LevelFilter::Info); log::set_max_level(log::LevelFilter::Info);
@ -178,10 +98,39 @@ pub fn main_core0() {
ram::init_alloc_core0(); ram::init_alloc_core0();
gic::InterruptController::gic(mpcore::RegisterBlock::mpcore()).enable_interrupts(); gic::InterruptController::gic(mpcore::RegisterBlock::mpcore()).enable_interrupts();
init_gateware(); info!("gateware ident: {}", identifier_read(&mut [0; 64]));
info!("detected gateware: {}", identifier_read(&mut [0; 64]));
i2c::init(); ksupport::i2c::init();
#[cfg(feature = "target_kasli_soc")]
{
let i2c_bus = unsafe { (ksupport::i2c::I2C_BUS).as_mut().unwrap() };
let mut io_expander0 = io_expander::IoExpander::new(i2c_bus, 0).unwrap();
let mut io_expander1 = io_expander::IoExpander::new(i2c_bus, 1).unwrap();
io_expander0
.init(i2c_bus)
.expect("I2C I/O expander #0 initialization failed");
io_expander1
.init(i2c_bus)
.expect("I2C I/O expander #1 initialization failed");
// Drive CLK_SEL to true
#[cfg(has_si549)]
io_expander0.set(1, 7, true);
// Drive TX_DISABLE to false on SFP0..3
io_expander0.set(0, 1, false);
io_expander1.set(0, 1, false);
io_expander0.set(1, 1, false);
io_expander1.set(1, 1, false);
io_expander0.service(i2c_bus).unwrap();
io_expander1.service(i2c_bus).unwrap();
#[cfg(has_virtual_leds)]
task::spawn(io_expanders_service(
RefCell::new(i2c_bus),
RefCell::new(io_expander0),
RefCell::new(io_expander1),
));
}
let cfg = match Config::new() { let cfg = match Config::new() {
Ok(cfg) => cfg, Ok(cfg) => cfg,
@ -191,8 +140,15 @@ pub fn main_core0() {
} }
}; };
init_rtio(&mut timer, &cfg); rtio_clocking::init(&mut timer, &cfg);
task::spawn(report_async_rtio_errors());
#[cfg(has_drtio_eem)]
drtio_eem::init(&mut timer, &cfg);
#[cfg(has_grabber)]
task::spawn(grabber::grabber_thread(timer));
task::spawn(ksupport::report_async_rtio_errors());
comms::main(timer, cfg); comms::main(timer, cfg);
} }

File diff suppressed because it is too large Load Diff

View File

@ -1,25 +1,23 @@
use core::fmt; use alloc::{collections::BTreeMap, rc::Rc};
use alloc::collections::BTreeMap; use core::{cell::RefCell, fmt};
use futures::{pin_mut, select_biased, FutureExt};
use libasync::{block_async, nb, smoltcp::TcpStream, task};
use libboard_artiq::drtio_routing;
use libboard_zynq::{smoltcp, time::Milliseconds, timer::GlobalTimer};
use libcortex_a9::mutex::Mutex;
use log::{debug, info, warn}; use log::{debug, info, warn};
use void::Void;
use libboard_zynq::{smoltcp, timer::GlobalTimer, time::Milliseconds};
use libasync::{task, smoltcp::TcpStream, block_async, nb};
use num_derive::{FromPrimitive, ToPrimitive}; use num_derive::{FromPrimitive, ToPrimitive};
use num_traits::{FromPrimitive, ToPrimitive}; use num_traits::{FromPrimitive, ToPrimitive};
use futures::{pin_mut, select_biased, FutureExt}; use void::Void;
use crate::proto_async::*; use crate::proto_async::*;
use crate::pl::csr;
#[derive(Debug, Clone, Copy, PartialEq, Eq)] #[derive(Debug, Clone, Copy, PartialEq, Eq)]
pub enum Error { pub enum Error {
NetworkError(smoltcp::Error), NetworkError(smoltcp::Error),
UnexpectedPattern, UnexpectedPattern,
UnrecognizedPacket, UnrecognizedPacket,
} }
pub type Result<T> = core::result::Result<T, Error>; pub type Result<T> = core::result::Result<T, Error>;
@ -45,62 +43,191 @@ enum HostMessage {
MonitorProbe = 0, MonitorProbe = 0,
MonitorInjection = 3, MonitorInjection = 3,
Inject = 1, Inject = 1,
GetInjectionStatus = 2 GetInjectionStatus = 2,
} }
#[derive(Debug, FromPrimitive, ToPrimitive)] #[derive(Debug, FromPrimitive, ToPrimitive)]
enum DeviceMessage { enum DeviceMessage {
MonitorStatus = 0, MonitorStatus = 0,
InjectionStatus = 1 InjectionStatus = 1,
} }
fn read_probe(channel: i32, probe: i8) -> i32 { #[cfg(has_drtio)]
mod remote_moninj {
use libboard_artiq::drtioaux_async;
use log::error;
use super::*;
use crate::rtio_mgt::{drtio, drtio::Error as DrtioError};
pub async fn read_probe(
aux_mutex: &Rc<Mutex<bool>>,
routing_table: &drtio_routing::RoutingTable,
timer: GlobalTimer,
linkno: u8,
destination: u8,
channel: i32,
probe: i8,
) -> i64 {
let reply = drtio::aux_transact(
aux_mutex,
linkno,
routing_table,
&drtioaux_async::Packet::MonitorRequest {
destination: destination,
channel: channel as _,
probe: probe as _,
},
timer,
)
.await;
match reply {
Ok(drtioaux_async::Packet::MonitorReply { value }) => return value as i64,
Ok(packet) => error!("received unexpected aux packet: {:?}", packet),
Err(DrtioError::LinkDown) => {
warn!("link is down");
}
Err(e) => error!("aux packet error ({})", e),
}
0
}
pub async fn inject(
aux_mutex: &Rc<Mutex<bool>>,
_routing_table: &drtio_routing::RoutingTable,
_timer: GlobalTimer,
linkno: u8,
destination: u8,
channel: i32,
overrd: i8,
value: i8,
) {
let _lock = aux_mutex.async_lock().await;
drtioaux_async::send(
linkno,
&drtioaux_async::Packet::InjectionRequest {
destination: destination,
channel: channel as _,
overrd: overrd as _,
value: value as _,
},
)
.await
.unwrap();
}
pub async fn read_injection_status(
aux_mutex: &Rc<Mutex<bool>>,
routing_table: &drtio_routing::RoutingTable,
timer: GlobalTimer,
linkno: u8,
destination: u8,
channel: i32,
overrd: i8,
) -> i8 {
let reply = drtio::aux_transact(
aux_mutex,
linkno,
routing_table,
&drtioaux_async::Packet::InjectionStatusRequest {
destination: destination,
channel: channel as _,
overrd: overrd as _,
},
timer,
)
.await;
match reply {
Ok(drtioaux_async::Packet::InjectionStatusReply { value }) => return value as i8,
Ok(packet) => error!("received unexpected aux packet: {:?}", packet),
Err(DrtioError::LinkDown) => {
warn!("link is down");
}
Err(e) => error!("aux packet error ({})", e),
}
0
}
}
mod local_moninj {
use libboard_artiq::pl::csr;
pub fn read_probe(channel: i32, probe: i8) -> i64 {
unsafe { unsafe {
csr::rtio_moninj::mon_chan_sel_write(channel as _); csr::rtio_moninj::mon_chan_sel_write(channel as _);
csr::rtio_moninj::mon_probe_sel_write(probe as _); csr::rtio_moninj::mon_probe_sel_write(probe as _);
csr::rtio_moninj::mon_value_update_write(1); csr::rtio_moninj::mon_value_update_write(1);
csr::rtio_moninj::mon_value_read() as i32 csr::rtio_moninj::mon_value_read() as i64
}
} }
}
fn inject(channel: i32, overrd: i8, value: i8) { pub fn inject(channel: i32, overrd: i8, value: i8) {
unsafe { unsafe {
csr::rtio_moninj::inj_chan_sel_write(channel as _); csr::rtio_moninj::inj_chan_sel_write(channel as _);
csr::rtio_moninj::inj_override_sel_write(overrd as _); csr::rtio_moninj::inj_override_sel_write(overrd as _);
csr::rtio_moninj::inj_value_write(value as _); csr::rtio_moninj::inj_value_write(value as _);
} }
} }
fn read_injection_status(channel: i32, overrd: i8) -> i8 { pub fn read_injection_status(channel: i32, overrd: i8) -> i8 {
unsafe { unsafe {
csr::rtio_moninj::inj_chan_sel_write(channel as _); csr::rtio_moninj::inj_chan_sel_write(channel as _);
csr::rtio_moninj::inj_override_sel_write(overrd as _); csr::rtio_moninj::inj_override_sel_write(overrd as _);
csr::rtio_moninj::inj_value_read() as i8 csr::rtio_moninj::inj_value_read() as i8
} }
}
} }
async fn handle_connection(stream: &TcpStream, timer: GlobalTimer) -> Result<()> { #[cfg(has_drtio)]
macro_rules! dispatch {
($timer:ident, $aux_mutex:ident, $routing_table:ident, $channel:expr, $func:ident $(, $param:expr)*) => {{
let destination = ($channel >> 16) as u8;
let channel = $channel;
let hop = $routing_table.0[destination as usize][0];
if hop == 0 {
local_moninj::$func(channel.into(), $($param, )*)
} else {
let linkno = hop - 1 as u8;
remote_moninj::$func($aux_mutex, $routing_table, $timer, linkno, destination, channel, $($param, )*).await
}
}}
}
#[cfg(not(has_drtio))]
macro_rules! dispatch {
($timer:ident, $aux_mutex:ident, $routing_table:ident, $channel:expr, $func:ident $(, $param:expr)*) => {{
let channel = $channel as u16;
local_moninj::$func(channel.into(), $($param, )*)
}}
}
async fn handle_connection(
stream: &TcpStream,
timer: GlobalTimer,
_aux_mutex: &Rc<Mutex<bool>>,
_routing_table: &drtio_routing::RoutingTable,
) -> Result<()> {
if !expect(&stream, b"ARTIQ moninj\n").await? { if !expect(&stream, b"ARTIQ moninj\n").await? {
return Err(Error::UnexpectedPattern); return Err(Error::UnexpectedPattern);
} }
stream.send_slice("e".as_bytes()).await?;
let mut probe_watch_list: BTreeMap<(i32, i8), Option<i32>> = BTreeMap::new(); let mut probe_watch_list: BTreeMap<(i32, i8), Option<i64>> = BTreeMap::new();
let mut inject_watch_list: BTreeMap<(i32, i8), Option<i8>> = BTreeMap::new(); let mut inject_watch_list: BTreeMap<(i32, i8), Option<i8>> = BTreeMap::new();
let mut next_check = Milliseconds(0); let mut next_check = timer.get_time();
loop { let timeout = |next_check: Milliseconds| -> nb::Result<(), Void> {
// TODO: we don't need fuse() here. if timer.get_time() < next_check {
// remove after https://github.com/rust-lang/futures-rs/issues/1989 lands
let read_message_f = read_i8(&stream).fuse();
let next_check_c = next_check.clone();
let timeout = || -> nb::Result<(), Void> {
if timer.get_time() < next_check_c {
Err(nb::Error::WouldBlock) Err(nb::Error::WouldBlock)
} else { } else {
Ok(()) Ok(())
} }
}; };
let timeout_f = block_async!(timeout()).fuse(); loop {
// TODO: we don't need fuse() here.
// remove after https://github.com/rust-lang/futures-rs/issues/1989 lands
let read_message_f = read_i8(&stream).fuse();
let next_check_c = next_check.clone();
let timeout_f = block_async!(timeout(next_check_c)).fuse();
pin_mut!(read_message_f, timeout_f); pin_mut!(read_message_f, timeout_f);
select_biased! { select_biased! {
message = read_message_f => { message = read_message_f => {
@ -135,13 +262,13 @@ async fn handle_connection(stream: &TcpStream, timer: GlobalTimer) -> Result<()>
let channel = read_i32(&stream).await?; let channel = read_i32(&stream).await?;
let overrd = read_i8(&stream).await?; let overrd = read_i8(&stream).await?;
let value = read_i8(&stream).await?; let value = read_i8(&stream).await?;
inject(channel, overrd, value); dispatch!(timer, _aux_mutex, _routing_table, channel, inject, overrd, value);
debug!("INJECT channel {}, overrd {}, value {}", channel, overrd, value); debug!("INJECT channel {}, overrd {}, value {}", channel, overrd, value);
}, },
HostMessage::GetInjectionStatus => { HostMessage::GetInjectionStatus => {
let channel = read_i32(&stream).await?; let channel = read_i32(&stream).await?;
let overrd = read_i8(&stream).await?; let overrd = read_i8(&stream).await?;
let value = read_injection_status(channel, overrd); let value = dispatch!(timer, _aux_mutex, _routing_table, channel, read_injection_status, overrd);
write_i8(&stream, DeviceMessage::InjectionStatus.to_i8().unwrap()).await?; write_i8(&stream, DeviceMessage::InjectionStatus.to_i8().unwrap()).await?;
write_i32(&stream, channel).await?; write_i32(&stream, channel).await?;
write_i8(&stream, overrd).await?; write_i8(&stream, overrd).await?;
@ -151,17 +278,17 @@ async fn handle_connection(stream: &TcpStream, timer: GlobalTimer) -> Result<()>
}, },
_ = timeout_f => { _ = timeout_f => {
for (&(channel, probe), previous) in probe_watch_list.iter_mut() { for (&(channel, probe), previous) in probe_watch_list.iter_mut() {
let current = read_probe(channel, probe); let current = dispatch!(timer, _aux_mutex, _routing_table, channel, read_probe, probe);
if previous.is_none() || previous.unwrap() != current { if previous.is_none() || previous.unwrap() != current {
write_i8(&stream, DeviceMessage::MonitorStatus.to_i8().unwrap()).await?; write_i8(&stream, DeviceMessage::MonitorStatus.to_i8().unwrap()).await?;
write_i32(&stream, channel).await?; write_i32(&stream, channel).await?;
write_i8(&stream, probe).await?; write_i8(&stream, probe).await?;
write_i32(&stream, current).await?; write_i64(&stream, current).await?;
*previous = Some(current); *previous = Some(current);
} }
} }
for (&(channel, overrd), previous) in inject_watch_list.iter_mut() { for (&(channel, overrd), previous) in inject_watch_list.iter_mut() {
let current = read_injection_status(channel, overrd); let current = dispatch!(timer, _aux_mutex, _routing_table, channel, read_injection_status, overrd);
if previous.is_none() || previous.unwrap() != current { if previous.is_none() || previous.unwrap() != current {
write_i8(&stream, DeviceMessage::InjectionStatus.to_i8().unwrap()).await?; write_i8(&stream, DeviceMessage::InjectionStatus.to_i8().unwrap()).await?;
write_i32(&stream, channel).await?; write_i32(&stream, channel).await?;
@ -170,21 +297,30 @@ async fn handle_connection(stream: &TcpStream, timer: GlobalTimer) -> Result<()>
*previous = Some(current); *previous = Some(current);
} }
} }
next_check = next_check + Milliseconds(200); next_check = timer.get_time() + Milliseconds(200);
} }
} }
} }
} }
pub fn start(timer: GlobalTimer) { pub fn start(
timer: GlobalTimer,
aux_mutex: &Rc<Mutex<bool>>,
routing_table: &Rc<RefCell<drtio_routing::RoutingTable>>,
) {
let aux_mutex = aux_mutex.clone();
let routing_table = routing_table.clone();
task::spawn(async move { task::spawn(async move {
loop { loop {
let aux_mutex = aux_mutex.clone();
let routing_table = routing_table.clone();
let stream = TcpStream::accept(1383, 2048, 2048).await.unwrap(); let stream = TcpStream::accept(1383, 2048, 2048).await.unwrap();
task::spawn(async move { task::spawn(async move {
info!("received connection"); info!("received connection");
let result = handle_connection(&stream, timer).await; let routing_table = routing_table.borrow();
let result = handle_connection(&stream, timer, &aux_mutex, &routing_table).await;
match result { match result {
Err(Error::NetworkError(smoltcp::Error::Illegal)) => info!("peer closed connection"), Err(Error::NetworkError(smoltcp::Error::Finished)) => info!("peer closed connection"),
Err(error) => warn!("connection terminated: {}", error), Err(error) => warn!("connection terminated: {}", error),
_ => (), _ => (),
} }

View File

@ -1,22 +1,22 @@
use libboard_zynq::{print, println}; #[cfg(feature = "target_kasli_soc")]
use libregister::RegisterR; use libboard_zynq::error_led::ErrorLED;
use libboard_zynq::{print, println, timer::GlobalTimer};
use libconfig::Config;
use libcortex_a9::regs::MPIDR; use libcortex_a9::regs::MPIDR;
use libregister::RegisterR;
use log::error;
use unwind::backtrace; use unwind::backtrace;
use crate::comms::soft_panic_main;
static mut PANICKED: [bool; 2] = [false; 2]; static mut PANICKED: [bool; 2] = [false; 2];
static mut SOFT_PANICKED: bool = false;
#[panic_handler] #[panic_handler]
fn panic(info: &core::panic::PanicInfo) -> ! { fn panic(info: &core::panic::PanicInfo) -> ! {
let id = MPIDR.read().cpu_id() as usize; let id = MPIDR.read().cpu_id() as usize;
print!("Core {} ", id); let soft_panicked = unsafe { SOFT_PANICKED };
unsafe { print!("Core {} panic at ", id);
if PANICKED[id] {
println!("nested panic!");
loop {}
}
PANICKED[id] = true;
}
print!("panic at ");
if let Some(location) = info.location() { if let Some(location) = info.location() {
print!("{}:{}:{}", location.file(), location.line(), location.column()); print!("{}:{}:{}", location.file(), location.line(), location.column());
} else { } else {
@ -27,6 +27,20 @@ fn panic(info: &core::panic::PanicInfo) -> ! {
} else { } else {
println!(""); println!("");
} }
unsafe {
// soft panics only allowed for core 0
if PANICKED[id] && (SOFT_PANICKED || id == 1) {
println!("nested panic!");
loop {}
}
SOFT_PANICKED = true;
PANICKED[id] = true;
}
#[cfg(feature = "target_kasli_soc")]
{
let mut err_led = ErrorLED::error_led();
err_led.toggle(true);
}
println!("Backtrace: "); println!("Backtrace: ");
let _ = backtrace(|ip| { let _ = backtrace(|ip| {
// Backtrace gives us the return address, i.e. the address after the delay slot, // Backtrace gives us the return address, i.e. the address after the delay slot,
@ -34,6 +48,26 @@ fn panic(info: &core::panic::PanicInfo) -> ! {
print!("{:#08x} ", ip - 2 * 4); print!("{:#08x} ", ip - 2 * 4);
}); });
println!("\nEnd backtrace"); println!("\nEnd backtrace");
if !soft_panicked && id == 0 {
soft_panic(info);
}
loop {} loop {}
} }
fn soft_panic(info: &core::panic::PanicInfo) -> ! {
// write panic info to log, so coremgmt can also read it
if let Some(location) = info.location() {
error!("panic at {}:{}:{}", location.file(), location.line(), location.column());
} else {
error!("panic at unknown location");
}
if let Some(message) = info.message() {
error!("panic message: {}", message);
}
let timer = GlobalTimer::start();
let cfg = match Config::new() {
Ok(cfg) => cfg,
Err(_) => Config::new_dummy(),
};
soft_panic_main(timer, cfg);
}

View File

@ -1,8 +1,7 @@
use core::cmp::min; use core::{cell::RefCell, cmp::min};
use core::cell::RefCell;
use libboard_zynq::smoltcp;
use libasync::smoltcp::TcpStream; use libasync::smoltcp::TcpStream;
use libboard_zynq::smoltcp;
type Result<T> = core::result::Result<T, smoltcp::Error>; type Result<T> = core::result::Result<T, smoltcp::Error>;
@ -14,7 +13,8 @@ enum RecvState<T> {
pub async fn expect(stream: &TcpStream, pattern: &[u8]) -> Result<bool> { pub async fn expect(stream: &TcpStream, pattern: &[u8]) -> Result<bool> {
let mut state = RecvState::NeedsMore(0, true); let mut state = RecvState::NeedsMore(0, true);
loop { loop {
state = stream.recv(|buf| { state = stream
.recv(|buf| {
let mut consumed = 0; let mut consumed = 0;
if let RecvState::NeedsMore(mut cur_index, _) = state { if let RecvState::NeedsMore(mut cur_index, _) = state {
for b in buf.iter() { for b in buf.iter() {
@ -32,7 +32,8 @@ pub async fn expect(stream: &TcpStream, pattern: &[u8]) -> Result<bool> {
} else { } else {
unreachable!(); unreachable!();
} }
}).await?; })
.await?;
if let RecvState::Completed(result) = state { if let RecvState::Completed(result) = state {
return Ok(result); return Ok(result);
} }
@ -40,15 +41,11 @@ pub async fn expect(stream: &TcpStream, pattern: &[u8]) -> Result<bool> {
} }
pub async fn read_bool(stream: &TcpStream) -> Result<bool> { pub async fn read_bool(stream: &TcpStream) -> Result<bool> {
Ok(stream.recv(|buf| { Ok(stream.recv(|buf| (1, buf[0] != 0)).await?)
(1, buf[0] != 0)
}).await?)
} }
pub async fn read_i8(stream: &TcpStream) -> Result<i8> { pub async fn read_i8(stream: &TcpStream) -> Result<i8> {
Ok(stream.recv(|buf| { Ok(stream.recv(|buf| (1, buf[0] as i8)).await?)
(1, buf[0] as i8)
}).await?)
} }
pub async fn read_i32(stream: &TcpStream) -> Result<i32> { pub async fn read_i32(stream: &TcpStream) -> Result<i32> {
@ -68,12 +65,14 @@ pub async fn read_chunk(stream: &TcpStream, destination: &mut [u8]) -> Result<()
let destination = RefCell::new(destination); let destination = RefCell::new(destination);
let mut done = 0; let mut done = 0;
while done < total { while done < total {
let count = stream.recv(|buf| { let count = stream
.recv(|buf| {
let mut destination = destination.borrow_mut(); let mut destination = destination.borrow_mut();
let count = min(total - done, buf.len()); let count = min(total - done, buf.len());
destination[done..done + count].copy_from_slice(&buf[..count]); destination[done..done + count].copy_from_slice(&buf[..count]);
(count, count) (count, count)
}).await?; })
.await?;
done += count; done += count;
} }
Ok(()) Ok(())

View File

@ -1,555 +0,0 @@
use core::str;
use core::future::Future;
use cslice::{CSlice, CMutSlice};
use log::trace;
use byteorder::{NativeEndian, ByteOrder};
use core_io::{Write, Error};
use libboard_zynq::smoltcp;
use libasync::smoltcp::TcpStream;
use alloc::boxed::Box;
use async_recursion::async_recursion;
use crate::proto_core_io::ProtoWrite;
use crate::proto_async;
use self::tag::{Tag, TagIterator, split_tag};
unsafe fn align_ptr<T>(ptr: *const ()) -> *const T {
let alignment = core::mem::align_of::<T>() as isize;
let fix = (alignment - (ptr as isize) % alignment) % alignment;
((ptr as isize) + fix) as *const T
}
unsafe fn align_ptr_mut<T>(ptr: *mut ()) -> *mut T {
let alignment = core::mem::align_of::<T>() as isize;
let fix = (alignment - (ptr as isize) % alignment) % alignment;
((ptr as isize) + fix) as *mut T
}
#[async_recursion(?Send)]
async unsafe fn recv_value<F>(stream: &TcpStream, tag: Tag<'async_recursion>, data: &mut *mut (),
alloc: &(impl Fn(usize) -> F + 'async_recursion))
-> Result<(), smoltcp::Error>
where F: Future<Output=*mut ()>
{
macro_rules! consume_value {
($ty:ty, |$ptr:ident| $map:expr) => ({
let $ptr = align_ptr_mut::<$ty>(*data);
*data = $ptr.offset(1) as *mut ();
$map
})
}
match tag {
Tag::None => Ok(()),
Tag::Bool =>
consume_value!(i8, |ptr| {
*ptr = proto_async::read_i8(stream).await?;
Ok(())
}),
Tag::Int32 =>
consume_value!(i32, |ptr| {
*ptr = proto_async::read_i32(stream).await?;
Ok(())
}),
Tag::Int64 | Tag::Float64 =>
consume_value!(i64, |ptr| {
*ptr = proto_async::read_i64(stream).await?;
Ok(())
}),
Tag::String | Tag::Bytes | Tag::ByteArray => {
consume_value!(CMutSlice<u8>, |ptr| {
let length = proto_async::read_i32(stream).await? as usize;
*ptr = CMutSlice::new(alloc(length).await as *mut u8, length);
proto_async::read_chunk(stream, (*ptr).as_mut()).await?;
Ok(())
})
}
Tag::Tuple(it, arity) => {
let mut it = it.clone();
for _ in 0..arity {
let tag = it.next().expect("truncated tag");
recv_value(stream, tag, data, alloc).await?;
}
Ok(())
}
Tag::List(it) => {
#[repr(C)]
struct List { elements: *mut (), length: u32 }
consume_value!(List, |ptr| {
let length = proto_async::read_i32(stream).await? as usize;
(*ptr).length = length as u32;
let tag = it.clone().next().expect("truncated tag");
let mut data = alloc(tag.size() * length as usize).await;
(*ptr).elements = data;
match tag {
Tag::Bool => {
let ptr = align_ptr_mut::<u8>(data);
let dest = core::slice::from_raw_parts_mut(ptr, length);
proto_async::read_chunk(stream, dest).await?;
},
Tag::Int32 => {
let ptr = align_ptr_mut::<u32>(data);
// reading as raw bytes and do endianness conversion later
let dest = core::slice::from_raw_parts_mut(ptr as *mut u8, length * 4);
proto_async::read_chunk(stream, dest).await?;
drop(dest);
let dest = core::slice::from_raw_parts_mut(ptr, length);
NativeEndian::from_slice_u32(dest);
},
Tag::Int64 | Tag::Float64 => {
let ptr = align_ptr_mut::<u64>(data);
let dest = core::slice::from_raw_parts_mut(ptr as *mut u8, length * 8);
proto_async::read_chunk(stream, dest).await?;
drop(dest);
let dest = core::slice::from_raw_parts_mut(ptr, length);
NativeEndian::from_slice_u64(dest);
},
_ => {
for _ in 0..(*ptr).length as usize {
recv_value(stream, tag, &mut data, alloc).await?
}
}
}
Ok(())
})
}
Tag::Array(it, num_dims) => {
consume_value!(*mut (), |buffer| {
let mut total_len: u32 = 1;
for _ in 0..num_dims {
let len = proto_async::read_i32(stream).await? as u32;
total_len *= len;
consume_value!(u32, |ptr| *ptr = len )
}
let elt_tag = it.clone().next().expect("truncated tag");
*buffer = alloc(elt_tag.size() * total_len as usize).await;
let length = total_len as usize;
let mut data = *buffer;
match elt_tag {
Tag::Bool => {
let ptr = align_ptr_mut::<u8>(data);
let dest = core::slice::from_raw_parts_mut(ptr, length);
proto_async::read_chunk(stream, dest).await?;
},
Tag::Int32 => {
let ptr = align_ptr_mut::<u32>(data);
let dest = core::slice::from_raw_parts_mut(ptr as *mut u8, length * 4);
proto_async::read_chunk(stream, dest).await?;
drop(dest);
let dest = core::slice::from_raw_parts_mut(ptr, length);
NativeEndian::from_slice_u32(dest);
},
Tag::Int64 | Tag::Float64 => {
let ptr = align_ptr_mut::<u64>(data);
let dest = core::slice::from_raw_parts_mut(ptr as *mut u8, length * 8);
proto_async::read_chunk(stream, dest).await?;
drop(dest);
let dest = core::slice::from_raw_parts_mut(ptr, length);
NativeEndian::from_slice_u64(dest);
},
_ => {
for _ in 0..length {
recv_value(stream, elt_tag, &mut data, alloc).await?
}
}
}
Ok(())
})
}
Tag::Range(it) => {
let tag = it.clone().next().expect("truncated tag");
recv_value(stream, tag, data, alloc).await?;
recv_value(stream, tag, data, alloc).await?;
recv_value(stream, tag, data, alloc).await?;
Ok(())
}
Tag::Keyword(_) => unreachable!(),
Tag::Object => unreachable!()
}
}
pub async fn recv_return<F>(stream: &TcpStream, tag_bytes: &[u8], data: *mut (),
alloc: &impl Fn(usize) -> F)
-> Result<(), smoltcp::Error>
where F: Future<Output=*mut ()>
{
let mut it = TagIterator::new(tag_bytes);
trace!("recv ...->{}", it);
let tag = it.next().expect("truncated tag");
let mut data = data;
unsafe { recv_value(stream, tag, &mut data, alloc).await? };
Ok(())
}
unsafe fn send_value<W>(writer: &mut W, tag: Tag, data: &mut *const ())
-> Result<(), Error>
where W: Write + ?Sized
{
macro_rules! consume_value {
($ty:ty, |$ptr:ident| $map:expr) => ({
let $ptr = align_ptr::<$ty>(*data);
*data = $ptr.offset(1) as *const ();
$map
})
}
writer.write_u8(tag.as_u8())?;
match tag {
Tag::None => Ok(()),
Tag::Bool =>
consume_value!(u8, |ptr|
writer.write_u8(*ptr)),
Tag::Int32 =>
consume_value!(u32, |ptr|
writer.write_u32(*ptr)),
Tag::Int64 | Tag::Float64 =>
consume_value!(u64, |ptr|
writer.write_u64(*ptr)),
Tag::String =>
consume_value!(CSlice<u8>, |ptr|
writer.write_string(str::from_utf8((*ptr).as_ref()).unwrap())),
Tag::Bytes | Tag::ByteArray =>
consume_value!(CSlice<u8>, |ptr|
writer.write_bytes((*ptr).as_ref())),
Tag::Tuple(it, arity) => {
let mut it = it.clone();
writer.write_u8(arity)?;
for _ in 0..arity {
let tag = it.next().expect("truncated tag");
send_value(writer, tag, data)?
}
Ok(())
}
Tag::List(it) => {
#[repr(C)]
struct List { elements: *const (), length: u32 }
consume_value!(List, |ptr| {
let length = (*ptr).length as isize;
writer.write_u32((*ptr).length)?;
let tag = it.clone().next().expect("truncated tag");
let mut data = (*ptr).elements;
writer.write_u8(tag.as_u8())?;
match tag {
Tag::Bool => {
// we can pretend this is u8...
let ptr1 = align_ptr::<u8>(data);
let slice = core::slice::from_raw_parts(ptr1, length as usize);
writer.write_all(slice)?;
},
Tag::Int32 => {
let ptr1 = align_ptr::<i32>(data);
let slice = core::slice::from_raw_parts(ptr1 as *const u8, length as usize * 4);
writer.write_all(slice)?;
},
Tag::Int64 | Tag::Float64 => {
let ptr1 = align_ptr::<i64>(data);
let slice = core::slice::from_raw_parts(ptr1 as *const u8, length as usize * 8);
writer.write_all(slice)?;
},
// non-primitive types, not sure if this would happen but we can handle it...
_ => {
for _ in 0..length {
send_value(writer, tag, &mut data)?;
}
}
};
Ok(())
})
}
Tag::Array(it, num_dims) => {
writer.write_u8(num_dims)?;
consume_value!(*const(), |buffer| {
let elt_tag = it.clone().next().expect("truncated tag");
let mut total_len = 1;
for _ in 0..num_dims {
consume_value!(u32, |len| {
writer.write_u32(*len)?;
total_len *= *len;
})
}
let mut data = *buffer;
let length = total_len as isize;
writer.write_u8(elt_tag.as_u8())?;
match elt_tag {
Tag::Bool => {
let ptr1 = align_ptr::<u8>(data);
let slice = core::slice::from_raw_parts(ptr1, length as usize);
writer.write_all(slice)?;
},
Tag::Int32 => {
let ptr1 = align_ptr::<i32>(data);
let slice = core::slice::from_raw_parts(ptr1 as *const u8, length as usize * 4);
writer.write_all(slice)?;
},
Tag::Int64 | Tag::Float64 => {
let ptr1 = align_ptr::<i64>(data);
let slice = core::slice::from_raw_parts(ptr1 as *const u8, length as usize * 8);
writer.write_all(slice)?;
},
// non-primitive types, not sure if this would happen but we can handle it...
_ => {
for _ in 0..length {
send_value(writer, elt_tag, &mut data)?;
}
}
};
Ok(())
})
}
Tag::Range(it) => {
let tag = it.clone().next().expect("truncated tag");
send_value(writer, tag, data)?;
send_value(writer, tag, data)?;
send_value(writer, tag, data)?;
Ok(())
}
Tag::Keyword(it) => {
#[repr(C)]
struct Keyword<'a> { name: CSlice<'a, u8> }
consume_value!(Keyword, |ptr| {
writer.write_string(str::from_utf8((*ptr).name.as_ref()).unwrap())?;
let tag = it.clone().next().expect("truncated tag");
let mut data = ptr.offset(1) as *const ();
send_value(writer, tag, &mut data)
})
// Tag::Keyword never appears in composite types, so we don't have
// to accurately advance data.
}
Tag::Object => {
#[repr(C)]
struct Object { id: u32 }
consume_value!(*const Object, |ptr|
writer.write_u32((**ptr).id))
}
}
}
pub fn send_args<W>(writer: &mut W, service: u32, tag_bytes: &[u8], data: *const *const ())
-> Result<(), Error>
where W: Write + ?Sized
{
let (arg_tags_bytes, return_tag_bytes) = split_tag(tag_bytes);
let mut args_it = TagIterator::new(arg_tags_bytes);
let return_it = TagIterator::new(return_tag_bytes);
trace!("send<{}>({})->{}", service, args_it, return_it);
writer.write_u32(service)?;
for index in 0.. {
if let Some(arg_tag) = args_it.next() {
let mut data = unsafe { *data.offset(index) };
unsafe { send_value(writer, arg_tag, &mut data)? };
} else {
break
}
}
writer.write_u8(0)?;
writer.write_bytes(return_tag_bytes)?;
Ok(())
}
mod tag {
use core::fmt;
pub fn split_tag(tag_bytes: &[u8]) -> (&[u8], &[u8]) {
let tag_separator =
tag_bytes.iter()
.position(|&b| b == b':')
.expect("tag without a return separator");
let (arg_tags_bytes, rest) = tag_bytes.split_at(tag_separator);
let return_tag_bytes = &rest[1..];
(arg_tags_bytes, return_tag_bytes)
}
#[derive(Debug, Clone, Copy)]
pub enum Tag<'a> {
None,
Bool,
Int32,
Int64,
Float64,
String,
Bytes,
ByteArray,
Tuple(TagIterator<'a>, u8),
List(TagIterator<'a>),
Array(TagIterator<'a>, u8),
Range(TagIterator<'a>),
Keyword(TagIterator<'a>),
Object
}
impl<'a> Tag<'a> {
pub fn as_u8(self) -> u8 {
match self {
Tag::None => b'n',
Tag::Bool => b'b',
Tag::Int32 => b'i',
Tag::Int64 => b'I',
Tag::Float64 => b'f',
Tag::String => b's',
Tag::Bytes => b'B',
Tag::ByteArray => b'A',
Tag::Tuple(_, _) => b't',
Tag::List(_) => b'l',
Tag::Array(_, _) => b'a',
Tag::Range(_) => b'r',
Tag::Keyword(_) => b'k',
Tag::Object => b'O',
}
}
pub fn size(self) -> usize {
match self {
Tag::None => 0,
Tag::Bool => 1,
Tag::Int32 => 4,
Tag::Int64 => 8,
Tag::Float64 => 8,
Tag::String => 8,
Tag::Bytes => 8,
Tag::ByteArray => 8,
Tag::Tuple(it, arity) => {
let mut size = 0;
let mut it = it.clone();
for _ in 0..arity {
let tag = it.next().expect("truncated tag");
size += tag.size();
}
size
}
Tag::List(_) => 8,
Tag::Array(_, num_dims) => 4 * (1 + num_dims as usize),
Tag::Range(it) => {
let tag = it.clone().next().expect("truncated tag");
tag.size() * 3
}
Tag::Keyword(_) => unreachable!(),
Tag::Object => unreachable!(),
}
}
}
#[derive(Debug, Clone, Copy)]
pub struct TagIterator<'a> {
data: &'a [u8]
}
impl<'a> TagIterator<'a> {
pub fn new(data: &'a [u8]) -> TagIterator<'a> {
TagIterator { data: data }
}
pub fn next(&mut self) -> Option<Tag<'a>> {
if self.data.len() == 0 {
return None
}
let tag_byte = self.data[0];
self.data = &self.data[1..];
Some(match tag_byte {
b'n' => Tag::None,
b'b' => Tag::Bool,
b'i' => Tag::Int32,
b'I' => Tag::Int64,
b'f' => Tag::Float64,
b's' => Tag::String,
b'B' => Tag::Bytes,
b'A' => Tag::ByteArray,
b't' => {
let count = self.data[0];
self.data = &self.data[1..];
Tag::Tuple(self.sub(count), count)
}
b'l' => Tag::List(self.sub(1)),
b'a' => {
let count = self.data[0];
self.data = &self.data[1..];
Tag::Array(self.sub(1), count)
}
b'r' => Tag::Range(self.sub(1)),
b'k' => Tag::Keyword(self.sub(1)),
b'O' => Tag::Object,
_ => unreachable!()
})
}
fn sub(&mut self, count: u8) -> TagIterator<'a> {
let data = self.data;
for _ in 0..count {
self.next().expect("truncated tag");
}
TagIterator { data: &data[..(data.len() - self.data.len())] }
}
}
impl<'a> fmt::Display for TagIterator<'a> {
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
let mut it = self.clone();
let mut first = true;
while let Some(tag) = it.next() {
if first {
first = false
} else {
write!(f, ", ")?
}
match tag {
Tag::None =>
write!(f, "None")?,
Tag::Bool =>
write!(f, "Bool")?,
Tag::Int32 =>
write!(f, "Int32")?,
Tag::Int64 =>
write!(f, "Int64")?,
Tag::Float64 =>
write!(f, "Float64")?,
Tag::String =>
write!(f, "String")?,
Tag::Bytes =>
write!(f, "Bytes")?,
Tag::ByteArray =>
write!(f, "ByteArray")?,
Tag::Tuple(it, _) => {
write!(f, "Tuple(")?;
it.fmt(f)?;
write!(f, ")")?;
}
Tag::List(it) => {
write!(f, "List(")?;
it.fmt(f)?;
write!(f, ")")?;
}
Tag::Array(it, num_dims) => {
write!(f, "Array(")?;
it.fmt(f)?;
write!(f, ", {})", num_dims)?;
}
Tag::Range(it) => {
write!(f, "Range(")?;
it.fmt(f)?;
write!(f, ")")?;
}
Tag::Keyword(it) => {
write!(f, "Keyword(")?;
it.fmt(f)?;
write!(f, ")")?;
}
Tag::Object =>
write!(f, "Object")?,
}
}
Ok(())
}
}
}

Some files were not shown because too many files have changed in this diff Show More