forked from M-Labs/zynq-rs
Compare commits
265 Commits
Author | SHA1 | Date |
---|---|---|
Sebastien Bourdeauducq | 731684abb4 | |
Florian Agbuya | 195a21fe78 | |
Florian Agbuya | 96cefe6f06 | |
morgan | 7c58c0cf43 | |
morgan | 9005b73316 | |
morgan | b1994dbe16 | |
morgan | 5bd336c961 | |
morgan | 298f64a2f9 | |
morgan | 4168eb63a7 | |
Sebastien Bourdeauducq | a43b8bf64e | |
Sebastien Bourdeauducq | 91bae572f9 | |
Sebastien Bourdeauducq | 301f9236e5 | |
Sebastien Bourdeauducq | 55b36ee37e | |
morgan | 24c804e6f0 | |
Sebastien Bourdeauducq | be672ab662 | |
mwojcik | 0106430805 | |
jmatyas | c15b54f92b | |
Sebastien Bourdeauducq | de42a5d1b2 | |
Sebastien Bourdeauducq | ff03bf92a3 | |
Sebastien Bourdeauducq | f20c008264 | |
Sebastien Bourdeauducq | 67dbb5932f | |
Sebastien Bourdeauducq | dab5c6f070 | |
Egor Savkin | 0a3a777652 | |
mwojcik | 92b3f3e1dd | |
mwojcik | f586ba5a13 | |
mwojcik | 42cc256812 | |
occheung | 043a152b91 | |
Sebastien Bourdeauducq | 6cd32f6ee0 | |
mwojcik | 605c8f73a6 | |
mwojcik | 56c27e98e4 | |
mwojcik | f496da4f3e | |
mwojcik | 1c8e2c318c | |
mwojcik | 67880b4e0b | |
Sebastien Bourdeauducq | e96222ff6f | |
mwojcik | dc1ca3d3d0 | |
mwojcik | c4c52c33b4 | |
mwojcik | 072fd5f015 | |
mwojcik | 2b3c7e4b2f | |
mwojcik | 84d6d391ce | |
mwojcik | 43e0440911 | |
mwojcik | 3e95df1f64 | |
mwojcik | 26ab2927b9 | |
mwojcik | dacc816eb4 | |
mwojcik | fbc783d7ad | |
mwojcik | 14b0247716 | |
mwojcik | bc41b91192 | |
mwojcik | 3efc682bd6 | |
mwojcik | e5e646f40e | |
Sebastien Bourdeauducq | 2e7cfe04c8 | |
mwojcik | 24e0d724f2 | |
Sebastien Bourdeauducq | 823e909281 | |
Sebastien Bourdeauducq | 57d8d8fbc7 | |
Sebastien Bourdeauducq | a4902966d1 | |
Sebastien Bourdeauducq | 2c161720fa | |
topquark12 | a42e5a95ff | |
Sebastien Bourdeauducq | 03122f810a | |
Sebastien Bourdeauducq | c7e9f85de2 | |
Sebastien Bourdeauducq | 104d1ef232 | |
Sebastien Bourdeauducq | b0ec74d764 | |
Sebastien Bourdeauducq | 4159aab6c8 | |
Sebastien Bourdeauducq | d18c77c0eb | |
Sebastien Bourdeauducq | 8dbe2cf9f3 | |
Sebastien Bourdeauducq | 040d41fd76 | |
Sebastien Bourdeauducq | 9180918619 | |
Sebastien Bourdeauducq | 8ec7216e9a | |
Sebastien Bourdeauducq | 0e9d3f146a | |
Sebastien Bourdeauducq | 411eebd96c | |
sb10q | e31adb722d | |
Sebastien Bourdeauducq | 759bf95a76 | |
Sebastien Bourdeauducq | f83ef218de | |
Sebastien Bourdeauducq | 062b894a4b | |
Sebastien Bourdeauducq | 2f9019ca0f | |
Sebastien Bourdeauducq | 7b29ab2628 | |
Sebastien Bourdeauducq | a9697ec8d8 | |
Sebastien Bourdeauducq | 0220cf19eb | |
Sebastien Bourdeauducq | a11cb852a8 | |
Sebastien Bourdeauducq | 42cdedae91 | |
Sebastien Bourdeauducq | 823ec374ba | |
Sebastien Bourdeauducq | 666c077cef | |
Sebastien Bourdeauducq | def17829d9 | |
Astro | ba252e72da | |
Astro | a2416f26a0 | |
Astro | bf9f1e33c8 | |
Astro | 481a0eb25f | |
Astro | 05c30dd52e | |
Astro | f816a04cef | |
Astro | faa64c2ce8 | |
Astro | 89e4d61dc0 | |
Astro | 0b07e9fefc | |
Astro | ccf758cc85 | |
pca006132 | 78d58d17ec | |
pca006132 | 06c646e61f | |
pca006132 | 7681745282 | |
pca006132 | 6e6612bc3e | |
pca006132 | b50540915d | |
pca006132 | 4aa252546f | |
pca006132 | b42869e655 | |
pca006132 | d62c77e6e0 | |
pca006132 | 4555afa624 | |
pca006132 | 5923a66512 | |
pca006132 | 2c6cc58c07 | |
Astro | b4d91e7904 | |
Astro | 4c79c797d5 | |
Astro | 966e43e14e | |
Astro | 8432ff3e30 | |
Astro | 1cd4056370 | |
Astro | ddff295ae1 | |
Astro | 379b6b973a | |
Astro | 178ab38e35 | |
Astro | 3172aba1a8 | |
Astro | a62ca507d0 | |
Astro | 975202a653 | |
Astro | d76a77b443 | |
Astro | 500472b2a8 | |
Astro | 02217f27d1 | |
Astro | a3eabf1947 | |
Astro | a32d7abb9a | |
Sebastien Bourdeauducq | 0e8354faa1 | |
Sebastien Bourdeauducq | 07f161d9d8 | |
Sebastien Bourdeauducq | ef160aa841 | |
Astro | cb50c8d61b | |
Astro | 7bbd16f143 | |
Astro | 0714162113 | |
Astro | 5b2c779cba | |
Astro | 0a40d4f36d | |
Astro | 55f8d02da8 | |
Astro | 990fa56d6a | |
Astro | 8fd317d580 | |
Astro | 07fedddad9 | |
Astro | 0fde82a982 | |
Astro | dffe3cb251 | |
Astro | b9323653bb | |
Astro | 515d3bb381 | |
Astro | 7e22010d7d | |
Astro | 9ee77d8f44 | |
Astro | e508b78b3e | |
Astro | aef010cb14 | |
pca006132 | d623913535 | |
pca006132 | 0efc7a616f | |
pca006132 | 22833ef0c6 | |
Sebastien Bourdeauducq | 80d12d5780 | |
Sebastien Bourdeauducq | 4dd8c93729 | |
Sebastien Bourdeauducq | 6266d28095 | |
Sebastien Bourdeauducq | 1796d4e236 | |
Sebastien Bourdeauducq | 56c94b0855 | |
Sebastien Bourdeauducq | 34a63d7732 | |
Sebastien Bourdeauducq | 27d310a937 | |
pca006132 | f60d0589cc | |
Sebastien Bourdeauducq | 7c9edfdbd5 | |
pca006132 | c336e450b1 | |
pca006132 | 6af453494b | |
Sebastien Bourdeauducq | ac3e6983b0 | |
Sebastien Bourdeauducq | 338f918531 | |
Sebastien Bourdeauducq | 4751fd6011 | |
Sebastien Bourdeauducq | e601ac9c45 | |
Sebastien Bourdeauducq | a6955edf14 | |
Sebastien Bourdeauducq | c634313d5e | |
Sebastien Bourdeauducq | 7360984efb | |
Sebastien Bourdeauducq | 82794d3abd | |
Sebastien Bourdeauducq | 450ccef18e | |
Sebastien Bourdeauducq | 4e18368aaf | |
Sebastien Bourdeauducq | 75494421c5 | |
Sebastien Bourdeauducq | c4fb7b4c41 | |
Sebastien Bourdeauducq | a51f8f2eea | |
Sebastien Bourdeauducq | 7680de26f0 | |
Sebastien Bourdeauducq | 7edd192c3b | |
pca006132 | 4fef8a7192 | |
pca006132 | ae244082ed | |
Sebastien Bourdeauducq | 66c66447dd | |
pca006132 | 02c67051e8 | |
pca006132 | 08fd1391c5 | |
pca006132 | a116142f63 | |
pca006132 | 157439bc88 | |
pca006132 | a73df780d0 | |
pca006132 | e73ec731aa | |
pca006132 | 73e4e4fd03 | |
Sebastien Bourdeauducq | 273f9ea72b | |
pca006132 | 671968bac3 | |
pca006132 | 39f672dde8 | |
pca006132 | c13ca614ef | |
pca006132 | bb09d25378 | |
pca006132 | a1f859637a | |
pca006132 | 7cb2669c3b | |
pca006132 | 511c906d4d | |
pca006132 | 1ba0aa450f | |
pca006132 | 283bc9b810 | |
Astro | b268fe015a | |
Astro | 64db9b0142 | |
Astro | 4b258c19f5 | |
Harry Ho | 1a96a7550a | |
Harry Ho | 36947104e3 | |
Harry Ho | 11089d8a64 | |
harry | c69cd9951e | |
Harry Ho | 76a4cac873 | |
Harry Ho | 4614ed1371 | |
pca006132 | fa07bdb681 | |
Harry Ho | 4565a75766 | |
Harry Ho | 16b2df91ca | |
Harry Ho | f7d3135ec7 | |
Harry Ho | c60230af25 | |
pca006132 | e8ba73a8c7 | |
pca006132 | 3958953ceb | |
Sebastien Bourdeauducq | a36a82d86d | |
pca006132 | 25c6d5eeaa | |
pca006132 | 9e97102e12 | |
pca006132 | b65606f2d0 | |
pca006132 | ee4089c52e | |
pca006132 | 36c3fbdacd | |
pca006132 | 8328ffc66b | |
pca006132 | 84041a3154 | |
pca006132 | 5850401d72 | |
pca006132 | ccce37dffd | |
pca006132 | 3bbd1513fb | |
pca006132 | 7d38c53c18 | |
pca006132 | 02a2c4d1e3 | |
pca006132 | 12669124a4 | |
pca006132 | 8f0a6bd5ea | |
pca006132 | c1f61b5673 | |
pca006132 | 2927c43309 | |
Astro | 187801c4a7 | |
pca006132 | 91ece367f2 | |
Astro | 1f05e6977e | |
Astro | e408a8b22d | |
Astro | 27effb6257 | |
Astro | de5f605d60 | |
pca006132 | ad47521e4b | |
pca006132 | c50e72f91e | |
pca006132 | b099c56569 | |
Astro | ef4fb598fb | |
Astro | 0aa75d3544 | |
Astro | f36b1a610e | |
Astro | 7f45d10af3 | |
Astro | 855d94c48e | |
Sebastien Bourdeauducq | 84f1380f48 | |
Sebastien Bourdeauducq | f8785c3f07 | |
Sebastien Bourdeauducq | 7b78bc0494 | |
Sebastien Bourdeauducq | ef88a1313a | |
Astro | 484e385160 | |
pca006132 | 074438c3c7 | |
Astro | 191abf6b8f | |
Sebastien Bourdeauducq | 371e59cef5 | |
pca006132 | e67efe439b | |
Astro | e4e7141bf3 | |
Sebastien Bourdeauducq | f68b5896ce | |
Sebastien Bourdeauducq | e430600683 | |
Sebastien Bourdeauducq | 0c60d684e4 | |
Sebastien Bourdeauducq | 6fa3a6bbd9 | |
Sebastien Bourdeauducq | 7082e07a18 | |
Sebastien Bourdeauducq | 21c0c5cbc8 | |
pca006132 | 90904634cd | |
Sebastien Bourdeauducq | ae4d3e2455 | |
Sebastien Bourdeauducq | 9fcf9243f2 | |
pca006132 | 90e33f688a | |
Astro | f0697c3ec3 | |
Astro | b2c707d543 | |
pca006132 | 6195ad40c3 | |
Sebastien Bourdeauducq | dd288912af | |
Astro | ec252b099c | |
Astro | a16c639eaf | |
Astro | c6fa18344e | |
Astro | 5c69bbdad6 | |
Astro | c0e66a632c | |
Astro | b129d3e0df | |
Astro | 1e4be13869 | |
Astro | eea042e2ee |
|
@ -1,5 +1,4 @@
|
|||
[target.armv7-none-eabihf]
|
||||
runner = "./runner.sh"
|
||||
rustflags = [
|
||||
"-C", "link-arg=-Tlink.x",
|
||||
"-C", "target-feature=a9,armv7-a,neon",
|
||||
|
|
|
@ -1 +1,2 @@
|
|||
/target
|
||||
result*
|
||||
|
|
|
@ -2,181 +2,257 @@
|
|||
# It is not intended for manual editing.
|
||||
[[package]]
|
||||
name = "bit_field"
|
||||
version = "0.10.0"
|
||||
version = "0.10.1"
|
||||
source = "registry+https://github.com/rust-lang/crates.io-index"
|
||||
checksum = "dcb6dd1c2376d2e096796e234a70e17e94cc2d5d54ff8ce42b28cef1d0d359a4"
|
||||
|
||||
[[package]]
|
||||
name = "bitflags"
|
||||
version = "1.2.1"
|
||||
version = "1.3.2"
|
||||
source = "registry+https://github.com/rust-lang/crates.io-index"
|
||||
checksum = "bef38d45163c2f1dde094a7dfd33ccf595c92905c8f8f4fdc18d06fb1037718a"
|
||||
|
||||
[[package]]
|
||||
name = "byteorder"
|
||||
version = "1.3.4"
|
||||
version = "1.4.3"
|
||||
source = "registry+https://github.com/rust-lang/crates.io-index"
|
||||
checksum = "14c189c53d098945499cdfa7ecc63567cf3886b3332b312a5b4585d8d3a6a610"
|
||||
|
||||
[[package]]
|
||||
name = "cc"
|
||||
version = "1.0.73"
|
||||
source = "registry+https://github.com/rust-lang/crates.io-index"
|
||||
checksum = "2fff2a6927b3bb87f9595d67196a70493f627687a71d87a0d692242c33f58c11"
|
||||
|
||||
[[package]]
|
||||
name = "cfg-if"
|
||||
version = "0.1.10"
|
||||
version = "1.0.0"
|
||||
source = "registry+https://github.com/rust-lang/crates.io-index"
|
||||
checksum = "baf1de4339761588bc0619e3cbc0120ee582ebb74b53b4efbf79117bd2da40fd"
|
||||
|
||||
[[package]]
|
||||
name = "compiler_builtins"
|
||||
version = "0.1.27"
|
||||
version = "0.1.39"
|
||||
source = "registry+https://github.com/rust-lang/crates.io-index"
|
||||
checksum = "3748f82c7d366a0b4950257d19db685d4958d2fa27c6d164a3f069fec42b748b"
|
||||
|
||||
[[package]]
|
||||
name = "core_io"
|
||||
version = "0.1.20210325"
|
||||
source = "registry+https://github.com/rust-lang/crates.io-index"
|
||||
checksum = "97f8932064288cc79feb4d343a399d353a6f6f001e586ece47fe518a9e8507df"
|
||||
dependencies = [
|
||||
"rustc_version",
|
||||
]
|
||||
|
||||
[[package]]
|
||||
name = "embedded-hal"
|
||||
version = "0.2.3"
|
||||
version = "0.2.7"
|
||||
source = "registry+https://github.com/rust-lang/crates.io-index"
|
||||
checksum = "35949884794ad573cf46071e41c9b60efb0cb311e3ca01f7af807af1debc66ff"
|
||||
dependencies = [
|
||||
"nb 0.1.2 (registry+https://github.com/rust-lang/crates.io-index)",
|
||||
"void 1.0.2 (registry+https://github.com/rust-lang/crates.io-index)",
|
||||
"nb 0.1.3",
|
||||
"void",
|
||||
]
|
||||
|
||||
[[package]]
|
||||
name = "experiments"
|
||||
version = "0.0.0"
|
||||
dependencies = [
|
||||
"embedded-hal 0.2.3 (registry+https://github.com/rust-lang/crates.io-index)",
|
||||
"libasync 0.0.0",
|
||||
"libboard_zynq 0.0.0",
|
||||
"libcortex_a9 0.0.0",
|
||||
"libregister 0.0.0",
|
||||
"libsupport_zynq 0.0.0",
|
||||
"log 0.4.8 (registry+https://github.com/rust-lang/crates.io-index)",
|
||||
"embedded-hal",
|
||||
"libasync",
|
||||
"libboard_zynq",
|
||||
"libcortex_a9",
|
||||
"libregister",
|
||||
"libsupport_zynq",
|
||||
"log",
|
||||
]
|
||||
|
||||
[[package]]
|
||||
name = "fatfs"
|
||||
version = "0.3.5"
|
||||
source = "registry+https://github.com/rust-lang/crates.io-index"
|
||||
checksum = "e18f80a87439240dac45d927fd8f8081b6f1e34c03e97271189fa8a8c2e96c8f"
|
||||
dependencies = [
|
||||
"bitflags",
|
||||
"byteorder",
|
||||
"core_io",
|
||||
"log",
|
||||
]
|
||||
|
||||
[[package]]
|
||||
name = "libasync"
|
||||
version = "0.0.0"
|
||||
dependencies = [
|
||||
"embedded-hal 0.2.3 (registry+https://github.com/rust-lang/crates.io-index)",
|
||||
"libcortex_a9 0.0.0",
|
||||
"nb 0.1.2 (registry+https://github.com/rust-lang/crates.io-index)",
|
||||
"pin-utils 0.1.0 (registry+https://github.com/rust-lang/crates.io-index)",
|
||||
"smoltcp 0.6.0 (registry+https://github.com/rust-lang/crates.io-index)",
|
||||
"embedded-hal",
|
||||
"libcortex_a9",
|
||||
"nb 1.0.0",
|
||||
"pin-utils",
|
||||
"smoltcp",
|
||||
]
|
||||
|
||||
[[package]]
|
||||
name = "libboard_zynq"
|
||||
version = "0.0.0"
|
||||
dependencies = [
|
||||
"bit_field 0.10.0 (registry+https://github.com/rust-lang/crates.io-index)",
|
||||
"embedded-hal 0.2.3 (registry+https://github.com/rust-lang/crates.io-index)",
|
||||
"libcortex_a9 0.0.0",
|
||||
"libregister 0.0.0",
|
||||
"log 0.4.8 (registry+https://github.com/rust-lang/crates.io-index)",
|
||||
"nb 0.1.2 (registry+https://github.com/rust-lang/crates.io-index)",
|
||||
"smoltcp 0.6.0 (registry+https://github.com/rust-lang/crates.io-index)",
|
||||
"void 1.0.2 (registry+https://github.com/rust-lang/crates.io-index)",
|
||||
"volatile-register 0.2.0 (registry+https://github.com/rust-lang/crates.io-index)",
|
||||
"bit_field",
|
||||
"embedded-hal",
|
||||
"libasync",
|
||||
"libcortex_a9",
|
||||
"libregister",
|
||||
"log",
|
||||
"nb 0.1.3",
|
||||
"smoltcp",
|
||||
"void",
|
||||
"volatile-register",
|
||||
]
|
||||
|
||||
[[package]]
|
||||
name = "libconfig"
|
||||
version = "0.1.0"
|
||||
dependencies = [
|
||||
"core_io",
|
||||
"fatfs",
|
||||
"libboard_zynq",
|
||||
"log",
|
||||
]
|
||||
|
||||
[[package]]
|
||||
name = "libcortex_a9"
|
||||
version = "0.0.0"
|
||||
dependencies = [
|
||||
"bit_field 0.10.0 (registry+https://github.com/rust-lang/crates.io-index)",
|
||||
"libregister 0.0.0",
|
||||
"bit_field",
|
||||
"libregister",
|
||||
"volatile-register",
|
||||
]
|
||||
|
||||
[[package]]
|
||||
name = "libregister"
|
||||
version = "0.0.0"
|
||||
dependencies = [
|
||||
"bit_field 0.10.0 (registry+https://github.com/rust-lang/crates.io-index)",
|
||||
"vcell 0.1.2 (registry+https://github.com/rust-lang/crates.io-index)",
|
||||
"volatile-register 0.2.0 (registry+https://github.com/rust-lang/crates.io-index)",
|
||||
"bit_field",
|
||||
"vcell",
|
||||
"volatile-register",
|
||||
]
|
||||
|
||||
[[package]]
|
||||
name = "libsupport_zynq"
|
||||
version = "0.0.0"
|
||||
dependencies = [
|
||||
"compiler_builtins 0.1.27 (registry+https://github.com/rust-lang/crates.io-index)",
|
||||
"libboard_zynq 0.0.0",
|
||||
"libcortex_a9 0.0.0",
|
||||
"libregister 0.0.0",
|
||||
"linked_list_allocator 0.8.3 (registry+https://github.com/rust-lang/crates.io-index)",
|
||||
"r0 1.0.0 (registry+https://github.com/rust-lang/crates.io-index)",
|
||||
"cc",
|
||||
"compiler_builtins",
|
||||
"libboard_zynq",
|
||||
"libcortex_a9",
|
||||
"libregister",
|
||||
"linked_list_allocator",
|
||||
"r0",
|
||||
]
|
||||
|
||||
[[package]]
|
||||
name = "linked_list_allocator"
|
||||
version = "0.8.3"
|
||||
version = "0.8.11"
|
||||
source = "registry+https://github.com/rust-lang/crates.io-index"
|
||||
checksum = "822add9edb1860698b79522510da17bef885171f75aa395cff099d770c609c24"
|
||||
|
||||
[[package]]
|
||||
name = "log"
|
||||
version = "0.4.8"
|
||||
version = "0.4.14"
|
||||
source = "registry+https://github.com/rust-lang/crates.io-index"
|
||||
checksum = "51b9bbe6c47d51fc3e1a9b945965946b4c44142ab8792c50835a980d362c2710"
|
||||
dependencies = [
|
||||
"cfg-if 0.1.10 (registry+https://github.com/rust-lang/crates.io-index)",
|
||||
"cfg-if",
|
||||
]
|
||||
|
||||
[[package]]
|
||||
name = "managed"
|
||||
version = "0.7.1"
|
||||
version = "0.7.2"
|
||||
source = "registry+https://github.com/rust-lang/crates.io-index"
|
||||
checksum = "c75de51135344a4f8ed3cfe2720dc27736f7711989703a0b43aadf3753c55577"
|
||||
|
||||
[[package]]
|
||||
name = "nb"
|
||||
version = "0.1.2"
|
||||
version = "0.1.3"
|
||||
source = "registry+https://github.com/rust-lang/crates.io-index"
|
||||
checksum = "801d31da0513b6ec5214e9bf433a77966320625a37860f910be265be6e18d06f"
|
||||
dependencies = [
|
||||
"nb 1.0.0",
|
||||
]
|
||||
|
||||
[[package]]
|
||||
name = "nb"
|
||||
version = "1.0.0"
|
||||
source = "registry+https://github.com/rust-lang/crates.io-index"
|
||||
checksum = "546c37ac5d9e56f55e73b677106873d9d9f5190605e41a856503623648488cae"
|
||||
|
||||
[[package]]
|
||||
name = "pin-utils"
|
||||
version = "0.1.0"
|
||||
source = "registry+https://github.com/rust-lang/crates.io-index"
|
||||
checksum = "8b870d8c151b6f2fb93e84a13146138f05d02ed11c7e7c54f8826aaaf7c9f184"
|
||||
|
||||
[[package]]
|
||||
name = "r0"
|
||||
version = "1.0.0"
|
||||
source = "registry+https://github.com/rust-lang/crates.io-index"
|
||||
checksum = "bd7a31eed1591dcbc95d92ad7161908e72f4677f8fabf2a32ca49b4237cbf211"
|
||||
|
||||
[[package]]
|
||||
name = "rustc_version"
|
||||
version = "0.1.7"
|
||||
source = "registry+https://github.com/rust-lang/crates.io-index"
|
||||
checksum = "c5f5376ea5e30ce23c03eb77cbe4962b988deead10910c372b226388b594c084"
|
||||
dependencies = [
|
||||
"semver",
|
||||
]
|
||||
|
||||
[[package]]
|
||||
name = "semver"
|
||||
version = "0.1.20"
|
||||
source = "registry+https://github.com/rust-lang/crates.io-index"
|
||||
checksum = "d4f410fedcf71af0345d7607d246e7ad15faaadd49d240ee3b24e5dc21a820ac"
|
||||
|
||||
[[package]]
|
||||
name = "smoltcp"
|
||||
version = "0.6.0"
|
||||
version = "0.7.5"
|
||||
source = "registry+https://github.com/rust-lang/crates.io-index"
|
||||
checksum = "3e4a069bef843d170df47e7c0a8bf8d037f217d9f5b325865acc3e466ffe40d3"
|
||||
dependencies = [
|
||||
"bitflags 1.2.1 (registry+https://github.com/rust-lang/crates.io-index)",
|
||||
"byteorder 1.3.4 (registry+https://github.com/rust-lang/crates.io-index)",
|
||||
"managed 0.7.1 (registry+https://github.com/rust-lang/crates.io-index)",
|
||||
"bitflags",
|
||||
"byteorder",
|
||||
"managed",
|
||||
]
|
||||
|
||||
[[package]]
|
||||
name = "szl"
|
||||
version = "0.1.0"
|
||||
dependencies = [
|
||||
"byteorder",
|
||||
"core_io",
|
||||
"libboard_zynq",
|
||||
"libconfig",
|
||||
"libcortex_a9",
|
||||
"libregister",
|
||||
"libsupport_zynq",
|
||||
"log",
|
||||
]
|
||||
|
||||
[[package]]
|
||||
name = "vcell"
|
||||
version = "0.1.2"
|
||||
version = "0.1.3"
|
||||
source = "registry+https://github.com/rust-lang/crates.io-index"
|
||||
checksum = "77439c1b53d2303b20d9459b1ade71a83c716e3f9c34f3228c00e6f185d6c002"
|
||||
|
||||
[[package]]
|
||||
name = "void"
|
||||
version = "1.0.2"
|
||||
source = "registry+https://github.com/rust-lang/crates.io-index"
|
||||
checksum = "6a02e4885ed3bc0f2de90ea6dd45ebcbb66dacffe03547fadbb0eeae2770887d"
|
||||
|
||||
[[package]]
|
||||
name = "volatile-register"
|
||||
version = "0.2.0"
|
||||
version = "0.2.1"
|
||||
source = "registry+https://github.com/rust-lang/crates.io-index"
|
||||
checksum = "9ee8f19f9d74293faf70901bc20ad067dc1ad390d2cbf1e3f75f721ffee908b6"
|
||||
dependencies = [
|
||||
"vcell 0.1.2 (registry+https://github.com/rust-lang/crates.io-index)",
|
||||
"vcell",
|
||||
]
|
||||
|
||||
[metadata]
|
||||
"checksum bit_field 0.10.0 (registry+https://github.com/rust-lang/crates.io-index)" = "a165d606cf084741d4ac3a28fb6e9b1eb0bd31f6cd999098cfddb0b2ab381dc0"
|
||||
"checksum bitflags 1.2.1 (registry+https://github.com/rust-lang/crates.io-index)" = "cf1de2fe8c75bc145a2f577add951f8134889b4795d47466a54a5c846d691693"
|
||||
"checksum byteorder 1.3.4 (registry+https://github.com/rust-lang/crates.io-index)" = "08c48aae112d48ed9f069b33538ea9e3e90aa263cfa3d1c24309612b1f7472de"
|
||||
"checksum cfg-if 0.1.10 (registry+https://github.com/rust-lang/crates.io-index)" = "4785bdd1c96b2a846b2bd7cc02e86b6b3dbf14e7e53446c4f54c92a361040822"
|
||||
"checksum compiler_builtins 0.1.27 (registry+https://github.com/rust-lang/crates.io-index)" = "38f18416546abfbf8d801c555a0e99524453e7214f9cc9107ad49de3d5948ccc"
|
||||
"checksum embedded-hal 0.2.3 (registry+https://github.com/rust-lang/crates.io-index)" = "ee4908a155094da7723c2d60d617b820061e3b4efcc3d9e293d206a5a76c170b"
|
||||
"checksum linked_list_allocator 0.8.3 (registry+https://github.com/rust-lang/crates.io-index)" = "d6b60501dd4c850950bb43f970d544f6ce04e0ca021da2db2538fbe9d923f19e"
|
||||
"checksum log 0.4.8 (registry+https://github.com/rust-lang/crates.io-index)" = "14b6052be84e6b71ab17edffc2eeabf5c2c3ae1fdb464aae35ac50c67a44e1f7"
|
||||
"checksum managed 0.7.1 (registry+https://github.com/rust-lang/crates.io-index)" = "fdcec5e97041c7f0f1c5b7d93f12e57293c831c646f4cc7a5db59460c7ea8de6"
|
||||
"checksum nb 0.1.2 (registry+https://github.com/rust-lang/crates.io-index)" = "b1411551beb3c11dedfb0a90a0fa256b47d28b9ec2cdff34c25a2fa59e45dbdc"
|
||||
"checksum pin-utils 0.1.0 (registry+https://github.com/rust-lang/crates.io-index)" = "8b870d8c151b6f2fb93e84a13146138f05d02ed11c7e7c54f8826aaaf7c9f184"
|
||||
"checksum r0 1.0.0 (registry+https://github.com/rust-lang/crates.io-index)" = "bd7a31eed1591dcbc95d92ad7161908e72f4677f8fabf2a32ca49b4237cbf211"
|
||||
"checksum smoltcp 0.6.0 (registry+https://github.com/rust-lang/crates.io-index)" = "0fe46639fd2ec79eadf8fe719f237a7a0bd4dac5d957f1ca5bbdbc1c3c39e53a"
|
||||
"checksum vcell 0.1.2 (registry+https://github.com/rust-lang/crates.io-index)" = "876e32dcadfe563a4289e994f7cb391197f362b6315dc45e8ba4aa6f564a4b3c"
|
||||
"checksum void 1.0.2 (registry+https://github.com/rust-lang/crates.io-index)" = "6a02e4885ed3bc0f2de90ea6dd45ebcbb66dacffe03547fadbb0eeae2770887d"
|
||||
"checksum volatile-register 0.2.0 (registry+https://github.com/rust-lang/crates.io-index)" = "0d67cb4616d99b940db1d6bd28844ff97108b498a6ca850e5b6191a532063286"
|
||||
|
|
19
Cargo.toml
19
Cargo.toml
|
@ -1,19 +1,20 @@
|
|||
[workspace]
|
||||
members = [
|
||||
"libregister", "libcortex_a9",
|
||||
"libboard_zynq", "libsupport_zynq",
|
||||
"libregister",
|
||||
"libcortex_a9",
|
||||
"libboard_zynq",
|
||||
"libsupport_zynq",
|
||||
"libasync",
|
||||
"libconfig",
|
||||
"experiments",
|
||||
"szl",
|
||||
]
|
||||
|
||||
[profile.dev]
|
||||
panic = "abort"
|
||||
lto = false
|
||||
|
||||
[profile.release]
|
||||
panic = "abort"
|
||||
debug = true
|
||||
# Link-Time Optimization:
|
||||
# turn off if you get unusable debug symbols.
|
||||
codegen-units = 1
|
||||
opt-level = 's'
|
||||
lto = true
|
||||
opt-level = 'z' # Optimize for size.
|
||||
debug-assertions = false
|
||||
overflow-checks = false
|
||||
|
|
|
@ -0,0 +1,165 @@
|
|||
GNU LESSER GENERAL PUBLIC LICENSE
|
||||
Version 3, 29 June 2007
|
||||
|
||||
Copyright (C) 2007 Free Software Foundation, Inc. <http://fsf.org/>
|
||||
Everyone is permitted to copy and distribute verbatim copies
|
||||
of this license document, but changing it is not allowed.
|
||||
|
||||
|
||||
This version of the GNU Lesser General Public License incorporates
|
||||
the terms and conditions of version 3 of the GNU General Public
|
||||
License, supplemented by the additional permissions listed below.
|
||||
|
||||
0. Additional Definitions.
|
||||
|
||||
As used herein, "this License" refers to version 3 of the GNU Lesser
|
||||
General Public License, and the "GNU GPL" refers to version 3 of the GNU
|
||||
General Public License.
|
||||
|
||||
"The Library" refers to a covered work governed by this License,
|
||||
other than an Application or a Combined Work as defined below.
|
||||
|
||||
An "Application" is any work that makes use of an interface provided
|
||||
by the Library, but which is not otherwise based on the Library.
|
||||
Defining a subclass of a class defined by the Library is deemed a mode
|
||||
of using an interface provided by the Library.
|
||||
|
||||
A "Combined Work" is a work produced by combining or linking an
|
||||
Application with the Library. The particular version of the Library
|
||||
with which the Combined Work was made is also called the "Linked
|
||||
Version".
|
||||
|
||||
The "Minimal Corresponding Source" for a Combined Work means the
|
||||
Corresponding Source for the Combined Work, excluding any source code
|
||||
for portions of the Combined Work that, considered in isolation, are
|
||||
based on the Application, and not on the Linked Version.
|
||||
|
||||
The "Corresponding Application Code" for a Combined Work means the
|
||||
object code and/or source code for the Application, including any data
|
||||
and utility programs needed for reproducing the Combined Work from the
|
||||
Application, but excluding the System Libraries of the Combined Work.
|
||||
|
||||
1. Exception to Section 3 of the GNU GPL.
|
||||
|
||||
You may convey a covered work under sections 3 and 4 of this License
|
||||
without being bound by section 3 of the GNU GPL.
|
||||
|
||||
2. Conveying Modified Versions.
|
||||
|
||||
If you modify a copy of the Library, and, in your modifications, a
|
||||
facility refers to a function or data to be supplied by an Application
|
||||
that uses the facility (other than as an argument passed when the
|
||||
facility is invoked), then you may convey a copy of the modified
|
||||
version:
|
||||
|
||||
a) under this License, provided that you make a good faith effort to
|
||||
ensure that, in the event an Application does not supply the
|
||||
function or data, the facility still operates, and performs
|
||||
whatever part of its purpose remains meaningful, or
|
||||
|
||||
b) under the GNU GPL, with none of the additional permissions of
|
||||
this License applicable to that copy.
|
||||
|
||||
3. Object Code Incorporating Material from Library Header Files.
|
||||
|
||||
The object code form of an Application may incorporate material from
|
||||
a header file that is part of the Library. You may convey such object
|
||||
code under terms of your choice, provided that, if the incorporated
|
||||
material is not limited to numerical parameters, data structure
|
||||
layouts and accessors, or small macros, inline functions and templates
|
||||
(ten or fewer lines in length), you do both of the following:
|
||||
|
||||
a) Give prominent notice with each copy of the object code that the
|
||||
Library is used in it and that the Library and its use are
|
||||
covered by this License.
|
||||
|
||||
b) Accompany the object code with a copy of the GNU GPL and this license
|
||||
document.
|
||||
|
||||
4. Combined Works.
|
||||
|
||||
You may convey a Combined Work under terms of your choice that,
|
||||
taken together, effectively do not restrict modification of the
|
||||
portions of the Library contained in the Combined Work and reverse
|
||||
engineering for debugging such modifications, if you also do each of
|
||||
the following:
|
||||
|
||||
a) Give prominent notice with each copy of the Combined Work that
|
||||
the Library is used in it and that the Library and its use are
|
||||
covered by this License.
|
||||
|
||||
b) Accompany the Combined Work with a copy of the GNU GPL and this license
|
||||
document.
|
||||
|
||||
c) For a Combined Work that displays copyright notices during
|
||||
execution, include the copyright notice for the Library among
|
||||
these notices, as well as a reference directing the user to the
|
||||
copies of the GNU GPL and this license document.
|
||||
|
||||
d) Do one of the following:
|
||||
|
||||
0) Convey the Minimal Corresponding Source under the terms of this
|
||||
License, and the Corresponding Application Code in a form
|
||||
suitable for, and under terms that permit, the user to
|
||||
recombine or relink the Application with a modified version of
|
||||
the Linked Version to produce a modified Combined Work, in the
|
||||
manner specified by section 6 of the GNU GPL for conveying
|
||||
Corresponding Source.
|
||||
|
||||
1) Use a suitable shared library mechanism for linking with the
|
||||
Library. A suitable mechanism is one that (a) uses at run time
|
||||
a copy of the Library already present on the user's computer
|
||||
system, and (b) will operate properly with a modified version
|
||||
of the Library that is interface-compatible with the Linked
|
||||
Version.
|
||||
|
||||
e) Provide Installation Information, but only if you would otherwise
|
||||
be required to provide such information under section 6 of the
|
||||
GNU GPL, and only to the extent that such information is
|
||||
necessary to install and execute a modified version of the
|
||||
Combined Work produced by recombining or relinking the
|
||||
Application with a modified version of the Linked Version. (If
|
||||
you use option 4d0, the Installation Information must accompany
|
||||
the Minimal Corresponding Source and Corresponding Application
|
||||
Code. If you use option 4d1, you must provide the Installation
|
||||
Information in the manner specified by section 6 of the GNU GPL
|
||||
for conveying Corresponding Source.)
|
||||
|
||||
5. Combined Libraries.
|
||||
|
||||
You may place library facilities that are a work based on the
|
||||
Library side by side in a single library together with other library
|
||||
facilities that are not Applications and are not covered by this
|
||||
License, and convey such a combined library under terms of your
|
||||
choice, if you do both of the following:
|
||||
|
||||
a) Accompany the combined library with a copy of the same work based
|
||||
on the Library, uncombined with any other library facilities,
|
||||
conveyed under the terms of this License.
|
||||
|
||||
b) Give prominent notice with the combined library that part of it
|
||||
is a work based on the Library, and explaining where to find the
|
||||
accompanying uncombined form of the same work.
|
||||
|
||||
6. Revised Versions of the GNU Lesser General Public License.
|
||||
|
||||
The Free Software Foundation may publish revised and/or new versions
|
||||
of the GNU Lesser General Public License from time to time. Such new
|
||||
versions will be similar in spirit to the present version, but may
|
||||
differ in detail to address new problems or concerns.
|
||||
|
||||
Each version is given a distinguishing version number. If the
|
||||
Library as you received it specifies that a certain numbered version
|
||||
of the GNU Lesser General Public License "or any later version"
|
||||
applies to it, you have the option of following the terms and
|
||||
conditions either of that published version or of any later version
|
||||
published by the Free Software Foundation. If the Library as you
|
||||
received it does not specify a version number of the GNU Lesser
|
||||
General Public License, you may choose any version of the GNU Lesser
|
||||
General Public License ever published by the Free Software Foundation.
|
||||
|
||||
If the Library as you received it specifies that a proxy can decide
|
||||
whether future versions of the GNU Lesser General Public License shall
|
||||
apply, that proxy's public statement of acceptance of any version is
|
||||
permanent authorization for you to choose that version for the
|
||||
Library.
|
108
README.md
108
README.md
|
@ -1,47 +1,49 @@
|
|||
# Build
|
||||
# Bare-metal Rust on Zynq-7000
|
||||
|
||||
Supported features:
|
||||
|
||||
* Clocking setup
|
||||
* UART
|
||||
* SDRAM setup
|
||||
* Ethernet with smoltcp and async-await on TCP sockets
|
||||
* SD card
|
||||
* PL programming and startup
|
||||
* Pure Rust SZL first-stage bootloader, with SD boot and netboot
|
||||
* Control of second CPU core and message passing, with async-await support
|
||||
|
||||
|
||||
Supported boards:
|
||||
* Kasli-SoC
|
||||
* ZC706
|
||||
* Red Pitaya
|
||||
* Cora Z7-10 (seems to also run on Cora Z7-07S, including dual-core support)
|
||||
|
||||
## Build
|
||||
|
||||
Zynq-rs is packaged using the [Nix](https://nixos.org) Flakes system. Install Nix 2.4+ and enable flakes by adding ``experimental-features = nix-command flakes`` to ``nix.conf`` (e.g. ``~/.config/nix/nix.conf``).
|
||||
|
||||
You can build SZL or experiments crate for the platform of your choice by using ``nix build`` command, e.g.
|
||||
|
||||
```shell
|
||||
nix-shell --command "cargo xbuild --release"
|
||||
nix build .#coraz7-experiments
|
||||
```
|
||||
|
||||
Currently the ELF output is placed at `target/armv7-none-eabihf/release/experiments`
|
||||
Alternatively, you can still use ``cargo xbuild`` within ``nix develop`` shell.
|
||||
|
||||
# Debug
|
||||
|
||||
## Using the Xilinx toolchain
|
||||
|
||||
Tested with the ZC706 board.
|
||||
|
||||
Run the Xilinx Microprocessor Debugger:
|
||||
```shell
|
||||
/opt/Xilinx/14.7/ISE_DS/EDK/bin/lin64/xmd
|
||||
nix develop
|
||||
cargo xbuild --release -p experiments
|
||||
```
|
||||
|
||||
Connect to target (given it is connected and you have permissions):
|
||||
```tcl
|
||||
connect arm hw
|
||||
```
|
||||
Currently the ELF output is placed at `target/armv7-none-eabihf/release/experiments`, or `result/experiments.elf` for Nix Flakes build.
|
||||
|
||||
Leave xmd running.
|
||||
|
||||
Start the Xilinx version of the GNU debugger with your latest build:
|
||||
```shell
|
||||
/opt/Xilinx/14.7/ISE_DS/EDK/gnu/arm/lin/bin/arm-xilinx-linux-gnueabi-gdb zc706
|
||||
```
|
||||
|
||||
Connect the debugger to xmd over TCP on localhost:
|
||||
```gdb
|
||||
target remote :1234
|
||||
```
|
||||
|
||||
Proceed using gdb with `load`, `c`
|
||||
|
||||
## Using OpenOCD
|
||||
## Debug
|
||||
|
||||
### Running on the ZC706
|
||||
|
||||
```shell
|
||||
nix-shell --command "cargo xbuild --release"
|
||||
nix develop
|
||||
cargo xbuild --release -p experiments
|
||||
cd openocd
|
||||
openocd -f zc706.cfg
|
||||
```
|
||||
|
@ -49,7 +51,8 @@ openocd -f zc706.cfg
|
|||
### Running on the Cora Z7-10
|
||||
|
||||
```shell
|
||||
nix-shell --command "cd experiments && cargo xbuild --release --no-default-features --features=target_cora_z7_10"
|
||||
nix develop
|
||||
cargo xbuild --release -p experiments --no-default-features --features=target_coraz7
|
||||
cd openocd
|
||||
openocd -f cora-z7-10.cfg
|
||||
```
|
||||
|
@ -57,43 +60,10 @@ openocd -f cora-z7-10.cfg
|
|||
### Loading a bitstream into volatile memory
|
||||
|
||||
```shell
|
||||
openocd -f zc706.cfg -c "pld load 0 blinker_migen.bit; exit"
|
||||
openocd -f zc706.cfg -c "pld load 0 blinker_migen.bit; exit"
|
||||
```
|
||||
|
||||
### Development Process
|
||||
|
||||
Clone this repo onto your development/build machine and the raspberry pi that controls the Xilinx 7000 board
|
||||
|
||||
On the dev machine, the below script builds zc706 and secure copies it to the target pi (in your pi $HOME directory)
|
||||
```shell
|
||||
cd ~/zc706
|
||||
./build.sh $your_user/ssh_id
|
||||
```
|
||||
|
||||
On the pi, we need an information rich environment that includes a relatively reliable `gdb` experience (that includes `ctrl-p` and `ctrl-n` command history that persists across `cgdb` executions), run:
|
||||
```shell
|
||||
ssh pi4
|
||||
cd zc706
|
||||
./tmux.sh
|
||||
```
|
||||
|
||||
Time to run your code with:
|
||||
```shell
|
||||
zynq-connect
|
||||
zynq-restart
|
||||
c
|
||||
```
|
||||
or, for a more succinct experience, (identical to above)
|
||||
```shell
|
||||
dc
|
||||
dr
|
||||
c
|
||||
```
|
||||
|
||||
After every build on your dev machine, simply run:
|
||||
```shell
|
||||
dr
|
||||
c
|
||||
```
|
||||
Sometimes you might need to type `load` after `dr`.
|
||||
## License
|
||||
|
||||
Copyright (C) 2019-2022 M-Labs Limited.
|
||||
Released under the GNU LGPL v3. See the LICENSE file for details.
|
||||
|
|
1
build.sh
1
build.sh
|
@ -1 +0,0 @@
|
|||
nix-shell --command "cargo xbuild --release" && scp -P 2204 -C target/armv7-none-eabihf/release/zc706-experiments $1@nixbld.m-labs.hk:/home/$1/zc706/zc706.elf
|
File diff suppressed because it is too large
Load Diff
63
default.nix
63
default.nix
|
@ -1,63 +0,0 @@
|
|||
{ # Use master branch of the overlay by default
|
||||
mozillaOverlay ? import (builtins.fetchTarball https://github.com/mozilla/nixpkgs-mozilla/archive/master.tar.gz),
|
||||
rustManifest ? ./channel-rust-nightly.toml,
|
||||
}:
|
||||
|
||||
let
|
||||
pkgs = import <nixpkgs> { overlays = [ mozillaOverlay ]; };
|
||||
rustcSrc = pkgs.fetchgit {
|
||||
url = https://github.com/rust-lang/rust.git;
|
||||
# master of 2020-04-25
|
||||
rev = "14b15521c52549ebbb113173b4abecd124b5a823";
|
||||
sha256 = "0a6bi8g636cajpdrpcfkpza95b7ss7041m9cs6hxcd7h8bf6xhwi";
|
||||
fetchSubmodules = true;
|
||||
};
|
||||
targets = [];
|
||||
rustChannelOfTargets = _channel: _date: targets:
|
||||
(pkgs.lib.rustLib.fromManifestFile rustManifest {
|
||||
inherit (pkgs) stdenv fetchurl patchelf;
|
||||
}).rust.override { inherit targets; };
|
||||
rust =
|
||||
rustChannelOfTargets "nightly" null targets;
|
||||
rustPlatform = pkgs.recurseIntoAttrs (pkgs.makeRustPlatform {
|
||||
rustc = rust // { src = rustcSrc; };
|
||||
cargo = rust;
|
||||
});
|
||||
gcc = pkgs.pkgsCross.armv7l-hf-multiplatform.buildPackages.gcc;
|
||||
xbuildRustPackage = { cargoFeatures, crateSubdir, ... } @ attrs:
|
||||
let
|
||||
buildPkg = rustPlatform.buildRustPackage attrs;
|
||||
in
|
||||
buildPkg.overrideAttrs ({ name, nativeBuildInputs, ... }: {
|
||||
nativeBuildInputs =
|
||||
nativeBuildInputs ++ [ pkgs.cargo-xbuild ];
|
||||
buildPhase = ''
|
||||
pushd ${crateSubdir}
|
||||
cargo xbuild --release --frozen \
|
||||
--no-default-features \
|
||||
--features=${cargoFeatures}
|
||||
popd
|
||||
'';
|
||||
XARGO_RUST_SRC = "${rustcSrc}/src";
|
||||
installPhase = ''
|
||||
mkdir $out
|
||||
ls -la target/armv7-none-eabihf/release/
|
||||
cp target/armv7-none-eabihf/release/${name} $out/${name}.elf
|
||||
'';
|
||||
});
|
||||
xbuildCrate = name: crate: features: xbuildRustPackage rec {
|
||||
name = "${crate}";
|
||||
src = ./.;
|
||||
crateSubdir = crate;
|
||||
cargoSha256 = "0xlynsr94dyv0g41qwk5490w3wnzd5g70msaih6mcbgr3v4s2q34";
|
||||
cargoFeatures = features;
|
||||
doCheck = false;
|
||||
dontFixup = true;
|
||||
};
|
||||
in {
|
||||
inherit pkgs rustPlatform rustcSrc gcc;
|
||||
zc706 = {
|
||||
experiments-zc706 = xbuildCrate "experiments-zc706" "experiments" "target_zc706";
|
||||
experiments-cora = xbuildCrate "experiments-cora" "experiments" "target_cora_z7_10";
|
||||
};
|
||||
}
|
|
@ -2,12 +2,14 @@
|
|||
name = "experiments"
|
||||
description = "Developing bare-metal Rust on Zynq"
|
||||
version = "0.0.0"
|
||||
authors = ["Astro <astro@spaceboyz.net>"]
|
||||
authors = ["M-Labs"]
|
||||
edition = "2018"
|
||||
|
||||
[features]
|
||||
target_zc706 = ["libboard_zynq/target_zc706", "libsupport_zynq/target_zc706"]
|
||||
target_cora_z7_10 = ["libboard_zynq/target_cora_z7_10", "libsupport_zynq/target_cora_z7_10"]
|
||||
target_coraz7 = ["libboard_zynq/target_coraz7", "libsupport_zynq/target_coraz7"]
|
||||
target_redpitaya = ["libboard_zynq/target_redpitaya", "libsupport_zynq/target_redpitaya"]
|
||||
target_kasli_soc = ["libboard_zynq/target_kasli_soc", "libsupport_zynq/target_kasli_soc"]
|
||||
default = ["target_zc706"]
|
||||
|
||||
[dependencies]
|
||||
|
@ -16,5 +18,5 @@ embedded-hal = "0.2"
|
|||
libregister = { path = "../libregister" }
|
||||
libcortex_a9 = { path = "../libcortex_a9" }
|
||||
libboard_zynq = { path = "../libboard_zynq" }
|
||||
libsupport_zynq = { path = "../libsupport_zynq" }
|
||||
libsupport_zynq = { path = "../libsupport_zynq", default-features = false, features = ["panic_handler", "dummy_fiq_handler"]}
|
||||
libasync = { path = "../libasync" }
|
||||
|
|
|
@ -1,14 +1,4 @@
|
|||
ENTRY(_boot_cores);
|
||||
|
||||
/* Provide some defaults */
|
||||
PROVIDE(Reset = _boot_cores);
|
||||
PROVIDE(UndefinedInstruction = Reset);
|
||||
PROVIDE(SoftwareInterrupt = Reset);
|
||||
PROVIDE(PrefetchAbort = Reset);
|
||||
PROVIDE(DataAbort = Reset);
|
||||
PROVIDE(ReservedException = Reset);
|
||||
PROVIDE(IRQ = Reset);
|
||||
PROVIDE(FIQ = Reset);
|
||||
ENTRY(Reset);
|
||||
|
||||
MEMORY
|
||||
{
|
||||
|
@ -42,19 +32,37 @@ SECTIONS
|
|||
*(.bss .bss.*);
|
||||
. = ALIGN(4);
|
||||
__bss_end = .;
|
||||
} > OCM
|
||||
} > OCM3
|
||||
|
||||
.irq_stack1 (NOLOAD) : ALIGN(8)
|
||||
{
|
||||
__irq_stack1_end = .;
|
||||
. += 0x100;
|
||||
__irq_stack1_start = .;
|
||||
} > OCM3
|
||||
|
||||
.irq_stack0 (NOLOAD) : ALIGN(8)
|
||||
{
|
||||
__irq_stack0_end = .;
|
||||
. += 0x100;
|
||||
__irq_stack0_start = .;
|
||||
} > OCM3
|
||||
|
||||
.stack1 (NOLOAD) : ALIGN(8) {
|
||||
__stack1_end = .;
|
||||
. += 0x200;
|
||||
__stack1_start = .;
|
||||
} > OCM
|
||||
} > OCM3
|
||||
|
||||
.stack0 (NOLOAD) : ALIGN(8) {
|
||||
__stack0_end = .;
|
||||
. = ORIGIN(OCM) + LENGTH(OCM) - 8;
|
||||
. = ORIGIN(OCM3) + LENGTH(OCM3) - 8;
|
||||
__stack0_start = .;
|
||||
} > OCM
|
||||
|
||||
/* unused heap0 to prevent the linker from complaining*/
|
||||
__heap0_start = .;
|
||||
__heap0_end = .;
|
||||
} > OCM3
|
||||
|
||||
/DISCARD/ :
|
||||
{
|
||||
|
|
|
@ -1,10 +1,12 @@
|
|||
#![no_std]
|
||||
#![no_main]
|
||||
#![feature(const_in_array_repeat_expressions)]
|
||||
#![feature(naked_functions)]
|
||||
#![feature(asm)]
|
||||
|
||||
extern crate alloc;
|
||||
|
||||
use alloc::{borrow::ToOwned, collections::BTreeMap, format};
|
||||
use core::task::Poll;
|
||||
use alloc::collections::BTreeMap;
|
||||
use libasync::{
|
||||
delay,
|
||||
smoltcp::{Sockets, TcpStream},
|
||||
|
@ -14,64 +16,118 @@ use libboard_zynq::{
|
|||
self as zynq,
|
||||
clocks::source::{ArmPll, ClockSource, IoPll},
|
||||
clocks::Clocks,
|
||||
print, println,
|
||||
sdio::sd_card::SdCard,
|
||||
println, stdio,
|
||||
mpcore,
|
||||
gic,
|
||||
smoltcp::{
|
||||
self,
|
||||
iface::{EthernetInterfaceBuilder, NeighborCache, Routes},
|
||||
time::Instant,
|
||||
wire::{EthernetAddress, IpAddress, IpCidr},
|
||||
},
|
||||
time::Milliseconds,
|
||||
};
|
||||
#[cfg(feature = "target_zc706")]
|
||||
use libboard_zynq::print;
|
||||
use libcortex_a9::{
|
||||
mutex::Mutex,
|
||||
sync_channel::{self, sync_channel},
|
||||
l2c::enable_l2_cache,
|
||||
sync_channel::{Sender, Receiver},
|
||||
sync_channel,
|
||||
regs::{MPIDR, SP},
|
||||
spin_lock_yield, notify_spin_lock,
|
||||
asm, interrupt_handler
|
||||
};
|
||||
use libregister::RegisterR;
|
||||
use libregister::{RegisterR, RegisterW};
|
||||
use libsupport_zynq::{
|
||||
boot, ram,
|
||||
boot, exception_vectors, ram,
|
||||
};
|
||||
use log::info;
|
||||
|
||||
mod ps7_init;
|
||||
use log::{info, warn};
|
||||
use core::sync::atomic::{AtomicBool, Ordering};
|
||||
|
||||
const HWADDR: [u8; 6] = [0, 0x23, 0xde, 0xea, 0xbe, 0xef];
|
||||
|
||||
static mut CORE1_REQ: (Sender<usize>, Receiver<usize>) = sync_channel!(usize, 10);
|
||||
static mut CORE1_RES: (Sender<usize>, Receiver<usize>) = sync_channel!(usize, 10);
|
||||
|
||||
extern "C" {
|
||||
static mut __stack1_start: u32;
|
||||
}
|
||||
|
||||
static CORE1_RESTART: AtomicBool = AtomicBool::new(false);
|
||||
|
||||
interrupt_handler!(IRQ, irq, __irq_stack0_start, __irq_stack1_start, {
|
||||
let mpcore = mpcore::RegisterBlock::mpcore();
|
||||
let mut gic = gic::InterruptController::gic(mpcore);
|
||||
let id = gic.get_interrupt_id();
|
||||
match MPIDR.read().cpu_id(){
|
||||
0 => {
|
||||
if id.0 == 0 {
|
||||
println!("Interrupting core0...");
|
||||
gic.end_interrupt(id);
|
||||
return;
|
||||
}
|
||||
},
|
||||
1 => {
|
||||
if id.0 == 0 {
|
||||
gic.end_interrupt(id);
|
||||
asm::exit_irq();
|
||||
SP.write(&mut __stack1_start as *mut _ as u32);
|
||||
asm::enable_irq();
|
||||
CORE1_RESTART.store(false, Ordering::Relaxed);
|
||||
notify_spin_lock();
|
||||
main_core1();
|
||||
}
|
||||
},
|
||||
_ => {}
|
||||
}
|
||||
stdio::drop_uart();
|
||||
println!("IRQ");
|
||||
loop {}
|
||||
});
|
||||
|
||||
pub fn restart_core1() {
|
||||
let mut interrupt_controller = gic::InterruptController::gic(mpcore::RegisterBlock::mpcore());
|
||||
CORE1_RESTART.store(true, Ordering::Relaxed);
|
||||
interrupt_controller.send_sgi(gic::InterruptId(0), gic::CPUCore::Core1.into());
|
||||
while CORE1_RESTART.load(Ordering::Relaxed) {
|
||||
spin_lock_yield();
|
||||
}
|
||||
}
|
||||
|
||||
#[no_mangle]
|
||||
pub fn main_core0() {
|
||||
exception_vectors::set_vector_table(0x0);
|
||||
// zynq::clocks::CpuClocks::enable_io(1_250_000_000);
|
||||
println!("\nzc706 main");
|
||||
enable_l2_cache(0x8);
|
||||
println!("\nZynq experiments");
|
||||
let mut interrupt_controller = gic::InterruptController::gic(mpcore::RegisterBlock::mpcore());
|
||||
interrupt_controller.enable_interrupts();
|
||||
|
||||
libboard_zynq::logger::init().unwrap();
|
||||
log::set_max_level(log::LevelFilter::Trace);
|
||||
|
||||
info!(
|
||||
"Boot mode: {:?}",
|
||||
zynq::slcr::RegisterBlock::new()
|
||||
zynq::slcr::RegisterBlock::slcr()
|
||||
.boot_mode
|
||||
.read()
|
||||
.boot_mode_pins()
|
||||
);
|
||||
|
||||
#[cfg(feature = "target_zc706")]
|
||||
#[cfg(any(
|
||||
feature = "target_zc706",
|
||||
feature = "target_redpitaya",
|
||||
feature = "target_kasli_soc",
|
||||
))]
|
||||
const CPU_FREQ: u32 = 800_000_000;
|
||||
#[cfg(feature = "target_cora_z7_10")]
|
||||
#[cfg(feature = "target_coraz7")]
|
||||
const CPU_FREQ: u32 = 650_000_000;
|
||||
|
||||
info!("Setup clock sources...");
|
||||
ArmPll::setup(2 * CPU_FREQ);
|
||||
Clocks::set_cpu_freq(CPU_FREQ);
|
||||
#[cfg(feature = "target_zc706")]
|
||||
{
|
||||
IoPll::setup(1_000_000_000);
|
||||
libboard_zynq::stdio::drop_uart();
|
||||
}
|
||||
#[cfg(feature = "target_cora_z7_10")]
|
||||
{
|
||||
IoPll::setup(1_000_000_000);
|
||||
libboard_zynq::stdio::drop_uart();
|
||||
}
|
||||
IoPll::setup(1_000_000_000);
|
||||
libboard_zynq::stdio::drop_uart();
|
||||
info!("PLLs set up");
|
||||
let clocks = zynq::clocks::Clocks::get();
|
||||
info!(
|
||||
|
@ -82,107 +138,87 @@ pub fn main_core0() {
|
|||
clocks.cpu_1x()
|
||||
);
|
||||
|
||||
let sd = libboard_zynq::sdio::SDIO::sdio0(true);
|
||||
// only test SD card if it is inserted
|
||||
if sd.is_card_inserted() {
|
||||
let result = SdCard::from_sdio(sd);
|
||||
match &result {
|
||||
Ok(_) => info!("OK!"),
|
||||
Err(a) => info!("{}", a),
|
||||
};
|
||||
const SIZE: usize = 512 * 2 + 1;
|
||||
let mut sd_card = result.unwrap();
|
||||
{
|
||||
let buffer: [u8; SIZE] = [5; SIZE];
|
||||
sd_card.write_block(0x0, 2, &buffer).unwrap();
|
||||
}
|
||||
let mut buffer: [u8; SIZE] = [0; SIZE];
|
||||
sd_card.read_block(0x1, 2, &mut buffer[1..]).unwrap();
|
||||
for i in 0..buffer.len() {
|
||||
info!("buffer[{}] = {}", i, buffer[i]);
|
||||
}
|
||||
info!("End");
|
||||
}
|
||||
|
||||
let mut flash = zynq::flash::Flash::new(200_000_000).linear_addressing_mode();
|
||||
let flash_ram: &[u8] = unsafe { core::slice::from_raw_parts(flash.ptr(), flash.size()) };
|
||||
for i in 0..=1 {
|
||||
print!("Flash {}:", i);
|
||||
for b in &flash_ram[(i * 16 * 1024 * 1024)..][..128] {
|
||||
print!(" {:02X}", *b);
|
||||
}
|
||||
println!("");
|
||||
}
|
||||
let mut flash = flash.stop();
|
||||
|
||||
let timer = libboard_zynq::timer::GlobalTimer::start();
|
||||
|
||||
let mut ddr = zynq::ddr::DdrRam::new();
|
||||
let mut ddr = zynq::ddr::DdrRam::ddrram();
|
||||
#[cfg(not(feature = "target_zc706"))]
|
||||
ddr.memtest();
|
||||
ram::init_alloc_ddr(&mut ddr);
|
||||
|
||||
#[cfg(dev)]
|
||||
for i in 0..=1 {
|
||||
let mut flash_io = flash.manual_mode(i);
|
||||
// println!("rdcr={:02X}", flash_io.rdcr());
|
||||
print!("Flash {} ID:", i);
|
||||
for b in flash_io.rdid() {
|
||||
print!(" {:02X}", b);
|
||||
}
|
||||
println!("");
|
||||
print!("Flash {} I/O:", i);
|
||||
for o in 0..8 {
|
||||
const CHUNK: u32 = 8;
|
||||
for b in flash_io.read(CHUNK * o, CHUNK as usize) {
|
||||
print!(" {:02X}", b);
|
||||
}
|
||||
}
|
||||
println!("");
|
||||
info!("Send software interrupt to core0");
|
||||
interrupt_controller.send_sgi(gic::InterruptId(0), gic::CPUCore::Core0.into());
|
||||
info!("Core0 returned from interrupt");
|
||||
|
||||
flash_io.dump("Read cr1", 0x35);
|
||||
flash_io.dump("Read Autoboot", 0x14);
|
||||
flash_io.dump("Read Bank", 0x16);
|
||||
flash_io.dump("DLP Bank", 0x16);
|
||||
flash_io.dump("Read ESig", 0xAB);
|
||||
flash_io.dump("OTP Read", 0x4B);
|
||||
flash_io.dump("DYB Read", 0xE0);
|
||||
flash_io.dump("PPB Read", 0xE2);
|
||||
flash_io.dump("ASP Read", 0x2B);
|
||||
flash_io.dump("Password Read", 0xE7);
|
||||
boot::Core1::start(false);
|
||||
|
||||
flash_io.write_enabled(|flash_io| {
|
||||
flash_io.erase(0);
|
||||
});
|
||||
flash_io.write_enabled(|flash_io| {
|
||||
flash_io.program(0, [0x23054223; 0x100 >> 2].iter().cloned());
|
||||
});
|
||||
|
||||
flash = flash_io.stop();
|
||||
}
|
||||
|
||||
let core1 = boot::Core1::start(false);
|
||||
|
||||
let (mut core1_req, rx) = sync_channel(10);
|
||||
*CORE1_REQ.lock() = Some(rx);
|
||||
let (tx, mut core1_res) = sync_channel(10);
|
||||
*CORE1_RES.lock() = Some(tx);
|
||||
let core1_req = unsafe { &mut CORE1_REQ.0 };
|
||||
let core1_res = unsafe { &mut CORE1_RES.1 };
|
||||
task::block_on(async {
|
||||
for i in 0..10 {
|
||||
restart_core1();
|
||||
core1_req.async_send(i).await;
|
||||
let j = core1_res.async_recv().await;
|
||||
println!("{} -> {}", i, j);
|
||||
}
|
||||
});
|
||||
core1.disable();
|
||||
unsafe {
|
||||
core1_req.drop_elements();
|
||||
}
|
||||
|
||||
let eth = zynq::eth::Eth::default(HWADDR.clone());
|
||||
// Test I2C
|
||||
#[cfg(feature = "target_zc706")]
|
||||
{
|
||||
let mut i2c = zynq::i2c::I2c::i2c0();
|
||||
i2c.init().unwrap();
|
||||
println!("I2C bit-banging enabled");
|
||||
let mut eeprom = zynq::i2c::eeprom::EEPROM::new(&mut i2c, 16);
|
||||
// Write to 0x00 and 0x08
|
||||
let eeprom_buffer: [u8; 22] = [
|
||||
0x66, 0x77, 0x88, 0x99, 0xaa, 0xbb,
|
||||
0x77, 0x88, 0x99, 0xaa, 0xbb, 0xcc, 0xdd, 0xee,
|
||||
0xef, 0xcd, 0xab, 0x89, 0x67, 0x45, 0x23, 0x01,
|
||||
];
|
||||
eeprom.write(0x00, &eeprom_buffer[0..6]).unwrap();
|
||||
eeprom.write(0x08, &eeprom_buffer[6..22]).unwrap();
|
||||
println!("Data written to EEPROM");
|
||||
let mut eeprom_buffer = [0u8; 24];
|
||||
// Read from 0x00
|
||||
eeprom.read(0x00, &mut eeprom_buffer).unwrap();
|
||||
print!("Data read from EEPROM @ 0x00: (hex) ");
|
||||
for i in 0..6 {
|
||||
print!("{:02x} ", eeprom_buffer[i]);
|
||||
}
|
||||
println!("");
|
||||
// Read from 0x08
|
||||
eeprom.read(0x08, &mut eeprom_buffer).unwrap();
|
||||
print!("Data read from EEPROM @ 0x08: (hex) ");
|
||||
for i in 0..16 {
|
||||
print!("{:02x} ", eeprom_buffer[i]);
|
||||
}
|
||||
println!("");
|
||||
}
|
||||
|
||||
#[cfg(feature = "target_kasli_soc")]
|
||||
{
|
||||
let mut err_cdwn = timer.countdown();
|
||||
let mut err_state = true;
|
||||
let mut led = zynq::error_led::ErrorLED::error_led();
|
||||
task::spawn( async move {
|
||||
loop {
|
||||
led.toggle(err_state);
|
||||
err_state = !err_state;
|
||||
delay(&mut err_cdwn, Milliseconds(1000)).await;
|
||||
}
|
||||
});
|
||||
}
|
||||
|
||||
let eth = zynq::eth::Eth::eth0(HWADDR.clone());
|
||||
println!("Eth on");
|
||||
|
||||
const RX_LEN: usize = 8;
|
||||
const RX_LEN: usize = 4096;
|
||||
// Number of transmission buffers (minimum is two because with
|
||||
// one, duplicate packet transmission occurs)
|
||||
const TX_LEN: usize = 8;
|
||||
const TX_LEN: usize = 4096;
|
||||
let eth = eth.start_rx(RX_LEN);
|
||||
let mut eth = eth.start_tx(TX_LEN);
|
||||
|
||||
|
@ -199,56 +235,45 @@ pub fn main_core0() {
|
|||
.neighbor_cache(neighbor_cache)
|
||||
.finalize();
|
||||
|
||||
#[cfg(feature = "target_zc706")]
|
||||
ps7_init::report_differences();
|
||||
|
||||
Sockets::init(32);
|
||||
/// `chargen`
|
||||
|
||||
const TCP_PORT: u16 = 19;
|
||||
async fn handle_connection(stream: TcpStream) -> smoltcp::Result<()> {
|
||||
stream.send("Enter your name: ".bytes()).await?;
|
||||
let name = stream
|
||||
.recv(|buf| {
|
||||
for (i, b) in buf.iter().enumerate() {
|
||||
if *b == '\n' as u8 {
|
||||
return match core::str::from_utf8(&buf[0..i]) {
|
||||
Ok(name) => Poll::Ready((i + 1, Some(name.to_owned()))),
|
||||
Err(_) => Poll::Ready((i + 1, None)),
|
||||
};
|
||||
// (rx, tx)
|
||||
let stats = alloc::rc::Rc::new(core::cell::RefCell::new((0, 0)));
|
||||
let stats_tx = stats.clone();
|
||||
task::spawn(async move {
|
||||
while let Ok(stream) = TcpStream::accept(TCP_PORT, 0x10_0000, 0x10_0000).await {
|
||||
let stats_tx = stats_tx.clone();
|
||||
task::spawn(async move {
|
||||
let tx_data = (0..=255).cycle().take(4096).collect::<alloc::vec::Vec<u8>>();
|
||||
loop {
|
||||
// const CHUNK_SIZE: usize = 65536;
|
||||
// match stream.send((0..=255).cycle().take(CHUNK_SIZE)).await {
|
||||
match stream.send_slice(&tx_data[..]).await {
|
||||
Ok(_len) => stats_tx.borrow_mut().1 += tx_data.len(), //CHUNK_SIZE,
|
||||
Err(e) => {
|
||||
warn!("tx: {:?}", e);
|
||||
break
|
||||
}
|
||||
}
|
||||
}
|
||||
if buf.len() > 100 {
|
||||
// Too much input, consume all
|
||||
Poll::Ready((buf.len(), None))
|
||||
} else {
|
||||
Poll::Pending
|
||||
}
|
||||
})
|
||||
.await?;
|
||||
match name {
|
||||
Some(name) => stream.send(format!("Hello {}!\n", name).bytes()).await?,
|
||||
None => {
|
||||
stream
|
||||
.send("I had trouble reading your name.\n".bytes())
|
||||
.await?
|
||||
}
|
||||
});
|
||||
}
|
||||
let _ = stream.close().await;
|
||||
Ok(())
|
||||
}
|
||||
|
||||
let counter = alloc::rc::Rc::new(core::cell::RefCell::new(0));
|
||||
});
|
||||
let stats_rx = stats.clone();
|
||||
task::spawn(async move {
|
||||
while let Ok(stream) = TcpStream::accept(TCP_PORT, 2048, 2408).await {
|
||||
let counter = counter.clone();
|
||||
while let Ok(stream) = TcpStream::accept(TCP_PORT+1, 0x10_0000, 0x10_0000).await {
|
||||
let stats_rx = stats_rx.clone();
|
||||
task::spawn(async move {
|
||||
*counter.borrow_mut() += 1;
|
||||
println!("Serving {} connections", *counter.borrow());
|
||||
handle_connection(stream)
|
||||
.await
|
||||
.unwrap_or_else(|e| println!("Connection: {:?}", e));
|
||||
*counter.borrow_mut() -= 1;
|
||||
println!("Now serving {} connections", *counter.borrow());
|
||||
loop {
|
||||
match stream.recv(|buf| (buf.len(), buf.len())).await {
|
||||
Ok(len) => stats_rx.borrow_mut().0 += len,
|
||||
Err(e) => {
|
||||
warn!("rx: {:?}", e);
|
||||
break
|
||||
}
|
||||
}
|
||||
}
|
||||
});
|
||||
}
|
||||
});
|
||||
|
@ -258,10 +283,16 @@ pub fn main_core0() {
|
|||
loop {
|
||||
delay(&mut countdown, Milliseconds(1000)).await;
|
||||
|
||||
let timestamp = timer.get_us();
|
||||
let timestamp = timer.get_us().0;
|
||||
let seconds = timestamp / 1_000_000;
|
||||
let micros = timestamp % 1_000_000;
|
||||
info!("time: {:6}.{:06}s", seconds, micros);
|
||||
let (rx, tx) = {
|
||||
let mut stats = stats.borrow_mut();
|
||||
let result = *stats;
|
||||
*stats = (0, 0);
|
||||
result
|
||||
};
|
||||
info!("time: {:6}.{:06}s, rx: {}k/s, tx: {}k/s", seconds, micros, rx / 1024, tx / 1024);
|
||||
}
|
||||
});
|
||||
|
||||
|
@ -270,27 +301,18 @@ pub fn main_core0() {
|
|||
})
|
||||
}
|
||||
|
||||
static CORE1_REQ: Mutex<Option<sync_channel::Receiver<usize>>> = Mutex::new(None);
|
||||
static CORE1_RES: Mutex<Option<sync_channel::Sender<usize>>> = Mutex::new(None);
|
||||
static DONE: Mutex<bool> = Mutex::new(false);
|
||||
|
||||
#[no_mangle]
|
||||
pub fn main_core1() {
|
||||
println!("Hello from core1!");
|
||||
|
||||
let mut req = None;
|
||||
while req.is_none() {
|
||||
req = CORE1_REQ.lock().take();
|
||||
}
|
||||
let req = req.unwrap();
|
||||
let mut res = None;
|
||||
while res.is_none() {
|
||||
res = CORE1_RES.lock().take();
|
||||
}
|
||||
let mut res = res.unwrap();
|
||||
let mut interrupt_controller = gic::InterruptController::gic(mpcore::RegisterBlock::mpcore());
|
||||
interrupt_controller.enable_interrupts();
|
||||
let req = unsafe { &mut CORE1_REQ.1 };
|
||||
let res = unsafe { &mut CORE1_RES.0 };
|
||||
|
||||
for i in req {
|
||||
res.send(*i * *i);
|
||||
res.send(i * i);
|
||||
}
|
||||
|
||||
println!("core1 done!");
|
||||
|
|
|
@ -1,68 +0,0 @@
|
|||
#![cfg(feature = "target_zc706")]
|
||||
|
||||
use libboard_zynq::println;
|
||||
|
||||
mod zc706;
|
||||
// mod cora_z7_10;
|
||||
|
||||
#[cfg(feature = "target_zc706")]
|
||||
use zc706 as target;
|
||||
// #[cfg(feature = "target_cora_z7_10")]
|
||||
// use cora_z7_10 as target;
|
||||
|
||||
pub fn report_differences() {
|
||||
for (i, op) in target::INIT_DATA.iter().enumerate() {
|
||||
let address = op.address();
|
||||
let overwritten_later = target::INIT_DATA[(i + 1)..].iter()
|
||||
.any(|later_op| later_op.address() == address);
|
||||
|
||||
if !overwritten_later {
|
||||
op.report_difference();
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
pub enum InitOp {
|
||||
MaskWrite(usize, usize, usize),
|
||||
MaskPoll(usize, usize),
|
||||
}
|
||||
|
||||
impl InitOp {
|
||||
fn address(&self) -> usize {
|
||||
match self {
|
||||
InitOp::MaskWrite(address, _, _) => *address,
|
||||
InitOp::MaskPoll(address, _) => *address,
|
||||
}
|
||||
}
|
||||
|
||||
fn read(&self) -> usize {
|
||||
unsafe { *(self.address() as *const usize) }
|
||||
}
|
||||
|
||||
fn difference(&self) -> Option<(usize, usize)> {
|
||||
let (mask, expected) = match self {
|
||||
InitOp::MaskWrite(_, mask, expected) =>
|
||||
(*mask, *expected),
|
||||
InitOp::MaskPoll(_, mask) =>
|
||||
(*mask, *mask),
|
||||
};
|
||||
let actual = self.read();
|
||||
if actual & mask == expected {
|
||||
None
|
||||
} else {
|
||||
Some((actual & mask, expected))
|
||||
}
|
||||
}
|
||||
|
||||
pub fn report_difference(&self) {
|
||||
if let Some((actual, expected)) = self.difference() {
|
||||
println!(
|
||||
"Register {:08X} is {:08X}&={:08X} != {:08X} expected",
|
||||
self.address(),
|
||||
self.read(),
|
||||
actual,
|
||||
expected
|
||||
);
|
||||
}
|
||||
}
|
||||
}
|
|
@ -1,203 +0,0 @@
|
|||
use super::InitOp::{self, *};
|
||||
|
||||
pub const INIT_DATA: &'static [InitOp] = &[
|
||||
// ps7_mio_init_data_1_0
|
||||
MaskWrite(0xF8000B40, 0x00000FFF, 0x00000600),
|
||||
MaskWrite(0xF8000B44, 0x00000FFF, 0x00000600),
|
||||
MaskWrite(0xF8000B48, 0x00000FFF, 0x00000672),
|
||||
MaskWrite(0xF8000B4C, 0x00000FFF, 0x00000672),
|
||||
MaskWrite(0xF8000B50, 0x00000FFF, 0x00000674),
|
||||
MaskWrite(0xF8000B54, 0x00000FFF, 0x00000674),
|
||||
MaskWrite(0xF8000B58, 0x00000FFF, 0x00000600),
|
||||
MaskWrite(0xF8000B5C, 0xFFFFFFFF, 0x0018C61C),
|
||||
MaskWrite(0xF8000B60, 0xFFFFFFFF, 0x00F9861C),
|
||||
MaskWrite(0xF8000B64, 0xFFFFFFFF, 0x00F9861C),
|
||||
MaskWrite(0xF8000B68, 0xFFFFFFFF, 0x00F9861C),
|
||||
MaskWrite(0xF8000B6C, 0x000073FF, 0x00000209),
|
||||
MaskWrite(0xF8000B70, 0x00000021, 0x00000021),
|
||||
MaskWrite(0xF8000B70, 0x00000021, 0x00000020),
|
||||
MaskWrite(0xF8000B70, 0x07FFFFFF, 0x00000823),
|
||||
MaskWrite(0xF8000700, 0x00003FFF, 0x00000600),
|
||||
MaskWrite(0xF8000704, 0x00003FFF, 0x00000702),
|
||||
MaskWrite(0xF8000708, 0x00003FFF, 0x00000702),
|
||||
MaskWrite(0xF800070C, 0x00003FFF, 0x00000702),
|
||||
MaskWrite(0xF8000710, 0x00003FFF, 0x00000702),
|
||||
MaskWrite(0xF8000714, 0x00003FFF, 0x00000702),
|
||||
MaskWrite(0xF8000718, 0x00003FFF, 0x00000702),
|
||||
MaskWrite(0xF800071C, 0x00003FFF, 0x00000600),
|
||||
MaskWrite(0xF8000720, 0x00003FFF, 0x00000700),
|
||||
MaskWrite(0xF8000724, 0x00003FFF, 0x00000600),
|
||||
MaskWrite(0xF8000728, 0x00003FFF, 0x00000600),
|
||||
MaskWrite(0xF800072C, 0x00003FFF, 0x00000600),
|
||||
MaskWrite(0xF8000730, 0x00003FFF, 0x00000600),
|
||||
MaskWrite(0xF8000734, 0x00003FFF, 0x00000600),
|
||||
MaskWrite(0xF8000738, 0x00003FFF, 0x00000600),
|
||||
MaskWrite(0xF800073C, 0x00003FFF, 0x00000600),
|
||||
MaskWrite(0xF8000740, 0x00003FFF, 0x00000302),
|
||||
MaskWrite(0xF8000744, 0x00003FFF, 0x00000302),
|
||||
MaskWrite(0xF8000748, 0x00003FFF, 0x00000302),
|
||||
MaskWrite(0xF800074C, 0x00003FFF, 0x00000302),
|
||||
MaskWrite(0xF8000750, 0x00003FFF, 0x00000302),
|
||||
MaskWrite(0xF8000754, 0x00003FFF, 0x00000302),
|
||||
MaskWrite(0xF8000758, 0x00003FFF, 0x00000303),
|
||||
MaskWrite(0xF800075C, 0x00003FFF, 0x00000303),
|
||||
MaskWrite(0xF8000760, 0x00003FFF, 0x00000303),
|
||||
MaskWrite(0xF8000764, 0x00003FFF, 0x00000303),
|
||||
MaskWrite(0xF8000768, 0x00003FFF, 0x00000303),
|
||||
MaskWrite(0xF800076C, 0x00003FFF, 0x00000303),
|
||||
MaskWrite(0xF8000770, 0x00003FFF, 0x00000304),
|
||||
MaskWrite(0xF8000774, 0x00003FFF, 0x00000305),
|
||||
MaskWrite(0xF8000778, 0x00003FFF, 0x00000304),
|
||||
MaskWrite(0xF800077C, 0x00003FFF, 0x00000305),
|
||||
MaskWrite(0xF8000780, 0x00003FFF, 0x00000304),
|
||||
MaskWrite(0xF8000784, 0x00003FFF, 0x00000304),
|
||||
MaskWrite(0xF8000788, 0x00003FFF, 0x00000304),
|
||||
MaskWrite(0xF800078C, 0x00003FFF, 0x00000304),
|
||||
MaskWrite(0xF8000790, 0x00003FFF, 0x00000305),
|
||||
MaskWrite(0xF8000794, 0x00003FFF, 0x00000304),
|
||||
MaskWrite(0xF8000798, 0x00003FFF, 0x00000304),
|
||||
MaskWrite(0xF800079C, 0x00003FFF, 0x00000304),
|
||||
MaskWrite(0xF80007A0, 0x00003FFF, 0x00000380),
|
||||
MaskWrite(0xF80007A4, 0x00003FFF, 0x00000380),
|
||||
MaskWrite(0xF80007A8, 0x00003FFF, 0x00000380),
|
||||
MaskWrite(0xF80007AC, 0x00003FFF, 0x00000380),
|
||||
MaskWrite(0xF80007B0, 0x00003FFF, 0x00000380),
|
||||
MaskWrite(0xF80007B4, 0x00003FFF, 0x00000380),
|
||||
MaskWrite(0xF80007B8, 0x00003F01, 0x00000201),
|
||||
MaskWrite(0xF80007BC, 0x00003F01, 0x00000201),
|
||||
MaskWrite(0xF80007C0, 0x00003FFF, 0x000002E0),
|
||||
MaskWrite(0xF80007C4, 0x00003FFF, 0x000002E1),
|
||||
MaskWrite(0xF80007C8, 0x00003FFF, 0x00000200),
|
||||
MaskWrite(0xF80007CC, 0x00003FFF, 0x00000200),
|
||||
MaskWrite(0xF80007D0, 0x00003FFF, 0x00000280),
|
||||
MaskWrite(0xF80007D4, 0x00003FFF, 0x00000280),
|
||||
MaskWrite(0xF8000830, 0x003F003F, 0x002F002E),
|
||||
// ps7_pll_init_data_1_0
|
||||
MaskWrite(0xF8000110, 0x003FFFF0, 0x000FA220),
|
||||
MaskWrite(0xF8000100, 0x0007F000, 0x00028000),
|
||||
MaskWrite(0xF8000100, 0x00000010, 0x00000010),
|
||||
MaskWrite(0xF8000100, 0x00000001, 0x00000001),
|
||||
MaskWrite(0xF8000100, 0x00000001, 0x00000000),
|
||||
MaskPoll(0xF800010C, 0x00000001),
|
||||
MaskWrite(0xF8000100, 0x00000010, 0x00000000),
|
||||
MaskWrite(0xF8000120, 0x1F003F30, 0x1F000200),
|
||||
MaskWrite(0xF8000114, 0x003FFFF0, 0x0012C220),
|
||||
MaskWrite(0xF8000104, 0x0007F000, 0x00020000),
|
||||
MaskWrite(0xF8000104, 0x00000010, 0x00000010),
|
||||
MaskWrite(0xF8000104, 0x00000001, 0x00000001),
|
||||
MaskWrite(0xF8000104, 0x00000001, 0x00000000),
|
||||
MaskPoll(0xF800010C, 0x00000002),
|
||||
MaskWrite(0xF8000104, 0x00000010, 0x00000000),
|
||||
MaskWrite(0xF8000124, 0xFFF00003, 0x0C200003),
|
||||
MaskWrite(0xF8000118, 0x003FFFF0, 0x001452C0),
|
||||
MaskWrite(0xF8000108, 0x0007F000, 0x0001E000),
|
||||
MaskWrite(0xF8000108, 0x00000010, 0x00000010),
|
||||
MaskWrite(0xF8000108, 0x00000001, 0x00000001),
|
||||
MaskWrite(0xF8000108, 0x00000001, 0x00000000),
|
||||
MaskPoll(0xF800010C, 0x00000004),
|
||||
MaskWrite(0xF8000108, 0x00000010, 0x00000000),
|
||||
// ps7_clock_init_data_1_0
|
||||
MaskWrite(0xF8000128, 0x03F03F01, 0x00700F01),
|
||||
MaskWrite(0xF8000138, 0x00000011, 0x00000001),
|
||||
MaskWrite(0xF8000140, 0x03F03F71, 0x00100801),
|
||||
MaskWrite(0xF800014C, 0x00003F31, 0x00000501),
|
||||
MaskWrite(0xF8000150, 0x00003F33, 0x00001401),
|
||||
MaskWrite(0xF8000154, 0x00003F33, 0x00001402),
|
||||
MaskWrite(0xF8000168, 0x00003F31, 0x00000501),
|
||||
MaskWrite(0xF8000170, 0x03F03F30, 0x00200400),
|
||||
MaskWrite(0xF80001C4, 0x00000001, 0x00000001),
|
||||
MaskWrite(0xF800012C, 0x01FFCCCD, 0x01EC044D),
|
||||
// ps7_ddr_init_data_1_0
|
||||
MaskWrite(0xF8006000, 0x0001FFFF, 0x00000080),
|
||||
MaskWrite(0xF8006004, 0x1FFFFFFF, 0x00081081),
|
||||
MaskWrite(0xF8006008, 0x03FFFFFF, 0x03C0780F),
|
||||
MaskWrite(0xF800600C, 0x03FFFFFF, 0x02001001),
|
||||
MaskWrite(0xF8006010, 0x03FFFFFF, 0x00014001),
|
||||
MaskWrite(0xF8006014, 0x001FFFFF, 0x0004159B),
|
||||
MaskWrite(0xF8006018, 0xF7FFFFFF, 0x452460D2),
|
||||
MaskWrite(0xF800601C, 0xFFFFFFFF, 0x720238E5),
|
||||
MaskWrite(0xF8006020, 0xFFFFFFFC, 0x272872D0),
|
||||
MaskWrite(0xF8006024, 0x0FFFFFFF, 0x0000003C),
|
||||
MaskWrite(0xF8006028, 0x00003FFF, 0x00002007),
|
||||
MaskWrite(0xF800602C, 0xFFFFFFFF, 0x00000008),
|
||||
MaskWrite(0xF8006030, 0xFFFFFFFF, 0x00040930),
|
||||
MaskWrite(0xF8006034, 0x13FF3FFF, 0x000116D4),
|
||||
MaskWrite(0xF8006038, 0x00001FC3, 0x00000000),
|
||||
MaskWrite(0xF800603C, 0x000FFFFF, 0x00000777),
|
||||
MaskWrite(0xF8006040, 0xFFFFFFFF, 0xFFF00000),
|
||||
MaskWrite(0xF8006044, 0x0FFFFFFF, 0x0FF66666),
|
||||
MaskWrite(0xF8006048, 0x3FFFFFFF, 0x0003C248),
|
||||
MaskWrite(0xF8006050, 0xFF0F8FFF, 0x77010800),
|
||||
MaskWrite(0xF8006058, 0x0001FFFF, 0x00000101),
|
||||
MaskWrite(0xF800605C, 0x0000FFFF, 0x00005003),
|
||||
MaskWrite(0xF8006060, 0x000017FF, 0x0000003E),
|
||||
MaskWrite(0xF8006064, 0x00021FE0, 0x00020000),
|
||||
MaskWrite(0xF8006068, 0x03FFFFFF, 0x00284141),
|
||||
MaskWrite(0xF800606C, 0x0000FFFF, 0x00001610),
|
||||
MaskWrite(0xF80060A0, 0x00FFFFFF, 0x00008000),
|
||||
MaskWrite(0xF80060A4, 0xFFFFFFFF, 0x10200802),
|
||||
MaskWrite(0xF80060A8, 0x0FFFFFFF, 0x0690CB73),
|
||||
MaskWrite(0xF80060AC, 0x000001FF, 0x000001FE),
|
||||
MaskWrite(0xF80060B0, 0x1FFFFFFF, 0x1CFFFFFF),
|
||||
MaskWrite(0xF80060B4, 0x000007FF, 0x00000200),
|
||||
MaskWrite(0xF80060B8, 0x01FFFFFF, 0x00200066),
|
||||
MaskWrite(0xF80060C4, 0x00000003, 0x00000000),
|
||||
MaskWrite(0xF80060C8, 0x000000FF, 0x00000000),
|
||||
MaskWrite(0xF80060DC, 0x00000001, 0x00000000),
|
||||
MaskWrite(0xF80060F0, 0x0000FFFF, 0x00000000),
|
||||
MaskWrite(0xF80060F4, 0x0000000F, 0x00000008),
|
||||
MaskWrite(0xF8006114, 0x000000FF, 0x00000000),
|
||||
MaskWrite(0xF8006118, 0x7FFFFFFF, 0x40000001),
|
||||
MaskWrite(0xF800611C, 0x7FFFFFFF, 0x40000001),
|
||||
MaskWrite(0xF8006120, 0x7FFFFFFF, 0x40000001),
|
||||
MaskWrite(0xF8006124, 0x7FFFFFFF, 0x40000001),
|
||||
MaskWrite(0xF800612C, 0x000FFFFF, 0x00033C03),
|
||||
MaskWrite(0xF8006130, 0x000FFFFF, 0x00034003),
|
||||
MaskWrite(0xF8006134, 0x000FFFFF, 0x0002F400),
|
||||
MaskWrite(0xF8006138, 0x000FFFFF, 0x00030400),
|
||||
MaskWrite(0xF8006140, 0x000FFFFF, 0x00000035),
|
||||
MaskWrite(0xF8006144, 0x000FFFFF, 0x00000035),
|
||||
MaskWrite(0xF8006148, 0x000FFFFF, 0x00000035),
|
||||
MaskWrite(0xF800614C, 0x000FFFFF, 0x00000035),
|
||||
MaskWrite(0xF8006154, 0x000FFFFF, 0x00000083),
|
||||
MaskWrite(0xF8006158, 0x000FFFFF, 0x00000083),
|
||||
MaskWrite(0xF800615C, 0x000FFFFF, 0x00000080),
|
||||
MaskWrite(0xF8006160, 0x000FFFFF, 0x00000080),
|
||||
MaskWrite(0xF8006168, 0x001FFFFF, 0x00000124),
|
||||
MaskWrite(0xF800616C, 0x001FFFFF, 0x00000125),
|
||||
MaskWrite(0xF8006170, 0x001FFFFF, 0x00000112),
|
||||
MaskWrite(0xF8006174, 0x001FFFFF, 0x00000116),
|
||||
MaskWrite(0xF800617C, 0x000FFFFF, 0x000000C3),
|
||||
MaskWrite(0xF8006180, 0x000FFFFF, 0x000000C3),
|
||||
MaskWrite(0xF8006184, 0x000FFFFF, 0x000000C0),
|
||||
MaskWrite(0xF8006188, 0x000FFFFF, 0x000000C0),
|
||||
MaskWrite(0xF8006190, 0xFFFFFFFF, 0x10040080),
|
||||
MaskWrite(0xF8006194, 0x000FFFFF, 0x0001FC82),
|
||||
MaskWrite(0xF8006204, 0xFFFFFFFF, 0x00000000),
|
||||
MaskWrite(0xF8006208, 0x000F03FF, 0x000803FF),
|
||||
MaskWrite(0xF800620C, 0x000F03FF, 0x000803FF),
|
||||
MaskWrite(0xF8006210, 0x000F03FF, 0x000803FF),
|
||||
MaskWrite(0xF8006214, 0x000F03FF, 0x000803FF),
|
||||
MaskWrite(0xF8006218, 0x000F03FF, 0x000003FF),
|
||||
MaskWrite(0xF800621C, 0x000F03FF, 0x000003FF),
|
||||
MaskWrite(0xF8006220, 0x000F03FF, 0x000003FF),
|
||||
MaskWrite(0xF8006224, 0x000F03FF, 0x000003FF),
|
||||
MaskWrite(0xF80062A8, 0x00000FF7, 0x00000000),
|
||||
MaskWrite(0xF80062AC, 0xFFFFFFFF, 0x00000000),
|
||||
MaskWrite(0xF80062B0, 0x003FFFFF, 0x00005125),
|
||||
MaskWrite(0xF80062B4, 0x0003FFFF, 0x000012A8),
|
||||
MaskPoll(0xF8000B74, 0x00002000),
|
||||
MaskWrite(0xF8006000, 0x0001FFFF, 0x00000081),
|
||||
MaskPoll(0xF8006054, 0x00000007),
|
||||
// ps7_peripherals_init_data_1_0
|
||||
MaskWrite(0xF8000B48, 0x00000180, 0x00000180),
|
||||
MaskWrite(0xF8000B4C, 0x00000180, 0x00000180),
|
||||
MaskWrite(0xF8000B50, 0x00000180, 0x00000180),
|
||||
MaskWrite(0xF8000B54, 0x00000180, 0x00000180),
|
||||
MaskWrite(0xE0001034, 0x000000FF, 0x00000006),
|
||||
MaskWrite(0xE0001018, 0x0000FFFF, 0x0000003E),
|
||||
MaskWrite(0xE0001000, 0x000001FF, 0x00000017),
|
||||
MaskWrite(0xE0001004, 0x00000FFF, 0x00000020),
|
||||
MaskWrite(0xE000D000, 0x00080000, 0x00080000),
|
||||
MaskWrite(0xF8007000, 0x20000000, 0x00000000),
|
||||
];
|
|
@ -0,0 +1,44 @@
|
|||
{
|
||||
"nodes": {
|
||||
"mozilla-overlay": {
|
||||
"flake": false,
|
||||
"locked": {
|
||||
"lastModified": 1704373101,
|
||||
"narHash": "sha256-+gi59LRWRQmwROrmE1E2b3mtocwueCQqZ60CwLG+gbg=",
|
||||
"owner": "mozilla",
|
||||
"repo": "nixpkgs-mozilla",
|
||||
"rev": "9b11a87c0cc54e308fa83aac5b4ee1816d5418a2",
|
||||
"type": "github"
|
||||
},
|
||||
"original": {
|
||||
"owner": "mozilla",
|
||||
"repo": "nixpkgs-mozilla",
|
||||
"type": "github"
|
||||
}
|
||||
},
|
||||
"nixpkgs": {
|
||||
"locked": {
|
||||
"lastModified": 1715087517,
|
||||
"narHash": "sha256-CLU5Tsg24Ke4+7sH8azHWXKd0CFd4mhLWfhYgUiDBpQ=",
|
||||
"owner": "NixOS",
|
||||
"repo": "nixpkgs",
|
||||
"rev": "b211b392b8486ee79df6cdfb1157ad2133427a29",
|
||||
"type": "github"
|
||||
},
|
||||
"original": {
|
||||
"owner": "NixOS",
|
||||
"ref": "nixos-unstable",
|
||||
"repo": "nixpkgs",
|
||||
"type": "github"
|
||||
}
|
||||
},
|
||||
"root": {
|
||||
"inputs": {
|
||||
"mozilla-overlay": "mozilla-overlay",
|
||||
"nixpkgs": "nixpkgs"
|
||||
}
|
||||
}
|
||||
},
|
||||
"root": "root",
|
||||
"version": 7
|
||||
}
|
|
@ -0,0 +1,172 @@
|
|||
{
|
||||
description = "Bare-metal Rust on Zynq-7000";
|
||||
|
||||
inputs.nixpkgs.url = github:NixOS/nixpkgs/nixos-unstable;
|
||||
inputs.mozilla-overlay = { url = github:mozilla/nixpkgs-mozilla; flake = false; };
|
||||
|
||||
outputs = { self, nixpkgs, mozilla-overlay }:
|
||||
let
|
||||
pkgs = import nixpkgs { system = "x86_64-linux"; overlays = [ (import mozilla-overlay) crosspkgs-overlay ]; };
|
||||
|
||||
rustManifest = pkgs.fetchurl {
|
||||
url = "https://static.rust-lang.org/dist/2021-01-29/channel-rust-nightly.toml";
|
||||
sha256 = "sha256-EZKgw89AH4vxaJpUHmIMzMW/80wAFQlfcxRoBD9nz0c=";
|
||||
};
|
||||
rustTargets = [];
|
||||
rustChannelOfTargets = _channel: _date: targets:
|
||||
(pkgs.lib.rustLib.fromManifestFile rustManifest {
|
||||
inherit (pkgs) stdenv lib fetchurl patchelf;
|
||||
}).rust.override {
|
||||
inherit targets;
|
||||
extensions = ["rust-src"];
|
||||
};
|
||||
rust = rustChannelOfTargets "nightly" null rustTargets;
|
||||
rustPlatform = pkgs.recurseIntoAttrs (pkgs.makeRustPlatform {
|
||||
rustc = rust;
|
||||
cargo = rust;
|
||||
});
|
||||
|
||||
crosspkgs-overlay = (self: super: {
|
||||
pkgsCross = super.pkgsCross // {
|
||||
zynq-baremetal = import super.path {
|
||||
system = "x86_64-linux";
|
||||
crossSystem = {
|
||||
config = "arm-none-eabihf";
|
||||
libc = "newlib";
|
||||
gcc.cpu = "cortex-a9";
|
||||
gcc.fpu = "vfpv3";
|
||||
};
|
||||
};
|
||||
};
|
||||
});
|
||||
|
||||
mkbootimage = pkgs.stdenv.mkDerivation {
|
||||
pname = "mkbootimage";
|
||||
version = "2.3dev";
|
||||
|
||||
src = pkgs.fetchFromGitHub {
|
||||
owner = "antmicro";
|
||||
repo = "zynq-mkbootimage";
|
||||
rev = "872363ce32c249f8278cf107bc6d3bdeb38d849f";
|
||||
sha256 = "sha256-5FPyAhUWZDwHbqmp9J2ZXTmjaXPz+dzrJMolaNwADHs=";
|
||||
};
|
||||
|
||||
propagatedBuildInputs = [ pkgs.libelf pkgs.pcre ];
|
||||
patchPhase =
|
||||
''
|
||||
substituteInPlace Makefile --replace "git rev-parse --short HEAD" "echo nix"
|
||||
'';
|
||||
installPhase =
|
||||
''
|
||||
mkdir -p $out/bin
|
||||
cp mkbootimage $out/bin
|
||||
'';
|
||||
hardeningDisable = [ "fortify" ];
|
||||
};
|
||||
|
||||
fsbl = { board ? "zc706" }: pkgs.stdenv.mkDerivation {
|
||||
name = "${board}-fsbl";
|
||||
src = pkgs.fetchFromGitHub {
|
||||
owner = "Xilinx";
|
||||
repo = "embeddedsw";
|
||||
rev = "xilinx_v2022.2";
|
||||
sha256 = "sha256-UDz9KK/Hw3qM1BAeKif30rE8Bi6C2uvuZlvyvtJCMfw=";
|
||||
};
|
||||
nativeBuildInputs = [
|
||||
pkgs.pkgsCross.zynq-baremetal.buildPackages.binutils
|
||||
pkgs.pkgsCross.zynq-baremetal.buildPackages.gcc
|
||||
];
|
||||
patchPhase = ''
|
||||
patchShebangs lib/sw_apps/zynq_fsbl/misc/copy_bsp.sh
|
||||
|
||||
for x in lib/sw_apps/zynq_fsbl/src/Makefile lib/sw_apps/zynq_fsbl/misc/copy_bsp.sh lib/bsp/standalone/src/arm/cortexa9/gcc/Makefile; do
|
||||
substituteInPlace $x \
|
||||
--replace "arm-none-eabi-" "arm-none-eabihf-"
|
||||
done
|
||||
'';
|
||||
buildPhase = ''
|
||||
cd lib/sw_apps/zynq_fsbl/src
|
||||
make BOARD=${board} "CFLAGS=-DFSBL_DEBUG_INFO -g"
|
||||
'';
|
||||
installPhase = ''
|
||||
mkdir $out
|
||||
cp fsbl.elf $out
|
||||
'';
|
||||
doCheck = false;
|
||||
dontFixup = true;
|
||||
};
|
||||
|
||||
cargo-xbuild = pkgs.cargo-xbuild.overrideAttrs(oa: {
|
||||
postPatch = "substituteInPlace src/sysroot.rs --replace 2021 2018";
|
||||
});
|
||||
|
||||
build-crate = name: crate: features: rustPlatform.buildRustPackage rec {
|
||||
name = "${crate}";
|
||||
|
||||
src = builtins.filterSource (path: type:
|
||||
baseNameOf path != "target"
|
||||
) ./.;
|
||||
cargoLock = { lockFile = ./Cargo.lock; };
|
||||
|
||||
nativeBuildInputs = [ cargo-xbuild pkgs.llvmPackages_14.clang-unwrapped ];
|
||||
buildPhase = ''
|
||||
export XARGO_RUST_SRC="${rust}/lib/rustlib/src/rust/library"
|
||||
export CARGO_HOME=$(mktemp -d cargo-home.XXX)
|
||||
pushd ${crate}
|
||||
cargo xbuild --release --frozen \
|
||||
--no-default-features \
|
||||
--features=${features}
|
||||
popd
|
||||
'';
|
||||
|
||||
installPhase = ''
|
||||
mkdir -p $out $out/nix-support
|
||||
cp target/armv7-none-eabihf/release/${name} $out/${name}.elf
|
||||
echo file binary-dist $out/${name}.elf >> $out/nix-support/hydra-build-products
|
||||
'';
|
||||
|
||||
doCheck = false;
|
||||
dontFixup = true;
|
||||
auditable = false;
|
||||
};
|
||||
|
||||
targetCrates = target: {
|
||||
"${target}-experiments" = build-crate "${target}-experiments" "experiments" "target_${target}";
|
||||
"${target}-szl" = build-crate "${target}-szl" "szl" "target_${target}";
|
||||
};
|
||||
targets = ["zc706" "coraz7" "redpitaya" "kasli_soc"];
|
||||
allTargetCrates = (builtins.foldl' (results: target:
|
||||
results // targetCrates target
|
||||
) {} targets);
|
||||
|
||||
szl = pkgs.runCommand "szl" {} (builtins.foldl' (commands: target:
|
||||
let
|
||||
szlResult = builtins.getAttr "${target}-szl" allTargetCrates;
|
||||
in
|
||||
commands + "ln -s ${szlResult}/szl.elf $out/szl-${target}.elf\n"
|
||||
) "mkdir $out\n" targets);
|
||||
in rec {
|
||||
packages.x86_64-linux = {
|
||||
inherit cargo-xbuild szl mkbootimage;
|
||||
zc706-fsbl = fsbl { board = "zc706"; };
|
||||
} // allTargetCrates ;
|
||||
|
||||
hydraJobs = packages.x86_64-linux;
|
||||
|
||||
inherit rust rustPlatform;
|
||||
|
||||
devShell.x86_64-linux = pkgs.mkShell {
|
||||
name = "zynq-rs-dev-shell";
|
||||
buildInputs = [
|
||||
rust
|
||||
cargo-xbuild
|
||||
mkbootimage
|
||||
|
||||
pkgs.openocd pkgs.gdb
|
||||
pkgs.openssh pkgs.rsync
|
||||
pkgs.llvmPackages_14.clang-unwrapped
|
||||
(pkgs.python3.withPackages(ps: [ ps.pyftdi ]))
|
||||
];
|
||||
};
|
||||
};
|
||||
}
|
|
@ -0,0 +1,17 @@
|
|||
from time import sleep
|
||||
from pyftdi.ftdi import Ftdi
|
||||
|
||||
POR = 1 << 7
|
||||
|
||||
def main():
|
||||
dev = Ftdi()
|
||||
dev.open_bitbang_from_url("ftdi://ftdi:4232h/0")
|
||||
dev.set_bitmode(POR, Ftdi.BitMode.BITBANG)
|
||||
dev.write_data(bytes([0]))
|
||||
sleep(0.1)
|
||||
dev.write_data(bytes([POR]))
|
||||
sleep(0.1)
|
||||
dev.close()
|
||||
|
||||
if __name__ == "__main__":
|
||||
main()
|
|
@ -2,17 +2,17 @@
|
|||
name = "libasync"
|
||||
description = "low-level async support"
|
||||
version = "0.0.0"
|
||||
authors = ["Astro <astro@spaceboyz.net>"]
|
||||
authors = ["M-Labs"]
|
||||
edition = "2018"
|
||||
|
||||
[dependencies]
|
||||
#futures = { version = "0.3", default-features = false }
|
||||
pin-utils = "0.1.0-alpha.4"
|
||||
embedded-hal = "0.2"
|
||||
nb = "0.1"
|
||||
nb = "1.0"
|
||||
libcortex_a9 = { path = "../libcortex_a9" }
|
||||
|
||||
[dependencies.smoltcp]
|
||||
version = "0.6"
|
||||
version = "0.7"
|
||||
default-features = false
|
||||
features = ["alloc"]
|
||||
|
|
|
@ -6,7 +6,7 @@ use core::{
|
|||
sync::atomic::{AtomicBool, Ordering},
|
||||
task::{Context, Poll, RawWaker, RawWakerVTable, Waker},
|
||||
};
|
||||
use alloc::{boxed::Box, collections::VecDeque as Deque};
|
||||
use alloc::{boxed::Box, vec::Vec};
|
||||
//use futures::future::FutureExt;
|
||||
use pin_utils::pin_mut;
|
||||
|
||||
|
@ -31,7 +31,7 @@ static VTABLE: RawWakerVTable = {
|
|||
/// ready should not move as long as this waker references it. That is
|
||||
/// the reason for keeping Tasks in a pinned box.
|
||||
fn wrap_waker(ready: &AtomicBool) -> Waker {
|
||||
unsafe { Waker::from_raw(RawWaker::new(ready as *const _ as *const _, &VTABLE)) }
|
||||
unsafe { Waker::from_raw(RawWaker::new(ready as *const _ as *const (), &VTABLE)) }
|
||||
}
|
||||
|
||||
/// A single-threaded executor
|
||||
|
@ -44,7 +44,7 @@ pub struct Executor {
|
|||
/// Tasks reside on the heap, so that we just queue pointers. They
|
||||
/// must also be pinned in memory because our RawWaker is a pointer
|
||||
/// to their `ready` field.
|
||||
tasks: RefCell<Deque<Pin<Box<Task>>>>,
|
||||
tasks: RefCell<Vec<Pin<Box<Task>>>>,
|
||||
}
|
||||
|
||||
impl Executor {
|
||||
|
@ -52,7 +52,7 @@ impl Executor {
|
|||
pub fn new() -> Self {
|
||||
Self {
|
||||
in_block_on: RefCell::new(false),
|
||||
tasks: RefCell::new(Deque::new()),
|
||||
tasks: RefCell::new(Vec::new()),
|
||||
}
|
||||
}
|
||||
|
||||
|
@ -72,6 +72,7 @@ impl Executor {
|
|||
pin_mut!(f);
|
||||
let ready = AtomicBool::new(true);
|
||||
let waker = wrap_waker(&ready);
|
||||
let mut backup = Vec::new();
|
||||
let val = loop {
|
||||
// advance the main task
|
||||
if ready.load(Ordering::Relaxed) {
|
||||
|
@ -85,10 +86,9 @@ impl Executor {
|
|||
// println!("ran block_on");
|
||||
}
|
||||
|
||||
// println!("tasks: {}", self.tasks.borrow().len());
|
||||
// advance other tasks
|
||||
let next_task = self.tasks.borrow_mut().pop_front();
|
||||
if let Some(mut task) = next_task {
|
||||
// advance all tasks
|
||||
core::mem::swap(&mut *self.tasks.borrow_mut(), &mut backup);
|
||||
for mut task in backup.drain(..) {
|
||||
// NOTE we don't need a CAS operation here because `wake` invocations that come from
|
||||
// interrupt handlers (the only source of 'race conditions' (!= data races)) are
|
||||
// "oneshot": they'll issue a `wake` and then disable themselves to not run again
|
||||
|
@ -106,7 +106,7 @@ impl Executor {
|
|||
}
|
||||
}
|
||||
// Requeue
|
||||
self.tasks.borrow_mut().push_back(task);
|
||||
self.tasks.borrow_mut().push(task);
|
||||
}
|
||||
|
||||
// // try to sleep; this will be a no-op if any of the previous tasks generated a SEV or an
|
||||
|
@ -119,7 +119,7 @@ impl Executor {
|
|||
|
||||
pub fn spawn(&self, f: impl Future + 'static) {
|
||||
let task = Box::pin(Task::new(f));
|
||||
self.tasks.borrow_mut().push_back(task);
|
||||
self.tasks.borrow_mut().push(task);
|
||||
}
|
||||
}
|
||||
|
||||
|
|
|
@ -7,17 +7,23 @@ use smoltcp::{
|
|||
iface::EthernetInterface,
|
||||
phy::Device,
|
||||
socket::SocketSet,
|
||||
time::Instant,
|
||||
time::{Duration, Instant},
|
||||
};
|
||||
use crate::task;
|
||||
|
||||
mod tcp_stream;
|
||||
pub use tcp_stream::TcpStream;
|
||||
|
||||
pub trait LinkCheck {
|
||||
type Link;
|
||||
fn is_idle(&self) -> bool;
|
||||
fn check_link_change(&mut self) -> Option<Self::Link>;
|
||||
}
|
||||
|
||||
static mut SOCKETS: Option<Sockets> = None;
|
||||
|
||||
pub struct Sockets {
|
||||
sockets: RefCell<SocketSet<'static, 'static, 'static>>,
|
||||
sockets: RefCell<SocketSet<'static>>,
|
||||
wakers: RefCell<Vec<Waker>>,
|
||||
}
|
||||
|
||||
|
@ -30,7 +36,7 @@ impl Sockets {
|
|||
let sockets = RefCell::new(SocketSet::new(sockets_storage));
|
||||
|
||||
let wakers = RefCell::new(Vec::new());
|
||||
|
||||
|
||||
let instance = Sockets {
|
||||
sockets,
|
||||
wakers,
|
||||
|
@ -41,14 +47,24 @@ impl Sockets {
|
|||
|
||||
/// Block and run executor indefinitely while polling the smoltcp
|
||||
/// iface
|
||||
pub fn run<'b, 'c, 'e, D: for<'d> Device<'d>>(
|
||||
iface: &mut EthernetInterface<'b, 'c, 'e, D>,
|
||||
pub fn run<'b, D: for<'d> Device<'d> + LinkCheck>(
|
||||
iface: &mut EthernetInterface<'b, D>,
|
||||
mut get_time: impl FnMut() -> Instant,
|
||||
) -> ! {
|
||||
task::block_on(async {
|
||||
let mut last_link_check = Instant::from_millis(0);
|
||||
const LINK_CHECK_INTERVAL: u64 = 500;
|
||||
|
||||
loop {
|
||||
let instant = get_time();
|
||||
Self::instance().poll(iface, instant);
|
||||
|
||||
let dev = iface.device_mut();
|
||||
if dev.is_idle() && instant >= last_link_check + Duration::from_millis(LINK_CHECK_INTERVAL) {
|
||||
dev.check_link_change();
|
||||
last_link_check = instant;
|
||||
}
|
||||
|
||||
task::r#yield().await;
|
||||
}
|
||||
})
|
||||
|
@ -57,10 +73,10 @@ impl Sockets {
|
|||
pub(crate) fn instance() -> &'static Self {
|
||||
unsafe { SOCKETS.as_ref().expect("Sockets") }
|
||||
}
|
||||
|
||||
fn poll<'b, 'c, 'e, D: for<'d> Device<'d>>(
|
||||
|
||||
fn poll<'b, D: for<'d> Device<'d>>(
|
||||
&self,
|
||||
iface: &mut EthernetInterface<'b, 'c, 'e, D>,
|
||||
iface: &mut EthernetInterface<'b, D>,
|
||||
instant: Instant
|
||||
) {
|
||||
let processed = {
|
||||
|
@ -81,7 +97,14 @@ impl Sockets {
|
|||
/// TODO: this was called through eg. TcpStream, another poll()
|
||||
/// might want to send packets before sleeping for an interrupt.
|
||||
pub(crate) fn register_waker(waker: Waker) {
|
||||
Self::instance().wakers.borrow_mut()
|
||||
.push(waker);
|
||||
let mut wakers = Self::instance().wakers.borrow_mut();
|
||||
for (i, w) in wakers.iter().enumerate() {
|
||||
if w.will_wake(&waker) {
|
||||
let last = wakers.len() - 1;
|
||||
wakers.swap(i, last);
|
||||
return;
|
||||
}
|
||||
}
|
||||
wakers.push(waker);
|
||||
}
|
||||
}
|
||||
|
|
|
@ -103,21 +103,19 @@ impl TcpStream {
|
|||
|
||||
/// Probe the receive buffer
|
||||
///
|
||||
/// Instead of handing you the data on the heap all at once,
|
||||
/// smoltcp's read interface is wrapped so that your callback can
|
||||
/// just return `Poll::Pending` if there is not enough data
|
||||
/// yet. Likewise, return the amount of bytes consumed from the
|
||||
/// buffer in the `Poll::Ready` result.
|
||||
/// Your callback will only be called when there is some data available,
|
||||
/// and it must consume at least one byte. It returns a tuple with the
|
||||
/// number of bytes it consumed, and a user-defined return value of type R.
|
||||
pub async fn recv<F, R>(&self, f: F) -> Result<R>
|
||||
where
|
||||
F: Fn(&[u8]) -> Poll<(usize, R)>,
|
||||
F: Fn(&[u8]) -> (usize, R),
|
||||
{
|
||||
struct Recv<'a, F: FnOnce(&[u8]) -> Poll<(usize, R)>, R> {
|
||||
struct Recv<'a, F: FnOnce(&[u8]) -> (usize, R), R> {
|
||||
stream: &'a TcpStream,
|
||||
f: F,
|
||||
}
|
||||
|
||||
impl<'a, F: Fn(&[u8]) -> Poll<(usize, R)>, R> Future for Recv<'a, F, R> {
|
||||
impl<'a, F: Fn(&[u8]) -> (usize, R), R> Future for Recv<'a, F, R> {
|
||||
type Output = Result<R>;
|
||||
|
||||
fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
|
||||
|
@ -128,13 +126,9 @@ impl TcpStream {
|
|||
|
||||
socket.recv(|buf| {
|
||||
if buf.len() > 0 {
|
||||
match (self.f)(buf) {
|
||||
Poll::Ready((amount, result)) =>
|
||||
(amount, Poll::Ready(Ok(result))),
|
||||
Poll::Pending =>
|
||||
// 0 bytes consumed
|
||||
(0, Poll::Pending),
|
||||
}
|
||||
let (amount, result) = (self.f)(buf);
|
||||
assert!(amount > 0);
|
||||
(amount, Poll::Ready(Ok(result)))
|
||||
} else {
|
||||
(0, Poll::Pending)
|
||||
}
|
||||
|
@ -268,6 +262,14 @@ impl TcpStream {
|
|||
pub fn set_timeout(&mut self, duration: Option<Duration>) {
|
||||
self.with_socket(|mut socket| socket.set_timeout(duration));
|
||||
}
|
||||
|
||||
pub fn ack_delay(&self) -> Option<Duration> {
|
||||
self.with_socket(|socket| socket.ack_delay())
|
||||
}
|
||||
|
||||
pub fn set_ack_delay(&mut self, duration: Option<Duration>) {
|
||||
self.with_socket(|mut socket| socket.set_ack_delay(duration));
|
||||
}
|
||||
}
|
||||
|
||||
impl Drop for TcpStream {
|
||||
|
|
|
@ -2,12 +2,15 @@
|
|||
name = "libboard_zynq"
|
||||
description = "Drivers for peripherals in the Zynq PS"
|
||||
version = "0.0.0"
|
||||
authors = ["Astro <astro@spaceboyz.net>"]
|
||||
authors = ["M-Labs"]
|
||||
edition = "2018"
|
||||
|
||||
[features]
|
||||
target_zc706 = []
|
||||
target_cora_z7_10 = []
|
||||
target_coraz7 = []
|
||||
target_redpitaya = []
|
||||
target_kasli_soc = []
|
||||
ipv6 = [ "smoltcp/proto-ipv6" ]
|
||||
|
||||
[dependencies]
|
||||
volatile-register = "0.2"
|
||||
|
@ -18,8 +21,9 @@ void = { version = "1", default-features = false }
|
|||
log = "0.4"
|
||||
libregister = { path = "../libregister" }
|
||||
libcortex_a9 = { path = "../libcortex_a9" }
|
||||
libasync = { path = "../libasync" }
|
||||
|
||||
[dependencies.smoltcp]
|
||||
version = "0.6"
|
||||
version = "0.7"
|
||||
features = ["ethernet", "proto-ipv4", "socket-tcp"]
|
||||
default-features = false
|
||||
|
|
|
@ -14,7 +14,7 @@ enum CpuClockMode {
|
|||
|
||||
impl CpuClockMode {
|
||||
pub fn get() -> Self {
|
||||
let regs = slcr::RegisterBlock::new();
|
||||
let regs = slcr::RegisterBlock::slcr();
|
||||
if regs.clk_621_true.read().clk_621_true() {
|
||||
CpuClockMode::C621
|
||||
} else {
|
||||
|
@ -59,7 +59,7 @@ impl Clocks {
|
|||
}
|
||||
|
||||
pub fn cpu_6x4x(&self) -> u32 {
|
||||
let slcr = slcr::RegisterBlock::new();
|
||||
let slcr = slcr::RegisterBlock::slcr();
|
||||
let arm_clk_ctrl = slcr.arm_clk_ctrl.read();
|
||||
let pll = match arm_clk_ctrl.srcsel() {
|
||||
ArmPllSource::ArmPll => self.arm,
|
||||
|
@ -92,7 +92,7 @@ impl Clocks {
|
|||
}
|
||||
|
||||
pub fn uart_ref_clk(&self) -> u32 {
|
||||
let regs = slcr::RegisterBlock::new();
|
||||
let regs = slcr::RegisterBlock::slcr();
|
||||
let uart_clk_ctrl = regs.uart_clk_ctrl.read();
|
||||
let pll = match uart_clk_ctrl.srcsel() {
|
||||
slcr::PllSource::ArmPll =>
|
||||
|
@ -106,7 +106,7 @@ impl Clocks {
|
|||
}
|
||||
|
||||
pub fn sdio_ref_clk(&self) -> u32 {
|
||||
let regs = slcr::RegisterBlock::new();
|
||||
let regs = slcr::RegisterBlock::slcr();
|
||||
let sdio_clk_ctrl = regs.sdio_clk_ctrl.read();
|
||||
let pll = match sdio_clk_ctrl.srcsel() {
|
||||
slcr::PllSource::ArmPll =>
|
||||
|
|
|
@ -4,8 +4,12 @@ use super::slcr;
|
|||
|
||||
#[cfg(feature = "target_zc706")]
|
||||
pub const PS_CLK: u32 = 33_333_333;
|
||||
#[cfg(feature = "target_cora_z7_10")]
|
||||
#[cfg(feature = "target_coraz7")]
|
||||
pub const PS_CLK: u32 = 50_000_000;
|
||||
#[cfg(feature = "target_redpitaya")]
|
||||
pub const PS_CLK: u32 = 33_333_333;
|
||||
#[cfg(feature = "target_kasli_soc")]
|
||||
pub const PS_CLK: u32 = 33_333_333;
|
||||
|
||||
/// (pll_fdiv_max, (pll_cp, pll_res, lock_cnt))
|
||||
const PLL_FDIV_LOCK_PARAM: &[(u16, (u8, u8, u16))] = &[
|
||||
|
@ -44,7 +48,7 @@ pub trait ClockSource {
|
|||
|
||||
/// get configured frequency
|
||||
fn freq() -> u32 {
|
||||
let mut slcr = slcr::RegisterBlock::new();
|
||||
let mut slcr = slcr::RegisterBlock::slcr();
|
||||
let (pll_ctrl, _, _) = Self::pll_regs(&mut slcr);
|
||||
u32::from(pll_ctrl.read().pll_fdiv()) * PS_CLK
|
||||
}
|
||||
|
@ -55,7 +59,7 @@ pub trait ClockSource {
|
|||
/// 25.10.4 PLLs
|
||||
fn setup(target_freq: u32) {
|
||||
let fdiv = (target_freq / PS_CLK).min(66) as u16;
|
||||
let (pll_res, pll_cp, lock_cnt) = PLL_FDIV_LOCK_PARAM.iter()
|
||||
let (pll_cp, pll_res, lock_cnt) = PLL_FDIV_LOCK_PARAM.iter()
|
||||
.filter(|(fdiv_max, _)| fdiv <= *fdiv_max)
|
||||
.nth(0)
|
||||
.expect("PLL_FDIV_LOCK_PARAM")
|
||||
|
|
|
@ -1,7 +1,9 @@
|
|||
use libregister::{RegisterR, RegisterW, RegisterRW};
|
||||
use log::{debug, info, error};
|
||||
use crate::{print, println};
|
||||
use super::slcr::{self, DdriobVrefSel};
|
||||
use super::slcr;
|
||||
#[cfg(feature = "target_zc706")]
|
||||
use super::slcr::DdriobVrefSel;
|
||||
use super::clocks::{Clocks, source::{DdrPll, ClockSource}};
|
||||
|
||||
mod regs;
|
||||
|
@ -10,26 +12,32 @@ mod regs;
|
|||
/// Micron MT41J256M8HX-15E: 667 MHz DDR3
|
||||
const DDR_FREQ: u32 = 666_666_666;
|
||||
|
||||
#[cfg(feature = "target_cora_z7_10")]
|
||||
#[cfg(feature = "target_coraz7")]
|
||||
/// Micron MT41K256M16HA-125: 800 MHz DDR3L, max supported 533 MHz
|
||||
const DDR_FREQ: u32 = 525_000_000;
|
||||
|
||||
/// MT41K256M16HA-125
|
||||
const DCI_FREQ: u32 = 10_000_000;
|
||||
#[cfg(feature = "target_redpitaya")]
|
||||
/// Alliance Memory AS4C256M16D3B: 800 MHz DDR3 at 533 MHz
|
||||
const DDR_FREQ: u32 = 533_333_333;
|
||||
|
||||
#[cfg(feature = "target_kasli_soc")]
|
||||
/// MT41K256M16HA-125:E: 800 MHz DDR3L at 533 MHz
|
||||
const DDR_FREQ: u32 = 533_333_333;
|
||||
|
||||
const DCI_MAX_FREQ: u32 = 10_000_000;
|
||||
|
||||
pub struct DdrRam {
|
||||
regs: &'static mut regs::RegisterBlock,
|
||||
}
|
||||
|
||||
impl DdrRam {
|
||||
pub fn new() -> Self {
|
||||
pub fn ddrram() -> Self {
|
||||
let clocks = Self::clock_setup();
|
||||
Self::calibrate_iob_impedance(&clocks);
|
||||
Self::configure_iob();
|
||||
|
||||
let regs = unsafe { regs::RegisterBlock::new() };
|
||||
Self::calibrate_iob_impedance(&clocks);
|
||||
let regs = regs::RegisterBlock::ddrc();
|
||||
let mut ddr = DdrRam { regs };
|
||||
ddr.reset_ddrc();
|
||||
ddr.reset_ddrc(|ddr| ddr.configure());
|
||||
ddr
|
||||
}
|
||||
|
||||
|
@ -55,14 +63,35 @@ impl DdrRam {
|
|||
clocks
|
||||
}
|
||||
|
||||
fn calculate_dci_divisors(clocks: &Clocks) -> (u8, u8) {
|
||||
let target = (DCI_MAX_FREQ - 1 + clocks.ddr) / DCI_MAX_FREQ;
|
||||
|
||||
let mut best = None;
|
||||
let mut best_error = 0;
|
||||
for divisor0 in 1..63 {
|
||||
for divisor1 in 1..63 {
|
||||
let current = (divisor0 as u32) * (divisor1 as u32);
|
||||
let error = if current > target {
|
||||
current - target
|
||||
} else {
|
||||
target - current
|
||||
};
|
||||
if best.is_none() || best_error > error {
|
||||
best = Some((divisor0, divisor1));
|
||||
best_error = error;
|
||||
}
|
||||
}
|
||||
}
|
||||
best.unwrap()
|
||||
}
|
||||
|
||||
/// Zynq-7000 AP SoC Technical Reference Manual:
|
||||
/// 10.6.2 DDR IOB Impedance Calibration
|
||||
fn calibrate_iob_impedance(clocks: &Clocks) {
|
||||
let divisor0 = ((DCI_FREQ - 1 + clocks.ddr) / DCI_FREQ)
|
||||
.max(1).min(63) as u8;
|
||||
let divisor1 = ((DCI_FREQ - 1 + clocks.ddr) / DCI_FREQ / u32::from(divisor0))
|
||||
.max(1).min(63) as u8;
|
||||
debug!("DDR DCI clock: {} Hz", clocks.ddr / u32::from(divisor0) / u32::from(divisor1));
|
||||
let (divisor0, divisor1) = Self::calculate_dci_divisors(clocks);
|
||||
debug!("DDR DCI clock: {} Hz (divisors={}*{})",
|
||||
clocks.ddr / u32::from(divisor0) / u32::from(divisor1),
|
||||
divisor0, divisor1);
|
||||
|
||||
slcr::RegisterBlock::unlocked(|slcr| {
|
||||
// Step 1.
|
||||
|
@ -118,13 +147,22 @@ impl DdrRam {
|
|||
.output_en(slcr::DdriobOutputEn::Obuf);
|
||||
#[cfg(feature = "target_zc706")]
|
||||
let data1_config = data0_config.clone();
|
||||
#[cfg(feature = "target_cora_z7_10")]
|
||||
#[cfg(any(feature = "target_coraz7", feature = "target_kasli_soc"))]
|
||||
let data0_config = slcr::DdriobConfig::zeroed()
|
||||
.inp_type(slcr::DdriobInputType::VrefDifferential)
|
||||
.term_en(true)
|
||||
.dci_type(slcr::DdriobDciType::Termination)
|
||||
.output_en(slcr::DdriobOutputEn::Obuf);
|
||||
#[cfg(feature = "target_cora_z7_10")]
|
||||
#[cfg(any(feature = "target_coraz7", feature = "target_kasli_soc"))]
|
||||
let data1_config = slcr::DdriobConfig::zeroed()
|
||||
.pullup_en(true);
|
||||
#[cfg(feature = "target_redpitaya")]
|
||||
let data0_config = slcr::DdriobConfig::zeroed()
|
||||
.inp_type(slcr::DdriobInputType::VrefDifferential)
|
||||
.term_en(true)
|
||||
.dci_type(slcr::DdriobDciType::Termination)
|
||||
.output_en(slcr::DdriobOutputEn::Obuf);
|
||||
#[cfg(feature = "target_redpitaya")]
|
||||
let data1_config = slcr::DdriobConfig::zeroed()
|
||||
.pullup_en(true);
|
||||
slcr.ddriob_data0.write(data0_config);
|
||||
|
@ -138,16 +176,24 @@ impl DdrRam {
|
|||
.output_en(slcr::DdriobOutputEn::Obuf);
|
||||
#[cfg(feature = "target_zc706")]
|
||||
let diff1_config = diff0_config.clone();
|
||||
#[cfg(feature = "target_cora_z7_10")]
|
||||
#[cfg(any(feature = "target_coraz7", feature = "target_kasli_soc"))]
|
||||
let diff0_config = slcr::DdriobConfig::zeroed()
|
||||
.inp_type(slcr::DdriobInputType::Differential)
|
||||
.term_en(true)
|
||||
.dci_type(slcr::DdriobDciType::Termination)
|
||||
.output_en(slcr::DdriobOutputEn::Obuf);
|
||||
#[cfg(feature = "target_cora_z7_10")]
|
||||
#[cfg(any(feature = "target_coraz7", feature = "target_kasli_soc"))]
|
||||
let diff1_config = slcr::DdriobConfig::zeroed()
|
||||
.pullup_en(true);
|
||||
#[cfg(feature = "target_redpitaya")]
|
||||
let diff0_config = slcr::DdriobConfig::zeroed()
|
||||
.inp_type(slcr::DdriobInputType::Differential)
|
||||
.term_en(true)
|
||||
.dci_type(slcr::DdriobDciType::Termination)
|
||||
.output_en(slcr::DdriobOutputEn::Obuf);
|
||||
#[cfg(feature = "target_redpitaya")]
|
||||
let diff1_config = slcr::DdriobConfig::zeroed()
|
||||
.pullup_en(true);
|
||||
|
||||
slcr.ddriob_diff0.write(diff0_config);
|
||||
slcr.ddriob_diff1.write(diff1_config);
|
||||
|
||||
|
@ -164,12 +210,12 @@ impl DdrRam {
|
|||
slcr.ddriob_drive_slew_clock.write(0x00F9861C);
|
||||
}
|
||||
|
||||
// Enable external V[REF]
|
||||
#[cfg(feature = "target_cora_z7_10")]
|
||||
#[cfg(any(feature = "target_coraz7", feature = "target_kasli_soc"))]
|
||||
slcr.ddriob_ddr_ctrl.modify(|_, w| w
|
||||
.vref_int_en(false)
|
||||
.vref_ext_en_lower(true)
|
||||
.vref_ext_en_upper(false)
|
||||
.refio_en(true)
|
||||
);
|
||||
#[cfg(feature = "target_zc706")]
|
||||
slcr.ddriob_ddr_ctrl.modify(|_, w| w
|
||||
|
@ -178,11 +224,183 @@ impl DdrRam {
|
|||
.vref_ext_en_lower(false)
|
||||
.vref_ext_en_upper(false)
|
||||
);
|
||||
#[cfg(feature = "target_redpitaya")]
|
||||
slcr.ddriob_ddr_ctrl.modify(|_, w| w
|
||||
.vref_int_en(false)
|
||||
.vref_ext_en_lower(true)
|
||||
.vref_ext_en_upper(false)
|
||||
.refio_en(true)
|
||||
);
|
||||
});
|
||||
}
|
||||
|
||||
fn configure(&mut self) {
|
||||
#[cfg(any(feature = "target_coraz7", feature = "target_kasli_soc"))]
|
||||
self.regs.dram_param0.write(
|
||||
regs::DramParam0::zeroed()
|
||||
.t_rc(0x1a)
|
||||
.t_rfc_min(0x9e)
|
||||
.post_selfref_gap_x32(0x10)
|
||||
);
|
||||
#[cfg(feature = "target_redpitaya")]
|
||||
self.regs.dram_param0.write(
|
||||
regs::DramParam0::zeroed()
|
||||
.t_rc(0x1b)
|
||||
.t_rfc_min(0xa0)
|
||||
.post_selfref_gap_x32(0x10)
|
||||
);
|
||||
#[cfg(feature = "target_zc706")]
|
||||
self.regs.dram_param0.write(
|
||||
regs::DramParam0::zeroed()
|
||||
.t_rc(0x1b)
|
||||
.t_rfc_min(0x56)
|
||||
.post_selfref_gap_x32(0x10)
|
||||
);
|
||||
#[cfg(feature = "target_redpitaya")]
|
||||
self.regs.dram_param1.modify(
|
||||
|_, w| w
|
||||
.wr2pre(0x12)
|
||||
.powerdown_to_x32(6)
|
||||
.t_faw(0x16)
|
||||
.t_ras_max(0x24)
|
||||
.t_ras_min(0x13)
|
||||
.t_cke(4)
|
||||
);
|
||||
|
||||
self.regs.dram_param2.write(
|
||||
regs::DramParam2::zeroed()
|
||||
.write_latency(0x5)
|
||||
.rd2wr(0x7)
|
||||
.wr2rd(0xe)
|
||||
.t_xp(0x4)
|
||||
.pad_pd(0x0)
|
||||
.rd2pre(0x4)
|
||||
.t_rcd(0x7)
|
||||
);
|
||||
#[cfg(feature = "target_redpitaya")]
|
||||
self.regs.dram_param3.modify(
|
||||
|_, w| w
|
||||
.t_ccd(4)
|
||||
.t_rrd(6)
|
||||
.refresh_margin(2)
|
||||
.t_rp(7)
|
||||
.refresh_to_x32(8)
|
||||
.mobile(false)
|
||||
.dfi_dram_clk_disable(false)
|
||||
.read_latency(7)
|
||||
.mode_ddr1_ddr2(true)
|
||||
.dis_pad_pd(false)
|
||||
);
|
||||
|
||||
self.regs.dram_emr_mr.write(
|
||||
regs::DramEmrMr::zeroed()
|
||||
.mr(0x930)
|
||||
.emr(0x4)
|
||||
);
|
||||
|
||||
#[cfg(any(feature = "target_coraz7", feature = "target_kasli_soc"))]
|
||||
self.regs.phy_configs[2].modify(
|
||||
|_, w| w.data_slice_in_use(false)
|
||||
);
|
||||
#[cfg(any(feature = "target_coraz7", feature = "target_kasli_soc"))]
|
||||
self.regs.phy_configs[3].modify(
|
||||
|_, w| w.data_slice_in_use(false)
|
||||
);
|
||||
#[cfg(feature = "target_redpitaya")]
|
||||
self.regs.phy_configs[2].modify(
|
||||
|_, w| w.data_slice_in_use(false)
|
||||
);
|
||||
#[cfg(feature = "target_redpitaya")]
|
||||
self.regs.phy_configs[3].modify(
|
||||
|_, w| w.data_slice_in_use(false)
|
||||
);
|
||||
|
||||
self.regs.phy_cmd_timeout_rddata_cpt.modify(
|
||||
|_, w| w
|
||||
.rd_cmd_to_data(0x0)
|
||||
.wr_cmd_to_data(0x0)
|
||||
.we_to_re_delay(0x8)
|
||||
.rdc_fifo_rst_disable(false)
|
||||
.use_fixed_re(true)
|
||||
.rdc_fifo_rst_err_cnt_clr(false)
|
||||
.dis_phy_ctrl_rstn(false)
|
||||
.clk_stall_level(false)
|
||||
.gatelvl_num_of_dq0(0x7)
|
||||
.wrlvl_num_of_dq0(0x7)
|
||||
);
|
||||
|
||||
self.regs.reg_2c.write(
|
||||
regs::Reg2C::zeroed()
|
||||
.wrlvl_max_x1024(0xfff)
|
||||
.rdlvl_max_x1024(0xfff)
|
||||
.twrlvl_max_error(false)
|
||||
.trdlvl_max_error(false)
|
||||
.dfi_wr_level_en(true)
|
||||
.dfi_rd_dqs_gate_level(true)
|
||||
.dfi_rd_data_eye_train(true)
|
||||
);
|
||||
|
||||
self.regs.dfi_timing.write(
|
||||
regs::DfiTiming::zeroed()
|
||||
.rddata_en(0x6)
|
||||
.ctrlup_min(0x3)
|
||||
.ctrlup_max(0x40)
|
||||
);
|
||||
|
||||
#[cfg(feature = "target_zc706")]
|
||||
self.regs.phy_init_ratios[3].write(
|
||||
regs::PhyInitRatio::zeroed()
|
||||
.wrlvl_init_ratio(0x21)
|
||||
.gatelvl_init_ratio(0xee)
|
||||
);
|
||||
|
||||
#[cfg(any(feature = "target_coraz7", feature = "target_kasli_soc"))]
|
||||
self.regs.reg_64.modify(
|
||||
|_, w| w
|
||||
.phy_ctrl_slave_ratio(0x100)
|
||||
.phy_invert_clkout(true)
|
||||
);
|
||||
#[cfg(feature = "target_redpitaya")]
|
||||
self.regs.reg_64.modify(
|
||||
|_, w| w
|
||||
.phy_bl2(false)
|
||||
.phy_invert_clkout(true)
|
||||
.phy_sel_logic(false)
|
||||
.phy_ctrl_slave_ratio(0x100)
|
||||
.phy_ctrl_slave_force(false)
|
||||
.phy_ctrl_slave_delay(0)
|
||||
.phy_lpddr(false)
|
||||
.phy_cmd_latency(false)
|
||||
);
|
||||
|
||||
self.regs.reg_65.write(
|
||||
regs::Reg65::zeroed()
|
||||
.wr_rl_delay(0x2)
|
||||
.rd_rl_delay(0x4)
|
||||
.dll_lock_diff(0xf)
|
||||
.use_wr_level(true)
|
||||
.use_rd_dqs_gate_level(true)
|
||||
.use_rd_data_eye_level(true)
|
||||
.dis_calib_rst(false)
|
||||
.ctrl_slave_delay(0x0)
|
||||
);
|
||||
}
|
||||
|
||||
/// Reset DDR controller
|
||||
fn reset_ddrc(&mut self) {
|
||||
fn reset_ddrc<F: FnMut(&mut Self)>(&mut self, mut f: F) {
|
||||
#[cfg(feature = "target_zc706")]
|
||||
let width = regs::DataBusWidth::Width32bit;
|
||||
#[cfg(any(feature = "target_coraz7", feature = "target_kasli_soc"))]
|
||||
let width = regs::DataBusWidth::Width16bit;
|
||||
#[cfg(feature = "target_redpitaya")]
|
||||
let width = regs::DataBusWidth::Width16bit;
|
||||
self.regs.ddrc_ctrl.modify(|_, w| w
|
||||
.soft_rstb(false)
|
||||
.powerdown_en(false)
|
||||
.data_bus_width(width)
|
||||
);
|
||||
f(self);
|
||||
|
||||
#[cfg(feature = "target_zc706")]
|
||||
unsafe {
|
||||
// row/column address bits
|
||||
|
@ -190,16 +408,18 @@ impl DdrRam {
|
|||
self.regs.dram_addr_map_col.write(0xFFF00000);
|
||||
self.regs.dram_addr_map_row.write(0x0F666666);
|
||||
}
|
||||
#[cfg(any(
|
||||
feature = "target_coraz7",
|
||||
feature = "target_redpitaya",
|
||||
feature = "target_kasli_soc",
|
||||
))]
|
||||
unsafe {
|
||||
// row/column address bits
|
||||
self.regs.dram_addr_map_bank.write(0x00000666);
|
||||
self.regs.dram_addr_map_col.write(0xFFFF0000);
|
||||
self.regs.dram_addr_map_row.write(0x0F555555);
|
||||
}
|
||||
|
||||
#[cfg(feature = "target_zc706")]
|
||||
let width = regs::DataBusWidth::Width32bit;
|
||||
#[cfg(feature = "target_cora_z7_10")]
|
||||
let width = regs::DataBusWidth::Width16bit;
|
||||
self.regs.ddrc_ctrl.modify(|_, w| w
|
||||
.soft_rstb(false)
|
||||
.powerdown_en(false)
|
||||
.data_bus_width(width)
|
||||
);
|
||||
self.regs.ddrc_ctrl.modify(|_, w| w
|
||||
.soft_rstb(true)
|
||||
.powerdown_en(false)
|
||||
|
@ -210,7 +430,7 @@ impl DdrRam {
|
|||
}
|
||||
|
||||
pub fn status(&self) -> regs::ControllerStatus {
|
||||
self.regs.mode_sts_reg.read().operating_mode()
|
||||
self.regs.mode_sts.read().operating_mode()
|
||||
}
|
||||
|
||||
pub fn ptr<T>(&mut self) -> *mut T {
|
||||
|
@ -220,10 +440,16 @@ impl DdrRam {
|
|||
/// actually there's 1 MB more but starting at 0x0000_0000
|
||||
/// overlaps with OCM.
|
||||
pub fn size(&self) -> usize {
|
||||
// DDR range ends at 0x3FFF_FFFF in the default SCU address
|
||||
// filtering address map
|
||||
#[cfg(feature = "target_zc706")]
|
||||
let megabytes = 1023;
|
||||
#[cfg(feature = "target_cora_z7_10")]
|
||||
let megabytes = 511;
|
||||
#[cfg(any(
|
||||
feature = "target_coraz7",
|
||||
feature = "target_redpitaya",
|
||||
feature = "target_kasli_soc",
|
||||
))]
|
||||
let megabytes = 512;
|
||||
|
||||
megabytes * 1024 * 1024
|
||||
}
|
||||
|
@ -239,7 +465,7 @@ impl DdrRam {
|
|||
|
||||
for megabyte in 0..slice.len() / (1024 * 1024) {
|
||||
let start = megabyte * 1024 * 1024 / 4;
|
||||
let end = ((megabyte + 1) * 1024 * 1024 / 4);
|
||||
let end = (megabyte + 1) * 1024 * 1024 / 4;
|
||||
for b in slice[start..end].iter_mut() {
|
||||
expected.map(|expected| {
|
||||
let read: u32 = *b;
|
||||
|
|
|
@ -1,6 +1,6 @@
|
|||
use volatile_register::{RO, RW};
|
||||
|
||||
use libregister::{register, register_bit, register_bits_typed};
|
||||
use libregister::{register, register_at, register_bit, register_bits, register_bits_typed};
|
||||
|
||||
#[allow(unused)]
|
||||
#[derive(Clone, Copy)]
|
||||
|
@ -29,70 +29,64 @@ pub enum ControllerStatus {
|
|||
pub struct RegisterBlock {
|
||||
pub ddrc_ctrl: DdrcCtrl,
|
||||
pub two_rank_cfg: RW<u32>,
|
||||
pub hpr_reg: RW<u32>,
|
||||
pub lpr_reg: RW<u32>,
|
||||
pub wr_reg: RW<u32>,
|
||||
pub dram_param_reg0: RW<u32>,
|
||||
pub dram_param_reg1: RW<u32>,
|
||||
pub dram_param_reg2: RW<u32>,
|
||||
pub dram_param_reg3: RW<u32>,
|
||||
pub dram_param_reg4: RW<u32>,
|
||||
pub hpr: RW<u32>,
|
||||
pub lpr: RW<u32>,
|
||||
pub wr: RW<u32>,
|
||||
pub dram_param0: DramParam0,
|
||||
pub dram_param1: DramParam1,
|
||||
pub dram_param2: DramParam2,
|
||||
pub dram_param3: DramParam3,
|
||||
pub dram_param4: RW<u32>,
|
||||
pub dram_init_param: RW<u32>,
|
||||
pub dram_emr_reg: RW<u32>,
|
||||
pub dram_emr_mr_reg: RW<u32>,
|
||||
pub dram_burst8_rdwr: RW<u32>,
|
||||
pub dram_emr: RW<u32>,
|
||||
pub dram_emr_mr: DramEmrMr,
|
||||
pub dram_burst8_rdwr: Burst8Rdwr,
|
||||
pub dram_disable_dq: RW<u32>,
|
||||
pub dram_addr_map_bank: RW<u32>,
|
||||
pub dram_addr_map_col: RW<u32>,
|
||||
pub dram_addr_map_row: RW<u32>,
|
||||
pub dram_odt_reg: RW<u32>,
|
||||
pub phy_dbg_reg: RW<u32>,
|
||||
pub phy_cmd_timeout_rddata_cpt: RW<u32>,
|
||||
pub mode_sts_reg: ModeStsReg,
|
||||
pub dram_odt: RW<u32>,
|
||||
pub phy_dbg: RW<u32>,
|
||||
pub phy_cmd_timeout_rddata_cpt: PhyCmdTimeoutRddataCpt,
|
||||
pub mode_sts: ModeStsReg,
|
||||
pub dll_calib: RW<u32>,
|
||||
pub odt_delay_hold: RW<u32>,
|
||||
pub ctrl_reg1: RW<u32>,
|
||||
pub ctrl_reg2: RW<u32>,
|
||||
pub ctrl_reg3: RW<u32>,
|
||||
pub ctrl_reg4: RW<u32>,
|
||||
pub ctrl1: RW<u32>,
|
||||
pub ctrl2: RW<u32>,
|
||||
pub ctrl3: RW<u32>,
|
||||
pub ctrl4: RW<u32>,
|
||||
_unused0: [RO<u32>; 2],
|
||||
pub ctrl_reg5: RW<u32>,
|
||||
pub ctrl_reg6: RW<u32>,
|
||||
pub ctrl5: RW<u32>,
|
||||
pub ctrl6: RW<u32>,
|
||||
_unused1: [RO<u32>; 8],
|
||||
pub che_refresh_timer01: RW<u32>,
|
||||
pub che_t_zq: RW<u32>,
|
||||
pub che_t_zq_short_interval_reg: RW<u32>,
|
||||
pub deep_pwrdwn_reg: RW<u32>,
|
||||
pub reg_2c: RW<u32>,
|
||||
pub che_t_zq: CheTZq,
|
||||
pub che_t_zq_short_interval: RW<u32>,
|
||||
pub deep_pwrdwn: RW<u32>,
|
||||
pub reg_2c: Reg2C,
|
||||
pub reg_2d: RW<u32>,
|
||||
pub dfi_timing: RW<u32>,
|
||||
pub dfi_timing: DfiTiming,
|
||||
_unused2: [RO<u32>; 2],
|
||||
pub che_ecc_control_reg_offset: RW<u32>,
|
||||
pub che_corr_ecc_log_reg_offset: RW<u32>,
|
||||
pub che_corr_ecc_addr_reg_offset: RW<u32>,
|
||||
pub che_corr_ecc_data_31_0_reg_offset: RW<u32>,
|
||||
pub che_corr_ecc_data_63_32_reg_offset: RW<u32>,
|
||||
pub che_corr_ecc_data_71_64_reg_offset: RW<u32>,
|
||||
pub che_uncorr_ecc_log_reg_offset: RW<u32>,
|
||||
pub che_uncorr_ecc_addr_reg_offset: RW<u32>,
|
||||
pub che_uncorr_ecc_data_31_0_reg_offset: RW<u32>,
|
||||
pub che_uncorr_ecc_data_63_32_reg_offset: RW<u32>,
|
||||
pub che_uncorr_ecc_data_71_64_reg_offset: RW<u32>,
|
||||
pub che_ecc_stats_reg_offset: RW<u32>,
|
||||
pub che_ecc_control_offset: RW<u32>,
|
||||
pub che_corr_ecc_log_offset: RW<u32>,
|
||||
pub che_corr_ecc_addr_offset: RW<u32>,
|
||||
pub che_corr_ecc_data_31_0_offset: RW<u32>,
|
||||
pub che_corr_ecc_data_63_32_offset: RW<u32>,
|
||||
pub che_corr_ecc_data_71_64_offset: RW<u32>,
|
||||
pub che_uncorr_ecc_log_offset: RW<u32>,
|
||||
pub che_uncorr_ecc_addr_offset: RW<u32>,
|
||||
pub che_uncorr_ecc_data_31_0_offset: RW<u32>,
|
||||
pub che_uncorr_ecc_data_63_32_offset: RW<u32>,
|
||||
pub che_uncorr_ecc_data_71_64_offset: RW<u32>,
|
||||
pub che_ecc_stats_offset: RW<u32>,
|
||||
pub ecc_scrub: RW<u32>,
|
||||
pub che_ecc_corr_bit_mask_31_0_reg_offset: RW<u32>,
|
||||
pub che_ecc_corr_bit_mask_63_32_reg_offset: RW<u32>,
|
||||
pub che_ecc_corr_bit_mask_31_0_offset: RW<u32>,
|
||||
pub che_ecc_corr_bit_mask_63_32_offset: RW<u32>,
|
||||
_unused3: [RO<u32>; 5],
|
||||
pub phy_rcvr_enable: RW<u32>,
|
||||
pub phy_config0: RW<u32>,
|
||||
pub phy_config1: RW<u32>,
|
||||
pub phy_config2: RW<u32>,
|
||||
pub phy_config3: RW<u32>,
|
||||
pub phy_configs: [PhyConfig; 4],
|
||||
_unused4: RO<u32>,
|
||||
pub phy_init_ratio0: RW<u32>,
|
||||
pub phy_init_ratio1: RW<u32>,
|
||||
pub phy_init_ratio2: RW<u32>,
|
||||
pub phy_init_ratio3: RW<u32>,
|
||||
pub phy_init_ratios: [PhyInitRatio; 4],
|
||||
_unused5: RO<u32>,
|
||||
pub phy_rd_dqs_cfg0: RW<u32>,
|
||||
pub phy_rd_dqs_cfg1: RW<u32>,
|
||||
|
@ -114,8 +108,8 @@ pub struct RegisterBlock {
|
|||
pub wr_data_slv2: RW<u32>,
|
||||
pub wr_data_slv3: RW<u32>,
|
||||
_unused9: RO<u32>,
|
||||
pub reg_64: RW<u32>,
|
||||
pub reg_65: RW<u32>,
|
||||
pub reg_64: Reg64,
|
||||
pub reg_65: Reg65,
|
||||
_unused10: [RO<u32>; 3],
|
||||
pub reg69_6a0: RW<u32>,
|
||||
pub reg69_6a1: RW<u32>,
|
||||
|
@ -134,18 +128,12 @@ pub struct RegisterBlock {
|
|||
_unused13: RO<u32>,
|
||||
pub dll_lock_sts: RW<u32>,
|
||||
pub phy_ctrl_sts: RW<u32>,
|
||||
pub phy_ctrl_sts_reg2: RW<u32>,
|
||||
pub phy_ctrl_sts2: RW<u32>,
|
||||
_unused14: [RO<u32>; 5],
|
||||
pub axi_id: RW<u32>,
|
||||
pub page_mask: RW<u32>,
|
||||
pub axi_priority_wr_port0: RW<u32>,
|
||||
pub axi_priority_wr_port1: RW<u32>,
|
||||
pub axi_priority_wr_port2: RW<u32>,
|
||||
pub axi_priority_wr_port3: RW<u32>,
|
||||
pub axi_priority_rd_port0: RW<u32>,
|
||||
pub axi_priority_rd_port1: RW<u32>,
|
||||
pub axi_priority_rd_port2: RW<u32>,
|
||||
pub axi_priority_rd_port3: RW<u32>,
|
||||
pub axi_priority_wr_ports: [RW<u32>; 4],
|
||||
pub axi_priority_rd_ports: [AxiPriorityRd; 4],
|
||||
_unused15: [RO<u32>; 27],
|
||||
pub excl_access_cfg0: RW<u32>,
|
||||
pub excl_access_cfg1: RW<u32>,
|
||||
|
@ -158,11 +146,7 @@ pub struct RegisterBlock {
|
|||
pub lpddr_ctrl3: RW<u32>,
|
||||
}
|
||||
|
||||
impl RegisterBlock {
|
||||
pub unsafe fn new() -> &'static mut Self {
|
||||
&mut *(0xF8006000 as *mut _)
|
||||
}
|
||||
}
|
||||
register_at!(RegisterBlock, 0xF8006000, ddrc);
|
||||
|
||||
register!(ddrc_ctrl, DdrcCtrl, RW, u32);
|
||||
register_bit!(ddrc_ctrl,
|
||||
|
@ -172,8 +156,124 @@ register_bit!(ddrc_ctrl, powerdown_en, 1);
|
|||
register_bits_typed!(ddrc_ctrl, data_bus_width, u8, DataBusWidth, 2, 3);
|
||||
// (ddrc_ctrl) ...
|
||||
|
||||
register!(dram_param0, DramParam0, RW, u32);
|
||||
register_bits!(dram_param0, t_rc, u8, 0, 5);
|
||||
register_bits!(dram_param0, t_rfc_min, u8, 6, 13);
|
||||
register_bits!(dram_param0, post_selfref_gap_x32, u8, 14, 20);
|
||||
|
||||
register!(dram_param1, DramParam1, RW, u32);
|
||||
register_bits!(dram_param1, wr2pre, u8, 0, 4);
|
||||
register_bits!(dram_param1, powerdown_to_x32, u8, 5, 9);
|
||||
register_bits!(dram_param1, t_faw, u8, 10, 15);
|
||||
register_bits!(dram_param1, t_ras_max, u8, 16, 21);
|
||||
register_bits!(dram_param1, t_ras_min, u8, 22, 26);
|
||||
register_bits!(dram_param1, t_cke, u8, 28, 31);
|
||||
|
||||
register!(dram_param2, DramParam2, RW, u32);
|
||||
register_bits!(dram_param2, write_latency, u8, 0, 4);
|
||||
register_bits!(dram_param2, rd2wr, u8, 5, 9);
|
||||
register_bits!(dram_param2, wr2rd, u8, 10, 14);
|
||||
register_bits!(dram_param2, t_xp, u8, 15, 19);
|
||||
register_bits!(dram_param2, pad_pd, u8, 20, 22);
|
||||
register_bits!(dram_param2, rd2pre, u8, 23, 27);
|
||||
register_bits!(dram_param2, t_rcd, u8, 28, 31);
|
||||
|
||||
register!(dram_param3, DramParam3, RW, u32);
|
||||
register_bits!(dram_param3, t_ccd, u8, 2, 4);
|
||||
register_bits!(dram_param3, t_rrd, u8, 5, 7);
|
||||
register_bits!(dram_param3, refresh_margin, u8, 8, 11);
|
||||
register_bits!(dram_param3, t_rp, u8, 12, 15);
|
||||
register_bits!(dram_param3, refresh_to_x32, u8, 16, 20);
|
||||
register_bit!(dram_param3, sdram, 21);
|
||||
register_bit!(dram_param3, mobile, 22);
|
||||
register_bit!(dram_param3, dfi_dram_clk_disable, 23);
|
||||
register_bits!(dram_param3, read_latency, u8, 24, 28);
|
||||
register_bit!(dram_param3, mode_ddr1_ddr2, 29);
|
||||
register_bit!(dram_param3, dis_pad_pd, 30);
|
||||
|
||||
register!(dram_emr_mr, DramEmrMr, RW, u32);
|
||||
register_bits!(dram_emr_mr, mr, u16, 0, 15);
|
||||
register_bits!(dram_emr_mr, emr, u16, 16, 31);
|
||||
|
||||
register!(burst8_rdwr, Burst8Rdwr, RW, u32);
|
||||
register_bits!(burst8_rdwr, burst_rdwr, u8, 0, 3);
|
||||
register_bits!(burst8_rdwr, pre_cke_x1024, u16, 4, 13);
|
||||
register_bits!(burst8_rdwr, post_cke_x1024, u16, 16, 25);
|
||||
register_bit!(burst8_rdwr, burstchop, 28);
|
||||
|
||||
register!(phy_cmd_timeout_rddata_cpt, PhyCmdTimeoutRddataCpt, RW, u32);
|
||||
register_bits!(phy_cmd_timeout_rddata_cpt, rd_cmd_to_data, u8, 0, 3);
|
||||
register_bits!(phy_cmd_timeout_rddata_cpt, wr_cmd_to_data, u8, 4, 7);
|
||||
register_bits!(phy_cmd_timeout_rddata_cpt, we_to_re_delay, u8, 8, 11);
|
||||
register_bit!(phy_cmd_timeout_rddata_cpt, rdc_fifo_rst_disable, 15);
|
||||
register_bit!(phy_cmd_timeout_rddata_cpt, use_fixed_re, 16);
|
||||
register_bit!(phy_cmd_timeout_rddata_cpt, rdc_fifo_rst_err_cnt_clr, 17);
|
||||
register_bit!(phy_cmd_timeout_rddata_cpt, dis_phy_ctrl_rstn, 18);
|
||||
register_bit!(phy_cmd_timeout_rddata_cpt, clk_stall_level, 19);
|
||||
register_bits!(phy_cmd_timeout_rddata_cpt, gatelvl_num_of_dq0, u8, 24, 27);
|
||||
register_bits!(phy_cmd_timeout_rddata_cpt, wrlvl_num_of_dq0, u8, 28, 31);
|
||||
|
||||
register!(che_t_zq, CheTZq, RW, u32);
|
||||
register_bit!(che_t_zq, dis_auto_zq, 0);
|
||||
register_bit!(che_t_zq, ddr3, 1);
|
||||
register_bits!(che_t_zq, t_mod, u8, 2, 11);
|
||||
register_bits!(che_t_zq, t_zq_long_nop, u16, 12, 21);
|
||||
register_bits!(che_t_zq, t_zq_short_nop, u16, 22, 31);
|
||||
|
||||
register!(reg_2c, Reg2C, RW, u32);
|
||||
register_bits!(reg_2c, wrlvl_max_x1024, u16, 0, 11);
|
||||
register_bits!(reg_2c, rdlvl_max_x1024, u16, 12, 23);
|
||||
register_bit!(reg_2c, twrlvl_max_error, 24);
|
||||
register_bit!(reg_2c, trdlvl_max_error, 25);
|
||||
register_bit!(reg_2c, dfi_wr_level_en, 26);
|
||||
register_bit!(reg_2c, dfi_rd_dqs_gate_level, 27);
|
||||
register_bit!(reg_2c, dfi_rd_data_eye_train, 28);
|
||||
|
||||
register!(dfi_timing, DfiTiming, RW, u32);
|
||||
register_bits!(dfi_timing, rddata_en, u8, 0, 4);
|
||||
register_bits!(dfi_timing, ctrlup_min, u16, 5, 14);
|
||||
register_bits!(dfi_timing, ctrlup_max, u16, 15, 24);
|
||||
|
||||
register!(phy_config, PhyConfig, RW, u32);
|
||||
register_bit!(phy_config, data_slice_in_use, 0);
|
||||
register_bit!(phy_config, rdlvl_inc_mode, 1);
|
||||
register_bit!(phy_config, gatelvl_inc_mode, 2);
|
||||
register_bit!(phy_config, wrlvl_inc_mode, 3);
|
||||
register_bits!(phy_config, dq_offset, u8, 24, 30);
|
||||
|
||||
register!(phy_init_ratio, PhyInitRatio, RW, u32);
|
||||
register_bits!(phy_init_ratio, wrlvl_init_ratio, u16, 0, 9);
|
||||
register_bits!(phy_init_ratio, gatelvl_init_ratio, u16, 10, 19);
|
||||
|
||||
register!(reg_64, Reg64, RW, u32);
|
||||
register_bit!(reg_64, phy_bl2, 1);
|
||||
register_bit!(reg_64, phy_invert_clkout, 7);
|
||||
register_bit!(reg_64, phy_sel_logic, 9);
|
||||
register_bits!(reg_64, phy_ctrl_slave_ratio, u16, 10, 19);
|
||||
register_bit!(reg_64, phy_ctrl_slave_force, 20);
|
||||
register_bits!(reg_64, phy_ctrl_slave_delay, u8, 21, 27);
|
||||
register_bit!(reg_64, phy_lpddr, 29);
|
||||
register_bit!(reg_64, phy_cmd_latency, 30);
|
||||
|
||||
register!(reg_65, Reg65, RW, u32);
|
||||
register_bits!(reg_65, wr_rl_delay, u8, 0, 4);
|
||||
register_bits!(reg_65, rd_rl_delay, u8, 5, 9);
|
||||
register_bits!(reg_65, dll_lock_diff, u8, 10, 13);
|
||||
register_bit!(reg_65, use_wr_level, 14);
|
||||
register_bit!(reg_65, use_rd_dqs_gate_level, 15);
|
||||
register_bit!(reg_65, use_rd_data_eye_level, 16);
|
||||
register_bit!(reg_65, dis_calib_rst, 17);
|
||||
register_bits!(reg_65, ctrl_slave_delay, u8, 18, 19);
|
||||
|
||||
// Controller operation mode status
|
||||
register!(mode_sts_reg,
|
||||
ModeStsReg, RO, u32);
|
||||
register_bits_typed!(mode_sts_reg, operating_mode, u8, ControllerStatus, 0, 2);
|
||||
// (mode_sts_reg) ...
|
||||
|
||||
register!(axi_priority_rd, AxiPriorityRd, RW, u32);
|
||||
register_bits!(axi_priority_rd, arb_pri_rd_portn, u16, 0, 9);
|
||||
register_bit!(axi_priority_rd, arb_disable_aging_rd_portn, 16);
|
||||
register_bit!(axi_priority_rd, arb_disable_urgent_rd_portn, 17);
|
||||
register_bit!(axi_priority_rd, arb_disable_page_match_rd_portn, 18);
|
||||
register_bit!(axi_priority_rd, arb_set_hpr_rd_portn, 19);
|
||||
|
|
|
@ -1,4 +1,3 @@
|
|||
use super::clocks::Clocks;
|
||||
use super::time::Milliseconds;
|
||||
use crate::slcr;
|
||||
use embedded_hal::timer::CountDown;
|
||||
|
@ -11,7 +10,7 @@ mod regs;
|
|||
pub struct DevC {
|
||||
regs: &'static mut regs::RegisterBlock,
|
||||
enabled: bool,
|
||||
count_down: super::timer::global::CountDown,
|
||||
count_down: super::timer::global::CountDown<Milliseconds>,
|
||||
timeout_ms: Milliseconds,
|
||||
}
|
||||
|
||||
|
|
|
@ -1,3 +0,0 @@
|
|||
//! PrimeCell DMA Controller (PL330)
|
||||
|
||||
mod regs;
|
|
@ -1,386 +0,0 @@
|
|||
use libregister::{
|
||||
register, register_at,
|
||||
register_bit, register_bits, register_bits_typed,
|
||||
};
|
||||
|
||||
#[allow(unused)]
|
||||
#[repr(C)]
|
||||
pub struct RegisterBlock {
|
||||
pub ds: Ds,
|
||||
pub dpc: DPc,
|
||||
pub inten: Inten,
|
||||
pub es: Es,
|
||||
pub intstatus: IntStatus,
|
||||
pub intclr: IntClr,
|
||||
pub fsm: Fsm,
|
||||
pub fsc: Fsc,
|
||||
pub ftm: Ftm,
|
||||
pub ftc: [Ftc; 8],
|
||||
pub cs0: Cs,
|
||||
pub cpc0: Cpc,
|
||||
pub cs1: Cs,
|
||||
pub cpc1: Cpc,
|
||||
pub cs2: Cs,
|
||||
pub cpc2: Cpc,
|
||||
pub cs3: Cs,
|
||||
pub cpc3: Cpc,
|
||||
pub cs4: Cs,
|
||||
pub cpc4: Cpc,
|
||||
pub cs5: Cs,
|
||||
pub cpc5: Cpc,
|
||||
pub cs6: Cs,
|
||||
pub cpc6: Cpc,
|
||||
pub cs7: Cs,
|
||||
pub cpc7: Cpc,
|
||||
pub sa0: Sa,
|
||||
pub da0: Da,
|
||||
pub cc0: Cc,
|
||||
pub lc0_0: Lc,
|
||||
pub lc0_1: Lc,
|
||||
pub sa1: Sa,
|
||||
pub da1: Da,
|
||||
pub cc1: Cc,
|
||||
pub lc1_0: Lc,
|
||||
pub lc1_1: Lc,
|
||||
pub sa2: Sa,
|
||||
pub da2: Da,
|
||||
pub cc2: Cc,
|
||||
pub lc2_0: Lc,
|
||||
pub lc2_1: Lc,
|
||||
pub sa3: Sa,
|
||||
pub da3: Da,
|
||||
pub cc3: Cc,
|
||||
pub lc3_0: Lc,
|
||||
pub lc3_1: Lc,
|
||||
pub sa4: Sa,
|
||||
pub da4: Da,
|
||||
pub cc4: Cc,
|
||||
pub lc4_0: Lc,
|
||||
pub lc4_1: Lc,
|
||||
pub sa5: Sa,
|
||||
pub da5: Da,
|
||||
pub cc5: Cc,
|
||||
pub lc5_0: Lc,
|
||||
pub lc5_1: Lc,
|
||||
pub sa6: Sa,
|
||||
pub da6: Da,
|
||||
pub cc6: Cc,
|
||||
pub lc6_0: Lc,
|
||||
pub lc6_1: Lc,
|
||||
pub sa7: Sa,
|
||||
pub da7: Da,
|
||||
pub cc7: Cc,
|
||||
pub lc7_0: Lc,
|
||||
pub lc7_1: Lc,
|
||||
pub dbgstatus: DbgStatus,
|
||||
pub dbgcmd: DbgCmd,
|
||||
pub dbginst0: DbgInst0,
|
||||
pub dbginst1: DbgInst1,
|
||||
pub cr0: Cr0,
|
||||
pub cr1: Cr1,
|
||||
pub cr2: Cr2,
|
||||
pub cr3: Cr3,
|
||||
pub cr4: Cr4,
|
||||
pub crdn: Crdn,
|
||||
pub wd: Wd,
|
||||
pub periph_id_0: PeriphId0,
|
||||
pub periph_id_1: PeriphId1,
|
||||
pub periph_id_2: PeriphId2,
|
||||
pub periph_id_3: PeriphId3,
|
||||
pub pcell_id_0: PCellId0,
|
||||
pub pcell_id_1: PCellId1,
|
||||
pub pcell_id_2: PCellId2,
|
||||
pub pcell_id_3: PCellId3,
|
||||
}
|
||||
|
||||
register_at!(RegisterBlock, 0xF8004000, dmac0_ns);
|
||||
register_at!(RegisterBlock, 0xF8003000, dmac0_s);
|
||||
|
||||
impl RegisterBlock {
|
||||
pub fn channel_regs(&mut self, channel: usize) -> Option<ChannelRegisters>
|
||||
{
|
||||
match channel {
|
||||
0 => Some(ChannelRegisters {
|
||||
ftc: &mut self.ftc[0],
|
||||
cs: &mut self.cs0,
|
||||
cpc: &mut self.cpc0,
|
||||
sa: &mut self.sa0,
|
||||
da: &mut self.da0,
|
||||
cc: &mut self.cc0,
|
||||
lc: [&mut self.lc0_0, &mut self.lc0_1],
|
||||
}),
|
||||
1 => Some(ChannelRegisters {
|
||||
ftc: &mut self.ftc[1],
|
||||
cs: &mut self.cs1,
|
||||
cpc: &mut self.cpc1,
|
||||
sa: &mut self.sa1,
|
||||
da: &mut self.da1,
|
||||
cc: &mut self.cc1,
|
||||
lc: [&mut self.lc1_0, &mut self.lc1_1],
|
||||
}),
|
||||
2 => Some(ChannelRegisters {
|
||||
ftc: &mut self.ftc[2],
|
||||
cs: &mut self.cs2,
|
||||
cpc: &mut self.cpc2,
|
||||
sa: &mut self.sa2,
|
||||
da: &mut self.da2,
|
||||
cc: &mut self.cc2,
|
||||
lc: [&mut self.lc2_0, &mut self.lc2_1],
|
||||
}),
|
||||
3 => Some(ChannelRegisters {
|
||||
ftc: &mut self.ftc[3],
|
||||
cs: &mut self.cs3,
|
||||
cpc: &mut self.cpc3,
|
||||
sa: &mut self.sa3,
|
||||
da: &mut self.da3,
|
||||
cc: &mut self.cc3,
|
||||
lc: [&mut self.lc3_0, &mut self.lc3_1],
|
||||
}),
|
||||
4 => Some(ChannelRegisters {
|
||||
ftc: &mut self.ftc[4],
|
||||
cs: &mut self.cs4,
|
||||
cpc: &mut self.cpc4,
|
||||
sa: &mut self.sa4,
|
||||
da: &mut self.da4,
|
||||
cc: &mut self.cc4,
|
||||
lc: [&mut self.lc4_0, &mut self.lc4_1],
|
||||
}),
|
||||
5 => Some(ChannelRegisters {
|
||||
ftc: &mut self.ftc[5],
|
||||
cs: &mut self.cs5,
|
||||
cpc: &mut self.cpc5,
|
||||
sa: &mut self.sa5,
|
||||
da: &mut self.da5,
|
||||
cc: &mut self.cc5,
|
||||
lc: [&mut self.lc5_0, &mut self.lc5_1],
|
||||
}),
|
||||
6 => Some(ChannelRegisters {
|
||||
ftc: &mut self.ftc[6],
|
||||
cs: &mut self.cs6,
|
||||
cpc: &mut self.cpc6,
|
||||
sa: &mut self.sa6,
|
||||
da: &mut self.da6,
|
||||
cc: &mut self.cc6,
|
||||
lc: [&mut self.lc6_0, &mut self.lc6_1],
|
||||
}),
|
||||
7 => Some(ChannelRegisters {
|
||||
ftc: &mut self.ftc[7],
|
||||
cs: &mut self.cs7,
|
||||
cpc: &mut self.cpc7,
|
||||
sa: &mut self.sa7,
|
||||
da: &mut self.da7,
|
||||
cc: &mut self.cc7,
|
||||
lc: [&mut self.lc7_0, &mut self.lc7_1],
|
||||
}),
|
||||
_ => None,
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
pub struct ChannelRegisters<'a> {
|
||||
ftc: &'a mut Ftc,
|
||||
cs: &'a mut Cs,
|
||||
cpc: &'a mut Cpc,
|
||||
sa: &'a mut Sa,
|
||||
da: &'a mut Da,
|
||||
cc: &'a mut Cc,
|
||||
lc: [&'a mut Lc; 2],
|
||||
}
|
||||
|
||||
#[allow(unused)]
|
||||
#[repr(u8)]
|
||||
pub enum WakeUpEvent{
|
||||
// @missing: there's a binary prefix ahead of this as per TRM 1173 Wakeup_event
|
||||
Event0 = 0b0000,
|
||||
Event1 = 0b0001,
|
||||
Event2 = 0b0010,
|
||||
Event3 = 0b0011,
|
||||
Event4 = 0b0100,
|
||||
Event5 = 0b0101,
|
||||
Event6 = 0b0110,
|
||||
Event7 = 0b0111,
|
||||
Event8 = 0b1000,
|
||||
Event9 = 0b1001,
|
||||
Event10 = 0b1010,
|
||||
Event11 = 0b1011,
|
||||
Event12 = 0b1100,
|
||||
Event13 = 0b1101,
|
||||
Event14 = 0b1110,
|
||||
Event15 = 0b1111,
|
||||
}
|
||||
#[allow(unused)]
|
||||
#[repr(u8)]
|
||||
pub enum DMAStatus{
|
||||
Stopped = 0b0000,
|
||||
Executing = 0b0001,
|
||||
CacheMiss = 0b0010,
|
||||
UpdatingPc = 0b0011,
|
||||
WaitingForEvent = 0b0100,
|
||||
Reserved0 = 0b0101,
|
||||
Reserved1 = 0b0110,
|
||||
Reserved2 = 0b0111,
|
||||
Reserved3 = 0b1000,
|
||||
Reserved4 = 0b1001,
|
||||
Reserved5 = 0b1010,
|
||||
Reserved6 = 0b1011,
|
||||
Reserved7 = 0b1100,
|
||||
Reserved8 = 0b1101,
|
||||
Reserved9 = 0b1110,
|
||||
Faulting = 0b1111,
|
||||
}
|
||||
|
||||
register!(ds, Ds, RW, u32);
|
||||
register_bit!(ds, dns, 9);
|
||||
register_bits_typed!(ds, wakeup_event, u8, WakeUpEvent, 4, 8);
|
||||
register_bits_typed!(ds, dma_status, u8, DMAStatus, 0, 3);
|
||||
|
||||
register!(dpc, DPc, RW, u32);
|
||||
register_bits!(dpc, pc_mgr, u8, 0, 31);
|
||||
|
||||
register!(inten, Inten, RW, u32);
|
||||
register_bits!(inten, event_irq_select, u8, 0, 31);
|
||||
|
||||
register!(es, Es, RW, u32);
|
||||
register_bits!(es, dmasev_active, u8, 0, 31);
|
||||
|
||||
register!(intstatus, IntStatus, RW, u32);
|
||||
register_bits!(intstatus, irq_status, u8, 0, 31);
|
||||
|
||||
register!(intclr, IntClr, RW, u32);
|
||||
register_bits!(intstatus, irq_clr, u8, 0, 31);
|
||||
|
||||
register!(fsm, Fsm, RW, u32);
|
||||
register_bit!(fsm, fs_mgr, 0);
|
||||
|
||||
register!(fsc, Fsc, RW, u32);
|
||||
register_bits!(fsc, fault_status, u8, 0, 7);
|
||||
|
||||
register!(ftm, Ftm, RW, u32);
|
||||
register_bit!(ftm, dbg_instr, 30);
|
||||
register_bit!(ftm, instr_fetch_err, 16);
|
||||
register_bit!(ftm, mgr_evnt_err, 5);
|
||||
register_bit!(ftm, dmago_err, 4);
|
||||
register_bit!(ftm, operand_invalid, 1);
|
||||
register_bit!(ftm, undef_instr, 0);
|
||||
|
||||
register!(ftc, Ftc, RW, u32);
|
||||
register_bit!(ftc, lockup_err, 31);
|
||||
register_bit!(ftc, dbg_instr, 30);
|
||||
register_bit!(ftc, data_read_err, 18);
|
||||
register_bit!(ftc, data_write_err, 17);
|
||||
register_bit!(ftc, instr_fetch_err, 16);
|
||||
register_bit!(ftc, st_data_unavailable, 13);
|
||||
register_bit!(ftc, mfifo_err, 12);
|
||||
register_bit!(ftc, ch_rdwr_err, 7);
|
||||
register_bit!(ftc, ch_periph_err, 6);
|
||||
register_bit!(ftc, ch_evnt_err, 5);
|
||||
register_bit!(ftc, operand_invalid, 1);
|
||||
register_bit!(ftc, undef_instr, 0);
|
||||
|
||||
register!(cs, Cs, RW, u32);
|
||||
register_bit!(cs, cns, 21);
|
||||
register_bit!(cs, dmawfp_periph, 15);
|
||||
register_bit!(cs, dmawfp_b_ns, 14);
|
||||
register_bits!(cs, wakeup_num, u8, 4, 8);
|
||||
register_bits!(cs, channel_status, u8, 0, 3);
|
||||
|
||||
register!(cpc, Cpc, RW, u32);
|
||||
register_bits!(cpc, pc_chnl, u8, 0, 31);
|
||||
|
||||
register!(sa, Sa, RW, u32);
|
||||
register_bits!(sa, src_addr, u8, 0, 31);
|
||||
|
||||
register!(da, Da, RW, u32);
|
||||
register_bits!(da, dest_addr, u8, 0, 31);
|
||||
|
||||
register!(cc, Cc, RW, u32);
|
||||
register_bits!(cc, endian_swap_size, u8, 28, 30);
|
||||
register_bits!(cc, dst_cache_ctrl, u8, 25, 27);
|
||||
register_bits!(cc, dst_prot_ctrl, u8, 22, 24);
|
||||
register_bits!(cc, dst_burst_len, u8, 18, 21);
|
||||
register_bits!(cc, dst_burst_size, u8, 15, 17);
|
||||
register_bit!(cc, dst_inc, 14);
|
||||
register_bits!(cc, src_cache_ctrl, u8, 11, 13);
|
||||
register_bits!(cc, src_prot_ctrl, u8, 8, 10);
|
||||
register_bits!(cc, src_burst_len, u8, 4, 7);
|
||||
register_bits!(cc, src_burst_size, u8, 1, 3);
|
||||
register_bit!(cc, src_inc, 0);
|
||||
|
||||
register!(lc0, Lc, RW, u32);
|
||||
register_bits!(lc0, loop_counter_iteration, u8, 0, 7);
|
||||
|
||||
register!(dbgstatus, DbgStatus, RW, u32);
|
||||
register_bit!(dbgstatus, dbgstatus, 0);
|
||||
|
||||
register!(dbgcmd, DbgCmd, RW, u32);
|
||||
register_bits!(dbgcmd, dbgcmd, u8, 0, 1);
|
||||
|
||||
register!(dbginst0, DbgInst0, RW, u32);
|
||||
register_bits!(dbginst0, instruction_byte1, u8, 24, 31);
|
||||
register_bits!(dbginst0, instruction_byte0, u8, 16, 23);
|
||||
register_bits!(dbginst0, channel_num, u8, 8, 10);
|
||||
register_bit!(dbginst0, debug_thread, 0);
|
||||
|
||||
register!(dbginst1, DbgInst1, RW, u32);
|
||||
register_bits!(dbginst1, instruction_byte5, u8, 24, 31);
|
||||
register_bits!(dbginst1, instruction_byte4, u8, 16, 23);
|
||||
register_bits!(dbginst1, instruction_byte3, u8, 8, 10);
|
||||
register_bits!(dbginst1, instruction_byte2, u8, 0, 7);
|
||||
|
||||
register!(cr0, Cr0, RW, u32);
|
||||
register_bits!(cr0, num_events, u8, 17, 21);
|
||||
register_bits!(cr0, num_periph_req, u8, 12, 16);
|
||||
register_bits!(cr0, num_chnls, u8, 4, 6);
|
||||
register_bit!(cr0, mgr_ns_at_rst, 2);
|
||||
register_bit!(cr0, boot_en, 1);
|
||||
register_bit!(cr0, periph_req, 0);
|
||||
|
||||
register!(cr1, Cr1, RW, u32);
|
||||
register_bits!(cr1, num_icache_lines, u8, 4, 7);
|
||||
register_bits!(cr1, icache_len, u8, 0, 2);
|
||||
|
||||
register!(cr2, Cr2, RW, u32);
|
||||
register_bits!(cr2, boot_addr, u8, 0, 31);
|
||||
|
||||
register!(cr3, Cr3, RW, u32);
|
||||
register_bits!(cr3, ins, u8, 0, 31);
|
||||
|
||||
register!(cr4, Cr4, RW, u32);
|
||||
register_bits!(cr4, ins, u8, 0, 31);
|
||||
|
||||
register!(crdn, Crdn, RW, u32);
|
||||
register_bits!(crdn, data_buffer_dep, u8, 20, 29);
|
||||
register_bits!(crdn, rd_q_dep, u8, 16, 19);
|
||||
register_bits!(crdn, rd_cap, u8, 12, 14);
|
||||
register_bits!(crdn, wr_q_dep, u8, 8, 11);
|
||||
register_bits!(crdn, wr_cap, u8, 4, 6);
|
||||
register_bits!(crdn, data_width, u8, 0, 2);
|
||||
|
||||
register!(wd, Wd, RW, u32);
|
||||
register_bit!(wd, wd_irq_only, 0);
|
||||
|
||||
register!(periph_id_0, PeriphId0, RW, u32);
|
||||
register_bits!(periph_id_0, part_number_0, u8, 0, 7);
|
||||
|
||||
register!(periph_id_1, PeriphId1, RW, u32);
|
||||
register_bits!(periph_id_1, designer_0, u8, 4, 7);
|
||||
register_bits!(periph_id_1, part_number_1, u8, 0, 3);
|
||||
|
||||
register!(periph_id_2, PeriphId2, RW, u32);
|
||||
register_bits!(periph_id_2, revision, u8, 4, 7);
|
||||
register_bits!(periph_id_2, designer_1, u8, 0, 3);
|
||||
|
||||
register!(periph_id_3, PeriphId3, RW, u32);
|
||||
register_bit!(periph_id_3, integration_cfg, 0);
|
||||
|
||||
register!(pcell_id_0, PCellId0, RW, u32);
|
||||
register_bits!(pcell_id_0, pcell_id_0, u8, 0, 7);
|
||||
|
||||
register!(pcell_id_1, PCellId1, RW, u32);
|
||||
register_bits!(pcell_id_1, pcell_id_1, u8, 0, 7);
|
||||
|
||||
register!(pcell_id_2, PCellId2, RW, u32);
|
||||
register_bits!(pcell_id_2, pcell_id_2, u8, 0, 7);
|
||||
|
||||
register!(pcell_id_3, PCellId3, RW, u32);
|
||||
register_bits!(pcell_id_3, pcell_id_3, u8, 0, 7);
|
|
@ -0,0 +1,114 @@
|
|||
use libregister::{RegisterRW, RegisterW};
|
||||
use libregister::{register, register_at, register_bit, register_bits};
|
||||
use super::slcr;
|
||||
|
||||
pub struct ErrorLED {
|
||||
regs: RegisterBlock,
|
||||
}
|
||||
|
||||
impl ErrorLED {
|
||||
#[cfg(feature = "target_kasli_soc")]
|
||||
pub fn error_led() -> Self {
|
||||
slcr::RegisterBlock::unlocked(|slcr| {
|
||||
// Error LED at MIO pin 37
|
||||
slcr.mio_pin_37.write(
|
||||
slcr::MioPin37::zeroed()
|
||||
.l3_sel(0b000)
|
||||
.io_type(slcr::IoBufferType::Lvcmos25)
|
||||
.pullup(true)
|
||||
.disable_rcvr(true)
|
||||
);
|
||||
});
|
||||
|
||||
Self::error_led_common(0xFFFF - 0x0080)
|
||||
}
|
||||
|
||||
fn error_led_common(gpio_output_mask: u16) -> Self {
|
||||
// Setup register block
|
||||
let self_ = Self {
|
||||
regs: RegisterBlock::error_led(),
|
||||
};
|
||||
|
||||
// Setup GPIO output mask
|
||||
self_.regs.gpio_output_mask.modify(|_, w| {
|
||||
w.mask(gpio_output_mask)
|
||||
});
|
||||
|
||||
self_.regs.gpio_direction.modify(|_, w| {
|
||||
w.lederr(true)
|
||||
});
|
||||
|
||||
self_
|
||||
}
|
||||
|
||||
fn led_oe(&mut self, oe: bool) {
|
||||
self.regs.gpio_output_enable.modify(|_, w| {
|
||||
w.lederr(oe)
|
||||
})
|
||||
}
|
||||
|
||||
fn led_o(&mut self, o: bool) {
|
||||
self.regs.gpio_output_mask.modify(|_, w| {
|
||||
w.lederr_o(o)
|
||||
})
|
||||
}
|
||||
|
||||
pub fn toggle(&mut self, state: bool) {
|
||||
self.led_o(state);
|
||||
self.led_oe(state);
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
pub struct RegisterBlock {
|
||||
pub gpio_output_mask: &'static mut GPIOOutputMask,
|
||||
pub gpio_direction: &'static mut GPIODirection,
|
||||
pub gpio_output_enable: &'static mut GPIOOutputEnable,
|
||||
}
|
||||
|
||||
impl RegisterBlock {
|
||||
pub fn error_led() -> Self {
|
||||
Self {
|
||||
gpio_output_mask: GPIOOutputMask::new(),
|
||||
gpio_direction: GPIODirection::new(),
|
||||
gpio_output_enable: GPIOOutputEnable::new()
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
register!(gpio_output_mask,
|
||||
/// MASK_DATA_1_LSW:
|
||||
/// Maskable output data for MIO[47:32]
|
||||
GPIOOutputMask, RW, u32);
|
||||
#[cfg(feature = "target_kasli_soc")]
|
||||
register_at!(GPIOOutputMask, 0xE000A008, new);
|
||||
#[cfg(feature = "target_kasli_soc")]
|
||||
register_bit!(gpio_output_mask,
|
||||
/// Output for LED_ERR (MIO[37])
|
||||
lederr_o, 5);
|
||||
#[cfg(feature = "target_kasli_soc")]
|
||||
register_bits!(gpio_output_mask,
|
||||
mask, u16, 16, 31);
|
||||
|
||||
register!(gpio_direction,
|
||||
/// DIRM_1:
|
||||
/// Direction mode for MIO[53:32]; 0/1 = in/out
|
||||
GPIODirection, RW, u32);
|
||||
#[cfg(feature = "target_kasli_soc")]
|
||||
register_at!(GPIODirection, 0xE000A244, new);
|
||||
#[cfg(feature = "target_kasli_soc")]
|
||||
register_bit!(gpio_direction,
|
||||
/// Direction for LED_ERR
|
||||
lederr, 5);
|
||||
|
||||
register!(gpio_output_enable,
|
||||
/// OEN_1:
|
||||
/// Output enable for MIO[53:32]
|
||||
GPIOOutputEnable, RW, u32);
|
||||
#[cfg(feature = "target_kasli_soc")]
|
||||
register_at!(GPIOOutputEnable, 0xE000A248, new);
|
||||
#[cfg(feature = "target_kasli_soc")]
|
||||
register_bit!(gpio_output_enable,
|
||||
/// Output enable for LED_ERR
|
||||
lederr, 5);
|
||||
|
|
@ -1,5 +1,8 @@
|
|||
use core::ops::{Deref, DerefMut};
|
||||
use log::{error, info, warn};
|
||||
use core::{
|
||||
marker::PhantomData,
|
||||
ops::{Deref, DerefMut},
|
||||
};
|
||||
use log::{debug, info, warn, error};
|
||||
use libregister::*;
|
||||
use super::slcr;
|
||||
use super::clocks::Clocks;
|
||||
|
@ -10,6 +13,9 @@ mod regs;
|
|||
pub mod rx;
|
||||
pub mod tx;
|
||||
|
||||
use super::time::Milliseconds;
|
||||
use embedded_hal::timer::CountDown;
|
||||
|
||||
/// Size of all the buffers
|
||||
pub const MTU: usize = 1536;
|
||||
/// Maximum MDC clock
|
||||
|
@ -24,7 +30,7 @@ const TX_1000: u32 = 125_000_000;
|
|||
pub struct Buffer(pub [u8; MTU]);
|
||||
|
||||
impl Buffer {
|
||||
pub fn new() -> Self {
|
||||
pub const fn new() -> Self {
|
||||
Buffer([0; MTU])
|
||||
}
|
||||
}
|
||||
|
@ -42,15 +48,112 @@ impl DerefMut for Buffer {
|
|||
}
|
||||
}
|
||||
|
||||
pub struct Eth<'r, RX, TX> {
|
||||
rx: RX,
|
||||
tx: TX,
|
||||
inner: EthInner<'r>,
|
||||
phy: Phy,
|
||||
/// Gigabit Ethernet Peripheral
|
||||
pub trait Gem {
|
||||
fn setup_clock(tx_clock: u32);
|
||||
fn regs() -> &'static mut regs::RegisterBlock;
|
||||
}
|
||||
|
||||
impl<'r> Eth<'r, (), ()> {
|
||||
pub fn default(macaddr: [u8; 6]) -> Self {
|
||||
/// first Gigabit Ethernet peripheral
|
||||
pub struct Gem0;
|
||||
|
||||
impl Gem for Gem0 {
|
||||
fn setup_clock(tx_clock: u32) {
|
||||
let (divisor0, divisor1) = calculate_tx_divisors(tx_clock);
|
||||
|
||||
slcr::RegisterBlock::unlocked(|slcr| {
|
||||
slcr.gem0_clk_ctrl.write(
|
||||
// 0x0050_0801: 8, 5: 100 Mb/s
|
||||
// ...: 8, 1: 1000 Mb/s
|
||||
slcr::GemClkCtrl::zeroed()
|
||||
.clkact(true)
|
||||
.srcsel(slcr::PllSource::IoPll)
|
||||
.divisor(divisor0 as u8)
|
||||
.divisor1(divisor1 as u8)
|
||||
);
|
||||
// Enable gem0 recv clock
|
||||
slcr.gem0_rclk_ctrl.write(
|
||||
// 0x0000_0801
|
||||
slcr::RclkCtrl::zeroed()
|
||||
.clkact(true)
|
||||
);
|
||||
});
|
||||
}
|
||||
|
||||
fn regs() -> &'static mut regs::RegisterBlock {
|
||||
regs::RegisterBlock::gem0()
|
||||
}
|
||||
}
|
||||
|
||||
/// second Gigabit Ethernet peripheal
|
||||
pub struct Gem1;
|
||||
|
||||
impl Gem for Gem1 {
|
||||
fn setup_clock(tx_clock: u32) {
|
||||
let (divisor0, divisor1) = calculate_tx_divisors(tx_clock);
|
||||
|
||||
slcr::RegisterBlock::unlocked(|slcr| {
|
||||
slcr.gem1_clk_ctrl.write(
|
||||
slcr::GemClkCtrl::zeroed()
|
||||
.clkact(true)
|
||||
.srcsel(slcr::PllSource::IoPll)
|
||||
.divisor(divisor0 as u8)
|
||||
.divisor1(divisor1 as u8)
|
||||
);
|
||||
// Enable gem1 recv clock
|
||||
slcr.gem1_rclk_ctrl.write(
|
||||
// 0x0000_0801
|
||||
slcr::RclkCtrl::zeroed()
|
||||
.clkact(true)
|
||||
);
|
||||
});
|
||||
}
|
||||
|
||||
fn regs() -> &'static mut regs::RegisterBlock {
|
||||
regs::RegisterBlock::gem1()
|
||||
}
|
||||
}
|
||||
|
||||
fn calculate_tx_divisors(tx_clock: u32) -> (u8, u8) {
|
||||
let io_pll = Clocks::get().io;
|
||||
let target = (tx_clock - 1 + io_pll) / tx_clock;
|
||||
|
||||
let mut best = None;
|
||||
let mut best_error = 0;
|
||||
for divisor0 in 1..63 {
|
||||
for divisor1 in 1..63 {
|
||||
let current = (divisor0 as u32) * (divisor1 as u32);
|
||||
let error = if current > target {
|
||||
current - target
|
||||
} else {
|
||||
target - current
|
||||
};
|
||||
if best.is_none() || best_error > error {
|
||||
best = Some((divisor0, divisor1));
|
||||
best_error = error;
|
||||
}
|
||||
}
|
||||
}
|
||||
let result = best.unwrap();
|
||||
debug!("Eth TX clock for {}: {} / {} / {} = {}",
|
||||
tx_clock, io_pll,
|
||||
result.0, result.1,
|
||||
io_pll / result.0 as u32 / result.1 as u32
|
||||
);
|
||||
result
|
||||
}
|
||||
|
||||
pub struct Eth<GEM: Gem, RX, TX> {
|
||||
rx: RX,
|
||||
tx: TX,
|
||||
inner: EthInner<GEM>,
|
||||
phy: Phy,
|
||||
/// keep track of RX path occupation to avoid needless `check_link_change()`
|
||||
idle: bool,
|
||||
}
|
||||
|
||||
impl Eth<Gem0, (), ()> {
|
||||
pub fn eth0(macaddr: [u8; 6]) -> Self {
|
||||
slcr::RegisterBlock::unlocked(|slcr| {
|
||||
// Manual example: 0x0000_1280
|
||||
// MDIO
|
||||
|
@ -126,48 +229,48 @@ impl<'r> Eth<'r, (), ()> {
|
|||
// RX_CLK
|
||||
slcr.mio_pin_22.write(
|
||||
slcr::MioPin22::zeroed()
|
||||
.tri_enable(true)
|
||||
.l0_sel(true)
|
||||
.speed(true)
|
||||
.io_type(slcr::IoBufferType::Hstl)
|
||||
.pullup(true)
|
||||
);
|
||||
// RX_CTRL
|
||||
slcr.mio_pin_27.write(
|
||||
slcr::MioPin27::zeroed()
|
||||
.tri_enable(true)
|
||||
.l0_sel(true)
|
||||
.speed(true)
|
||||
.io_type(slcr::IoBufferType::Hstl)
|
||||
.pullup(true)
|
||||
);
|
||||
// RXD3
|
||||
slcr.mio_pin_26.write(
|
||||
slcr::MioPin26::zeroed()
|
||||
.tri_enable(true)
|
||||
.l0_sel(true)
|
||||
.speed(true)
|
||||
.io_type(slcr::IoBufferType::Hstl)
|
||||
.pullup(true)
|
||||
);
|
||||
// RXD2
|
||||
slcr.mio_pin_25.write(
|
||||
slcr::MioPin25::zeroed()
|
||||
.tri_enable(true)
|
||||
.l0_sel(true)
|
||||
.speed(true)
|
||||
.io_type(slcr::IoBufferType::Hstl)
|
||||
.pullup(true)
|
||||
);
|
||||
// RXD1
|
||||
slcr.mio_pin_24.write(
|
||||
slcr::MioPin24::zeroed()
|
||||
.tri_enable(true)
|
||||
.l0_sel(true)
|
||||
.speed(true)
|
||||
.io_type(slcr::IoBufferType::Hstl)
|
||||
.pullup(true)
|
||||
);
|
||||
// RXD0
|
||||
slcr.mio_pin_23.write(
|
||||
slcr::MioPin23::zeroed()
|
||||
.tri_enable(true)
|
||||
.l0_sel(true)
|
||||
.speed(true)
|
||||
.io_type(slcr::IoBufferType::Hstl)
|
||||
.pullup(true)
|
||||
);
|
||||
|
@ -182,132 +285,102 @@ impl<'r> Eth<'r, (), ()> {
|
|||
}
|
||||
|
||||
pub fn gem0(macaddr: [u8; 6]) -> Self {
|
||||
Self::setup_gem0_clock(TX_1000);
|
||||
|
||||
let regs = regs::RegisterBlock::gem0();
|
||||
Self::from_regs(regs, macaddr)
|
||||
Self::gem_common(macaddr)
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
impl Eth<Gem1, (), ()> {
|
||||
// TODO: Add a `eth1()`
|
||||
|
||||
pub fn gem1(macaddr: [u8; 6]) -> Self {
|
||||
Self::setup_gem1_clock(TX_1000);
|
||||
|
||||
let regs = regs::RegisterBlock::gem1();
|
||||
Self::from_regs(regs, macaddr)
|
||||
Self::gem_common(macaddr)
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
impl<GEM: Gem> Eth<GEM, (), ()> {
|
||||
fn gem_common(macaddr: [u8; 6]) -> Self {
|
||||
GEM::setup_clock(TX_1000);
|
||||
|
||||
#[cfg(feature="target_kasli_soc")]
|
||||
{
|
||||
let mut eth_reset_pin = PhyRst::rst_pin();
|
||||
eth_reset_pin.reset();
|
||||
}
|
||||
|
||||
fn from_regs(regs: &'r mut regs::RegisterBlock, macaddr: [u8; 6]) -> Self {
|
||||
let mut inner = EthInner {
|
||||
regs,
|
||||
gem: PhantomData,
|
||||
link: None,
|
||||
};
|
||||
inner.init();
|
||||
|
||||
inner.configure(macaddr);
|
||||
|
||||
let phy = Phy::find(&mut inner).expect("phy");
|
||||
phy.reset(&mut inner);
|
||||
phy.restart_autoneg(&mut inner);
|
||||
#[cfg(feature="target_kasli_soc")]
|
||||
phy.set_leds(&mut inner);
|
||||
|
||||
Eth {
|
||||
rx: (),
|
||||
tx: (),
|
||||
inner,
|
||||
phy,
|
||||
idle: true,
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl<'r, RX, TX> Eth<'r, RX, TX> {
|
||||
pub fn setup_gem0_clock(tx_clock: u32) {
|
||||
let io_pll = Clocks::get().io;
|
||||
let d0 = ((tx_clock - 1 + io_pll) / tx_clock).max(1).min(63);
|
||||
let d1 = (io_pll / tx_clock / d0).max(1).min(63);
|
||||
|
||||
slcr::RegisterBlock::unlocked(|slcr| {
|
||||
slcr.gem0_clk_ctrl.write(
|
||||
// 0x0050_0801: 8, 5: 100 Mb/s
|
||||
// ...: 8, 1: 1000 Mb/s
|
||||
slcr::GemClkCtrl::zeroed()
|
||||
.clkact(true)
|
||||
.srcsel(slcr::PllSource::IoPll)
|
||||
.divisor(d0 as u8)
|
||||
.divisor1(d1 as u8)
|
||||
);
|
||||
// Enable gem0 recv clock
|
||||
slcr.gem0_rclk_ctrl.write(
|
||||
// 0x0000_0801
|
||||
slcr::RclkCtrl::zeroed()
|
||||
.clkact(true)
|
||||
);
|
||||
});
|
||||
}
|
||||
|
||||
pub fn setup_gem1_clock(tx_clock: u32) {
|
||||
let io_pll = Clocks::get().io;
|
||||
let d0 = ((tx_clock - 1 + io_pll) / tx_clock).max(1).min(63);
|
||||
let d1 = (io_pll / tx_clock / d0).max(1).min(63);
|
||||
|
||||
slcr::RegisterBlock::unlocked(|slcr| {
|
||||
slcr.gem1_clk_ctrl.write(
|
||||
slcr::GemClkCtrl::zeroed()
|
||||
.clkact(true)
|
||||
.srcsel(slcr::PllSource::IoPll)
|
||||
.divisor(d0 as u8)
|
||||
.divisor1(d1 as u8)
|
||||
);
|
||||
// Enable gem1 recv clock
|
||||
slcr.gem1_rclk_ctrl.write(
|
||||
// 0x0000_0801
|
||||
slcr::RclkCtrl::zeroed()
|
||||
.clkact(true)
|
||||
);
|
||||
});
|
||||
}
|
||||
|
||||
pub fn start_rx(self, rx_size: usize) -> Eth<'r, rx::DescList, TX> {
|
||||
impl<GEM: Gem, RX, TX> Eth<GEM, RX, TX> {
|
||||
pub fn start_rx(self, rx_size: usize) -> Eth<GEM, rx::DescList, TX> {
|
||||
let new_self = Eth {
|
||||
rx: rx::DescList::new(rx_size),
|
||||
tx: self.tx,
|
||||
inner: self.inner,
|
||||
phy: self.phy,
|
||||
idle: self.idle,
|
||||
};
|
||||
let list_addr = new_self.rx.list_addr();
|
||||
assert!(list_addr & 0b11 == 0);
|
||||
new_self.inner.regs.rx_qbar.write(
|
||||
GEM::regs().rx_qbar.write(
|
||||
regs::RxQbar::zeroed()
|
||||
.rx_q_baseaddr(list_addr >> 2)
|
||||
);
|
||||
new_self.inner.regs.net_ctrl.modify(|_, w|
|
||||
GEM::regs().net_ctrl.modify(|_, w|
|
||||
w.rx_en(true)
|
||||
);
|
||||
new_self
|
||||
}
|
||||
|
||||
pub fn start_tx(self, tx_size: usize) -> Eth<'r, RX, tx::DescList> {
|
||||
pub fn start_tx(self, tx_size: usize) -> Eth<GEM, RX, tx::DescList> {
|
||||
let new_self = Eth {
|
||||
rx: self.rx,
|
||||
tx: tx::DescList::new(tx_size),
|
||||
inner: self.inner,
|
||||
phy: self.phy,
|
||||
idle: self.idle,
|
||||
};
|
||||
let list_addr = &new_self.tx.list_addr();
|
||||
assert!(list_addr & 0b11 == 0);
|
||||
new_self.inner.regs.tx_qbar.write(
|
||||
GEM::regs().tx_qbar.write(
|
||||
regs::TxQbar::zeroed()
|
||||
.tx_q_baseaddr(list_addr >> 2)
|
||||
);
|
||||
new_self.inner.regs.net_ctrl.modify(|_, w|
|
||||
GEM::regs().net_ctrl.modify(|_, w|
|
||||
w.tx_en(true)
|
||||
);
|
||||
new_self
|
||||
}
|
||||
}
|
||||
|
||||
impl<'r, TX> Eth<'r, rx::DescList, TX> {
|
||||
impl<GEM: Gem, TX> Eth<GEM, rx::DescList, TX> {
|
||||
pub fn recv_next<'s: 'p, 'p>(&'s mut self) -> Result<Option<rx::PktRef<'p>>, rx::Error> {
|
||||
let status = self.inner.regs.rx_status.read();
|
||||
let status = GEM::regs().rx_status.read();
|
||||
if status.hresp_not_ok() {
|
||||
// Clear
|
||||
self.inner.regs.rx_status.write(
|
||||
GEM::regs().rx_status.write(
|
||||
regs::RxStatus::zeroed()
|
||||
.hresp_not_ok(true)
|
||||
);
|
||||
|
@ -315,7 +388,7 @@ impl<'r, TX> Eth<'r, rx::DescList, TX> {
|
|||
}
|
||||
if status.rx_overrun() {
|
||||
// Clear
|
||||
self.inner.regs.rx_status.write(
|
||||
GEM::regs().rx_status.write(
|
||||
regs::RxStatus::zeroed()
|
||||
.rx_overrun(true)
|
||||
);
|
||||
|
@ -323,7 +396,7 @@ impl<'r, TX> Eth<'r, rx::DescList, TX> {
|
|||
}
|
||||
if status.buffer_not_avail() {
|
||||
// Clear
|
||||
self.inner.regs.rx_status.write(
|
||||
GEM::regs().rx_status.write(
|
||||
regs::RxStatus::zeroed()
|
||||
.buffer_not_avail(true)
|
||||
);
|
||||
|
@ -335,28 +408,42 @@ impl<'r, TX> Eth<'r, rx::DescList, TX> {
|
|||
match result {
|
||||
Ok(None) => {
|
||||
// No packet, clear status bit
|
||||
self.inner.regs.rx_status.write(
|
||||
GEM::regs().rx_status.write(
|
||||
regs::RxStatus::zeroed()
|
||||
.frame_recd(true)
|
||||
);
|
||||
self.idle = true;
|
||||
}
|
||||
_ => {}
|
||||
_ =>
|
||||
self.idle = false,
|
||||
}
|
||||
result
|
||||
} else {
|
||||
self.inner.check_link_change(&self.phy);
|
||||
self.idle = true;
|
||||
Ok(None)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl<'r, RX> Eth<'r, RX, tx::DescList> {
|
||||
pub fn send<'s: 'p, 'p>(&'s mut self, length: usize) -> Option<tx::PktRef<'p>> {
|
||||
self.tx.send(self.inner.regs, length)
|
||||
impl<GEM: Gem, TX> libasync::smoltcp::LinkCheck for &mut Eth<GEM, rx::DescList, TX> {
|
||||
type Link = Option<phy::Link>;
|
||||
|
||||
fn check_link_change(&mut self) -> Option<Self::Link> {
|
||||
self.inner.check_link_change(&self.phy)
|
||||
}
|
||||
|
||||
fn is_idle(&self) -> bool {
|
||||
self.idle
|
||||
}
|
||||
}
|
||||
|
||||
impl<'r, 'a> smoltcp::phy::Device<'a> for &mut Eth<'r, rx::DescList, tx::DescList> {
|
||||
impl<GEM: Gem, RX> Eth<GEM, RX, tx::DescList> {
|
||||
pub fn send<'s: 'p, 'p>(&'s mut self, length: usize) -> Option<tx::PktRef<'p>> {
|
||||
self.tx.send(GEM::regs(), length)
|
||||
}
|
||||
}
|
||||
|
||||
impl<'a, GEM: Gem> smoltcp::phy::Device<'a> for &mut Eth<GEM, rx::DescList, tx::DescList> {
|
||||
type RxToken = rx::PktRef<'a>;
|
||||
type TxToken = tx::Token<'a>;
|
||||
|
||||
|
@ -370,6 +457,7 @@ impl<'r, 'a> smoltcp::phy::Device<'a> for &mut Eth<'r, rx::DescList, tx::DescLis
|
|||
|
||||
let mut caps = DeviceCapabilities::default();
|
||||
caps.max_transmission_unit = MTU;
|
||||
caps.max_burst_size = Some(self.rx.len().min(self.tx.len()));
|
||||
caps.checksum = checksum_caps;
|
||||
|
||||
caps
|
||||
|
@ -379,13 +467,14 @@ impl<'r, 'a> smoltcp::phy::Device<'a> for &mut Eth<'r, rx::DescList, tx::DescLis
|
|||
match self.rx.recv_next() {
|
||||
Ok(Some(pktref)) => {
|
||||
let tx_token = tx::Token {
|
||||
regs: self.inner.regs,
|
||||
regs: GEM::regs(),
|
||||
desc_list: &mut self.tx,
|
||||
};
|
||||
self.idle = false;
|
||||
Some((pktref, tx_token))
|
||||
}
|
||||
Ok(None) => {
|
||||
self.inner.check_link_change(&self.phy);
|
||||
self.idle = true;
|
||||
None
|
||||
}
|
||||
Err(e) => {
|
||||
|
@ -397,33 +486,95 @@ impl<'r, 'a> smoltcp::phy::Device<'a> for &mut Eth<'r, rx::DescList, tx::DescLis
|
|||
|
||||
fn transmit(&'a mut self) -> Option<Self::TxToken> {
|
||||
Some(tx::Token {
|
||||
regs: self.inner.regs,
|
||||
regs: GEM::regs(),
|
||||
desc_list: &mut self.tx,
|
||||
})
|
||||
}
|
||||
}
|
||||
|
||||
pub struct PhyRst {
|
||||
regs: regs::GpioRegisterBlock,
|
||||
count_down: super::timer::global::CountDown<Milliseconds>,
|
||||
}
|
||||
|
||||
impl PhyRst {
|
||||
pub fn rst_pin() -> Self {
|
||||
slcr::RegisterBlock::unlocked(|slcr| {
|
||||
// Hardware Reset for PHY
|
||||
slcr.mio_pin_47.write(
|
||||
slcr::MioPin47::zeroed()
|
||||
.l3_sel(0b000)
|
||||
.io_type(slcr::IoBufferType::Lvcmos18)
|
||||
.pullup(true)
|
||||
.disable_rcvr(true)
|
||||
);
|
||||
});
|
||||
Self::eth_reset_common(0xFFFF - 0x8000)
|
||||
}
|
||||
|
||||
fn delay_ms(&mut self, ms: u64) {
|
||||
self.count_down.start(Milliseconds(ms));
|
||||
nb::block!(self.count_down.wait()).unwrap();
|
||||
}
|
||||
|
||||
fn eth_reset_common(gpio_output_mask: u16) -> Self {
|
||||
let self_ = Self {
|
||||
regs: regs::GpioRegisterBlock::regs(),
|
||||
count_down: unsafe { super::timer::GlobalTimer::get() }.countdown(),
|
||||
};
|
||||
|
||||
// Setup GPIO output mask
|
||||
self_.regs.gpio_output_mask.modify(|_, w| {
|
||||
w.mask(gpio_output_mask)
|
||||
});
|
||||
|
||||
self_.regs.gpio_direction.modify(|_, w| {
|
||||
w.phy_rst(true)
|
||||
});
|
||||
|
||||
self_
|
||||
}
|
||||
|
||||
fn oe(&mut self, oe: bool) {
|
||||
self.regs.gpio_output_enable.modify(|_, w| {
|
||||
w.phy_rst(oe)
|
||||
})
|
||||
}
|
||||
|
||||
fn toggle(&mut self, o: bool) {
|
||||
self.regs.gpio_output_mask.modify(|_, w| {
|
||||
w.phy_rst(o)
|
||||
})
|
||||
}
|
||||
|
||||
pub fn reset(&mut self) {
|
||||
self.toggle(false); // drive phy_rst (active LOW) pin low
|
||||
self.oe(true); // enable pin's output
|
||||
self.delay_ms(10);
|
||||
self.toggle(true);
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
struct EthInner<'r> {
|
||||
regs: &'r mut regs::RegisterBlock,
|
||||
struct EthInner<GEM: Gem> {
|
||||
gem: PhantomData<GEM>,
|
||||
link: Option<phy::Link>,
|
||||
}
|
||||
|
||||
impl<'r> EthInner<'r> {
|
||||
impl<GEM: Gem> EthInner<GEM> {
|
||||
fn init(&mut self) {
|
||||
// Clear the Network Control register.
|
||||
self.regs.net_ctrl.write(regs::NetCtrl::zeroed());
|
||||
self.regs.net_ctrl.write(regs::NetCtrl::zeroed().clear_stat_regs(true));
|
||||
GEM::regs().net_ctrl.write(regs::NetCtrl::zeroed());
|
||||
GEM::regs().net_ctrl.write(regs::NetCtrl::zeroed().clear_stat_regs(true));
|
||||
// Clear the Status registers.
|
||||
self.regs.rx_status.write(
|
||||
GEM::regs().rx_status.write(
|
||||
regs::RxStatus::zeroed()
|
||||
.buffer_not_avail(true)
|
||||
.frame_recd(true)
|
||||
.rx_overrun(true)
|
||||
.hresp_not_ok(true)
|
||||
);
|
||||
self.regs.tx_status.write(
|
||||
GEM::regs().tx_status.write(
|
||||
regs::TxStatus::zeroed()
|
||||
.used_bit_read(true)
|
||||
.collision(true)
|
||||
|
@ -437,7 +588,7 @@ impl<'r> EthInner<'r> {
|
|||
.hresp_not_ok(true)
|
||||
);
|
||||
// Disable all interrupts.
|
||||
self.regs.intr_dis.write(
|
||||
GEM::regs().intr_dis.write(
|
||||
regs::IntrDis::zeroed()
|
||||
.mgmt_done(true)
|
||||
.rx_complete(true)
|
||||
|
@ -467,29 +618,32 @@ impl<'r> EthInner<'r> {
|
|||
.tsu_sec_incr(true)
|
||||
);
|
||||
// Clear the buffer queues.
|
||||
self.regs.rx_qbar.write(
|
||||
GEM::regs().rx_qbar.write(
|
||||
regs::RxQbar::zeroed()
|
||||
);
|
||||
self.regs.tx_qbar.write(
|
||||
GEM::regs().tx_qbar.write(
|
||||
regs::TxQbar::zeroed()
|
||||
);
|
||||
}
|
||||
|
||||
fn configure(&mut self, macaddr: [u8; 6]) {
|
||||
let clocks = Clocks::get();
|
||||
let mdc_clk_div = (clocks.cpu_1x() / MAX_MDC) + 1;
|
||||
let mut mdc_clk_div = clocks.cpu_1x() / MAX_MDC;
|
||||
if clocks.cpu_1x() % MAX_MDC > 0 {
|
||||
mdc_clk_div += 1;
|
||||
}
|
||||
|
||||
self.regs.net_cfg.write(
|
||||
GEM::regs().net_cfg.write(
|
||||
regs::NetCfg::zeroed()
|
||||
.full_duplex(true)
|
||||
.gige_en(true)
|
||||
.speed(true)
|
||||
.no_broadcast(false)
|
||||
.multi_hash_en(true)
|
||||
// Promiscuous mode (TODO?)
|
||||
.copy_all(true)
|
||||
.rx_1536_byte_frames(true)
|
||||
// Remove 4-byte Frame CheckSum
|
||||
.fcs_remove(true)
|
||||
.dis_cp_pause_frame(true)
|
||||
// RX checksum offload
|
||||
.rx_chksum_offld_en(true)
|
||||
// One of the slower speeds
|
||||
|
@ -497,24 +651,25 @@ impl<'r> EthInner<'r> {
|
|||
);
|
||||
|
||||
let macaddr_msbs =
|
||||
(u16::from(macaddr[0]) << 8) |
|
||||
u16::from(macaddr[1]);
|
||||
(u16::from(macaddr[5]) << 8) |
|
||||
u16::from(macaddr[4]);
|
||||
let macaddr_lsbs =
|
||||
(u32::from(macaddr[2]) << 24) |
|
||||
(u32::from(macaddr[3]) << 16) |
|
||||
(u32::from(macaddr[4]) << 8) |
|
||||
u32::from(macaddr[5]);
|
||||
self.regs.spec_addr1_top.write(
|
||||
regs::SpecAddrTop::zeroed()
|
||||
.addr_msbs(macaddr_msbs)
|
||||
);
|
||||
self.regs.spec_addr1_bot.write(
|
||||
(u32::from(macaddr[3]) << 24) |
|
||||
(u32::from(macaddr[2]) << 16) |
|
||||
(u32::from(macaddr[1]) << 8) |
|
||||
u32::from(macaddr[0]);
|
||||
// writing to bot would disable the specific address
|
||||
GEM::regs().spec_addr1_bot.write(
|
||||
regs::SpecAddrBot::zeroed()
|
||||
.addr_lsbs(macaddr_lsbs)
|
||||
);
|
||||
// writing to top would enable it again
|
||||
GEM::regs().spec_addr1_top.write(
|
||||
regs::SpecAddrTop::zeroed()
|
||||
.addr_msbs(macaddr_msbs)
|
||||
);
|
||||
|
||||
|
||||
self.regs.dma_cfg.write(
|
||||
GEM::regs().dma_cfg.write(
|
||||
regs::DmaCfg::zeroed()
|
||||
// 1536 bytes
|
||||
.ahb_mem_rx_buf_size((MTU >> 6) as u8)
|
||||
|
@ -530,7 +685,7 @@ impl<'r> EthInner<'r> {
|
|||
.ahb_fixed_burst_len(0x10)
|
||||
);
|
||||
|
||||
self.regs.net_ctrl.write(
|
||||
GEM::regs().net_ctrl.write(
|
||||
regs::NetCtrl::zeroed()
|
||||
.mgmt_port_en(true)
|
||||
);
|
||||
|
@ -538,17 +693,11 @@ impl<'r> EthInner<'r> {
|
|||
|
||||
|
||||
fn wait_phy_idle(&self) {
|
||||
while !self.regs.net_status.read().phy_mgmt_idle() {}
|
||||
while !GEM::regs().net_status.read().phy_mgmt_idle() {}
|
||||
}
|
||||
|
||||
|
||||
fn check_link_change(&mut self, phy: &Phy) {
|
||||
// As the PHY access takes some time, exit early if there was
|
||||
// already a link. TODO: check once per second.
|
||||
if self.link.is_some() {
|
||||
return
|
||||
}
|
||||
|
||||
fn check_link_change(&mut self, phy: &Phy) -> Option<Option<phy::Link>> {
|
||||
let link = phy.get_link(self);
|
||||
|
||||
// Check link state transition
|
||||
|
@ -557,17 +706,15 @@ impl<'r> EthInner<'r> {
|
|||
Some(link) => {
|
||||
info!("eth: got {:?}", link);
|
||||
|
||||
use phy::LinkSpeed::*;
|
||||
use phy::{LinkDuplex::Full, LinkSpeed::*};
|
||||
let txclock = match link.speed {
|
||||
S10 => TX_10,
|
||||
S100 => TX_100,
|
||||
S1000 => TX_1000,
|
||||
};
|
||||
Eth::<(), ()>::setup_gem0_clock(txclock);
|
||||
/* .full_duplex(false) doesn't work even if
|
||||
half duplex has been negotiated. */
|
||||
self.regs.net_cfg.modify(|_, w| w
|
||||
.full_duplex(true)
|
||||
GEM::setup_clock(txclock);
|
||||
GEM::regs().net_cfg.modify(|_, w| w
|
||||
.full_duplex(link.duplex == Full)
|
||||
.gige_en(link.speed == S1000)
|
||||
.speed(link.speed != S10)
|
||||
);
|
||||
|
@ -582,14 +729,17 @@ impl<'r> EthInner<'r> {
|
|||
}
|
||||
|
||||
self.link = link;
|
||||
Some(link)
|
||||
} else {
|
||||
None
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl<'r> PhyAccess for EthInner<'r> {
|
||||
impl<GEM: Gem> PhyAccess for EthInner<GEM> {
|
||||
fn read_phy(&mut self, addr: u8, reg: u8) -> u16 {
|
||||
self.wait_phy_idle();
|
||||
self.regs.phy_maint.write(
|
||||
GEM::regs().phy_maint.write(
|
||||
regs::PhyMaint::zeroed()
|
||||
.clause_22(true)
|
||||
.operation(regs::PhyOperation::Read)
|
||||
|
@ -598,12 +748,12 @@ impl<'r> PhyAccess for EthInner<'r> {
|
|||
.must_10(0b10)
|
||||
);
|
||||
self.wait_phy_idle();
|
||||
self.regs.phy_maint.read().data()
|
||||
GEM::regs().phy_maint.read().data()
|
||||
}
|
||||
|
||||
fn write_phy(&mut self, addr: u8, reg: u8, data: u16) {
|
||||
self.wait_phy_idle();
|
||||
self.regs.phy_maint.write(
|
||||
GEM::regs().phy_maint.write(
|
||||
regs::PhyMaint::zeroed()
|
||||
.clause_22(true)
|
||||
.operation(regs::PhyOperation::Write)
|
||||
|
|
|
@ -82,6 +82,10 @@ impl PhyRegister for Control {
|
|||
fn addr() -> u8 {
|
||||
0
|
||||
}
|
||||
|
||||
fn page() -> u8 {
|
||||
0
|
||||
}
|
||||
}
|
||||
|
||||
impl From<u16> for Control {
|
||||
|
|
|
@ -1,59 +0,0 @@
|
|||
use bit_field::BitField;
|
||||
use super::{PhyRegister, Link, LinkDuplex, LinkSpeed};
|
||||
|
||||
#[derive(Clone, Copy, Debug)]
|
||||
/// 1000Base-T Extended Status Register
|
||||
pub struct ExtendedStatus(pub u16);
|
||||
|
||||
impl ExtendedStatus {
|
||||
pub fn cap_1000base_t_half(&self) -> bool {
|
||||
self.0.get_bit(12)
|
||||
}
|
||||
pub fn cap_1000base_t_full(&self) -> bool {
|
||||
self.0.get_bit(13)
|
||||
}
|
||||
pub fn cap_1000base_x_half(&self) -> bool {
|
||||
self.0.get_bit(14)
|
||||
}
|
||||
pub fn cap_1000base_x_full(&self) -> bool {
|
||||
self.0.get_bit(12)
|
||||
}
|
||||
|
||||
pub fn get_link(&self) -> Option<Link> {
|
||||
if self.cap_1000base_t_half() {
|
||||
Some(Link {
|
||||
speed: LinkSpeed::S1000,
|
||||
duplex: LinkDuplex::Half,
|
||||
})
|
||||
} else if self.cap_1000base_t_full() {
|
||||
Some(Link {
|
||||
speed: LinkSpeed::S1000,
|
||||
duplex: LinkDuplex::Full,
|
||||
})
|
||||
} else if self.cap_1000base_x_half() {
|
||||
Some(Link {
|
||||
speed: LinkSpeed::S1000,
|
||||
duplex: LinkDuplex::Half,
|
||||
})
|
||||
} else if self.cap_1000base_x_full() {
|
||||
Some(Link {
|
||||
speed: LinkSpeed::S1000,
|
||||
duplex: LinkDuplex::Full,
|
||||
})
|
||||
} else {
|
||||
None
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl PhyRegister for ExtendedStatus {
|
||||
fn addr() -> u8 {
|
||||
0xF
|
||||
}
|
||||
}
|
||||
|
||||
impl From<u16> for ExtendedStatus {
|
||||
fn from(value: u16) -> Self {
|
||||
ExtendedStatus(value)
|
||||
}
|
||||
}
|
|
@ -11,6 +11,9 @@ pub struct PhyIdentifier {
|
|||
}
|
||||
|
||||
pub fn identify_phy<PA: PhyAccess>(pa: &mut PA, addr: u8) -> Option<PhyIdentifier> {
|
||||
#[cfg(feature = "target_kasli_soc")]
|
||||
pa.write_phy(addr, 0x16, 0); //reset page
|
||||
|
||||
let id1 = pa.read_phy(addr, 2);
|
||||
let id2 = pa.read_phy(addr, 3);
|
||||
if id1 != 0xFFFF || id2 != 0xFFFF {
|
||||
|
|
|
@ -0,0 +1,79 @@
|
|||
use bit_field::BitField;
|
||||
use super::{PhyRegister, Led0Control, Led1Control};
|
||||
|
||||
#[derive(Clone, Copy, Debug)]
|
||||
/// LED Control Register
|
||||
pub struct Leds(pub u16);
|
||||
|
||||
impl Leds {
|
||||
pub fn led0(&self) -> Led0Control {
|
||||
match self.0.get_bits(0..=3) {
|
||||
0b0000 => Led0Control::OnLinkOffNoLink,
|
||||
0b0001 => Led0Control::OnLinkBlinkActivityOffNoLink,
|
||||
0b0010 => Led0Control::BlinkDependingOnLink,
|
||||
0b0011 => Led0Control::OnActivityOffNoActivity,
|
||||
0b0100 => Led0Control::BlinkActivityOffNoActivity,
|
||||
0b0101 => Led0Control::OnTransmitOffNoTransmit,
|
||||
0b0110 => Led0Control::OnCopperLinkOffElse,
|
||||
0b0111 => Led0Control::On1000LinkOffElse,
|
||||
0b1000 => Led0Control::ForceOff,
|
||||
0b1001 => Led0Control::ForceOn,
|
||||
0b1010 => Led0Control::ForceHiZ,
|
||||
0b1011 => Led0Control::ForceBlink,
|
||||
0b1100 => Led0Control::Mode1,
|
||||
0b1101 => Led0Control::Mode2,
|
||||
0b1110 => Led0Control::Mode3,
|
||||
0b1111 => Led0Control::Mode4,
|
||||
_ => unreachable!()
|
||||
}
|
||||
}
|
||||
pub fn led1(&self) -> Led1Control {
|
||||
match self.0.get_bits(4..=7) {
|
||||
0b0000 => Led1Control::OnReceiveOffNoReceive,
|
||||
0b0001 => Led1Control::OnLinkBlinkActivityOffNoLink,
|
||||
0b0010 => Led1Control::OnLinkBlinkReceiveOffNoLink,
|
||||
0b0011 => Led1Control::OnActivityOffNoActivity,
|
||||
0b0100 => Led1Control::BlinkActivityOffNoActivity,
|
||||
0b0101 => Led1Control::On100OrFiberOffElse,
|
||||
0b0110 => Led1Control::On1001000LinkOffElse,
|
||||
0b0111 => Led1Control::On100LinkOffElse,
|
||||
0b1000 => Led1Control::ForceOff,
|
||||
0b1001 => Led1Control::ForceOn,
|
||||
0b1010 => Led1Control::ForceHiZ,
|
||||
0b1011 => Led1Control::ForceBlink,
|
||||
_ => unreachable!()
|
||||
}
|
||||
}
|
||||
|
||||
pub fn set_led0(mut self, setting: Led0Control) -> Self {
|
||||
self.0.set_bits(0..=3, setting as u16);
|
||||
self
|
||||
}
|
||||
|
||||
pub fn set_led1(mut self, setting: Led1Control) -> Self {
|
||||
self.0.set_bits(4..=7, setting as u16);
|
||||
self
|
||||
}
|
||||
}
|
||||
|
||||
impl PhyRegister for Leds {
|
||||
fn addr() -> u8 {
|
||||
0x10
|
||||
}
|
||||
|
||||
fn page() -> u8 {
|
||||
3
|
||||
}
|
||||
}
|
||||
|
||||
impl From<u16> for Leds {
|
||||
fn from(value: u16) -> Self {
|
||||
Leds(value)
|
||||
}
|
||||
}
|
||||
|
||||
impl Into<u16> for Leds {
|
||||
fn into(self) -> u16 {
|
||||
self.0
|
||||
}
|
||||
}
|
|
@ -2,12 +2,14 @@ pub mod id;
|
|||
use id::{identify_phy, PhyIdentifier};
|
||||
mod status;
|
||||
pub use status::Status;
|
||||
mod extended_status;
|
||||
pub use extended_status::ExtendedStatus;
|
||||
mod control;
|
||||
pub use control::Control;
|
||||
mod pssr;
|
||||
pub use pssr::PSSR;
|
||||
mod leds;
|
||||
pub use leds::Leds;
|
||||
|
||||
#[derive(Clone, Debug, PartialEq)]
|
||||
#[derive(Copy, Clone, Debug, PartialEq)]
|
||||
pub struct Link {
|
||||
pub speed: LinkSpeed,
|
||||
pub duplex: LinkDuplex,
|
||||
|
@ -26,58 +28,98 @@ pub enum LinkDuplex {
|
|||
Full,
|
||||
}
|
||||
|
||||
#[derive(Copy, Clone, Debug, PartialEq)]
|
||||
pub enum Led0Control {
|
||||
OnLinkOffNoLink = 0b0000,
|
||||
OnLinkBlinkActivityOffNoLink = 0b0001,
|
||||
BlinkDependingOnLink = 0b0010,
|
||||
OnActivityOffNoActivity = 0b0011,
|
||||
BlinkActivityOffNoActivity = 0b0100,
|
||||
OnTransmitOffNoTransmit = 0b0101,
|
||||
OnCopperLinkOffElse = 0b0110,
|
||||
On1000LinkOffElse = 0b0111,
|
||||
ForceOff = 0b1000,
|
||||
ForceOn = 0b1001,
|
||||
ForceHiZ = 0b1010,
|
||||
ForceBlink = 0b1011,
|
||||
Mode1 = 0b1100,
|
||||
Mode2 = 0b1101,
|
||||
Mode3 = 0b1110,
|
||||
Mode4 = 0b1111
|
||||
}
|
||||
|
||||
#[derive(Copy, Clone, Debug, PartialEq)]
|
||||
pub enum Led1Control {
|
||||
OnReceiveOffNoReceive = 0b0000,
|
||||
OnLinkBlinkActivityOffNoLink = 0b0001,
|
||||
OnLinkBlinkReceiveOffNoLink = 0b0010,
|
||||
OnActivityOffNoActivity = 0b0011,
|
||||
BlinkActivityOffNoActivity = 0b0100,
|
||||
On100OrFiberOffElse = 0b0101,
|
||||
On1001000LinkOffElse = 0b0110,
|
||||
On100LinkOffElse = 0b0111,
|
||||
ForceOff = 0b1000,
|
||||
ForceOn = 0b1001,
|
||||
ForceHiZ = 0b1010,
|
||||
ForceBlink = 0b1011,
|
||||
}
|
||||
|
||||
pub trait PhyAccess {
|
||||
fn read_phy(&mut self, addr: u8, reg: u8) -> u16;
|
||||
fn write_phy(&mut self, addr: u8, reg: u8, data: u16);
|
||||
}
|
||||
|
||||
pub trait PhyRegister {
|
||||
fn addr() -> u8;
|
||||
fn page() -> u8;
|
||||
}
|
||||
|
||||
|
||||
#[derive(Clone)]
|
||||
pub struct Phy {
|
||||
pub addr: u8,
|
||||
device: PhyDevice,
|
||||
}
|
||||
|
||||
#[derive(Clone, Copy)]
|
||||
pub enum PhyDevice {
|
||||
Marvel88E1116R,
|
||||
Rtl8211E,
|
||||
}
|
||||
|
||||
const OUI_MARVEL: u32 = 0x005043;
|
||||
const OUI_MARVELL: u32 = 0x005043;
|
||||
const OUI_REALTEK: u32 = 0x000732;
|
||||
const OUI_LANTIQ : u32 = 0x355969;
|
||||
|
||||
//only change pages on Kasli-SoC's Marvel 88E11xx
|
||||
#[cfg(feature="target_kasli_soc")]
|
||||
const PAGE_REGISTER: u8 = 0x16;
|
||||
|
||||
impl Phy {
|
||||
/// Probe all addresses on MDIO for a known PHY
|
||||
pub fn find<PA: PhyAccess>(pa: &mut PA) -> Option<Phy> {
|
||||
for addr in 1..32 {
|
||||
let device = match identify_phy(pa, addr) {
|
||||
(0..32).find(|addr| {
|
||||
match identify_phy(pa, *addr) {
|
||||
Some(PhyIdentifier {
|
||||
oui: OUI_MARVEL,
|
||||
oui: OUI_MARVELL,
|
||||
// Marvell 88E1116R
|
||||
model: 36,
|
||||
..
|
||||
}) => Some(PhyDevice::Marvel88E1116R),
|
||||
}) => true,
|
||||
Some(PhyIdentifier {
|
||||
oui: OUI_MARVELL,
|
||||
// Marvell 88E1512
|
||||
model: 29,
|
||||
..
|
||||
}) => true,
|
||||
Some(PhyIdentifier {
|
||||
oui: OUI_REALTEK,
|
||||
// RTL 8211E
|
||||
model: 0b010001,
|
||||
rev: 0b0101,
|
||||
}) => Some(PhyDevice::Rtl8211E),
|
||||
_ => None,
|
||||
};
|
||||
match device {
|
||||
Some(device) =>
|
||||
return Some(Phy { addr, device }),
|
||||
None => {}
|
||||
}) => true,
|
||||
Some(PhyIdentifier {
|
||||
oui: OUI_LANTIQ,
|
||||
// Intel XWAY PHY11G (PEF 7071/PEF 7072) v1.5 / v1.6
|
||||
model: 0,
|
||||
..
|
||||
}) => true,
|
||||
_ => false,
|
||||
}
|
||||
}
|
||||
|
||||
None
|
||||
}
|
||||
|
||||
pub fn name(&self) -> &'static str {
|
||||
match self.device {
|
||||
PhyDevice::Marvel88E1116R => &"Marvel 88E1116R",
|
||||
PhyDevice::Rtl8211E => &"RTL8211E",
|
||||
}
|
||||
}).map(|addr| Phy { addr })
|
||||
}
|
||||
|
||||
pub fn read_reg<PA, PR>(&self, pa: &mut PA) -> PR
|
||||
|
@ -85,6 +127,9 @@ impl Phy {
|
|||
PA: PhyAccess,
|
||||
PR: PhyRegister + From<u16>,
|
||||
{
|
||||
#[cfg(feature="target_kasli_soc")]
|
||||
pa.write_phy(self.addr, PAGE_REGISTER, PR::page().into());
|
||||
|
||||
pa.read_phy(self.addr, PR::addr()).into()
|
||||
}
|
||||
|
||||
|
@ -94,6 +139,9 @@ impl Phy {
|
|||
PR: PhyRegister + From<u16> + Into<u16>,
|
||||
F: FnMut(PR) -> PR,
|
||||
{
|
||||
#[cfg(feature="target_kasli_soc")]
|
||||
pa.write_phy(self.addr, PAGE_REGISTER, PR::page().into());
|
||||
|
||||
let reg = pa.read_phy(self.addr, PR::addr()).into();
|
||||
let reg = f(reg);
|
||||
pa.write_phy(self.addr, PR::addr(), reg.into())
|
||||
|
@ -107,6 +155,14 @@ impl Phy {
|
|||
self.modify_reg(pa, f)
|
||||
}
|
||||
|
||||
pub fn modify_leds<PA, F>(&self, pa: &mut PA, f: F)
|
||||
where
|
||||
PA: PhyAccess,
|
||||
F: FnMut(Leds) -> Leds,
|
||||
{
|
||||
self.modify_reg(pa, f)
|
||||
}
|
||||
|
||||
pub fn get_control<PA: PhyAccess>(&self, pa: &mut PA) -> Control {
|
||||
self.read_reg(pa)
|
||||
}
|
||||
|
@ -120,12 +176,8 @@ impl Phy {
|
|||
if !status.link_status() {
|
||||
None
|
||||
} else if status.cap_1000base_t_extended_status() {
|
||||
let ext_status: ExtendedStatus = self.read_reg(pa);
|
||||
if let Some(link) = ext_status.get_link() {
|
||||
Some(link)
|
||||
} else {
|
||||
status.get_link()
|
||||
}
|
||||
let phy_status: PSSR = self.read_reg(pa);
|
||||
phy_status.get_link()
|
||||
} else {
|
||||
status.get_link()
|
||||
}
|
||||
|
@ -144,8 +196,12 @@ impl Phy {
|
|||
.set_restart_autoneg(true)
|
||||
);
|
||||
}
|
||||
}
|
||||
|
||||
pub trait PhyRegister {
|
||||
fn addr() -> u8;
|
||||
#[cfg(feature="target_kasli_soc")]
|
||||
pub fn set_leds<PA: PhyAccess>(&self, pa: &mut PA) {
|
||||
self.modify_leds(pa, |leds|
|
||||
leds.set_led0(Led0Control::OnCopperLinkOffElse)
|
||||
.set_led1(Led1Control::BlinkActivityOffNoActivity)
|
||||
);
|
||||
}
|
||||
}
|
||||
|
|
|
@ -0,0 +1,56 @@
|
|||
use bit_field::BitField;
|
||||
use super::{PhyRegister, Link, LinkDuplex, LinkSpeed};
|
||||
|
||||
#[derive(Clone, Copy, Debug)]
|
||||
/// PHY-Specific Status Register
|
||||
pub struct PSSR(pub u16);
|
||||
|
||||
impl PSSR {
|
||||
pub fn link(&self) -> bool {
|
||||
self.0.get_bit(10)
|
||||
}
|
||||
|
||||
pub fn duplex(&self) -> LinkDuplex {
|
||||
if self.0.get_bit(13) {
|
||||
LinkDuplex::Full
|
||||
} else {
|
||||
LinkDuplex::Half
|
||||
}
|
||||
}
|
||||
|
||||
pub fn speed(&self) -> Option<LinkSpeed> {
|
||||
match self.0.get_bits(14..=15) {
|
||||
0b00 => Some(LinkSpeed::S10),
|
||||
0b01 => Some(LinkSpeed::S100),
|
||||
0b10 => Some(LinkSpeed::S1000),
|
||||
_ => None,
|
||||
}
|
||||
}
|
||||
|
||||
pub fn get_link(&self) -> Option<Link> {
|
||||
if self.link() {
|
||||
Some(Link {
|
||||
speed: self.speed()?,
|
||||
duplex: self.duplex(),
|
||||
})
|
||||
} else {
|
||||
None
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl PhyRegister for PSSR {
|
||||
fn addr() -> u8 {
|
||||
0x11
|
||||
}
|
||||
|
||||
fn page() -> u8 {
|
||||
0
|
||||
}
|
||||
}
|
||||
|
||||
impl From<u16> for PSSR {
|
||||
fn from(value: u16) -> Self {
|
||||
PSSR(value)
|
||||
}
|
||||
}
|
|
@ -100,6 +100,10 @@ impl PhyRegister for Status {
|
|||
fn addr() -> u8 {
|
||||
1
|
||||
}
|
||||
|
||||
fn page() -> u8 {
|
||||
0
|
||||
}
|
||||
}
|
||||
|
||||
impl From<u16> for Status {
|
||||
|
|
|
@ -1,6 +1,6 @@
|
|||
use volatile_register::{RO, WO, RW};
|
||||
|
||||
use libregister::{register, register_bit, register_bits, register_bits_typed};
|
||||
use libregister::{register, register_at, register_bit, register_bits, register_bits_typed};
|
||||
|
||||
#[repr(C)]
|
||||
pub struct RegisterBlock {
|
||||
|
@ -110,19 +110,52 @@ pub struct RegisterBlock {
|
|||
pub design_cfg5: RO<u32>,
|
||||
}
|
||||
|
||||
impl RegisterBlock {
|
||||
const GEM0: *mut Self = 0xE000B000 as *mut _;
|
||||
const GEM1: *mut Self = 0xE000C000 as *mut _;
|
||||
pub struct GpioRegisterBlock {
|
||||
pub gpio_output_mask: &'static mut OutputMask,
|
||||
pub gpio_direction: &'static mut Direction,
|
||||
pub gpio_output_enable: &'static mut OutputEnable,
|
||||
}
|
||||
|
||||
pub fn gem0() -> &'static mut Self {
|
||||
unsafe { &mut *Self::GEM0 }
|
||||
}
|
||||
|
||||
pub fn gem1() -> &'static mut Self {
|
||||
unsafe { &mut *Self::GEM1 }
|
||||
impl GpioRegisterBlock {
|
||||
pub fn regs() -> Self {
|
||||
Self {
|
||||
gpio_output_mask: OutputMask::new(),
|
||||
gpio_direction: Direction::new(),
|
||||
gpio_output_enable: OutputEnable::new(),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
register!(gpio_output_mask,
|
||||
/// MASK_DATA_1_SW:
|
||||
/// Maskable output data for MIO[47:32]
|
||||
OutputMask, RW, u32);
|
||||
register_at!(OutputMask, 0xE000A008, new);
|
||||
register_bit!(gpio_output_mask,
|
||||
/// Output for PHY_RST (MIO[47])
|
||||
phy_rst, 15);
|
||||
register_bits!(gpio_output_mask,
|
||||
mask, u16, 16, 31);
|
||||
register!(gpio_direction,
|
||||
/// DIRM_1:
|
||||
/// Direction mode for MIO[53:32]; 0/1 = in/out
|
||||
Direction, RW, u32);
|
||||
register_at!(Direction, 0xE000A244, new);
|
||||
register_bit!(gpio_direction,
|
||||
/// Direction for PHY_RST
|
||||
phy_rst, 15);
|
||||
register!(gpio_output_enable,
|
||||
/// OEN_1:
|
||||
/// Output enable for MIO[53:32]
|
||||
OutputEnable, RW, u32);
|
||||
register_at!(OutputEnable, 0xE000A248, new);
|
||||
register_bit!(gpio_output_enable,
|
||||
/// Output enable for PHY_RST
|
||||
phy_rst, 15);
|
||||
|
||||
register_at!(RegisterBlock, 0xE000B000, gem0);
|
||||
register_at!(RegisterBlock, 0xE000C000, gem1);
|
||||
|
||||
register!(net_ctrl, NetCtrl, RW, u32);
|
||||
register_bit!(net_ctrl, loopback_local, 1);
|
||||
register_bit!(net_ctrl, rx_en, 2);
|
||||
|
|
|
@ -93,6 +93,10 @@ impl DescList {
|
|||
}
|
||||
}
|
||||
|
||||
pub fn len(&self) -> usize {
|
||||
self.list.len().min(self.buffers.len())
|
||||
}
|
||||
|
||||
pub fn list_addr(&self) -> u32 {
|
||||
&self.list[0] as *const _ as u32
|
||||
}
|
||||
|
@ -104,6 +108,20 @@ impl DescList {
|
|||
if entry.word0.read().used() {
|
||||
let word1 = entry.word1.read();
|
||||
let len = word1.frame_length_lsbs().into();
|
||||
let padding = {
|
||||
let diff = len % 0x20;
|
||||
if diff == 0 {
|
||||
0
|
||||
} else {
|
||||
0x20 - diff
|
||||
}
|
||||
};
|
||||
unsafe {
|
||||
// invalidate the buffer
|
||||
// we cannot do it in the drop function, as L2 cache data prefetch would prefetch
|
||||
// the data, and there is no way for us to prevent that unless changing MMU table.
|
||||
dci_slice(&mut self.buffers[self.next][0..len + padding]);
|
||||
}
|
||||
let buffer = &mut self.buffers[self.next][0..len];
|
||||
|
||||
self.next += 1;
|
||||
|
@ -131,10 +149,6 @@ pub struct PktRef<'a> {
|
|||
|
||||
impl<'a> Drop for PktRef<'a> {
|
||||
fn drop(&mut self) {
|
||||
// Flush buffer from cache, to be filled by the peripheral
|
||||
// before next read
|
||||
dcci_slice(self.buffer);
|
||||
|
||||
self.entry.word0.modify(|_, w| w.used(false));
|
||||
dmb();
|
||||
}
|
||||
|
|
|
@ -85,6 +85,10 @@ impl DescList {
|
|||
}
|
||||
}
|
||||
|
||||
pub fn len(&self) -> usize {
|
||||
self.list.len().min(self.buffers.len())
|
||||
}
|
||||
|
||||
pub fn list_addr(&self) -> u32 {
|
||||
&self.list[0] as *const _ as u32
|
||||
}
|
||||
|
@ -128,10 +132,8 @@ impl<'a> Drop for PktRef<'a> {
|
|||
dcc_slice(self.buffer);
|
||||
|
||||
self.entry.word1.modify(|_, w| w.used(false));
|
||||
if ! self.regs.tx_status.read().tx_go() {
|
||||
// Start TX if not already running
|
||||
self.regs.net_ctrl.modify(|_, w| w.start_tx(true));
|
||||
}
|
||||
// Start the TX engine
|
||||
self.regs.net_ctrl.modify(|_, w| w.start_tx(true));
|
||||
}
|
||||
}
|
||||
|
||||
|
@ -162,10 +164,7 @@ impl<'a> smoltcp::phy::TxToken for Token<'a> {
|
|||
None =>
|
||||
Err(smoltcp::Error::Exhausted),
|
||||
Some(mut pktref) => {
|
||||
let result = f(pktref.deref_mut());
|
||||
// TODO: on result.is_err() don;t send
|
||||
drop(pktref);
|
||||
result
|
||||
f(pktref.deref_mut())
|
||||
}
|
||||
}
|
||||
}
|
||||
|
|
|
@ -1,41 +0,0 @@
|
|||
pub trait BytesTransferExt: Sized {
|
||||
// Turn u32 into u8
|
||||
fn bytes_transfer(self) -> BytesTransfer<Self>
|
||||
where
|
||||
Self: Iterator<Item = u32>;
|
||||
}
|
||||
|
||||
impl<I: Iterator<Item = u32>> BytesTransferExt for I {
|
||||
// Turn u32 into u8
|
||||
fn bytes_transfer(self) -> BytesTransfer<Self> {
|
||||
BytesTransfer {
|
||||
iter: self,
|
||||
shift: 0,
|
||||
word: 0,
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
pub struct BytesTransfer<I: Iterator<Item = u32> + Sized> {
|
||||
iter: I,
|
||||
shift: u8,
|
||||
word: u32,
|
||||
}
|
||||
|
||||
impl<I: Iterator<Item = u32> + Sized> Iterator for BytesTransfer<I> {
|
||||
type Item = u8;
|
||||
|
||||
fn next(&mut self) -> Option<u8> {
|
||||
if self.shift > 0 {
|
||||
self.shift -= 8;
|
||||
Some((self.word >> self.shift) as u8)
|
||||
} else {
|
||||
self.iter.next()
|
||||
.and_then(|word| {
|
||||
self.shift = 32;
|
||||
self.word = word;
|
||||
self.next()
|
||||
})
|
||||
}
|
||||
}
|
||||
}
|
|
@ -1,503 +0,0 @@
|
|||
//! Quad-SPI Flash Controller
|
||||
|
||||
use core::marker::PhantomData;
|
||||
use log::{error, info, warn};
|
||||
use libregister::{RegisterR, RegisterW, RegisterRW};
|
||||
use crate::{print, println};
|
||||
use super::slcr;
|
||||
use super::clocks::source::{IoPll, ClockSource};
|
||||
|
||||
mod regs;
|
||||
mod bytes;
|
||||
pub use bytes::{BytesTransferExt, BytesTransfer};
|
||||
mod spi_flash_register;
|
||||
use spi_flash_register::*;
|
||||
mod transfer;
|
||||
use transfer::Transfer;
|
||||
|
||||
const FLASH_BAUD_RATE: u32 = 50_000_000;
|
||||
/// 16 MB
|
||||
pub const SINGLE_CAPACITY: u32 = 0x1000000;
|
||||
pub const SECTOR_SIZE: u32 = 0x10000;
|
||||
pub const PAGE_SIZE: u32 = 0x100;
|
||||
|
||||
/// Instruction: Read Identification
|
||||
const INST_RDID: u8 = 0x9F;
|
||||
/// Instruction: Read
|
||||
const INST_READ: u8 = 0x03;
|
||||
/// Instruction: Quad I/O Fast Read
|
||||
const INST_4IO_FAST_READ: u8 = 0xEB;
|
||||
/// Instruction: Write Disable
|
||||
const INST_WRDI: u8 = 0x04;
|
||||
/// Instruction: Write Enable
|
||||
const INST_WREN: u8 = 0x06;
|
||||
/// Instruction: Program page
|
||||
const INST_PP: u8 = 0x02;
|
||||
/// Instruction: Erase 4K Block
|
||||
const INST_BE_4K: u8 = 0x20;
|
||||
|
||||
#[derive(Clone)]
|
||||
pub enum SpiWord {
|
||||
W8(u8),
|
||||
W16(u16),
|
||||
W24(u32),
|
||||
W32(u32),
|
||||
}
|
||||
|
||||
impl From<u8> for SpiWord {
|
||||
fn from(x: u8) -> Self {
|
||||
SpiWord::W8(x)
|
||||
}
|
||||
}
|
||||
|
||||
impl From<u16> for SpiWord {
|
||||
fn from(x: u16) -> Self {
|
||||
SpiWord::W16(x)
|
||||
}
|
||||
}
|
||||
|
||||
impl From<u32> for SpiWord {
|
||||
fn from(x: u32) -> Self {
|
||||
SpiWord::W32(x)
|
||||
}
|
||||
}
|
||||
|
||||
/// Memory-mapped mode
|
||||
pub struct LinearAddressing;
|
||||
/// Manual I/O mode
|
||||
pub struct Manual;
|
||||
|
||||
/// Flash Interface Driver
|
||||
///
|
||||
/// For 2x Spansion S25FL128SAGMFIR01
|
||||
pub struct Flash<MODE> {
|
||||
regs: &'static mut regs::RegisterBlock,
|
||||
_mode: PhantomData<MODE>,
|
||||
}
|
||||
|
||||
impl<MODE> Flash<MODE> {
|
||||
fn transition<TO>(self) -> Flash<TO> {
|
||||
Flash {
|
||||
regs: self.regs,
|
||||
_mode: PhantomData,
|
||||
}
|
||||
}
|
||||
|
||||
fn disable_interrupts(&mut self) {
|
||||
self.regs.intr_dis.write(
|
||||
regs::IntrDis::zeroed()
|
||||
.rx_overflow(true)
|
||||
.tx_fifo_not_full(true)
|
||||
.tx_fifo_full(true)
|
||||
.rx_fifo_not_empty(true)
|
||||
.rx_fifo_full(true)
|
||||
.tx_fifo_underflow(true)
|
||||
);
|
||||
}
|
||||
|
||||
fn clear_rx_fifo(&self) {
|
||||
while self.regs.intr_status.read().rx_fifo_not_empty() {
|
||||
let _ = self.regs.rx_data.read();
|
||||
}
|
||||
}
|
||||
|
||||
fn clear_interrupt_status(&mut self) {
|
||||
self.regs.intr_status.write(
|
||||
regs::IntrStatus::zeroed()
|
||||
.rx_overflow(true)
|
||||
.tx_fifo_underflow(true)
|
||||
);
|
||||
}
|
||||
|
||||
fn wait_tx_fifo_flush(&mut self) {
|
||||
self.regs.config.modify(|_, w| w.man_start_com(true));
|
||||
while !self.regs.intr_status.read().tx_fifo_not_full() {}
|
||||
}
|
||||
}
|
||||
|
||||
impl Flash<()> {
|
||||
pub fn new(clock: u32) -> Self {
|
||||
Self::enable_clocks(clock);
|
||||
Self::setup_signals();
|
||||
Self::reset();
|
||||
|
||||
let regs = regs::RegisterBlock::qspi();
|
||||
let mut flash = Flash { regs, _mode: PhantomData };
|
||||
flash.configure((FLASH_BAUD_RATE - 1 + clock) / FLASH_BAUD_RATE);
|
||||
flash
|
||||
}
|
||||
|
||||
/// typical: `200_000_000` Hz
|
||||
fn enable_clocks(clock: u32) {
|
||||
let io_pll = IoPll::freq();
|
||||
let divisor = ((clock - 1 + io_pll) / clock)
|
||||
.max(1).min(63) as u8;
|
||||
|
||||
slcr::RegisterBlock::unlocked(|slcr| {
|
||||
slcr.lqspi_clk_ctrl.write(
|
||||
slcr::LqspiClkCtrl::zeroed()
|
||||
.src_sel(slcr::PllSource::IoPll)
|
||||
.divisor(divisor)
|
||||
.clkact(true)
|
||||
);
|
||||
});
|
||||
}
|
||||
|
||||
fn setup_signals() {
|
||||
slcr::RegisterBlock::unlocked(|slcr| {
|
||||
// 1. Configure MIO pin 1 for chip select 0 output.
|
||||
slcr.mio_pin_01.write(
|
||||
slcr::MioPin01::zeroed()
|
||||
.l0_sel(true)
|
||||
.io_type(slcr::IoBufferType::Lvcmos18)
|
||||
.pullup(true)
|
||||
);
|
||||
|
||||
// Configure MIO pins 2 through 5 for I/O.
|
||||
slcr.mio_pin_02.write(
|
||||
slcr::MioPin02::zeroed()
|
||||
.l0_sel(true)
|
||||
.io_type(slcr::IoBufferType::Lvcmos18)
|
||||
);
|
||||
slcr.mio_pin_03.write(
|
||||
slcr::MioPin03::zeroed()
|
||||
.l0_sel(true)
|
||||
.io_type(slcr::IoBufferType::Lvcmos18)
|
||||
);
|
||||
slcr.mio_pin_04.write(
|
||||
slcr::MioPin04::zeroed()
|
||||
.l0_sel(true)
|
||||
.io_type(slcr::IoBufferType::Lvcmos18)
|
||||
);
|
||||
slcr.mio_pin_05.write(
|
||||
slcr::MioPin05::zeroed()
|
||||
.l0_sel(true)
|
||||
.io_type(slcr::IoBufferType::Lvcmos18)
|
||||
);
|
||||
|
||||
// 3. Configure MIO pin 6 for serial clock 0 output.
|
||||
slcr.mio_pin_06.write(
|
||||
slcr::MioPin06::zeroed()
|
||||
.l0_sel(true)
|
||||
.io_type(slcr::IoBufferType::Lvcmos18)
|
||||
);
|
||||
|
||||
// Option: Add Second Device Chip Select
|
||||
// 4. Configure MIO pin 0 for chip select 1 output.
|
||||
slcr.mio_pin_00.write(
|
||||
slcr::MioPin00::zeroed()
|
||||
.l0_sel(true)
|
||||
.io_type(slcr::IoBufferType::Lvcmos18)
|
||||
);
|
||||
|
||||
// Option: Add Second Serial Clock
|
||||
// 5. Configure MIO pin 9 for serial clock 1 output.
|
||||
slcr.mio_pin_09.write(
|
||||
slcr::MioPin09::zeroed()
|
||||
.l0_sel(true)
|
||||
.io_type(slcr::IoBufferType::Lvcmos18)
|
||||
.pullup(true)
|
||||
);
|
||||
|
||||
// Option: Add 4-bit Data
|
||||
// 6. Configure MIO pins 10 through 13 for I/O.
|
||||
slcr.mio_pin_10.write(
|
||||
slcr::MioPin10::zeroed()
|
||||
.l0_sel(true)
|
||||
.io_type(slcr::IoBufferType::Lvcmos18)
|
||||
.pullup(true)
|
||||
);
|
||||
slcr.mio_pin_11.write(
|
||||
slcr::MioPin11::zeroed()
|
||||
.l0_sel(true)
|
||||
.io_type(slcr::IoBufferType::Lvcmos18)
|
||||
.pullup(true)
|
||||
);
|
||||
slcr.mio_pin_12.write(
|
||||
slcr::MioPin12::zeroed()
|
||||
.l0_sel(true)
|
||||
.io_type(slcr::IoBufferType::Lvcmos18)
|
||||
.pullup(true)
|
||||
);
|
||||
slcr.mio_pin_13.write(
|
||||
slcr::MioPin13::zeroed()
|
||||
.l0_sel(true)
|
||||
.io_type(slcr::IoBufferType::Lvcmos18)
|
||||
.pullup(true)
|
||||
);
|
||||
|
||||
// Option: Add Feedback Output Clock
|
||||
// 7. Configure MIO pin 8 for feedback clock.
|
||||
slcr.mio_pin_08.write(
|
||||
slcr::MioPin08::zeroed()
|
||||
.l0_sel(true)
|
||||
.io_type(slcr::IoBufferType::Lvcmos18)
|
||||
.pullup(true)
|
||||
);
|
||||
});
|
||||
}
|
||||
|
||||
fn reset() {
|
||||
slcr::RegisterBlock::unlocked(|slcr| {
|
||||
slcr.lqspi_rst_ctrl.write(
|
||||
slcr::LqspiRstCtrl::zeroed()
|
||||
.ref_rst(true)
|
||||
.cpu1x_rst(true)
|
||||
);
|
||||
slcr.lqspi_rst_ctrl.write(
|
||||
slcr::LqspiRstCtrl::zeroed()
|
||||
);
|
||||
});
|
||||
}
|
||||
|
||||
fn configure(&mut self, divider: u32) {
|
||||
// Disable
|
||||
self.regs.enable.write(
|
||||
regs::Enable::zeroed()
|
||||
);
|
||||
self.disable_interrupts();
|
||||
self.regs.lqspi_cfg.write(
|
||||
regs::LqspiCfg::zeroed()
|
||||
);
|
||||
self.clear_rx_fifo();
|
||||
self.clear_interrupt_status();
|
||||
|
||||
// for a baud_rate_div=1 LPBK_DLY_ADJ would be required
|
||||
let mut baud_rate_div = 2u32;
|
||||
while baud_rate_div < 7 && 2u32.pow(1 + baud_rate_div) < divider {
|
||||
baud_rate_div += 1;
|
||||
}
|
||||
|
||||
self.regs.config.write(regs::Config::zeroed()
|
||||
.baud_rate_div(baud_rate_div as u8)
|
||||
.mode_sel(true)
|
||||
.leg_flsh(true)
|
||||
.holdb_dr(true)
|
||||
// 32 bits TX FIFO width
|
||||
.fifo_width(0b11)
|
||||
);
|
||||
|
||||
// Initialize RX/TX pipes thresholds
|
||||
unsafe {
|
||||
self.regs.rx_thres.write(1);
|
||||
self.regs.tx_thres.write(1);
|
||||
}
|
||||
}
|
||||
|
||||
pub fn linear_addressing_mode(self) -> Flash<LinearAddressing> {
|
||||
// Set manual start enable to auto mode.
|
||||
// Assert the chip select.
|
||||
self.regs.config.modify(|_, w| w
|
||||
.man_start_en(false)
|
||||
.pcs(false)
|
||||
.manual_cs(false)
|
||||
);
|
||||
|
||||
self.regs.lqspi_cfg.write(regs::LqspiCfg::zeroed()
|
||||
// Quad I/O Fast Read
|
||||
.inst_code(INST_4IO_FAST_READ)
|
||||
.dummy_mask(0x2)
|
||||
.mode_en(false)
|
||||
.mode_bits(0xFF)
|
||||
// 2 devices
|
||||
.two_mem(true)
|
||||
.u_page(false)
|
||||
// Quad SPI mode
|
||||
.lq_mode(true)
|
||||
);
|
||||
|
||||
self.regs.enable.write(
|
||||
regs::Enable::zeroed()
|
||||
.spi_en(true)
|
||||
);
|
||||
|
||||
self.transition()
|
||||
}
|
||||
|
||||
pub fn manual_mode(self, chip_index: usize) -> Flash<Manual> {
|
||||
self.regs.config.modify(|_, w| w
|
||||
.man_start_en(true)
|
||||
.manual_cs(true)
|
||||
.endian(true)
|
||||
);
|
||||
|
||||
self.regs.lqspi_cfg.write(regs::LqspiCfg::zeroed()
|
||||
// Quad I/O Fast Read
|
||||
.inst_code(INST_READ)
|
||||
.dummy_mask(0x2)
|
||||
.mode_en(false)
|
||||
.mode_bits(0xFF)
|
||||
// 2 devices
|
||||
.two_mem(true)
|
||||
.u_page(chip_index != 0)
|
||||
// Quad SPI mode
|
||||
.lq_mode(false)
|
||||
);
|
||||
|
||||
self.transition()
|
||||
}
|
||||
}
|
||||
|
||||
impl Flash<LinearAddressing> {
|
||||
/// Stop linear addressing mode
|
||||
pub fn stop(self) -> Flash<()> {
|
||||
self.regs.enable.modify(|_, w| w.spi_en(false));
|
||||
// De-assert chip select.
|
||||
self.regs.config.modify(|_, w| w.pcs(true));
|
||||
|
||||
self.transition()
|
||||
}
|
||||
|
||||
pub fn ptr<T>(&mut self) -> *mut T {
|
||||
0xFC00_0000 as *mut _
|
||||
}
|
||||
|
||||
pub fn size(&self) -> usize {
|
||||
2 * (SINGLE_CAPACITY as usize)
|
||||
}
|
||||
}
|
||||
|
||||
impl Flash<Manual> {
|
||||
pub fn stop(self) -> Flash<()> {
|
||||
self.transition()
|
||||
}
|
||||
|
||||
pub fn read_reg<R: SpiFlashRegister>(&mut self) -> R {
|
||||
let args = Some(R::inst_code());
|
||||
let transfer = self.transfer(args.into_iter(), 2)
|
||||
.bytes_transfer();
|
||||
R::new(transfer.skip(1).next().unwrap())
|
||||
}
|
||||
|
||||
pub fn read_reg_until<R, F, A>(&mut self, f: F) -> A
|
||||
where
|
||||
R: SpiFlashRegister,
|
||||
F: Fn(R) -> Option<A>,
|
||||
{
|
||||
let mut result = None;
|
||||
while result.is_none() {
|
||||
let args = Some(R::inst_code());
|
||||
for b in self.transfer(args.into_iter(), 32)
|
||||
.bytes_transfer().skip(1) {
|
||||
result = f(R::new(b));
|
||||
|
||||
if result.is_none() {
|
||||
break;
|
||||
}
|
||||
}
|
||||
}
|
||||
result.unwrap()
|
||||
}
|
||||
|
||||
/// Status Register-1 remains `0x00` immediately after invoking a command.
|
||||
fn wait_while_sr1_zeroed(&mut self) -> SR1 {
|
||||
self.read_reg_until::<SR1, _, SR1>(|sr1|
|
||||
if sr1.is_zeroed() {
|
||||
None
|
||||
} else {
|
||||
Some(sr1)
|
||||
}
|
||||
)
|
||||
}
|
||||
|
||||
/// Read Identification
|
||||
pub fn rdid(&mut self) -> core::iter::Skip<BytesTransfer<Transfer<core::option::IntoIter<u32>, u32>>> {
|
||||
let args = Some((INST_RDID as u32) << 24);
|
||||
self.transfer(args.into_iter(), 0x44)
|
||||
.bytes_transfer().skip(1)
|
||||
}
|
||||
|
||||
/// Read flash data
|
||||
pub fn read(&mut self, offset: u32, len: usize
|
||||
) -> core::iter::Take<core::iter::Skip<BytesTransfer<Transfer<core::option::IntoIter<u32>, u32>>>>
|
||||
{
|
||||
let args = Some(((INST_READ as u32) << 24) | (offset as u32));
|
||||
self.transfer(args.into_iter(), len + 6)
|
||||
.bytes_transfer().skip(6).take(len)
|
||||
}
|
||||
|
||||
pub fn erase(&mut self, offset: u32) {
|
||||
let args = Some(((INST_BE_4K as u32) << 24) | (offset as u32));
|
||||
self.transfer(args.into_iter(), 4);
|
||||
|
||||
let sr1 = self.wait_while_sr1_zeroed();
|
||||
|
||||
if sr1.e_err() {
|
||||
error!("E_ERR");
|
||||
} else if sr1.p_err() {
|
||||
error!("P_ERR");
|
||||
} else if sr1.wip() {
|
||||
info!("Erase in progress");
|
||||
while self.read_reg::<SR1>().wip() {
|
||||
print!(".");
|
||||
}
|
||||
println!("");
|
||||
} else {
|
||||
warn!("erased? sr1={:02X}", sr1.inner);
|
||||
}
|
||||
}
|
||||
|
||||
pub fn program<I: Iterator<Item=u32>>(&mut self, offset: u32, data: I) {
|
||||
{
|
||||
let len = 4 + 4 * data.size_hint().0;
|
||||
let args = Some(SpiWord::W32(((INST_PP as u32) << 24) | (offset as u32))).into_iter()
|
||||
.chain(data.map(SpiWord::W32));
|
||||
self.transfer(args, len);
|
||||
}
|
||||
|
||||
// let sr1 = self.wait_while_sr1_zeroed();
|
||||
let sr1 = self.read_reg::<SR1>();
|
||||
|
||||
if sr1.e_err() {
|
||||
error!("E_ERR");
|
||||
} else if sr1.p_err() {
|
||||
error!("P_ERR");
|
||||
} else if sr1.wip() {
|
||||
info!("Program in progress");
|
||||
while self.read_reg::<SR1>().wip() {
|
||||
print!(".");
|
||||
}
|
||||
println!("");
|
||||
} else {
|
||||
warn!("programmed? sr1={:02X}", sr1.inner);
|
||||
}
|
||||
}
|
||||
|
||||
pub fn write_enabled<F: Fn(&mut Self) -> R, R>(&mut self, f: F) -> R {
|
||||
// Write Enable
|
||||
let args = Some(INST_WREN);
|
||||
self.transfer(args.into_iter(), 1);
|
||||
self.regs.gpio.modify(|_, w| w.wp_n(true));
|
||||
let sr1 = self.wait_while_sr1_zeroed();
|
||||
if !sr1.wel() {
|
||||
panic!("Cannot write-enable flash");
|
||||
}
|
||||
|
||||
let result = f(self);
|
||||
|
||||
// Write Disable
|
||||
let args = Some(INST_WRDI);
|
||||
self.transfer(args.into_iter(), 1);
|
||||
self.regs.gpio.modify(|_, w| w.wp_n(false));
|
||||
|
||||
result
|
||||
}
|
||||
|
||||
pub fn transfer<'s: 't, 't, Args, W>(&'s mut self, args: Args, len: usize) -> Transfer<'t, Args, W>
|
||||
where
|
||||
Args: Iterator<Item = W>,
|
||||
W: Into<SpiWord>,
|
||||
{
|
||||
Transfer::new(self, args, len)
|
||||
}
|
||||
|
||||
pub fn dump(&mut self, label: &'_ str, inst_code: u8) {
|
||||
print!("{}:", label);
|
||||
|
||||
let args = Some(u32::from(inst_code) << 24);
|
||||
for b in self.transfer(args.into_iter(), 32).bytes_transfer() {
|
||||
print!(" {:02X}", b);
|
||||
}
|
||||
println!("");
|
||||
}
|
||||
}
|
|
@ -1,126 +0,0 @@
|
|||
use volatile_register::{RO, WO, RW};
|
||||
|
||||
use libregister::{register, register_bit, register_bits};
|
||||
|
||||
#[repr(C)]
|
||||
pub struct RegisterBlock {
|
||||
pub config: Config,
|
||||
pub intr_status: IntrStatus,
|
||||
pub intr_en: IntrEn,
|
||||
pub intr_dis: IntrDis,
|
||||
pub intr_mask: RO<u32>,
|
||||
pub enable: Enable,
|
||||
pub delay: RW<u32>,
|
||||
pub txd0: WO<u32>,
|
||||
pub rx_data: RO<u32>,
|
||||
pub slave_idle_count: RW<u32>,
|
||||
pub tx_thres: RW<u32>,
|
||||
pub rx_thres: RW<u32>,
|
||||
pub gpio: QspiGpio,
|
||||
pub _unused1: RO<u32>,
|
||||
pub lpbk_dly_adj: RW<u32>,
|
||||
pub _unused2: [RO<u32>; 17],
|
||||
pub txd1: WO<u32>,
|
||||
pub txd2: WO<u32>,
|
||||
pub txd3: WO<u32>,
|
||||
pub _unused3: [RO<u32>; 5],
|
||||
pub lqspi_cfg: LqspiCfg,
|
||||
pub lqspi_sts: RW<u32>,
|
||||
pub _unused4: [RO<u32>; 21],
|
||||
pub mod_id: RW<u32>,
|
||||
}
|
||||
|
||||
impl RegisterBlock {
|
||||
const BASE_ADDRESS: *mut Self = 0xE000D000 as *mut _;
|
||||
|
||||
pub fn qspi() -> &'static mut Self {
|
||||
unsafe { &mut *Self::BASE_ADDRESS }
|
||||
}
|
||||
}
|
||||
|
||||
register!(config, Config, RW, u32);
|
||||
register_bit!(config,
|
||||
/// Enables master mode
|
||||
mode_sel, 0);
|
||||
register_bit!(config,
|
||||
/// Clock polarity low/high
|
||||
clk_pol, 1);
|
||||
register_bit!(config,
|
||||
/// Clock phase
|
||||
clk_ph, 2);
|
||||
register_bits!(config,
|
||||
/// divider = 2 ** (1 + baud_rate_div)
|
||||
baud_rate_div, u8, 3, 5);
|
||||
register_bits!(config,
|
||||
/// Must be set to 0b11
|
||||
fifo_width, u8, 6, 7);
|
||||
register_bit!(config,
|
||||
/// Must be 0
|
||||
ref_clk, 8);
|
||||
register_bit!(config,
|
||||
/// Peripheral Chip Select Line
|
||||
pcs, 10);
|
||||
register_bit!(config,
|
||||
/// false: auto mode, true: manual CS mode
|
||||
manual_cs, 14);
|
||||
register_bit!(config,
|
||||
/// false: auto mode, true: enables manual start enable
|
||||
man_start_en, 15);
|
||||
register_bit!(config,
|
||||
/// false: auto mode, true: enables manual start command
|
||||
man_start_com, 16);
|
||||
register_bit!(config, holdb_dr, 19);
|
||||
register_bit!(config,
|
||||
/// false: little, true: endian
|
||||
endian, 26);
|
||||
register_bit!(config,
|
||||
/// false: legacy SPI mode, true: Flash memory interface mode
|
||||
leg_flsh, 31);
|
||||
|
||||
register!(intr_status, IntrStatus, RW, u32);
|
||||
register_bit!(intr_status, rx_overflow, 0);
|
||||
register_bit!(intr_status,
|
||||
/// < tx_thres
|
||||
tx_fifo_not_full, 2);
|
||||
register_bit!(intr_status, tx_fifo_full, 3);
|
||||
register_bit!(intr_status,
|
||||
/// >= rx_thres
|
||||
rx_fifo_not_empty, 4);
|
||||
register_bit!(intr_status, rx_fifo_full, 5);
|
||||
register_bit!(intr_status, tx_fifo_underflow, 6);
|
||||
|
||||
register!(intr_en, IntrEn, WO, u32);
|
||||
register_bit!(intr_en, rx_overflow, 0);
|
||||
register_bit!(intr_en, tx_fifo_not_full, 2);
|
||||
register_bit!(intr_en, tx_fifo_full, 3);
|
||||
register_bit!(intr_en, rx_fifo_not_empty, 4);
|
||||
register_bit!(intr_en, rx_fifo_full, 5);
|
||||
register_bit!(intr_en, tx_fifo_underflow, 6);
|
||||
|
||||
register!(intr_dis, IntrDis, WO, u32);
|
||||
register_bit!(intr_dis, rx_overflow, 0);
|
||||
register_bit!(intr_dis, tx_fifo_not_full, 2);
|
||||
register_bit!(intr_dis, tx_fifo_full, 3);
|
||||
register_bit!(intr_dis, rx_fifo_not_empty, 4);
|
||||
register_bit!(intr_dis, rx_fifo_full, 5);
|
||||
register_bit!(intr_dis, tx_fifo_underflow, 6);
|
||||
|
||||
register!(enable, Enable, RW, u32);
|
||||
register_bit!(enable, spi_en, 0);
|
||||
|
||||
// named to avoid confusion with normal gpio
|
||||
register!(qspi_gpio, QspiGpio, RW, u32);
|
||||
register_bit!(qspi_gpio,
|
||||
/// Write protect pin (inverted)
|
||||
wp_n, 0);
|
||||
|
||||
register!(lqspi_cfg, LqspiCfg, RW, u32);
|
||||
register_bits!(lqspi_cfg, inst_code, u8, 0, 7);
|
||||
register_bits!(lqspi_cfg, dummy_mask, u8, 8, 10);
|
||||
register_bits!(lqspi_cfg, mode_bits, u8, 16, 23);
|
||||
register_bit!(lqspi_cfg, mode_on, 24);
|
||||
register_bit!(lqspi_cfg, mode_en, 25);
|
||||
register_bit!(lqspi_cfg, u_page, 28);
|
||||
register_bit!(lqspi_cfg, sep_bus, 29);
|
||||
register_bit!(lqspi_cfg, two_mem, 30);
|
||||
register_bit!(lqspi_cfg, lq_mode, 31);
|
|
@ -1,62 +0,0 @@
|
|||
use bit_field::BitField;
|
||||
|
||||
pub trait SpiFlashRegister {
|
||||
fn inst_code() -> u8;
|
||||
fn new(src: u8) -> Self;
|
||||
}
|
||||
|
||||
macro_rules! u8_register {
|
||||
($name: ident, $doc: tt, $inst_code: expr) => {
|
||||
#[derive(Clone)]
|
||||
#[doc=$doc]
|
||||
pub struct $name {
|
||||
pub inner: u8,
|
||||
}
|
||||
|
||||
impl SpiFlashRegister for $name {
|
||||
fn inst_code() -> u8 {
|
||||
$inst_code
|
||||
}
|
||||
|
||||
fn new(src: u8) -> Self {
|
||||
$name {
|
||||
inner: src,
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl $name {
|
||||
#[allow(unused)]
|
||||
pub fn is_zeroed(&self) -> bool {
|
||||
self.inner == 0
|
||||
}
|
||||
}
|
||||
};
|
||||
}
|
||||
|
||||
u8_register!(CR, "Configuration Register", 0x35);
|
||||
u8_register!(SR1, "Status Register-1", 0x05);
|
||||
impl SR1 {
|
||||
/// Write In Progress
|
||||
pub fn wip(&self) -> bool {
|
||||
self.inner.get_bit(0)
|
||||
}
|
||||
|
||||
/// Write Enable Latch
|
||||
pub fn wel(&self) -> bool {
|
||||
self.inner.get_bit(1)
|
||||
}
|
||||
|
||||
/// Erase Error Occurred
|
||||
pub fn e_err(&self) -> bool {
|
||||
self.inner.get_bit(5)
|
||||
}
|
||||
|
||||
/// Programming Error Occurred
|
||||
pub fn p_err(&self) -> bool {
|
||||
self.inner.get_bit(6)
|
||||
}
|
||||
}
|
||||
|
||||
u8_register!(SR2, "Status Register-2", 0x07);
|
||||
u8_register!(BA, "Bank Address Register", 0xB9);
|
|
@ -1,125 +0,0 @@
|
|||
use libregister::{RegisterR, RegisterW, RegisterRW};
|
||||
use super::regs;
|
||||
use super::{SpiWord, Flash, Manual};
|
||||
|
||||
pub struct Transfer<'a, Args: Iterator<Item = W>, W: Into<SpiWord>> {
|
||||
flash: &'a mut Flash<Manual>,
|
||||
args: Args,
|
||||
sent: usize,
|
||||
received: usize,
|
||||
len: usize,
|
||||
}
|
||||
|
||||
impl<'a, Args: Iterator<Item = W>, W: Into<SpiWord>> Transfer<'a, Args, W> {
|
||||
pub fn new(flash: &'a mut Flash<Manual>, args: Args, len: usize) -> Self {
|
||||
flash.regs.config.modify(|_, w| w.pcs(false));
|
||||
flash.regs.enable.write(
|
||||
regs::Enable::zeroed()
|
||||
.spi_en(true)
|
||||
);
|
||||
|
||||
let mut xfer = Transfer {
|
||||
flash,
|
||||
args,
|
||||
sent: 0,
|
||||
received: 0,
|
||||
len,
|
||||
};
|
||||
xfer.fill_tx_fifo();
|
||||
xfer.flash.regs.config.modify(|_, w| w.man_start_com(true));
|
||||
xfer
|
||||
}
|
||||
|
||||
fn fill_tx_fifo(&mut self) {
|
||||
while self.sent < self.len && !self.flash.regs.intr_status.read().tx_fifo_full() {
|
||||
let arg = self.args.next()
|
||||
.map(|n| n.into())
|
||||
.unwrap_or(SpiWord::W32(0));
|
||||
match arg {
|
||||
SpiWord::W32(w) => {
|
||||
// println!("txd0 {:08X}", w);
|
||||
unsafe {
|
||||
self.flash.regs.txd0.write(w);
|
||||
}
|
||||
self.sent += 4;
|
||||
}
|
||||
// Only txd0 can be used without flushing
|
||||
_ => {
|
||||
if !self.flash.regs.intr_status.read().tx_fifo_not_full() {
|
||||
// Flush if necessary
|
||||
self.flash.wait_tx_fifo_flush();
|
||||
}
|
||||
|
||||
match arg {
|
||||
SpiWord::W8(w) => {
|
||||
// println!("txd1 {:02X}", w);
|
||||
unsafe {
|
||||
self.flash.regs.txd1.write(u32::from(w) << 24);
|
||||
}
|
||||
self.sent += 1;
|
||||
}
|
||||
SpiWord::W16(w) => {
|
||||
unsafe {
|
||||
self.flash.regs.txd2.write(u32::from(w) << 16);
|
||||
}
|
||||
self.sent += 2;
|
||||
}
|
||||
SpiWord::W24(w) => {
|
||||
unsafe {
|
||||
self.flash.regs.txd3.write(w << 8);
|
||||
}
|
||||
self.sent += 3;
|
||||
}
|
||||
SpiWord::W32(_) => unreachable!(),
|
||||
}
|
||||
|
||||
self.flash.wait_tx_fifo_flush();
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
fn can_read(&mut self) -> bool {
|
||||
self.flash.regs.intr_status.read().rx_fifo_not_empty()
|
||||
}
|
||||
|
||||
fn read(&mut self) -> u32 {
|
||||
let rx = self.flash.regs.rx_data.read();
|
||||
self.received += 4;
|
||||
rx
|
||||
}
|
||||
}
|
||||
|
||||
impl<'a, Args: Iterator<Item = W>, W: Into<SpiWord>> Drop for Transfer<'a, Args, W> {
|
||||
fn drop(&mut self) {
|
||||
// Discard remaining rx_data
|
||||
while self.can_read() {
|
||||
self.read();
|
||||
}
|
||||
|
||||
// Stop
|
||||
self.flash.regs.enable.write(
|
||||
regs::Enable::zeroed()
|
||||
.spi_en(false)
|
||||
);
|
||||
self.flash.regs.config.modify(|_, w| w
|
||||
.pcs(true)
|
||||
.man_start_com(false)
|
||||
);
|
||||
}
|
||||
}
|
||||
|
||||
impl<'a, Args: Iterator<Item = W>, W: Into<SpiWord>> Iterator for Transfer<'a, Args, W> {
|
||||
type Item = u32;
|
||||
|
||||
fn next<'s>(&'s mut self) -> Option<u32> {
|
||||
if self.received >= self.len {
|
||||
return None;
|
||||
}
|
||||
|
||||
self.fill_tx_fifo();
|
||||
|
||||
while !self.can_read() {}
|
||||
Some(self.read())
|
||||
}
|
||||
}
|
|
@ -0,0 +1,150 @@
|
|||
//! ARM Generic Interrupt Controller
|
||||
|
||||
use bit_field::BitField;
|
||||
use libregister::{RegisterW, RegisterRW, RegisterR};
|
||||
use super::mpcore;
|
||||
|
||||
#[derive(Debug, Clone, Copy)]
|
||||
pub struct InterruptId(pub u8);
|
||||
|
||||
#[derive(Debug, Clone, Copy)]
|
||||
#[repr(u8)]
|
||||
pub enum CPUCore {
|
||||
Core0 = 0b01,
|
||||
Core1 = 0b10
|
||||
}
|
||||
|
||||
#[derive(Debug, Clone, Copy)]
|
||||
pub struct TargetCPU(u8);
|
||||
|
||||
impl TargetCPU {
|
||||
pub const fn none() -> TargetCPU {
|
||||
TargetCPU(0)
|
||||
}
|
||||
|
||||
pub const fn and(self, other: TargetCPU) -> TargetCPU {
|
||||
TargetCPU(self.0 | other.0)
|
||||
}
|
||||
}
|
||||
|
||||
impl From<CPUCore> for TargetCPU {
|
||||
fn from(core: CPUCore) -> Self {
|
||||
TargetCPU(core as u8)
|
||||
}
|
||||
}
|
||||
|
||||
pub enum TargetList {
|
||||
CPUList(TargetCPU),
|
||||
Others,
|
||||
This
|
||||
}
|
||||
|
||||
impl From<CPUCore> for TargetList {
|
||||
fn from(core: CPUCore) -> Self {
|
||||
TargetList::CPUList(TargetCPU(core as u8))
|
||||
}
|
||||
}
|
||||
|
||||
impl From<TargetCPU> for TargetList {
|
||||
fn from(cpu: TargetCPU) -> Self {
|
||||
TargetList::CPUList(cpu)
|
||||
}
|
||||
}
|
||||
|
||||
#[derive(Debug, Clone, Copy)]
|
||||
pub enum InterruptSensitivity {
|
||||
Level,
|
||||
Edge,
|
||||
}
|
||||
|
||||
pub struct InterruptController {
|
||||
mpcore: &'static mut mpcore::RegisterBlock,
|
||||
}
|
||||
|
||||
impl InterruptController {
|
||||
pub fn gic(mpcore: &'static mut mpcore::RegisterBlock) -> Self {
|
||||
InterruptController { mpcore }
|
||||
}
|
||||
|
||||
pub fn disable_interrupts(&mut self) {
|
||||
self.mpcore.iccicr.modify(|_, w| w.enable_ns(false)
|
||||
.enable_s(false));
|
||||
// FIXME: Should we disable the distributor globally when we disable interrupt (for a single
|
||||
// core)?
|
||||
// self.mpcore.icddcr.modify(|_, w| w.enable_secure(false)
|
||||
// .enable_non_secure(false));
|
||||
}
|
||||
|
||||
/// enable interrupt signaling
|
||||
pub fn enable_interrupts(&mut self) {
|
||||
self.mpcore.iccicr.modify(|_, w| w.enable_ns(true)
|
||||
.enable_s(true));
|
||||
self.mpcore.icddcr.modify(|_, w| w.enable_secure(true));
|
||||
|
||||
// Enable all interrupts except those of the lowest priority.
|
||||
self.mpcore.iccpmr.write(mpcore::ICCPMR::zeroed().priority(0xFF));
|
||||
}
|
||||
|
||||
/// send software generated interrupt
|
||||
pub fn send_sgi(&mut self, id: InterruptId, targets: TargetList) {
|
||||
assert!(id.0 < 16);
|
||||
self.mpcore.icdsgir.modify(|_, w| match targets {
|
||||
TargetList::CPUList(list) => w.target_list_filter(0).cpu_target_list(list.0),
|
||||
TargetList::Others => w.target_list_filter(0b01),
|
||||
TargetList::This => w.target_list_filter(0b10)
|
||||
}.sgiintid(id.0).satt(false));
|
||||
}
|
||||
|
||||
/// enable the interrupt *for this core*.
|
||||
/// Not needed for SGI.
|
||||
pub fn enable(&mut self, id: InterruptId, target_cpu: CPUCore, sensitivity: InterruptSensitivity, priority: u8) {
|
||||
// only 5 bits of the priority is useful
|
||||
assert!(priority < 32);
|
||||
|
||||
self.disable_interrupts();
|
||||
|
||||
// enable
|
||||
let m = (id.0 >> 5) as usize;
|
||||
let n = (id.0 & 0x1F) as usize;
|
||||
assert!(m < 3);
|
||||
unsafe {
|
||||
self.mpcore.icdiser[m].modify(|mut icdiser| *icdiser.set_bit(n, true));
|
||||
}
|
||||
|
||||
// target cpu
|
||||
let m = (id.0 >> 2) as usize;
|
||||
let n = (8 * (id.0 & 3)) as usize;
|
||||
unsafe {
|
||||
self.mpcore.icdiptr[m].modify(|mut icdiptr| *icdiptr.set_bits(n..=n+1, target_cpu as u32));
|
||||
}
|
||||
|
||||
// sensitivity
|
||||
let m = (id.0 >> 4) as usize;
|
||||
let n = (2 * (id.0 & 0xF)) as usize;
|
||||
unsafe {
|
||||
self.mpcore.icdicfr[m].modify(|mut icdicfr| *icdicfr.set_bits(n..=n+1, match sensitivity {
|
||||
InterruptSensitivity::Level => 0b00,
|
||||
InterruptSensitivity::Edge => 0b10,
|
||||
}));
|
||||
}
|
||||
|
||||
// priority
|
||||
let offset = (id.0 % 4) * 8;
|
||||
let priority: u32 = (priority as u32) << (offset + 3);
|
||||
let mask: u32 = 0xFFFFFFFF ^ (0xFF << offset);
|
||||
unsafe {
|
||||
self.mpcore.icdipr[id.0 as usize / 4].modify(|v| (v & mask) | priority);
|
||||
}
|
||||
|
||||
self.enable_interrupts();
|
||||
}
|
||||
|
||||
pub fn end_interrupt(&mut self, id: InterruptId) {
|
||||
self.mpcore.icceoir.modify(|_, w| w.eoiintid(id.0 as u32));
|
||||
}
|
||||
|
||||
pub fn get_interrupt_id(&self) -> InterruptId {
|
||||
InterruptId(self.mpcore.icciar.read().ackintid() as u8)
|
||||
}
|
||||
|
||||
}
|
|
@ -0,0 +1,124 @@
|
|||
use super::I2c;
|
||||
use crate::time::Milliseconds;
|
||||
use embedded_hal::timer::CountDown;
|
||||
|
||||
pub struct EEPROM<'a> {
|
||||
i2c: &'a mut I2c,
|
||||
port: u8,
|
||||
address: u8,
|
||||
page_size: u8,
|
||||
count_down: crate::timer::global::CountDown<Milliseconds>
|
||||
}
|
||||
|
||||
impl<'a> EEPROM<'a> {
|
||||
#[cfg(feature = "target_zc706")]
|
||||
pub fn new(i2c: &'a mut I2c, page_size: u8) -> Self {
|
||||
EEPROM {
|
||||
i2c: i2c,
|
||||
port: 2,
|
||||
address: 0b1010100,
|
||||
page_size: page_size,
|
||||
count_down: unsafe { crate::timer::GlobalTimer::get() }.countdown()
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(feature = "target_kasli_soc")]
|
||||
pub fn new(i2c: &'a mut I2c, page_size: u8) -> Self {
|
||||
EEPROM {
|
||||
i2c: i2c,
|
||||
port: 3,
|
||||
address: 0x57,
|
||||
page_size: page_size,
|
||||
count_down: unsafe { crate::timer::GlobalTimer::get() }.countdown()
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(feature = "target_zc706")]
|
||||
fn select(&mut self) -> Result<(), &'static str> {
|
||||
self.i2c.pca954x_select(0b1110100, Some(self.port))?;
|
||||
Ok(())
|
||||
}
|
||||
|
||||
#[cfg(feature = "target_kasli_soc")]
|
||||
fn select(&mut self) -> Result<(), &'static str> {
|
||||
// tca9548 is compatible with pca9548
|
||||
self.i2c.pca954x_select(0b1110001, Some(self.port))?;
|
||||
Ok(())
|
||||
}
|
||||
|
||||
/// Random read
|
||||
pub fn read<'r>(&mut self, addr: u8, buf: &'r mut [u8]) -> Result<(), &'static str> {
|
||||
self.select()?;
|
||||
|
||||
self.i2c.start()?;
|
||||
self.i2c.write(self.address << 1)?;
|
||||
self.i2c.write(addr)?;
|
||||
|
||||
self.i2c.restart()?;
|
||||
self.i2c.write((self.address << 1) | 1)?;
|
||||
let buf_len = buf.len();
|
||||
for (i, byte) in buf.iter_mut().enumerate() {
|
||||
*byte = self.i2c.read(i < buf_len - 1)?;
|
||||
}
|
||||
|
||||
self.i2c.stop()?;
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
/// Smart multi-page writing
|
||||
/// Using the "Page Write" function of an EEPROM, the memory region for each transaction
|
||||
/// (i.e. from byte `addr` to byte `addr+buf.len()`) should fit under each page
|
||||
/// (i.e. `addr+buf.len()` < `addr/self.page_size+1`); otherwise, a roll-oever occurs,
|
||||
/// where bytes beyond the page end. This smart function takes care of the scenario to avoid
|
||||
/// any roll-over when writing ambiguous memory regions.
|
||||
pub fn write(&mut self, addr: u8, buf: &[u8]) -> Result<(), &'static str> {
|
||||
self.select()?;
|
||||
|
||||
let buf_len = buf.len();
|
||||
let mut pb: u8 = addr % self.page_size;
|
||||
for (i, byte) in buf.iter().enumerate() {
|
||||
if (i == 0) || (pb == 0) {
|
||||
self.i2c.start()?;
|
||||
self.i2c.write(self.address << 1)?;
|
||||
self.i2c.write(addr + (i as u8))?;
|
||||
}
|
||||
self.i2c.write(*byte)?;
|
||||
pb += 1;
|
||||
|
||||
if (i == buf_len-1) || (pb == self.page_size) {
|
||||
self.i2c.stop()?;
|
||||
self.poll(1_000)?;
|
||||
pb = 0;
|
||||
}
|
||||
}
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
/// Poll
|
||||
pub fn poll(&mut self, timeout_ms: u64) -> Result<(), &'static str> {
|
||||
self.select()?;
|
||||
|
||||
self.count_down.start(Milliseconds(timeout_ms));
|
||||
loop {
|
||||
self.i2c.start()?;
|
||||
let ack = self.i2c.write(self.address << 1)?;
|
||||
self.i2c.stop()?;
|
||||
if ack {
|
||||
break
|
||||
};
|
||||
if !self.count_down.waiting() {
|
||||
return Err("I2C polling timeout")
|
||||
}
|
||||
}
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
pub fn read_eui48<'r>(&mut self) -> Result<[u8; 6], &'static str> {
|
||||
let mut buffer = [0u8; 6];
|
||||
self.read(0xFA, &mut buffer)?;
|
||||
Ok(buffer)
|
||||
}
|
||||
}
|
|
@ -0,0 +1,332 @@
|
|||
//! I2C Bit-banging Controller
|
||||
|
||||
mod regs;
|
||||
pub mod eeprom;
|
||||
use super::slcr;
|
||||
use super::time::Microseconds;
|
||||
use embedded_hal::timer::CountDown;
|
||||
use libregister::{RegisterR, RegisterRW, RegisterW};
|
||||
#[cfg(feature = "target_kasli_soc")]
|
||||
use log::info;
|
||||
|
||||
pub enum I2cMultiplexer {
|
||||
PCA9548 = 0,
|
||||
#[cfg(feature = "target_kasli_soc")]
|
||||
PCA9547 = 1,
|
||||
}
|
||||
|
||||
pub struct I2c {
|
||||
regs: regs::RegisterBlock,
|
||||
count_down: super::timer::global::CountDown<Microseconds>,
|
||||
pca_type: I2cMultiplexer
|
||||
}
|
||||
|
||||
impl I2c {
|
||||
#[cfg(any(feature = "target_zc706", feature = "target_kasli_soc"))]
|
||||
pub fn i2c0() -> Self {
|
||||
// Route I2C 0 SCL / SDA Signals to MIO Pins 50 / 51
|
||||
slcr::RegisterBlock::unlocked(|slcr| {
|
||||
// SCL
|
||||
slcr.mio_pin_50.write(
|
||||
slcr::MioPin50::zeroed()
|
||||
.l3_sel(0b000) // as GPIO 50
|
||||
.io_type(slcr::IoBufferType::Lvcmos18)
|
||||
.pullup(true)
|
||||
.disable_rcvr(true)
|
||||
);
|
||||
// SDA
|
||||
slcr.mio_pin_51.write(
|
||||
slcr::MioPin51::zeroed()
|
||||
.l3_sel(0b000) // as GPIO 51
|
||||
.io_type(slcr::IoBufferType::Lvcmos18)
|
||||
.pullup(true)
|
||||
.disable_rcvr(true)
|
||||
);
|
||||
// On Kasli-SoC prototype, leakage through the unconfigured I2C_SW_RESET
|
||||
// MIO pin develops enough voltage on the T21 gate to assert the reset.
|
||||
// Configure the pin to avoid this problem.
|
||||
#[cfg(feature = "target_kasli_soc")]
|
||||
slcr.mio_pin_33.write(
|
||||
slcr::MioPin33::zeroed()
|
||||
.l3_sel(0b000)
|
||||
.io_type(slcr::IoBufferType::Lvcmos33)
|
||||
.pullup(false)
|
||||
.disable_rcvr(true)
|
||||
);
|
||||
});
|
||||
|
||||
Self::i2c_common(0xFFFF - 0x000C, 0xFFFF - 0x0002)
|
||||
}
|
||||
|
||||
fn i2c_common(gpio_output_mask: u16, _gpio_output_mask_lower: u16) -> Self {
|
||||
// Setup register block
|
||||
let self_ = Self {
|
||||
regs: regs::RegisterBlock::i2c(),
|
||||
count_down: unsafe { super::timer::GlobalTimer::get() }.countdown(),
|
||||
pca_type: I2cMultiplexer::PCA9548 //default for zc706
|
||||
};
|
||||
|
||||
// Setup GPIO output mask
|
||||
self_.regs.gpio_output_mask.modify(|_, w| {
|
||||
w.mask(gpio_output_mask)
|
||||
});
|
||||
// Setup GPIO driver direction
|
||||
self_.regs.gpio_direction.modify(|_, w| {
|
||||
w.scl(true).sda(true)
|
||||
});
|
||||
|
||||
//Kasli-SoC only: I2C_SW_RESET configuration
|
||||
#[cfg(feature = "target_kasli_soc")]
|
||||
{
|
||||
self_.regs.gpio_output_mask_lower.modify(|_, w| {
|
||||
w.mask(_gpio_output_mask_lower)
|
||||
});
|
||||
self_.regs.gpio_direction.modify(|_, w| {
|
||||
w.i2cswr(true)
|
||||
});
|
||||
}
|
||||
|
||||
self_
|
||||
}
|
||||
|
||||
/// Delay for I2C operations, simple wrapper for nb.
|
||||
fn delay_us(&mut self, us: u64) {
|
||||
self.count_down.start(Microseconds(us));
|
||||
nb::block!(self.count_down.wait()).unwrap();
|
||||
}
|
||||
|
||||
fn unit_delay(&mut self) { self.delay_us(100) }
|
||||
|
||||
fn sda_i(&mut self) -> bool {
|
||||
self.regs.gpio_input.read().sda()
|
||||
}
|
||||
|
||||
fn scl_i(&mut self) -> bool {
|
||||
self.regs.gpio_input.read().scl()
|
||||
}
|
||||
|
||||
fn sda_oe(&mut self, oe: bool) {
|
||||
self.regs.gpio_output_enable.modify(|_, w| {
|
||||
w.sda(oe)
|
||||
})
|
||||
}
|
||||
|
||||
fn sda_o(&mut self, o: bool) {
|
||||
self.regs.gpio_output_mask.modify(|_, w| {
|
||||
w.sda_o(o)
|
||||
})
|
||||
}
|
||||
|
||||
fn scl_oe(&mut self, oe: bool) {
|
||||
self.regs.gpio_output_enable.modify(|_, w| {
|
||||
w.scl(oe)
|
||||
})
|
||||
}
|
||||
|
||||
fn scl_o(&mut self, o: bool) {
|
||||
self.regs.gpio_output_mask.modify(|_, w| {
|
||||
w.scl_o(o)
|
||||
})
|
||||
}
|
||||
|
||||
#[cfg(feature = "target_kasli_soc")]
|
||||
fn i2cswr_oe(&mut self, oe: bool) {
|
||||
self.regs.gpio_output_enable.modify(|_, w| {
|
||||
w.i2cswr(oe)
|
||||
})
|
||||
}
|
||||
|
||||
#[cfg(feature = "target_kasli_soc")]
|
||||
fn i2cswr_o(&mut self, o: bool) {
|
||||
self.regs.gpio_output_mask_lower.modify(|_, w| {
|
||||
w.i2cswr_o(o)
|
||||
})
|
||||
}
|
||||
|
||||
#[cfg(feature = "target_kasli_soc")]
|
||||
fn pca_autodetect(&mut self) -> Result<I2cMultiplexer, &'static str> {
|
||||
// start with resetting the PCA954X
|
||||
// SDA must be clear (before start)
|
||||
// reset time is 500ns, unit_delay (100us) to account for propagation
|
||||
self.i2cswr_o(true);
|
||||
self.unit_delay();
|
||||
self.i2cswr_o(false);
|
||||
self.unit_delay();
|
||||
|
||||
let pca954x_read_addr = (0x71 << 1) | 0x01;
|
||||
|
||||
self.start()?;
|
||||
// read the config register
|
||||
if !self.write(pca954x_read_addr)? {
|
||||
return Err("PCA954X failed to ack read address");
|
||||
}
|
||||
let config = self.read(false)?;
|
||||
|
||||
let pca = match config {
|
||||
0x00 => { info!("PCA9548 detected"); I2cMultiplexer::PCA9548 },
|
||||
0x08 => { info!("PCA9547 detected"); I2cMultiplexer::PCA9547 },
|
||||
_ => { return Err("Unknown response for PCA954X autodetect")},
|
||||
};
|
||||
self.stop()?;
|
||||
Ok(pca)
|
||||
}
|
||||
|
||||
pub fn init(&mut self) -> Result<(), &'static str> {
|
||||
self.scl_oe(false);
|
||||
self.sda_oe(false);
|
||||
self.scl_o(false);
|
||||
self.sda_o(false);
|
||||
|
||||
// Check the I2C bus is ready
|
||||
self.unit_delay();
|
||||
self.unit_delay();
|
||||
if !self.sda_i() {
|
||||
// Try toggling SCL a few times
|
||||
for _bit in 0..8 {
|
||||
self.scl_oe(true);
|
||||
self.unit_delay();
|
||||
self.scl_oe(false);
|
||||
self.unit_delay();
|
||||
}
|
||||
}
|
||||
|
||||
if !self.sda_i() {
|
||||
return Err("SDA is stuck low and doesn't get unstuck");
|
||||
}
|
||||
if !self.scl_i() {
|
||||
return Err("SCL is stuck low");
|
||||
}
|
||||
// postcondition: SCL and SDA high
|
||||
|
||||
#[cfg(feature = "target_kasli_soc")]
|
||||
{
|
||||
self.i2cswr_oe(true);
|
||||
self.pca_type = self.pca_autodetect()?;
|
||||
}
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
pub fn start(&mut self) -> Result<(), &'static str> {
|
||||
// precondition: SCL and SDA high
|
||||
if !self.scl_i() {
|
||||
return Err("SCL is stuck low");
|
||||
}
|
||||
if !self.sda_i() {
|
||||
return Err("SDA arbitration lost");
|
||||
}
|
||||
self.sda_oe(true);
|
||||
self.unit_delay();
|
||||
self.scl_oe(true);
|
||||
self.unit_delay();
|
||||
// postcondition: SCL and SDA low
|
||||
Ok(())
|
||||
}
|
||||
|
||||
pub fn restart(&mut self) -> Result<(), &'static str> {
|
||||
// precondition SCL and SDA low
|
||||
self.sda_oe(false);
|
||||
self.unit_delay();
|
||||
self.scl_oe(false);
|
||||
self.unit_delay();
|
||||
self.start()?;
|
||||
// postcondition: SCL and SDA low
|
||||
Ok(())
|
||||
}
|
||||
|
||||
pub fn stop(&mut self) -> Result<(), &'static str> {
|
||||
// precondition: SCL and SDA low
|
||||
self.unit_delay();
|
||||
self.scl_oe(false);
|
||||
self.unit_delay();
|
||||
self.sda_oe(false);
|
||||
self.unit_delay();
|
||||
if !self.sda_i() {
|
||||
return Err("SDA arbitration lost");
|
||||
}
|
||||
// postcondition: SCL and SDA high
|
||||
Ok(())
|
||||
}
|
||||
|
||||
pub fn write(&mut self, data: u8) -> Result<bool, &'static str> {
|
||||
// precondition: SCL and SDA low
|
||||
// MSB first
|
||||
for bit in (0..8).rev() {
|
||||
self.sda_oe(data & (1 << bit) == 0);
|
||||
self.unit_delay();
|
||||
self.scl_oe(false);
|
||||
self.unit_delay();
|
||||
self.scl_oe(true);
|
||||
self.unit_delay();
|
||||
}
|
||||
self.sda_oe(false);
|
||||
self.unit_delay();
|
||||
self.scl_oe(false);
|
||||
self.unit_delay();
|
||||
// Read ack/nack
|
||||
let ack = !self.sda_i();
|
||||
self.scl_oe(true);
|
||||
self.unit_delay();
|
||||
self.sda_oe(true);
|
||||
// postcondition: SCL and SDA low
|
||||
|
||||
Ok(ack)
|
||||
}
|
||||
|
||||
pub fn read(&mut self, ack: bool) -> Result<u8, &'static str> {
|
||||
// precondition: SCL and SDA low
|
||||
self.sda_oe(false);
|
||||
|
||||
let mut data: u8 = 0;
|
||||
|
||||
// MSB first
|
||||
for bit in (0..8).rev() {
|
||||
self.unit_delay();
|
||||
self.scl_oe(false);
|
||||
self.unit_delay();
|
||||
if self.sda_i() { data |= 1 << bit }
|
||||
self.scl_oe(true);
|
||||
}
|
||||
// Send ack/nack (true = nack, false = ack)
|
||||
self.sda_oe(ack);
|
||||
self.unit_delay();
|
||||
self.scl_oe(false);
|
||||
self.unit_delay();
|
||||
self.scl_oe(true);
|
||||
self.sda_oe(true);
|
||||
// postcondition: SCL and SDA low
|
||||
|
||||
Ok(data)
|
||||
}
|
||||
|
||||
pub fn pca954x_select(&mut self, address: u8, channel: Option<u8>) -> Result<(), &'static str> {
|
||||
self.start()?;
|
||||
// PCA9547 supports only one channel at a time
|
||||
// for compatibility, PCA9548 is treated as such too
|
||||
// channel - Some(x) - # of the channel [0,7], or None for all disabled
|
||||
let setting = match self.pca_type {
|
||||
I2cMultiplexer::PCA9548 => {
|
||||
match channel {
|
||||
Some(ch) => 1 << ch,
|
||||
None => 0,
|
||||
}
|
||||
},
|
||||
#[cfg(feature = "target_kasli_soc")]
|
||||
I2cMultiplexer::PCA9547 => {
|
||||
match channel {
|
||||
Some(ch) => ch | 0x08,
|
||||
None => 0,
|
||||
}
|
||||
}
|
||||
};
|
||||
|
||||
if !self.write(address << 1)? {
|
||||
return Err("PCA954X failed to ack write address")
|
||||
}
|
||||
if !self.write(setting)? {
|
||||
return Err("PCA954X failed to ack control word")
|
||||
}
|
||||
self.stop()?;
|
||||
Ok(())
|
||||
}
|
||||
}
|
|
@ -0,0 +1,134 @@
|
|||
use libregister::{
|
||||
register, register_at,
|
||||
register_bit, register_bits
|
||||
};
|
||||
|
||||
// With reference to:
|
||||
//
|
||||
// artiq:artiq/gateware/targets/kasli.py:
|
||||
// self.submodules.i2c = gpio.GPIOTristate([i2c.scl, i2c.sda])
|
||||
//
|
||||
// misoc:misoc/cores/gpio.py:
|
||||
// class GPIOTristate(Module, AutoCSR):
|
||||
// def __init__(self, signals, reset_out=0, reset_oe=0):
|
||||
// l = len(signals)
|
||||
// self._in = CSRStatus(l)
|
||||
// self._out = CSRStorage(l, reset=reset_out)
|
||||
// self._oe = CSRStorage(l, reset=reset_oe)
|
||||
//
|
||||
// Hence, using GPIOs as SCL and SDA GPIOs respectively.
|
||||
//
|
||||
// Current compatibility:
|
||||
// zc706: GPIO 50, 51 == SCL, SDA
|
||||
// kasli_soc: GPIO 50, 51 == SCL, SDA; GPIO 33 == I2C_SW_RESET
|
||||
|
||||
pub struct RegisterBlock {
|
||||
pub gpio_output_mask: &'static mut GPIOOutputMask,
|
||||
pub gpio_input: &'static mut GPIOInput,
|
||||
pub gpio_direction: &'static mut GPIODirection,
|
||||
pub gpio_output_enable: &'static mut GPIOOutputEnable,
|
||||
#[cfg(feature = "target_kasli_soc")]
|
||||
pub gpio_output_mask_lower: &'static mut GPIOOutputMaskLower,
|
||||
}
|
||||
|
||||
impl RegisterBlock {
|
||||
pub fn i2c() -> Self {
|
||||
Self {
|
||||
gpio_output_mask: GPIOOutputMask::new(),
|
||||
gpio_input: GPIOInput::new(),
|
||||
gpio_direction: GPIODirection::new(),
|
||||
gpio_output_enable: GPIOOutputEnable::new(),
|
||||
#[cfg(feature = "target_kasli_soc")]
|
||||
gpio_output_mask_lower: GPIOOutputMaskLower::new(),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
register!(gpio_output_mask,
|
||||
/// MASK_DATA_1_MSW:
|
||||
/// Maskable output data for MIO[53:48]
|
||||
GPIOOutputMask, RW, u32);
|
||||
#[cfg(any(feature = "target_zc706", feature = "target_kasli_soc"))]
|
||||
register_at!(GPIOOutputMask, 0xE000A00C, new);
|
||||
#[cfg(any(feature = "target_zc706", feature = "target_kasli_soc"))]
|
||||
register_bit!(gpio_output_mask,
|
||||
/// Output for SCL
|
||||
scl_o, 2);
|
||||
#[cfg(any(feature = "target_zc706", feature = "target_kasli_soc"))]
|
||||
register_bit!(gpio_output_mask,
|
||||
/// Output for SDA
|
||||
sda_o, 3);
|
||||
#[cfg(any(feature = "target_zc706", feature = "target_kasli_soc"))]
|
||||
register_bits!(gpio_output_mask,
|
||||
/// Mask for keeping bits except SCL and SDA unchanged
|
||||
mask, u16, 16, 31);
|
||||
|
||||
|
||||
register!(gpio_output_mask_lower,
|
||||
/// MASK_DATA_1_LSW:
|
||||
/// Maskable output data for MIO[47:32]
|
||||
GPIOOutputMaskLower, RW, u32);
|
||||
#[cfg(feature = "target_kasli_soc")]
|
||||
register_at!(GPIOOutputMaskLower, 0xE000A008, new);
|
||||
#[cfg(feature = "target_kasli_soc")]
|
||||
register_bit!(gpio_output_mask_lower,
|
||||
/// Output for I2C_SW_RESET (MIO[33])
|
||||
i2cswr_o, 1);
|
||||
#[cfg(feature = "target_kasli_soc")]
|
||||
register_bits!(gpio_output_mask_lower,
|
||||
mask, u16, 16, 31);
|
||||
|
||||
register!(gpio_input,
|
||||
/// DATA_1_RO:
|
||||
/// Input data for MIO[53:32]
|
||||
GPIOInput, RO, u32);
|
||||
#[cfg(any(feature = "target_zc706", feature = "target_kasli_soc"))]
|
||||
register_at!(GPIOInput, 0xE000A064, new);
|
||||
#[cfg(any(feature = "target_zc706", feature = "target_kasli_soc"))]
|
||||
register_bit!(gpio_input,
|
||||
/// Input for SCL
|
||||
scl, 18);
|
||||
#[cfg(any(feature = "target_zc706", feature = "target_kasli_soc"))]
|
||||
register_bit!(gpio_input,
|
||||
/// Input for SDA
|
||||
sda, 19);
|
||||
|
||||
|
||||
register!(gpio_direction,
|
||||
/// DIRM_1:
|
||||
/// Direction mode for MIO[53:32]; 0/1 = in/out
|
||||
GPIODirection, RW, u32);
|
||||
#[cfg(any(feature = "target_zc706", feature = "target_kasli_soc"))]
|
||||
register_at!(GPIODirection, 0xE000A244, new);
|
||||
#[cfg(any(feature = "target_zc706", feature = "target_kasli_soc"))]
|
||||
register_bit!(gpio_direction,
|
||||
/// Direction for SCL
|
||||
scl, 18);
|
||||
#[cfg(any(feature = "target_zc706", feature = "target_kasli_soc"))]
|
||||
register_bit!(gpio_direction,
|
||||
/// Direction for SDA
|
||||
sda, 19);
|
||||
#[cfg(feature = "target_kasli_soc")]
|
||||
register_bit!(gpio_direction,
|
||||
/// Direction for I2C_SW_RESET
|
||||
i2cswr, 1);
|
||||
|
||||
register!(gpio_output_enable,
|
||||
/// OEN_1:
|
||||
/// Output enable for MIO[53:32]
|
||||
GPIOOutputEnable, RW, u32);
|
||||
#[cfg(any(feature = "target_zc706", feature = "target_kasli_soc"))]
|
||||
register_at!(GPIOOutputEnable, 0xE000A248, new);
|
||||
#[cfg(any(feature = "target_zc706", feature = "target_kasli_soc"))]
|
||||
register_bit!(gpio_output_enable,
|
||||
/// Output enable for SCL
|
||||
scl, 18);
|
||||
#[cfg(any(feature = "target_zc706", feature = "target_kasli_soc"))]
|
||||
register_bit!(gpio_output_enable,
|
||||
/// Output enable for SDA
|
||||
sda, 19);
|
||||
#[cfg(feature = "target_kasli_soc")]
|
||||
register_bit!(gpio_output_enable,
|
||||
/// Output enable for I2C_SW_RESET
|
||||
i2cswr, 1);
|
||||
|
|
@ -15,9 +15,13 @@ pub mod axi_hp;
|
|||
pub mod axi_gp;
|
||||
pub mod ddr;
|
||||
pub mod mpcore;
|
||||
pub mod flash;
|
||||
pub mod dmac;
|
||||
pub mod gic;
|
||||
pub mod time;
|
||||
pub mod timer;
|
||||
pub mod sdio;
|
||||
#[cfg(any(feature = "target_zc706", feature = "target_kasli_soc"))]
|
||||
pub mod i2c;
|
||||
pub mod logger;
|
||||
pub mod ps7_init;
|
||||
#[cfg(feature="target_kasli_soc")]
|
||||
pub mod error_led;
|
||||
|
|
|
@ -19,7 +19,7 @@ impl log::Log for Logger {
|
|||
if self.enabled(record.metadata()) {
|
||||
let timestamp = unsafe {
|
||||
GlobalTimer::get()
|
||||
}.get_us();
|
||||
}.get_us().0;
|
||||
let seconds = timestamp / 1_000_000;
|
||||
let micros = timestamp % 1_000_000;
|
||||
|
||||
|
|
|
@ -8,47 +8,140 @@ use libregister::{
|
|||
|
||||
#[repr(C)]
|
||||
pub struct RegisterBlock {
|
||||
/// SCU Control Register
|
||||
pub scu_control: ScuControl,
|
||||
pub scu_config: RO<u32>,
|
||||
pub scu_cpu_power: RW<u32>,
|
||||
/// SCU Configuration Register
|
||||
pub scu_config: ScuConfig,
|
||||
/// SCU CPU Power Status Register
|
||||
pub scu_cpu_power_status: SCUCPUPowerStatusRegister,
|
||||
/// SCU Invalidate All Registers in Secure State
|
||||
pub scu_invalidate: ScuInvalidate,
|
||||
reserved0: [u32; 12],
|
||||
pub filter_start: RW<u32>,
|
||||
pub filter_end: RW<u32>,
|
||||
reserved1: [u32; 2],
|
||||
pub scu_access_control: RW<u32>,
|
||||
pub scu_non_secure_access_control: RW<u32>,
|
||||
reserved2: [u32; 42],
|
||||
pub iccicr: RW<u32>,
|
||||
pub iccpmw: RW<u32>,
|
||||
pub iccbpr: RW<u32>,
|
||||
pub icciar: RW<u32>,
|
||||
pub icceoir: RW<u32>,
|
||||
pub iccrpr: RW<u32>,
|
||||
pub icchpir: RW<u32>,
|
||||
pub iccabpr: RW<u32>,
|
||||
reserved3: [u32; 55],
|
||||
pub iccidr: RW<u32>,
|
||||
unused0: [u32; 12],
|
||||
/// Filtering Start Address Register
|
||||
pub filtering_start_address: FilteringStartAddressRegister,
|
||||
/// Defined by FILTEREND input
|
||||
pub filtering_end_address: FilteringEndAddressRegister,
|
||||
unused1: [u32; 2],
|
||||
/// SCU Access Control (SAC) Register
|
||||
pub scu_access_control_sac: SCUAccessControlRegisterSAC,
|
||||
/// SCU Non-secure Access Control Register SNSAC
|
||||
pub scu_non_secure_access_control: SCUNonSecureAccessControlRegister,
|
||||
unused2: [u32; 42],
|
||||
/// CPU Interface Control Register
|
||||
pub iccicr: ICCICR,
|
||||
/// Interrupt Priority Mask Register
|
||||
pub iccpmr: ICCPMR,
|
||||
/// Binary Point Register
|
||||
pub iccbpr: ICCBPR,
|
||||
/// Interrupt Acknowledge Register
|
||||
pub icciar: ICCIAR,
|
||||
/// End Of Interrupt Register
|
||||
pub icceoir: ICCEOIR,
|
||||
/// Running Priority Register
|
||||
pub iccrpr: ICCRPR,
|
||||
/// Highest Pending Interrupt Register
|
||||
pub icchpir: ICCHPIR,
|
||||
/// Aliased Non-secure Binary Point Register
|
||||
pub iccabpr: ICCABPR,
|
||||
unused3: [u32; 55],
|
||||
/// CPU Interface Implementer Identification Register
|
||||
pub iccidr: ICCIDR,
|
||||
/// Global Timer Counter Register 0
|
||||
pub global_timer_counter0: ValueRegister,
|
||||
pub global_timer_counter1: ValueRegister,
|
||||
/// Global Timer Control Register
|
||||
pub global_timer_control: GlobalTimerControl,
|
||||
pub global_timer_interrupt_status: RW<u32>,
|
||||
/// Global Timer Interrupt Status Register
|
||||
pub global_timer_interrupt_status: GlobalTimerInterruptStatusRegister,
|
||||
/// Comparator Value Register_0
|
||||
pub comparator_value0: ValueRegister,
|
||||
pub comparator_value1: ValueRegister,
|
||||
pub auto_increment: ValueRegister,
|
||||
reserved4: [u32; 249],
|
||||
pub private_timer_load: ValueRegister,
|
||||
pub private_timer_counter: ValueRegister,
|
||||
pub private_timer_control: RW<u32>,
|
||||
pub private_timer_interrupt_status: RW<u32>,
|
||||
reserved5: [u32; 4],
|
||||
pub watchdog_load: ValueRegister,
|
||||
pub watchdog_counter: ValueRegister,
|
||||
pub watchdog_control: RW<u32>,
|
||||
pub watchdog_interrupt_status: RW<u32>,
|
||||
// there is plenty more (unimplemented)
|
||||
/// Auto-increment Register
|
||||
pub auto_increment: RW<u32>,
|
||||
unused4: [u32; 249],
|
||||
/// Private Timer Load Register
|
||||
pub private_timer_load: RW<u32>,
|
||||
/// Private Timer Counter Register
|
||||
pub private_timer_counter: RW<u32>,
|
||||
/// Private Timer Control Register
|
||||
pub private_timer_control: PrivateTimerControlRegister,
|
||||
/// Private Timer Interrupt Status Register
|
||||
pub private_timer_interrupt_status: PrivateTimerInterruptStatusRegister,
|
||||
unused5: [u32; 4],
|
||||
/// Watchdog Load Register
|
||||
pub watchdog_load: RW<u32>,
|
||||
/// Watchdog Counter Register
|
||||
pub watchdog_counter: RW<u32>,
|
||||
/// Watchdog Control Register
|
||||
pub watchdog_control: WatchdogControlRegister,
|
||||
/// Watchdog Interrupt Status Register
|
||||
pub watchdog_interrupt_status: WatchdogInterruptStatusRegister,
|
||||
/// Watchdog Reset Status Register
|
||||
pub watchdog_reset_status: WatchdogResetStatusRegister,
|
||||
/// Watchdog Disable Register
|
||||
pub watchdog_disable: RW<u32>,
|
||||
unused6: [u32; 626],
|
||||
/// Distributor Control Register
|
||||
pub icddcr: ICDDCR,
|
||||
/// Interrupt Controller Type Register
|
||||
pub icdictr: ICDICTR,
|
||||
/// Distributor Implementer Identification Register
|
||||
pub icdiidr: ICDIIDR,
|
||||
unused7: [u32; 29],
|
||||
/// Interrupt Security Register
|
||||
pub icdisr0: RW<u32>,
|
||||
pub icdisr1: RW<u32>,
|
||||
pub icdisr2: RW<u32>,
|
||||
unused8: [u32; 29],
|
||||
/// Interrupt Set-enable Registers
|
||||
pub icdiser: [RW<u32>; 3],
|
||||
unused9: [u32; 29],
|
||||
/// Interrupt Clear-Enable Register 0
|
||||
pub icdicer0: RW<u32>,
|
||||
/// Interrupt Clear-Enable Register 1
|
||||
pub icdicer1: RW<u32>,
|
||||
/// Interrupt Clear-Enable Register 2
|
||||
pub icdicer2: RW<u32>,
|
||||
unused10: [u32; 29],
|
||||
/// Interrupt Set-pending Register
|
||||
pub icdispr0: RW<u32>,
|
||||
pub icdispr1: RW<u32>,
|
||||
pub icdispr2: RW<u32>,
|
||||
unused11: [u32; 29],
|
||||
/// Interrupt Clear-Pending Register
|
||||
pub icdicpr0: RW<u32>,
|
||||
pub icdicpr1: RW<u32>,
|
||||
pub icdicpr2: RW<u32>,
|
||||
unused12: [u32; 29],
|
||||
/// Active Bit register
|
||||
pub icdabr0: RW<u32>,
|
||||
pub icdabr1: RW<u32>,
|
||||
pub icdabr2: RW<u32>,
|
||||
unused13: [u32; 61],
|
||||
/// Interrupt Priority Register
|
||||
pub icdipr: [RW<u32>; 24],
|
||||
unused14: [u32; 232],
|
||||
/// Interrupt Processor Targets Registers
|
||||
pub icdiptr: [RW<u32>; 24],
|
||||
unused15: [u32; 232],
|
||||
/// Interrupt Configuration Registers
|
||||
pub icdicfr: [RW<u32>; 6],
|
||||
unused16: [u32; 58],
|
||||
/// PPI Status Register
|
||||
pub ppi_status: PpiStatus,
|
||||
/// SPI Status Register 0
|
||||
pub spi_status_0: RO<u32>,
|
||||
/// SPI Status Register 1
|
||||
pub spi_status_1: RO<u32>,
|
||||
unused17: [u32; 125],
|
||||
/// Software Generated Interrupt Register
|
||||
pub icdsgir: ICDSGIR,
|
||||
}
|
||||
register_at!(RegisterBlock, 0xF8F00000, new);
|
||||
|
||||
register_at!(RegisterBlock, 0xF8F00000, mpcore);
|
||||
|
||||
register!(value_register, ValueRegister, RW, u32);
|
||||
register_bits!(value_register, value, u32, 0, 31);
|
||||
|
||||
register!(scu_control, ScuControl, RW, u32);
|
||||
register_bit!(scu_control, ic_standby_enable, 6);
|
||||
|
@ -61,10 +154,21 @@ register_bit!(scu_control, enable, 0);
|
|||
|
||||
impl ScuControl {
|
||||
pub fn start(&mut self) {
|
||||
self.modify(|_, w| w.enable(true));
|
||||
self.modify(|_, w| w.enable(true).scu_speculative_linefill_enable(true));
|
||||
}
|
||||
}
|
||||
|
||||
register!(scu_config, ScuConfig, RO, u32);
|
||||
register_bits!(scu_config, tag_ram_sizes, u8, 8, 15);
|
||||
register_bits!(scu_config, cpus_smp, u8, 4, 7);
|
||||
register_bits!(scu_config, cpu_number, u8, 0, 1);
|
||||
|
||||
register!(scu_cpu_power_status, SCUCPUPowerStatusRegister, RW, u32);
|
||||
register_bits!(scu_cpu_power_status, cpu3_status, u8, 24, 25);
|
||||
register_bits!(scu_cpu_power_status, cpu2_status, u8, 16, 17);
|
||||
register_bits!(scu_cpu_power_status, cpu1_status, u8, 8, 9);
|
||||
register_bits!(scu_cpu_power_status, cpu0_status, u8, 0, 1);
|
||||
|
||||
register!(scu_invalidate, ScuInvalidate, WO, u32);
|
||||
register_bits!(scu_invalidate, cpu0_ways, u8, 0, 3);
|
||||
register_bits!(scu_invalidate, cpu1_ways, u8, 4, 7);
|
||||
|
@ -88,8 +192,71 @@ impl ScuInvalidate {
|
|||
}
|
||||
}
|
||||
|
||||
register!(value_register, ValueRegister, RW, u32);
|
||||
register_bits!(value_register, value, u32, 0, 31);
|
||||
register!(filtering_start_address, FilteringStartAddressRegister, RW, u32);
|
||||
register_bits!(filtering_start_address, filtering_start_address, u32, 20, 31);
|
||||
register_bits!(filtering_start_address, sbz, u32, 0, 19);
|
||||
|
||||
register!(filtering_end_address, FilteringEndAddressRegister, RW, u32);
|
||||
register_bits!(filtering_end_address, filtering_end_address, u32, 20, 31);
|
||||
register_bits!(filtering_end_address, sbz, u32, 0, 19);
|
||||
|
||||
register!(scu_access_control_sac, SCUAccessControlRegisterSAC, RW, u32);
|
||||
register_bit!(scu_access_control_sac, cp_u3, 3);
|
||||
register_bit!(scu_access_control_sac, cp_u2, 2);
|
||||
register_bit!(scu_access_control_sac, cp_u1, 1);
|
||||
register_bit!(scu_access_control_sac, cp_u0, 0);
|
||||
|
||||
register!(scu_non_secure_access_control, SCUNonSecureAccessControlRegister, RO, u32);
|
||||
register_bits!(scu_non_secure_access_control, sbz, u32, 12, 31);
|
||||
register_bit!(scu_non_secure_access_control, cpu3_global_timer, 11);
|
||||
register_bit!(scu_non_secure_access_control, cpu2_global_timer, 10);
|
||||
register_bit!(scu_non_secure_access_control, cpu1_global_timer, 9);
|
||||
register_bit!(scu_non_secure_access_control, cpu0_global_timer, 8);
|
||||
register_bit!(scu_non_secure_access_control, private_timers_for_cpu3, 7);
|
||||
register_bit!(scu_non_secure_access_control, private_timers_for_cpu2, 6);
|
||||
register_bit!(scu_non_secure_access_control, private_timers_for_cpu1, 5);
|
||||
register_bit!(scu_non_secure_access_control, private_timers_for_cpu0, 4);
|
||||
register_bit!(scu_non_secure_access_control, component_access_for_cpu3, 3);
|
||||
register_bit!(scu_non_secure_access_control, component_access_for_cpu2, 2);
|
||||
register_bit!(scu_non_secure_access_control, component_access_for_cpu1, 1);
|
||||
register_bit!(scu_non_secure_access_control, component_access_for_cpu0, 0);
|
||||
|
||||
register!(iccicr, ICCICR, RW, u32);
|
||||
register_bit!(iccicr, sbpr, 4);
|
||||
register_bit!(iccicr, fiq_en, 3);
|
||||
register_bit!(iccicr, ack_ctl, 2);
|
||||
register_bit!(iccicr, enable_ns, 1);
|
||||
register_bit!(iccicr, enable_s, 0);
|
||||
|
||||
register!(iccpmr, ICCPMR, RW, u32);
|
||||
register_bits!(iccpmr, priority, u8, 0, 7);
|
||||
|
||||
register!(iccbpr, ICCBPR, RW, u32);
|
||||
register_bits!(iccbpr, binary_point, u8, 0, 2);
|
||||
|
||||
register!(icciar, ICCIAR, RW, u32);
|
||||
register_bits!(icciar, cpuid, u8, 10, 12);
|
||||
register_bits!(icciar, ackintid, u32, 0, 9);
|
||||
|
||||
register!(icceoir, ICCEOIR, RW, u32);
|
||||
register_bits!(icceoir, cpuid, u8, 10, 12);
|
||||
register_bits!(icceoir, eoiintid, u32, 0, 9);
|
||||
|
||||
register!(iccrpr, ICCRPR, RW, u32);
|
||||
register_bits!(iccrpr, priority, u8, 0, 7);
|
||||
|
||||
register!(icchpir, ICCHPIR, RW, u32);
|
||||
register_bits!(icchpir, cpuid, u8, 10, 12);
|
||||
register_bits!(icchpir, pendintid, u32, 0, 9);
|
||||
|
||||
register!(iccabpr, ICCABPR, RW, u32);
|
||||
register_bits!(iccabpr, binary_point, u8, 0, 2);
|
||||
|
||||
register!(iccidr, ICCIDR, RO, u32);
|
||||
register_bits!(iccidr, part_number, u32, 20, 31);
|
||||
register_bits!(iccidr, architecture_version, u8, 16, 19);
|
||||
register_bits!(iccidr, revision_number, u8, 12, 15);
|
||||
register_bits!(iccidr, implementer, u32, 0, 11);
|
||||
|
||||
register!(global_timer_control, GlobalTimerControl, RW, u32);
|
||||
register_bits!(global_timer_control, prescaler, u8, 8, 15);
|
||||
|
@ -97,3 +264,58 @@ register_bit!(global_timer_control, auto_increment_mode, 3);
|
|||
register_bit!(global_timer_control, irq_enable, 2);
|
||||
register_bit!(global_timer_control, comp_enablea, 1);
|
||||
register_bit!(global_timer_control, timer_enable, 0);
|
||||
|
||||
register!(global_timer_interrupt_status, GlobalTimerInterruptStatusRegister, RW, u32);
|
||||
register_bit!(global_timer_interrupt_status, event_flag, 0);
|
||||
|
||||
register!(private_timer_control, PrivateTimerControlRegister, RW, u32);
|
||||
register_bits!(private_timer_control, sbzp, u32, 16, 31);
|
||||
register_bits!(private_timer_control, prescaler, u8, 8, 15);
|
||||
register_bits!(private_timer_control, unk_sbzp, u8, 3, 7);
|
||||
register_bit!(private_timer_control, irq_enable, 2);
|
||||
register_bit!(private_timer_control, auto_reload, 1);
|
||||
register_bit!(private_timer_control, timer_enable, 0);
|
||||
|
||||
register!(private_timer_interrupt_status, PrivateTimerInterruptStatusRegister, RW, u32);
|
||||
register_bits!(private_timer_interrupt_status, unk_sbzp, u32, 1, 31);
|
||||
|
||||
register!(watchdog_control, WatchdogControlRegister, RW, u32);
|
||||
register_bits!(watchdog_control, prescaler, u8, 8, 15);
|
||||
register_bit!(watchdog_control, watchdog_mode, 3);
|
||||
register_bit!(watchdog_control, it_enable, 2);
|
||||
register_bit!(watchdog_control, auto_reload, 1);
|
||||
register_bit!(watchdog_control, watchdog_enable, 0);
|
||||
|
||||
register!(watchdog_interrupt_status, WatchdogInterruptStatusRegister, RW, u32);
|
||||
register_bit!(watchdog_interrupt_status, event_flag, 0);
|
||||
|
||||
register!(watchdog_reset_status, WatchdogResetStatusRegister, RW, u32);
|
||||
register_bit!(watchdog_reset_status, reset_flag, 0);
|
||||
|
||||
register!(icddcr, ICDDCR, RW, u32);
|
||||
register_bit!(icddcr, enable_non_secure, 1);
|
||||
register_bit!(icddcr, enable_secure, 0);
|
||||
|
||||
register!(icdictr, ICDICTR, RO, u32);
|
||||
register_bits!(icdictr, lspi, u8, 11, 15);
|
||||
register_bit!(icdictr, security_extn, 10);
|
||||
register_bits!(icdictr, sbz, u8, 8, 9);
|
||||
register_bits!(icdictr, cpu_number, u8, 5, 7);
|
||||
register_bits!(icdictr, it_lines_number, u8, 0, 4);
|
||||
|
||||
register!(icdiidr, ICDIIDR, RO, u32);
|
||||
register_bits!(icdiidr, implementation_version, u8, 24, 31);
|
||||
register_bits!(icdiidr, revision_number, u32, 12, 23);
|
||||
register_bits!(icdiidr, implementer, u32, 0, 11);
|
||||
|
||||
register!(ppi_status, PpiStatus, RO, u32);
|
||||
register_bits!(ppi_status, ppi_status, u8, 11, 15);
|
||||
register_bits!(ppi_status, sbz, u32, 0, 10);
|
||||
|
||||
register!(icdsgir, ICDSGIR, RW, u32);
|
||||
register_bits!(icdsgir, target_list_filter, u8, 24, 25);
|
||||
register_bits!(icdsgir, cpu_target_list, u8, 16, 23);
|
||||
register_bit!(icdsgir, satt, 15);
|
||||
register_bits!(icdsgir, sbz, u32, 4, 14);
|
||||
register_bits!(icdsgir, sgiintid, u8, 0, 3);
|
||||
|
||||
|
|
|
@ -0,0 +1,108 @@
|
|||
use crate::println;
|
||||
|
||||
#[cfg(feature = "target_zc706")]
|
||||
mod zc706;
|
||||
#[cfg(not(feature = "target_zc706"))]
|
||||
mod none;
|
||||
|
||||
#[cfg(feature = "target_zc706")]
|
||||
use zc706 as target;
|
||||
#[cfg(not(feature = "target_zc706"))]
|
||||
use none as target;
|
||||
|
||||
pub fn report_differences() {
|
||||
for (i, op) in target::INIT_DATA.iter().enumerate() {
|
||||
let address = op.address();
|
||||
let overwritten_later = target::INIT_DATA[(i + 1)..].iter()
|
||||
.any(|later_op| later_op.address() == address);
|
||||
|
||||
if !overwritten_later {
|
||||
op.report_difference();
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
pub fn apply() {
|
||||
for op in target::INIT_DATA {
|
||||
op.apply();
|
||||
}
|
||||
}
|
||||
|
||||
#[derive(Clone, Debug)]
|
||||
pub enum InitOp {
|
||||
MaskWrite(usize, usize, usize),
|
||||
MaskPoll(usize, usize),
|
||||
MaskDelay(usize, usize),
|
||||
}
|
||||
|
||||
impl InitOp {
|
||||
fn address(&self) -> usize {
|
||||
match self {
|
||||
InitOp::MaskWrite(address, _, _) => *address,
|
||||
InitOp::MaskPoll(address, _) => *address,
|
||||
InitOp::MaskDelay(address, _) => *address,
|
||||
}
|
||||
}
|
||||
|
||||
fn read(&self) -> usize {
|
||||
unsafe { *(self.address() as *const usize) }
|
||||
}
|
||||
|
||||
fn difference(&self) -> Option<(usize, usize)> {
|
||||
let expected = match self {
|
||||
InitOp::MaskWrite(_, mask, expected) =>
|
||||
Some((*mask, *expected)),
|
||||
InitOp::MaskPoll(_, mask) =>
|
||||
Some((*mask, *mask)),
|
||||
_ => None,
|
||||
};
|
||||
match expected {
|
||||
Some((mask, expected)) => {
|
||||
let actual = self.read();
|
||||
if actual & mask == expected {
|
||||
None
|
||||
} else {
|
||||
Some((actual & mask, expected))
|
||||
}
|
||||
}
|
||||
None =>
|
||||
None
|
||||
}
|
||||
}
|
||||
|
||||
pub fn report_difference(&self) {
|
||||
if let Some((actual, expected)) = self.difference() {
|
||||
println!(
|
||||
"Register {:08X} is {:08X}&={:08X} != {:08X} expected",
|
||||
self.address(),
|
||||
self.read(),
|
||||
actual,
|
||||
expected
|
||||
);
|
||||
}
|
||||
}
|
||||
|
||||
pub fn apply(&self) {
|
||||
let reg = self.address() as *mut usize;
|
||||
println!("apply {:?}", self);
|
||||
match self {
|
||||
InitOp::MaskWrite(_, mask, val) =>
|
||||
unsafe {
|
||||
*reg = (val & mask) | (*reg & !mask);
|
||||
},
|
||||
InitOp::MaskPoll(_, mask) =>
|
||||
while unsafe { *reg } & mask == 0 {},
|
||||
InitOp::MaskDelay(_, mask) => {
|
||||
let delay = get_number_of_cycles_for_delay(*mask);
|
||||
while unsafe { *reg } < delay {
|
||||
println!("W");
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
fn get_number_of_cycles_for_delay(delay: usize) -> usize {
|
||||
const APU_FREQ: usize = 666666687;
|
||||
APU_FREQ * delay/ (2 * 1000)
|
||||
}
|
|
@ -0,0 +1,4 @@
|
|||
use super::InitOp;
|
||||
|
||||
pub const INIT_DATA: &'static [InitOp] = &[
|
||||
];
|
File diff suppressed because it is too large
Load Diff
|
@ -1,6 +1,6 @@
|
|||
/// ADMA library
|
||||
use core::mem::MaybeUninit;
|
||||
use super::SDIO;
|
||||
use super::Sdio;
|
||||
use libcortex_a9::cache;
|
||||
use libregister::{
|
||||
register, register_bit,
|
||||
|
@ -32,7 +32,7 @@ impl Adma2DescTable {
|
|||
}
|
||||
|
||||
/// Initialize the table and setup `adma_system_address`
|
||||
pub fn setup(&mut self, sdio: &mut SDIO, blk_cnt: u32, buffer: &[u8]) {
|
||||
pub fn setup(&mut self, sdio: &mut Sdio, blk_cnt: u32, buffer: &[u8]) {
|
||||
let descr_table = &mut self.0;
|
||||
let blk_size = sdio
|
||||
.regs
|
||||
|
|
|
@ -12,9 +12,9 @@ use log::{trace, debug};
|
|||
use nb;
|
||||
|
||||
/// Basic SDIO Struct with common low-level functions.
|
||||
pub struct SDIO {
|
||||
pub struct Sdio {
|
||||
regs: &'static mut regs::RegisterBlock,
|
||||
count_down: super::timer::global::CountDown,
|
||||
count_down: super::timer::global::CountDown<Milliseconds>,
|
||||
input_clk_hz: u32,
|
||||
card_type: CardType,
|
||||
card_detect: bool,
|
||||
|
@ -48,7 +48,7 @@ pub enum CardType {
|
|||
CardMmc,
|
||||
}
|
||||
|
||||
impl SDIO {
|
||||
impl Sdio {
|
||||
/// Initialize SDIO0
|
||||
/// card_detect means if we would use the card detect pin,
|
||||
/// false to disable card detection (assume there is card inserted)
|
||||
|
@ -105,7 +105,7 @@ impl SDIO {
|
|||
);
|
||||
}
|
||||
// cora card detect pin
|
||||
#[cfg(feature = "target_cora_z7_10")]
|
||||
#[cfg(feature = "target_coraz7")]
|
||||
{
|
||||
unsafe {
|
||||
slcr.sd0_wp_cd_sel.write(47 << 16);
|
||||
|
@ -116,12 +116,24 @@ impl SDIO {
|
|||
.speed(true),
|
||||
);
|
||||
}
|
||||
// redpitaya card detect pin
|
||||
#[cfg(any(feature = "target_redpitaya", feature = "target_kasli_soc"))]
|
||||
{
|
||||
unsafe {
|
||||
slcr.sd0_wp_cd_sel.write(46 << 16);
|
||||
}
|
||||
slcr.mio_pin_46.write(
|
||||
slcr::MioPin46::zeroed()
|
||||
.io_type(slcr::IoBufferType::Lvcmos25)
|
||||
.speed(true),
|
||||
);
|
||||
}
|
||||
slcr.sdio_rst_ctrl.reset_sdio0();
|
||||
slcr.aper_clk_ctrl.enable_sdio0();
|
||||
slcr.sdio_clk_ctrl.enable_sdio0();
|
||||
});
|
||||
let clocks = Clocks::get();
|
||||
let mut self_ = SDIO {
|
||||
let mut self_ = Sdio {
|
||||
regs: regs::RegisterBlock::sdio0(),
|
||||
count_down: unsafe { super::timer::GlobalTimer::get() }.countdown(),
|
||||
input_clk_hz: clocks.sdio_ref_clk(),
|
||||
|
|
|
@ -1,4 +1,4 @@
|
|||
use super::{adma::Adma2DescTable, cmd, CardType, CmdTransferError, SDIO};
|
||||
use super::{adma::Adma2DescTable, cmd, CardType, CmdTransferError, Sdio};
|
||||
use libcortex_a9::cache;
|
||||
use libregister::{RegisterR, RegisterRW, RegisterW};
|
||||
use log::{trace, debug};
|
||||
|
@ -37,7 +37,7 @@ enum CardVersion {
|
|||
}
|
||||
|
||||
pub struct SdCard {
|
||||
sdio: SDIO,
|
||||
sdio: Sdio,
|
||||
adma2_desc_table: Adma2DescTable,
|
||||
card_version: CardVersion,
|
||||
hcs: bool,
|
||||
|
@ -171,8 +171,8 @@ impl SdCard {
|
|||
Ok(())
|
||||
}
|
||||
|
||||
/// Convert SDIO into SdCard struct, error if no card inserted or it is not an SD card.
|
||||
pub fn from_sdio(mut sdio: SDIO) -> Result<Self, CardInitializationError> {
|
||||
/// Convert Sdio into SdCard struct, error if no card inserted or it is not an SD card.
|
||||
pub fn from_sdio(mut sdio: Sdio) -> Result<Self, CardInitializationError> {
|
||||
match sdio.identify_card()? {
|
||||
CardType::CardSd => (),
|
||||
_ => return Err(CardInitializationError::NoCardInserted),
|
||||
|
@ -192,8 +192,8 @@ impl SdCard {
|
|||
Ok(_self)
|
||||
}
|
||||
|
||||
/// Convert SdCard struct back to SDIO struct.
|
||||
pub fn to_sdio(self) -> SDIO {
|
||||
/// Convert SdCard struct back to Sdio struct.
|
||||
pub fn to_sdio(self) -> Sdio {
|
||||
self.sdio
|
||||
}
|
||||
|
||||
|
|
|
@ -102,19 +102,19 @@ pub struct RegisterBlock {
|
|||
pub dbg_clk_ctrl: RW<u32>,
|
||||
pub pcap_clk_ctrl: RW<u32>,
|
||||
pub topsw_clk_ctrl: RW<u32>,
|
||||
pub fpga0_clk_ctrl: RW<u32>,
|
||||
pub fpga0_clk_ctrl: Fpga0ClkCtrl,
|
||||
pub fpga0_thr_ctrl: RW<u32>,
|
||||
pub fpga0_thr_cnt: RW<u32>,
|
||||
pub fpga0_thr_sta: RO<u32>,
|
||||
pub fpga1_clk_ctrl: RW<u32>,
|
||||
pub fpga1_clk_ctrl: Fpga1ClkCtrl,
|
||||
pub fpga1_thr_ctrl: RW<u32>,
|
||||
pub fpga1_thr_cnt: RW<u32>,
|
||||
pub fpga1_thr_sta: RO<u32>,
|
||||
pub fpga2_clk_ctrl: RW<u32>,
|
||||
pub fpga2_clk_ctrl: Fpga2ClkCtrl,
|
||||
pub fpga2_thr_ctrl: RW<u32>,
|
||||
pub fpga2_thr_cnt: RW<u32>,
|
||||
pub fpga2_thr_sta: RO<u32>,
|
||||
pub fpga3_clk_ctrl: RW<u32>,
|
||||
pub fpga3_clk_ctrl: Fpga3ClkCtrl,
|
||||
pub fpga3_thr_ctrl: RW<u32>,
|
||||
pub fpga3_thr_cnt: RW<u32>,
|
||||
pub fpga3_thr_sta: RO<u32>,
|
||||
|
@ -132,7 +132,7 @@ pub struct RegisterBlock {
|
|||
pub can_rst_ctrl: RW<u32>,
|
||||
pub i2c_rst_ctrl: RW<u32>,
|
||||
pub uart_rst_ctrl: UartRstCtrl,
|
||||
pub gpio_rst_ctrl: RW<u32>,
|
||||
pub gpio_rst_ctrl: GpioRstCtrl,
|
||||
pub lqspi_rst_ctrl: LqspiRstCtrl,
|
||||
pub smc_rst_ctrl: RW<u32>,
|
||||
pub ocm_rst_ctrl: RW<u32>,
|
||||
|
@ -253,26 +253,18 @@ pub struct RegisterBlock {
|
|||
pub ddriob_dci_ctrl: DdriobDciCtrl,
|
||||
pub ddriob_dci_status: DdriobDciStatus,
|
||||
}
|
||||
register_at!(RegisterBlock, 0xF8000000, new);
|
||||
register_at!(RegisterBlock, 0xF8000000, slcr);
|
||||
|
||||
impl RegisterBlock {
|
||||
/// Required to modify any sclr register
|
||||
pub fn unlocked<F: FnMut(&mut Self) -> R, R>(mut f: F) -> R {
|
||||
let mut self_ = Self::new();
|
||||
let mut self_ = Self::slcr();
|
||||
self_.slcr_unlock.unlock();
|
||||
let r = f(&mut self_);
|
||||
self_.slcr_lock.lock();
|
||||
r
|
||||
}
|
||||
|
||||
/// Perform a soft reset
|
||||
pub fn soft_reset(&mut self) {
|
||||
self.pss_rst_ctrl.write(
|
||||
PssRstCtrl::zeroed()
|
||||
.soft_rst(true)
|
||||
);
|
||||
}
|
||||
|
||||
pub fn init_preload_fpga(&mut self) {
|
||||
// Assert FPGA top level output resets
|
||||
self.fpga_rst_ctrl.write(
|
||||
|
@ -539,6 +531,20 @@ impl UartRstCtrl {
|
|||
}
|
||||
}
|
||||
|
||||
register!(gpio_rst_ctrl, GpioRstCtrl, RW, u32);
|
||||
register_bit!(gpio_rst_ctrl, gpio_cpu1x_rst, 0);
|
||||
register_at!(GpioRstCtrl, 0xF800022C, new);
|
||||
impl GpioRstCtrl {
|
||||
pub fn reset_gpio(&mut self) {
|
||||
self.modify(|_, w|
|
||||
w.gpio_cpu1x_rst(true)
|
||||
);
|
||||
self.modify(|_, w|
|
||||
w.gpio_cpu1x_rst(false)
|
||||
);
|
||||
}
|
||||
}
|
||||
|
||||
register!(lqspi_clk_ctrl, LqspiClkCtrl, RW, u32);
|
||||
register_bit!(lqspi_clk_ctrl, clkact, 0);
|
||||
register_bits_typed!(lqspi_clk_ctrl, src_sel, u8, PllSource, 4, 5);
|
||||
|
@ -548,6 +554,26 @@ register!(lqspi_rst_ctrl, LqspiRstCtrl, RW, u32);
|
|||
register_bit!(lqspi_rst_ctrl, ref_rst, 1);
|
||||
register_bit!(lqspi_rst_ctrl, cpu1x_rst, 0);
|
||||
|
||||
register!(fpga0_clk_ctrl, Fpga0ClkCtrl, RW, u32);
|
||||
register_bits!(fpga0_clk_ctrl, divisor1, u8, 20, 25);
|
||||
register_bits!(fpga0_clk_ctrl, divisor0, u8, 8, 13);
|
||||
register_bits_typed!(fpga0_clk_ctrl, src_sel, u8, PllSource, 4, 5);
|
||||
|
||||
register!(fpga1_clk_ctrl, Fpga1ClkCtrl, RW, u32);
|
||||
register_bits!(fpga1_clk_ctrl, divisor1, u8, 20, 25);
|
||||
register_bits!(fpga1_clk_ctrl, divisor0, u8, 8, 13);
|
||||
register_bits_typed!(fpga1_clk_ctrl, src_sel, u8, PllSource, 4, 5);
|
||||
|
||||
register!(fpga2_clk_ctrl, Fpga2ClkCtrl, RW, u32);
|
||||
register_bits!(fpga2_clk_ctrl, divisor1, u8, 20, 25);
|
||||
register_bits!(fpga2_clk_ctrl, divisor0, u8, 8, 13);
|
||||
register_bits_typed!(fpga2_clk_ctrl, src_sel, u8, PllSource, 4, 5);
|
||||
|
||||
register!(fpga3_clk_ctrl, Fpga3ClkCtrl, RW, u32);
|
||||
register_bits!(fpga3_clk_ctrl, divisor1, u8, 20, 25);
|
||||
register_bits!(fpga3_clk_ctrl, divisor0, u8, 8, 13);
|
||||
register_bits_typed!(fpga3_clk_ctrl, src_sel, u8, PllSource, 4, 5);
|
||||
|
||||
register!(fpga_rst_ctrl, FpgaRstCtrl, RW, u32);
|
||||
register_bit!(fpga_rst_ctrl, fpga0_out_rst, 0);
|
||||
register_bit!(fpga_rst_ctrl, fpga1_out_rst, 1);
|
||||
|
@ -561,22 +587,36 @@ register_bit!(a9_cpu_rst_ctrl, a9_clkstop0, 4);
|
|||
register_bit!(a9_cpu_rst_ctrl, a9_rst1, 1);
|
||||
register_bit!(a9_cpu_rst_ctrl, a9_rst0, 0);
|
||||
|
||||
pub fn reboot() {
|
||||
RegisterBlock::unlocked(|slcr| {
|
||||
unsafe {
|
||||
let reboot = slcr.reboot_status.read();
|
||||
slcr.reboot_status.write(reboot & 0xF0FFFFFF);
|
||||
slcr.pss_rst_ctrl.modify(|_, w| w.soft_rst(true));
|
||||
}
|
||||
});
|
||||
}
|
||||
|
||||
|
||||
#[derive(Clone, Copy, Debug, PartialEq)]
|
||||
#[repr(u8)]
|
||||
pub enum BootModePins {
|
||||
// CAUTION!
|
||||
// The BOOT_MODE bits table 6-4 in UG585 are *out of order*.
|
||||
Jtag = 0b000,
|
||||
Nor = 0b001,
|
||||
Nand = 0b010,
|
||||
QuadSpi = 0b100,
|
||||
SdCard = 0b110,
|
||||
Nor = 0b010,
|
||||
Nand = 0b100,
|
||||
QuadSpi = 0b001,
|
||||
SdCard = 0b101,
|
||||
}
|
||||
|
||||
register!(boot_mode, BootMode, RO, u32);
|
||||
register_bit!(boot_mode, pll_bypass, 4);
|
||||
register_bits_typed!(boot_mode, boot_mode_pins, u8, BootModePins, 0, 3);
|
||||
register_bit!(boot_mode, jtag_routing, 3);
|
||||
register_bits_typed!(boot_mode, boot_mode_pins, u8, BootModePins, 0, 2);
|
||||
|
||||
register!(pss_rst_ctrl, PssRstCtrl, RW, u32);
|
||||
register_bit!(pss_rst_ctrl, soft_rst, 1);
|
||||
register_bit!(pss_rst_ctrl, soft_rst, 0);
|
||||
|
||||
/// Used for MioPin*.io_type
|
||||
#[repr(u8)]
|
||||
|
|
|
@ -1,5 +1,5 @@
|
|||
use core::ops::{Deref, DerefMut};
|
||||
use libcortex_a9::mutex::{Mutex, MutexGuard};
|
||||
use libcortex_a9::{asm, mutex::{Mutex, MutexGuard}};
|
||||
use crate::uart::Uart;
|
||||
|
||||
const UART_RATE: u32 = 115_200;
|
||||
|
@ -10,7 +10,15 @@ pub fn get_uart<'a>() -> MutexGuard<'a, LazyUart> {
|
|||
unsafe { UART.lock() }
|
||||
}
|
||||
|
||||
/// Deinitialize so that the Uart will be reinitialized on next
|
||||
/// output.
|
||||
///
|
||||
/// Delays so that an outstanding transmission can finish.
|
||||
pub fn drop_uart() {
|
||||
for _ in 0..1_000_000 {
|
||||
asm::nop();
|
||||
}
|
||||
|
||||
unsafe { UART = Mutex::new(LazyUart::Uninitialized); }
|
||||
}
|
||||
|
||||
|
@ -37,7 +45,10 @@ impl DerefMut for LazyUart {
|
|||
fn deref_mut(&mut self) -> &mut Uart {
|
||||
match self {
|
||||
LazyUart::Uninitialized => {
|
||||
let uart = Uart::serial(UART_RATE);
|
||||
#[cfg(any(feature = "target_coraz7", feature = "target_redpitaya"))]
|
||||
let uart = Uart::uart0(UART_RATE);
|
||||
#[cfg(any(feature = "target_zc706", feature = "target_kasli_soc"))]
|
||||
let uart = Uart::uart1(UART_RATE);
|
||||
*self = LazyUart::Initialized(uart);
|
||||
self
|
||||
}
|
||||
|
|
|
@ -8,3 +8,18 @@ impl core::ops::Add for Milliseconds {
|
|||
Milliseconds(self.0 + rhs.0)
|
||||
}
|
||||
}
|
||||
|
||||
#[derive(Debug, Clone, Copy, PartialEq, PartialOrd)]
|
||||
pub struct Microseconds(pub u64);
|
||||
|
||||
impl core::ops::Add for Microseconds {
|
||||
type Output = Self;
|
||||
|
||||
fn add(self, rhs: Self) -> Self::Output {
|
||||
Microseconds(self.0 + rhs.0)
|
||||
}
|
||||
}
|
||||
|
||||
pub trait TimeSource<U> {
|
||||
fn now(&self) -> U;
|
||||
}
|
||||
|
|
|
@ -1,9 +1,10 @@
|
|||
use core::ops::Add;
|
||||
use void::Void;
|
||||
use libregister::{RegisterR, RegisterW};
|
||||
use crate::{
|
||||
clocks::Clocks,
|
||||
mpcore,
|
||||
time::Milliseconds,
|
||||
time::{Milliseconds, Microseconds, TimeSource},
|
||||
};
|
||||
|
||||
/// "uptime"
|
||||
|
@ -15,13 +16,13 @@ pub struct GlobalTimer {
|
|||
impl GlobalTimer {
|
||||
/// Get the potentially uninitialized timer
|
||||
pub unsafe fn get() -> GlobalTimer {
|
||||
let regs = mpcore::RegisterBlock::new();
|
||||
let regs = mpcore::RegisterBlock::mpcore();
|
||||
GlobalTimer { regs }
|
||||
}
|
||||
|
||||
/// Get the timer with a reset
|
||||
pub fn start() -> GlobalTimer {
|
||||
let mut regs = mpcore::RegisterBlock::new();
|
||||
let mut regs = mpcore::RegisterBlock::mpcore();
|
||||
Self::reset(&mut regs);
|
||||
GlobalTimer { regs }
|
||||
}
|
||||
|
@ -79,41 +80,91 @@ impl GlobalTimer {
|
|||
}
|
||||
|
||||
/// read with high precision
|
||||
pub fn get_us(&self) -> u64 {
|
||||
pub fn get_us(&self) -> Microseconds {
|
||||
let prescaler = self.regs.global_timer_control.read().prescaler() as u64;
|
||||
let clocks = Clocks::get();
|
||||
|
||||
1_000_000 * self.get_counter() * (prescaler + 1) / clocks.cpu_3x2x() as u64
|
||||
Microseconds(1_000_000 * self.get_counter() * (prescaler + 1) / clocks.cpu_3x2x() as u64)
|
||||
}
|
||||
|
||||
/// return a handle that has implements
|
||||
/// `embedded_hal::timer::CountDown`
|
||||
pub fn countdown(&self) -> CountDown {
|
||||
pub fn countdown<U>(&self) -> CountDown<U>
|
||||
where
|
||||
Self: TimeSource<U>,
|
||||
{
|
||||
CountDown {
|
||||
timer: self.clone(),
|
||||
timeout: Milliseconds(0),
|
||||
timeout: self.now(),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[derive(Clone)]
|
||||
pub struct CountDown {
|
||||
timer: GlobalTimer,
|
||||
timeout: Milliseconds,
|
||||
impl TimeSource<Milliseconds> for GlobalTimer {
|
||||
fn now(&self) -> Milliseconds {
|
||||
self.get_time()
|
||||
}
|
||||
}
|
||||
|
||||
impl embedded_hal::timer::CountDown for CountDown {
|
||||
type Time = Milliseconds;
|
||||
impl TimeSource<Microseconds> for GlobalTimer {
|
||||
fn now(&self) -> Microseconds {
|
||||
self.get_us()
|
||||
}
|
||||
}
|
||||
|
||||
#[derive(Clone)]
|
||||
pub struct CountDown<U> {
|
||||
timer: GlobalTimer,
|
||||
timeout: U,
|
||||
}
|
||||
|
||||
/// embedded-hal async API
|
||||
impl<U: Add<Output=U> + PartialOrd> embedded_hal::timer::CountDown for CountDown<U>
|
||||
where
|
||||
GlobalTimer: TimeSource<U>,
|
||||
{
|
||||
type Time = U;
|
||||
|
||||
fn start<T: Into<Self::Time>>(&mut self, count: T) {
|
||||
self.timeout = self.timer.get_time() + count.into();
|
||||
self.timeout = self.timer.now() + count.into();
|
||||
}
|
||||
|
||||
fn wait(&mut self) -> nb::Result<(), Void> {
|
||||
if self.timer.get_time() < self.timeout {
|
||||
if self.timer.now() <= self.timeout {
|
||||
Err(nb::Error::WouldBlock)
|
||||
} else {
|
||||
Ok(())
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl<U: PartialOrd> CountDown<U>
|
||||
where
|
||||
GlobalTimer: TimeSource<U>,
|
||||
{
|
||||
pub fn waiting(&self) -> bool {
|
||||
self.timer.now() <= self.timeout
|
||||
}
|
||||
}
|
||||
|
||||
/// embedded-hal sync API
|
||||
impl embedded_hal::blocking::delay::DelayMs<u64> for GlobalTimer {
|
||||
fn delay_ms(&mut self, ms: u64) {
|
||||
use embedded_hal::timer::CountDown;
|
||||
|
||||
let mut countdown = self.countdown::<Milliseconds>();
|
||||
countdown.start(Milliseconds(ms));
|
||||
nb::block!(countdown.wait()).unwrap();
|
||||
}
|
||||
}
|
||||
|
||||
/// embedded-hal sync API
|
||||
impl embedded_hal::blocking::delay::DelayUs<u64> for GlobalTimer {
|
||||
fn delay_us(&mut self, us: u64) {
|
||||
use embedded_hal::timer::CountDown;
|
||||
|
||||
let mut countdown = self.countdown::<Microseconds>();
|
||||
countdown.start(Microseconds(us));
|
||||
nb::block!(countdown.wait()).unwrap();
|
||||
}
|
||||
}
|
||||
|
|
|
@ -13,31 +13,8 @@ pub struct Uart {
|
|||
}
|
||||
|
||||
impl Uart {
|
||||
#[cfg(feature = "target_zc706")]
|
||||
pub fn serial(baudrate: u32) -> Self {
|
||||
slcr::RegisterBlock::unlocked(|slcr| {
|
||||
// Route UART 1 RxD/TxD Signals to MIO Pins
|
||||
// TX pin
|
||||
slcr.mio_pin_48.write(
|
||||
slcr::MioPin48::zeroed()
|
||||
.l3_sel(0b111)
|
||||
.io_type(slcr::IoBufferType::Lvcmos18)
|
||||
.pullup(true)
|
||||
);
|
||||
// RX pin
|
||||
slcr.mio_pin_49.write(
|
||||
slcr::MioPin49::zeroed()
|
||||
.tri_enable(true)
|
||||
.l3_sel(0b111)
|
||||
.io_type(slcr::IoBufferType::Lvcmos18)
|
||||
.pullup(true)
|
||||
);
|
||||
});
|
||||
Self::uart1(baudrate)
|
||||
}
|
||||
|
||||
#[cfg(feature = "target_cora_z7_10")]
|
||||
pub fn serial(baudrate: u32) -> Self {
|
||||
#[cfg(any(feature = "target_coraz7", feature = "target_redpitaya"))]
|
||||
pub fn uart0(baudrate: u32) -> Self {
|
||||
slcr::RegisterBlock::unlocked(|slcr| {
|
||||
// Route UART 0 RxD/TxD Signals to MIO Pins
|
||||
// TX pin
|
||||
|
@ -56,10 +33,7 @@ impl Uart {
|
|||
.pullup(true)
|
||||
);
|
||||
});
|
||||
Self::uart0(baudrate)
|
||||
}
|
||||
|
||||
pub fn uart0(baudrate: u32) -> Self {
|
||||
slcr::RegisterBlock::unlocked(|slcr| {
|
||||
slcr.uart_rst_ctrl.reset_uart0();
|
||||
slcr.aper_clk_ctrl.enable_uart0();
|
||||
|
@ -72,7 +46,27 @@ impl Uart {
|
|||
self_
|
||||
}
|
||||
|
||||
#[cfg(any(feature = "target_zc706", feature = "target_kasli_soc"))]
|
||||
pub fn uart1(baudrate: u32) -> Self {
|
||||
slcr::RegisterBlock::unlocked(|slcr| {
|
||||
// Route UART 1 RxD/TxD Signals to MIO Pins
|
||||
// TX pin
|
||||
slcr.mio_pin_48.write(
|
||||
slcr::MioPin48::zeroed()
|
||||
.l3_sel(0b111)
|
||||
.io_type(slcr::IoBufferType::Lvcmos18)
|
||||
.pullup(true)
|
||||
);
|
||||
// RX pin
|
||||
slcr.mio_pin_49.write(
|
||||
slcr::MioPin49::zeroed()
|
||||
.tri_enable(true)
|
||||
.l3_sel(0b111)
|
||||
.io_type(slcr::IoBufferType::Lvcmos18)
|
||||
.pullup(true)
|
||||
);
|
||||
});
|
||||
|
||||
slcr::RegisterBlock::unlocked(|slcr| {
|
||||
slcr.uart_rst_ctrl.reset_uart1();
|
||||
slcr.aper_clk_ctrl.enable_uart1();
|
||||
|
|
|
@ -0,0 +1,19 @@
|
|||
[package]
|
||||
name = "libconfig"
|
||||
version = "0.1.0"
|
||||
authors = ["M-Labs"]
|
||||
edition = "2018"
|
||||
|
||||
[dependencies]
|
||||
libboard_zynq = { path = "../libboard_zynq" }
|
||||
core_io = { version = "0.1", features = ["collections"] }
|
||||
fatfs = { version = "0.3", features = ["core_io"], default-features = false }
|
||||
log = "0.4"
|
||||
|
||||
[features]
|
||||
target_zc706 = []
|
||||
target_coraz7 = []
|
||||
target_redpitaya = []
|
||||
target_kasli_soc = []
|
||||
ipv6 = []
|
||||
fat_lfn = [ "fatfs/alloc" ]
|
|
@ -0,0 +1,181 @@
|
|||
use alloc::vec::Vec;
|
||||
use core_io::{Error, Read, Seek, SeekFrom};
|
||||
use libboard_zynq::devc;
|
||||
use log::debug;
|
||||
|
||||
#[derive(Debug)]
|
||||
pub enum BootgenLoadingError {
|
||||
InvalidBootImageHeader,
|
||||
MissingPartition,
|
||||
EncryptedBitstream,
|
||||
IoError(Error),
|
||||
DevcError(devc::DevcError),
|
||||
}
|
||||
|
||||
impl From<Error> for BootgenLoadingError {
|
||||
fn from(error: Error) -> Self {
|
||||
BootgenLoadingError::IoError(error)
|
||||
}
|
||||
}
|
||||
|
||||
impl From<devc::DevcError> for BootgenLoadingError {
|
||||
fn from(error: devc::DevcError) -> Self {
|
||||
BootgenLoadingError::DevcError(error)
|
||||
}
|
||||
}
|
||||
|
||||
impl core::fmt::Display for BootgenLoadingError {
|
||||
fn fmt(&self, f: &mut core::fmt::Formatter<'_>) -> core::fmt::Result {
|
||||
use BootgenLoadingError::*;
|
||||
match self {
|
||||
InvalidBootImageHeader => write!(
|
||||
f,
|
||||
"Invalid boot image header. Check if the file is correct."
|
||||
),
|
||||
MissingPartition => write!(f, "Partition not found. Check your compile configuration."),
|
||||
EncryptedBitstream => write!(f, "Encrypted bitstream is not supported."),
|
||||
IoError(e) => write!(f, "Error while reading: {}", e),
|
||||
DevcError(e) => write!(f, "PCAP interface error: {}", e),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[repr(C)]
|
||||
struct PartitionHeader {
|
||||
pub encrypted_length: u32,
|
||||
pub unencrypted_length: u32,
|
||||
pub word_length: u32,
|
||||
pub dest_load_addr: u32,
|
||||
pub dest_exec_addr: u32,
|
||||
pub data_offset: u32,
|
||||
pub attribute_bits: u32,
|
||||
pub section_count: u32,
|
||||
pub checksum_offset: u32,
|
||||
pub header_offset: u32,
|
||||
pub cert_offset: u32,
|
||||
pub reserved: [u32; 4],
|
||||
pub checksum: u32,
|
||||
}
|
||||
|
||||
/// Read a u32 word from the reader.
|
||||
fn read_u32<Reader: Read>(reader: &mut Reader) -> Result<u32, BootgenLoadingError> {
|
||||
let mut buffer: [u8; 4] = [0; 4];
|
||||
reader.read_exact(&mut buffer)?;
|
||||
let mut result: u32 = 0;
|
||||
for i in 0..4 {
|
||||
result |= (buffer[i] as u32) << (i * 8);
|
||||
}
|
||||
Ok(result)
|
||||
}
|
||||
|
||||
/// Load PL partition header.
|
||||
fn load_pl_header<File: Read + Seek>(
|
||||
file: &mut File,
|
||||
) -> Result<Option<PartitionHeader>, BootgenLoadingError> {
|
||||
let mut buffer: [u8; 0x40] = [0; 0x40];
|
||||
file.read_exact(&mut buffer)?;
|
||||
let header = unsafe { core::mem::transmute::<_, PartitionHeader>(buffer) };
|
||||
if header.attribute_bits & (2 << 4) != 0 {
|
||||
Ok(Some(header))
|
||||
} else {
|
||||
Ok(None)
|
||||
}
|
||||
}
|
||||
|
||||
fn load_ps_header<File: Read + Seek>(
|
||||
file: &mut File,
|
||||
) -> Result<Option<PartitionHeader>, BootgenLoadingError> {
|
||||
let mut buffer: [u8; 0x40] = [0; 0x40];
|
||||
file.read_exact(&mut buffer)?;
|
||||
let header = unsafe { core::mem::transmute::<_, PartitionHeader>(buffer) };
|
||||
if header.attribute_bits & (1 << 4) != 0 {
|
||||
Ok(Some(header))
|
||||
} else {
|
||||
Ok(None)
|
||||
}
|
||||
}
|
||||
|
||||
/// Locate the partition from the image, and return the size (in bytes) of the partition if successful.
|
||||
/// This function would seek the file to the location of the partition.
|
||||
fn locate<
|
||||
File: Read + Seek,
|
||||
F: Fn(&mut File) -> Result<Option<PartitionHeader>, BootgenLoadingError>,
|
||||
>(
|
||||
file: &mut File,
|
||||
f: F,
|
||||
) -> Result<usize, BootgenLoadingError> {
|
||||
file.seek(SeekFrom::Start(0))?;
|
||||
const BOOT_HEADER_SIGN: u32 = 0x584C4E58;
|
||||
// read boot header signature
|
||||
file.seek(SeekFrom::Start(0x24))?;
|
||||
if read_u32(file)? != BOOT_HEADER_SIGN {
|
||||
return Err(BootgenLoadingError::InvalidBootImageHeader);
|
||||
}
|
||||
// find fsbl offset
|
||||
file.seek(SeekFrom::Start(0x30))?;
|
||||
// the length is in bytes, we have to convert it to words to compare with the partition offset
|
||||
// later
|
||||
let fsbl = read_u32(file)? / 4;
|
||||
// read partition header offset
|
||||
file.seek(SeekFrom::Start(0x9C))?;
|
||||
let ptr = read_u32(file)?;
|
||||
debug!("Partition header pointer = {:0X}", ptr);
|
||||
file.seek(SeekFrom::Start(ptr as u64))?;
|
||||
|
||||
// at most 3 partition headers
|
||||
for _ in 0..3 {
|
||||
if let Some(header) = f(file)? {
|
||||
let encrypted_length = header.encrypted_length;
|
||||
let unencrypted_length = header.unencrypted_length;
|
||||
debug!("Unencrypted length = {:0X}", unencrypted_length);
|
||||
if encrypted_length != unencrypted_length {
|
||||
return Err(BootgenLoadingError::EncryptedBitstream);
|
||||
}
|
||||
|
||||
let start_addr = header.data_offset;
|
||||
// skip fsbl
|
||||
if start_addr == fsbl {
|
||||
continue;
|
||||
}
|
||||
debug!("Partition start address: {:0X}", start_addr);
|
||||
file.seek(SeekFrom::Start(start_addr as u64 * 4))?;
|
||||
|
||||
return Ok(unencrypted_length as usize * 4);
|
||||
}
|
||||
}
|
||||
Err(BootgenLoadingError::MissingPartition)
|
||||
}
|
||||
|
||||
/// Load bitstream from bootgen file.
|
||||
/// This function parses the file, locate the bitstream and load it through the PCAP driver.
|
||||
/// It requires a large buffer, please enable the DDR RAM before using it.
|
||||
pub fn load_bitstream<File: Read + Seek>(file: &mut File) -> Result<(), BootgenLoadingError> {
|
||||
let size = locate(file, load_pl_header)?;
|
||||
unsafe {
|
||||
// align to 64 bytes
|
||||
let ptr = alloc::alloc::alloc(alloc::alloc::Layout::from_size_align(size, 64).unwrap());
|
||||
let buffer = core::slice::from_raw_parts_mut(ptr, size);
|
||||
file.read_exact(buffer).map_err(|e| {
|
||||
core::ptr::drop_in_place(ptr);
|
||||
e
|
||||
})?;
|
||||
let mut devcfg = devc::DevC::new();
|
||||
devcfg.enable();
|
||||
devcfg.program(&buffer).map_err(|e| {
|
||||
core::ptr::drop_in_place(ptr);
|
||||
e
|
||||
})?;
|
||||
core::ptr::drop_in_place(ptr);
|
||||
Ok(())
|
||||
}
|
||||
}
|
||||
|
||||
pub fn get_runtime<File: Read + Seek>(file: &mut File) -> Result<Vec<u8>, BootgenLoadingError> {
|
||||
let size = locate(file, load_ps_header)?;
|
||||
let mut buffer = Vec::with_capacity(size);
|
||||
unsafe {
|
||||
buffer.set_len(size);
|
||||
}
|
||||
file.read_exact(&mut buffer)?;
|
||||
Ok(buffer)
|
||||
}
|
|
@ -0,0 +1,174 @@
|
|||
#![no_std]
|
||||
extern crate alloc;
|
||||
|
||||
use core::fmt;
|
||||
use alloc::{string::FromUtf8Error, string::String, vec::Vec, rc::Rc};
|
||||
use core_io::{self as io, BufRead, BufReader, Read, Write, Seek, SeekFrom};
|
||||
use libboard_zynq::sdio;
|
||||
|
||||
pub mod sd_reader;
|
||||
pub mod net_settings;
|
||||
pub mod bootgen;
|
||||
|
||||
#[derive(Debug)]
|
||||
pub enum Error<'a> {
|
||||
SdError(sdio::sd_card::CardInitializationError),
|
||||
IoError(io::Error),
|
||||
Utf8Error(FromUtf8Error),
|
||||
KeyNotFoundError(&'a str),
|
||||
NoConfig,
|
||||
}
|
||||
|
||||
pub type Result<'a, T> = core::result::Result<T, Error<'a>>;
|
||||
|
||||
impl<'a> fmt::Display for Error<'a> {
|
||||
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
|
||||
match self {
|
||||
Error::SdError(error) => write!(f, "SD error: {}", error),
|
||||
Error::IoError(error) => write!(f, "I/O error: {}", error),
|
||||
Error::Utf8Error(error) => write!(f, "UTF-8 error: {}", error),
|
||||
Error::KeyNotFoundError(name) => write!(f, "Configuration key `{}` not found", name),
|
||||
Error::NoConfig => write!(f, "Configuration not present"),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl<'a> From<sdio::sd_card::CardInitializationError> for Error<'a> {
|
||||
fn from(error: sdio::sd_card::CardInitializationError) -> Self {
|
||||
Error::SdError(error)
|
||||
}
|
||||
}
|
||||
|
||||
impl<'a> From<io::Error> for Error<'a> {
|
||||
fn from(error: io::Error) -> Self {
|
||||
Error::IoError(error)
|
||||
}
|
||||
}
|
||||
|
||||
impl<'a> From<FromUtf8Error> for Error<'a> {
|
||||
fn from(error: FromUtf8Error) -> Self {
|
||||
Error::Utf8Error(error)
|
||||
}
|
||||
}
|
||||
|
||||
fn parse_config<'a>(
|
||||
key: &'a str,
|
||||
buffer: &mut Vec<u8>,
|
||||
file: fatfs::File<sd_reader::SdReader>,
|
||||
) -> Result<'a, ()> {
|
||||
let prefix = [key, "="].concat().to_ascii_lowercase();
|
||||
for line in BufReader::new(file).lines() {
|
||||
let line = line?.to_ascii_lowercase();
|
||||
if line.starts_with(&prefix) {
|
||||
buffer.extend(line[prefix.len()..].as_bytes());
|
||||
return Ok(());
|
||||
}
|
||||
}
|
||||
Err(Error::KeyNotFoundError(key))
|
||||
}
|
||||
|
||||
pub struct Config {
|
||||
fs: Option<Rc<fatfs::FileSystem<sd_reader::SdReader>>>,
|
||||
}
|
||||
|
||||
const NEWLINE: &[u8] = b"\n";
|
||||
|
||||
impl Config {
|
||||
pub fn new() -> Result<'static, Self> {
|
||||
let sdio = sdio::Sdio::sdio0(true);
|
||||
if !sdio.is_card_inserted() {
|
||||
Err(sdio::sd_card::CardInitializationError::NoCardInserted)?;
|
||||
}
|
||||
let sd = sdio::sd_card::SdCard::from_sdio(sdio)?;
|
||||
let reader = sd_reader::SdReader::new(sd);
|
||||
|
||||
let fs = reader.mount_fatfs(sd_reader::PartitionEntry::Entry1)?;
|
||||
Ok(Config { fs: Some(Rc::new(fs)) })
|
||||
}
|
||||
|
||||
pub fn from_fs(fs: Option<Rc<fatfs::FileSystem<sd_reader::SdReader>>>) -> Self {
|
||||
Config { fs }
|
||||
}
|
||||
|
||||
pub fn new_dummy() -> Self {
|
||||
Config { fs: None }
|
||||
}
|
||||
|
||||
pub fn read<'b>(&self, key: &'b str) -> Result<'b, Vec<u8>> {
|
||||
if let Some(fs) = &self.fs {
|
||||
let root_dir = fs.root_dir();
|
||||
let mut buffer: Vec<u8> = Vec::new();
|
||||
match root_dir.open_file(&["/CONFIG/", key, ".BIN"].concat()) {
|
||||
Ok(mut f) => f.read_to_end(&mut buffer).map(|_| ())?,
|
||||
Err(_) => match root_dir.open_file("/CONFIG.TXT") {
|
||||
Ok(f) => parse_config(key, &mut buffer, f)?,
|
||||
Err(_) => return Err(Error::KeyNotFoundError(key)),
|
||||
},
|
||||
};
|
||||
Ok(buffer)
|
||||
} else {
|
||||
Err(Error::NoConfig)
|
||||
}
|
||||
}
|
||||
|
||||
pub fn read_str<'b>(&self, key: &'b str) -> Result<'b, String> {
|
||||
Ok(String::from_utf8(self.read(key)?)?)
|
||||
}
|
||||
|
||||
pub fn remove<'b>(&self, key: &'b str) -> Result<'b, ()> {
|
||||
if let Some(fs) = &self.fs {
|
||||
let root_dir = fs.root_dir();
|
||||
match root_dir.remove(&["/CONFIG/", key, ".BIN"].concat()) {
|
||||
Ok(()) => Ok(()),
|
||||
Err(_) => {
|
||||
let prefix = [key, "="].concat().to_ascii_lowercase();
|
||||
match root_dir.create_file("/CONFIG.TXT") {
|
||||
Ok(mut f) => {
|
||||
let mut buffer = String::new();
|
||||
f.read_to_string(&mut buffer)?;
|
||||
f.seek(SeekFrom::Start(0))?;
|
||||
f.truncate()?;
|
||||
for line in buffer.lines() {
|
||||
if line.len() > 0 && !line.to_ascii_lowercase().starts_with(&prefix) {
|
||||
f.write(line.as_bytes())?;
|
||||
f.write(NEWLINE)?;
|
||||
}
|
||||
}
|
||||
Ok(())
|
||||
},
|
||||
Err(_) => Err(Error::KeyNotFoundError(key))
|
||||
}
|
||||
}
|
||||
}
|
||||
} else {
|
||||
Err(Error::NoConfig)
|
||||
}
|
||||
}
|
||||
|
||||
pub fn write<'b>(&self, key: &'b str, value: Vec<u8>) -> Result<'b, ()> {
|
||||
if self.fs.is_none() {
|
||||
return Err(Error::NoConfig);
|
||||
}
|
||||
let fs = self.fs.as_ref().unwrap();
|
||||
let root_dir = fs.root_dir();
|
||||
let is_str = value.len() <= 100 && value.is_ascii() && !value.contains(&b'\n');
|
||||
if key == "boot" {
|
||||
let mut f = root_dir.create_file("/BOOT.BIN")?;
|
||||
f.truncate()?;
|
||||
f.write_all(&value)?;
|
||||
drop(f);
|
||||
} else {
|
||||
let _ = self.remove(key);
|
||||
if is_str {
|
||||
let mut f = root_dir.create_file("/CONFIG.TXT")?;
|
||||
f.seek(SeekFrom::End(0))?;
|
||||
write!(f, "{}={}\n", key, String::from_utf8(value).unwrap())?;
|
||||
} else {
|
||||
let dir = root_dir.create_dir("/CONFIG")?;
|
||||
let mut f = dir.create_file(&[key, ".BIN"].concat())?;
|
||||
f.write_all(&value)?;
|
||||
}
|
||||
}
|
||||
Ok(())
|
||||
}
|
||||
}
|
|
@ -0,0 +1,88 @@
|
|||
use core::fmt;
|
||||
|
||||
use libboard_zynq::smoltcp::wire::{EthernetAddress, IpAddress};
|
||||
|
||||
use super::Config;
|
||||
|
||||
pub struct NetAddresses {
|
||||
pub hardware_addr: EthernetAddress,
|
||||
pub ipv4_addr: IpAddress,
|
||||
#[cfg(feature = "ipv6")]
|
||||
pub ipv6_ll_addr: IpAddress,
|
||||
#[cfg(feature = "ipv6")]
|
||||
pub ipv6_addr: Option<IpAddress>
|
||||
}
|
||||
|
||||
impl fmt::Display for NetAddresses {
|
||||
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
|
||||
write!(f, "MAC={} IPv4={} ",
|
||||
self.hardware_addr, self.ipv4_addr)?;
|
||||
|
||||
#[cfg(feature = "ipv6")]
|
||||
{
|
||||
write!(f, "IPv6-LL={}", self.ipv6_ll_addr)?;
|
||||
match self.ipv6_addr {
|
||||
Some(addr) => write!(f, " {}", addr)?,
|
||||
None => write!(f, " IPv6: no configured address")?
|
||||
}
|
||||
}
|
||||
Ok(())
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(feature = "target_kasli_soc")]
|
||||
fn get_address_from_eeprom() -> EthernetAddress {
|
||||
use libboard_zynq::i2c::{I2c, eeprom};
|
||||
|
||||
let mut i2c = I2c::i2c0();
|
||||
i2c.init().unwrap();
|
||||
let mut eeprom = eeprom::EEPROM::new(&mut i2c, 16);
|
||||
let address = eeprom.read_eui48().unwrap_or([0x02, 0x00, 0x00, 0x00, 0x00, 0x56]);
|
||||
|
||||
EthernetAddress(address)
|
||||
}
|
||||
|
||||
pub fn get_addresses(cfg: &Config) -> NetAddresses {
|
||||
#[cfg(feature = "target_zc706")]
|
||||
let mut hardware_addr = EthernetAddress([0x02, 0x00, 0x00, 0x00, 0x00, 0x52]);
|
||||
#[cfg(feature = "target_zc706")]
|
||||
let mut ipv4_addr = IpAddress::v4(192, 168, 1, 52);
|
||||
#[cfg(feature = "target_coraz7")]
|
||||
let mut hardware_addr = EthernetAddress([0x02, 0x00, 0x00, 0x00, 0x00, 0x54]);
|
||||
#[cfg(feature = "target_coraz7")]
|
||||
let mut ipv4_addr = IpAddress::v4(192, 168, 1, 54);
|
||||
#[cfg(feature = "target_redpitaya")]
|
||||
let mut hardware_addr = EthernetAddress([0x02, 0x00, 0x00, 0x00, 0x00, 0x55]);
|
||||
#[cfg(feature = "target_redpitaya")]
|
||||
let mut ipv4_addr = IpAddress::v4(192, 168, 1, 55);
|
||||
#[cfg(feature = "target_kasli_soc")]
|
||||
let mut hardware_addr = get_address_from_eeprom();
|
||||
#[cfg(feature = "target_kasli_soc")]
|
||||
let mut ipv4_addr = IpAddress::v4(192, 168, 1, 56);
|
||||
|
||||
if let Ok(Ok(addr)) = cfg.read_str("mac").map(|s| s.parse()) {
|
||||
hardware_addr = addr;
|
||||
}
|
||||
if let Ok(Ok(addr)) = cfg.read_str("ip").map(|s| s.parse()) {
|
||||
ipv4_addr = addr;
|
||||
}
|
||||
#[cfg(feature = "ipv6")]
|
||||
let ipv6_addr = cfg.read_str("ip6").ok().and_then(|s| s.parse().ok());
|
||||
|
||||
#[cfg(feature = "ipv6")]
|
||||
let ipv6_ll_addr = IpAddress::v6(
|
||||
0xfe80, 0x0000, 0x0000, 0x0000,
|
||||
(((hardware_addr.0[0] ^ 0x02) as u16) << 8) | (hardware_addr.0[1] as u16),
|
||||
((hardware_addr.0[2] as u16) << 8) | 0x00ff,
|
||||
0xfe00 | (hardware_addr.0[3] as u16),
|
||||
((hardware_addr.0[4] as u16) << 8) | (hardware_addr.0[5] as u16));
|
||||
|
||||
NetAddresses {
|
||||
hardware_addr,
|
||||
ipv4_addr,
|
||||
#[cfg(feature = "ipv6")]
|
||||
ipv6_ll_addr,
|
||||
#[cfg(feature = "ipv6")]
|
||||
ipv6_addr
|
||||
}
|
||||
}
|
|
@ -0,0 +1,304 @@
|
|||
use core_io::{BufRead, Error, ErrorKind, Read, Result as IoResult, Seek, SeekFrom, Write};
|
||||
use fatfs;
|
||||
use libboard_zynq::sdio::{sd_card::SdCard, CmdTransferError};
|
||||
use log::debug;
|
||||
use alloc::vec::Vec;
|
||||
|
||||
const MBR_SIGNATURE: [u8; 2] = [0x55, 0xAA];
|
||||
const PARTID_FAT12: u8 = 0x01;
|
||||
const PARTID_FAT16_LESS32M: u8 = 0x04;
|
||||
const PARTID_FAT16: u8 = 0x06;
|
||||
const PARTID_FAT32: u8 = 0x0B;
|
||||
const PARTID_FAT32_LBA: u8 = 0x0C;
|
||||
const PARTID_FAT16_LBA: u8 = 0x0E;
|
||||
|
||||
fn cmd_error_to_io_error(_: CmdTransferError) -> Error {
|
||||
Error::new(ErrorKind::Other, "Command transfer error")
|
||||
}
|
||||
|
||||
const BLOCK_SIZE: usize = 512;
|
||||
|
||||
/// SdReader struct implementing `Read + BufRead + Write + Seek` traits for `core_io`.
|
||||
/// Used as an adaptor for fatfs crate, but could be used directly for raw data access.
|
||||
///
|
||||
/// Implementation: all read/writes would be split into unaligned and block-aligned parts,
|
||||
/// unaligned read/writes would do a buffered read/write using a block-sized internal buffer,
|
||||
/// while aligned transactions would be sent to the SD card directly for performance reason.
|
||||
pub struct SdReader {
|
||||
/// Internal SdCard handle.
|
||||
sd: SdCard,
|
||||
/// Read buffer with the size of 1 block.
|
||||
buffer: Vec<u8>,
|
||||
/// Address for the next byte.
|
||||
byte_addr: u32,
|
||||
/// Internal index for the next byte.
|
||||
/// Normally in range `[0, BLOCK_SIZE - 1]`.
|
||||
///
|
||||
/// `index = BLOCK_SIZE` means that the `buffer` is invalid for the current `byte_addr`,
|
||||
/// the next `fill_buf` call would fill the buffer.
|
||||
index: usize,
|
||||
/// Dirty flag indicating the content has to be flushed.
|
||||
dirty: bool,
|
||||
/// Base offset for translation from logical address to physical address.
|
||||
offset: u32,
|
||||
}
|
||||
|
||||
#[derive(Copy, Clone)]
|
||||
#[allow(unused)]
|
||||
// Partition entry enum, normally we would use entry1.
|
||||
pub enum PartitionEntry {
|
||||
Entry1 = 0x1BE,
|
||||
Entry2 = 0x1CE,
|
||||
Entry3 = 0x1DE,
|
||||
Entry4 = 0x1EE,
|
||||
}
|
||||
|
||||
impl SdReader {
|
||||
/// Create SdReader from SdCard
|
||||
pub fn new(sd: SdCard) -> SdReader {
|
||||
let mut vec: Vec<u8> = Vec::with_capacity(BLOCK_SIZE);
|
||||
unsafe {
|
||||
vec.set_len(vec.capacity());
|
||||
}
|
||||
SdReader {
|
||||
sd,
|
||||
buffer: vec,
|
||||
byte_addr: 0,
|
||||
index: BLOCK_SIZE,
|
||||
dirty: false,
|
||||
offset: 0,
|
||||
}
|
||||
}
|
||||
|
||||
/// Internal read function for unaligned read.
|
||||
/// The read must not cross block boundary.
|
||||
fn read_unaligned(&mut self, buf: &mut [u8]) -> IoResult<usize> {
|
||||
if buf.len() == 0 {
|
||||
return Ok(0);
|
||||
}
|
||||
let filled_buffer = self.fill_buf()?;
|
||||
for (dest, src) in buf.iter_mut().zip(filled_buffer.iter()) {
|
||||
*dest = *src;
|
||||
}
|
||||
self.consume(buf.len());
|
||||
Ok(buf.len())
|
||||
}
|
||||
|
||||
/// Internal write function for unaligned write.
|
||||
/// The write must not cross block boundary.
|
||||
fn write_unaligned(&mut self, buf: &[u8]) -> IoResult<usize> {
|
||||
if buf.len() == 0 {
|
||||
return Ok(0);
|
||||
}
|
||||
// update buffer if needed, as we will flush the entire block later.
|
||||
self.fill_buf()?;
|
||||
self.dirty = true;
|
||||
let dest_buffer = &mut self.buffer[self.index..];
|
||||
for (src, dest) in buf.iter().zip(dest_buffer.iter_mut()) {
|
||||
*dest = *src;
|
||||
}
|
||||
self.consume(buf.len());
|
||||
Ok(buf.len())
|
||||
}
|
||||
|
||||
/// Split the slice into three segments, with the middle block-aligned.
|
||||
/// Alignment depends on the current `self.byte_addr` instead of the slice pointer address
|
||||
fn block_align<'b>(&self, buf: &'b [u8]) -> (&'b [u8], &'b [u8], &'b [u8]) {
|
||||
let head_len = BLOCK_SIZE - (self.byte_addr as usize % BLOCK_SIZE);
|
||||
if head_len > buf.len() {
|
||||
(buf, &[], &[])
|
||||
} else {
|
||||
let remaining_length = buf.len() - head_len;
|
||||
let mid_length = remaining_length - remaining_length % BLOCK_SIZE;
|
||||
let (head, remaining) = buf.split_at(head_len);
|
||||
let (mid, tail) = remaining.split_at(mid_length);
|
||||
(head, mid, tail)
|
||||
}
|
||||
}
|
||||
|
||||
/// Split the mutable slice into three segments, with the middle block-aligned.
|
||||
/// Alignment depends on the current `self.byte_addr` instead of the slice pointer address
|
||||
fn block_align_mut<'b>(&self, buf: &'b mut [u8]) -> (&'b mut [u8], &'b mut [u8], &'b mut [u8]) {
|
||||
let head_len = BLOCK_SIZE - (self.byte_addr as usize % BLOCK_SIZE);
|
||||
if head_len > buf.len() {
|
||||
(buf, &mut [], &mut [])
|
||||
} else {
|
||||
let remaining_length = buf.len() - head_len;
|
||||
let mid_length = remaining_length - remaining_length % BLOCK_SIZE;
|
||||
let (head, remaining) = buf.split_at_mut(head_len);
|
||||
let (mid, tail) = remaining.split_at_mut(mid_length);
|
||||
(head, mid, tail)
|
||||
}
|
||||
}
|
||||
|
||||
/// Invalidate the buffer, so later unaligned read/write would reload the buffer from SD card.
|
||||
fn invalidate_buffer(&mut self) {
|
||||
self.index = BLOCK_SIZE;
|
||||
}
|
||||
|
||||
/// Set the base offset of the SD card, to transform from physical address to logical address.
|
||||
fn set_base_offset(&mut self, offset: u32) -> IoResult<u64> {
|
||||
self.offset = offset;
|
||||
self.seek(SeekFrom::Start(0))
|
||||
}
|
||||
|
||||
/// Mount fatfs from partition entry, and return the fatfs object if success.
|
||||
/// This takes the ownership of self, so currently there is no way to recover from an error,
|
||||
/// except creating a new SD card instance.
|
||||
pub fn mount_fatfs(mut self, entry: PartitionEntry) -> IoResult<fatfs::FileSystem<Self>> {
|
||||
let mut buffer: [u8; 4] = [0; 4];
|
||||
self.seek(SeekFrom::Start(0x1FE))?;
|
||||
self.read_exact(&mut buffer[..2])?;
|
||||
// check MBR signature
|
||||
if buffer[..2] != MBR_SIGNATURE {
|
||||
return Err(Error::new(
|
||||
ErrorKind::InvalidData,
|
||||
"Incorrect signature for MBR sector.",
|
||||
));
|
||||
}
|
||||
// Read partition ID.
|
||||
self.seek(SeekFrom::Start(entry as u64 + 0x4))?;
|
||||
self.read_exact(&mut buffer[..1])?;
|
||||
debug!("Partition ID: {:0X}", buffer[0]);
|
||||
match buffer[0] {
|
||||
PARTID_FAT12 | PARTID_FAT16_LESS32M | PARTID_FAT16 |
|
||||
PARTID_FAT16_LBA | PARTID_FAT32 | PARTID_FAT32_LBA => {}
|
||||
_ => {
|
||||
return Err(Error::new(
|
||||
ErrorKind::InvalidData,
|
||||
"No FAT partition found for the specified entry.",
|
||||
));
|
||||
}
|
||||
}
|
||||
// Read LBA
|
||||
self.seek(SeekFrom::Current(0x3))?;
|
||||
self.read_exact(&mut buffer)?;
|
||||
let mut lba: u32 = 0;
|
||||
// Little endian
|
||||
for i in 0..4 {
|
||||
lba |= (buffer[i] as u32) << (i * 8);
|
||||
}
|
||||
// Set to logical address
|
||||
self.set_base_offset(lba * BLOCK_SIZE as u32)?;
|
||||
// setup fatfs
|
||||
fatfs::FileSystem::new(self, fatfs::FsOptions::new())
|
||||
}
|
||||
}
|
||||
|
||||
impl Read for SdReader {
|
||||
fn read(&mut self, buf: &mut [u8]) -> IoResult<usize> {
|
||||
let total_length = buf.len();
|
||||
let (a, b, c) = self.block_align_mut(buf);
|
||||
self.read_unaligned(a)?;
|
||||
if b.len() > 0 {
|
||||
// invalidate internal buffer
|
||||
self.invalidate_buffer();
|
||||
if let Err(_) = self.sd.read_block(
|
||||
self.byte_addr / BLOCK_SIZE as u32,
|
||||
(b.len() / BLOCK_SIZE) as u16,
|
||||
b,
|
||||
) {
|
||||
// we have to allow partial read, as per the trait required
|
||||
return Ok(a.len());
|
||||
}
|
||||
self.byte_addr += b.len() as u32;
|
||||
}
|
||||
if let Err(_) = self.read_unaligned(c) {
|
||||
// we have to allow partial read, as per the trait required
|
||||
return Ok(a.len() + b.len());
|
||||
}
|
||||
Ok(total_length)
|
||||
}
|
||||
}
|
||||
|
||||
impl BufRead for SdReader {
|
||||
fn fill_buf(&mut self) -> IoResult<&[u8]> {
|
||||
if self.index == BLOCK_SIZE {
|
||||
// flush the buffer if it is dirty before overwriting it with new data
|
||||
if self.dirty {
|
||||
self.flush()?;
|
||||
}
|
||||
// reload buffer
|
||||
self.sd
|
||||
.read_block(self.byte_addr / (BLOCK_SIZE as u32), 1, &mut self.buffer)
|
||||
.map_err(cmd_error_to_io_error)?;
|
||||
self.index = (self.byte_addr as usize) % BLOCK_SIZE;
|
||||
}
|
||||
Ok(&self.buffer[self.index..])
|
||||
}
|
||||
|
||||
fn consume(&mut self, amt: usize) {
|
||||
self.index += amt;
|
||||
self.byte_addr += amt as u32;
|
||||
}
|
||||
}
|
||||
|
||||
impl Write for SdReader {
|
||||
fn write(&mut self, buf: &[u8]) -> IoResult<usize> {
|
||||
let (a, b, c) = self.block_align(buf);
|
||||
self.write_unaligned(a)?;
|
||||
if b.len() > 0 {
|
||||
self.flush()?;
|
||||
self.invalidate_buffer();
|
||||
if let Err(_) = self.sd.write_block(
|
||||
self.byte_addr / BLOCK_SIZE as u32,
|
||||
(b.len() / BLOCK_SIZE) as u16,
|
||||
b,
|
||||
) {
|
||||
return Ok(a.len());
|
||||
}
|
||||
self.byte_addr += b.len() as u32;
|
||||
}
|
||||
if let Err(_) = self.write_unaligned(c) {
|
||||
return Ok(a.len() + b.len());
|
||||
}
|
||||
Ok(buf.len())
|
||||
}
|
||||
|
||||
fn flush(&mut self) -> IoResult<()> {
|
||||
if self.dirty {
|
||||
let block_addr = (self.byte_addr - self.index as u32) / (BLOCK_SIZE as u32);
|
||||
self.sd
|
||||
.write_block(block_addr, 1, &self.buffer)
|
||||
.map_err(cmd_error_to_io_error)?;
|
||||
self.dirty = false;
|
||||
}
|
||||
Ok(())
|
||||
}
|
||||
}
|
||||
|
||||
impl Seek for SdReader {
|
||||
fn seek(&mut self, pos: SeekFrom) -> IoResult<u64> {
|
||||
let raw_target = match pos {
|
||||
SeekFrom::Start(x) => self.offset as i64 + x as i64,
|
||||
SeekFrom::Current(x) => self.byte_addr as i64 + x,
|
||||
SeekFrom::End(_) => panic!("SD card does not support seek from end"),
|
||||
};
|
||||
if raw_target < self.offset as i64 || raw_target > core::u32::MAX as i64 {
|
||||
return Err(Error::new(ErrorKind::InvalidInput, "Invalid address"));
|
||||
}
|
||||
let target_byte_addr = raw_target as u32;
|
||||
let address_same_block =
|
||||
self.byte_addr / (BLOCK_SIZE as u32) == target_byte_addr / (BLOCK_SIZE as u32);
|
||||
// if the buffer was invalidated, we consider seek as different block
|
||||
let same_block = address_same_block && self.index != BLOCK_SIZE;
|
||||
if !same_block {
|
||||
self.flush()?;
|
||||
}
|
||||
self.byte_addr = target_byte_addr;
|
||||
self.index = if same_block {
|
||||
target_byte_addr as usize % BLOCK_SIZE
|
||||
} else {
|
||||
// invalidate the buffer as we moved to a different block
|
||||
BLOCK_SIZE
|
||||
};
|
||||
Ok((self.byte_addr - self.offset) as u64)
|
||||
}
|
||||
}
|
||||
|
||||
impl Drop for SdReader {
|
||||
fn drop(&mut self) {
|
||||
// just try to flush it, ignore error if any
|
||||
self.flush().unwrap_or(());
|
||||
}
|
||||
}
|
|
@ -1,14 +1,14 @@
|
|||
[package]
|
||||
name = "libcortex_a9"
|
||||
version = "0.0.0"
|
||||
authors = ["Astro <astro@spaceboyz.net>"]
|
||||
authors = ["M-Labs"]
|
||||
edition = "2018"
|
||||
|
||||
[features]
|
||||
target_zc706 = []
|
||||
target_cora_z7_10 = []
|
||||
default = ["target_zc706"]
|
||||
power_saving = []
|
||||
default = []
|
||||
|
||||
[dependencies]
|
||||
bit_field = "0.10"
|
||||
volatile-register = "0.2"
|
||||
libregister = { path = "../libregister" }
|
||||
|
|
|
@ -33,3 +33,50 @@ pub fn dsb() {
|
|||
pub fn isb() {
|
||||
unsafe { llvm_asm!("isb" :::: "volatile") }
|
||||
}
|
||||
|
||||
/// Enable FIQ
|
||||
#[inline]
|
||||
pub unsafe fn enable_fiq() {
|
||||
llvm_asm!("cpsie f":::: "volatile");
|
||||
}
|
||||
|
||||
/// Enable IRQ
|
||||
#[inline]
|
||||
pub unsafe fn enable_irq() {
|
||||
llvm_asm!("cpsie i":::: "volatile");
|
||||
}
|
||||
|
||||
/// Disable IRQ, return if IRQ was originally enabled.
|
||||
#[inline]
|
||||
pub unsafe fn enter_critical() -> bool {
|
||||
let mut cpsr: u32;
|
||||
llvm_asm!(
|
||||
"mrs $0, cpsr
|
||||
cpsid i"
|
||||
: "=r"(cpsr) ::: "volatile");
|
||||
(cpsr & (1 << 7)) == 0
|
||||
}
|
||||
|
||||
#[inline]
|
||||
pub unsafe fn exit_critical(enable: bool) {
|
||||
// https://stackoverflow.com/questions/40019929/temporarily-disable-interrupts-on-arm
|
||||
let mask: u32 = if enable {
|
||||
1 << 7
|
||||
} else {
|
||||
0
|
||||
};
|
||||
llvm_asm!(
|
||||
"mrs r1, cpsr
|
||||
bic r1, r1, $0
|
||||
msr cpsr_c, r1"
|
||||
:: "r"(mask) : "r1");
|
||||
}
|
||||
|
||||
/// Exiting IRQ
|
||||
#[inline]
|
||||
pub unsafe fn exit_irq() {
|
||||
llvm_asm!("
|
||||
mrs r0, SPSR
|
||||
msr CPSR, r0
|
||||
" ::: "r0");
|
||||
}
|
||||
|
|
|
@ -1,4 +1,5 @@
|
|||
use super::asm::{dmb, dsb};
|
||||
use super::l2c::*;
|
||||
|
||||
/// Invalidate TLBs
|
||||
#[inline(always)]
|
||||
|
@ -44,9 +45,17 @@ pub fn dcisw(setway: u32) {
|
|||
}
|
||||
}
|
||||
|
||||
/// Data cache clean by set/way
|
||||
#[inline(always)]
|
||||
pub fn dccisw(setway: u32) {
|
||||
unsafe {
|
||||
llvm_asm!("mcr p15, 0, $0, c7, c14, 2" :: "r" (setway) :: "volatile");
|
||||
}
|
||||
}
|
||||
|
||||
/// A made-up "instruction": invalidate all of the L1 D-Cache
|
||||
#[inline(always)]
|
||||
pub fn dciall() {
|
||||
pub fn dciall_l1() {
|
||||
// the cache associativity could be read from a register, but will
|
||||
// always be 4 in L1 data cache of a cortex a9
|
||||
let ways = 4;
|
||||
|
@ -71,6 +80,50 @@ pub fn dciall() {
|
|||
}
|
||||
}
|
||||
|
||||
/// A made-up "instruction": invalidate all of the L1 L2 D-Cache
|
||||
#[inline(always)]
|
||||
pub fn dciall() {
|
||||
dmb();
|
||||
l2_cache_invalidate_all();
|
||||
dciall_l1();
|
||||
}
|
||||
|
||||
/// A made-up "instruction": flush and invalidate all of the L1 D-Cache
|
||||
#[inline(always)]
|
||||
pub fn dcciall_l1() {
|
||||
// the cache associativity could be read from a register, but will
|
||||
// always be 4 in L1 data cache of a cortex a9
|
||||
let ways = 4;
|
||||
let bit_pos_of_way = 30; // 32 - log2(ways)
|
||||
|
||||
// the cache sets could be read from a register, but are always
|
||||
// 256 for the cores in the zync-7000; in general, 128 or 512 are
|
||||
// also possible.
|
||||
let sets = 256;
|
||||
let bit_pos_of_set = 5; // for a line size of 8 words = 2^5 bytes
|
||||
|
||||
// select L1 data cache
|
||||
unsafe {
|
||||
llvm_asm!("mcr p15, 2, $0, c0, c0, 0" :: "r" (0) :: "volatile");
|
||||
}
|
||||
|
||||
// Invalidate entire D-Cache by iterating every set and every way
|
||||
for set in 0..sets {
|
||||
for way in 0..ways {
|
||||
dccisw((set << bit_pos_of_set) | (way << bit_pos_of_way));
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[inline(always)]
|
||||
pub fn dcciall() {
|
||||
dmb();
|
||||
dcciall_l1();
|
||||
dsb();
|
||||
l2_cache_clean_invalidate_all();
|
||||
dcciall_l1();
|
||||
dsb();
|
||||
}
|
||||
|
||||
const CACHE_LINE: usize = 0x20;
|
||||
const CACHE_LINE_MASK: usize = CACHE_LINE - 1;
|
||||
|
@ -109,7 +162,16 @@ pub fn dccimvac(addr: usize) {
|
|||
|
||||
/// Data cache clean and invalidate for an object.
|
||||
pub fn dcci<T>(object: &T) {
|
||||
// ref: L2C310 TRM 3.3.10
|
||||
dmb();
|
||||
for addr in object_cache_line_addrs(object) {
|
||||
dccmvac(addr);
|
||||
}
|
||||
dsb();
|
||||
for addr in object_cache_line_addrs(object) {
|
||||
l2_cache_clean_invalidate(addr);
|
||||
}
|
||||
l2_cache_sync();
|
||||
for addr in object_cache_line_addrs(object) {
|
||||
dccimvac(addr);
|
||||
}
|
||||
|
@ -118,6 +180,14 @@ pub fn dcci<T>(object: &T) {
|
|||
|
||||
pub fn dcci_slice<T>(slice: &[T]) {
|
||||
dmb();
|
||||
for addr in slice_cache_line_addrs(slice) {
|
||||
dccmvac(addr);
|
||||
}
|
||||
dsb();
|
||||
for addr in slice_cache_line_addrs(slice) {
|
||||
l2_cache_clean_invalidate(addr);
|
||||
}
|
||||
l2_cache_sync();
|
||||
for addr in slice_cache_line_addrs(slice) {
|
||||
dccimvac(addr);
|
||||
}
|
||||
|
@ -139,17 +209,28 @@ pub fn dcc<T>(object: &T) {
|
|||
dccmvac(addr);
|
||||
}
|
||||
dsb();
|
||||
for addr in object_cache_line_addrs(object) {
|
||||
l2_cache_clean(addr);
|
||||
}
|
||||
l2_cache_sync();
|
||||
}
|
||||
|
||||
/// Data cache clean for an object. Panics if not properly
|
||||
/// aligned and properly sized to be contained in an exact number of
|
||||
/// cache lines.
|
||||
pub fn dcc_slice<T>(slice: &[T]) {
|
||||
if slice.len() == 0 {
|
||||
return;
|
||||
}
|
||||
dmb();
|
||||
for addr in slice_cache_line_addrs(slice) {
|
||||
dccmvac(addr);
|
||||
}
|
||||
dsb();
|
||||
for addr in slice_cache_line_addrs(slice) {
|
||||
l2_cache_clean(addr);
|
||||
}
|
||||
l2_cache_sync();
|
||||
}
|
||||
|
||||
/// Data cache invalidate by memory virtual address. This and
|
||||
|
@ -169,6 +250,10 @@ pub unsafe fn dci<T>(object: &mut T) {
|
|||
assert_eq!(beyond_addr & CACHE_LINE_MASK, 0, "dci object beyond_addr must be aligned");
|
||||
|
||||
dmb();
|
||||
for addr in (first_addr..beyond_addr).step_by(CACHE_LINE) {
|
||||
l2_cache_invalidate(addr);
|
||||
}
|
||||
l2_cache_sync();
|
||||
for addr in (first_addr..beyond_addr).step_by(CACHE_LINE) {
|
||||
dcimvac(addr);
|
||||
}
|
||||
|
@ -183,6 +268,10 @@ pub unsafe fn dci_slice<T>(slice: &mut [T]) {
|
|||
assert_eq!(beyond_addr & CACHE_LINE_MASK, 0, "dci slice beyond_addr must be aligned");
|
||||
|
||||
dmb();
|
||||
for addr in (first_addr..beyond_addr).step_by(CACHE_LINE) {
|
||||
l2_cache_invalidate(addr);
|
||||
}
|
||||
l2_cache_sync();
|
||||
for addr in (first_addr..beyond_addr).step_by(CACHE_LINE) {
|
||||
dcimvac(addr);
|
||||
}
|
||||
|
|
|
@ -0,0 +1,14 @@
|
|||
/// Enable FPU in the current core.
|
||||
pub fn enable_fpu() {
|
||||
unsafe {
|
||||
llvm_asm!("
|
||||
mrc p15, 0, r1, c1, c0, 2
|
||||
orr r1, r1, (0b1111<<20)
|
||||
mcr p15, 0, r1, c1, c0, 2
|
||||
|
||||
vmrs r1, fpexc
|
||||
orr r1, r1, (1<<30)
|
||||
vmsr fpexc, r1
|
||||
":::"r1");
|
||||
}
|
||||
}
|
|
@ -0,0 +1,333 @@
|
|||
use libregister::{register, register_at, register_bit, register_bits, RegisterRW, RegisterR, RegisterW};
|
||||
use super::asm::dmb;
|
||||
use volatile_register::RW;
|
||||
|
||||
/// enable L2 cache with specific prefetch offset
|
||||
/// prefetch offset requires manual tuning, it seems that 8 is good for ZC706 current settings
|
||||
pub fn enable_l2_cache(offset: u8) {
|
||||
dmb();
|
||||
let regs = RegisterBlock::new();
|
||||
// disable L2 cache
|
||||
regs.reg1_control.modify(|_, w| w.l2_enable(false));
|
||||
|
||||
regs.reg15_prefetch_ctrl.modify(|_, w|
|
||||
w.instr_prefetch_en(true)
|
||||
.data_prefetch_en(true)
|
||||
.double_linefill_en(true)
|
||||
.incr_double_linefill_en(true)
|
||||
.pref_drop_en(true)
|
||||
.prefetch_offset(offset)
|
||||
);
|
||||
regs.reg1_aux_control.modify(|_, w| {
|
||||
w.early_bresp_en(true)
|
||||
.instr_prefetch_en(true)
|
||||
.data_prefetch_en(true)
|
||||
.cache_replace_policy(true)
|
||||
.way_size(3)
|
||||
});
|
||||
regs.reg1_tag_ram_control.modify(|_, w| w.ram_wr_access_lat(1).ram_rd_access_lat(1).ram_setup_lat(1));
|
||||
regs.reg1_data_ram_control.modify(|_, w| w.ram_wr_access_lat(1).ram_rd_access_lat(2).ram_setup_lat(1));
|
||||
// invalidate L2 ways
|
||||
unsafe {
|
||||
regs.reg7_inv_way.write(0xFFFF);
|
||||
}
|
||||
// poll for completion
|
||||
while regs.reg7_cache_sync.read().c() {}
|
||||
// write to a magic memory location with a magic sequence
|
||||
// required in UG585 Section 3.4.10 Initialization Sequence
|
||||
unsafe {
|
||||
core::ptr::write_volatile(0xF8000008usize as *mut u32, 0xDF0D);
|
||||
core::ptr::write_volatile(0xF8000A1Cusize as *mut u32, 0x020202);
|
||||
core::ptr::write_volatile(0xF8000004usize as *mut u32, 0x767B);
|
||||
}
|
||||
regs.reg1_control.modify(|_, w| w.l2_enable(true));
|
||||
dmb();
|
||||
}
|
||||
|
||||
#[inline(always)]
|
||||
pub fn l2_cache_invalidate_all() {
|
||||
let regs = RegisterBlock::new();
|
||||
unsafe {
|
||||
regs.reg7_inv_way.write(0xFFFF);
|
||||
}
|
||||
// poll for completion
|
||||
while regs.reg7_cache_sync.read().c() {}
|
||||
}
|
||||
|
||||
#[inline(always)]
|
||||
pub fn l2_cache_clean_all() {
|
||||
let regs = RegisterBlock::new();
|
||||
unsafe {
|
||||
regs.reg7_clean_way.write(0xFFFF);
|
||||
}
|
||||
// poll for completion
|
||||
while regs.reg7_cache_sync.read().c() {}
|
||||
}
|
||||
|
||||
#[inline(always)]
|
||||
pub fn l2_cache_clean_invalidate_all() {
|
||||
let regs = RegisterBlock::new();
|
||||
unsafe {
|
||||
regs.reg7_clean_inv_way.write(0xFFFF);
|
||||
}
|
||||
// poll for completion
|
||||
while regs.reg7_cache_sync.read().c() {}
|
||||
}
|
||||
|
||||
/// L2 cache sync, similar to dsb for L1 cache
|
||||
#[inline(always)]
|
||||
pub fn l2_cache_sync() {
|
||||
let regs = RegisterBlock::new();
|
||||
regs.reg7_cache_sync.write(Reg7CacheSync::zeroed().c(false));
|
||||
}
|
||||
|
||||
#[inline(always)]
|
||||
pub fn l2_cache_clean(addr: usize) {
|
||||
let regs = RegisterBlock::new();
|
||||
unsafe {
|
||||
regs.reg7_clean_pa.write(addr as u32);
|
||||
}
|
||||
}
|
||||
|
||||
#[inline(always)]
|
||||
pub fn l2_cache_invalidate(addr: usize) {
|
||||
let regs = RegisterBlock::new();
|
||||
unsafe {
|
||||
regs.reg7_inv_pa.write(addr as u32);
|
||||
}
|
||||
}
|
||||
|
||||
#[inline(always)]
|
||||
pub fn l2_cache_clean_invalidate(addr: usize) {
|
||||
let regs = RegisterBlock::new();
|
||||
unsafe {
|
||||
regs.reg7_clean_inv_pa.write(addr as u32);
|
||||
}
|
||||
}
|
||||
|
||||
#[repr(C)]
|
||||
struct RegisterBlock {
|
||||
/// cache ID register, Returns the 32-bit device ID code it reads off the CACHEID input bus.
|
||||
/// The value is specified by the system integrator. Reset value: 0x410000c8
|
||||
pub reg0_cache_id: Reg0CacheId,
|
||||
/// cache type register, Returns the 32-bit cache type. Reset value: 0x1c100100
|
||||
pub reg0_cache_type: Reg0CacheType,
|
||||
unused0: [u32; 62],
|
||||
/// control register, reset value: 0x0
|
||||
pub reg1_control: Reg1Control,
|
||||
/// auxilary control register, reset value: 0x02020000
|
||||
pub reg1_aux_control: Reg1AuxControl,
|
||||
/// Configures Tag RAM latencies
|
||||
pub reg1_tag_ram_control: Reg1TagRamControl,
|
||||
/// configures data RAM latencies
|
||||
pub reg1_data_ram_control: Reg1DataRamControl,
|
||||
unused1: [u32; 60],
|
||||
/// Permits the event counters to be enabled and reset.
|
||||
pub reg2_ev_counter_ctrl: Reg2EvCounterCtrl,
|
||||
/// Enables event counter 1 to be driven by a specific event. Counter 1 increments when the
|
||||
/// event occurs.
|
||||
pub reg2_ev_counter1_cfg: Reg2EvCounter1Cfg,
|
||||
/// Enables event counter 0 to be driven by a specific event. Counter 0 increments when the
|
||||
/// event occurs.
|
||||
pub reg2_ev_counter0_cfg: Reg2EvCounter0Cfg,
|
||||
/// Enable the programmer to read off the counter value. The counter counts an event as
|
||||
/// specified by the Counter Configuration Registers. The counter can be preloaded if counting
|
||||
/// is disabled and reset by the Event Counter Control Register.
|
||||
pub reg2_ev_counter1: RW<u32>,
|
||||
/// Enable the programmer to read off the counter value. The counter counts an event as
|
||||
/// specified by the Counter Configuration Registers. The counter can be preloaded if counting
|
||||
/// is disabled and reset by the Event Counter Control Register.
|
||||
pub reg2_ev_counter0: RW<u32>,
|
||||
/// This register enables or masks interrupts from being triggered on the external pins of the
|
||||
/// cache controller. Figure 3-8 on page 3-17 shows the register bit assignments. The bit
|
||||
/// assignments enables the masking of the interrupts on both their individual outputs and the
|
||||
/// combined L2CCINTR line. Clearing a bit by writing a 0, disables the interrupt triggering on
|
||||
/// that pin. All bits are cleared by a reset. You must write to the register bits with a 1 to
|
||||
/// enable the generation of interrupts. 1 = Enabled. 0 = Masked. This is the default.
|
||||
pub reg2_int_mask: Reg2IntMask,
|
||||
/// This register is a read-only.It returns the masked interrupt status. This register can be
|
||||
/// accessed by secure and non-secure operations. The register gives an AND function of the raw
|
||||
/// interrupt status with the values of the interrupt mask register. All the bits are cleared
|
||||
/// by a reset. A write to this register is ignored. Bits read can be HIGH or LOW: HIGH If the
|
||||
/// bits read HIGH, they reflect the status of the input lines triggering an interrupt. LOW If
|
||||
/// the bits read LOW, either no interrupt has been generated, or the interrupt is masked.
|
||||
pub reg2_int_mask_status: Reg2IntMaskStatus,
|
||||
/// The Raw Interrupt Status Register enables the interrupt status that excludes the masking
|
||||
/// logic. Bits read can be HIGH or LOW: HIGH If the bits read HIGH, they reflect the status of
|
||||
/// the input lines triggering an interrupt. LOW If the bits read LOW, no interrupt has been
|
||||
/// generated.
|
||||
pub reg2_int_raw_status: Reg2IntRawStatus,
|
||||
/// Clears the Raw Interrupt Status Register bits. When a bit is written as 1, it clears the
|
||||
/// corresponding bit in the Raw Interrupt Status Register. When a bit is written as 0, it has
|
||||
/// no effect
|
||||
pub reg2_int_clear: Reg2IntClear,
|
||||
unused2: [u32; 323],
|
||||
/// Drain the STB. Operation complete when all buffers, LRB, LFB, STB, and EB, are empty
|
||||
pub reg7_cache_sync: Reg7CacheSync,
|
||||
unused3: [u32; 15],
|
||||
/// Invalidate Line by PA: Specific L2 cache line is marked as not valid
|
||||
pub reg7_inv_pa: RW<u32>,
|
||||
unused4: [u32; 2],
|
||||
/// Invalidate by Way Invalidate all data in specified ways, including dirty data. An
|
||||
/// Invalidate by way while selecting all cache ways is equivalent to invalidating all cache
|
||||
/// entries. Completes as a background task with the way, or ways, locked, preventing
|
||||
/// allocation.
|
||||
pub reg7_inv_way: RW<u32>,
|
||||
unused5: [u32; 12],
|
||||
/// Clean Line by PA Write the specific L2 cache line to L3 main memory if the line is marked
|
||||
/// as valid and dirty. The line is marked as not dirty. The valid bit is unchanged
|
||||
pub reg7_clean_pa: RW<u32>,
|
||||
unused6: [u32; 1],
|
||||
/// Clean Line by Set/Way Write the specific L2 cache line within the specified way to L3 main
|
||||
/// memory if the line is marked as valid and dirty. The line is marked as not dirty. The valid
|
||||
/// bit is unchanged
|
||||
pub reg7_clean_index: Reg7CleanIndex,
|
||||
/// Clean by Way Writes each line of the specified L2 cache ways to L3 main memory if the line
|
||||
/// is marked as valid and dirty. The lines are marked as not dirty. The valid bits are
|
||||
/// unchanged. Completes as a background task with the way, or ways, locked, preventing
|
||||
/// allocation.
|
||||
pub reg7_clean_way: RW<u32>,
|
||||
unused7: [u32; 12],
|
||||
/// Clean and Invalidate Line by PA Write the specific L2 cache line to L3 main memory if the
|
||||
/// line is marked as valid and dirty. The line is marked as not valid
|
||||
pub reg7_clean_inv_pa: RW<u32>,
|
||||
unused8: [u32; 1],
|
||||
/// Clean and Invalidate Line by Set/Way Write the specific L2 cache line within the specified
|
||||
/// way to L3 main memory if the line is marked as valid and dirty. The line is marked as not
|
||||
/// valid
|
||||
pub reg7_clean_inv_index: Reg7CleanInvIndex,
|
||||
/// Clean and Invalidate by Way Writes each line of the specified L2 cache ways to L3 main
|
||||
/// memory if the line is marked as valid and dirty. The lines are marked as not valid.
|
||||
/// Completes as a background task with the way, or ways, locked, preventing allocation.
|
||||
pub reg7_clean_inv_way: RW<u32>,
|
||||
unused9: [u32; 0x1D8],
|
||||
pub reg15_prefetch_ctrl: Reg15PrefetechCtrl,
|
||||
}
|
||||
|
||||
register_at!(RegisterBlock, 0xF8F02000, new);
|
||||
|
||||
register!(reg0_cache_id, Reg0CacheId, RW, u32);
|
||||
register_bits!(reg0_cache_id, implementer, u8, 24, 31);
|
||||
register_bits!(reg0_cache_id, cache_id, u8, 10, 15);
|
||||
register_bits!(reg0_cache_id, part_num, u8, 6, 9);
|
||||
register_bits!(reg0_cache_id, rtl_release, u8, 0, 5);
|
||||
|
||||
register!(reg0_cache_type, Reg0CacheType, RW, u32);
|
||||
register_bit!(reg0_cache_type, data_banking, 31);
|
||||
register_bits!(reg0_cache_type, ctype, u8, 25, 28);
|
||||
register_bit!(reg0_cache_type, h, 24);
|
||||
register_bits!(reg0_cache_type, dsize_middsize_19, u8, 20, 22);
|
||||
register_bit!(reg0_cache_type, l2_assoc_d, 18);
|
||||
register_bits!(reg0_cache_type, l2cache_line_len_disize_11, u8, 12, 13);
|
||||
register_bits!(reg0_cache_type, isize_midisize_7, u8, 8, 10);
|
||||
register_bit!(reg0_cache_type, l2_assoc_i, 6);
|
||||
register_bits!(reg0_cache_type, l2cache_line_len_i, u8, 0, 1);
|
||||
|
||||
register!(reg1_control, Reg1Control, RW, u32);
|
||||
register_bit!(reg1_control, l2_enable, 0);
|
||||
|
||||
register!(reg1_aux_control, Reg1AuxControl, RW, u32);
|
||||
register_bit!(reg1_aux_control, early_bresp_en, 30);
|
||||
register_bit!(reg1_aux_control, instr_prefetch_en, 29);
|
||||
register_bit!(reg1_aux_control, data_prefetch_en, 28);
|
||||
register_bit!(reg1_aux_control, nonsec_inte_access_ctrl, 27);
|
||||
register_bit!(reg1_aux_control, nonsec_lockdown_en, 26);
|
||||
register_bit!(reg1_aux_control, cache_replace_policy, 25);
|
||||
register_bits!(reg1_aux_control, force_write_alloc, u8, 23, 24);
|
||||
register_bit!(reg1_aux_control, shared_attr_override_en, 22);
|
||||
register_bit!(reg1_aux_control, parity_en, 21);
|
||||
register_bit!(reg1_aux_control, event_mon_bus_en, 20);
|
||||
register_bits!(reg1_aux_control, way_size, u8, 17, 19);
|
||||
register_bit!(reg1_aux_control, associativity, 16);
|
||||
register_bit!(reg1_aux_control, shared_attr_inva_en, 13);
|
||||
register_bit!(reg1_aux_control, ex_cache_config, 12);
|
||||
register_bit!(reg1_aux_control, store_buff_dev_lim_en, 11);
|
||||
register_bit!(reg1_aux_control, high_pr_so_dev_rd_en, 10);
|
||||
register_bit!(reg1_aux_control, full_line_zero_enable, 0);
|
||||
|
||||
register!(reg1_tag_ram_control, Reg1TagRamControl, RW, u32);
|
||||
register_bits!(reg1_tag_ram_control, ram_wr_access_lat, u8, 8, 10);
|
||||
register_bits!(reg1_tag_ram_control, ram_rd_access_lat, u8, 4, 6);
|
||||
register_bits!(reg1_tag_ram_control, ram_setup_lat, u8, 0, 2);
|
||||
|
||||
register!(reg1_data_ram_control, Reg1DataRamControl, RW, u32);
|
||||
register_bits!(reg1_data_ram_control, ram_wr_access_lat, u8, 8, 10);
|
||||
register_bits!(reg1_data_ram_control, ram_rd_access_lat, u8, 4, 6);
|
||||
register_bits!(reg1_data_ram_control, ram_setup_lat, u8, 0, 2);
|
||||
|
||||
register!(reg2_ev_counter_ctrl, Reg2EvCounterCtrl, RW, u32);
|
||||
register_bit!(reg2_ev_counter_ctrl, ev_ctr_en, 0);
|
||||
|
||||
register!(reg2_ev_counter1_cfg, Reg2EvCounter1Cfg, RW, u32);
|
||||
register_bits!(reg2_ev_counter1_cfg, ctr_ev_src, u8, 2, 5);
|
||||
register_bits!(reg2_ev_counter1_cfg, ev_ctr_intr_gen, u8, 0, 1);
|
||||
|
||||
register!(reg2_ev_counter0_cfg, Reg2EvCounter0Cfg, RW, u32);
|
||||
register_bits!(reg2_ev_counter0_cfg, ctr_ev_src, u8, 2, 5);
|
||||
register_bits!(reg2_ev_counter0_cfg, ev_ctr_intr_gen, u8, 0, 1);
|
||||
|
||||
register!(reg2_int_mask, Reg2IntMask, RW, u32);
|
||||
register_bit!(reg2_int_mask, decerr, 8);
|
||||
register_bit!(reg2_int_mask, slverr, 7);
|
||||
register_bit!(reg2_int_mask, errrd, 6);
|
||||
register_bit!(reg2_int_mask, errrt, 5);
|
||||
register_bit!(reg2_int_mask, errwd, 4);
|
||||
register_bit!(reg2_int_mask, errwt, 3);
|
||||
register_bit!(reg2_int_mask, parrd, 2);
|
||||
register_bit!(reg2_int_mask, parrt, 1);
|
||||
register_bit!(reg2_int_mask, ecntr, 0);
|
||||
|
||||
register!(reg2_int_mask_status, Reg2IntMaskStatus, RW, u32);
|
||||
register_bit!(reg2_int_mask_status, decerr, 8);
|
||||
register_bit!(reg2_int_mask_status, slverr, 7);
|
||||
register_bit!(reg2_int_mask_status, errrd, 6);
|
||||
register_bit!(reg2_int_mask_status, errrt, 5);
|
||||
register_bit!(reg2_int_mask_status, errwd, 4);
|
||||
register_bit!(reg2_int_mask_status, errwt, 3);
|
||||
register_bit!(reg2_int_mask_status, parrd, 2);
|
||||
register_bit!(reg2_int_mask_status, parrt, 1);
|
||||
register_bit!(reg2_int_mask_status, ecntr, 0);
|
||||
|
||||
register!(reg2_int_raw_status, Reg2IntRawStatus, RW, u32);
|
||||
register_bit!(reg2_int_raw_status, decerr, 8);
|
||||
register_bit!(reg2_int_raw_status, slverr, 7);
|
||||
register_bit!(reg2_int_raw_status, errrd, 6);
|
||||
register_bit!(reg2_int_raw_status, errrt, 5);
|
||||
register_bit!(reg2_int_raw_status, errwd, 4);
|
||||
register_bit!(reg2_int_raw_status, errwt, 3);
|
||||
register_bit!(reg2_int_raw_status, parrd, 2);
|
||||
register_bit!(reg2_int_raw_status, parrt, 1);
|
||||
register_bit!(reg2_int_raw_status, ecntr, 0);
|
||||
|
||||
register!(reg2_int_clear, Reg2IntClear, RW, u32, 0);
|
||||
register_bit!(reg2_int_clear, decerr, 8, WTC);
|
||||
register_bit!(reg2_int_clear, slverr, 7, WTC);
|
||||
register_bit!(reg2_int_clear, errrd, 6, WTC);
|
||||
register_bit!(reg2_int_clear, errrt, 5, WTC);
|
||||
register_bit!(reg2_int_clear, errwd, 4, WTC);
|
||||
register_bit!(reg2_int_clear, errwt, 3, WTC);
|
||||
register_bit!(reg2_int_clear, parrd, 2, WTC);
|
||||
register_bit!(reg2_int_clear, parrt, 1, WTC);
|
||||
register_bit!(reg2_int_clear, ecntr, 0, WTC);
|
||||
|
||||
register!(reg7_cache_sync, Reg7CacheSync, RW, u32);
|
||||
register_bit!(reg7_cache_sync, c, 0);
|
||||
|
||||
register!(reg7_clean_index, Reg7CleanIndex, RW, u32);
|
||||
register_bits!(reg7_clean_index, way, u8, 28, 30);
|
||||
register_bits!(reg7_clean_index, index, u8, 5, 11);
|
||||
register_bit!(reg7_clean_index, c, 0);
|
||||
|
||||
register!(reg7_clean_inv_index, Reg7CleanInvIndex, RW, u32);
|
||||
register_bits!(reg7_clean_inv_index, way, u8, 28, 30);
|
||||
register_bits!(reg7_clean_inv_index, index, u8, 5, 11);
|
||||
register_bit!(reg7_clean_inv_index, c, 0);
|
||||
|
||||
register!(reg15_prefetch_ctrl, Reg15PrefetechCtrl, RW, u32);
|
||||
register_bit!(reg15_prefetch_ctrl, double_linefill_en, 30);
|
||||
register_bit!(reg15_prefetch_ctrl, instr_prefetch_en, 29);
|
||||
register_bit!(reg15_prefetch_ctrl, data_prefetch_en, 28);
|
||||
register_bit!(reg15_prefetch_ctrl, pref_drop_en, 24);
|
||||
register_bit!(reg15_prefetch_ctrl, incr_double_linefill_en, 23);
|
||||
register_bits!(reg15_prefetch_ctrl, prefetch_offset, u8, 0, 4);
|
||||
|
|
@ -1,16 +1,81 @@
|
|||
#![no_std]
|
||||
#![feature(llvm_asm, global_asm)]
|
||||
#![feature(never_type)]
|
||||
#![feature(const_fn)]
|
||||
|
||||
extern crate alloc;
|
||||
|
||||
pub mod asm;
|
||||
pub mod regs;
|
||||
pub mod cache;
|
||||
mod fpu;
|
||||
pub mod l2c;
|
||||
pub mod mmu;
|
||||
pub mod mutex;
|
||||
pub mod regs;
|
||||
pub mod semaphore;
|
||||
pub mod sync_channel;
|
||||
mod uncached;
|
||||
pub use fpu::enable_fpu;
|
||||
pub use uncached::UncachedSlice;
|
||||
|
||||
global_asm!(include_str!("exceptions.s"));
|
||||
|
||||
#[inline]
|
||||
pub fn spin_lock_yield() {
|
||||
#[cfg(feature = "power_saving")]
|
||||
asm::wfe();
|
||||
}
|
||||
|
||||
#[inline]
|
||||
pub fn notify_spin_lock() {
|
||||
#[cfg(feature = "power_saving")]
|
||||
{
|
||||
asm::dsb();
|
||||
asm::sev();
|
||||
}
|
||||
}
|
||||
|
||||
#[macro_export]
|
||||
/// Interrupt handler, which setup the stack and preserve registers before jumping to actual interrupt handler.
|
||||
/// Registers r0-r12, PC, SP and CPSR are restored after the actual handler.
|
||||
///
|
||||
/// - `name` is the name of the interrupt, should be the same as the one defined in vector table.
|
||||
/// - `name2` is the name for the actual handler, should be different from name.
|
||||
/// - `stack0` is the stack for the interrupt handler when called from core0.
|
||||
/// - `stack1` is the stack for the interrupt handler when called from core1.
|
||||
/// - `body` is the body of the actual interrupt handler, should be a normal unsafe rust function
|
||||
/// body.
|
||||
///
|
||||
/// Note that the interrupt handler would use the same stack as normal programs by default.
|
||||
macro_rules! interrupt_handler {
|
||||
($name:ident, $name2:ident, $stack0:ident, $stack1:ident, $body:block) => {
|
||||
#[link_section = ".text.boot"]
|
||||
#[no_mangle]
|
||||
#[naked]
|
||||
pub unsafe extern "C" fn $name() -> ! {
|
||||
asm!(
|
||||
// setup SP, depending on CPU 0 or 1
|
||||
// and preserve registers
|
||||
"sub lr, lr, #4",
|
||||
"stmfd sp!, {{r0-r12, lr}}",
|
||||
"mrc p15, #0, r0, c0, c0, #5",
|
||||
concat!("movw r1, :lower16:", stringify!($stack0)),
|
||||
concat!("movt r1, :upper16:", stringify!($stack0)),
|
||||
"tst r0, #3",
|
||||
concat!("movwne r1, :lower16:", stringify!($stack1)),
|
||||
concat!("movtne r1, :upper16:", stringify!($stack1)),
|
||||
"mov r0, sp",
|
||||
"mov sp, r1",
|
||||
"push {{r0, r1}}", // 2 registers are pushed to maintain 8 byte stack alignment
|
||||
concat!("bl ", stringify!($name2)),
|
||||
"pop {{r0, r1}}",
|
||||
"mov sp, r0",
|
||||
"ldmfd sp!, {{r0-r12, pc}}^", // caret ^ : copy SPSR to the CPSR
|
||||
options(noreturn)
|
||||
);
|
||||
}
|
||||
|
||||
#[no_mangle]
|
||||
pub unsafe extern "C" fn $name2() $body
|
||||
};
|
||||
}
|
||||
|
|
|
@ -1,5 +1,5 @@
|
|||
use bit_field::BitField;
|
||||
use super::{regs::*, asm, cache};
|
||||
use super::{regs::*, asm::*, cache::*};
|
||||
use libregister::RegisterW;
|
||||
|
||||
#[derive(Copy, Clone)]
|
||||
|
@ -158,7 +158,7 @@ impl L1Table {
|
|||
global: true,
|
||||
shareable: true,
|
||||
access: AccessPermissions::FullAccess,
|
||||
tex: 0b101,
|
||||
tex: 0b0,
|
||||
domain: 0b1111,
|
||||
exec: true,
|
||||
cacheable: true,
|
||||
|
@ -213,7 +213,7 @@ impl L1Table {
|
|||
access: AccessPermissions::FullAccess,
|
||||
tex: 0,
|
||||
domain: 0,
|
||||
exec: true,
|
||||
exec: false,
|
||||
cacheable: false,
|
||||
bufferable: true,
|
||||
});
|
||||
|
@ -338,7 +338,7 @@ impl L1Table {
|
|||
/* 0xfff00000 - 0xffffffff (256K OCM when mapped to high address space) */
|
||||
self.direct_mapped_section(0xfff, L1Section {
|
||||
global: true,
|
||||
shareable: false,
|
||||
shareable: true,
|
||||
access: AccessPermissions::FullAccess,
|
||||
tex: 0b100,
|
||||
domain: 0,
|
||||
|
@ -368,10 +368,19 @@ impl L1Table {
|
|||
let result = f(&mut section);
|
||||
entry.set_section(section);
|
||||
|
||||
asm::dmb();
|
||||
cache::tlbiall();
|
||||
asm::dsb();
|
||||
asm::isb();
|
||||
// Flush L1Dcache
|
||||
dcciall();
|
||||
// // TODO: L2?
|
||||
|
||||
// Invalidate TLB
|
||||
tlbiall();
|
||||
// Invalidate all branch predictors
|
||||
bpiall();
|
||||
|
||||
// ensure completion of the BP and TLB invalidation
|
||||
dsb();
|
||||
// synchronize context on this processor
|
||||
isb();
|
||||
|
||||
result
|
||||
}
|
||||
|
@ -401,14 +410,15 @@ pub fn with_mmu<F: FnMut() -> !>(l1table: &L1Table, mut f: F) -> ! {
|
|||
.a(false)
|
||||
.c(true)
|
||||
.i(true)
|
||||
.z(true)
|
||||
.unaligned(true)
|
||||
);
|
||||
|
||||
// Synchronization barriers
|
||||
// Allows MMU to start
|
||||
asm::dsb();
|
||||
dsb();
|
||||
// Flushes pre-fetch buffer
|
||||
asm::isb();
|
||||
isb();
|
||||
|
||||
f();
|
||||
}
|
||||
|
|
|
@ -1,20 +1,13 @@
|
|||
use core::ops::{Deref, DerefMut};
|
||||
use core::sync::atomic::{AtomicU32, Ordering};
|
||||
use core::cell::UnsafeCell;
|
||||
use super::asm::*;
|
||||
|
||||
/// [Power-saving features](http://infocenter.arm.com/help/index.jsp?topic=/com.arm.doc.dht0008a/ch01s03s02.html)
|
||||
#[inline]
|
||||
fn wait_for_update() {
|
||||
wfe();
|
||||
}
|
||||
|
||||
/// [Power-saving features](http://infocenter.arm.com/help/index.jsp?topic=/com.arm.doc.dht0008a/ch01s03s02.html)
|
||||
#[inline]
|
||||
fn signal_update() {
|
||||
dsb();
|
||||
sev();
|
||||
}
|
||||
use core::task::{Context, Poll};
|
||||
use core::pin::Pin;
|
||||
use core::future::Future;
|
||||
use super::{
|
||||
spin_lock_yield, notify_spin_lock,
|
||||
asm::{enter_critical, exit_critical}
|
||||
};
|
||||
|
||||
const LOCKED: u32 = 1;
|
||||
const UNLOCKED: u32 = 0;
|
||||
|
@ -30,6 +23,23 @@ pub struct Mutex<T> {
|
|||
unsafe impl<T: Send> Sync for Mutex<T> {}
|
||||
unsafe impl<T: Send> Send for Mutex<T> {}
|
||||
|
||||
struct Fut<'a, T>(&'a Mutex<T>);
|
||||
|
||||
impl<'a, T> Future for Fut<'a, T> {
|
||||
type Output = MutexGuard<'a, T>;
|
||||
fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
|
||||
let irq = unsafe { enter_critical() };
|
||||
if self.0.locked.compare_exchange_weak(UNLOCKED, LOCKED, Ordering::AcqRel, Ordering::Relaxed).is_err() {
|
||||
unsafe { exit_critical(irq) };
|
||||
cx.waker().wake_by_ref();
|
||||
Poll::Pending
|
||||
}
|
||||
else {
|
||||
Poll::Ready(MutexGuard { mutex: self.0, irq })
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl<T> Mutex<T> {
|
||||
/// Constructor, const-fn
|
||||
pub const fn new(inner: T) -> Self {
|
||||
|
@ -41,18 +51,35 @@ impl<T> Mutex<T> {
|
|||
|
||||
/// Lock the Mutex, blocks when already locked
|
||||
pub fn lock(&self) -> MutexGuard<T> {
|
||||
while self.locked.compare_and_swap(UNLOCKED, LOCKED, Ordering::Acquire) != UNLOCKED {
|
||||
wait_for_update();
|
||||
let mut irq = unsafe { enter_critical() };
|
||||
while self.locked.compare_exchange_weak(UNLOCKED, LOCKED, Ordering::AcqRel, Ordering::Relaxed).is_err() {
|
||||
unsafe {
|
||||
exit_critical(irq);
|
||||
spin_lock_yield();
|
||||
irq = enter_critical();
|
||||
}
|
||||
}
|
||||
MutexGuard { mutex: self, irq }
|
||||
}
|
||||
|
||||
pub async fn async_lock(&self) -> MutexGuard<'_, T> {
|
||||
Fut(&self).await
|
||||
}
|
||||
|
||||
pub fn try_lock(&self) -> Option<MutexGuard<T>> {
|
||||
let irq = unsafe { enter_critical() };
|
||||
if self.locked.compare_exchange_weak(UNLOCKED, LOCKED, Ordering::AcqRel, Ordering::Relaxed).is_err() {
|
||||
unsafe { exit_critical(irq) };
|
||||
None
|
||||
} else {
|
||||
Some(MutexGuard { mutex: self, irq })
|
||||
}
|
||||
dmb();
|
||||
MutexGuard { mutex: self }
|
||||
}
|
||||
|
||||
fn unlock(&self) {
|
||||
dmb();
|
||||
self.locked.store(UNLOCKED, Ordering::Release);
|
||||
|
||||
signal_update();
|
||||
notify_spin_lock();
|
||||
}
|
||||
}
|
||||
|
||||
|
@ -60,6 +87,7 @@ impl<T> Mutex<T> {
|
|||
/// `Deref`/`DerefMutx`
|
||||
pub struct MutexGuard<'a, T> {
|
||||
mutex: &'a Mutex<T>,
|
||||
irq: bool,
|
||||
}
|
||||
|
||||
impl<'a, T> Deref for MutexGuard<'a, T> {
|
||||
|
@ -79,5 +107,6 @@ impl<'a, T> DerefMut for MutexGuard<'a, T> {
|
|||
impl<'a, T> Drop for MutexGuard<'a, T> {
|
||||
fn drop(&mut self) {
|
||||
self.mutex.unlock();
|
||||
unsafe { exit_critical(self.irq) };
|
||||
}
|
||||
}
|
||||
|
|
|
@ -91,8 +91,19 @@ pub struct HVBAR;
|
|||
def_reg_r!(HVBAR, u32, "mrc p15, 4, $0, c12, c0, 0");
|
||||
def_reg_w!(HVBAR, u32, "mcr p15, 4, $0, c12, c0, 0");
|
||||
|
||||
/// Multiprocess Affinity Register
|
||||
pub struct MPIDR;
|
||||
def_reg_r!(MPIDR, u32, "mrc p15, 0, $0, c0, c0, 5");
|
||||
def_reg_r!(MPIDR, mpidr::Read, "mrc p15, 0, $0, c0, c0, 5");
|
||||
wrap_reg!(mpidr);
|
||||
register_bits!(mpidr,
|
||||
/// CPU core index
|
||||
cpu_id, u8, 0, 1);
|
||||
register_bits!(mpidr,
|
||||
/// Processor index in "multi-socket" systems
|
||||
cluster_id, u8, 8, 11);
|
||||
register_bit!(mpidr,
|
||||
/// true if part of uniprocessor system
|
||||
u, 30);
|
||||
|
||||
pub struct DFAR;
|
||||
def_reg_r!(DFAR, u32, "mrc p15, 0, $0, c6, c0, 0");
|
||||
|
@ -145,6 +156,8 @@ register_bit!(actlr, excl, 7);
|
|||
register_bit!(actlr, smp, 6);
|
||||
register_bit!(actlr, write_full_line_of_zeros, 3);
|
||||
register_bit!(actlr, l1_prefetch_enable, 2);
|
||||
// L2 cache prefetch hint, in UG585 section 3.4.8
|
||||
register_bit!(actlr, l2_prefetch_enable, 1);
|
||||
// Cache/TLB maintenance broadcast
|
||||
register_bit!(actlr, fw, 0);
|
||||
|
||||
|
@ -160,7 +173,11 @@ impl RegisterRW for ACTLR {
|
|||
|
||||
impl ACTLR {
|
||||
pub fn enable_smp(&mut self) {
|
||||
self.modify(|_, w| w.smp(true).fw(true));
|
||||
self.modify(|_, w| w.smp(true).fw(true).alloc_one_way(true));
|
||||
}
|
||||
|
||||
pub fn enable_prefetch(&mut self) {
|
||||
self.modify(|_, w| w.l1_prefetch_enable(true).l2_prefetch_enable(true))
|
||||
}
|
||||
}
|
||||
|
||||
|
|
|
@ -0,0 +1,71 @@
|
|||
use super::{spin_lock_yield, notify_spin_lock};
|
||||
use core::{
|
||||
task::{Context, Poll},
|
||||
pin::Pin,
|
||||
future::Future,
|
||||
sync::atomic::{AtomicI32, Ordering}
|
||||
};
|
||||
|
||||
pub struct Semaphore {
|
||||
value: AtomicI32,
|
||||
max: i32
|
||||
}
|
||||
|
||||
impl Semaphore {
|
||||
pub const fn new(value: i32, max: i32) -> Self {
|
||||
Semaphore { value: AtomicI32::new(value), max}
|
||||
}
|
||||
|
||||
pub fn try_wait(&self) -> Option<()> {
|
||||
loop {
|
||||
let value = self.value.load(Ordering::Relaxed);
|
||||
if value > 0 {
|
||||
if self.value.compare_exchange_weak(value, value - 1, Ordering::SeqCst, Ordering::Relaxed).is_ok() {
|
||||
return Some(());
|
||||
}
|
||||
} else {
|
||||
return None;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
pub fn wait(&self) {
|
||||
while self.try_wait().is_none() {
|
||||
spin_lock_yield();
|
||||
}
|
||||
}
|
||||
|
||||
pub async fn async_wait(&self) {
|
||||
struct Fut<'a>(&'a Semaphore);
|
||||
|
||||
impl Future for Fut<'_> {
|
||||
type Output = ();
|
||||
fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
|
||||
match self.0.try_wait() {
|
||||
Some(_) => Poll::Ready(()),
|
||||
None => {
|
||||
cx.waker().wake_by_ref();
|
||||
Poll::Pending
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
Fut(&self).await
|
||||
}
|
||||
|
||||
pub fn signal(&self) {
|
||||
loop {
|
||||
let value = self.value.load(Ordering::Relaxed);
|
||||
if value < self.max {
|
||||
if self.value.compare_exchange_weak(value, value + 1, Ordering::SeqCst, Ordering::Relaxed).is_ok() {
|
||||
notify_spin_lock();
|
||||
return;
|
||||
}
|
||||
} else {
|
||||
return;
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
|
@ -1,115 +1,72 @@
|
|||
use core::{
|
||||
future::Future,
|
||||
pin::Pin,
|
||||
ptr::null_mut,
|
||||
sync::atomic::{AtomicPtr, Ordering},
|
||||
future::Future,
|
||||
sync::atomic::{AtomicPtr, AtomicUsize, Ordering},
|
||||
task::{Context, Poll},
|
||||
};
|
||||
use alloc::{
|
||||
boxed::Box,
|
||||
sync::Arc,
|
||||
vec::Vec,
|
||||
};
|
||||
use super::asm::*;
|
||||
use alloc::boxed::Box;
|
||||
use super::{spin_lock_yield, notify_spin_lock};
|
||||
|
||||
|
||||
type Channel<T> = Vec<AtomicPtr<T>>;
|
||||
|
||||
/// Create a bounded channel
|
||||
///
|
||||
/// Returns `(tx, rx)` where one should be used one the local core,
|
||||
/// and the other is to be shared with another core.
|
||||
pub fn sync_channel<T>(bound: usize) -> (Sender<T>, Receiver<T>) {
|
||||
// allow for bound=0
|
||||
let len = bound + 1;
|
||||
let mut channel = Vec::with_capacity(len);
|
||||
for _ in 0..len {
|
||||
channel.push(AtomicPtr::default());
|
||||
}
|
||||
|
||||
let channel = Arc::new(channel);
|
||||
let sender = Sender {
|
||||
channel: channel.clone(),
|
||||
pos: 0,
|
||||
};
|
||||
let receiver = Receiver {
|
||||
channel: channel,
|
||||
pos: 0,
|
||||
};
|
||||
(sender, receiver)
|
||||
pub struct Sender<'a, T> where T: Clone {
|
||||
list: &'a [AtomicPtr<T>],
|
||||
write: &'a AtomicUsize,
|
||||
read: &'a AtomicUsize,
|
||||
}
|
||||
|
||||
/// Sending half of a channel
|
||||
pub struct Sender<T> {
|
||||
channel: Arc<Channel<T>>,
|
||||
pos: usize,
|
||||
pub struct Receiver<'a, T> where T: Clone {
|
||||
list: &'a [AtomicPtr<T>],
|
||||
write: &'a AtomicUsize,
|
||||
read: &'a AtomicUsize,
|
||||
}
|
||||
|
||||
impl<T> Sender<T> {
|
||||
/// Blocking send
|
||||
pub fn send<B: Into<Box<T>>>(&mut self, content: B) {
|
||||
let ptr = Box::into_raw(content.into());
|
||||
let entry = &self.channel[self.pos];
|
||||
// try to write the new pointer if the current pointer is
|
||||
// NULL, retrying while it is not NULL
|
||||
while entry.compare_and_swap(null_mut(), ptr, Ordering::Acquire) != null_mut() {
|
||||
// power-saving
|
||||
wfe();
|
||||
}
|
||||
dsb();
|
||||
// wake power-saving receivers
|
||||
sev();
|
||||
|
||||
// advance
|
||||
self.pos += 1;
|
||||
// wrap
|
||||
if self.pos >= self.channel.len() {
|
||||
self.pos = 0;
|
||||
}
|
||||
impl<'a, T> Sender<'a, T> where T: Clone {
|
||||
pub const fn new(list: &'static [AtomicPtr<T>], write: &'static AtomicUsize, read: &'static AtomicUsize) -> Self {
|
||||
Sender {list, write, read}
|
||||
}
|
||||
|
||||
/// Non-blocking send, handing you back ownership of the content on **failure**
|
||||
pub fn try_send<B: Into<Box<T>>>(&mut self, content: B) -> Option<Box<T>> {
|
||||
let ptr = Box::into_raw(content.into());
|
||||
let entry = &self.channel[self.pos];
|
||||
// try to write the new pointer if the current pointer is
|
||||
// NULL
|
||||
if entry.compare_and_swap(null_mut(), ptr, Ordering::Acquire) == null_mut() {
|
||||
dsb();
|
||||
// wake power-saving receivers
|
||||
sev();
|
||||
|
||||
// advance
|
||||
self.pos += 1;
|
||||
// wrap
|
||||
if self.pos >= self.channel.len() {
|
||||
self.pos = 0;
|
||||
}
|
||||
|
||||
// success
|
||||
None
|
||||
pub fn try_send<B: Into<Box<T>>>(&mut self, content: B) -> Result<(), B> {
|
||||
let write = self.write.load(Ordering::Relaxed);
|
||||
if (write + 1) % self.list.len() == self.read.load(Ordering::Acquire) {
|
||||
Err(content)
|
||||
} else {
|
||||
let content = unsafe { Box::from_raw(ptr) };
|
||||
// failure
|
||||
Some(content)
|
||||
let ptr = Box::into_raw(content.into());
|
||||
let entry = &self.list[write];
|
||||
let prev = entry.swap(ptr, Ordering::Relaxed);
|
||||
// we allow other end get it first
|
||||
self.write.store((write + 1) % self.list.len(), Ordering::Release);
|
||||
notify_spin_lock();
|
||||
if !prev.is_null() {
|
||||
unsafe {
|
||||
Box::from_raw(prev);
|
||||
}
|
||||
}
|
||||
Ok(())
|
||||
}
|
||||
}
|
||||
|
||||
pub fn send<B: Into<Box<T>>>(&mut self, content: B) {
|
||||
let mut content = content;
|
||||
while let Err(back) = self.try_send(content) {
|
||||
content = back;
|
||||
spin_lock_yield();
|
||||
}
|
||||
}
|
||||
|
||||
pub async fn async_send<B: Into<Box<T>>>(&mut self, content: B) {
|
||||
struct Send<'a, T> {
|
||||
sender: &'a mut Sender<T>,
|
||||
content: Option<Box<T>>,
|
||||
struct Send<'a, 'b, T> where T: Clone, 'b: 'a {
|
||||
sender: &'a mut Sender<'b, T>,
|
||||
content: Result<(), Box<T>>,
|
||||
}
|
||||
|
||||
impl<T> Future for Send<'_, T> {
|
||||
impl<T> Future for Send<'_, '_, T> where T: Clone {
|
||||
type Output = ();
|
||||
|
||||
fn poll(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
|
||||
match self.content.take() {
|
||||
Some(content) => {
|
||||
if let Some(content) = self.sender.try_send(content) {
|
||||
match core::mem::replace(&mut self.content, Ok(())) {
|
||||
Err(content) => {
|
||||
if let Err(content) = self.sender.try_send(content) {
|
||||
// failure
|
||||
self.content = Some(content);
|
||||
self.content = Err(content);
|
||||
cx.waker().wake_by_ref();
|
||||
Poll::Pending
|
||||
} else {
|
||||
|
@ -117,93 +74,80 @@ impl<T> Sender<T> {
|
|||
Poll::Ready(())
|
||||
}
|
||||
}
|
||||
None => panic!("Send future polled after success"),
|
||||
Ok(_) => panic!("Send future polled after success"),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
Send {
|
||||
sender: self,
|
||||
content: Some(content.into()),
|
||||
content: Err(content.into()),
|
||||
}.await
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
|
||||
|
||||
/// Receiving half of a channel
|
||||
pub struct Receiver<T> {
|
||||
channel: Arc<Channel<T>>,
|
||||
pos: usize,
|
||||
}
|
||||
|
||||
impl<T> Receiver<T> {
|
||||
/// Blocking receive
|
||||
pub fn recv(&mut self) -> Box<T> {
|
||||
let entry = &self.channel[self.pos];
|
||||
|
||||
loop {
|
||||
dmb();
|
||||
let ptr = entry.swap(null_mut(), Ordering::Release);
|
||||
if ptr != null_mut() {
|
||||
dsb();
|
||||
// wake power-saving senders
|
||||
sev();
|
||||
|
||||
let content = unsafe { Box::from_raw(ptr) };
|
||||
|
||||
// advance
|
||||
self.pos += 1;
|
||||
// wrap
|
||||
if self.pos >= self.channel.len() {
|
||||
self.pos = 0;
|
||||
}
|
||||
|
||||
return content;
|
||||
/// free all items in the queue. It is the user's responsibility to
|
||||
/// ensure no reader is trying to copy the data.
|
||||
pub unsafe fn drop_elements(&mut self) {
|
||||
for v in self.list.iter() {
|
||||
let original = v.swap(core::ptr::null_mut(), Ordering::Relaxed);
|
||||
if !original.is_null() {
|
||||
Box::from_raw(original);
|
||||
}
|
||||
|
||||
// power-saving
|
||||
wfe();
|
||||
}
|
||||
}
|
||||
|
||||
/// Non-blocking receive
|
||||
pub fn try_recv(&mut self) -> Option<Box<T>> {
|
||||
let entry = &self.channel[self.pos];
|
||||
/// Reset the `sync_channel`, *forget* all items in the queue. Affects both the sender and
|
||||
/// receiver.
|
||||
pub unsafe fn reset(&mut self) {
|
||||
self.write.store(0, Ordering::Relaxed);
|
||||
self.read.store(0, Ordering::Relaxed);
|
||||
for v in self.list.iter() {
|
||||
v.store(core::ptr::null_mut(), Ordering::Relaxed);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
dmb();
|
||||
let ptr = entry.swap(null_mut(), Ordering::Release);
|
||||
if ptr != null_mut() {
|
||||
dsb();
|
||||
// wake power-saving senders
|
||||
sev();
|
||||
impl<'a, T> Receiver<'a, T> where T: Clone {
|
||||
pub const fn new(list: &'static [AtomicPtr<T>], write: &'static AtomicUsize, read: &'static AtomicUsize) -> Self {
|
||||
Receiver {list, write, read}
|
||||
}
|
||||
|
||||
let content = unsafe { Box::from_raw(ptr) };
|
||||
|
||||
// advance
|
||||
self.pos += 1;
|
||||
// wrap
|
||||
if self.pos >= self.channel.len() {
|
||||
self.pos = 0;
|
||||
}
|
||||
|
||||
Some(content)
|
||||
pub fn try_recv(&mut self) -> Result<T, ()> {
|
||||
let read = self.read.load(Ordering::Relaxed);
|
||||
if read == self.write.load(Ordering::Acquire) {
|
||||
Err(())
|
||||
} else {
|
||||
None
|
||||
let entry = &self.list[read];
|
||||
let data = unsafe {
|
||||
// we cannot deallocate the box
|
||||
Box::leak(Box::from_raw(entry.load(Ordering::Relaxed)))
|
||||
};
|
||||
let result = data.clone();
|
||||
self.read.store((read + 1) % self.list.len(), Ordering::Release);
|
||||
notify_spin_lock();
|
||||
Ok(result)
|
||||
}
|
||||
}
|
||||
|
||||
pub async fn async_recv(&mut self) -> Box<T> {
|
||||
struct Recv<'a, T> {
|
||||
receiver: &'a mut Receiver<T>,
|
||||
pub fn recv(&mut self) -> T {
|
||||
loop {
|
||||
if let Ok(data) = self.try_recv() {
|
||||
return data;
|
||||
}
|
||||
spin_lock_yield();
|
||||
}
|
||||
}
|
||||
|
||||
pub async fn async_recv(&mut self) -> T {
|
||||
struct Recv<'a, 'b, T> where T: Clone, 'b: 'a {
|
||||
receiver: &'a mut Receiver<'b, T>,
|
||||
}
|
||||
|
||||
impl<T> Future for Recv<'_, T> {
|
||||
type Output = Box<T>;
|
||||
impl<T> Future for Recv<'_, '_, T> where T: Clone {
|
||||
type Output = T;
|
||||
|
||||
fn poll(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
|
||||
if let Some(content) = self.receiver.try_recv() {
|
||||
if let Ok(content) = self.receiver.try_recv() {
|
||||
Poll::Ready(content)
|
||||
} else {
|
||||
cx.waker().wake_by_ref();
|
||||
|
@ -218,10 +162,26 @@ impl<T> Receiver<T> {
|
|||
}
|
||||
}
|
||||
|
||||
impl<T> Iterator for Receiver<T> {
|
||||
type Item = Box<T>;
|
||||
impl<'a, T> Iterator for Receiver<'a, T> where T: Clone {
|
||||
type Item = T;
|
||||
|
||||
fn next(&mut self) -> Option<Self::Item> {
|
||||
Some(self.recv())
|
||||
}
|
||||
}
|
||||
|
||||
#[macro_export]
|
||||
/// Macro for initializing the sync_channel with static buffer and indexes.
|
||||
/// Note that this requires `#![feature(const_in_array_repeat_expressions)]`
|
||||
macro_rules! sync_channel {
|
||||
($t: ty, $cap: expr) => {
|
||||
{
|
||||
use core::sync::atomic::{AtomicUsize, AtomicPtr};
|
||||
use $crate::sync_channel::{Sender, Receiver};
|
||||
static LIST: [AtomicPtr<$t>; $cap + 1] = [AtomicPtr::new(core::ptr::null_mut()); $cap + 1];
|
||||
static WRITE: AtomicUsize = AtomicUsize::new(0);
|
||||
static READ: AtomicUsize = AtomicUsize::new(0);
|
||||
(Sender::new(&LIST, &WRITE, &READ), Receiver::new(&LIST, &WRITE, &READ))
|
||||
}
|
||||
};
|
||||
}
|
||||
|
|
|
@ -2,7 +2,7 @@ use core::{
|
|||
ops::{Deref, DerefMut},
|
||||
mem::{align_of, size_of},
|
||||
};
|
||||
use alloc::alloc::{dealloc, Layout, LayoutErr};
|
||||
use alloc::alloc::{dealloc, Layout, LayoutError};
|
||||
use crate::mmu::{L1_PAGE_SIZE, L1Table};
|
||||
|
||||
pub struct UncachedSlice<T: 'static> {
|
||||
|
@ -12,7 +12,7 @@ pub struct UncachedSlice<T: 'static> {
|
|||
|
||||
impl<T> UncachedSlice<T> {
|
||||
/// allocates in chunks of 1 MB
|
||||
pub fn new<F: Fn() -> T>(len: usize, default: F) -> Result<Self, LayoutErr> {
|
||||
pub fn new<F: Fn() -> T>(len: usize, default: F) -> Result<Self, LayoutError> {
|
||||
// round to full pages
|
||||
let size = ((len * size_of::<T>() - 1) | (L1_PAGE_SIZE - 1)) + 1;
|
||||
let align = align_of::<T>()
|
||||
|
@ -23,9 +23,11 @@ impl<T> UncachedSlice<T> {
|
|||
assert_eq!(start & (L1_PAGE_SIZE - 1), 0);
|
||||
|
||||
for page_start in (start..(start + size)).step_by(L1_PAGE_SIZE) {
|
||||
// non-shareable device
|
||||
L1Table::get()
|
||||
.update(page_start as *const (), |l1_section| {
|
||||
l1_section.cacheable = false;
|
||||
l1_section.tex = 0b10;
|
||||
l1_section.cacheable = true;
|
||||
l1_section.bufferable = false;
|
||||
});
|
||||
}
|
||||
|
|
|
@ -1,7 +1,7 @@
|
|||
[package]
|
||||
name = "libregister"
|
||||
version = "0.0.0"
|
||||
authors = ["Astro <astro@spaceboyz.net>"]
|
||||
authors = ["M-Labs"]
|
||||
edition = "2018"
|
||||
|
||||
[dependencies]
|
||||
|
|
|
@ -30,8 +30,9 @@ pub trait RegisterRW: RegisterR + RegisterW {
|
|||
#[doc(hidden)]
|
||||
#[macro_export]
|
||||
macro_rules! register_common {
|
||||
($mod_name: ident, $struct_name: ident, $access: ty, $inner: ty) => (
|
||||
($mod_name: ident, $(#[$outer:meta])* $struct_name: ident, $access: ty, $inner: ty) => (
|
||||
#[repr(C)]
|
||||
$(#[$outer])*
|
||||
pub struct $struct_name {
|
||||
inner: $access,
|
||||
}
|
||||
|
@ -52,7 +53,7 @@ macro_rules! register_common {
|
|||
#[macro_export]
|
||||
macro_rules! register_r {
|
||||
($mod_name: ident, $struct_name: ident) => (
|
||||
impl libregister::RegisterR for $struct_name {
|
||||
impl $crate::RegisterR for $struct_name {
|
||||
type R = $mod_name::Read;
|
||||
|
||||
#[inline]
|
||||
|
@ -67,7 +68,7 @@ macro_rules! register_r {
|
|||
#[macro_export]
|
||||
macro_rules! register_w {
|
||||
($mod_name: ident, $struct_name: ident) => (
|
||||
impl libregister::RegisterW for $struct_name {
|
||||
impl $crate::RegisterW for $struct_name {
|
||||
type W = $mod_name::Write;
|
||||
|
||||
#[inline]
|
||||
|
@ -88,7 +89,7 @@ macro_rules! register_w {
|
|||
#[macro_export]
|
||||
macro_rules! register_rw {
|
||||
($mod_name: ident, $struct_name: ident) => (
|
||||
impl libregister::RegisterRW for $struct_name {
|
||||
impl $crate::RegisterRW for $struct_name {
|
||||
#[inline]
|
||||
fn modify<F: FnOnce(Self::R, Self::W) -> Self::W>(&mut self, f: F) {
|
||||
unsafe {
|
||||
|
@ -101,7 +102,7 @@ macro_rules! register_rw {
|
|||
}
|
||||
);
|
||||
($mod_name: ident, $struct_name: ident, $mask: expr) => (
|
||||
impl libregister::RegisterRW for $struct_name {
|
||||
impl $crate::RegisterRW for $struct_name {
|
||||
#[inline]
|
||||
fn modify<F: FnOnce(Self::R, Self::W) -> Self::W>(&mut self, f: F) {
|
||||
unsafe {
|
||||
|
@ -119,7 +120,7 @@ macro_rules! register_rw {
|
|||
#[macro_export]
|
||||
macro_rules! register_vcell {
|
||||
($mod_name: ident, $struct_name: ident) => (
|
||||
impl libregister::RegisterR for $struct_name {
|
||||
impl $crate::RegisterR for $struct_name {
|
||||
type R = $mod_name::Read;
|
||||
|
||||
#[inline]
|
||||
|
@ -128,7 +129,7 @@ macro_rules! register_vcell {
|
|||
$mod_name::Read { inner }
|
||||
}
|
||||
}
|
||||
impl libregister::RegisterW for $struct_name {
|
||||
impl $crate::RegisterW for $struct_name {
|
||||
type W = $mod_name::Write;
|
||||
|
||||
#[inline]
|
||||
|
@ -141,7 +142,7 @@ macro_rules! register_vcell {
|
|||
self.inner.set(w.inner);
|
||||
}
|
||||
}
|
||||
impl libregister::RegisterRW for $struct_name {
|
||||
impl $crate::RegisterRW for $struct_name {
|
||||
#[inline]
|
||||
fn modify<F: FnOnce(Self::R, Self::W) -> Self::W>(&mut self, f: F) {
|
||||
let r = self.read();
|
||||
|
@ -157,37 +158,37 @@ macro_rules! register_vcell {
|
|||
#[macro_export]
|
||||
macro_rules! register {
|
||||
// Define read-only register
|
||||
($mod_name: ident, $struct_name: ident, RO, $inner: ty) => (
|
||||
libregister::register_common!($mod_name, $struct_name, libregister::RO<$inner>, $inner);
|
||||
libregister::register_r!($mod_name, $struct_name);
|
||||
($mod_name: ident, $(#[$outer:meta])* $struct_name: ident, RO, $inner: ty) => (
|
||||
$crate::register_common!($mod_name, $(#[$outer])* $struct_name, $crate::RO<$inner>, $inner);
|
||||
$crate::register_r!($mod_name, $struct_name);
|
||||
);
|
||||
|
||||
// Define write-only register
|
||||
($mod_name: ident, $struct_name: ident, WO, $inner: ty) => (
|
||||
libregister::register_common!($mod_name, $struct_name, volatile_register::WO<$inner>, $inner);
|
||||
libregister::register_w!($mod_name, $struct_name);
|
||||
($mod_name: ident, $(#[$outer:meta])* $struct_name: ident, WO, $inner: ty) => (
|
||||
$crate::register_common!($mod_name, $(#[$outer])* $struct_name, volatile_register::WO<$inner>, $inner);
|
||||
$crate::register_w!($mod_name, $struct_name);
|
||||
);
|
||||
|
||||
// Define read-write register
|
||||
($mod_name: ident, $struct_name: ident, RW, $inner: ty) => (
|
||||
libregister::register_common!($mod_name, $struct_name, volatile_register::RW<$inner>, $inner);
|
||||
libregister::register_r!($mod_name, $struct_name);
|
||||
libregister::register_w!($mod_name, $struct_name);
|
||||
libregister::register_rw!($mod_name, $struct_name);
|
||||
($mod_name: ident, $(#[$outer:meta])* $struct_name: ident, RW, $inner: ty) => (
|
||||
$crate::register_common!($mod_name, $(#[$outer])* $struct_name, volatile_register::RW<$inner>, $inner);
|
||||
$crate::register_r!($mod_name, $struct_name);
|
||||
$crate::register_w!($mod_name, $struct_name);
|
||||
$crate::register_rw!($mod_name, $struct_name);
|
||||
);
|
||||
|
||||
// Define read-write register
|
||||
($mod_name: ident, $struct_name: ident, VolatileCell, $inner: ty) => (
|
||||
libregister::register_common!($mod_name, $struct_name, VolatileCell<$inner>, $inner);
|
||||
libregister::register_vcell!($mod_name, $struct_name);
|
||||
($mod_name: ident, $(#[$outer:meta])* $struct_name: ident, VolatileCell, $inner: ty) => (
|
||||
$crate::register_common!($mod_name, $(#[$outer])* $struct_name, VolatileCell<$inner>, $inner);
|
||||
$crate::register_vcell!($mod_name, $struct_name);
|
||||
);
|
||||
|
||||
// Define read-write register with mask on write (for WTC mixed access.)
|
||||
($mod_name: ident, $struct_name: ident, RW, $inner: ty, $mask: expr) => (
|
||||
libregister::register_common!($mod_name, $struct_name, volatile_register::RW<$inner>, $inner);
|
||||
libregister::register_r!($mod_name, $struct_name);
|
||||
libregister::register_w!($mod_name, $struct_name);
|
||||
libregister::register_rw!($mod_name, $struct_name, $mask);
|
||||
($mod_name: ident, $(#[$outer:meta])* $struct_name: ident, RW, $inner: ty, $mask: expr) => (
|
||||
$crate::register_common!($mod_name, $(#[$outer])* $struct_name, volatile_register::RW<$inner>, $inner);
|
||||
$crate::register_r!($mod_name, $struct_name);
|
||||
$crate::register_w!($mod_name, $struct_name);
|
||||
$crate::register_rw!($mod_name, $struct_name, $mask);
|
||||
);
|
||||
}
|
||||
|
||||
|
|
|
@ -2,17 +2,28 @@
|
|||
name = "libsupport_zynq"
|
||||
description = "Software support for running in the Zynq PS"
|
||||
version = "0.0.0"
|
||||
authors = ["Astro <astro@spaceboyz.net>"]
|
||||
authors = ["M-Labs"]
|
||||
edition = "2018"
|
||||
|
||||
[features]
|
||||
target_zc706 = ["libboard_zynq/target_zc706"]
|
||||
target_cora_z7_10 = ["libboard_zynq/target_cora_z7_10"]
|
||||
target_coraz7 = ["libboard_zynq/target_coraz7"]
|
||||
target_redpitaya = ["libboard_zynq/target_redpitaya"]
|
||||
target_kasli_soc = ["libboard_zynq/target_kasli_soc"]
|
||||
panic_handler = []
|
||||
dummy_irq_handler = []
|
||||
dummy_fiq_handler = []
|
||||
alloc_core = []
|
||||
|
||||
default = ["panic_handler", "dummy_irq_handler", "dummy_fiq_handler"]
|
||||
|
||||
[dependencies]
|
||||
r0 = "1"
|
||||
compiler_builtins = "0.1"
|
||||
linked_list_allocator = { version = "0.8", default-features = false }
|
||||
compiler_builtins = "=0.1.39"
|
||||
linked_list_allocator = { version = "0.8", default-features = false, features = ["const_mut_refs"] }
|
||||
libregister = { path = "../libregister" }
|
||||
libcortex_a9 = { path = "../libcortex_a9" }
|
||||
libboard_zynq = { path = "../libboard_zynq" }
|
||||
|
||||
[build-dependencies]
|
||||
cc = { version = "1.0" }
|
||||
|
|
|
@ -0,0 +1,24 @@
|
|||
fn main() {
|
||||
println!("cargo:rerun-if-changed=build.rs");
|
||||
compile_memcpy();
|
||||
}
|
||||
|
||||
fn compile_memcpy() {
|
||||
use std::path::Path;
|
||||
extern crate cc;
|
||||
let cfg = &mut cc::Build::new();
|
||||
cfg.compiler("clang");
|
||||
cfg.no_default_flags(true);
|
||||
cfg.warnings(false);
|
||||
cfg.flag("--target=armv7-none-eabihf");
|
||||
let sources = vec![
|
||||
"memcpy.S",
|
||||
];
|
||||
let root = Path::new("src/asm");
|
||||
for src in sources {
|
||||
println!("cargo:rerun-if-changed={}", src);
|
||||
cfg.file(root.join(src));
|
||||
}
|
||||
cfg.compile("memcpy");
|
||||
}
|
||||
|
|
@ -1,21 +0,0 @@
|
|||
use libboard_zynq::{println, slcr, stdio};
|
||||
|
||||
#[no_mangle]
|
||||
pub unsafe extern "C" fn PrefetchAbort() {
|
||||
stdio::drop_uart();
|
||||
|
||||
println!("PrefetchAbort");
|
||||
|
||||
slcr::RegisterBlock::unlocked(|slcr| slcr.soft_reset());
|
||||
loop {}
|
||||
}
|
||||
|
||||
#[no_mangle]
|
||||
pub unsafe extern "C" fn DataAbort() {
|
||||
stdio::drop_uart();
|
||||
|
||||
println!("DataAbort");
|
||||
|
||||
slcr::RegisterBlock::unlocked(|slcr| slcr.soft_reset());
|
||||
loop {}
|
||||
}
|
|
@ -0,0 +1,626 @@
|
|||
/* Copyright (c) 2013, Linaro Limited
|
||||
All rights reserved.
|
||||
|
||||
Redistribution and use in source and binary forms, with or without
|
||||
modification, are permitted provided that the following conditions
|
||||
are met:
|
||||
|
||||
* Redistributions of source code must retain the above copyright
|
||||
notice, this list of conditions and the following disclaimer.
|
||||
|
||||
* Redistributions in binary form must reproduce the above copyright
|
||||
notice, this list of conditions and the following disclaimer in the
|
||||
documentation and/or other materials provided with the distribution.
|
||||
|
||||
* Neither the name of Linaro Limited nor the names of its
|
||||
contributors may be used to endorse or promote products derived
|
||||
from this software without specific prior written permission.
|
||||
|
||||
THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS
|
||||
"AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT
|
||||
LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR
|
||||
A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT
|
||||
HOLDER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL,
|
||||
SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT
|
||||
LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE,
|
||||
DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY
|
||||
THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT
|
||||
(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE
|
||||
OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
|
||||
|
||||
This memcpy routine is optimised for Cortex-A15 cores and takes advantage
|
||||
of VFP or NEON when built with the appropriate flags.
|
||||
|
||||
Assumptions:
|
||||
|
||||
ARMv6 (ARMv7-a if using Neon)
|
||||
ARM state
|
||||
Unaligned accesses
|
||||
LDRD/STRD support unaligned word accesses
|
||||
|
||||
If compiled with GCC, this file should be enclosed within following
|
||||
pre-processing check:
|
||||
if defined (__ARM_ARCH_7A__) && defined (__ARM_FEATURE_UNALIGNED)
|
||||
|
||||
*/
|
||||
.syntax unified
|
||||
/* This implementation requires ARM state. */
|
||||
.arm
|
||||
|
||||
#ifdef __ARM_NEON__
|
||||
|
||||
.fpu neon
|
||||
.arch armv7-a
|
||||
# define FRAME_SIZE 4
|
||||
# define USE_VFP
|
||||
# define USE_NEON
|
||||
|
||||
#elif !defined (__SOFTFP__)
|
||||
|
||||
.arch armv6
|
||||
.fpu vfpv2
|
||||
# define FRAME_SIZE 32
|
||||
# define USE_VFP
|
||||
|
||||
#else
|
||||
.arch armv6
|
||||
# define FRAME_SIZE 32
|
||||
|
||||
#endif
|
||||
|
||||
/* Old versions of GAS incorrectly implement the NEON align semantics. */
|
||||
#ifdef BROKEN_ASM_NEON_ALIGN
|
||||
#define ALIGN(addr, align) addr,:align
|
||||
#else
|
||||
#define ALIGN(addr, align) addr:align
|
||||
#endif
|
||||
|
||||
#define PC_OFFSET 8 /* PC pipeline compensation. */
|
||||
#define INSN_SIZE 4
|
||||
|
||||
/* Call parameters. */
|
||||
#define dstin r0
|
||||
#define src r1
|
||||
#define count r2
|
||||
|
||||
/* Locals. */
|
||||
#define tmp1 r3
|
||||
#define dst ip
|
||||
#define tmp2 r10
|
||||
|
||||
#ifndef USE_NEON
|
||||
/* For bulk copies using GP registers. */
|
||||
#define A_l r2 /* Call-clobbered. */
|
||||
#define A_h r3 /* Call-clobbered. */
|
||||
#define B_l r4
|
||||
#define B_h r5
|
||||
#define C_l r6
|
||||
#define C_h r7
|
||||
#define D_l r8
|
||||
#define D_h r9
|
||||
#endif
|
||||
|
||||
/* Number of lines ahead to pre-fetch data. If you change this the code
|
||||
below will need adjustment to compensate. */
|
||||
|
||||
#define prefetch_lines 5
|
||||
|
||||
#ifdef USE_VFP
|
||||
.macro cpy_line_vfp vreg, base
|
||||
vstr \vreg, [dst, #\base]
|
||||
vldr \vreg, [src, #\base]
|
||||
vstr d0, [dst, #\base + 8]
|
||||
vldr d0, [src, #\base + 8]
|
||||
vstr d1, [dst, #\base + 16]
|
||||
vldr d1, [src, #\base + 16]
|
||||
vstr d2, [dst, #\base + 24]
|
||||
vldr d2, [src, #\base + 24]
|
||||
vstr \vreg, [dst, #\base + 32]
|
||||
vldr \vreg, [src, #\base + prefetch_lines * 64 - 32]
|
||||
vstr d0, [dst, #\base + 40]
|
||||
vldr d0, [src, #\base + 40]
|
||||
vstr d1, [dst, #\base + 48]
|
||||
vldr d1, [src, #\base + 48]
|
||||
vstr d2, [dst, #\base + 56]
|
||||
vldr d2, [src, #\base + 56]
|
||||
.endm
|
||||
|
||||
.macro cpy_tail_vfp vreg, base
|
||||
vstr \vreg, [dst, #\base]
|
||||
vldr \vreg, [src, #\base]
|
||||
vstr d0, [dst, #\base + 8]
|
||||
vldr d0, [src, #\base + 8]
|
||||
vstr d1, [dst, #\base + 16]
|
||||
vldr d1, [src, #\base + 16]
|
||||
vstr d2, [dst, #\base + 24]
|
||||
vldr d2, [src, #\base + 24]
|
||||
vstr \vreg, [dst, #\base + 32]
|
||||
vstr d0, [dst, #\base + 40]
|
||||
vldr d0, [src, #\base + 40]
|
||||
vstr d1, [dst, #\base + 48]
|
||||
vldr d1, [src, #\base + 48]
|
||||
vstr d2, [dst, #\base + 56]
|
||||
vldr d2, [src, #\base + 56]
|
||||
.endm
|
||||
#endif
|
||||
|
||||
.macro def_fn f p2align=0
|
||||
.text
|
||||
.p2align \p2align
|
||||
.global \f
|
||||
.type \f, %function
|
||||
\f:
|
||||
.endm
|
||||
|
||||
.global __aeabi_memcpy
|
||||
.global __aeabi_memcpy4
|
||||
.global __aeabi_memcpy8
|
||||
.set __aeabi_memcpy, fast_memcpy
|
||||
.set __aeabi_memcpy4, fast_memcpy
|
||||
.set __aeabi_memcpy8, fast_memcpy
|
||||
def_fn fast_memcpy p2align=6
|
||||
|
||||
mov dst, dstin /* Preserve dstin, we need to return it. */
|
||||
cmp count, #64
|
||||
bge .Lcpy_not_short
|
||||
/* Deal with small copies quickly by dropping straight into the
|
||||
exit block. */
|
||||
|
||||
.Ltail63unaligned:
|
||||
#ifdef USE_NEON
|
||||
and tmp1, count, #0x38
|
||||
rsb tmp1, tmp1, #(56 - PC_OFFSET + INSN_SIZE)
|
||||
add pc, pc, tmp1
|
||||
vld1.8 {d0}, [src]! /* 14 words to go. */
|
||||
vst1.8 {d0}, [dst]!
|
||||
vld1.8 {d0}, [src]! /* 12 words to go. */
|
||||
vst1.8 {d0}, [dst]!
|
||||
vld1.8 {d0}, [src]! /* 10 words to go. */
|
||||
vst1.8 {d0}, [dst]!
|
||||
vld1.8 {d0}, [src]! /* 8 words to go. */
|
||||
vst1.8 {d0}, [dst]!
|
||||
vld1.8 {d0}, [src]! /* 6 words to go. */
|
||||
vst1.8 {d0}, [dst]!
|
||||
vld1.8 {d0}, [src]! /* 4 words to go. */
|
||||
vst1.8 {d0}, [dst]!
|
||||
vld1.8 {d0}, [src]! /* 2 words to go. */
|
||||
vst1.8 {d0}, [dst]!
|
||||
|
||||
tst count, #4
|
||||
ldrne tmp1, [src], #4
|
||||
strne tmp1, [dst], #4
|
||||
#else
|
||||
/* Copy up to 15 full words of data. May not be aligned. */
|
||||
/* Cannot use VFP for unaligned data. */
|
||||
and tmp1, count, #0x3c
|
||||
add dst, dst, tmp1
|
||||
add src, src, tmp1
|
||||
rsb tmp1, tmp1, #(60 - PC_OFFSET/2 + INSN_SIZE/2)
|
||||
/* Jump directly into the sequence below at the correct offset. */
|
||||
add pc, pc, tmp1, lsl #1
|
||||
|
||||
ldr tmp1, [src, #-60] /* 15 words to go. */
|
||||
str tmp1, [dst, #-60]
|
||||
|
||||
ldr tmp1, [src, #-56] /* 14 words to go. */
|
||||
str tmp1, [dst, #-56]
|
||||
ldr tmp1, [src, #-52]
|
||||
str tmp1, [dst, #-52]
|
||||
|
||||
ldr tmp1, [src, #-48] /* 12 words to go. */
|
||||
str tmp1, [dst, #-48]
|
||||
ldr tmp1, [src, #-44]
|
||||
str tmp1, [dst, #-44]
|
||||
|
||||
ldr tmp1, [src, #-40] /* 10 words to go. */
|
||||
str tmp1, [dst, #-40]
|
||||
ldr tmp1, [src, #-36]
|
||||
str tmp1, [dst, #-36]
|
||||
|
||||
ldr tmp1, [src, #-32] /* 8 words to go. */
|
||||
str tmp1, [dst, #-32]
|
||||
ldr tmp1, [src, #-28]
|
||||
str tmp1, [dst, #-28]
|
||||
|
||||
ldr tmp1, [src, #-24] /* 6 words to go. */
|
||||
str tmp1, [dst, #-24]
|
||||
ldr tmp1, [src, #-20]
|
||||
str tmp1, [dst, #-20]
|
||||
|
||||
ldr tmp1, [src, #-16] /* 4 words to go. */
|
||||
str tmp1, [dst, #-16]
|
||||
ldr tmp1, [src, #-12]
|
||||
str tmp1, [dst, #-12]
|
||||
|
||||
ldr tmp1, [src, #-8] /* 2 words to go. */
|
||||
str tmp1, [dst, #-8]
|
||||
ldr tmp1, [src, #-4]
|
||||
str tmp1, [dst, #-4]
|
||||
#endif
|
||||
|
||||
lsls count, count, #31
|
||||
ldrhcs tmp1, [src], #2
|
||||
ldrbne src, [src] /* Src is dead, use as a scratch. */
|
||||
strhcs tmp1, [dst], #2
|
||||
strbne src, [dst]
|
||||
bx lr
|
||||
|
||||
.Lcpy_not_short:
|
||||
/* At least 64 bytes to copy, but don't know the alignment yet. */
|
||||
str tmp2, [sp, #-FRAME_SIZE]!
|
||||
and tmp2, src, #7
|
||||
and tmp1, dst, #7
|
||||
cmp tmp1, tmp2
|
||||
bne .Lcpy_notaligned
|
||||
|
||||
#ifdef USE_VFP
|
||||
/* Magic dust alert! Force VFP on Cortex-A9. Experiments show
|
||||
that the FP pipeline is much better at streaming loads and
|
||||
stores. This is outside the critical loop. */
|
||||
vmov.f32 s0, s0
|
||||
#endif
|
||||
|
||||
/* SRC and DST have the same mutual 32-bit alignment, but we may
|
||||
still need to pre-copy some bytes to get to natural alignment.
|
||||
We bring DST into full 64-bit alignment. */
|
||||
lsls tmp2, dst, #29
|
||||
beq 1f
|
||||
rsbs tmp2, tmp2, #0
|
||||
sub count, count, tmp2, lsr #29
|
||||
ldrmi tmp1, [src], #4
|
||||
strmi tmp1, [dst], #4
|
||||
lsls tmp2, tmp2, #2
|
||||
ldrhcs tmp1, [src], #2
|
||||
ldrbne tmp2, [src], #1
|
||||
strhcs tmp1, [dst], #2
|
||||
strbne tmp2, [dst], #1
|
||||
|
||||
1:
|
||||
subs tmp2, count, #64 /* Use tmp2 for count. */
|
||||
blt .Ltail63aligned
|
||||
|
||||
cmp tmp2, #512
|
||||
bge .Lcpy_body_long
|
||||
|
||||
.Lcpy_body_medium: /* Count in tmp2. */
|
||||
#ifdef USE_VFP
|
||||
1:
|
||||
vldr d0, [src, #0]
|
||||
subs tmp2, tmp2, #64
|
||||
vldr d1, [src, #8]
|
||||
vstr d0, [dst, #0]
|
||||
vldr d0, [src, #16]
|
||||
vstr d1, [dst, #8]
|
||||
vldr d1, [src, #24]
|
||||
vstr d0, [dst, #16]
|
||||
vldr d0, [src, #32]
|
||||
vstr d1, [dst, #24]
|
||||
vldr d1, [src, #40]
|
||||
vstr d0, [dst, #32]
|
||||
vldr d0, [src, #48]
|
||||
vstr d1, [dst, #40]
|
||||
vldr d1, [src, #56]
|
||||
vstr d0, [dst, #48]
|
||||
add src, src, #64
|
||||
vstr d1, [dst, #56]
|
||||
add dst, dst, #64
|
||||
bge 1b
|
||||
tst tmp2, #0x3f
|
||||
beq .Ldone
|
||||
|
||||
.Ltail63aligned: /* Count in tmp2. */
|
||||
and tmp1, tmp2, #0x38
|
||||
add dst, dst, tmp1
|
||||
add src, src, tmp1
|
||||
rsb tmp1, tmp1, #(56 - PC_OFFSET + INSN_SIZE)
|
||||
add pc, pc, tmp1
|
||||
|
||||
vldr d0, [src, #-56] /* 14 words to go. */
|
||||
vstr d0, [dst, #-56]
|
||||
vldr d0, [src, #-48] /* 12 words to go. */
|
||||
vstr d0, [dst, #-48]
|
||||
vldr d0, [src, #-40] /* 10 words to go. */
|
||||
vstr d0, [dst, #-40]
|
||||
vldr d0, [src, #-32] /* 8 words to go. */
|
||||
vstr d0, [dst, #-32]
|
||||
vldr d0, [src, #-24] /* 6 words to go. */
|
||||
vstr d0, [dst, #-24]
|
||||
vldr d0, [src, #-16] /* 4 words to go. */
|
||||
vstr d0, [dst, #-16]
|
||||
vldr d0, [src, #-8] /* 2 words to go. */
|
||||
vstr d0, [dst, #-8]
|
||||
#else
|
||||
sub src, src, #8
|
||||
sub dst, dst, #8
|
||||
1:
|
||||
ldrd A_l, A_h, [src, #8]
|
||||
strd A_l, A_h, [dst, #8]
|
||||
ldrd A_l, A_h, [src, #16]
|
||||
strd A_l, A_h, [dst, #16]
|
||||
ldrd A_l, A_h, [src, #24]
|
||||
strd A_l, A_h, [dst, #24]
|
||||
ldrd A_l, A_h, [src, #32]
|
||||
strd A_l, A_h, [dst, #32]
|
||||
ldrd A_l, A_h, [src, #40]
|
||||
strd A_l, A_h, [dst, #40]
|
||||
ldrd A_l, A_h, [src, #48]
|
||||
strd A_l, A_h, [dst, #48]
|
||||
ldrd A_l, A_h, [src, #56]
|
||||
strd A_l, A_h, [dst, #56]
|
||||
ldrd A_l, A_h, [src, #64]!
|
||||
strd A_l, A_h, [dst, #64]!
|
||||
subs tmp2, tmp2, #64
|
||||
bge 1b
|
||||
tst tmp2, #0x3f
|
||||
bne 1f
|
||||
ldr tmp2,[sp], #FRAME_SIZE
|
||||
bx lr
|
||||
1:
|
||||
add src, src, #8
|
||||
add dst, dst, #8
|
||||
|
||||
.Ltail63aligned: /* Count in tmp2. */
|
||||
/* Copy up to 7 d-words of data. Similar to Ltail63unaligned, but
|
||||
we know that the src and dest are 32-bit aligned so we can use
|
||||
LDRD/STRD to improve efficiency. */
|
||||
/* TMP2 is now negative, but we don't care about that. The bottom
|
||||
six bits still tell us how many bytes are left to copy. */
|
||||
|
||||
and tmp1, tmp2, #0x38
|
||||
add dst, dst, tmp1
|
||||
add src, src, tmp1
|
||||
rsb tmp1, tmp1, #(56 - PC_OFFSET + INSN_SIZE)
|
||||
add pc, pc, tmp1
|
||||
ldrd A_l, A_h, [src, #-56] /* 14 words to go. */
|
||||
strd A_l, A_h, [dst, #-56]
|
||||
ldrd A_l, A_h, [src, #-48] /* 12 words to go. */
|
||||
strd A_l, A_h, [dst, #-48]
|
||||
ldrd A_l, A_h, [src, #-40] /* 10 words to go. */
|
||||
strd A_l, A_h, [dst, #-40]
|
||||
ldrd A_l, A_h, [src, #-32] /* 8 words to go. */
|
||||
strd A_l, A_h, [dst, #-32]
|
||||
ldrd A_l, A_h, [src, #-24] /* 6 words to go. */
|
||||
strd A_l, A_h, [dst, #-24]
|
||||
ldrd A_l, A_h, [src, #-16] /* 4 words to go. */
|
||||
strd A_l, A_h, [dst, #-16]
|
||||
ldrd A_l, A_h, [src, #-8] /* 2 words to go. */
|
||||
strd A_l, A_h, [dst, #-8]
|
||||
|
||||
#endif
|
||||
tst tmp2, #4
|
||||
ldrne tmp1, [src], #4
|
||||
strne tmp1, [dst], #4
|
||||
lsls tmp2, tmp2, #31 /* Count (tmp2) now dead. */
|
||||
ldrhcs tmp1, [src], #2
|
||||
ldrbne tmp2, [src]
|
||||
strhcs tmp1, [dst], #2
|
||||
strbne tmp2, [dst]
|
||||
|
||||
.Ldone:
|
||||
ldr tmp2, [sp], #FRAME_SIZE
|
||||
bx lr
|
||||
|
||||
.Lcpy_body_long: /* Count in tmp2. */
|
||||
|
||||
/* Long copy. We know that there's at least (prefetch_lines * 64)
|
||||
bytes to go. */
|
||||
#ifdef USE_VFP
|
||||
/* Don't use PLD. Instead, read some data in advance of the current
|
||||
copy position into a register. This should act like a PLD
|
||||
operation but we won't have to repeat the transfer. */
|
||||
|
||||
vldr d3, [src, #0]
|
||||
vldr d4, [src, #64]
|
||||
vldr d5, [src, #128]
|
||||
vldr d6, [src, #192]
|
||||
vldr d7, [src, #256]
|
||||
|
||||
vldr d0, [src, #8]
|
||||
vldr d1, [src, #16]
|
||||
vldr d2, [src, #24]
|
||||
add src, src, #32
|
||||
|
||||
subs tmp2, tmp2, #prefetch_lines * 64 * 2
|
||||
blt 2f
|
||||
1:
|
||||
cpy_line_vfp d3, 0
|
||||
cpy_line_vfp d4, 64
|
||||
cpy_line_vfp d5, 128
|
||||
add dst, dst, #3 * 64
|
||||
add src, src, #3 * 64
|
||||
cpy_line_vfp d6, 0
|
||||
cpy_line_vfp d7, 64
|
||||
add dst, dst, #2 * 64
|
||||
add src, src, #2 * 64
|
||||
subs tmp2, tmp2, #prefetch_lines * 64
|
||||
bge 1b
|
||||
|
||||
2:
|
||||
cpy_tail_vfp d3, 0
|
||||
cpy_tail_vfp d4, 64
|
||||
cpy_tail_vfp d5, 128
|
||||
add src, src, #3 * 64
|
||||
add dst, dst, #3 * 64
|
||||
cpy_tail_vfp d6, 0
|
||||
vstr d7, [dst, #64]
|
||||
vldr d7, [src, #64]
|
||||
vstr d0, [dst, #64 + 8]
|
||||
vldr d0, [src, #64 + 8]
|
||||
vstr d1, [dst, #64 + 16]
|
||||
vldr d1, [src, #64 + 16]
|
||||
vstr d2, [dst, #64 + 24]
|
||||
vldr d2, [src, #64 + 24]
|
||||
vstr d7, [dst, #64 + 32]
|
||||
add src, src, #96
|
||||
vstr d0, [dst, #64 + 40]
|
||||
vstr d1, [dst, #64 + 48]
|
||||
vstr d2, [dst, #64 + 56]
|
||||
add dst, dst, #128
|
||||
add tmp2, tmp2, #prefetch_lines * 64
|
||||
b .Lcpy_body_medium
|
||||
#else
|
||||
/* Long copy. Use an SMS style loop to maximize the I/O
|
||||
bandwidth of the core. We don't have enough spare registers
|
||||
to synthesise prefetching, so use PLD operations. */
|
||||
/* Pre-bias src and dst. */
|
||||
sub src, src, #8
|
||||
sub dst, dst, #8
|
||||
pld [src, #8]
|
||||
pld [src, #72]
|
||||
subs tmp2, tmp2, #64
|
||||
pld [src, #136]
|
||||
ldrd A_l, A_h, [src, #8]
|
||||
strd B_l, B_h, [sp, #8]
|
||||
ldrd B_l, B_h, [src, #16]
|
||||
strd C_l, C_h, [sp, #16]
|
||||
ldrd C_l, C_h, [src, #24]
|
||||
strd D_l, D_h, [sp, #24]
|
||||
pld [src, #200]
|
||||
ldrd D_l, D_h, [src, #32]!
|
||||
b 1f
|
||||
.p2align 6
|
||||
2:
|
||||
pld [src, #232]
|
||||
strd A_l, A_h, [dst, #40]
|
||||
ldrd A_l, A_h, [src, #40]
|
||||
strd B_l, B_h, [dst, #48]
|
||||
ldrd B_l, B_h, [src, #48]
|
||||
strd C_l, C_h, [dst, #56]
|
||||
ldrd C_l, C_h, [src, #56]
|
||||
strd D_l, D_h, [dst, #64]!
|
||||
ldrd D_l, D_h, [src, #64]!
|
||||
subs tmp2, tmp2, #64
|
||||
1:
|
||||
strd A_l, A_h, [dst, #8]
|
||||
ldrd A_l, A_h, [src, #8]
|
||||
strd B_l, B_h, [dst, #16]
|
||||
ldrd B_l, B_h, [src, #16]
|
||||
strd C_l, C_h, [dst, #24]
|
||||
ldrd C_l, C_h, [src, #24]
|
||||
strd D_l, D_h, [dst, #32]
|
||||
ldrd D_l, D_h, [src, #32]
|
||||
bcs 2b
|
||||
/* Save the remaining bytes and restore the callee-saved regs. */
|
||||
strd A_l, A_h, [dst, #40]
|
||||
add src, src, #40
|
||||
strd B_l, B_h, [dst, #48]
|
||||
ldrd B_l, B_h, [sp, #8]
|
||||
strd C_l, C_h, [dst, #56]
|
||||
ldrd C_l, C_h, [sp, #16]
|
||||
strd D_l, D_h, [dst, #64]
|
||||
ldrd D_l, D_h, [sp, #24]
|
||||
add dst, dst, #72
|
||||
tst tmp2, #0x3f
|
||||
bne .Ltail63aligned
|
||||
ldr tmp2, [sp], #FRAME_SIZE
|
||||
bx lr
|
||||
#endif
|
||||
|
||||
.Lcpy_notaligned:
|
||||
pld [src]
|
||||
pld [src, #64]
|
||||
/* There's at least 64 bytes to copy, but there is no mutual
|
||||
alignment. */
|
||||
/* Bring DST to 64-bit alignment. */
|
||||
lsls tmp2, dst, #29
|
||||
pld [src, #(2 * 64)]
|
||||
beq 1f
|
||||
rsbs tmp2, tmp2, #0
|
||||
sub count, count, tmp2, lsr #29
|
||||
ldrmi tmp1, [src], #4
|
||||
strmi tmp1, [dst], #4
|
||||
lsls tmp2, tmp2, #2
|
||||
ldrbne tmp1, [src], #1
|
||||
ldrhcs tmp2, [src], #2
|
||||
strbne tmp1, [dst], #1
|
||||
strhcs tmp2, [dst], #2
|
||||
1:
|
||||
pld [src, #(3 * 64)]
|
||||
subs count, count, #64
|
||||
ldrmi tmp2, [sp], #FRAME_SIZE
|
||||
bmi .Ltail63unaligned
|
||||
pld [src, #(4 * 64)]
|
||||
|
||||
#ifdef USE_NEON
|
||||
vld1.8 {d0-d3}, [src]!
|
||||
vld1.8 {d4-d7}, [src]!
|
||||
subs count, count, #64
|
||||
bmi 2f
|
||||
1:
|
||||
pld [src, #(4 * 64)]
|
||||
vst1.8 {d0-d3}, [ALIGN (dst, 64)]!
|
||||
vld1.8 {d0-d3}, [src]!
|
||||
vst1.8 {d4-d7}, [ALIGN (dst, 64)]!
|
||||
vld1.8 {d4-d7}, [src]!
|
||||
subs count, count, #64
|
||||
bpl 1b
|
||||
2:
|
||||
vst1.8 {d0-d3}, [ALIGN (dst, 64)]!
|
||||
vst1.8 {d4-d7}, [ALIGN (dst, 64)]!
|
||||
ands count, count, #0x3f
|
||||
#else
|
||||
/* Use an SMS style loop to maximize the I/O bandwidth. */
|
||||
sub src, src, #4
|
||||
sub dst, dst, #8
|
||||
subs tmp2, count, #64 /* Use tmp2 for count. */
|
||||
ldr A_l, [src, #4]
|
||||
ldr A_h, [src, #8]
|
||||
strd B_l, B_h, [sp, #8]
|
||||
ldr B_l, [src, #12]
|
||||
ldr B_h, [src, #16]
|
||||
strd C_l, C_h, [sp, #16]
|
||||
ldr C_l, [src, #20]
|
||||
ldr C_h, [src, #24]
|
||||
strd D_l, D_h, [sp, #24]
|
||||
ldr D_l, [src, #28]
|
||||
ldr D_h, [src, #32]!
|
||||
b 1f
|
||||
.p2align 6
|
||||
2:
|
||||
pld [src, #(5 * 64) - (32 - 4)]
|
||||
strd A_l, A_h, [dst, #40]
|
||||
ldr A_l, [src, #36]
|
||||
ldr A_h, [src, #40]
|
||||
strd B_l, B_h, [dst, #48]
|
||||
ldr B_l, [src, #44]
|
||||
ldr B_h, [src, #48]
|
||||
strd C_l, C_h, [dst, #56]
|
||||
ldr C_l, [src, #52]
|
||||
ldr C_h, [src, #56]
|
||||
strd D_l, D_h, [dst, #64]!
|
||||
ldr D_l, [src, #60]
|
||||
ldr D_h, [src, #64]!
|
||||
subs tmp2, tmp2, #64
|
||||
1:
|
||||
strd A_l, A_h, [dst, #8]
|
||||
ldr A_l, [src, #4]
|
||||
ldr A_h, [src, #8]
|
||||
strd B_l, B_h, [dst, #16]
|
||||
ldr B_l, [src, #12]
|
||||
ldr B_h, [src, #16]
|
||||
strd C_l, C_h, [dst, #24]
|
||||
ldr C_l, [src, #20]
|
||||
ldr C_h, [src, #24]
|
||||
strd D_l, D_h, [dst, #32]
|
||||
ldr D_l, [src, #28]
|
||||
ldr D_h, [src, #32]
|
||||
bcs 2b
|
||||
|
||||
/* Save the remaining bytes and restore the callee-saved regs. */
|
||||
strd A_l, A_h, [dst, #40]
|
||||
add src, src, #36
|
||||
strd B_l, B_h, [dst, #48]
|
||||
ldrd B_l, B_h, [sp, #8]
|
||||
strd C_l, C_h, [dst, #56]
|
||||
ldrd C_l, C_h, [sp, #16]
|
||||
strd D_l, D_h, [dst, #64]
|
||||
ldrd D_l, D_h, [sp, #24]
|
||||
add dst, dst, #72
|
||||
ands count, tmp2, #0x3f
|
||||
#endif
|
||||
ldr tmp2, [sp], #FRAME_SIZE
|
||||
bne .Ltail63unaligned
|
||||
bx lr
|
||||
|
||||
.size memcpy, . - memcpy
|
||||
|
|
@ -2,9 +2,9 @@ use r0::zero_bss;
|
|||
use core::ptr::write_volatile;
|
||||
use libregister::{
|
||||
VolatileCell,
|
||||
RegisterR, RegisterW, RegisterRW,
|
||||
RegisterR, RegisterRW,
|
||||
};
|
||||
use libcortex_a9::{asm, regs::*, cache, mmu};
|
||||
use libcortex_a9::{asm, l2c, regs::*, cache, mmu, spin_lock_yield, notify_spin_lock, enable_fpu, interrupt_handler};
|
||||
use libboard_zynq::{slcr, mpcore};
|
||||
|
||||
extern "C" {
|
||||
|
@ -18,34 +18,28 @@ extern "C" {
|
|||
|
||||
static mut CORE1_ENABLED: VolatileCell<bool> = VolatileCell::new(false);
|
||||
|
||||
#[link_section = ".text.boot"]
|
||||
#[no_mangle]
|
||||
#[naked]
|
||||
pub unsafe extern "C" fn _boot_cores() -> ! {
|
||||
const CORE_MASK: u32 = 0x3;
|
||||
|
||||
match MPIDR.read() & CORE_MASK {
|
||||
interrupt_handler!(Reset, reset_irq, __stack0_start, __stack1_start, {
|
||||
// no need to setup stack here, as we already did when entering the handler
|
||||
match MPIDR.read().cpu_id() {
|
||||
0 => {
|
||||
SP.write(&mut __stack0_start as *mut _ as u32);
|
||||
boot_core0();
|
||||
}
|
||||
1 => {
|
||||
while !CORE1_ENABLED.get() {
|
||||
asm::wfe();
|
||||
spin_lock_yield();
|
||||
}
|
||||
SP.write(&mut __stack1_start as *mut _ as u32);
|
||||
boot_core1();
|
||||
}
|
||||
_ => unreachable!(),
|
||||
}
|
||||
}
|
||||
});
|
||||
|
||||
#[naked]
|
||||
#[inline(never)]
|
||||
unsafe fn boot_core0() -> ! {
|
||||
unsafe extern "C" fn boot_core0() -> ! {
|
||||
l1_cache_init();
|
||||
|
||||
let mpcore = mpcore::RegisterBlock::new();
|
||||
enable_fpu();
|
||||
let mpcore = mpcore::RegisterBlock::mpcore();
|
||||
mpcore.scu_invalidate.invalidate_all_cores();
|
||||
|
||||
zero_bss(&mut __bss_start, &mut __bss_end);
|
||||
|
@ -55,30 +49,35 @@ unsafe fn boot_core0() -> ! {
|
|||
mmu::with_mmu(mmu_table, || {
|
||||
mpcore.scu_control.start();
|
||||
ACTLR.enable_smp();
|
||||
ACTLR.enable_prefetch();
|
||||
// TODO: Barriers reqd when core1 is not yet starting?
|
||||
asm::dmb();
|
||||
asm::dsb();
|
||||
|
||||
asm::enable_fiq();
|
||||
asm::enable_irq();
|
||||
main_core0();
|
||||
panic!("return from main");
|
||||
});
|
||||
}
|
||||
|
||||
#[naked]
|
||||
#[inline(never)]
|
||||
unsafe fn boot_core1() -> ! {
|
||||
unsafe extern "C" fn boot_core1() -> ! {
|
||||
l1_cache_init();
|
||||
|
||||
let mpcore = mpcore::RegisterBlock::new();
|
||||
let mpcore = mpcore::RegisterBlock::mpcore();
|
||||
mpcore.scu_invalidate.invalidate_core1();
|
||||
|
||||
let mmu_table = mmu::L1Table::get();
|
||||
mmu::with_mmu(mmu_table, || {
|
||||
ACTLR.enable_smp();
|
||||
ACTLR.enable_prefetch();
|
||||
// TODO: Barriers reqd when core1 is not yet starting?
|
||||
asm::dmb();
|
||||
asm::dsb();
|
||||
|
||||
asm::enable_fiq();
|
||||
asm::enable_irq();
|
||||
main_core1();
|
||||
panic!("return from main_core1");
|
||||
});
|
||||
|
@ -101,7 +100,7 @@ fn l1_cache_init() {
|
|||
// for all of the L1 data cache rather than a (previously
|
||||
// unspecified) combination of one cache set and one cache
|
||||
// way.
|
||||
dciall();
|
||||
dciall_l1();
|
||||
}
|
||||
|
||||
pub struct Core1 {
|
||||
|
@ -131,12 +130,13 @@ impl Core1 {
|
|||
unsafe {
|
||||
CORE1_ENABLED.set(true);
|
||||
}
|
||||
// Ensure values have been written to cache
|
||||
asm::dmb();
|
||||
// Flush cache-line
|
||||
cache::dccmvac(unsafe { &CORE1_ENABLED } as *const _ as usize);
|
||||
cache::dcc(unsafe { &CORE1_ENABLED });
|
||||
if sdram {
|
||||
cache::dccmvac(0);
|
||||
asm::dsb();
|
||||
l2c::l2_cache_clean(0);
|
||||
l2c::l2_cache_sync();
|
||||
}
|
||||
|
||||
// wake up core1
|
||||
|
@ -144,6 +144,7 @@ impl Core1 {
|
|||
slcr.a9_cpu_rst_ctrl.modify(|_, w| w.a9_rst1(false));
|
||||
slcr.a9_cpu_rst_ctrl.modify(|_, w| w.a9_clkstop1(false));
|
||||
});
|
||||
notify_spin_lock();
|
||||
|
||||
Core1 {}
|
||||
}
|
||||
|
@ -151,6 +152,8 @@ impl Core1 {
|
|||
pub fn disable(&self) {
|
||||
unsafe {
|
||||
CORE1_ENABLED.set(false);
|
||||
cache::dccmvac(&CORE1_ENABLED as *const _ as usize);
|
||||
asm::dsb();
|
||||
}
|
||||
self.restart();
|
||||
}
|
||||
|
@ -158,7 +161,9 @@ impl Core1 {
|
|||
pub fn restart(&self) {
|
||||
slcr::RegisterBlock::unlocked(|slcr| {
|
||||
slcr.a9_cpu_rst_ctrl.modify(|_, w| w.a9_rst1(true));
|
||||
slcr.a9_cpu_rst_ctrl.modify(|_, w| w.a9_clkstop1(true));
|
||||
slcr.a9_cpu_rst_ctrl.modify(|_, w| w.a9_rst1(false));
|
||||
slcr.a9_cpu_rst_ctrl.modify(|_, w| w.a9_clkstop1(false));
|
||||
});
|
||||
}
|
||||
}
|
||||
|
|
|
@ -0,0 +1,54 @@
|
|||
use libregister::{RegisterR, RegisterW};
|
||||
use libcortex_a9::{regs::{DFSR, MPIDR, VBAR}, interrupt_handler};
|
||||
use libboard_zynq::{println, stdio};
|
||||
|
||||
pub fn set_vector_table(base_addr: u32){
|
||||
VBAR.write(base_addr);
|
||||
}
|
||||
|
||||
interrupt_handler!(UndefinedInstruction, undefined_instruction, __irq_stack0_start, __irq_stack1_start, {
|
||||
stdio::drop_uart();
|
||||
println!("UndefinedInstruction");
|
||||
loop {}
|
||||
});
|
||||
|
||||
interrupt_handler!(SoftwareInterrupt, software_interrupt, __irq_stack0_start, __irq_stack1_start, {
|
||||
stdio::drop_uart();
|
||||
println!("SoftwareInterrupt");
|
||||
loop {}
|
||||
});
|
||||
|
||||
interrupt_handler!(PrefetchAbort, prefetch_abort, __irq_stack0_start, __irq_stack1_start, {
|
||||
stdio::drop_uart();
|
||||
println!("PrefetchAbort");
|
||||
loop {}
|
||||
});
|
||||
|
||||
interrupt_handler!(DataAbort, data_abort, __irq_stack0_start, __irq_stack1_start, {
|
||||
stdio::drop_uart();
|
||||
|
||||
println!("DataAbort on core {}", MPIDR.read().cpu_id());
|
||||
println!("DFSR: {:03X}", DFSR.read());
|
||||
|
||||
loop {}
|
||||
});
|
||||
|
||||
interrupt_handler!(ReservedException, reserved_exception, __irq_stack0_start, __irq_stack1_start, {
|
||||
stdio::drop_uart();
|
||||
println!("ReservedException");
|
||||
loop {}
|
||||
});
|
||||
|
||||
#[cfg(feature = "dummy_irq_handler")]
|
||||
interrupt_handler!(IRQ, irq, __irq_stack0_start, __irq_stack1_start, {
|
||||
stdio::drop_uart();
|
||||
println!("IRQ");
|
||||
loop {}
|
||||
});
|
||||
|
||||
#[cfg(feature = "dummy_fiq_handler")]
|
||||
interrupt_handler!(FIQ, fiq, __irq_stack0_start, __irq_stack1_start, {
|
||||
stdio::drop_uart();
|
||||
println!("FIQ");
|
||||
loop {}
|
||||
});
|
|
@ -1,13 +1,16 @@
|
|||
#![no_std]
|
||||
|
||||
#![feature(naked_functions)]
|
||||
#![feature(alloc_error_handler)]
|
||||
#![feature(panic_info_message)]
|
||||
#![feature(naked_functions)]
|
||||
#![feature(asm)]
|
||||
|
||||
pub extern crate alloc;
|
||||
pub extern crate compiler_builtins;
|
||||
|
||||
pub mod boot;
|
||||
mod abort;
|
||||
pub mod exception_vectors;
|
||||
#[cfg(feature = "panic_handler")]
|
||||
mod panic;
|
||||
pub mod ram;
|
||||
|
||||
|
|
|
@ -1,4 +1,6 @@
|
|||
use libboard_zynq::{slcr, print, println};
|
||||
use libboard_zynq::{print, println};
|
||||
#[cfg(feature = "target_kasli_soc")]
|
||||
use libboard_zynq::error_led::ErrorLED;
|
||||
|
||||
#[panic_handler]
|
||||
fn panic(info: &core::panic::PanicInfo) -> ! {
|
||||
|
@ -13,7 +15,10 @@ fn panic(info: &core::panic::PanicInfo) -> ! {
|
|||
} else {
|
||||
println!("");
|
||||
}
|
||||
|
||||
slcr::RegisterBlock::unlocked(|slcr| slcr.soft_reset());
|
||||
#[cfg(feature = "target_kasli_soc")]
|
||||
{
|
||||
let mut err_led = ErrorLED::error_led();
|
||||
err_led.toggle(true);
|
||||
}
|
||||
loop {}
|
||||
}
|
||||
|
|
|
@ -1,55 +1,100 @@
|
|||
use alloc::alloc::Layout;
|
||||
use core::alloc::GlobalAlloc;
|
||||
use core::ptr::NonNull;
|
||||
use alloc::alloc::Layout;
|
||||
use libcortex_a9::{
|
||||
mutex::Mutex,
|
||||
regs::MPIDR
|
||||
};
|
||||
use libregister::RegisterR;
|
||||
use linked_list_allocator::Heap;
|
||||
use libcortex_a9::mutex::Mutex;
|
||||
#[cfg(not(feature = "alloc_core"))]
|
||||
use libboard_zynq::ddr::DdrRam;
|
||||
|
||||
#[global_allocator]
|
||||
static ALLOCATOR: CortexA9Alloc = CortexA9Alloc(Mutex::new(Heap::empty()));
|
||||
static ALLOCATOR: CortexA9Alloc = CortexA9Alloc(
|
||||
Mutex::new(Heap::empty()),
|
||||
Mutex::new(Heap::empty()),
|
||||
);
|
||||
|
||||
/// LockedHeap doesn't lock properly
|
||||
struct CortexA9Alloc(Mutex<Heap>);
|
||||
struct CortexA9Alloc(Mutex<Heap>, Mutex<Heap>);
|
||||
|
||||
unsafe impl Sync for CortexA9Alloc {}
|
||||
|
||||
unsafe impl GlobalAlloc for CortexA9Alloc {
|
||||
unsafe fn alloc(&self, layout: Layout) -> *mut u8 {
|
||||
self.0.lock()
|
||||
.allocate_first_fit(layout)
|
||||
.ok()
|
||||
.map_or(0 as *mut u8, |allocation| allocation.as_ptr())
|
||||
if cfg!(not(feature = "alloc_core")) || MPIDR.read().cpu_id() == 0 {
|
||||
&self.0
|
||||
} else {
|
||||
&self.1
|
||||
}
|
||||
.lock()
|
||||
.allocate_first_fit(layout)
|
||||
.ok()
|
||||
.map_or(0 as *mut u8, |allocation| allocation.as_ptr())
|
||||
}
|
||||
|
||||
unsafe fn dealloc(&self, ptr: *mut u8, layout: Layout) {
|
||||
self.0.lock()
|
||||
.deallocate(NonNull::new_unchecked(ptr), layout)
|
||||
if cfg!(not(feature = "alloc_core"))
|
||||
|| ((&__heap0_start as *const usize as usize <= ptr as usize)
|
||||
&& ((ptr as usize) < &__heap0_end as *const usize as usize))
|
||||
{
|
||||
&self.0
|
||||
} else {
|
||||
&self.1
|
||||
}
|
||||
.lock()
|
||||
.deallocate(NonNull::new_unchecked(ptr), layout)
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(not(feature = "alloc_core"))]
|
||||
pub fn init_alloc_ddr(ddr: &mut DdrRam) {
|
||||
unsafe {
|
||||
ALLOCATOR.0.lock()
|
||||
ALLOCATOR
|
||||
.0
|
||||
.lock()
|
||||
.init(ddr.ptr::<u8>() as usize, ddr.size());
|
||||
}
|
||||
}
|
||||
|
||||
extern "C" {
|
||||
static __heap_start: usize;
|
||||
static __heap_end: usize;
|
||||
static __heap0_start: usize;
|
||||
static __heap0_end: usize;
|
||||
#[cfg(feature = "alloc_core")]
|
||||
static __heap1_start: usize;
|
||||
#[cfg(feature = "alloc_core")]
|
||||
static __heap1_end: usize;
|
||||
}
|
||||
|
||||
pub fn init_alloc_linker() {
|
||||
pub fn init_alloc_core0() {
|
||||
unsafe {
|
||||
let start = &__heap_start as *const usize as usize;
|
||||
let end = &__heap_end as *const usize as usize;
|
||||
ALLOCATOR.0.lock()
|
||||
.init(start, end - start);
|
||||
let start = &__heap0_start as *const usize as usize;
|
||||
let end = &__heap0_end as *const usize as usize;
|
||||
ALLOCATOR.0.lock().init(start, end - start);
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(feature = "alloc_core")]
|
||||
pub fn init_alloc_core1() {
|
||||
unsafe {
|
||||
let start = &__heap1_start as *const usize as usize;
|
||||
let end = &__heap1_end as *const usize as usize;
|
||||
ALLOCATOR.1.lock().init(start, end - start);
|
||||
}
|
||||
}
|
||||
|
||||
#[alloc_error_handler]
|
||||
fn alloc_error(_: core::alloc::Layout) -> ! {
|
||||
panic!("alloc_error")
|
||||
fn alloc_error(layout: core::alloc::Layout) -> ! {
|
||||
let id = MPIDR.read().cpu_id();
|
||||
let used = if cfg!(not(feature = "alloc_core")) || id == 0 {
|
||||
ALLOCATOR.0.lock().used()
|
||||
} else {
|
||||
ALLOCATOR.1.lock().used()
|
||||
};
|
||||
panic!(
|
||||
"Core {} alloc_error, layout: {:?}, used memory: {}",
|
||||
id,
|
||||
layout,
|
||||
used
|
||||
);
|
||||
}
|
||||
|
|
|
@ -0,0 +1,20 @@
|
|||
set XC7_JSHUTDOWN 0x0d
|
||||
set XC7_JPROGRAM 0x0b
|
||||
set XC7_JSTART 0x0c
|
||||
set XC7_BYPASS 0x3f
|
||||
|
||||
proc xc7_program {tap} {
|
||||
global XC7_JSHUTDOWN XC7_JPROGRAM XC7_JSTART XC7_BYPASS
|
||||
irscan $tap $XC7_JSHUTDOWN
|
||||
irscan $tap $XC7_JPROGRAM
|
||||
runtest 60000
|
||||
#JSTART prevents this from working...
|
||||
#irscan $tap $XC7_JSTART
|
||||
runtest 2000
|
||||
irscan $tap $XC7_BYPASS
|
||||
runtest 2000
|
||||
}
|
||||
|
||||
pld device virtex2 zynq.tap 1
|
||||
init
|
||||
xc7_program zynq.tap
|
|
@ -5,37 +5,15 @@ set PL_TAPID 0x13722093
|
|||
set SMP 1
|
||||
|
||||
source ./zynq-7000.cfg
|
||||
source ./xilinx-tcl.cfg
|
||||
source ./ps7_init.tcl
|
||||
|
||||
reset_config srst_only srst_push_pull
|
||||
|
||||
set XC7_JSHUTDOWN 0x0d
|
||||
set XC7_JPROGRAM 0x0b
|
||||
set XC7_JSTART 0x0c
|
||||
set XC7_BYPASS 0x3f
|
||||
source ./common.cfg
|
||||
|
||||
proc xc7_program {tap} {
|
||||
global XC7_JSHUTDOWN XC7_JPROGRAM XC7_JSTART XC7_BYPASS
|
||||
irscan $tap $XC7_JSHUTDOWN
|
||||
irscan $tap $XC7_JPROGRAM
|
||||
runtest 60000
|
||||
#JSTART prevents this from working...
|
||||
#irscan $tap $XC7_JSTART
|
||||
runtest 2000
|
||||
irscan $tap $XC7_BYPASS
|
||||
runtest 2000
|
||||
}
|
||||
|
||||
pld device virtex2 zynq.tap 1
|
||||
init
|
||||
xc7_program zynq.tap
|
||||
|
||||
xilinx_ps7_init
|
||||
reset halt
|
||||
|
||||
# Disable MMU
|
||||
targets $_TARGETNAME_1
|
||||
arm mcr 15 0 1 0 0 [expr [arm mrc 15 0 1 0 0] & ~0xd]
|
||||
arm mcr 15 0 1 0 0 [expr { [arm mrc 15 0 1 0 0] & ~0xd }]
|
||||
targets $_TARGETNAME_0
|
||||
arm mcr 15 0 1 0 0 [expr [arm mrc 15 0 1 0 0] & ~0xd]
|
||||
|
||||
arm mcr 15 0 1 0 0 [expr { [arm mrc 15 0 1 0 0] & ~0xd }]
|
||||
|
|
|
@ -0,0 +1,12 @@
|
|||
# this is the original file from OpenOCD, but with ftdi_device_desc
|
||||
# removed because some cables don't have it programmed.
|
||||
|
||||
# this supports JTAG-HS2 (and apparently Nexys4 as well)
|
||||
|
||||
adapter driver ftdi
|
||||
ftdi_vid_pid 0x0403 0x6014
|
||||
|
||||
ftdi_channel 0
|
||||
ftdi_layout_init 0x00e8 0x60eb
|
||||
|
||||
reset_config none
|
|
@ -1,18 +0,0 @@
|
|||
#
|
||||
# Digilent JTAG-SMT2-NC
|
||||
#
|
||||
# http://store.digilentinc.com/jtag-smt2-nc-surface-mount-programming-module/
|
||||
# https://reference.digilentinc.com/_media/jtag_smt2nc/jtag-smt2-nc_rm.pdf
|
||||
#
|
||||
# Based on reference sheet (above) and Xilinx KCU105 schematics
|
||||
# https://www.xilinx.com/products/boards-and-kits/kcu105.html#documentation
|
||||
#
|
||||
# Note that the digilent_jtag_smt2 layout does not work and hangs while
|
||||
# the ftdi_device_desc from digilent_hs2 is wrong.
|
||||
|
||||
interface ftdi
|
||||
ftdi_device_desc "Digilent USB Device"
|
||||
ftdi_vid_pid 0x0403 0x6014
|
||||
ftdi_channel 0
|
||||
ftdi_layout_init 0x00e8 0x60eb
|
||||
ftdi_layout_signal nSRST -data 0x2000
|
|
@ -1,28 +0,0 @@
|
|||
def zynq-connect
|
||||
target remote :3333
|
||||
end
|
||||
|
||||
def zynq-fsbl-restart
|
||||
mon xilinx_ps7_init
|
||||
end
|
||||
|
||||
def zynq-restart
|
||||
mon xilinx_ps7_init
|
||||
load
|
||||
end
|
||||
|
||||
# easily typed shortcuts
|
||||
# device connect
|
||||
def dc
|
||||
zynq-connect
|
||||
end
|
||||
# device restart
|
||||
def dr
|
||||
zynq-restart
|
||||
end
|
||||
|
||||
def dfr
|
||||
zynq-fsbl-restart
|
||||
end
|
||||
|
||||
|
|
@ -0,0 +1,28 @@
|
|||
adapter driver ftdi
|
||||
ftdi_device_desc "Quad RS232-HS"
|
||||
ftdi_vid_pid 0x0403 0x6011
|
||||
ftdi_channel 0
|
||||
# some GPIOs need to be set, otherwise the FTDI chip craps out for some reason.
|
||||
ftdi_layout_init 0x0098 0x008b
|
||||
transport select jtag
|
||||
adapter speed 1000
|
||||
|
||||
set PL_TAPID 0x1372c093
|
||||
set SMP 1
|
||||
|
||||
source ./zynq-7000.cfg
|
||||
|
||||
ftdi_layout_signal nSRST -oe 0x0004
|
||||
reset_config srst_only srst_open_drain
|
||||
adapter srst pulse_width 250
|
||||
adapter srst delay 400
|
||||
|
||||
source ./common.cfg
|
||||
|
||||
reset halt
|
||||
|
||||
# Disable MMU
|
||||
targets $_TARGETNAME_1
|
||||
arm mcr 15 0 1 0 0 [expr { [arm mrc 15 0 1 0 0] & ~0xd }]
|
||||
targets $_TARGETNAME_0
|
||||
arm mcr 15 0 1 0 0 [expr { [arm mrc 15 0 1 0 0] & ~0xd }]
|
|
@ -1,771 +0,0 @@
|
|||
proc ps7_pll_init_data_3_0 {} {
|
||||
mwr -force 0XF8000008 0x0000DF0D
|
||||
mask_write 0XF8000110 0x003FFFF0 0x000FA220
|
||||
mask_write 0XF8000100 0x0007F000 0x00028000
|
||||
mask_write 0XF8000100 0x00000010 0x00000010
|
||||
mask_write 0XF8000100 0x00000001 0x00000001
|
||||
mask_write 0XF8000100 0x00000001 0x00000000
|
||||
mask_poll 0XF800010C 0x00000001
|
||||
mask_write 0XF8000100 0x00000010 0x00000000
|
||||
mask_write 0XF8000120 0x1F003F30 0x1F000200
|
||||
mask_write 0XF8000114 0x003FFFF0 0x0012C220
|
||||
mask_write 0XF8000104 0x0007F000 0x00020000
|
||||
mask_write 0XF8000104 0x00000010 0x00000010
|
||||
mask_write 0XF8000104 0x00000001 0x00000001
|
||||
mask_write 0XF8000104 0x00000001 0x00000000
|
||||
mask_poll 0XF800010C 0x00000002
|
||||
mask_write 0XF8000104 0x00000010 0x00000000
|
||||
mask_write 0XF8000124 0xFFF00003 0x0C200003
|
||||
mask_write 0XF8000118 0x003FFFF0 0x001452C0
|
||||
mask_write 0XF8000108 0x0007F000 0x0001E000
|
||||
mask_write 0XF8000108 0x00000010 0x00000010
|
||||
mask_write 0XF8000108 0x00000001 0x00000001
|
||||
mask_write 0XF8000108 0x00000001 0x00000000
|
||||
mask_poll 0XF800010C 0x00000004
|
||||
mask_write 0XF8000108 0x00000010 0x00000000
|
||||
mwr -force 0XF8000004 0x0000767B
|
||||
}
|
||||
proc ps7_clock_init_data_3_0 {} {
|
||||
mwr -force 0XF8000008 0x0000DF0D
|
||||
mask_write 0XF8000128 0x03F03F01 0x00700F01
|
||||
mask_write 0XF8000138 0x00000011 0x00000001
|
||||
mask_write 0XF8000140 0x03F03F71 0x00100801
|
||||
mask_write 0XF800014C 0x00003F31 0x00000501
|
||||
mask_write 0XF8000150 0x00003F33 0x00001401
|
||||
mask_write 0XF8000154 0x00003F33 0x00001402
|
||||
mask_write 0XF8000168 0x00003F31 0x00000501
|
||||
mask_write 0XF8000170 0x03F03F30 0x00200500
|
||||
mask_write 0XF80001C4 0x00000001 0x00000001
|
||||
mask_write 0XF800012C 0x01FFCCCD 0x01EC044D
|
||||
mwr -force 0XF8000004 0x0000767B
|
||||
}
|
||||
proc ps7_ddr_init_data_3_0 {} {
|
||||
mask_write 0XF8006000 0x0001FFFF 0x00000080
|
||||
mask_write 0XF8006004 0x0007FFFF 0x00001081
|
||||
mask_write 0XF8006008 0x03FFFFFF 0x03C0780F
|
||||
mask_write 0XF800600C 0x03FFFFFF 0x02001001
|
||||
mask_write 0XF8006010 0x03FFFFFF 0x00014001
|
||||
mask_write 0XF8006014 0x001FFFFF 0x0004159B
|
||||
mask_write 0XF8006018 0xF7FFFFFF 0x452460D2
|
||||
mask_write 0XF800601C 0xFFFFFFFF 0x720238E5
|
||||
mask_write 0XF8006020 0x7FDFFFFC 0x270872D0
|
||||
mask_write 0XF8006024 0x0FFFFFC3 0x00000000
|
||||
mask_write 0XF8006028 0x00003FFF 0x00002007
|
||||
mask_write 0XF800602C 0xFFFFFFFF 0x00000008
|
||||
mask_write 0XF8006030 0xFFFFFFFF 0x00040930
|
||||
mask_write 0XF8006034 0x13FF3FFF 0x000116D4
|
||||
mask_write 0XF8006038 0x00000003 0x00000000
|
||||
mask_write 0XF800603C 0x000FFFFF 0x00000777
|
||||
mask_write 0XF8006040 0xFFFFFFFF 0xFFF00000
|
||||
mask_write 0XF8006044 0x0FFFFFFF 0x0FF66666
|
||||
mask_write 0XF8006048 0x0003F03F 0x0003C008
|
||||
mask_write 0XF8006050 0xFF0F8FFF 0x77010800
|
||||
mask_write 0XF8006058 0x00010000 0x00000000
|
||||
mask_write 0XF800605C 0x0000FFFF 0x00005003
|
||||
mask_write 0XF8006060 0x000017FF 0x0000003E
|
||||
mask_write 0XF8006064 0x00021FE0 0x00020000
|
||||
mask_write 0XF8006068 0x03FFFFFF 0x00284141
|
||||
mask_write 0XF800606C 0x0000FFFF 0x00001610
|
||||
mask_write 0XF8006078 0x03FFFFFF 0x00466111
|
||||
mask_write 0XF800607C 0x000FFFFF 0x00032222
|
||||
mask_write 0XF80060A4 0xFFFFFFFF 0x10200802
|
||||
mask_write 0XF80060A8 0x0FFFFFFF 0x0690CB73
|
||||
mask_write 0XF80060AC 0x000001FF 0x000001FE
|
||||
mask_write 0XF80060B0 0x1FFFFFFF 0x1CFFFFFF
|
||||
mask_write 0XF80060B4 0x00000200 0x00000200
|
||||
mask_write 0XF80060B8 0x01FFFFFF 0x00200066
|
||||
mask_write 0XF80060C4 0x00000003 0x00000000
|
||||
mask_write 0XF80060C8 0x000000FF 0x00000000
|
||||
mask_write 0XF80060DC 0x00000001 0x00000000
|
||||
mask_write 0XF80060F0 0x0000FFFF 0x00000000
|
||||
mask_write 0XF80060F4 0x0000000F 0x00000008
|
||||
mask_write 0XF8006114 0x000000FF 0x00000000
|
||||
mask_write 0XF8006118 0x7FFFFFCF 0x40000001
|
||||
mask_write 0XF800611C 0x7FFFFFCF 0x40000001
|
||||
mask_write 0XF8006120 0x7FFFFFCF 0x40000001
|
||||
mask_write 0XF8006124 0x7FFFFFCF 0x40000001
|
||||
mask_write 0XF800612C 0x000FFFFF 0x00033C03
|
||||
mask_write 0XF8006130 0x000FFFFF 0x00034003
|
||||
mask_write 0XF8006134 0x000FFFFF 0x0002F400
|
||||
mask_write 0XF8006138 0x000FFFFF 0x00030400
|
||||
mask_write 0XF8006140 0x000FFFFF 0x00000035
|
||||
mask_write 0XF8006144 0x000FFFFF 0x00000035
|
||||
mask_write 0XF8006148 0x000FFFFF 0x00000035
|
||||
mask_write 0XF800614C 0x000FFFFF 0x00000035
|
||||
mask_write 0XF8006154 0x000FFFFF 0x00000083
|
||||
mask_write 0XF8006158 0x000FFFFF 0x00000083
|
||||
mask_write 0XF800615C 0x000FFFFF 0x00000080
|
||||
mask_write 0XF8006160 0x000FFFFF 0x00000080
|
||||
mask_write 0XF8006168 0x001FFFFF 0x00000124
|
||||
mask_write 0XF800616C 0x001FFFFF 0x00000125
|
||||
mask_write 0XF8006170 0x001FFFFF 0x00000112
|
||||
mask_write 0XF8006174 0x001FFFFF 0x00000116
|
||||
mask_write 0XF800617C 0x000FFFFF 0x000000C3
|
||||
mask_write 0XF8006180 0x000FFFFF 0x000000C3
|
||||
mask_write 0XF8006184 0x000FFFFF 0x000000C0
|
||||
mask_write 0XF8006188 0x000FFFFF 0x000000C0
|
||||
mask_write 0XF8006190 0x6FFFFEFE 0x00040080
|
||||
mask_write 0XF8006194 0x000FFFFF 0x0001FC82
|
||||
mask_write 0XF8006204 0xFFFFFFFF 0x00000000
|
||||
mask_write 0XF8006208 0x000703FF 0x000003FF
|
||||
mask_write 0XF800620C 0x000703FF 0x000003FF
|
||||
mask_write 0XF8006210 0x000703FF 0x000003FF
|
||||
mask_write 0XF8006214 0x000703FF 0x000003FF
|
||||
mask_write 0XF8006218 0x000F03FF 0x000003FF
|
||||
mask_write 0XF800621C 0x000F03FF 0x000003FF
|
||||
mask_write 0XF8006220 0x000F03FF 0x000003FF
|
||||
mask_write 0XF8006224 0x000F03FF 0x000003FF
|
||||
mask_write 0XF80062A8 0x00000FF5 0x00000000
|
||||
mask_write 0XF80062AC 0xFFFFFFFF 0x00000000
|
||||
mask_write 0XF80062B0 0x003FFFFF 0x00005125
|
||||
mask_write 0XF80062B4 0x0003FFFF 0x000012A8
|
||||
mask_poll 0XF8000B74 0x00002000
|
||||
mask_write 0XF8006000 0x0001FFFF 0x00000081
|
||||
mask_poll 0XF8006054 0x00000007
|
||||
}
|
||||
proc ps7_mio_init_data_3_0 {} {
|
||||
mwr -force 0XF8000008 0x0000DF0D
|
||||
mask_write 0XF8000B40 0x00000FFF 0x00000600
|
||||
mask_write 0XF8000B44 0x00000FFF 0x00000600
|
||||
mask_write 0XF8000B48 0x00000FFF 0x00000672
|
||||
mask_write 0XF8000B4C 0x00000FFF 0x00000672
|
||||
mask_write 0XF8000B50 0x00000FFF 0x00000674
|
||||
mask_write 0XF8000B54 0x00000FFF 0x00000674
|
||||
mask_write 0XF8000B58 0x00000FFF 0x00000600
|
||||
mask_write 0XF8000B5C 0xFFFFFFFF 0x0018C61C
|
||||
mask_write 0XF8000B60 0xFFFFFFFF 0x00F9861C
|
||||
mask_write 0XF8000B64 0xFFFFFFFF 0x00F9861C
|
||||
mask_write 0XF8000B68 0xFFFFFFFF 0x00F9861C
|
||||
mask_write 0XF8000B6C 0x00007FFF 0x00000209
|
||||
mask_write 0XF8000B70 0x00000001 0x00000001
|
||||
mask_write 0XF8000B70 0x00000021 0x00000020
|
||||
mask_write 0XF8000B70 0x07FEFFFF 0x00000823
|
||||
mask_write 0XF8000700 0x00003FFF 0x00000600
|
||||
mask_write 0XF8000704 0x00003FFF 0x00000702
|
||||
mask_write 0XF8000708 0x00003FFF 0x00000702
|
||||
mask_write 0XF800070C 0x00003FFF 0x00000702
|
||||
mask_write 0XF8000710 0x00003FFF 0x00000702
|
||||
mask_write 0XF8000714 0x00003FFF 0x00000702
|
||||
mask_write 0XF8000718 0x00003FFF 0x00000702
|
||||
mask_write 0XF800071C 0x00003FFF 0x00000600
|
||||
mask_write 0XF8000720 0x00003FFF 0x00000700
|
||||
mask_write 0XF8000724 0x00003FFF 0x00000600
|
||||
mask_write 0XF8000728 0x00003FFF 0x00000600
|
||||
mask_write 0XF800072C 0x00003FFF 0x00000600
|
||||
mask_write 0XF8000730 0x00003FFF 0x00000600
|
||||
mask_write 0XF8000734 0x00003FFF 0x00000600
|
||||
mask_write 0XF8000738 0x00003FFF 0x00000600
|
||||
mask_write 0XF800073C 0x00003FFF 0x00000600
|
||||
mask_write 0XF8000740 0x00003FFF 0x00000302
|
||||
mask_write 0XF8000744 0x00003FFF 0x00000302
|
||||
mask_write 0XF8000748 0x00003FFF 0x00000302
|
||||
mask_write 0XF800074C 0x00003FFF 0x00000302
|
||||
mask_write 0XF8000750 0x00003FFF 0x00000302
|
||||
mask_write 0XF8000754 0x00003FFF 0x00000302
|
||||
mask_write 0XF8000758 0x00003FFF 0x00000303
|
||||
mask_write 0XF800075C 0x00003FFF 0x00000303
|
||||
mask_write 0XF8000760 0x00003FFF 0x00000303
|
||||
mask_write 0XF8000764 0x00003FFF 0x00000303
|
||||
mask_write 0XF8000768 0x00003FFF 0x00000303
|
||||
mask_write 0XF800076C 0x00003FFF 0x00000303
|
||||
mask_write 0XF8000770 0x00003FFF 0x00000304
|
||||
mask_write 0XF8000774 0x00003FFF 0x00000305
|
||||
mask_write 0XF8000778 0x00003FFF 0x00000304
|
||||
mask_write 0XF800077C 0x00003FFF 0x00000305
|
||||
mask_write 0XF8000780 0x00003FFF 0x00000304
|
||||
mask_write 0XF8000784 0x00003FFF 0x00000304
|
||||
mask_write 0XF8000788 0x00003FFF 0x00000304
|
||||
mask_write 0XF800078C 0x00003FFF 0x00000304
|
||||
mask_write 0XF8000790 0x00003FFF 0x00000305
|
||||
mask_write 0XF8000794 0x00003FFF 0x00000304
|
||||
mask_write 0XF8000798 0x00003FFF 0x00000304
|
||||
mask_write 0XF800079C 0x00003FFF 0x00000304
|
||||
mask_write 0XF80007A0 0x00003FFF 0x00000380
|
||||
mask_write 0XF80007A4 0x00003FFF 0x00000380
|
||||
mask_write 0XF80007A8 0x00003FFF 0x00000380
|
||||
mask_write 0XF80007AC 0x00003FFF 0x00000380
|
||||
mask_write 0XF80007B0 0x00003FFF 0x00000380
|
||||
mask_write 0XF80007B4 0x00003FFF 0x00000380
|
||||
mask_write 0XF80007B8 0x00003F01 0x00000201
|
||||
mask_write 0XF80007BC 0x00003F01 0x00000201
|
||||
mask_write 0XF80007C0 0x00003FFF 0x000002E0
|
||||
mask_write 0XF80007C4 0x00003FFF 0x000002E1
|
||||
mask_write 0XF80007C8 0x00003FFF 0x00000200
|
||||
mask_write 0XF80007CC 0x00003FFF 0x00000200
|
||||
mask_write 0XF80007D0 0x00003FFF 0x00000280
|
||||
mask_write 0XF80007D4 0x00003FFF 0x00000280
|
||||
mask_write 0XF8000830 0x003F003F 0x002F002E
|
||||
mwr -force 0XF8000004 0x0000767B
|
||||
}
|
||||
proc ps7_peripherals_init_data_3_0 {} {
|
||||
mwr -force 0XF8000008 0x0000DF0D
|
||||
mask_write 0XF8000B48 0x00000180 0x00000180
|
||||
mask_write 0XF8000B4C 0x00000180 0x00000180
|
||||
mask_write 0XF8000B50 0x00000180 0x00000180
|
||||
mask_write 0XF8000B54 0x00000180 0x00000180
|
||||
mwr -force 0XF8000004 0x0000767B
|
||||
mask_write 0XE0001034 0x000000FF 0x00000006
|
||||
mask_write 0XE0001018 0x0000FFFF 0x0000003E
|
||||
mask_write 0XE0001000 0x000001FF 0x00000017
|
||||
mask_write 0XE0001004 0x000003FF 0x00000020
|
||||
mask_write 0XE000D000 0x00080000 0x00080000
|
||||
mask_write 0XF8007000 0x20000000 0x00000000
|
||||
}
|
||||
proc ps7_post_config_3_0 {} {
|
||||
mwr -force 0XF8000008 0x0000DF0D
|
||||
mask_write 0XF8000900 0x0000000F 0x0000000F
|
||||
mask_write 0XF8000240 0xFFFFFFFF 0x00000000
|
||||
mwr -force 0XF8000004 0x0000767B
|
||||
}
|
||||
proc ps7_debug_3_0 {} {
|
||||
mwr -force 0XF8898FB0 0xC5ACCE55
|
||||
mwr -force 0XF8899FB0 0xC5ACCE55
|
||||
mwr -force 0XF8809FB0 0xC5ACCE55
|
||||
}
|
||||
proc ps7_pll_init_data_2_0 {} {
|
||||
mwr -force 0XF8000008 0x0000DF0D
|
||||
mask_write 0XF8000110 0x003FFFF0 0x000FA220
|
||||
mask_write 0XF8000100 0x0007F000 0x00028000
|
||||
mask_write 0XF8000100 0x00000010 0x00000010
|
||||
mask_write 0XF8000100 0x00000001 0x00000001
|
||||
mask_write 0XF8000100 0x00000001 0x00000000
|
||||
mask_poll 0XF800010C 0x00000001
|
||||
mask_write 0XF8000100 0x00000010 0x00000000
|
||||
mask_write 0XF8000120 0x1F003F30 0x1F000200
|
||||
mask_write 0XF8000114 0x003FFFF0 0x0012C220
|
||||
mask_write 0XF8000104 0x0007F000 0x00020000
|
||||
mask_write 0XF8000104 0x00000010 0x00000010
|
||||
mask_write 0XF8000104 0x00000001 0x00000001
|
||||
mask_write 0XF8000104 0x00000001 0x00000000
|
||||
mask_poll 0XF800010C 0x00000002
|
||||
mask_write 0XF8000104 0x00000010 0x00000000
|
||||
mask_write 0XF8000124 0xFFF00003 0x0C200003
|
||||
mask_write 0XF8000118 0x003FFFF0 0x001452C0
|
||||
mask_write 0XF8000108 0x0007F000 0x0001E000
|
||||
mask_write 0XF8000108 0x00000010 0x00000010
|
||||
mask_write 0XF8000108 0x00000001 0x00000001
|
||||
mask_write 0XF8000108 0x00000001 0x00000000
|
||||
mask_poll 0XF800010C 0x00000004
|
||||
mask_write 0XF8000108 0x00000010 0x00000000
|
||||
mwr -force 0XF8000004 0x0000767B
|
||||
}
|
||||
proc ps7_clock_init_data_2_0 {} {
|
||||
mwr -force 0XF8000008 0x0000DF0D
|
||||
mask_write 0XF8000128 0x03F03F01 0x00700F01
|
||||
mask_write 0XF8000138 0x00000011 0x00000001
|
||||
mask_write 0XF8000140 0x03F03F71 0x00100801
|
||||
mask_write 0XF800014C 0x00003F31 0x00000501
|
||||
mask_write 0XF8000150 0x00003F33 0x00001401
|
||||
mask_write 0XF8000154 0x00003F33 0x00001402
|
||||
mask_write 0XF8000168 0x00003F31 0x00000501
|
||||
mask_write 0XF8000170 0x03F03F30 0x00200500
|
||||
mask_write 0XF80001C4 0x00000001 0x00000001
|
||||
mask_write 0XF800012C 0x01FFCCCD 0x01EC044D
|
||||
mwr -force 0XF8000004 0x0000767B
|
||||
}
|
||||
proc ps7_ddr_init_data_2_0 {} {
|
||||
mask_write 0XF8006000 0x0001FFFF 0x00000080
|
||||
mask_write 0XF8006004 0x1FFFFFFF 0x00081081
|
||||
mask_write 0XF8006008 0x03FFFFFF 0x03C0780F
|
||||
mask_write 0XF800600C 0x03FFFFFF 0x02001001
|
||||
mask_write 0XF8006010 0x03FFFFFF 0x00014001
|
||||
mask_write 0XF8006014 0x001FFFFF 0x0004159B
|
||||
mask_write 0XF8006018 0xF7FFFFFF 0x452460D2
|
||||
mask_write 0XF800601C 0xFFFFFFFF 0x720238E5
|
||||
mask_write 0XF8006020 0xFFFFFFFC 0x272872D0
|
||||
mask_write 0XF8006024 0x0FFFFFFF 0x0000003C
|
||||
mask_write 0XF8006028 0x00003FFF 0x00002007
|
||||
mask_write 0XF800602C 0xFFFFFFFF 0x00000008
|
||||
mask_write 0XF8006030 0xFFFFFFFF 0x00040930
|
||||
mask_write 0XF8006034 0x13FF3FFF 0x000116D4
|
||||
mask_write 0XF8006038 0x00001FC3 0x00000000
|
||||
mask_write 0XF800603C 0x000FFFFF 0x00000777
|
||||
mask_write 0XF8006040 0xFFFFFFFF 0xFFF00000
|
||||
mask_write 0XF8006044 0x0FFFFFFF 0x0FF66666
|
||||
mask_write 0XF8006048 0x3FFFFFFF 0x0003C248
|
||||
mask_write 0XF8006050 0xFF0F8FFF 0x77010800
|
||||
mask_write 0XF8006058 0x0001FFFF 0x00000101
|
||||
mask_write 0XF800605C 0x0000FFFF 0x00005003
|
||||
mask_write 0XF8006060 0x000017FF 0x0000003E
|
||||
mask_write 0XF8006064 0x00021FE0 0x00020000
|
||||
mask_write 0XF8006068 0x03FFFFFF 0x00284141
|
||||
mask_write 0XF800606C 0x0000FFFF 0x00001610
|
||||
mask_write 0XF8006078 0x03FFFFFF 0x00466111
|
||||
mask_write 0XF800607C 0x000FFFFF 0x00032222
|
||||
mask_write 0XF80060A0 0x00FFFFFF 0x00008000
|
||||
mask_write 0XF80060A4 0xFFFFFFFF 0x10200802
|
||||
mask_write 0XF80060A8 0x0FFFFFFF 0x0690CB73
|
||||
mask_write 0XF80060AC 0x000001FF 0x000001FE
|
||||
mask_write 0XF80060B0 0x1FFFFFFF 0x1CFFFFFF
|
||||
mask_write 0XF80060B4 0x000007FF 0x00000200
|
||||
mask_write 0XF80060B8 0x01FFFFFF 0x00200066
|
||||
mask_write 0XF80060C4 0x00000003 0x00000000
|
||||
mask_write 0XF80060C8 0x000000FF 0x00000000
|
||||
mask_write 0XF80060DC 0x00000001 0x00000000
|
||||
mask_write 0XF80060F0 0x0000FFFF 0x00000000
|
||||
mask_write 0XF80060F4 0x0000000F 0x00000008
|
||||
mask_write 0XF8006114 0x000000FF 0x00000000
|
||||
mask_write 0XF8006118 0x7FFFFFFF 0x40000001
|
||||
mask_write 0XF800611C 0x7FFFFFFF 0x40000001
|
||||
mask_write 0XF8006120 0x7FFFFFFF 0x40000001
|
||||
mask_write 0XF8006124 0x7FFFFFFF 0x40000001
|
||||
mask_write 0XF800612C 0x000FFFFF 0x00033C03
|
||||
mask_write 0XF8006130 0x000FFFFF 0x00034003
|
||||
mask_write 0XF8006134 0x000FFFFF 0x0002F400
|
||||
mask_write 0XF8006138 0x000FFFFF 0x00030400
|
||||
mask_write 0XF8006140 0x000FFFFF 0x00000035
|
||||
mask_write 0XF8006144 0x000FFFFF 0x00000035
|
||||
mask_write 0XF8006148 0x000FFFFF 0x00000035
|
||||
mask_write 0XF800614C 0x000FFFFF 0x00000035
|
||||
mask_write 0XF8006154 0x000FFFFF 0x00000083
|
||||
mask_write 0XF8006158 0x000FFFFF 0x00000083
|
||||
mask_write 0XF800615C 0x000FFFFF 0x00000080
|
||||
mask_write 0XF8006160 0x000FFFFF 0x00000080
|
||||
mask_write 0XF8006168 0x001FFFFF 0x00000124
|
||||
mask_write 0XF800616C 0x001FFFFF 0x00000125
|
||||
mask_write 0XF8006170 0x001FFFFF 0x00000112
|
||||
mask_write 0XF8006174 0x001FFFFF 0x00000116
|
||||
mask_write 0XF800617C 0x000FFFFF 0x000000C3
|
||||
mask_write 0XF8006180 0x000FFFFF 0x000000C3
|
||||
mask_write 0XF8006184 0x000FFFFF 0x000000C0
|
||||
mask_write 0XF8006188 0x000FFFFF 0x000000C0
|
||||
mask_write 0XF8006190 0xFFFFFFFF 0x10040080
|
||||
mask_write 0XF8006194 0x000FFFFF 0x0001FC82
|
||||
mask_write 0XF8006204 0xFFFFFFFF 0x00000000
|
||||
mask_write 0XF8006208 0x000F03FF 0x000803FF
|
||||
mask_write 0XF800620C 0x000F03FF 0x000803FF
|
||||
mask_write 0XF8006210 0x000F03FF 0x000803FF
|
||||
mask_write 0XF8006214 0x000F03FF 0x000803FF
|
||||
mask_write 0XF8006218 0x000F03FF 0x000003FF
|
||||
mask_write 0XF800621C 0x000F03FF 0x000003FF
|
||||
mask_write 0XF8006220 0x000F03FF 0x000003FF
|
||||
mask_write 0XF8006224 0x000F03FF 0x000003FF
|
||||
mask_write 0XF80062A8 0x00000FF7 0x00000000
|
||||
mask_write 0XF80062AC 0xFFFFFFFF 0x00000000
|
||||
mask_write 0XF80062B0 0x003FFFFF 0x00005125
|
||||
mask_write 0XF80062B4 0x0003FFFF 0x000012A8
|
||||
mask_poll 0XF8000B74 0x00002000
|
||||
mask_write 0XF8006000 0x0001FFFF 0x00000081
|
||||
mask_poll 0XF8006054 0x00000007
|
||||
}
|
||||
proc ps7_mio_init_data_2_0 {} {
|
||||
mwr -force 0XF8000008 0x0000DF0D
|
||||
mask_write 0XF8000B40 0x00000FFF 0x00000600
|
||||
mask_write 0XF8000B44 0x00000FFF 0x00000600
|
||||
mask_write 0XF8000B48 0x00000FFF 0x00000672
|
||||
mask_write 0XF8000B4C 0x00000FFF 0x00000672
|
||||
mask_write 0XF8000B50 0x00000FFF 0x00000674
|
||||
mask_write 0XF8000B54 0x00000FFF 0x00000674
|
||||
mask_write 0XF8000B58 0x00000FFF 0x00000600
|
||||
mask_write 0XF8000B5C 0xFFFFFFFF 0x0018C61C
|
||||
mask_write 0XF8000B60 0xFFFFFFFF 0x00F9861C
|
||||
mask_write 0XF8000B64 0xFFFFFFFF 0x00F9861C
|
||||
mask_write 0XF8000B68 0xFFFFFFFF 0x00F9861C
|
||||
mask_write 0XF8000B6C 0x00007FFF 0x00000209
|
||||
mask_write 0XF8000B70 0x00000021 0x00000021
|
||||
mask_write 0XF8000B70 0x00000021 0x00000020
|
||||
mask_write 0XF8000B70 0x07FFFFFF 0x00000823
|
||||
mask_write 0XF8000700 0x00003FFF 0x00000600
|
||||
mask_write 0XF8000704 0x00003FFF 0x00000702
|
||||
mask_write 0XF8000708 0x00003FFF 0x00000702
|
||||
mask_write 0XF800070C 0x00003FFF 0x00000702
|
||||
mask_write 0XF8000710 0x00003FFF 0x00000702
|
||||
mask_write 0XF8000714 0x00003FFF 0x00000702
|
||||
mask_write 0XF8000718 0x00003FFF 0x00000702
|
||||
mask_write 0XF800071C 0x00003FFF 0x00000600
|
||||
mask_write 0XF8000720 0x00003FFF 0x00000700
|
||||
mask_write 0XF8000724 0x00003FFF 0x00000600
|
||||
mask_write 0XF8000728 0x00003FFF 0x00000600
|
||||
mask_write 0XF800072C 0x00003FFF 0x00000600
|
||||
mask_write 0XF8000730 0x00003FFF 0x00000600
|
||||
mask_write 0XF8000734 0x00003FFF 0x00000600
|
||||
mask_write 0XF8000738 0x00003FFF 0x00000600
|
||||
mask_write 0XF800073C 0x00003FFF 0x00000600
|
||||
mask_write 0XF8000740 0x00003FFF 0x00000302
|
||||
mask_write 0XF8000744 0x00003FFF 0x00000302
|
||||
mask_write 0XF8000748 0x00003FFF 0x00000302
|
||||
mask_write 0XF800074C 0x00003FFF 0x00000302
|
||||
mask_write 0XF8000750 0x00003FFF 0x00000302
|
||||
mask_write 0XF8000754 0x00003FFF 0x00000302
|
||||
mask_write 0XF8000758 0x00003FFF 0x00000303
|
||||
mask_write 0XF800075C 0x00003FFF 0x00000303
|
||||
mask_write 0XF8000760 0x00003FFF 0x00000303
|
||||
mask_write 0XF8000764 0x00003FFF 0x00000303
|
||||
mask_write 0XF8000768 0x00003FFF 0x00000303
|
||||
mask_write 0XF800076C 0x00003FFF 0x00000303
|
||||
mask_write 0XF8000770 0x00003FFF 0x00000304
|
||||
mask_write 0XF8000774 0x00003FFF 0x00000305
|
||||
mask_write 0XF8000778 0x00003FFF 0x00000304
|
||||
mask_write 0XF800077C 0x00003FFF 0x00000305
|
||||
mask_write 0XF8000780 0x00003FFF 0x00000304
|
||||
mask_write 0XF8000784 0x00003FFF 0x00000304
|
||||
mask_write 0XF8000788 0x00003FFF 0x00000304
|
||||
mask_write 0XF800078C 0x00003FFF 0x00000304
|
||||
mask_write 0XF8000790 0x00003FFF 0x00000305
|
||||
mask_write 0XF8000794 0x00003FFF 0x00000304
|
||||
mask_write 0XF8000798 0x00003FFF 0x00000304
|
||||
mask_write 0XF800079C 0x00003FFF 0x00000304
|
||||
mask_write 0XF80007A0 0x00003FFF 0x00000380
|
||||
mask_write 0XF80007A4 0x00003FFF 0x00000380
|
||||
mask_write 0XF80007A8 0x00003FFF 0x00000380
|
||||
mask_write 0XF80007AC 0x00003FFF 0x00000380
|
||||
mask_write 0XF80007B0 0x00003FFF 0x00000380
|
||||
mask_write 0XF80007B4 0x00003FFF 0x00000380
|
||||
mask_write 0XF80007B8 0x00003F01 0x00000201
|
||||
mask_write 0XF80007BC 0x00003F01 0x00000201
|
||||
mask_write 0XF80007C0 0x00003FFF 0x000002E0
|
||||
mask_write 0XF80007C4 0x00003FFF 0x000002E1
|
||||
mask_write 0XF80007C8 0x00003FFF 0x00000200
|
||||
mask_write 0XF80007CC 0x00003FFF 0x00000200
|
||||
mask_write 0XF80007D0 0x00003FFF 0x00000280
|
||||
mask_write 0XF80007D4 0x00003FFF 0x00000280
|
||||
mask_write 0XF8000830 0x003F003F 0x002F002E
|
||||
mwr -force 0XF8000004 0x0000767B
|
||||
}
|
||||
proc ps7_peripherals_init_data_2_0 {} {
|
||||
mwr -force 0XF8000008 0x0000DF0D
|
||||
mask_write 0XF8000B48 0x00000180 0x00000180
|
||||
mask_write 0XF8000B4C 0x00000180 0x00000180
|
||||
mask_write 0XF8000B50 0x00000180 0x00000180
|
||||
mask_write 0XF8000B54 0x00000180 0x00000180
|
||||
mwr -force 0XF8000004 0x0000767B
|
||||
mask_write 0XE0001034 0x000000FF 0x00000006
|
||||
mask_write 0XE0001018 0x0000FFFF 0x0000003E
|
||||
mask_write 0XE0001000 0x000001FF 0x00000017
|
||||
mask_write 0XE0001004 0x00000FFF 0x00000020
|
||||
mask_write 0XE000D000 0x00080000 0x00080000
|
||||
mask_write 0XF8007000 0x20000000 0x00000000
|
||||
}
|
||||
proc ps7_post_config_2_0 {} {
|
||||
mwr -force 0XF8000008 0x0000DF0D
|
||||
mask_write 0XF8000900 0x0000000F 0x0000000F
|
||||
mask_write 0XF8000240 0xFFFFFFFF 0x00000000
|
||||
mwr -force 0XF8000004 0x0000767B
|
||||
}
|
||||
proc ps7_debug_2_0 {} {
|
||||
mwr -force 0XF8898FB0 0xC5ACCE55
|
||||
mwr -force 0XF8899FB0 0xC5ACCE55
|
||||
mwr -force 0XF8809FB0 0xC5ACCE55
|
||||
}
|
||||
proc ps7_pll_init_data_1_0 {} {
|
||||
mwr -force 0XF8000008 0x0000DF0D
|
||||
mask_write 0XF8000110 0x003FFFF0 0x000FA220
|
||||
mask_write 0XF8000100 0x0007F000 0x00028000
|
||||
mask_write 0XF8000100 0x00000010 0x00000010
|
||||
mask_write 0XF8000100 0x00000001 0x00000001
|
||||
mask_write 0XF8000100 0x00000001 0x00000000
|
||||
mask_poll 0XF800010C 0x00000001
|
||||
mask_write 0XF8000100 0x00000010 0x00000000
|
||||
mask_write 0XF8000120 0x1F003F30 0x1F000200
|
||||
mask_write 0XF8000114 0x003FFFF0 0x0012C220
|
||||
mask_write 0XF8000104 0x0007F000 0x00020000
|
||||
mask_write 0XF8000104 0x00000010 0x00000010
|
||||
mask_write 0XF8000104 0x00000001 0x00000001
|
||||
mask_write 0XF8000104 0x00000001 0x00000000
|
||||
mask_poll 0XF800010C 0x00000002
|
||||
mask_write 0XF8000104 0x00000010 0x00000000
|
||||
mask_write 0XF8000124 0xFFF00003 0x0C200003
|
||||
mask_write 0XF8000118 0x003FFFF0 0x001452C0
|
||||
mask_write 0XF8000108 0x0007F000 0x0001E000
|
||||
mask_write 0XF8000108 0x00000010 0x00000010
|
||||
mask_write 0XF8000108 0x00000001 0x00000001
|
||||
mask_write 0XF8000108 0x00000001 0x00000000
|
||||
mask_poll 0XF800010C 0x00000004
|
||||
mask_write 0XF8000108 0x00000010 0x00000000
|
||||
mwr -force 0XF8000004 0x0000767B
|
||||
}
|
||||
proc ps7_clock_init_data_1_0 {} {
|
||||
mwr -force 0XF8000008 0x0000DF0D
|
||||
mask_write 0XF8000128 0x03F03F01 0x00700F01
|
||||
mask_write 0XF8000138 0x00000011 0x00000001
|
||||
mask_write 0XF8000140 0x03F03F71 0x00100801
|
||||
mask_write 0XF800014C 0x00003F31 0x00000501
|
||||
mask_write 0XF8000150 0x00003F33 0x00001401
|
||||
mask_write 0XF8000154 0x00003F33 0x00001402
|
||||
mask_write 0XF8000168 0x00003F31 0x00000501
|
||||
mask_write 0XF8000170 0x03F03F30 0x00200400
|
||||
mask_write 0XF80001C4 0x00000001 0x00000001
|
||||
mask_write 0XF800012C 0x01FFCCCD 0x01EC044D
|
||||
mwr -force 0XF8000004 0x0000767B
|
||||
}
|
||||
proc ps7_ddr_init_data_1_0 {} {
|
||||
mask_write 0XF8006000 0x0001FFFF 0x00000080
|
||||
mask_write 0XF8006004 0x1FFFFFFF 0x00081081
|
||||
mask_write 0XF8006008 0x03FFFFFF 0x03C0780F
|
||||
mask_write 0XF800600C 0x03FFFFFF 0x02001001
|
||||
mask_write 0XF8006010 0x03FFFFFF 0x00014001
|
||||
mask_write 0XF8006014 0x001FFFFF 0x0004159B
|
||||
mask_write 0XF8006018 0xF7FFFFFF 0x452460D2
|
||||
mask_write 0XF800601C 0xFFFFFFFF 0x720238E5
|
||||
mask_write 0XF8006020 0xFFFFFFFC 0x272872D0
|
||||
mask_write 0XF8006024 0x0FFFFFFF 0x0000003C
|
||||
mask_write 0XF8006028 0x00003FFF 0x00002007
|
||||
mask_write 0XF800602C 0xFFFFFFFF 0x00000008
|
||||
mask_write 0XF8006030 0xFFFFFFFF 0x00040930
|
||||
mask_write 0XF8006034 0x13FF3FFF 0x000116D4
|
||||
mask_write 0XF8006038 0x00001FC3 0x00000000
|
||||
mask_write 0XF800603C 0x000FFFFF 0x00000777
|
||||
mask_write 0XF8006040 0xFFFFFFFF 0xFFF00000
|
||||
mask_write 0XF8006044 0x0FFFFFFF 0x0FF66666
|
||||
mask_write 0XF8006048 0x3FFFFFFF 0x0003C248
|
||||
mask_write 0XF8006050 0xFF0F8FFF 0x77010800
|
||||
mask_write 0XF8006058 0x0001FFFF 0x00000101
|
||||
mask_write 0XF800605C 0x0000FFFF 0x00005003
|
||||
mask_write 0XF8006060 0x000017FF 0x0000003E
|
||||
mask_write 0XF8006064 0x00021FE0 0x00020000
|
||||
mask_write 0XF8006068 0x03FFFFFF 0x00284141
|
||||
mask_write 0XF800606C 0x0000FFFF 0x00001610
|
||||
mask_write 0XF80060A0 0x00FFFFFF 0x00008000
|
||||
mask_write 0XF80060A4 0xFFFFFFFF 0x10200802
|
||||
mask_write 0XF80060A8 0x0FFFFFFF 0x0690CB73
|
||||
mask_write 0XF80060AC 0x000001FF 0x000001FE
|
||||
mask_write 0XF80060B0 0x1FFFFFFF 0x1CFFFFFF
|
||||
mask_write 0XF80060B4 0x000007FF 0x00000200
|
||||
mask_write 0XF80060B8 0x01FFFFFF 0x00200066
|
||||
mask_write 0XF80060C4 0x00000003 0x00000000
|
||||
mask_write 0XF80060C8 0x000000FF 0x00000000
|
||||
mask_write 0XF80060DC 0x00000001 0x00000000
|
||||
mask_write 0XF80060F0 0x0000FFFF 0x00000000
|
||||
mask_write 0XF80060F4 0x0000000F 0x00000008
|
||||
mask_write 0XF8006114 0x000000FF 0x00000000
|
||||
mask_write 0XF8006118 0x7FFFFFFF 0x40000001
|
||||
mask_write 0XF800611C 0x7FFFFFFF 0x40000001
|
||||
mask_write 0XF8006120 0x7FFFFFFF 0x40000001
|
||||
mask_write 0XF8006124 0x7FFFFFFF 0x40000001
|
||||
mask_write 0XF800612C 0x000FFFFF 0x00033C03
|
||||
mask_write 0XF8006130 0x000FFFFF 0x00034003
|
||||
mask_write 0XF8006134 0x000FFFFF 0x0002F400
|
||||
mask_write 0XF8006138 0x000FFFFF 0x00030400
|
||||
mask_write 0XF8006140 0x000FFFFF 0x00000035
|
||||
mask_write 0XF8006144 0x000FFFFF 0x00000035
|
||||
mask_write 0XF8006148 0x000FFFFF 0x00000035
|
||||
mask_write 0XF800614C 0x000FFFFF 0x00000035
|
||||
mask_write 0XF8006154 0x000FFFFF 0x00000083
|
||||
mask_write 0XF8006158 0x000FFFFF 0x00000083
|
||||
mask_write 0XF800615C 0x000FFFFF 0x00000080
|
||||
mask_write 0XF8006160 0x000FFFFF 0x00000080
|
||||
mask_write 0XF8006168 0x001FFFFF 0x00000124
|
||||
mask_write 0XF800616C 0x001FFFFF 0x00000125
|
||||
mask_write 0XF8006170 0x001FFFFF 0x00000112
|
||||
mask_write 0XF8006174 0x001FFFFF 0x00000116
|
||||
mask_write 0XF800617C 0x000FFFFF 0x000000C3
|
||||
mask_write 0XF8006180 0x000FFFFF 0x000000C3
|
||||
mask_write 0XF8006184 0x000FFFFF 0x000000C0
|
||||
mask_write 0XF8006188 0x000FFFFF 0x000000C0
|
||||
mask_write 0XF8006190 0xFFFFFFFF 0x10040080
|
||||
mask_write 0XF8006194 0x000FFFFF 0x0001FC82
|
||||
mask_write 0XF8006204 0xFFFFFFFF 0x00000000
|
||||
mask_write 0XF8006208 0x000F03FF 0x000803FF
|
||||
mask_write 0XF800620C 0x000F03FF 0x000803FF
|
||||
mask_write 0XF8006210 0x000F03FF 0x000803FF
|
||||
mask_write 0XF8006214 0x000F03FF 0x000803FF
|
||||
mask_write 0XF8006218 0x000F03FF 0x000003FF
|
||||
mask_write 0XF800621C 0x000F03FF 0x000003FF
|
||||
mask_write 0XF8006220 0x000F03FF 0x000003FF
|
||||
mask_write 0XF8006224 0x000F03FF 0x000003FF
|
||||
mask_write 0XF80062A8 0x00000FF7 0x00000000
|
||||
mask_write 0XF80062AC 0xFFFFFFFF 0x00000000
|
||||
mask_write 0XF80062B0 0x003FFFFF 0x00005125
|
||||
mask_write 0XF80062B4 0x0003FFFF 0x000012A8
|
||||
mask_poll 0XF8000B74 0x00002000
|
||||
mask_write 0XF8006000 0x0001FFFF 0x00000081
|
||||
mask_poll 0XF8006054 0x00000007
|
||||
}
|
||||
proc ps7_mio_init_data_1_0 {} {
|
||||
mwr -force 0XF8000008 0x0000DF0D
|
||||
mask_write 0XF8000B40 0x00000FFF 0x00000600
|
||||
mask_write 0XF8000B44 0x00000FFF 0x00000600
|
||||
mask_write 0XF8000B48 0x00000FFF 0x00000672
|
||||
mask_write 0XF8000B4C 0x00000FFF 0x00000672
|
||||
mask_write 0XF8000B50 0x00000FFF 0x00000674
|
||||
mask_write 0XF8000B54 0x00000FFF 0x00000674
|
||||
mask_write 0XF8000B58 0x00000FFF 0x00000600
|
||||
mask_write 0XF8000B5C 0xFFFFFFFF 0x0018C61C
|
||||
mask_write 0XF8000B60 0xFFFFFFFF 0x00F9861C
|
||||
mask_write 0XF8000B64 0xFFFFFFFF 0x00F9861C
|
||||
mask_write 0XF8000B68 0xFFFFFFFF 0x00F9861C
|
||||
mask_write 0XF8000B6C 0x000073FF 0x00000209
|
||||
mask_write 0XF8000B70 0x00000021 0x00000021
|
||||
mask_write 0XF8000B70 0x00000021 0x00000020
|
||||
mask_write 0XF8000B70 0x07FFFFFF 0x00000823
|
||||
mask_write 0XF8000700 0x00003FFF 0x00000600
|
||||
mask_write 0XF8000704 0x00003FFF 0x00000702
|
||||
mask_write 0XF8000708 0x00003FFF 0x00000702
|
||||
mask_write 0XF800070C 0x00003FFF 0x00000702
|
||||
mask_write 0XF8000710 0x00003FFF 0x00000702
|
||||
mask_write 0XF8000714 0x00003FFF 0x00000702
|
||||
mask_write 0XF8000718 0x00003FFF 0x00000702
|
||||
mask_write 0XF800071C 0x00003FFF 0x00000600
|
||||
mask_write 0XF8000720 0x00003FFF 0x00000700
|
||||
mask_write 0XF8000724 0x00003FFF 0x00000600
|
||||
mask_write 0XF8000728 0x00003FFF 0x00000600
|
||||
mask_write 0XF800072C 0x00003FFF 0x00000600
|
||||
mask_write 0XF8000730 0x00003FFF 0x00000600
|
||||
mask_write 0XF8000734 0x00003FFF 0x00000600
|
||||
mask_write 0XF8000738 0x00003FFF 0x00000600
|
||||
mask_write 0XF800073C 0x00003FFF 0x00000600
|
||||
mask_write 0XF8000740 0x00003FFF 0x00000302
|
||||
mask_write 0XF8000744 0x00003FFF 0x00000302
|
||||
mask_write 0XF8000748 0x00003FFF 0x00000302
|
||||
mask_write 0XF800074C 0x00003FFF 0x00000302
|
||||
mask_write 0XF8000750 0x00003FFF 0x00000302
|
||||
mask_write 0XF8000754 0x00003FFF 0x00000302
|
||||
mask_write 0XF8000758 0x00003FFF 0x00000303
|
||||
mask_write 0XF800075C 0x00003FFF 0x00000303
|
||||
mask_write 0XF8000760 0x00003FFF 0x00000303
|
||||
mask_write 0XF8000764 0x00003FFF 0x00000303
|
||||
mask_write 0XF8000768 0x00003FFF 0x00000303
|
||||
mask_write 0XF800076C 0x00003FFF 0x00000303
|
||||
mask_write 0XF8000770 0x00003FFF 0x00000304
|
||||
mask_write 0XF8000774 0x00003FFF 0x00000305
|
||||
mask_write 0XF8000778 0x00003FFF 0x00000304
|
||||
mask_write 0XF800077C 0x00003FFF 0x00000305
|
||||
mask_write 0XF8000780 0x00003FFF 0x00000304
|
||||
mask_write 0XF8000784 0x00003FFF 0x00000304
|
||||
mask_write 0XF8000788 0x00003FFF 0x00000304
|
||||
mask_write 0XF800078C 0x00003FFF 0x00000304
|
||||
mask_write 0XF8000790 0x00003FFF 0x00000305
|
||||
mask_write 0XF8000794 0x00003FFF 0x00000304
|
||||
mask_write 0XF8000798 0x00003FFF 0x00000304
|
||||
mask_write 0XF800079C 0x00003FFF 0x00000304
|
||||
mask_write 0XF80007A0 0x00003FFF 0x00000380
|
||||
mask_write 0XF80007A4 0x00003FFF 0x00000380
|
||||
mask_write 0XF80007A8 0x00003FFF 0x00000380
|
||||
mask_write 0XF80007AC 0x00003FFF 0x00000380
|
||||
mask_write 0XF80007B0 0x00003FFF 0x00000380
|
||||
mask_write 0XF80007B4 0x00003FFF 0x00000380
|
||||
mask_write 0XF80007B8 0x00003F01 0x00000201
|
||||
mask_write 0XF80007BC 0x00003F01 0x00000201
|
||||
mask_write 0XF80007C0 0x00003FFF 0x000002E0
|
||||
mask_write 0XF80007C4 0x00003FFF 0x000002E1
|
||||
mask_write 0XF80007C8 0x00003FFF 0x00000200
|
||||
mask_write 0XF80007CC 0x00003FFF 0x00000200
|
||||
mask_write 0XF80007D0 0x00003FFF 0x00000280
|
||||
mask_write 0XF80007D4 0x00003FFF 0x00000280
|
||||
mask_write 0XF8000830 0x003F003F 0x002F002E
|
||||
mwr -force 0XF8000004 0x0000767B
|
||||
}
|
||||
proc ps7_peripherals_init_data_1_0 {} {
|
||||
mwr -force 0XF8000008 0x0000DF0D
|
||||
mask_write 0XF8000B48 0x00000180 0x00000180
|
||||
mask_write 0XF8000B4C 0x00000180 0x00000180
|
||||
mask_write 0XF8000B50 0x00000180 0x00000180
|
||||
mask_write 0XF8000B54 0x00000180 0x00000180
|
||||
mwr -force 0XF8000004 0x0000767B
|
||||
mask_write 0XE0001034 0x000000FF 0x00000006
|
||||
mask_write 0XE0001018 0x0000FFFF 0x0000003E
|
||||
mask_write 0XE0001000 0x000001FF 0x00000017
|
||||
mask_write 0XE0001004 0x00000FFF 0x00000020
|
||||
mask_write 0XE000D000 0x00080000 0x00080000
|
||||
mask_write 0XF8007000 0x20000000 0x00000000
|
||||
}
|
||||
proc ps7_post_config_1_0 {} {
|
||||
mwr -force 0XF8000008 0x0000DF0D
|
||||
mask_write 0XF8000900 0x0000000F 0x0000000F
|
||||
mask_write 0XF8000240 0xFFFFFFFF 0x00000000
|
||||
mwr -force 0XF8000004 0x0000767B
|
||||
}
|
||||
proc ps7_debug_1_0 {} {
|
||||
mwr -force 0XF8898FB0 0xC5ACCE55
|
||||
mwr -force 0XF8899FB0 0xC5ACCE55
|
||||
mwr -force 0XF8809FB0 0xC5ACCE55
|
||||
}
|
||||
set PCW_SILICON_VER_1_0 "0x0"
|
||||
set PCW_SILICON_VER_2_0 "0x1"
|
||||
set PCW_SILICON_VER_3_0 "0x2"
|
||||
set APU_FREQ 666666667
|
||||
|
||||
|
||||
|
||||
proc mask_poll { addr mask } {
|
||||
set count 1
|
||||
set curval "0x[string range [mrd $addr] end-8 end]"
|
||||
set maskedval [expr {$curval & $mask}]
|
||||
while { $maskedval == 0 } {
|
||||
set curval "0x[string range [mrd $addr] end-8 end]"
|
||||
set maskedval [expr {$curval & $mask}]
|
||||
set count [ expr { $count + 1 } ]
|
||||
if { $count == 100000000 } {
|
||||
puts "Timeout Reached. Mask poll failed at ADDRESS: $addr MASK: $mask"
|
||||
break
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
|
||||
proc mask_delay { addr val } {
|
||||
set delay [ get_number_of_cycles_for_delay $val ]
|
||||
perf_reset_and_start_timer
|
||||
set curval "0x[string range [mrd $addr] end-8 end]"
|
||||
set maskedval [expr {$curval < $delay}]
|
||||
while { $maskedval == 1 } {
|
||||
set curval "0x[string range [mrd $addr] end-8 end]"
|
||||
set maskedval [expr {$curval < $delay}]
|
||||
}
|
||||
perf_reset_clock
|
||||
}
|
||||
|
||||
proc ps_version { } {
|
||||
set si_ver "0x[string range [mrd 0xF8007080] end-8 end]"
|
||||
set mask_sil_ver "0x[expr {$si_ver >> 28}]"
|
||||
return $mask_sil_ver;
|
||||
}
|
||||
|
||||
proc ps7_post_config {} {
|
||||
|
||||
ps7_post_config_1_0
|
||||
|
||||
}
|
||||
|
||||
proc ps7_debug {} {
|
||||
ps7_debug_1_0
|
||||
|
||||
}
|
||||
proc ps7_init {} {
|
||||
|
||||
ps7_mio_init_data_1_0
|
||||
ps7_pll_init_data_1_0
|
||||
ps7_clock_init_data_1_0
|
||||
ps7_ddr_init_data_1_0
|
||||
ps7_peripherals_init_data_1_0
|
||||
}
|
||||
|
||||
|
||||
# For delay calculation using global timer
|
||||
|
||||
# start timer
|
||||
proc perf_start_clock { } {
|
||||
|
||||
#writing SCU_GLOBAL_TIMER_CONTROL register
|
||||
|
||||
mask_write 0xF8F00208 0x00000109 0x00000009
|
||||
}
|
||||
|
||||
# stop timer and reset timer count regs
|
||||
proc perf_reset_clock { } {
|
||||
perf_disable_clock
|
||||
mask_write 0xF8F00200 0xFFFFFFFF 0x00000000
|
||||
mask_write 0xF8F00204 0xFFFFFFFF 0x00000000
|
||||
}
|
||||
|
||||
# Compute mask for given delay in miliseconds
|
||||
proc get_number_of_cycles_for_delay { delay } {
|
||||
|
||||
# GTC is always clocked at 1/2 of the CPU frequency (CPU_3x2x)
|
||||
variable APU_FREQ
|
||||
return [ expr ($delay * $APU_FREQ /(2 * 1000))]
|
||||
}
|
||||
|
||||
|
||||
# stop timer
|
||||
proc perf_disable_clock {} {
|
||||
mask_write 0xF8F00208 0xFFFFFFFF 0x00000000
|
||||
}
|
||||
|
||||
proc perf_reset_and_start_timer {} {
|
||||
perf_reset_clock
|
||||
perf_start_clock
|
||||
}
|
||||
|
||||
|
|
@ -0,0 +1,19 @@
|
|||
source ./digilent-hs2.cfg
|
||||
adapter speed 1000
|
||||
|
||||
set PL_TAPID 0x13722093
|
||||
set SMP 1
|
||||
|
||||
source ./zynq-7000.cfg
|
||||
|
||||
reset_config none
|
||||
|
||||
source ./common.cfg
|
||||
|
||||
halt
|
||||
|
||||
# Disable MMU
|
||||
targets $_TARGETNAME_1
|
||||
arm mcr 15 0 1 0 0 [expr { [arm mrc 15 0 1 0 0] & ~0xd }]
|
||||
targets $_TARGETNAME_0
|
||||
arm mcr 15 0 1 0 0 [expr { [arm mrc 15 0 1 0 0] & ~0xd }]
|
Some files were not shown because too many files have changed in this diff Show More
Loading…
Reference in New Issue