flake: update dependencies

Signed-off-by: Jonathan Coates <jonathan.coates@oxionics.com>

.gitignore

@@ -3,3 +3,11 @@ examples/*.elf
 __pycache__
 
 build
+
+src/libboard_artiq/Cargo.toml
+src/libc/Cargo.toml
+src/libdyld/Cargo.toml
+src/libio/Cargo.toml
+src/libksupport/Cargo.toml
+src/runtime/Cargo.toml
+src/satman/Cargo.toml

README.md

@@ -4,67 +4,107 @@ ARTIQ on Zynq
 How to use
 ----------
 
-1. Install ARTIQ-6 or newer.
+1. [Install ARTIQ](https://m-labs.hk/artiq/manual/installing.html). Get the corresponding version to the ``artiq-zynq`` version you are targeting.
-2. Select the latest successful build on Hydra: https://nixbld.m-labs.hk/jobset/artiq/zynq
+2. To obtain firmware binaries, use AFWS or build your own; see [the ARTIQ manual](https://m-labs.hk/artiq/manual/building_developing.html) for detailed instructions or skip to "Development" below. ZC706 variants only can also be downloaded from latest successful build on [Hydra](https://nixbld.m-labs.hk/).
-3. Search for the job named ``<board>-<variant>-sd`` (for example: ``zc706-nist_clock-sd`` or ``zc706-nist_qc2-sd``).
+3. Place ``boot.bin`` file at the root ``/`` of a FAT-formatted SD card.
-4. Download the ``boot.bin`` "binary distribution" and place it at the root of a FAT-formatted SD card.
+4. Optionally, create a ``config.txt`` configuration file containing ``key=value`` pairs on each line and place it at the root of the SD card. See below for valid keys. The ``ip``, ``ip6`` and ``mac`` keys can be used to set networking information. If these keys are not found, the firmware will use default values which may or may not be compatible with your network.
-5. Optionally, create a ``config.txt`` configuration file at the root of the SD card containing ``key=value`` pairs on each line. Use the ``ip``, ``ip6`` and ``mac`` keys to respectively set the IPv4, IPv6 and MAC address of the board. Configuring an IPv6 address is entirely optional. If these keys are not found, the firmware will use default values that may or may not be compatible with your network.
+5. Insert the SD card into the board and set the board to boot from the SD card. For ZC706, this is achieved by placing the large DIP switch SW11 into the 00110 position. On Kasli-SoC, place the BOOT MODE switches to SD.
-6. Insert the SD card into the board and set up the board to boot from the SD card. For the ZC706, this is achieved by placing the large DIP switch SW11 in the 00110 position.
+6. Power up the board. After successful boot the firmware should respond to ping at its IP addresses. Boot output can be observed from UART at 115200bps 8-N-1.
-7. Power up the board. After the firmware starts successfully, it should respond to ping at its IP addresses, and boot messages can be observed from its UART at 115200bps.
+7. Create and use an ARTIQ device database as usual.
-8. Create and use an ARTIQ device database as usual, but set ``"target": "cortexa9"`` in the arguments of the core device.
 
 Configuration
 -------------
 
-Configuring the device is done using the ``config.txt`` text file at the root of the SD card, plus the contents of the ``config`` folder. When searching for a configuration key, the firmware first looks for a file named ``/config/[key].bin`` and, if it exists, returns the contents of that file. If not, it looks into ``/config.txt``, which contains a list of ``key=value`` pairs, one per line. The ``config`` folder allows configuration values that consist in binary data, such as the startup kernel.
+Configuring the device is done using the ``config.txt`` text file at the root of the SD card plus optionally a ``config`` folder. When searching for a configuration key, the firmware first looks for a file named ``/config/[key].bin`` and, if it exists, returns the contents of that file. If not, it looks into ``/config.txt``, which should contain a list of ``key=value`` pairs, one per line. ``config.txt`` should be used for most keys but the ``config`` folder allows for setting configuration values which consist of binary data, such as the startup kernel.
 
-The following configuration keys are available:
+The following configuration keys are available among others:
 
 - ``mac``: Ethernet MAC address.
 - ``ip``: IPv4 address.
 - ``ip6``: IPv6 address.
-- ``startup``: startup kernel in ELF format (as produced by ``artiq_compile``).
+- ``idle_kernel``: idle kernel in ELF format (as produced by ``artiq_compile``).
+- ``startup_kernel``: startup kernel in ELF format (as produced by ``artiq_compile``).
 - ``rtio_clock``: source of RTIO clock; valid values are ``ext0_bypass`` and ``int_125``.
-- ``boot``: SD card "boot.bin" file, for replacing the boot firmware/gateware. Write only.
 
-Configurations can be read/written/removed via ``artiq_coremgmt``. Config erase is
+See [ARTIQ manual](https://m-labs.hk/artiq/manual-beta/core_device.html#configuration-storage) for full list. Configurations can be read/written/removed with ``artiq_coremgmt``. Config erase is not implemented, as it isn't particularly useful.
-not implemented as it seems not very useful.
+
+For convenience, the ``boot`` key can be used with ``artiq_coremgmt`` and a ``boot.bin`` file to replace firmware/gateware in a running system. This key is read-only. When loading ``boot.bin`` onto the SD card directly, place it at the root and not in the ``config`` folder.
 
 Development instructions
 ------------------------
 
-ARTIQ on Zynq is packaged using the [Nix](https://nixos.org) Flakes system. Install Nix 2.4+ and enable flakes by adding ``experimental-features = nix-command flakes`` to ``nix.conf`` (e.g. ``~/.config/nix/nix.conf``). 
+ARTIQ on Zynq is packaged using [Nix](https://nixos.org) Flakes. Install Nix 2.8+ and enable flakes by adding ``experimental-features = nix-command flakes`` to ``nix.conf`` (e.g. ``~/.config/nix/nix.conf``).
 
-Pure build with Nix and execution on a remote JTAG server:
+**Pure build with Nix:**
 
 ```shell
-nix build .#zc706-nist_clock-jtag  # or zc706-nist_qc2-jtag or zc706-nist_clock_satellite-jtag etc.
+nix build .#zc706-nist_clock-jtag  # or zc706-nist_qc2-jtag or zc706-nist_clock-sd or etc
-./remote_run.sh
 ```
 
-Impure incremental build and execution on a remote JTAG server:
+Run ``nix flake show`` to see all valid build targets. Targets suffixed with ``-jtag`` produce separate firmware and gateware files, intended for use in booting via JTAG server/Ethernet, e.g. ``./remote_run.sh -i`` with a remote JTAG server. Targets suffixed with ``-sd`` will produce ``boot.bin`` file suitable for SD card boot. ``-firmware`` and ``-gateware`` respectively build firmware and gateware only.
+
+The Kasli-SoC target requires a system description file as input. See ARTIQ manual for exact instructions or use incremental build.
+
+**Impure incremental build:**
+
+For boards with fixed variants, i.e. ZC706, etc. :
 
 ```shell
 nix develop
 cd src
-gateware/zc706.py -g ../build/gateware -V <variant> # build gateware
+gateware/<board>.py -g ../build/gateware -V <variant> # gateware
-make GWARGS="-V <variant>" <runtime/satman>    # build firmware
+make GWARGS="-V <variant>" <runtime/satman>    # firmware
-cd ..
+```
-./remote_run.sh -i
+
+For boards with system descriptions, i.e. Kasli-SoC, etc. :
+
+```shell
+nix develop
+cd src
+gateware/<board>.py -g ../build/gateware <description.json> # gateware
+make TARGET=<board> GWARGS="path/to/description.json" <runtime/satman> # firmware
+```
+
+``szl.elf`` can be obtained with:
+
+```shell
+nix build git+https://git.m-labs.hk/m-labs/zynq-rs#<board>-szl
+```
+
+To generate ``boot.bin`` use ``mkbootimage``, e.g.:
+
+```shell
+echo "the_ROM_image:
+    {
+        [bootloader]result/szl.elf
+        gateware/top.bit
+        firmware/armv7-none-eabihf/release/<runtime/satman>
+    }
+    EOF" >> boot.bif
+mkbootimage boot.bif boot.bin
 ```
 
 Notes:
 
 - The impure build process is also compatible with non-Nix systems.
-- When calling make, you need to specify both the variant and firmware type.
 - Firmware type must be either ``runtime`` for DRTIO-less or DRTIO master variants, or ``satman`` for DRTIO satellite.
-- If the board is connected to the local machine, use the ``local_run.sh`` script.
+- If the board is connected to the local machine by JTAG, use the ``local_run.sh`` script.
-- To update ``zynq-rs``, update the cargo files as per usual for Rust projects, but also keep ``flake.lock`` in sync.
+- A known Xilinx hardware bug prevents repeatedly loading the bootloader over JTAG without a POR reset. If booting over JTAG, install a jumper on ``PS_POR_B`` and use the POR reset script [here](https://git.m-labs.hk/M-Labs/zynq-rs/src/branch/master/kasli_soc_por.py).
+
+Pre-Commit Hooks
+----------------
+
+You are strongly recommended to use the provided pre-commit hooks to automatically reformat files and check for non-optimal Rust/C/C++ practices. Run `pre-commit install` to install the hook and `pre-commit` will automatically run `cargo fmt`, `cargo clippy`, and `clang-format` for you.
+
+Several things to note:
+
+- If `cargo fmt`, `cargo clippy`, or `clang-format` returns an error, the pre-commit hook will fail. You should fix all errors before trying to commit again.
+- If `cargo fmt` or `clang-format` reformats some files, the pre-commit hook will also fail. You should review the changes and, if satisfied, try to commit again.
 
 License
 -------
 
-Copyright (C) 2019-2022 M-Labs Limited.
+Copyright (C) 2019-2024 M-Labs Limited.
 
 ARTIQ is free software: you can redistribute it and/or modify
 it under the terms of the GNU Lesser General Public License as published by

examples/device_db.py

@@ -8,7 +8,7 @@ device_db = {
         "arguments": {
             "host": "192.168.1.52",
             "ref_period": 1e-9,
-            "ref_multiplier": 1,
+            "ref_multiplier": 8,
             "target": "cortexa9"
         }
     },
@@ -59,6 +59,14 @@ device_db["ad9914dds1"] = {
     "arguments": {"sysclk": 3e9, "bus_channel": 50, "channel": 1},
 }
 
+for i in range(4):
+    device_db["ttl"+str(i)+"_counter"] = {
+        "type": "local",
+        "module": "artiq.coredevice.edge_counter",
+        "class": "EdgeCounter",
+        "arguments": {"channel": 52+i}
+    }
+
 # for ARTIQ test suite
 device_db.update(
     loop_out="ttl0",

examples/ebaz4205/device_db.py

@@ -0,0 +1,78 @@
+core_addr = "192.168.1.57"
+
+device_db = {
+    "core": {
+        "type": "local",
+        "module": "artiq.coredevice.core",
+        "class": "Core",
+        "arguments": {
+            "host": core_addr,
+            "ref_period": 1e-9,
+            "target": "cortexa9",
+        },
+    },
+    "core_log": {
+        "type": "controller",
+        "host": "::1",
+        "port": 1068,
+        "command": "aqctl_corelog -p {port} --bind {bind} " + core_addr,
+    },
+    "core_moninj": {
+        "type": "controller",
+        "host": "::1",
+        "port_proxy": 1383,
+        "port": 1384,
+        "command": "aqctl_moninj_proxy --port-proxy {port_proxy} --port-control {port} --bind {bind} "
+        + core_addr,
+    },
+    "core_analyzer": {
+        "type": "controller",
+        "host": "::1",
+        "port_proxy": 1385,
+        "port": 1386,
+        "command": "aqctl_coreanalyzer_proxy --port-proxy {port_proxy} --port-control {port} --bind {bind} "
+        + core_addr,
+    },
+    "core_cache": {
+        "type": "local",
+        "module": "artiq.coredevice.cache",
+        "class": "CoreCache",
+    },
+    "core_dma": {"type": "local", "module": "artiq.coredevice.dma", "class": "CoreDMA"},
+    "led0": {
+        "type": "local",
+        "module": "artiq.coredevice.ttl",
+        "class": "TTLOut",
+        "arguments": {"channel": 0},
+    },
+    "led1": {
+        "type": "local",
+        "module": "artiq.coredevice.ttl",
+        "class": "TTLOut",
+        "arguments": {"channel": 1},
+    },
+}
+
+# TTLs starting at RTIO channel 2, ending at RTIO channel 15
+for i in range(2, 16):
+    device_db["ttl" + str(i)] = {
+        "type": "local",
+        "module": "artiq.coredevice.ttl",
+        "class": "TTLInOut",
+        "arguments": {"channel": i},
+    }
+
+device_db.update(
+    spi0={
+        "type": "local",
+        "module": "artiq.coredevice.spi2",
+        "class": "SPIMaster",
+        "arguments": {"channel": 16},
+    },
+    dds0={
+        "type": "local",
+        "module": "artiq.coredevice.ad9834",
+        "class": "AD9834",
+        "arguments": {"spi_device": "spi0"},
+    },
+)

flake.lock

@@ -3,19 +3,19 @@
     "artiq": {
       "inputs": {
         "artiq-comtools": "artiq-comtools",
-        "mozilla-overlay": "mozilla-overlay",
         "nixpkgs": "nixpkgs",
+        "rust-overlay": "rust-overlay",
         "sipyco": "sipyco",
         "src-migen": "src-migen",
         "src-misoc": "src-misoc",
         "src-pythonparser": "src-pythonparser"
       },
       "locked": {
-        "lastModified": 1654087576,
+        "lastModified": 1732066716,
-        "narHash": "sha256-d+LCvCXikhhEjsf4qBZakx3Sda85p+4vVZVwE1YuS90=",
+        "narHash": "sha256-krjvt9+RccnAxSEZcFhRpjA2S3CoqE4MSa1JUg421b4=",
-        "ref": "master",
+        "ref": "refs/heads/master",
-        "rev": "68ef0073ea66fe9c7f7c178979ecb8c681c47caa",
+        "rev": "270a417a28b516d36983779a1adb6d33a3c55a4a",
-        "revCount": 8068,
+        "revCount": 9102,
         "type": "git",
         "url": "https://github.com/m-labs/artiq.git"
       },
@@ -26,6 +26,7 @@
     },
     "artiq-comtools": {
       "inputs": {
+        "flake-utils": "flake-utils",
         "nixpkgs": [
           "artiq",
           "nixpkgs"
@@ -36,11 +37,11 @@
         ]
       },
       "locked": {
-        "lastModified": 1654007592,
+        "lastModified": 1720768567,
-        "narHash": "sha256-vaDFhE1ItjqtIcinC/6RAJGbj44pxxMUEeQUa3FtgEE=",
+        "narHash": "sha256-3VoK7o5MtHtbHLrc6Pv+eQWFtaz5Gd/YWyV5TD3c5Ss=",
         "owner": "m-labs",
         "repo": "artiq-comtools",
-        "rev": "cb73281154656ee8f74db1866859e31bf42755cd",
+        "rev": "f93570d8f2ed5a3cfb3e1c16ab00f2540551e994",
         "type": "github"
       },
       "original": {
@@ -49,66 +50,36 @@
         "type": "github"
       }
     },
-    "mozilla-overlay": {
+    "flake-utils": {
-      "flake": false,
+      "inputs": {
+        "systems": "systems"
+      },
       "locked": {
-        "lastModified": 1650459918,
+        "lastModified": 1710146030,
-        "narHash": "sha256-sroCK+QJTmoXtcRkwZyKOP9iAYOPID2Bwdxn4GkG16w=",
+        "narHash": "sha256-SZ5L6eA7HJ/nmkzGG7/ISclqe6oZdOZTNoesiInkXPQ=",
-        "owner": "mozilla",
+        "owner": "numtide",
-        "repo": "nixpkgs-mozilla",
+        "repo": "flake-utils",
-        "rev": "e1f7540fc0a8b989fb8cf701dc4fd7fc76bcf168",
+        "rev": "b1d9ab70662946ef0850d488da1c9019f3a9752a",
         "type": "github"
       },
       "original": {
-        "owner": "mozilla",
+        "owner": "numtide",
-        "repo": "nixpkgs-mozilla",
+        "repo": "flake-utils",
-        "type": "github"
-      }
-    },
-    "mozilla-overlay_2": {
-      "flake": false,
-      "locked": {
-        "lastModified": 1650459918,
-        "narHash": "sha256-sroCK+QJTmoXtcRkwZyKOP9iAYOPID2Bwdxn4GkG16w=",
-        "owner": "mozilla",
-        "repo": "nixpkgs-mozilla",
-        "rev": "e1f7540fc0a8b989fb8cf701dc4fd7fc76bcf168",
-        "type": "github"
-      },
-      "original": {
-        "owner": "mozilla",
-        "repo": "nixpkgs-mozilla",
-        "type": "github"
-      }
-    },
-    "mozilla-overlay_3": {
-      "flake": false,
-      "locked": {
-        "lastModified": 1650459918,
-        "narHash": "sha256-sroCK+QJTmoXtcRkwZyKOP9iAYOPID2Bwdxn4GkG16w=",
-        "owner": "mozilla",
-        "repo": "nixpkgs-mozilla",
-        "rev": "e1f7540fc0a8b989fb8cf701dc4fd7fc76bcf168",
-        "type": "github"
-      },
-      "original": {
-        "owner": "mozilla",
-        "repo": "nixpkgs-mozilla",
         "type": "github"
       }
     },
     "nixpkgs": {
       "locked": {
-        "lastModified": 1653920503,
+        "lastModified": 1731319897,
-        "narHash": "sha256-BBeCZwZImtjP3oYy4WogkQYy5OxNyfNciVSc1AfZgLQ=",
+        "narHash": "sha256-PbABj4tnbWFMfBp6OcUK5iGy1QY+/Z96ZcLpooIbuEI=",
         "owner": "NixOS",
         "repo": "nixpkgs",
-        "rev": "a634c8f6c1fbf9b9730e01764999666f3436f10a",
+        "rev": "dc460ec76cbff0e66e269457d7b728432263166c",
         "type": "github"
       },
       "original": {
         "owner": "NixOS",
-        "ref": "nixos-22.05",
+        "ref": "nixos-unstable",
         "repo": "nixpkgs",
         "type": "github"
       }
@@ -116,10 +87,53 @@
     "root": {
       "inputs": {
         "artiq": "artiq",
-        "mozilla-overlay": "mozilla-overlay_2",
         "zynq-rs": "zynq-rs"
       }
     },
+    "rust-overlay": {
+      "inputs": {
+        "nixpkgs": [
+          "artiq",
+          "nixpkgs"
+        ]
+      },
+      "locked": {
+        "lastModified": 1719454714,
+        "narHash": "sha256-MojqG0lyUINkEk0b3kM2drsU5vyaF8DFZe/FAlZVOGs=",
+        "owner": "oxalica",
+        "repo": "rust-overlay",
+        "rev": "d1c527659cf076ecc4b96a91c702d080b213801e",
+        "type": "github"
+      },
+      "original": {
+        "owner": "oxalica",
+        "ref": "snapshot/2024-08-01",
+        "repo": "rust-overlay",
+        "type": "github"
+      }
+    },
+    "rust-overlay_2": {
+      "inputs": {
+        "nixpkgs": [
+          "zynq-rs",
+          "nixpkgs"
+        ]
+      },
+      "locked": {
+        "lastModified": 1719454714,
+        "narHash": "sha256-MojqG0lyUINkEk0b3kM2drsU5vyaF8DFZe/FAlZVOGs=",
+        "owner": "oxalica",
+        "repo": "rust-overlay",
+        "rev": "d1c527659cf076ecc4b96a91c702d080b213801e",
+        "type": "github"
+      },
+      "original": {
+        "owner": "oxalica",
+        "ref": "snapshot/2024-08-01",
+        "repo": "rust-overlay",
+        "type": "github"
+      }
+    },
     "sipyco": {
       "inputs": {
         "nixpkgs": [
@@ -128,11 +142,11 @@
         ]
       },
       "locked": {
-        "lastModified": 1654006751,
+        "lastModified": 1728371104,
-        "narHash": "sha256-OWAnoTCutvTQcYdtdtLQuL6uRtG+7Jz7sbRhcScv8bo=",
+        "narHash": "sha256-PPnAyDedUQ7Og/Cby9x5OT9wMkNGTP8GS53V6N/dk4w=",
         "owner": "m-labs",
         "repo": "sipyco",
-        "rev": "b3d03a94c751a24769c54a61a0dbe9d6af52dade",
+        "rev": "094a6cd63ffa980ef63698920170e50dc9ba77fd",
         "type": "github"
       },
       "original": {
@@ -144,11 +158,11 @@
     "src-migen": {
       "flake": false,
       "locked": {
-        "lastModified": 1650337393,
+        "lastModified": 1727677091,
-        "narHash": "sha256-rm1SlFmF2ASz0vIy2nDEzGlyRw2oYNeJRr8Kh8Mg2Qc=",
+        "narHash": "sha256-Zg3SQnTwMM/VkOGKogbPyuCC2NhLy8HB2SPEUWWNgCU=",
         "owner": "m-labs",
         "repo": "migen",
-        "rev": "d4e3f34177c32f09904397179e6ed9c83175e528",
+        "rev": "c19ae9f8ae162ffe2d310a92bfce53ac2a821bc8",
         "type": "github"
       },
       "original": {
@@ -160,11 +174,11 @@
     "src-misoc": {
       "flake": false,
       "locked": {
-        "lastModified": 1649324486,
+        "lastModified": 1729234629,
-        "narHash": "sha256-Mw/fQS3lHFvCm7L1k63joRkz5uyijQfywcOq+X2+o2s=",
+        "narHash": "sha256-TLsTCXV5AC2xh+bS7EhBVBKqdqIU3eKrnlWcFF9LtAM=",
-        "ref": "master",
+        "ref": "refs/heads/master",
-        "rev": "f1dc58d2b8c222ba41c25cee4301626625f46e43",
+        "rev": "6085a312bca26adeca6584e37d08c8ba2e1d6e38",
-        "revCount": 2420,
+        "revCount": 2460,
         "submodules": true,
         "type": "git",
         "url": "https://github.com/m-labs/misoc.git"
@@ -191,20 +205,35 @@
         "type": "github"
       }
     },
+    "systems": {
+      "locked": {
+        "lastModified": 1681028828,
+        "narHash": "sha256-Vy1rq5AaRuLzOxct8nz4T6wlgyUR7zLU309k9mBC768=",
+        "owner": "nix-systems",
+        "repo": "default",
+        "rev": "da67096a3b9bf56a91d16901293e51ba5b49a27e",
+        "type": "github"
+      },
+      "original": {
+        "owner": "nix-systems",
+        "repo": "default",
+        "type": "github"
+      }
+    },
     "zynq-rs": {
       "inputs": {
-        "mozilla-overlay": "mozilla-overlay_3",
         "nixpkgs": [
           "artiq",
           "nixpkgs"
-        ]
+        ],
+        "rust-overlay": "rust-overlay_2"
       },
       "locked": {
-        "lastModified": 1654002148,
+        "lastModified": 1731749494,
-        "narHash": "sha256-Ztzx7ze8o0gdu+sDpc+PS2M88h/b22rwFq0b12wMqZQ=",
+        "narHash": "sha256-WGigAhvVCGN5YZ1dHPyvoqAh47W1Gtph036O1aKFlLE=",
-        "ref": "master",
+        "ref": "refs/heads/master",
-        "rev": "6cd32f6ee0e7bb7ce5a279f8be943903a393a476",
+        "rev": "12975de2e110d7948bf47b768559f727d0abc8fc",
-        "revCount": 617,
+        "revCount": 655,
         "type": "git",
         "url": "https://git.m-labs.hk/m-labs/zynq-rs"
       },

flake.nix

@@ -2,25 +2,26 @@
   description = "ARTIQ port to the Zynq-7000 platform";
 
   inputs.artiq.url = git+https://github.com/m-labs/artiq.git;
-  inputs.mozilla-overlay = { url = github:mozilla/nixpkgs-mozilla; flake = false; };
   inputs.zynq-rs.url = git+https://git.m-labs.hk/m-labs/zynq-rs;
   inputs.zynq-rs.inputs.nixpkgs.follows = "artiq/nixpkgs";
 
-  outputs = { self, mozilla-overlay, zynq-rs, artiq }:
+  outputs = { self, zynq-rs, artiq }:
   let
-    pkgs = import artiq.inputs.nixpkgs { system = "x86_64-linux"; overlays = [ (import mozilla-overlay) ]; };
+    pkgs = import artiq.inputs.nixpkgs { system = "x86_64-linux"; overlays = [ (import zynq-rs.inputs.rust-overlay) ]; };
     zynqpkgs = zynq-rs.packages.x86_64-linux;
     artiqpkgs = artiq.packages.x86_64-linux;
+    llvmPackages_11 = zynq-rs.llvmPackages_11;
 
+    rust = zynq-rs.rust;
     rustPlatform = zynq-rs.rustPlatform;
 
     fastnumbers = pkgs.python3Packages.buildPythonPackage rec {
       pname = "fastnumbers";
-      version = "2.2.1";
+      version = "5.1.0";
 
       src = pkgs.python3Packages.fetchPypi {
         inherit pname version;
-        sha256 = "0j15i54p7nri6hkzn1wal9pxri4pgql01wgjccig6ar0v5jjbvsy";
+        sha256 = "sha256-4JLTP4uVwxcaL7NOV57+DFSwKQ3X+W/6onYkN2AdkKc=";
       };
     };
 
@@ -37,63 +38,53 @@
 
     ramda = pkgs.python3Packages.buildPythonPackage {
       pname = "ramda";
-      version = "unstable-2019-02-01";
+      version = "unstable-2020-04-11";
 
       src = pkgs.fetchFromGitHub {
         owner = "peteut";
         repo = "ramda.py";
-        rev = "bd58f8e69d0e9a713d9c1f286a1ac5e5603956b1";
+        rev = "d315a9717ebd639366bf3fe26bad9e3d08ec3c49";
-        sha256 = "0qzd5yp9lbaham8p1wiymdjapzbqsli7lvngv24c3z4ybd9jlq9g";
+        sha256 = "sha256-bmSt/IHDnULsZjsC6edELnNH7LoJSVF4L4XhwBAXRkY=";
       };
 
       nativeBuildInputs = with pkgs.python3Packages; [ pbr ];
       propagatedBuildInputs = with pkgs.python3Packages; [ future fastnumbers ];
 
-      checkInputs = with pkgs.python3Packages; [ pytest pytest-flake8 ];
+      checkInputs = with pkgs.python3Packages; [ pytest ];
       checkPhase = "pytest";
       doCheck = false;
 
       preBuild = ''
-        export PBR_VERSION=0.0.1
+        export PBR_VERSION=0.5.5
       '';
     };
 
     migen-axi = pkgs.python3Packages.buildPythonPackage {
       pname = "migen-axi";
-      version = "unstable-2021-09-15";
+      version = "unstable-2023-01-06";
 
       src = pkgs.fetchFromGitHub {
         owner = "peteut";
         repo = "migen-axi";
-        rev = "9763505ee96acd7572280a2d1233721342dc7c3f";
+        rev = "27eaa84a70a3abfe1930c86c36c4de2cd652da35";
-        sha256 = "15c7g05n183rka66fl1glzp6h7xjlpy1p6k8biry24dangsmxmvg";
+        sha256 = "sha256-3Y9W5ns+1wbVd14iePzgSBzE+LxnGMUDtUw3BccFt80=";
       };
 
-      nativeBuildInputs = with pkgs.python3Packages; [ pbr ];
+      format = "pyproject";
+
       propagatedBuildInputs = with pkgs.python3Packages; [ setuptools click numpy toolz jinja2 ramda artiqpkgs.migen artiqpkgs.misoc ];
 
+      checkInputs = with pkgs.python3Packages; [ pytestCheckHook pytest-timeout ];
+
+      # migen/misoc version checks are broken with pyproject for some reason
       postPatch = ''
-        substituteInPlace requirements.txt \
+        sed -i "1,4d" pyproject.toml
-          --replace "jinja2==2.11.3" "jinja2"
+        substituteInPlace pyproject.toml \
-        substituteInPlace requirements.txt \
+          --replace '"migen@git+https://github.com/m-labs/migen",' ""
-          --replace "future==0.18.2" "future"
+        substituteInPlace pyproject.toml \
-        substituteInPlace requirements.txt \
+          --replace '"misoc@git+https://github.com/m-labs/misoc.git",' ""
-          --replace "ramda==0.5.5" "ramda"
+        # pytest-flake8 is broken with recent flake8. Re-enable after fix.
-        substituteInPlace requirements.txt \
+        substituteInPlace setup.cfg --replace '--flake8' ""
-          --replace "colorama==0.4.3" "colorama"
-        substituteInPlace requirements.txt \
-          --replace "toolz==0.10.0" "toolz"
-        substituteInPlace requirements.txt \
-          --replace "pyserial==3.4" "pyserial"
-        substituteInPlace requirements.txt \
-          --replace "markupsafe==1.1.1" "markupsafe"
-      '';
-
-      checkInputs = with pkgs.python3Packages; [ pytest pytest-timeout pytest-flake8 ];
-      checkPhase = "pytest";
-
-      preBuild = ''
-        export PBR_VERSION=0.0.1
       '';
     };
     binutils = { platform, target, zlib }: pkgs.stdenv.mkDerivation rec {
@@ -122,34 +113,34 @@
       "nist_clock_satellite" "nist_qc2_satellite" "acpki_nist_clock_satellite" "acpki_nist_qc2_satellite" 
       "nist_clock_satellite_100mhz" "nist_qc2_satellite_100mhz" "acpki_nist_clock_satellite_100mhz" "acpki_nist_qc2_satellite_100mhz"
     ];
-    build = { target, variant, json ? null }: let
+    board-package-set = { target, variant, json ? null }: let
       szl = zynqpkgs."${target}-szl";
       fsbl = zynqpkgs."${target}-fsbl";
       fwtype = if builtins.elem variant sat_variants then "satman" else "runtime";
 
       firmware = rustPlatform.buildRustPackage rec {
-
         name = "firmware";
         src = ./src;
         cargoLock = { 
           lockFile = src/Cargo.lock;
           outputHashes = {
-            "libasync-0.0.0" = "sha256-xuwesRrQiccopPTCkwGqQxld74X74q7EVsKIrE0zirc=";
+              "tar-no-std-0.1.8" = "sha256-xm17108v4smXOqxdLvHl9CxTCJslmeogjm4Y87IXFuM=";
-          };
+              "nalgebra-0.32.6" = "sha256-L/YudkVOtfGYoNQKBD7LMk/sMYgRDzPDdpGL5rO7G2I=";
+            };
         };
 
         nativeBuildInputs = [
           pkgs.gnumake
-          (pkgs.python3.withPackages(ps: (with artiqpkgs; [ ps.jsonschema migen migen-axi misoc artiq ])))
+          (pkgs.python3.withPackages(ps: [ ps.jsonschema artiqpkgs.migen migen-axi artiqpkgs.misoc artiqpkgs.artiq ]))
-          artiqpkgs.artiq
           zynqpkgs.cargo-xbuild
-          pkgs.llvmPackages_9.llvm
+          llvmPackages_11.llvm
-          pkgs.llvmPackages_9.clang-unwrapped
+          llvmPackages_11.clang-unwrapped
         ];
         buildPhase = ''
-          export XARGO_RUST_SRC="${rustPlatform.rust.rustc}/lib/rustlib/src/rust/library"
+          export XARGO_RUST_SRC="${rust}/lib/rustlib/src/rust/library"
-          export CLANG_EXTRA_INCLUDE_DIR="${pkgs.llvmPackages_9.clang-unwrapped.lib}/lib/clang/9.0.1/include"
+          export CLANG_EXTRA_INCLUDE_DIR="${llvmPackages_11.clang-unwrapped.lib}/lib/clang/11.1.0/include"
           export CARGO_HOME=$(mktemp -d cargo-home.XXX)
+          export ZYNQ_RS=${zynq-rs}
           make TARGET=${target} GWARGS="${if json == null then "-V ${variant}" else json}" ${fwtype}
         '';
 
@@ -163,12 +154,12 @@
 
         doCheck = false;
         dontFixup = true;
+        auditable = false;
       };
       gateware = pkgs.runCommand "${target}-${variant}-gateware"
         {
           nativeBuildInputs = [ 
-            (pkgs.python3.withPackages(ps: (with artiqpkgs; [ ps.jsonschema migen migen-axi misoc artiq ])))
+            (pkgs.python3.withPackages(ps: [ ps.jsonschema artiqpkgs.migen migen-axi artiqpkgs.misoc artiqpkgs.artiq ]))
-            artiqpkgs.artiq
             artiqpkgs.vivado
           ];
         }
@@ -252,8 +243,7 @@
       name = "gateware-sim";
       
       nativeBuildInputs = [ 
-        (pkgs.python3.withPackages(ps: (with artiqpkgs; [ migen migen-axi artiq ]))) 
+        (pkgs.python3.withPackages(ps: [ artiqpkgs.migen migen-axi artiqpkgs.artiq ]))
-        artiqpkgs.artiq
       ];
 
       phases = [ "buildPhase" ];
@@ -265,8 +255,26 @@
         '';
     };
 
+    fmt-check = pkgs.stdenvNoCC.mkDerivation {
+      name = "fmt-check";
+
+      src = ./src;
+
+      nativeBuildInputs = [ rust pkgs.gnumake ];
+
+      phases = [ "unpackPhase" "buildPhase" ];
+
+      buildPhase =
+        ''
+        export ZYNQ_RS=${zynq-rs}
+        make manifests
+        cargo fmt -- --check
+        touch $out
+        '';
+    };
+
     # for hitl-tests
-    zc706-nist_qc2 = (build { target = "zc706"; variant = "nist_qc2"; });
+    zc706-nist_qc2 = (board-package-set { target = "zc706"; variant = "nist_qc2"; });
     zc706-hitl-tests = pkgs.stdenv.mkDerivation {
       name = "zc706-hitl-tests";
 
@@ -329,35 +337,43 @@
         '';
     };
   in rec {
-    packages.x86_64-linux = (build { target = "zc706"; variant = "nist_clock"; }) //
+    packages.x86_64-linux =
-      (build { target = "zc706"; variant = "nist_clock_master"; }) //
+      {
-      (build { target = "zc706"; variant = "nist_clock_satellite"; }) //
+        inherit fastnumbers artiq-netboot ramda migen-axi binutils-arm;
-      (build { target = "zc706"; variant = "nist_clock_satellite_100mhz"; }) //
+      } //
-      (build { target = "zc706"; variant = "nist_qc2"; }) //
+      (board-package-set { target = "zc706"; variant = "nist_clock"; }) //
-      (build { target = "zc706"; variant = "nist_qc2_master"; }) //
+      (board-package-set { target = "zc706"; variant = "nist_clock_master"; }) //
-      (build { target = "zc706"; variant = "nist_qc2_satellite"; }) //
+      (board-package-set { target = "zc706"; variant = "nist_clock_master_100mhz"; }) //
-      (build { target = "zc706"; variant = "nist_qc2_satellite_100mhz"; }) //
+      (board-package-set { target = "zc706"; variant = "nist_clock_satellite"; }) //
-      (build { target = "zc706"; variant = "acpki_nist_clock"; }) //
+      (board-package-set { target = "zc706"; variant = "nist_clock_satellite_100mhz"; }) //
-      (build { target = "zc706"; variant = "acpki_nist_clock_master"; }) //
+      (board-package-set { target = "zc706"; variant = "nist_qc2"; }) //
-      (build { target = "zc706"; variant = "acpki_nist_clock_satellite"; }) //
+      (board-package-set { target = "zc706"; variant = "nist_qc2_master"; }) //
-      (build { target = "zc706"; variant = "acpki_nist_clock_satellite_100mhz"; }) //
+      (board-package-set { target = "zc706"; variant = "nist_qc2_master_100mhz"; }) //
-      (build { target = "zc706"; variant = "acpki_nist_qc2"; }) //
+      (board-package-set { target = "zc706"; variant = "nist_qc2_satellite"; }) //
-      (build { target = "zc706"; variant = "acpki_nist_qc2_master"; }) //
+      (board-package-set { target = "zc706"; variant = "nist_qc2_satellite_100mhz"; }) //
-      (build { target = "zc706"; variant = "acpki_nist_qc2_satellite"; }) //
+      (board-package-set { target = "zc706"; variant = "acpki_nist_clock"; }) //
-      (build { target = "zc706"; variant = "acpki_nist_qc2_satellite_100mhz"; }) //
+      (board-package-set { target = "zc706"; variant = "acpki_nist_clock_master"; }) //
-      (build { target = "kasli_soc"; variant = "demo"; json = ./demo.json; }) //
+      (board-package-set { target = "zc706"; variant = "acpki_nist_clock_master_100mhz"; }) //
-      (build { target = "kasli_soc"; variant = "master"; json = ./kasli-soc-master.json; }) //
+      (board-package-set { target = "zc706"; variant = "acpki_nist_clock_satellite"; }) //
-      (build { target = "kasli_soc"; variant = "satellite"; json = ./kasli-soc-satellite.json; });
+      (board-package-set { target = "zc706"; variant = "acpki_nist_clock_satellite_100mhz"; }) //
+      (board-package-set { target = "zc706"; variant = "acpki_nist_qc2"; }) //
+      (board-package-set { target = "zc706"; variant = "acpki_nist_qc2_master"; }) //
+      (board-package-set { target = "zc706"; variant = "acpki_nist_qc2_master_100mhz"; }) //
+      (board-package-set { target = "zc706"; variant = "acpki_nist_qc2_satellite"; }) //
+      (board-package-set { target = "zc706"; variant = "acpki_nist_qc2_satellite_100mhz"; }) //
+      (board-package-set { target = "kasli_soc"; variant = "demo"; json = ./demo.json; }) //
+      (board-package-set { target = "kasli_soc"; variant = "master"; json = ./kasli-soc-master.json; }) //
+      (board-package-set { target = "kasli_soc"; variant = "satellite"; json = ./kasli-soc-satellite.json; }) //
+      (board-package-set { target = "ebaz4205"; variant = "base"; });
 
-    hydraJobs = packages.x86_64-linux // { inherit zc706-hitl-tests; inherit gateware-sim; };
+    hydraJobs = packages.x86_64-linux // { inherit zc706-hitl-tests; inherit gateware-sim; inherit fmt-check; };
 
     devShell.x86_64-linux = pkgs.mkShell {
       name = "artiq-zynq-dev-shell";
       buildInputs = with pkgs; [
-        rustPlatform.rust.rustc
+        rust
-        rustPlatform.rust.cargo
+        llvmPackages_11.llvm
-        llvmPackages_9.llvm
+        llvmPackages_11.clang-unwrapped
-        llvmPackages_9.clang-unwrapped
         gnumake
         cacert
         zynqpkgs.cargo-xbuild
@@ -368,14 +384,16 @@
         artiqpkgs.artiq
         artiqpkgs.vivado
         binutils-arm
+        pre-commit
       ];
-      XARGO_RUST_SRC = "${rustPlatform.rust.rustc}/lib/rustlib/src/rust/library";
+      XARGO_RUST_SRC = "${rust}/lib/rustlib/src/rust/library";
-      CLANG_EXTRA_INCLUDE_DIR = "${pkgs.llvmPackages_9.clang-unwrapped.lib}/lib/clang/9.0.1/include";
+      CLANG_EXTRA_INCLUDE_DIR = "${llvmPackages_11.clang-unwrapped.lib}/lib/clang/11.1.0/include";
+      ZYNQ_RS = "${zynq-rs}";
       OPENOCD_ZYNQ = "${zynq-rs}/openocd";
       SZL = "${zynqpkgs.szl}";
     };
 
-    makeArtiqZynqPackage = build;
+    makeArtiqZynqPackage = board-package-set;
 
   };
-}
+}

src/.clang-format

@@ -0,0 +1,32 @@
+BasedOnStyle: LLVM
+
+Language: Cpp
+Standard: Cpp11
+
+AccessModifierOffset: -1
+AlignEscapedNewlines: Left
+AlwaysBreakAfterReturnType: None
+AlwaysBreakTemplateDeclarations: Yes
+AllowAllParametersOfDeclarationOnNextLine: false
+AllowShortFunctionsOnASingleLine: Inline
+BinPackParameters: false
+BreakBeforeBinaryOperators: NonAssignment
+BreakBeforeTernaryOperators: true
+BreakConstructorInitializers: AfterColon
+BreakInheritanceList: AfterColon
+ColumnLimit: 120
+ConstructorInitializerAllOnOneLineOrOnePerLine: true
+ContinuationIndentWidth: 4
+DerivePointerAlignment: false
+IndentCaseLabels: true
+IndentPPDirectives: None
+IndentWidth: 4
+MaxEmptyLinesToKeep: 1
+PointerAlignment: Left
+ReflowComments: true
+SortIncludes: false
+SortUsingDeclarations: true
+SpaceAfterTemplateKeyword: false
+SpacesBeforeTrailingComments: 2
+TabWidth: 4
+UseTab: Never

src/.clippy.toml

@@ -0,0 +1 @@
+doc-valid-idents = ["CPython", "NumPy", ".."]

src/.pre-commit-config.yaml

@@ -0,0 +1,32 @@
+# See https://pre-commit.com for more information
+# See https://pre-commit.com/hooks.html for more hooks
+
+default_stages: [commit]
+
+repos:
+  - repo: local
+    hooks:
+      - id: cargo-fmt
+        name: artiq-zynq cargo format
+        entry: nix
+        language: system
+        types: [file, rust]
+        pass_filenames: false
+        description: Runs cargo fmt on the codebase.
+        args: [develop, -c, cargo, fmt, --manifest-path, src/Cargo.toml, --all]
+      - id: cargo-clippy
+        name: artiq-zynq cargo clippy
+        entry: nix
+        language: system
+        types: [file, rust]
+        pass_filenames: false
+        description: Runs cargo clippy on the codebase.
+        args: [develop, -c, cargo, clippy, --manifest-path, src/Cargo.toml, --tests]
+  - repo: https://github.com/pre-commit/mirrors-clang-format
+    rev: v19.1.0
+    hooks:
+      - id: clang-format
+        name: artiq-zynq clang-format
+        description: Runs clang-format on the codebase.
+        files: \.(cpp|h|hpp|c)$
+        args: [-style=file, -fallback-style=none, -assume-filename=src/.clang-format]

src/Cargo.lock

@@ -1,5 +1,22 @@
 # This file is automatically @generated by Cargo.
 # It is not intended for manual editing.
+version = 3
+
+[[package]]
+name = "approx"
+version = "0.5.1"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "cab112f0a86d568ea0e627cc1d6be74a1e9cd55214684db5561995f6dad897c6"
+dependencies = [
+ "num-traits",
+]
+
+[[package]]
+name = "arrayvec"
+version = "0.7.4"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "96d30a06541fbafbc7f82ed10c06164cfbd2c401138f6addd8404629c4b16711"
+
 [[package]]
 name = "async-recursion"
 version = "0.3.2"
@@ -47,9 +64,9 @@ checksum = "14c189c53d098945499cdfa7ecc63567cf3886b3332b312a5b4585d8d3a6a610"
 
 [[package]]
 name = "cc"
-version = "1.0.73"
+version = "1.0.77"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "2fff2a6927b3bb87f9595d67196a70493f627687a71d87a0d692242c33f58c11"
+checksum = "e9f73505338f7d905b19d18738976aae232eb46b8efc15554ffc56deb5d9ebe4"
 
 [[package]]
 name = "cfg-if"
@@ -136,9 +153,9 @@ dependencies = [
 
 [[package]]
 name = "futures"
-version = "0.3.21"
+version = "0.3.25"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "f73fe65f54d1e12b726f517d3e2135ca3125a437b6d998caf1962961f7172d9e"
+checksum = "38390104763dc37a5145a53c29c63c1290b5d316d6086ec32c293f6736051bb0"
 dependencies = [
  "futures-channel",
  "futures-core",
@@ -150,9 +167,9 @@ dependencies = [
 
 [[package]]
 name = "futures-channel"
-version = "0.3.21"
+version = "0.3.25"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "c3083ce4b914124575708913bca19bfe887522d6e2e6d0952943f5eac4a74010"
+checksum = "52ba265a92256105f45b719605a571ffe2d1f0fea3807304b522c1d778f79eed"
 dependencies = [
  "futures-core",
  "futures-sink",
@@ -160,21 +177,21 @@ dependencies = [
 
 [[package]]
 name = "futures-core"
-version = "0.3.21"
+version = "0.3.25"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "0c09fd04b7e4073ac7156a9539b57a484a8ea920f79c7c675d05d289ab6110d3"
+checksum = "04909a7a7e4633ae6c4a9ab280aeb86da1236243a77b694a49eacd659a4bd3ac"
 
 [[package]]
 name = "futures-io"
-version = "0.3.21"
+version = "0.3.25"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "fc4045962a5a5e935ee2fdedaa4e08284547402885ab326734432bed5d12966b"
+checksum = "00f5fb52a06bdcadeb54e8d3671f8888a39697dcb0b81b23b55174030427f4eb"
 
 [[package]]
 name = "futures-macro"
-version = "0.3.21"
+version = "0.3.25"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "33c1e13800337f4d4d7a316bf45a567dbcb6ffe087f16424852d97e97a91f512"
+checksum = "bdfb8ce053d86b91919aad980c220b1fb8401a9394410e1c289ed7e66b61835d"
 dependencies = [
  "proc-macro2",
  "quote",
@@ -183,21 +200,21 @@ dependencies = [
 
 [[package]]
 name = "futures-sink"
-version = "0.3.21"
+version = "0.3.25"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "21163e139fa306126e6eedaf49ecdb4588f939600f0b1e770f4205ee4b7fa868"
+checksum = "39c15cf1a4aa79df40f1bb462fb39676d0ad9e366c2a33b590d7c66f4f81fcf9"
 
 [[package]]
 name = "futures-task"
-version = "0.3.21"
+version = "0.3.25"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "57c66a976bf5909d801bbef33416c41372779507e7a6b3a5e25e4749c58f776a"
+checksum = "2ffb393ac5d9a6eaa9d3fdf37ae2776656b706e200c8e16b1bdb227f5198e6ea"
 
 [[package]]
 name = "futures-util"
-version = "0.3.21"
+version = "0.3.25"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "d8b7abd5d659d9b90c8cba917f6ec750a74e2dc23902ef9cd4cc8c8b22e6036a"
+checksum = "197676987abd2f9cadff84926f410af1c183608d36641465df73ae8211dc65d6"
 dependencies = [
  "futures-core",
  "futures-macro",
@@ -216,10 +233,38 @@ dependencies = [
  "libsupport_zynq",
 ]
 
+[[package]]
+name = "ksupport"
+version = "0.1.0"
+dependencies = [
+ "build_zynq",
+ "byteorder",
+ "core_io",
+ "cslice",
+ "dwarf",
+ "dyld",
+ "io",
+ "libasync",
+ "libboard_artiq",
+ "libboard_zynq",
+ "libc",
+ "libconfig",
+ "libcortex_a9",
+ "libm",
+ "libregister",
+ "libsupport_zynq",
+ "log",
+ "log_buffer",
+ "nalgebra",
+ "nb 0.1.3",
+ "unwind",
+ "vcell",
+ "void",
+]
+
 [[package]]
 name = "libasync"
 version = "0.0.0"
-source = "git+https://git.m-labs.hk/M-Labs/zynq-rs.git#605c8f73a60cf41a6e2d535c5850933d3154e935"
 dependencies = [
  "embedded-hal",
  "libcortex_a9",
@@ -242,6 +287,7 @@ dependencies = [
  "libconfig",
  "libcortex_a9",
  "libregister",
+ "libsupport_zynq",
  "log",
  "log_buffer",
  "nb 1.0.0",
@@ -251,7 +297,6 @@ dependencies = [
 [[package]]
 name = "libboard_zynq"
 version = "0.0.0"
-source = "git+https://git.m-labs.hk/M-Labs/zynq-rs.git#605c8f73a60cf41a6e2d535c5850933d3154e935"
 dependencies = [
  "bit_field",
  "embedded-hal",
@@ -276,7 +321,6 @@ dependencies = [
 [[package]]
 name = "libconfig"
 version = "0.1.0"
-source = "git+https://git.m-labs.hk/M-Labs/zynq-rs.git#605c8f73a60cf41a6e2d535c5850933d3154e935"
 dependencies = [
  "core_io",
  "fatfs",
@@ -287,7 +331,6 @@ dependencies = [
 [[package]]
 name = "libcortex_a9"
 version = "0.0.0"
-source = "git+https://git.m-labs.hk/M-Labs/zynq-rs.git#605c8f73a60cf41a6e2d535c5850933d3154e935"
 dependencies = [
  "bit_field",
  "libregister",
@@ -296,14 +339,13 @@ dependencies = [
 
 [[package]]
 name = "libm"
-version = "0.2.2"
+version = "0.2.6"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "33a33a362ce288760ec6a508b94caaec573ae7d3bbbd91b87aa0bad4456839db"
+checksum = "348108ab3fba42ec82ff6e9564fc4ca0247bdccdc68dd8af9764bbc79c3c8ffb"
 
 [[package]]
 name = "libregister"
 version = "0.0.0"
-source = "git+https://git.m-labs.hk/M-Labs/zynq-rs.git#605c8f73a60cf41a6e2d535c5850933d3154e935"
 dependencies = [
  "bit_field",
  "vcell",
@@ -313,7 +355,6 @@ dependencies = [
 [[package]]
 name = "libsupport_zynq"
 version = "0.0.0"
-source = "git+https://git.m-labs.hk/M-Labs/zynq-rs.git#605c8f73a60cf41a6e2d535c5850933d3154e935"
 dependencies = [
  "cc",
  "compiler_builtins",
@@ -332,9 +373,9 @@ checksum = "822add9edb1860698b79522510da17bef885171f75aa395cff099d770c609c24"
 
 [[package]]
 name = "log"
-version = "0.4.14"
+version = "0.4.17"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "51b9bbe6c47d51fc3e1a9b945965946b4c44142ab8792c50835a980d362c2710"
+checksum = "abb12e687cfb44aa40f41fc3978ef76448f9b6038cad6aef4259d3c095a2382e"
 dependencies = [
  "cfg-if 1.0.0",
 ]
@@ -351,6 +392,19 @@ version = "0.7.2"
 source = "registry+https://github.com/rust-lang/crates.io-index"
 checksum = "c75de51135344a4f8ed3cfe2720dc27736f7711989703a0b43aadf3753c55577"
 
+[[package]]
+name = "nalgebra"
+version = "0.32.6"
+source = "git+https://git.m-labs.hk/M-Labs/nalgebra.git?rev=dd00f9b#dd00f9b46046e0b931d1b470166db02fd29591be"
+dependencies = [
+ "approx",
+ "num-complex",
+ "num-rational",
+ "num-traits",
+ "simba",
+ "typenum",
+]
+
 [[package]]
 name = "nb"
 version = "0.1.3"
@@ -366,6 +420,15 @@ version = "1.0.0"
 source = "registry+https://github.com/rust-lang/crates.io-index"
 checksum = "546c37ac5d9e56f55e73b677106873d9d9f5190605e41a856503623648488cae"
 
+[[package]]
+name = "num-complex"
+version = "0.4.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "26873667bbbb7c5182d4a37c1add32cdf09f841af72da53318fdb81543c15085"
+dependencies = [
+ "num-traits",
+]
+
 [[package]]
 name = "num-derive"
 version = "0.3.3"
@@ -378,19 +441,46 @@ dependencies = [
 ]
 
 [[package]]
-name = "num-traits"
+name = "num-integer"
-version = "0.2.14"
+version = "0.1.46"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "9a64b1ec5cda2586e284722486d802acf1f7dbdc623e2bfc57e65ca1cd099290"
+checksum = "7969661fd2958a5cb096e56c8e1ad0444ac2bbcd0061bd28660485a44879858f"
 dependencies = [
- "autocfg",
+ "num-traits",
 ]
 
 [[package]]
-name = "pin-project-lite"
+name = "num-rational"
-version = "0.2.8"
+version = "0.4.0"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "e280fbe77cc62c91527259e9442153f4688736748d24660126286329742b4c6c"
+checksum = "d41702bd167c2df5520b384281bc111a4b5efcf7fbc4c9c222c815b07e0a6a6a"
+dependencies = [
+ "autocfg",
+ "num-integer",
+ "num-traits",
+]
+
+[[package]]
+name = "num-traits"
+version = "0.2.15"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "578ede34cf02f8924ab9447f50c28075b4d3e5b269972345e7e0372b38c6cdcd"
+dependencies = [
+ "autocfg",
+ "libm",
+]
+
+[[package]]
+name = "paste"
+version = "1.0.15"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "57c0d7b74b563b49d38dae00a0c37d4d6de9b432382b2892f0574ddcae73fd0a"
+
+[[package]]
+name = "pin-project-lite"
+version = "0.2.9"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "e0a7ae3ac2f1173085d398531c705756c94a4c56843785df85a60c1a0afac116"
 
 [[package]]
 name = "pin-utils"
@@ -400,18 +490,18 @@ checksum = "8b870d8c151b6f2fb93e84a13146138f05d02ed11c7e7c54f8826aaaf7c9f184"
 
 [[package]]
 name = "proc-macro2"
-version = "1.0.36"
+version = "1.0.43"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "c7342d5883fbccae1cc37a2353b09c87c9b0f3afd73f5fb9bba687a1f733b029"
+checksum = "0a2ca2c61bc9f3d74d2886294ab7b9853abd9c1ad903a3ac7815c58989bb7bab"
 dependencies = [
- "unicode-xid",
+ "unicode-ident",
 ]
 
 [[package]]
 name = "quote"
-version = "1.0.15"
+version = "1.0.21"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "864d3e96a899863136fc6e99f3d7cae289dafe43bf2c5ac19b70df7210c0a145"
+checksum = "bbe448f377a7d6961e30f5955f9b8d106c3f5e449d493ee1b125c1d43c2b5179"
 dependencies = [
  "proc-macro2",
 ]
@@ -436,20 +526,20 @@ dependencies = [
  "embedded-hal",
  "futures",
  "io",
+ "ksupport",
  "libasync",
  "libboard_artiq",
  "libboard_zynq",
  "libc",
  "libconfig",
  "libcortex_a9",
- "libm",
  "libregister",
  "libsupport_zynq",
  "log",
  "log_buffer",
- "nb 0.1.3",
  "num-derive",
  "num-traits",
+ "tar-no-std",
  "unwind",
  "vcell",
  "void",
@@ -469,7 +559,13 @@ name = "satman"
 version = "0.0.0"
 dependencies = [
  "build_zynq",
+ "byteorder",
+ "core_io",
+ "crc",
+ "cslice",
  "embedded-hal",
+ "io",
+ "ksupport",
  "libasync",
  "libboard_artiq",
  "libboard_zynq",
@@ -488,6 +584,18 @@ version = "0.1.20"
 source = "registry+https://github.com/rust-lang/crates.io-index"
 checksum = "d4f410fedcf71af0345d7607d246e7ad15faaadd49d240ee3b24e5dc21a820ac"
 
+[[package]]
+name = "simba"
+version = "0.8.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "50582927ed6f77e4ac020c057f37a268fc6aebc29225050365aacbb9deeeddc4"
+dependencies = [
+ "approx",
+ "num-complex",
+ "num-traits",
+ "paste",
+]
+
 [[package]]
 name = "smoltcp"
 version = "0.7.5"
@@ -501,20 +609,36 @@ dependencies = [
 
 [[package]]
 name = "syn"
-version = "1.0.86"
+version = "1.0.101"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "8a65b3f4ffa0092e9887669db0eae07941f023991ab58ea44da8fe8e2d511c6b"
+checksum = "e90cde112c4b9690b8cbe810cba9ddd8bc1d7472e2cae317b69e9438c1cba7d2"
 dependencies = [
  "proc-macro2",
  "quote",
- "unicode-xid",
+ "unicode-ident",
 ]
 
 [[package]]
-name = "unicode-xid"
+name = "tar-no-std"
-version = "0.2.2"
+version = "0.1.8"
+source = "git+https://git.m-labs.hk/M-Labs/tar-no-std?rev=2ab6dc5#2ab6dc58e5249c59c4eb03eaf3a119bcdd678d32"
+dependencies = [
+ "arrayvec",
+ "bitflags",
+ "log",
+]
+
+[[package]]
+name = "typenum"
+version = "1.17.0"
 source = "registry+https://github.com/rust-lang/crates.io-index"
-checksum = "8ccb82d61f80a663efe1f787a51b16b5a51e3314d6ac365b08639f52387b33f3"
+checksum = "42ff0bf0c66b8238c6f3b578df37d0b7848e55df8577b3f74f92a69acceeb825"
+
+[[package]]
+name = "unicode-ident"
+version = "1.0.5"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "6ceab39d59e4c9499d4e5a8ee0e2735b891bb7308ac83dfb4e80cad195c9f6f3"
 
 [[package]]
 name = "unwind"

src/Cargo.toml

@@ -5,6 +5,7 @@ members = [
   "libdwarf",
   "libio",
   "libunwind",
+  "libksupport",
   "runtime",
   "satman"
 ]

src/Makefile

@@ -7,13 +7,20 @@ runtime: ../build/runtime.bin
 
 satman: ../build/satman.bin
 
-.PHONY: all runtime_target satman_target
+.PHONY: all manifests
+
+manifests = libboard_artiq/Cargo.toml libc/Cargo.toml libdyld/Cargo.toml libio/Cargo.toml libksupport/Cargo.toml runtime/Cargo.toml satman/Cargo.toml
+
+$(manifests): %.toml: %.toml.tpl
+	sed s+@@ZYNQ_RS@@+$(ZYNQ_RS)+g $< > $@
+
+manifests: $(manifests)
 
 ../build/pl.rs ../build/rustc-cfg ../build/mem.rs: gateware/* 
 	mkdir -p ../build
 	python gateware/$(TARGET).py -r ../build/pl.rs -c ../build/rustc-cfg -m ../build/mem.rs $(GWARGS)
 
-../build/firmware/armv7-none-eabihf/release/runtime: ../build/pl.rs ../build/rustc-cfg ../build/mem.rs $(shell find . -type f -print)
+../build/firmware/armv7-none-eabihf/release/runtime: ../build/pl.rs ../build/rustc-cfg ../build/mem.rs $(manifests) $(shell find . -type f -not -name Cargo.toml -print)
 	cd runtime && \
 	XBUILD_SYSROOT_PATH=`pwd`/../../build/sysroot \
 	cargo xbuild --release \
@@ -23,7 +30,7 @@ satman: ../build/satman.bin
 ../build/runtime.bin: ../build/firmware/armv7-none-eabihf/release/runtime
 	llvm-objcopy -O binary ../build/firmware/armv7-none-eabihf/release/runtime ../build/runtime.bin
 
-../build/firmware/armv7-none-eabihf/release/satman: ../build/pl.rs ../build/rustc-cfg ../build/mem.rs $(shell find . -type f -print)
+../build/firmware/armv7-none-eabihf/release/satman: ../build/pl.rs ../build/rustc-cfg ../build/mem.rs $(manifests) $(shell find . -type f -not -name Cargo.toml -print)
 	cd satman && \
 	XBUILD_SYSROOT_PATH=`pwd`/../../build/sysroot \
 	cargo xbuild --release \
@@ -31,4 +38,4 @@ satman: ../build/satman.bin
 		--no-default-features --features=target_$(TARGET)
 
 ../build/satman.bin: ../build/firmware/armv7-none-eabihf/release/satman
-	llvm-objcopy -O binary ../build/firmware/armv7-none-eabihf/release/satman ../build/satman.bin
+	llvm-objcopy -O binary ../build/firmware/armv7-none-eabihf/release/satman ../build/satman.bin

src/gateware/config.py

@@ -0,0 +1,16 @@
+from misoc.integration import cpu_interface
+
+def write_csr_file(soc, filename):
+    with open(filename, "w") as f:
+        f.write(cpu_interface.get_csr_rust(
+            soc.get_csr_regions(), soc.get_csr_groups(), soc.get_constants()))
+
+def write_mem_file(soc, filename):
+    with open(filename, "w") as f:
+        f.write(cpu_interface.get_mem_rust(
+            soc.get_memory_regions(), soc.get_memory_groups(), None))
+
+def write_rustc_cfg_file(soc, filename):
+    with open(filename, "w") as f:
+        f.write(cpu_interface.get_rust_cfg(
+            soc.get_csr_regions(), soc.get_constants()))

src/gateware/ddmtd.py

@@ -0,0 +1,119 @@
+from migen import *
+from migen.genlib.cdc import PulseSynchronizer, MultiReg
+from misoc.interconnect.csr import *
+
+
+class DDMTDSampler(Module):
+    def __init__(self, cd_ref, main_clk_se):
+        self.ref_beating = Signal()
+        self.main_beating = Signal()
+
+        # # #
+
+        ref_clk = Signal()
+        self.specials +=[
+            # ISERDESE2 can only be driven from fabric via IDELAYE2 (see UG471)
+            Instance("IDELAYE2",
+                    p_DELAY_SRC="DATAIN",
+                    p_HIGH_PERFORMANCE_MODE="TRUE",
+                    p_REFCLK_FREQUENCY=208.3,   # REFCLK frequency from IDELAYCTRL
+                    p_IDELAY_VALUE=0,
+
+                    i_DATAIN=cd_ref.clk,
+
+                    o_DATAOUT=ref_clk
+            ),
+            Instance("ISERDESE2",
+                    p_IOBDELAY="IFD",   # use DDLY as input
+                    p_DATA_RATE="SDR",
+                    p_DATA_WIDTH=2,     # min is 2
+                    p_NUM_CE=1,
+
+                    i_DDLY=ref_clk,
+                    i_CE1=1,
+                    i_CLK=ClockSignal("helper"),
+                    i_CLKDIV=ClockSignal("helper"),
+
+                    o_Q1=self.ref_beating
+            ),
+            Instance("ISERDESE2",
+                    p_DATA_RATE="SDR",
+                    p_DATA_WIDTH=2,     # min is 2
+                    p_NUM_CE=1,
+
+                    i_D=main_clk_se,
+                    i_CE1=1,
+                    i_CLK=ClockSignal("helper"),
+                    i_CLKDIV=ClockSignal("helper"),
+
+                    o_Q1=self.main_beating,
+            ),
+        ]
+
+
+class DDMTDDeglitcherMedianEdge(Module):
+    def __init__(self, counter, input_signal, stable_0_period=100, stable_1_period=100):
+        self.tag = Signal(len(counter))
+        self.detect = Signal()
+
+        stable_0_counter = Signal(reset=stable_0_period - 1, max=stable_0_period)
+        stable_1_counter = Signal(reset=stable_1_period - 1, max=stable_1_period)
+
+        # # #
+
+        # Based on CERN's median edge deglitcher FSM
+        # https://white-rabbit.web.cern.ch/documents/Precise_time_and_frequency_transfer_in_a_White_Rabbit_network.pdf (p.72)
+        fsm = ClockDomainsRenamer("helper")(FSM(reset_state="WAIT_STABLE_0"))
+        self.submodules += fsm
+
+        fsm.act("WAIT_STABLE_0",
+            If(stable_0_counter != 0,
+                NextValue(stable_0_counter, stable_0_counter - 1)
+            ).Else(
+                NextValue(stable_0_counter, stable_0_period - 1),
+                NextState("WAIT_EDGE")
+            ),
+            If(input_signal,
+                NextValue(stable_0_counter, stable_0_period - 1)
+            ),
+        )
+        fsm.act("WAIT_EDGE",
+            If(input_signal,
+                NextValue(self.tag, counter),
+                NextState("GOT_EDGE")
+            )
+        )
+        fsm.act("GOT_EDGE",
+            If(stable_1_counter != 0,
+                NextValue(stable_1_counter, stable_1_counter - 1)
+            ).Else(
+                NextValue(stable_1_counter, stable_1_period - 1),
+                self.detect.eq(1),
+                NextState("WAIT_STABLE_0")
+            ),
+            If(~input_signal,
+                NextValue(self.tag, self.tag + 1),
+                NextValue(stable_1_counter, stable_1_period - 1)
+            ),
+        )
+        
+
+class DDMTD(Module):
+    def __init__(self, counter, input_signal):
+
+        # in helper clock domain
+        self.h_tag = Signal(len(counter))
+        self.h_tag_update = Signal()
+
+        # # #
+
+        deglitcher = DDMTDDeglitcherMedianEdge(counter, input_signal)
+        self.submodules += deglitcher
+
+        self.sync.helper += [
+            self.h_tag_update.eq(0),
+            If(deglitcher.detect,
+                self.h_tag_update.eq(1),
+                self.h_tag.eq(deglitcher.tag)
+               )
+        ]

src/gateware/drtio_aux_controller.py

@@ -1,12 +1,12 @@
 """Auxiliary controller, common to satellite and master"""
 
-from artiq.gateware.drtio.aux_controller import Transmitter, Receiver
+from artiq.gateware.drtio.aux_controller import (max_packet, aux_buffer_count,
+    Transmitter, Receiver)
 from migen.fhdl.simplify import FullMemoryWE
 from misoc.interconnect.csr import *
 from migen_axi.interconnect.sram import SRAM
 from migen_axi.interconnect import axi
 
-max_packet = 1024
 
 class _DRTIOAuxControllerBase(Module):
     def __init__(self, link_layer):
@@ -27,12 +27,12 @@ class DRTIOAuxControllerAxi(_DRTIOAuxControllerBase):
         tx_sdram_if = SRAM(self.transmitter.mem, read_only=False)
         rx_sdram_if = SRAM(self.receiver.mem, read_only=True)
         aw_decoder = axi.AddressDecoder(self.bus.aw,
-            [(lambda a: a[log2_int(max_packet)] == 0, tx_sdram_if.bus.aw),
+            [(lambda a: a[log2_int(max_packet*aux_buffer_count)] == 0, tx_sdram_if.bus.aw),
-             (lambda a: a[log2_int(max_packet)] == 1, rx_sdram_if.bus.aw)],
+             (lambda a: a[log2_int(max_packet*aux_buffer_count)] == 1, rx_sdram_if.bus.aw)],
             register=True)
         ar_decoder = axi.AddressDecoder(self.bus.ar,
-            [(lambda a: a[log2_int(max_packet)] == 0, tx_sdram_if.bus.ar),
+            [(lambda a: a[log2_int(max_packet*aux_buffer_count)] == 0, tx_sdram_if.bus.ar),
-             (lambda a: a[log2_int(max_packet)] == 1, rx_sdram_if.bus.ar)],
+             (lambda a: a[log2_int(max_packet*aux_buffer_count)] == 1, rx_sdram_if.bus.ar)],
             register=True)
         # unlike wb, axi address decoder only connects ar/aw lanes,
         # the rest must also be connected!
@@ -82,4 +82,4 @@ class DRTIOAuxControllerBare(_DRTIOAuxControllerBase):
         return self.receiver.mem.get_port(write_capable=False)
 
     def get_mem_size(self):
-        return max_packet
+        return max_packet*aux_buffer_count

src/gateware/ebaz4205.py

@@ -0,0 +1,307 @@
+#!/usr/bin/env python
+
+import argparse
+
+import analyzer
+import dma
+from artiq.gateware import rtio
+from artiq.gateware.rtio.phy import spi2, ttl_simple
+from artiq.gateware.rtio.xilinx_clocking import fix_serdes_timing_path
+from config import write_csr_file, write_mem_file, write_rustc_cfg_file
+from migen import *
+from migen.build.generic_platform import IOStandard, Misc, Pins, Subsignal
+from migen.build.platforms import ebaz4205
+from migen_axi.integration.soc_core import SoCCore
+from misoc.interconnect.csr import *
+
+_ps = [
+    (
+        "ps",
+        0,
+        Subsignal("clk", Pins("E7"), IOStandard("LVCMOS33"), Misc("SLEW=FAST")),
+        Subsignal("por_b", Pins("C7"), IOStandard("LVCMOS33"), Misc("SLEW=FAST")),
+        Subsignal("srst_b", Pins("B10"), IOStandard("LVCMOS18"), Misc("SLEW=FAST")),
+    )
+]
+
+_ddr = [
+    (
+        "ddr",
+        0,
+        Subsignal(
+            "a",
+            Pins("N2 K2 M3 K3 M4 L1 L4 K4 K1 J4 F5 G4 E4 D4 F4"),
+            IOStandard("SSTL15"),
+        ),
+        Subsignal("ba", Pins("L5 R4 J5"), IOStandard("SSTL15")),
+        Subsignal("cas_n", Pins("P5"), IOStandard("SSTL15")),
+        Subsignal("cke", Pins("N3"), IOStandard("SSTL15")),
+        Subsignal("cs_n", Pins("N1"), IOStandard("SSTL15")),
+        Subsignal("ck_n", Pins("M2"), IOStandard("DIFF_SSTL15"), Misc("SLEW=FAST")),
+        Subsignal("ck_p", Pins("L2"), IOStandard("DIFF_SSTL15"), Misc("SLEW=FAST")),
+        # Pins "T1 Y1" not connected
+        Subsignal("dm", Pins("A1 F1"), IOStandard("SSTL15_T_DCI"), Misc("SLEW=FAST")),
+        Subsignal(
+            "dq",
+            Pins("C3 B3 A2 A4 D3 D1 C1 E1 E2 E3 G3 H3 J3 H2 H1 J1"),
+            # Pins "P1 P3 R3 R1 T4 U4 U2 U3 V1 Y3 W1 Y4 Y2 W3 V2 V3" not connected
+            IOStandard("SSTL15_T_DCI"),
+            Misc("SLEW=FAST"),
+        ),
+        Subsignal(
+            "dqs_n",
+            Pins("B2 F2"),  # Pins "T2 W4" not connected
+            IOStandard("DIFF_SSTL15_T_DCI"),
+            Misc("SLEW=FAST"),
+        ),
+        Subsignal(
+            "dqs_p",
+            Pins("C2 G2"),  # Pins "R2 W5" not connected
+            IOStandard("DIFF_SSTL15_T_DCI"),
+            Misc("SLEW=FAST"),
+        ),
+        Subsignal("vrn", Pins("G5"), IOStandard("SSTL15_T_DCI"), Misc("SLEW=FAST")),
+        Subsignal("vrp", Pins("H5"), IOStandard("SSTL15_T_DCI"), Misc("SLEW=FAST")),
+        Subsignal("drst_n", Pins("B4"), IOStandard("SSTL15"), Misc("SLEW=FAST")),
+        Subsignal("odt", Pins("N5"), IOStandard("SSTL15")),
+        Subsignal("ras_n", Pins("P4"), IOStandard("SSTL15")),
+        Subsignal("we_n", Pins("M5"), IOStandard("SSTL15")),
+    )
+]
+
+# Connector J3
+_i2c = [
+    (
+        "i2c",
+        0,
+        Subsignal("scl", Pins("U12"), IOStandard("LVCMOS33")),
+        Subsignal("sda", Pins("V13"), IOStandard("LVCMOS33")),
+    )
+]
+
+_spi = [
+    (
+        "spi",
+        0,
+        Subsignal("clk", Pins("V20")),
+        Subsignal("mosi", Pins("U20")),
+        Subsignal("cs_n", Pins("P19")),
+        IOStandard("LVCMOS33"),
+    )
+]
+
+
+# Connector DATA1
+def _create_ttl():
+    _ttl = []
+
+    for idx, elem in enumerate([x for x in range(5, 21) if x not in (10, 12)]):
+        _ttl.append(
+            ("ttl", idx, Pins("DATA1:DATA1-{}".format(elem)), IOStandard("LVCMOS33")),
+        )
+    return _ttl
+
+
+class EBAZ4205(SoCCore):
+    def __init__(self, rtio_clk=125e6, acpki=False):
+        self.acpki = acpki
+
+        platform = ebaz4205.Platform()
+        platform.toolchain.bitstream_commands.extend(
+            [
+                "set_property BITSTREAM.GENERAL.COMPRESS True [current_design]",
+            ]
+        )
+        platform.add_extension(_ps)
+        platform.add_extension(_ddr)
+        platform.add_extension(_i2c)
+        platform.add_extension(_spi)
+        platform.add_extension(_create_ttl())
+
+        gmii = platform.request("gmii")
+        platform.add_period_constraint(gmii.rx_clk, 10)
+        platform.add_period_constraint(gmii.tx_clk, 10)
+        platform.add_platform_command(
+            "set_property CLOCK_DEDICATED_ROUTE FALSE [get_nets gmii_tx_clk_IBUF]"
+        )
+
+        ident = self.__class__.__name__
+        if self.acpki:
+            ident = "acpki_" + ident
+        SoCCore.__init__(self, platform=platform, csr_data_width=32, ident=ident)
+        fix_serdes_timing_path(platform)
+        self.config["RTIO_FREQUENCY"] = str(rtio_clk / 1e6)
+        platform.add_period_constraint(self.ps7.cd_sys.clk, 10)
+
+        self.comb += [
+            self.ps7.enet0.enet.gmii.tx_clk.eq(gmii.tx_clk),
+            self.ps7.enet0.enet.gmii.rx_clk.eq(gmii.rx_clk),
+        ]
+        self.clock_domains.cd_eth_rx = ClockDomain(reset_less=False)
+        self.clock_domains.cd_eth_tx = ClockDomain(reset_less=False)
+        self.comb += [
+            ClockSignal("eth_rx").eq(gmii.rx_clk),
+            ClockSignal("eth_tx").eq(gmii.tx_clk),
+        ]
+        self.sync.eth_tx += [
+            gmii.txd.eq(self.ps7.enet0.enet.gmii.txd),
+            gmii.tx_en.eq(self.ps7.enet0.enet.gmii.tx_en),
+        ]
+        self.sync.eth_rx += [
+            self.ps7.enet0.enet.gmii.rxd.eq(gmii.rxd),
+            self.ps7.enet0.enet.gmii.rx_dv.eq(gmii.rx_dv),
+        ]
+
+        # MDIO
+        mdio = platform.request("mdio")
+        self.comb += mdio.mdc.eq(self.ps7.enet0.enet.mdio.mdc)
+        self.specials += Instance(
+            "IOBUF",
+            i_I=self.ps7.enet0.enet.mdio.o,
+            io_IO=mdio.mdio,
+            o_O=self.ps7.enet0.enet.mdio.i,
+            i_T=~self.ps7.enet0.enet.mdio.t_n,
+        )
+
+        # I2C
+        i2c = self.platform.request("i2c")
+        self.specials += [
+            # SCL
+            Instance(
+                "IOBUF",
+                i_I=self.ps7.i2c0.scl.o,
+                io_IO=i2c.scl,
+                o_O=self.ps7.i2c0.scl.i,
+                i_T=~self.ps7.i2c0.scl.t_n,
+            ),
+            # SDA
+            Instance(
+                "IOBUF",
+                i_I=self.ps7.i2c0.sda.o,
+                io_IO=i2c.sda,
+                o_O=self.ps7.i2c0.sda.i,
+                i_T=~self.ps7.i2c0.sda.t_n,
+            ),
+        ]
+
+        self.rtio_channels = []
+        for i in (0, 1):
+            print("USER LED at RTIO channel 0x{:06x}".format(len(self.rtio_channels)))
+            user_led = self.platform.request("user_led", i)
+            phy = ttl_simple.Output(user_led)
+            self.submodules += phy
+            self.rtio_channels.append(rtio.Channel.from_phy(phy))
+
+        for i in range(14):
+            print("TTL at RTIO channel 0x{:06x}".format(len(self.rtio_channels)))
+            ttl = self.platform.request("ttl", i)
+            phy = ttl_simple.InOut(ttl)
+            self.submodules += phy
+            self.rtio_channels.append(rtio.Channel.from_phy(phy))
+
+        print("SPI at RTIO channel 0x{:06x}".format(len(self.rtio_channels)))
+        spi_phy = spi2.SPIMaster(platform.request("spi"))
+        self.submodules += spi_phy
+        self.rtio_channels.append(rtio.Channel.from_phy(spi_phy, ififo_depth=4))
+        self.config["RTIO_LOG_CHANNEL"] = len(self.rtio_channels)
+        self.rtio_channels.append(rtio.LogChannel())
+
+        self.submodules.rtio_tsc = rtio.TSC(glbl_fine_ts_width=3)
+        self.submodules.rtio_core = rtio.Core(self.rtio_tsc, self.rtio_channels)
+        self.csr_devices.append("rtio_core")
+        if self.acpki:
+            import acpki
+
+            self.config["KI_IMPL"] = "acp"
+            self.submodules.rtio = acpki.KernelInitiator(
+                self.rtio_tsc,
+                bus=self.ps7.s_axi_acp,
+                user=self.ps7.s_axi_acp_user,
+                evento=self.ps7.event.o,
+            )
+            self.csr_devices.append("rtio")
+        else:
+            self.config["KI_IMPL"] = "csr"
+            self.submodules.rtio = rtio.KernelInitiator(self.rtio_tsc, now64=True)
+            self.csr_devices.append("rtio")
+
+        self.submodules.rtio_dma = dma.DMA(self.ps7.s_axi_hp0)
+        self.csr_devices.append("rtio_dma")
+
+        self.submodules.cri_con = rtio.CRIInterconnectShared(
+            [self.rtio.cri, self.rtio_dma.cri],
+            [self.rtio_core.cri],
+            enable_routing=True,
+        )
+        self.csr_devices.append("cri_con")
+
+        self.submodules.rtio_moninj = rtio.MonInj(self.rtio_channels)
+        self.csr_devices.append("rtio_moninj")
+
+        self.submodules.rtio_analyzer = analyzer.Analyzer(
+            self.rtio_tsc, self.rtio_core.cri, self.ps7.s_axi_hp1
+        )
+        self.csr_devices.append("rtio_analyzer")
+
+
+class BASE(EBAZ4205):
+    def __init__(self, rtio_clk, acpki):
+        EBAZ4205.__init__(self, rtio_clk, acpki)
+
+
+VARIANTS = {cls.__name__.lower(): cls for cls in [BASE]}
+
+
+def main():
+    parser = argparse.ArgumentParser(
+        description="ARTIQ port to the EBAZ4205 control card of Ebit E9+ BTC miner"
+    )
+    parser.add_argument(
+        "-r", default=None, help="build Rust interface into the specified file"
+    )
+    parser.add_argument(
+        "-m", default=None, help="build Rust memory interface into the specified file"
+    )
+    parser.add_argument(
+        "-c",
+        default=None,
+        help="build Rust compiler configuration into the specified file",
+    )
+    parser.add_argument(
+        "-g", default=None, help="build gateware into the specified directory"
+    )
+    parser.add_argument("--rtio-clk", default=125e6, help="RTIO Clock Frequency (Hz)")
+    parser.add_argument(
+        "-V",
+        "--variant",
+        default="base",
+        help="variant: " "[acpki_]base" "(default: %(default)s)",
+    )
+    args = parser.parse_args()
+
+    rtio_clk = int(args.rtio_clk)
+    variant = args.variant.lower()
+    acpki = variant.startswith("acpki_")
+    if acpki:
+        variant = variant[6:]
+
+    try:
+        cls = VARIANTS[variant]
+    except KeyError:
+        raise SystemExit("Invalid variant (-V/--variant)")
+
+    soc = cls(rtio_clk=rtio_clk, acpki=acpki)
+    soc.finalize()
+
+    if args.r is not None:
+        write_csr_file(soc, args.r)
+    if args.m is not None:
+        write_mem_file(soc, args.m)
+    if args.c is not None:
+        write_rustc_cfg_file(soc, args.c)
+    if args.g is not None:
+        soc.build(build_dir=args.g)
+
+
+if __name__ == "__main__":
+    main()

src/gateware/kasli_soc.py

@@ -10,72 +10,25 @@ from migen.genlib.cdc import MultiReg
 from migen_axi.integration.soc_core import SoCCore
 from migen_axi.platforms import kasli_soc
 from misoc.interconnect.csr import *
-from misoc.integration import cpu_interface
+from misoc.cores import virtual_leds
 
 from artiq.coredevice import jsondesc
 from artiq.gateware import rtio, eem_7series
+from artiq.gateware.rtio.xilinx_clocking import fix_serdes_timing_path
 from artiq.gateware.rtio.phy import ttl_simple
-from artiq.gateware.rtio.xilinx_clocking import RTIOClockMultiplier
+from artiq.gateware.drtio.transceiver import gtx_7series, eem_serdes
-from artiq.gateware.drtio.transceiver import gtx_7series
 from artiq.gateware.drtio.siphaser import SiPhaser7Series
 from artiq.gateware.drtio.rx_synchronizer import XilinxRXSynchronizer
 from artiq.gateware.drtio import *
+from artiq.gateware.wrpll import wrpll
 
 import dma
 import analyzer
 import acpki
 import drtio_aux_controller
+import zynq_clocking
+from config import write_csr_file, write_mem_file, write_rustc_cfg_file
 
-class RTIOCRG(Module, AutoCSR):
-    def __init__(self, platform):
-        self.pll_reset = CSRStorage(reset=1)
-        self.pll_locked = CSRStatus()
-        self.clock_domains.cd_rtio = ClockDomain()
-        self.clock_domains.cd_rtiox4 = ClockDomain(reset_less=True)
-
-        clk_synth = platform.request("cdr_clk_clean_fabric")
-        clk_synth_se = Signal()
-        platform.add_period_constraint(clk_synth.p, 8.0)
-        self.specials += [
-            Instance("IBUFGDS",
-                p_DIFF_TERM="TRUE", p_IBUF_LOW_PWR="FALSE",
-                i_I=clk_synth.p, i_IB=clk_synth.n, o_O=clk_synth_se),
-        ]
-
-        pll_locked = Signal()
-        rtio_clk = Signal()
-        rtiox4_clk = Signal()
-        fb_clk = Signal()
-        self.specials += [
-            Instance("PLLE2_ADV",
-                     p_STARTUP_WAIT="FALSE", o_LOCKED=pll_locked,
-                     p_BANDWIDTH="HIGH",
-                     p_REF_JITTER1=0.001,
-                     p_CLKIN1_PERIOD=8.0, p_CLKIN2_PERIOD=8.0,
-                     i_CLKIN2=clk_synth_se,
-                     # Warning: CLKINSEL=0 means CLKIN2 is selected
-                     i_CLKINSEL=0,
-
-                     # VCO @ 1.5GHz when using 125MHz input
-                     p_CLKFBOUT_MULT=12, p_DIVCLK_DIVIDE=1,
-                     i_CLKFBIN=fb_clk,
-                     i_RST=self.pll_reset.storage,
-
-                     o_CLKFBOUT=fb_clk,
-
-                     p_CLKOUT0_DIVIDE=3, p_CLKOUT0_PHASE=0.0,
-                     o_CLKOUT0=rtiox4_clk,
-
-                     p_CLKOUT1_DIVIDE=12, p_CLKOUT1_PHASE=0.0,
-                     o_CLKOUT1=rtio_clk),
-            Instance("BUFG", i_I=rtio_clk, o_O=self.cd_rtio.clk),
-            Instance("BUFG", i_I=rtiox4_clk, o_O=self.cd_rtiox4.clk),
-
-            AsyncResetSynchronizer(self.cd_rtio, ~pll_locked),
-            MultiReg(pll_locked, self.pll_locked.status)
-        ]
-
-        
 eem_iostandard_dict = {
      0: "LVDS_25",
      1: "LVDS_25",
@@ -109,35 +62,105 @@ class SMAClkinForward(Module):
         ]
 
 
+class GTPBootstrapClock(Module):
+    def __init__(self, platform, freq=125e6):
+        self.clock_domains.cd_bootstrap = ClockDomain(reset_less=True)
+        self.cd_bootstrap.clk.attr.add("keep")
+
+        bootstrap_125 = platform.request("clk125_gtp")
+        bootstrap_se = Signal()
+        clk_out = Signal()
+        platform.add_period_constraint(bootstrap_125.p, 8.0)
+        self.specials += [
+            Instance("IBUFDS_GTE2",
+                i_CEB=0,
+                i_I=bootstrap_125.p, i_IB=bootstrap_125.n, 
+                o_O=bootstrap_se,
+                p_CLKCM_CFG="TRUE",
+                p_CLKRCV_TRST="TRUE",
+                p_CLKSWING_CFG=3),
+            Instance("BUFG", i_I=bootstrap_se, o_O=clk_out)
+        ]
+        if freq == 125e6:
+            self.comb += self.cd_bootstrap.clk.eq(clk_out)
+        elif freq == 100e6:
+            pll_fb = Signal()
+            pll_out = Signal()
+            self.specials += [
+                Instance("PLLE2_BASE",
+                    p_CLKIN1_PERIOD=8.0,
+                    i_CLKIN1=clk_out,
+                    i_CLKFBIN=pll_fb,
+                    o_CLKFBOUT=pll_fb,
+
+                    # VCO @ 1GHz
+                    p_CLKFBOUT_MULT=8, p_DIVCLK_DIVIDE=1,
+
+                    # 100MHz for bootstrap
+                    p_CLKOUT1_DIVIDE=10, p_CLKOUT1_PHASE=0.0, o_CLKOUT1=pll_out,
+                ),
+                Instance("BUFG", i_I=pll_out, o_O=self.cd_bootstrap.clk)
+            ]
+        else:
+            raise ValueError("Bootstrap frequency must be 100 or 125MHz")
+
+
 class GenericStandalone(SoCCore):
     def __init__(self, description, acpki=False):
         self.acpki = acpki
-        self.rustc_cfg = dict()
+        clk_freq = description["rtio_frequency"]
+        with_wrpll = description["enable_wrpll"]
 
         platform = kasli_soc.Platform()
         platform.toolchain.bitstream_commands.extend([
             "set_property BITSTREAM.GENERAL.COMPRESS True [current_design]",
         ])
-        ident = self.__class__.__name__
+        ident = description["variant"]
         if self.acpki:
             ident = "acpki_" + ident
-        SoCCore.__init__(self, platform=platform, csr_data_width=32, ident=ident)
+        SoCCore.__init__(self, platform=platform, csr_data_width=32, ident=ident, ps_cd_sys=False)
 
-        platform.add_platform_command("create_clock -name clk_fpga_0 -period 8 [get_pins \"PS7/FCLKCLK[0]\"]")
+        self.config["HW_REV"] = description["hw_rev"]
-        platform.add_platform_command("set_input_jitter clk_fpga_0 0.24")
+        clk_synth = platform.request("cdr_clk_clean_fabric")
+        clk_synth_se = Signal()
+        clk_synth_se_buf = Signal()
+        platform.add_period_constraint(clk_synth.p, 8.0)
 
-        self.submodules += SMAClkinForward(self.platform)
+        self.specials += [ 
-
+            Instance("IBUFGDS",
-        self.rustc_cfg["has_si5324"] = None
+                p_DIFF_TERM="TRUE", p_IBUF_LOW_PWR="FALSE",
-        self.rustc_cfg["si5324_soft_reset"] = None
+                i_I=clk_synth.p, i_IB=clk_synth.n, o_O=clk_synth_se
+            ),
+            Instance("BUFG", i_I=clk_synth_se, o_O=clk_synth_se_buf),
+        ]
+        fix_serdes_timing_path(platform)
+        self.submodules.bootstrap = GTPBootstrapClock(self.platform, clk_freq)
+        self.config["RTIO_FREQUENCY"] = str(clk_freq/1e6)
+        self.config["CLOCK_FREQUENCY"] = int(clk_freq)
 
+        self.submodules.sys_crg = zynq_clocking.SYSCRG(self.platform, self.ps7, clk_synth_se_buf)
+        platform.add_false_path_constraints(
+            self.bootstrap.cd_bootstrap.clk, self.sys_crg.cd_sys.clk)
+        self.csr_devices.append("sys_crg")
         self.crg = self.ps7 # HACK for eem_7series to find the clock
-        self.submodules.rtio_crg = RTIOCRG(self.platform)
+        self.crg.cd_sys = self.sys_crg.cd_sys
-        self.csr_devices.append("rtio_crg")
+
-        self.platform.add_period_constraint(self.rtio_crg.cd_rtio.clk, 8.)
+        if with_wrpll:
-        self.platform.add_false_path_constraints(
+            self.submodules.wrpll_refclk = wrpll.FrequencyMultiplier(platform.request("sma_clkin"))
-            self.ps7.cd_sys.clk,
+            self.submodules.wrpll = wrpll.WRPLL(
-            self.rtio_crg.cd_rtio.clk)
+                platform=self.platform,
+                cd_ref=self.wrpll_refclk.cd_ref,
+                main_clk_se=clk_synth_se)
+            self.csr_devices.append("wrpll_refclk")
+            self.csr_devices.append("wrpll")
+            self.comb += self.ps7.core.core0.nfiq.eq(self.wrpll.ev.irq)
+            self.config["HAS_SI549"] = None
+            self.config["WRPLL_REF_CLK"] = "SMA_CLKIN"
+        else:
+            self.submodules += SMAClkinForward(self.platform)
+            self.config["HAS_SI5324"] = None
+            self.config["SI5324_SOFT_RESET"] = None
+
 
         self.rtio_channels = []
         has_grabber = any(peripheral["type"] == "grabber" for peripheral in description["peripherals"])
@@ -153,19 +176,21 @@ class GenericStandalone(SoCCore):
         self.config["RTIO_LOG_CHANNEL"] = len(self.rtio_channels)
         self.rtio_channels.append(rtio.LogChannel())
 
-        self.submodules.rtio_tsc = rtio.TSC("async", glbl_fine_ts_width=3)
+        self.submodules.rtio_tsc = rtio.TSC(glbl_fine_ts_width=3)
-        self.submodules.rtio_core = rtio.Core(self.rtio_tsc, self.rtio_channels)
+        self.submodules.rtio_core = rtio.Core(
+            self.rtio_tsc, self.rtio_channels, lane_count=description["sed_lanes"]
+        )
         self.csr_devices.append("rtio_core")
 
         if self.acpki:
-            self.rustc_cfg["ki_impl"] = "acp"
+            self.config["KI_IMPL"] = "acp"
             self.submodules.rtio = acpki.KernelInitiator(self.rtio_tsc,
                                                          bus=self.ps7.s_axi_acp,
                                                          user=self.ps7.s_axi_acp_user,
                                                          evento=self.ps7.event.o)
             self.csr_devices.append("rtio")
         else:
-            self.rustc_cfg["ki_impl"] = "csr"
+            self.config["KI_IMPL"] = "csr"
             self.submodules.rtio = rtio.KernelInitiator(self.rtio_tsc, now64=True)
             self.csr_devices.append("rtio")
 
@@ -185,52 +210,90 @@ class GenericStandalone(SoCCore):
         self.csr_devices.append("rtio_analyzer")
 
         if has_grabber:
-            self.rustc_cfg["has_grabber"] = None
+            self.config["HAS_GRABBER"] = None
             self.add_csr_group("grabber", self.grabber_csr_group)
             for grabber in self.grabber_csr_group:
                 self.platform.add_false_path_constraints(
-                    self.rtio_crg.cd_rtio.clk, getattr(self, grabber).deserializer.cd_cl.clk)
+                    self.sys_crg.cd_sys.clk, getattr(self, grabber).deserializer.cd_cl.clk)
 
 
 class GenericMaster(SoCCore):
     def __init__(self, description, acpki=False):
-        sys_clk_freq = 125e6
+        clk_freq = description["rtio_frequency"]
-        rtio_clk_freq = description["rtio_frequency"]
+        with_wrpll = description["enable_wrpll"]
 
+        has_drtio_over_eem = any(peripheral["type"] == "shuttler" for peripheral in description["peripherals"])
         self.acpki = acpki
-        self.rustc_cfg = dict()
 
         platform = kasli_soc.Platform()
         platform.toolchain.bitstream_commands.extend([
             "set_property BITSTREAM.GENERAL.COMPRESS True [current_design]",
         ])
-        ident = self.__class__.__name__
+        ident = description["variant"]
         if self.acpki:
             ident = "acpki_" + ident
-        SoCCore.__init__(self, platform=platform, csr_data_width=32, ident=ident)
+        SoCCore.__init__(self, platform=platform, csr_data_width=32, ident=ident, ps_cd_sys=False)
 
-        platform.add_platform_command("create_clock -name clk_fpga_0 -period 8 [get_pins \"PS7/FCLKCLK[0]\"]")
+        self.config["HW_REV"] = description["hw_rev"]
-        platform.add_platform_command("set_input_jitter clk_fpga_0 0.24")
-
-        self.submodules += SMAClkinForward(self.platform)
 
         data_pads = [platform.request("sfp", i) for i in range(4)]
 
-        self.submodules.drtio_transceiver = gtx_7series.GTX(
+        self.submodules.gt_drtio = gtx_7series.GTX(
             clock_pads=platform.request("clk_gtp"),
             pads=data_pads,
-            sys_clk_freq=sys_clk_freq)
+            clk_freq=clk_freq)
-        self.csr_devices.append("drtio_transceiver")
+        self.csr_devices.append("gt_drtio")
+        self.config["RTIO_FREQUENCY"] = str(clk_freq/1e6)
+        self.config["CLOCK_FREQUENCY"] = int(clk_freq)
 
+        txout_buf = Signal()
+        gtx0 = self.gt_drtio.gtxs[0]
+        self.specials += Instance("BUFG", i_I=gtx0.txoutclk, o_O=txout_buf)
+
+        ext_async_rst = Signal()
+
+        self.submodules.bootstrap = GTPBootstrapClock(self.platform, clk_freq)
+        self.submodules.sys_crg = zynq_clocking.SYSCRG(
+            self.platform,
+            self.ps7,
+            txout_buf,
+            clk_sw=self.gt_drtio.stable_clkin.storage,
+            clk_sw_status=gtx0.tx_init.done,
+            ext_async_rst=ext_async_rst)
+        self.csr_devices.append("sys_crg")
         self.crg = self.ps7 # HACK for eem_7series to find the clock
-        self.submodules.rtio_crg = RTIOClockMultiplier(rtio_clk_freq)
+        self.crg.cd_sys = self.sys_crg.cd_sys
-        self.csr_devices.append("rtio_crg")
+        platform.add_false_path_constraints(
+            self.bootstrap.cd_bootstrap.clk, self.sys_crg.cd_sys.clk)
+        fix_serdes_timing_path(platform)
 
-        self.rustc_cfg["has_si5324"] = None
+        self.comb += ext_async_rst.eq(self.sys_crg.clk_sw_fsm.o_clk_sw & ~gtx0.tx_init.done)
-        self.rustc_cfg["si5324_soft_reset"] = None
+        self.specials += MultiReg(self.sys_crg.clk_sw_fsm.o_clk_sw & self.sys_crg.mmcm_locked, self.gt_drtio.clk_path_ready, odomain="bootstrap")
+
+        if with_wrpll:
+            clk_synth = platform.request("cdr_clk_clean_fabric")
+            clk_synth_se = Signal()
+            platform.add_period_constraint(clk_synth.p, 8.0)
+            self.specials += Instance("IBUFGDS", p_DIFF_TERM="TRUE", p_IBUF_LOW_PWR="FALSE", i_I=clk_synth.p, i_IB=clk_synth.n, o_O=clk_synth_se)
+            self.submodules.wrpll_refclk = wrpll.FrequencyMultiplier(platform.request("sma_clkin"))
+            self.submodules.wrpll = wrpll.WRPLL(
+                platform=self.platform,
+                cd_ref=self.wrpll_refclk.cd_ref,
+                main_clk_se=clk_synth_se)
+            self.csr_devices.append("wrpll_refclk")
+            self.csr_devices.append("wrpll")
+            self.comb += self.ps7.core.core0.nfiq.eq(self.wrpll.ev.irq)
+            self.config["HAS_SI549"] = None
+            self.config["WRPLL_REF_CLK"] = "SMA_CLKIN"
+        else:
+            self.submodules += SMAClkinForward(self.platform)
+            self.config["HAS_SI5324"] = None
+            self.config["SI5324_SOFT_RESET"] = None
 
         self.rtio_channels = []
         has_grabber = any(peripheral["type"] == "grabber" for peripheral in description["peripherals"])
+        if has_drtio_over_eem:
+            self.eem_drtio_channels = []
         if has_grabber:
             self.grabber_csr_group = []
         eem_7series.add_peripherals(self, description["peripherals"], iostandard=eem_iostandard)
@@ -243,23 +306,23 @@ class GenericMaster(SoCCore):
         self.config["RTIO_LOG_CHANNEL"] = len(self.rtio_channels)
         self.rtio_channels.append(rtio.LogChannel())
 
-        self.submodules.rtio_tsc = rtio.TSC("async", glbl_fine_ts_width=3)
+        self.submodules.rtio_tsc = rtio.TSC(glbl_fine_ts_width=3)
 
-        drtio_csr_group = []
+        self.drtio_csr_group = []
-        drtioaux_csr_group = []
+        self.drtioaux_csr_group = []
-        drtioaux_memory_group = []
+        self.drtioaux_memory_group = []
         self.drtio_cri = []
-        for i in range(len(self.drtio_transceiver.channels)):
+        for i in range(len(self.gt_drtio.channels)):
             core_name = "drtio" + str(i)
             coreaux_name = "drtioaux" + str(i)
             memory_name = "drtioaux" + str(i) + "_mem"
-            drtio_csr_group.append(core_name)
+            self.drtio_csr_group.append(core_name)
-            drtioaux_csr_group.append(coreaux_name)
+            self.drtioaux_csr_group.append(coreaux_name)
-            drtioaux_memory_group.append(memory_name)
+            self.drtioaux_memory_group.append(memory_name)
 
             cdr = ClockDomainsRenamer({"rtio_rx": "rtio_rx" + str(i)})
 
-            core = cdr(DRTIOMaster(self.rtio_tsc, self.drtio_transceiver.channels[i]))
+            core = cdr(DRTIOMaster(self.rtio_tsc, self.gt_drtio.channels[i]))
             setattr(self.submodules, core_name, core)
             self.drtio_cri.append(core.cri)
             self.csr_devices.append(core_name)
@@ -272,24 +335,27 @@ class GenericMaster(SoCCore):
             memory_address = self.axi2csr.register_port(coreaux.get_tx_port(), size)
             self.axi2csr.register_port(coreaux.get_rx_port(), size)
             self.add_memory_region(memory_name, self.mem_map["csr"] + memory_address, size * 2)
-        self.rustc_cfg["has_drtio"] = None
+        self.config["HAS_DRTIO"] = None
-        self.rustc_cfg["has_drtio_routing"] = None
+        self.config["HAS_DRTIO_ROUTING"] = None
-        self.add_csr_group("drtio", drtio_csr_group)
-        self.add_csr_group("drtioaux", drtioaux_csr_group)
-        self.add_memory_group("drtioaux_mem", drtioaux_memory_group)
 
-        self.submodules.rtio_core = rtio.Core(self.rtio_tsc, self.rtio_channels)
+        if has_drtio_over_eem:
+            self.add_eem_drtio(self.eem_drtio_channels)
+        self.add_drtio_cpuif_groups()
+
+        self.submodules.rtio_core = rtio.Core(
+            self.rtio_tsc, self.rtio_channels, lane_count=description["sed_lanes"]
+        )
         self.csr_devices.append("rtio_core")
 
         if self.acpki:
-            self.rustc_cfg["ki_impl"] = "acp"
+            self.config["KI_IMPL"] = "acp"
             self.submodules.rtio = acpki.KernelInitiator(self.rtio_tsc,
                                                          bus=self.ps7.s_axi_acp,
                                                          user=self.ps7.s_axi_acp_user,
                                                          evento=self.ps7.event.o)
             self.csr_devices.append("rtio")
         else:
-            self.rustc_cfg["ki_impl"] = "csr"
+            self.config["KI_IMPL"] = "csr"
             self.submodules.rtio = rtio.KernelInitiator(self.rtio_tsc, now64=True)
             self.csr_devices.append("rtio")
 
@@ -313,42 +379,104 @@ class GenericMaster(SoCCore):
         self.csr_devices.append("rtio_analyzer")
 
         if has_grabber:
-            self.rustc_cfg["has_grabber"] = None
+            self.config["HAS_GRABBER"] = None
             self.add_csr_group("grabber", self.grabber_csr_group)
+        
+
+        self.submodules.virtual_leds = virtual_leds.VirtualLeds()
+        self.csr_devices.append("virtual_leds")
+
+        self.comb += [self.virtual_leds.get(i).eq(channel.rx_ready)
+                for i, channel in enumerate(self.gt_drtio.channels)]
+
+    def add_eem_drtio(self, eem_drtio_channels):
+        # Must be called before invoking add_rtio() to construct the CRI
+        # interconnect properly
+        self.submodules.eem_transceiver = eem_serdes.EEMSerdes(self.platform, eem_drtio_channels)
+        self.csr_devices.append("eem_transceiver")
+        self.config["HAS_DRTIO_EEM"] = None
+        self.config["EEM_DRTIO_COUNT"] = len(eem_drtio_channels)
+
+        cdr = ClockDomainsRenamer({"rtio_rx": "sys"})
+        for i in range(len(self.eem_transceiver.channels)):
+            channel = i + len(self.gt_drtio.channels)
+            core_name = "drtio" + str(channel)
+            coreaux_name = "drtioaux" + str(channel)
+            memory_name = "drtioaux" + str(channel) + "_mem"
+            self.drtio_csr_group.append(core_name)
+            self.drtioaux_csr_group.append(coreaux_name)
+            self.drtioaux_memory_group.append(memory_name)
+
+            core = cdr(DRTIOMaster(self.rtio_tsc, self.eem_transceiver.channels[i]))
+            setattr(self.submodules, core_name, core)
+            self.drtio_cri.append(core.cri)
+            self.csr_devices.append(core_name)
+
+            coreaux = cdr(drtio_aux_controller.DRTIOAuxControllerBare(core.link_layer))
+            setattr(self.submodules, coreaux_name, coreaux)
+            self.csr_devices.append(coreaux_name)
+
+            size = coreaux.get_mem_size()
+            memory_address = self.axi2csr.register_port(coreaux.get_tx_port(), size)
+            self.axi2csr.register_port(coreaux.get_rx_port(), size)
+            self.add_memory_region(memory_name, self.mem_map["csr"] + memory_address, size * 2)
+
+    def add_drtio_cpuif_groups(self):
+        self.add_csr_group("drtio", self.drtio_csr_group)
+        self.add_csr_group("drtioaux", self.drtioaux_csr_group)
+        self.add_memory_group("drtioaux_mem", self.drtioaux_memory_group)
 
 
 class GenericSatellite(SoCCore):
     def __init__(self, description, acpki=False):
-        sys_clk_freq = 125e6  
+        clk_freq = description["rtio_frequency"]
-        rtio_clk_freq = description["rtio_frequency"]
+        with_wrpll = description["enable_wrpll"]
 
         self.acpki = acpki
-        self.rustc_cfg = dict()
 
         platform = kasli_soc.Platform()
         platform.toolchain.bitstream_commands.extend([
             "set_property BITSTREAM.GENERAL.COMPRESS True [current_design]",
         ])
-        ident = self.__class__.__name__
+        ident = description["variant"]
         if self.acpki:
             ident = "acpki_" + ident
-        SoCCore.__init__(self, platform=platform, csr_data_width=32, ident=ident)
+        SoCCore.__init__(self, platform=platform, csr_data_width=32, ident=ident, ps_cd_sys=False)
 
-        platform.add_platform_command("create_clock -name clk_fpga_0 -period 8 [get_pins \"PS7/FCLKCLK[0]\"]")
+        self.config["HW_REV"] = description["hw_rev"]
-        platform.add_platform_command("set_input_jitter clk_fpga_0 0.24")
 
-        self.crg = self.ps7 # HACK for eem_7series to find the clock
-        self.submodules.rtio_crg = RTIOClockMultiplier(rtio_clk_freq)
-        self.csr_devices.append("rtio_crg")
-        self.rustc_cfg["has_rtio_crg"] = None
-        
         data_pads = [platform.request("sfp", i) for i in range(4)]
         
-        self.submodules.drtio_transceiver = gtx_7series.GTX(
+        self.submodules.gt_drtio = gtx_7series.GTX(
             clock_pads=platform.request("clk_gtp"),  
             pads=data_pads,
-            sys_clk_freq=sys_clk_freq)
+            clk_freq=clk_freq)
-        self.csr_devices.append("drtio_transceiver")
+        self.csr_devices.append("gt_drtio")
+
+        txout_buf = Signal()
+        gtx0 = self.gt_drtio.gtxs[0]
+        self.specials += Instance("BUFG", i_I=gtx0.txoutclk, o_O=txout_buf)
+
+        ext_async_rst = Signal()
+
+        self.submodules.bootstrap = GTPBootstrapClock(self.platform, clk_freq)
+        self.submodules.sys_crg = zynq_clocking.SYSCRG(
+            self.platform, 
+            self.ps7,
+            txout_buf,
+            clk_sw=self.gt_drtio.stable_clkin.storage,
+            clk_sw_status=gtx0.tx_init.done,
+            ext_async_rst=ext_async_rst)
+        platform.add_false_path_constraints(
+            self.bootstrap.cd_bootstrap.clk, self.sys_crg.cd_sys.clk)
+        self.csr_devices.append("sys_crg")
+        self.crg = self.ps7 # HACK for eem_7series to find the clock
+        self.crg.cd_sys = self.sys_crg.cd_sys
+
+        fix_serdes_timing_path(platform)
+
+        self.comb += ext_async_rst.eq(self.sys_crg.clk_sw_fsm.o_clk_sw & ~gtx0.tx_init.done)
+        self.specials += MultiReg(self.sys_crg.clk_sw_fsm.o_clk_sw & self.sys_crg.mmcm_locked, self.gt_drtio.clk_path_ready, odomain="bootstrap")
 
         self.rtio_channels = []
         has_grabber = any(peripheral["type"] == "grabber" for peripheral in description["peripherals"])
@@ -364,13 +492,13 @@ class GenericSatellite(SoCCore):
         self.config["RTIO_LOG_CHANNEL"] = len(self.rtio_channels)
         self.rtio_channels.append(rtio.LogChannel())
 
-        self.submodules.rtio_tsc = rtio.TSC("sync", glbl_fine_ts_width=3)
+        self.submodules.rtio_tsc = rtio.TSC(glbl_fine_ts_width=3)
 
         drtioaux_csr_group = []
         drtioaux_memory_group = []
         drtiorep_csr_group = []
         self.drtio_cri = []
-        for i in range(len(self.drtio_transceiver.channels)):
+        for i in range(len(self.gt_drtio.channels)):
             coreaux_name = "drtioaux" + str(i)
             memory_name = "drtioaux" + str(i) + "_mem"
             drtioaux_csr_group.append(coreaux_name)
@@ -381,7 +509,7 @@ class GenericSatellite(SoCCore):
             if i == 0:
                 self.submodules.rx_synchronizer = cdr(XilinxRXSynchronizer())
                 core = cdr(DRTIOSatellite(
-                    self.rtio_tsc, self.drtio_transceiver.channels[i],
+                    self.rtio_tsc, self.gt_drtio.channels[i],
                     self.rx_synchronizer))
                 self.submodules.drtiosat = core
                 self.csr_devices.append("drtiosat")
@@ -390,7 +518,7 @@ class GenericSatellite(SoCCore):
                 drtiorep_csr_group.append(corerep_name)
 
                 core = cdr(DRTIORepeater(
-                    self.rtio_tsc, self.drtio_transceiver.channels[i]))
+                    self.rtio_tsc, self.gt_drtio.channels[i]))
                 setattr(self.submodules, corerep_name, core)
                 self.drtio_cri.append(core.cri)
                 self.csr_devices.append(corerep_name)
@@ -408,34 +536,39 @@ class GenericSatellite(SoCCore):
             # and registered in PS interface
             # manually, because software refers to rx/tx by halves of entire memory block, not names
             self.add_memory_region(memory_name, self.mem_map["csr"] + memory_address, mem_size * 2)
-        self.rustc_cfg["has_drtio"] = None
+        self.config["HAS_DRTIO"] = None
-        self.rustc_cfg["has_drtio_routing"] = None
+        self.config["HAS_DRTIO_ROUTING"] = None
         self.add_csr_group("drtioaux", drtioaux_csr_group)
         self.add_memory_group("drtioaux_mem", drtioaux_memory_group)
         self.add_csr_group("drtiorep", drtiorep_csr_group)
 
         if self.acpki:
-            self.rustc_cfg["ki_impl"] = "acp"
+            self.config["KI_IMPL"] = "acp"
             self.submodules.rtio = acpki.KernelInitiator(self.rtio_tsc,
                                                          bus=self.ps7.s_axi_acp,
                                                          user=self.ps7.s_axi_acp_user,
                                                          evento=self.ps7.event.o)
             self.csr_devices.append("rtio")
         else:
-            self.rustc_cfg["ki_impl"] = "csr"
+            self.config["KI_IMPL"] = "csr"
             self.submodules.rtio = rtio.KernelInitiator(self.rtio_tsc, now64=True)
             self.csr_devices.append("rtio")
 
         self.submodules.rtio_dma = dma.DMA(self.ps7.s_axi_hp0)
         self.csr_devices.append("rtio_dma")
 
-        self.submodules.local_io = SyncRTIO(self.rtio_tsc, self.rtio_channels)
+        self.submodules.local_io = SyncRTIO(
-        self.comb += self.drtiosat.async_errors.eq(self.local_io.async_errors)
+            self.rtio_tsc, self.rtio_channels, lane_count=description["sed_lanes"]
+        )
+        self.comb += [
+            self.drtiosat.async_errors.eq(self.local_io.async_errors),
+            self.local_io.sed_spread_enable.eq(self.drtiosat.sed_spread_enable.storage)
+        ]
 
         self.submodules.cri_con = rtio.CRIInterconnectShared(
-            [self.drtiosat.cri],
+            [self.drtiosat.cri, self.rtio_dma.cri, self.rtio.cri],
             [self.local_io.cri] + self.drtio_cri,
-            mode="sync", enable_routing=True)
+            enable_routing=True)
         self.csr_devices.append("cri_con")
 
         self.submodules.routing_table = rtio.RoutingTableAccess(self.cri_con)
@@ -444,58 +577,53 @@ class GenericSatellite(SoCCore):
         self.submodules.rtio_moninj = rtio.MonInj(self.rtio_channels)
         self.csr_devices.append("rtio_moninj")
 
-        rtio_clk_period = 1e9/rtio_clk_freq
+        self.submodules.rtio_analyzer = analyzer.Analyzer(self.rtio_tsc, self.local_io.cri,
-        self.rustc_cfg["rtio_frequency"] = str(rtio_clk_freq/1e6)
+                                                          self.ps7.s_axi_hp1)
+        self.csr_devices.append("rtio_analyzer")
 
-        self.submodules.siphaser = SiPhaser7Series(
+        rtio_clk_period = 1e9/clk_freq
-            si5324_clkin=platform.request("cdr_clk"),
+        self.config["RTIO_FREQUENCY"] = str(clk_freq/1e6)
-            rx_synchronizer=self.rx_synchronizer,
+        self.config["CLOCK_FREQUENCY"] = int(clk_freq)
-            ultrascale=False,
-            rtio_clk_freq=self.drtio_transceiver.rtio_clk_freq)
-        platform.add_false_path_constraints(
-            self.crg.cd_sys.clk, self.siphaser.mmcm_freerun_output)
-        self.csr_devices.append("siphaser")
-        self.rustc_cfg["has_si5324"] = None
-        self.rustc_cfg["has_siphaser"] = None
-        self.rustc_cfg["si5324_soft_reset"] = None
 
-        gtx0 = self.drtio_transceiver.gtxs[0]
+        if with_wrpll:
-        platform.add_period_constraint(gtx0.txoutclk, rtio_clk_period)
+            clk_synth = platform.request("cdr_clk_clean_fabric")
-        platform.add_period_constraint(gtx0.rxoutclk, rtio_clk_period)
+            clk_synth_se = Signal()
+            platform.add_period_constraint(clk_synth.p, 8.0)
+            self.specials += Instance("IBUFGDS", p_DIFF_TERM="TRUE", p_IBUF_LOW_PWR="FALSE", i_I=clk_synth.p, i_IB=clk_synth.n, o_O=clk_synth_se)
+            self.submodules.wrpll = wrpll.WRPLL(
+                platform=self.platform,
+                cd_ref=self.gt_drtio.cd_rtio_rx0,
+                main_clk_se=clk_synth_se)
+            self.submodules.wrpll_skewtester = wrpll.SkewTester(self.rx_synchronizer)
+            self.csr_devices.append("wrpll_skewtester")
+            self.csr_devices.append("wrpll")
+            self.comb += self.ps7.core.core0.nfiq.eq(self.wrpll.ev.irq)
+            self.config["HAS_SI549"] = None
+            self.config["WRPLL_REF_CLK"] = "GT_CDR"
+        else:
+            self.submodules.siphaser = SiPhaser7Series(
+                si5324_clkin=platform.request("cdr_clk"),
+                rx_synchronizer=self.rx_synchronizer,
+                ultrascale=False,
+                rtio_clk_freq=self.gt_drtio.rtio_clk_freq)
+            self.csr_devices.append("siphaser")
+            self.config["HAS_SI5324"] = None
+            self.config["SI5324_SOFT_RESET"] = None
+
+        gtx0 = self.gt_drtio.gtxs[0]
         platform.add_false_path_constraints(
-            self.crg.cd_sys.clk,
             gtx0.txoutclk, gtx0.rxoutclk)
-        for gtx in self.drtio_transceiver.gtxs[1:]:
-            platform.add_period_constraint(gtx.rxoutclk, rtio_clk_period)
-            platform.add_false_path_constraints(
-                self.crg.cd_sys.clk, gtx.rxoutclk)
 
         if has_grabber:
-            self.rustc_cfg["has_grabber"] = None
+            self.config["HAS_GRABBER"] = None
             self.add_csr_group("grabber", self.grabber_csr_group)
             # no RTIO CRG here
-     
+        
-
+        self.submodules.virtual_leds = virtual_leds.VirtualLeds()
-def write_mem_file(soc, filename):
+        self.csr_devices.append("virtual_leds")
-    with open(filename, "w") as f:
-        f.write(cpu_interface.get_mem_rust(
-            soc.get_memory_regions(), soc.get_memory_groups(), None))
-
-
-def write_csr_file(soc, filename):
-    with open(filename, "w") as f:
-        f.write(cpu_interface.get_csr_rust(
-            soc.get_csr_regions(), soc.get_csr_groups(), soc.get_constants()))
-
-
-def write_rustc_cfg_file(soc, filename):
-    with open(filename, "w") as f:
-        for k, v in sorted(soc.rustc_cfg.items(), key=itemgetter(0)):
-            if v is None:
-                f.write("{}\n".format(k))
-            else:
-                f.write("{}=\"{}\"\n".format(k, v))
 
+        self.comb += [self.virtual_leds.get(i).eq(channel.rx_ready)
+                for i, channel in enumerate(self.gt_drtio.channels)]
 
 def main():
     parser = argparse.ArgumentParser(
@@ -518,14 +646,14 @@ def main():
     if description["target"] != "kasli_soc":
         raise ValueError("Description is for a different target")
 
-    if description["base"] == "standalone":
+    if description["drtio_role"] == "standalone":
         cls = GenericStandalone
-    elif description["base"] == "master":
+    elif description["drtio_role"] == "master":
         cls = GenericMaster
-    elif description["base"] == "satellite":
+    elif description["drtio_role"] == "satellite":
         cls = GenericSatellite
     else:
-        raise ValueError("Invalid base")
+        raise ValueError("Invalid DRTIO role")
 
     soc = cls(description, acpki=args.acpki)
     soc.finalize()

src/gateware/test_dma.py

@@ -168,7 +168,7 @@ class FullStackTB(Module):
         bus = axi.Interface(ws*8)
         self.memory = AXIMemorySim(bus, sequence)
         self.submodules.dut = dma.DMA(bus)
-        self.submodules.tsc = rtio.TSC("async")
+        self.submodules.tsc = rtio.TSC()
         self.submodules.rtio = rtio.Core(self.tsc, rtio_channels)
         self.comb += self.dut.cri.connect(self.rtio.cri)
 
@@ -229,7 +229,7 @@ class TestDMA(unittest.TestCase):
             do_dma(tb.dut, 0), monitor(),
             (None for _ in range(70)),
             tb.memory.ar(), tb.memory.r()
-        ]}, {"sys": 8, "rsys": 8, "rtio": 8, "rio": 8, "rio_phy": 8})
+        ]}, {"sys": 8, "rsys": 8, "rio": 8, "rio_phy": 8})
 
         correct_changes = [(timestamp + 11, channel)
                            for channel, timestamp, _, _ in test_writes_full_stack]

src/gateware/zc706.py

@@ -10,12 +10,11 @@ from migen.genlib.cdc import MultiReg
 from migen_axi.integration.soc_core import SoCCore
 from migen_axi.platforms import zc706
 from misoc.interconnect.csr import *
-from misoc.integration import cpu_interface
 from misoc.cores import gpio
 
 from artiq.gateware import rtio, nist_clock, nist_qc2
-from artiq.gateware.rtio.phy import ttl_simple, ttl_serdes_7series, dds, spi2
+from artiq.gateware.rtio.phy import ttl_simple, ttl_serdes_7series, dds, spi2, edge_counter
-from artiq.gateware.rtio.xilinx_clocking import RTIOClockMultiplier, fix_serdes_timing_path
+from artiq.gateware.rtio.xilinx_clocking import fix_serdes_timing_path
 from artiq.gateware.drtio.transceiver import gtx_7series
 from artiq.gateware.drtio.siphaser import SiPhaser7Series
 from artiq.gateware.drtio.rx_synchronizer import XilinxRXSynchronizer
@@ -25,51 +24,8 @@ import dma
 import analyzer
 import acpki
 import drtio_aux_controller
-
+import zynq_clocking
-
+from config import write_csr_file, write_mem_file, write_rustc_cfg_file
-class RTIOCRG(Module, AutoCSR):
-    def __init__(self, platform, rtio_internal_clk):
-        self.clock_sel = CSRStorage()
-        self.pll_reset = CSRStorage(reset=1)
-        self.pll_locked = CSRStatus()
-        self.clock_domains.cd_rtio = ClockDomain()
-        self.clock_domains.cd_rtiox4 = ClockDomain(reset_less=True)
-
-        rtio_external_clk = Signal()
-        user_sma_clock = platform.request("user_sma_clock")
-        platform.add_period_constraint(user_sma_clock.p, 8.0)
-        self.specials += Instance("IBUFDS",
-                                  i_I=user_sma_clock.p, i_IB=user_sma_clock.n,
-                                  o_O=rtio_external_clk)
-
-        pll_locked = Signal()
-        rtio_clk = Signal()
-        rtiox4_clk = Signal()
-        self.specials += [
-            Instance("PLLE2_ADV",
-                     p_STARTUP_WAIT="FALSE", o_LOCKED=pll_locked,
-
-                     p_REF_JITTER1=0.01,
-                     p_CLKIN1_PERIOD=8.0, p_CLKIN2_PERIOD=8.0,
-                     i_CLKIN1=rtio_internal_clk, i_CLKIN2=rtio_external_clk,
-                     # Warning: CLKINSEL=0 means CLKIN2 is selected
-                     i_CLKINSEL=~self.clock_sel.storage,
-
-                     # VCO @ 1GHz when using 125MHz input
-                     p_CLKFBOUT_MULT=8, p_DIVCLK_DIVIDE=1,
-                     i_CLKFBIN=self.cd_rtio.clk,
-                     i_RST=self.pll_reset.storage,
-
-                     o_CLKFBOUT=rtio_clk,
-
-                     p_CLKOUT0_DIVIDE=2, p_CLKOUT0_PHASE=0.0,
-                     o_CLKOUT0=rtiox4_clk),
-            Instance("BUFG", i_I=rtio_clk, o_O=self.cd_rtio.clk),
-            Instance("BUFG", i_I=rtiox4_clk, o_O=self.cd_rtiox4.clk),
-            AsyncResetSynchronizer(self.cd_rtio, ~pll_locked),
-            MultiReg(pll_locked, self.pll_locked.status)
-        ]
-
 
 class SMAClkinForward(Module):
     def __init__(self, platform):
@@ -84,6 +40,37 @@ class SMAClkinForward(Module):
         ]
 
 
+class CLK200BootstrapClock(Module):
+    def __init__(self, platform, freq=125e6):
+        self.clock_domains.cd_bootstrap = ClockDomain(reset_less=True)
+        self.cd_bootstrap.clk.attr.add("keep")
+
+        clk200 = platform.request("clk200")
+        clk200_se = Signal()
+
+        pll_fb = Signal()
+        pll_clkout = Signal()
+        assert freq in [125e6, 100e6]
+        divide = int(1e9/freq)
+        self.specials += [
+            Instance("IBUFDS",
+                i_I=clk200.p, i_IB=clk200.n, o_O=clk200_se),
+            Instance("PLLE2_BASE",
+                p_CLKIN1_PERIOD=5.0,
+                i_CLKIN1=clk200_se,
+                i_CLKFBIN=pll_fb,
+                o_CLKFBOUT=pll_fb,
+
+                # VCO @ 1GHz
+                p_CLKFBOUT_MULT=5, p_DIVCLK_DIVIDE=1,
+
+                # 125MHz/100MHz for bootstrap
+                p_CLKOUT1_DIVIDE=divide, p_CLKOUT1_PHASE=0.0, o_CLKOUT1=pll_clkout,
+            ),
+            Instance("BUFG", i_I=pll_clkout, o_O=self.cd_bootstrap.clk)
+        ]
+
+
 # The NIST backplanes require setting VADJ to 3.3V by reprogramming the power supply.
 # This also changes the I/O standard for some on-board LEDs.
 leds_fmc33 = [
@@ -135,14 +122,10 @@ def prepare_zc706_platform(platform):
     platform.toolchain.bitstream_commands.extend([
         "set_property BITSTREAM.GENERAL.COMPRESS True [current_design]",
     ])
-    platform.add_platform_command("create_clock -name clk_fpga_0 -period 8 [get_pins \"PS7/FCLKCLK[0]\"]")
-    platform.add_platform_command("set_input_jitter clk_fpga_0 0.24")
-
 
 class ZC706(SoCCore):
     def __init__(self, acpki=False):
         self.acpki = acpki
-        self.rustc_cfg = dict()
 
         platform = zc706.Platform()
         prepare_zc706_platform(platform)
@@ -150,30 +133,49 @@ class ZC706(SoCCore):
         ident = self.__class__.__name__
         if self.acpki:
             ident = "acpki_" + ident
-        SoCCore.__init__(self, platform=platform, csr_data_width=32, ident=ident)
+        SoCCore.__init__(self, platform=platform, csr_data_width=32, ident=ident, ps_cd_sys=False)
 
-        self.submodules.rtio_crg = RTIOCRG(self.platform, self.ps7.cd_sys.clk)
+        platform.add_extension(si5324_fmc33)
-        self.csr_devices.append("rtio_crg")
+        self.comb += platform.request("si5324_33").rst_n.eq(1)
-        self.rustc_cfg["has_rtio_crg_clock_sel"] = None
+
-        self.platform.add_period_constraint(self.rtio_crg.cd_rtio.clk, 8.)
+        cdr_clk = Signal()
-        self.platform.add_false_path_constraints(
+        cdr_clk_buf = Signal()
-            self.ps7.cd_sys.clk,
+        si5324_out = platform.request("si5324_clkout")
-            self.rtio_crg.cd_rtio.clk)
+        platform.add_period_constraint(si5324_out.p, 8.0)
+        self.specials += [
+            Instance("IBUFDS_GTE2",
+                i_CEB=0,
+                i_I=si5324_out.p, i_IB=si5324_out.n,
+                o_O=cdr_clk,
+                p_CLKCM_CFG="TRUE",
+                p_CLKRCV_TRST="TRUE",
+                p_CLKSWING_CFG=3),
+            Instance("BUFG", i_I=cdr_clk, o_O=cdr_clk_buf)
+        ]
+        self.config["HAS_SI5324"] = None
+        self.config["SI5324_AS_SYNTHESIZER"] = None
+        self.config["SI5324_SOFT_RESET"] = None
+        
+        self.submodules.bootstrap = CLK200BootstrapClock(platform)
+        self.submodules.sys_crg = zynq_clocking.SYSCRG(self.platform, self.ps7, cdr_clk_buf)
+        platform.add_false_path_constraints(
+            self.bootstrap.cd_bootstrap.clk, self.sys_crg.cd_sys.clk)
+        self.csr_devices.append("sys_crg")
 
     def add_rtio(self, rtio_channels):
-        self.submodules.rtio_tsc = rtio.TSC("async", glbl_fine_ts_width=3)
+        self.submodules.rtio_tsc = rtio.TSC(glbl_fine_ts_width=3)
         self.submodules.rtio_core = rtio.Core(self.rtio_tsc, rtio_channels)
         self.csr_devices.append("rtio_core")
 
         if self.acpki:
-            self.rustc_cfg["ki_impl"] = "acp"
+            self.config["KI_IMPL"] = "acp"
             self.submodules.rtio = acpki.KernelInitiator(self.rtio_tsc,
                                                          bus=self.ps7.s_axi_acp,
                                                          user=self.ps7.s_axi_acp_user,
                                                          evento=self.ps7.event.o)
             self.csr_devices.append("rtio")
         else:
-            self.rustc_cfg["ki_impl"] = "csr"
+            self.config["KI_IMPL"] = "csr"
             self.submodules.rtio = rtio.KernelInitiator(self.rtio_tsc, now64=True)
             self.csr_devices.append("rtio")
 
@@ -196,22 +198,18 @@ class ZC706(SoCCore):
 class _MasterBase(SoCCore):
     def __init__(self, acpki=False, drtio100mhz=False):
         self.acpki = acpki
-        self.rustc_cfg = dict()
+
+        clk_freq = 100e6 if drtio100mhz else 125e6
 
         platform = zc706.Platform()
         prepare_zc706_platform(platform)
         ident = self.__class__.__name__
         if self.acpki:
             ident = "acpki_" + ident
-        SoCCore.__init__(self, platform=platform, csr_data_width=32, ident=ident)
+        SoCCore.__init__(self, platform=platform, csr_data_width=32, ident=ident, ps_cd_sys=False)
 
         platform.add_extension(si5324_fmc33)
 
-        self.sys_clk_freq = 125e6
-        rtio_clk_freq = 100e6 if drtio100mhz else self.sys_clk_freq
-
-        platform = self.platform
-
         self.comb += platform.request("sfp_tx_disable_n").eq(1)
         data_pads = [
             platform.request("sfp"),
@@ -221,20 +219,38 @@ class _MasterBase(SoCCore):
         self.submodules += SMAClkinForward(self.platform)
 
         # 1000BASE_BX10 Ethernet compatible, 125MHz RTIO clock
-        self.submodules.drtio_transceiver = gtx_7series.GTX(
+        self.submodules.gt_drtio = gtx_7series.GTX(
             clock_pads=platform.request("si5324_clkout"),
             pads=data_pads,
-            sys_clk_freq=self.sys_clk_freq,
+            clk_freq=clk_freq)
-            rtio_clk_freq=rtio_clk_freq)
+        self.csr_devices.append("gt_drtio")
-        self.csr_devices.append("drtio_transceiver")
 
-        self.submodules.rtio_tsc = rtio.TSC("async", glbl_fine_ts_width=3)
+        self.submodules.rtio_tsc = rtio.TSC(glbl_fine_ts_width=3)
+        ext_async_rst = Signal()
+        txout_buf = Signal()
+        gtx0 = self.gt_drtio.gtxs[0]
+        self.specials += Instance("BUFG", i_I=gtx0.txoutclk, o_O=txout_buf)
+        self.submodules.bootstrap = CLK200BootstrapClock(platform, clk_freq)
+        self.submodules.sys_crg = zynq_clocking.SYSCRG(
+            self.platform, 
+            self.ps7, 
+            txout_buf,
+            clk_sw=self.gt_drtio.stable_clkin.storage,
+            clk_sw_status=gtx0.tx_init.done,
+            ext_async_rst=ext_async_rst,
+            freq=clk_freq)
+        platform.add_false_path_constraints(
+            self.bootstrap.cd_bootstrap.clk, self.sys_crg.cd_sys.clk)
+        self.csr_devices.append("sys_crg")
+
+        self.comb += ext_async_rst.eq(self.sys_crg.clk_sw_fsm.o_clk_sw & ~gtx0.tx_init.done)
+        self.specials += MultiReg(self.sys_crg.clk_sw_fsm.o_clk_sw & self.sys_crg.mmcm_locked, self.gt_drtio.clk_path_ready, odomain="bootstrap")
 
         drtio_csr_group = []
         drtioaux_csr_group = []
         drtioaux_memory_group = []
         self.drtio_cri = []
-        for i in range(len(self.drtio_transceiver.channels)):
+        for i in range(len(self.gt_drtio.channels)):
             core_name = "drtio" + str(i)
             coreaux_name = "drtioaux" + str(i)
             memory_name = "drtioaux" + str(i) + "_mem"
@@ -245,7 +261,7 @@ class _MasterBase(SoCCore):
             cdr = ClockDomainsRenamer({"rtio_rx": "rtio_rx" + str(i)})
 
             core = cdr(DRTIOMaster(
-                self.rtio_tsc, self.drtio_transceiver.channels[i]))
+                self.rtio_tsc, self.gt_drtio.channels[i]))
             setattr(self.submodules, core_name, core)
             self.drtio_cri.append(core.cri)
             self.csr_devices.append(core_name)
@@ -258,53 +274,45 @@ class _MasterBase(SoCCore):
             memory_address = self.axi2csr.register_port(coreaux.get_tx_port(), mem_size)
             self.axi2csr.register_port(coreaux.get_rx_port(), mem_size)
             self.add_memory_region(memory_name, self.mem_map["csr"] + memory_address, mem_size * 2)
-        self.rustc_cfg["has_drtio"] = None
+        self.config["HAS_DRTIO"] = None
-        self.rustc_cfg["has_drtio_routing"] = None
+        self.config["HAS_DRTIO_ROUTING"] = None
         self.add_csr_group("drtio", drtio_csr_group)
         self.add_csr_group("drtioaux", drtioaux_csr_group)
         self.add_memory_group("drtioaux_mem", drtioaux_memory_group)
 
-        self.rustc_cfg["rtio_frequency"] = str(self.drtio_transceiver.rtio_clk_freq/1e6)
+        self.config["RTIO_FREQUENCY"] = str(self.gt_drtio.rtio_clk_freq/1e6)
 
         self.submodules.si5324_rst_n = gpio.GPIOOut(platform.request("si5324_33").rst_n)
         self.csr_devices.append("si5324_rst_n")
-        self.rustc_cfg["has_si5324"] = None
+        self.config["HAS_SI5324"] = None
-        self.rustc_cfg["si5324_as_synthesizer"] = None
+        self.config["SI5324_AS_SYNTHESIZER"] = None
 
-        rtio_clk_period = 1e9/self.drtio_transceiver.rtio_clk_freq
         # Constrain TX & RX timing for the first transceiver channel
         # (First channel acts as master for phase alignment for all channels' TX)
-        gtx0 = self.drtio_transceiver.gtxs[0]
-        platform.add_period_constraint(gtx0.txoutclk, rtio_clk_period)
-        platform.add_period_constraint(gtx0.rxoutclk, rtio_clk_period)
         platform.add_false_path_constraints(
-            self.ps7.cd_sys.clk,
             gtx0.txoutclk, gtx0.rxoutclk)
         # Constrain RX timing for the each transceiver channel
         # (Each channel performs single-lane phase alignment for RX)
-        for gtx in self.drtio_transceiver.gtxs[1:]:
+        for gtx in self.gt_drtio.gtxs[1:]:
-            platform.add_period_constraint(gtx.rxoutclk, rtio_clk_period)
             platform.add_false_path_constraints(
-                self.ps7.cd_sys.clk, gtx0.txoutclk, gtx.rxoutclk)
+                gtx0.txoutclk, gtx.rxoutclk)
 
-        self.submodules.rtio_crg = RTIOClockMultiplier(self.sys_clk_freq)
+        fix_serdes_timing_path(platform)
-        self.csr_devices.append("rtio_crg")
-        fix_serdes_timing_path(self.platform)
 
     def add_rtio(self, rtio_channels):
-        self.submodules.rtio_tsc = rtio.TSC("async", glbl_fine_ts_width=3)
+        self.submodules.rtio_tsc = rtio.TSC(glbl_fine_ts_width=3)
         self.submodules.rtio_core = rtio.Core(self.rtio_tsc, rtio_channels)
         self.csr_devices.append("rtio_core")
 
         if self.acpki:
-            self.rustc_cfg["ki_impl"] = "acp"
+            self.config["KI_IMPL"] = "acp"
             self.submodules.rtio = acpki.KernelInitiator(self.rtio_tsc,
                                                          bus=self.ps7.s_axi_acp,
                                                          user=self.ps7.s_axi_acp_user,
                                                          evento=self.ps7.event.o)
             self.csr_devices.append("rtio")
         else:
-            self.rustc_cfg["ki_impl"] = "csr"
+            self.config["KI_IMPL"] = "csr"
             self.submodules.rtio = rtio.KernelInitiator(self.rtio_tsc, now64=True)
             self.csr_devices.append("rtio")
 
@@ -314,7 +322,7 @@ class _MasterBase(SoCCore):
         self.submodules.cri_con = rtio.CRIInterconnectShared(
             [self.rtio.cri, self.rtio_dma.cri],
             [self.rtio_core.cri] + self.drtio_cri,
-            mode="sync", enable_routing=True)
+            enable_routing=True)
         self.csr_devices.append("cri_con")
 
         self.submodules.rtio_moninj = rtio.MonInj(rtio_channels)
@@ -331,21 +339,18 @@ class _MasterBase(SoCCore):
 class _SatelliteBase(SoCCore):
     def __init__(self, acpki=False, drtio100mhz=False):
         self.acpki = acpki
-        self.rustc_cfg = dict()
+
+        clk_freq = 100e6 if drtio100mhz else 125e6
 
         platform = zc706.Platform()
         prepare_zc706_platform(platform)
         ident = self.__class__.__name__
         if self.acpki:
             ident = "acpki_" + ident
-        SoCCore.__init__(self, platform=platform, csr_data_width=32, ident=ident)
+        SoCCore.__init__(self, platform=platform, csr_data_width=32, ident=ident, ps_cd_sys=False)
 
         platform.add_extension(si5324_fmc33)
 
-        self.sys_clk_freq = 125e6
-        rtio_clk_freq = 100e6 if drtio100mhz else self.sys_clk_freq
-        platform = self.platform
-
         # SFP
         self.comb += platform.request("sfp_tx_disable_n").eq(0)
         data_pads = [
@@ -353,21 +358,44 @@ class _SatelliteBase(SoCCore):
             platform.request("user_sma_mgt")
         ]
 
-        self.submodules.rtio_tsc = rtio.TSC("sync", glbl_fine_ts_width=3)
+        self.submodules.rtio_tsc = rtio.TSC(glbl_fine_ts_width=3)
 
         # 1000BASE_BX10 Ethernet compatible, 125MHz RTIO clock
-        self.submodules.drtio_transceiver = gtx_7series.GTX(
+        self.submodules.gt_drtio = gtx_7series.GTX(
             clock_pads=platform.request("si5324_clkout"),
             pads=data_pads,
-            sys_clk_freq=self.sys_clk_freq,
+            clk_freq=clk_freq)
-            rtio_clk_freq=rtio_clk_freq)
+        self.csr_devices.append("gt_drtio")
-        self.csr_devices.append("drtio_transceiver")
+
+        ext_async_rst = Signal()
+        txout_buf = Signal()
+        txout_buf.attr.add("keep")
+        gtx0 = self.gt_drtio.gtxs[0]
+        self.specials += Instance(
+            "BUFG", 
+            i_I=gtx0.txoutclk, 
+            o_O=txout_buf)
+        self.submodules.bootstrap = CLK200BootstrapClock(platform, clk_freq)
+        self.submodules.sys_crg = zynq_clocking.SYSCRG(
+            self.platform, 
+            self.ps7, 
+            txout_buf,
+            clk_sw=self.gt_drtio.stable_clkin.storage,
+            clk_sw_status=gtx0.tx_init.done,
+            ext_async_rst=ext_async_rst,
+            freq=clk_freq)
+        platform.add_false_path_constraints(
+            self.bootstrap.cd_bootstrap.clk, self.sys_crg.cd_sys.clk)
+        self.csr_devices.append("sys_crg")
+
+        self.comb += ext_async_rst.eq(self.sys_crg.clk_sw_fsm.o_clk_sw & ~gtx0.tx_init.done)
+        self.specials += MultiReg(self.sys_crg.clk_sw_fsm.o_clk_sw & self.sys_crg.mmcm_locked, self.gt_drtio.clk_path_ready, odomain="bootstrap")
 
         drtioaux_csr_group = []
         drtioaux_memory_group = []
         drtiorep_csr_group = []
         self.drtio_cri = []
-        for i in range(len(self.drtio_transceiver.channels)):
+        for i in range(len(self.gt_drtio.channels)):
             coreaux_name = "drtioaux" + str(i)
             memory_name = "drtioaux" + str(i) + "_mem"
             drtioaux_csr_group.append(coreaux_name)
@@ -379,7 +407,7 @@ class _SatelliteBase(SoCCore):
             if i == 0:
                 self.submodules.rx_synchronizer = cdr(XilinxRXSynchronizer())
                 core = cdr(DRTIOSatellite(
-                    self.rtio_tsc, self.drtio_transceiver.channels[0], self.rx_synchronizer))
+                    self.rtio_tsc, self.gt_drtio.channels[0], self.rx_synchronizer))
                 self.submodules.drtiosat = core
                 self.csr_devices.append("drtiosat")
             # Repeaters
@@ -387,7 +415,7 @@ class _SatelliteBase(SoCCore):
                 corerep_name = "drtiorep" + str(i-1)
                 drtiorep_csr_group.append(corerep_name)
                 core = cdr(DRTIORepeater(
-                    self.rtio_tsc, self.drtio_transceiver.channels[i]))
+                    self.rtio_tsc, self.gt_drtio.channels[i]))
                 setattr(self.submodules, corerep_name, core)
                 self.drtio_cri.append(core.cri)
                 self.csr_devices.append(corerep_name)
@@ -405,72 +433,74 @@ class _SatelliteBase(SoCCore):
             # and registered in PS interface
             # manually, because software refers to rx/tx by halves of entire memory block, not names
             self.add_memory_region(memory_name, self.mem_map["csr"] + memory_address, mem_size * 2)
-        self.rustc_cfg["has_drtio"] = None
+        self.config["HAS_DRTIO"] = None
-        self.rustc_cfg["has_drtio_routing"] = None
+        self.config["HAS_DRTIO_ROUTING"] = None
         self.add_csr_group("drtioaux", drtioaux_csr_group)
         self.add_csr_group("drtiorep", drtiorep_csr_group)
         self.add_memory_group("drtioaux_mem", drtioaux_memory_group)
 
-        self.rustc_cfg["rtio_frequency"] = str(self.drtio_transceiver.rtio_clk_freq/1e6)
+        self.config["RTIO_FREQUENCY"] = str(self.gt_drtio.rtio_clk_freq/1e6)
 
         # Si5324 Phaser
         self.submodules.siphaser = SiPhaser7Series(
             si5324_clkin=platform.request("si5324_clkin"),
             rx_synchronizer=self.rx_synchronizer,
             ultrascale=False,
-            rtio_clk_freq=self.drtio_transceiver.rtio_clk_freq)
+            rtio_clk_freq=self.gt_drtio.rtio_clk_freq)
         platform.add_false_path_constraints(
-            self.ps7.cd_sys.clk, self.siphaser.mmcm_freerun_output)
+            self.sys_crg.cd_sys.clk, self.siphaser.mmcm_freerun_output)
         self.csr_devices.append("siphaser")
         self.submodules.si5324_rst_n = gpio.GPIOOut(platform.request("si5324_33").rst_n)
         self.csr_devices.append("si5324_rst_n")
-        self.rustc_cfg["has_si5324"] = None
+        self.config["HAS_SI5324"] = None
-        self.rustc_cfg["has_siphaser"] = None
 
-        rtio_clk_period = 1e9/self.drtio_transceiver.rtio_clk_freq
+        rtio_clk_period = 1e9/self.gt_drtio.rtio_clk_freq
         # Constrain TX & RX timing for the first transceiver channel
         # (First channel acts as master for phase alignment for all channels' TX)
-        gtx0 = self.drtio_transceiver.gtxs[0]
-        platform.add_period_constraint(gtx0.txoutclk, rtio_clk_period)
-        platform.add_period_constraint(gtx0.rxoutclk, rtio_clk_period)
         platform.add_false_path_constraints(
-            self.ps7.cd_sys.clk,
             gtx0.txoutclk, gtx0.rxoutclk)
         # Constrain RX timing for the each transceiver channel
         # (Each channel performs single-lane phase alignment for RX)
-        for gtx in self.drtio_transceiver.gtxs[1:]:
+        for gtx in self.gt_drtio.gtxs[1:]:
-            platform.add_period_constraint(gtx.rxoutclk, rtio_clk_period)
             platform.add_false_path_constraints(
-                self.ps7.cd_sys.clk, gtx.rxoutclk)
+                self.sys_crg.cd_sys.clk, gtx.rxoutclk)
 
-        self.submodules.rtio_crg = RTIOClockMultiplier(self.sys_clk_freq)
+        fix_serdes_timing_path(platform)
-        self.csr_devices.append("rtio_crg")
-        self.rustc_cfg["has_rtio_crg"] = None
-        fix_serdes_timing_path(self.platform)
 
     def add_rtio(self, rtio_channels):
         self.submodules.rtio_moninj = rtio.MonInj(rtio_channels)
         self.csr_devices.append("rtio_moninj")
 
         if self.acpki:
-            self.rustc_cfg["ki_impl"] = "acp"
+            self.config["KI_IMPL"] = "acp"
             self.submodules.rtio = acpki.KernelInitiator(self.rtio_tsc,
                                                          bus=self.ps7.s_axi_acp,
                                                          user=self.ps7.s_axi_acp_user,
                                                          evento=self.ps7.event.o)
             self.csr_devices.append("rtio")
         else:
-            self.rustc_cfg["ki_impl"] = "csr"
+            self.config["KI_IMPL"] = "csr"
             self.submodules.rtio = rtio.KernelInitiator(self.rtio_tsc, now64=True)
             self.csr_devices.append("rtio")
 
+        self.submodules.rtio_dma = dma.DMA(self.ps7.s_axi_hp0)
+        self.csr_devices.append("rtio_dma")
+
         self.submodules.local_io = SyncRTIO(self.rtio_tsc, rtio_channels)
+        self.comb += [
+            self.drtiosat.async_errors.eq(self.local_io.async_errors),
+            self.local_io.sed_spread_enable.eq(self.drtiosat.sed_spread_enable.storage)
+        ]
         self.submodules.cri_con = rtio.CRIInterconnectShared(
-            [self.drtiosat.cri],
+            [self.drtiosat.cri, self.rtio_dma.cri, self.rtio.cri],
             [self.local_io.cri] + self.drtio_cri,
-            mode="sync", enable_routing=True)
+            enable_routing=True)
         self.csr_devices.append("cri_con")
 
+        self.submodules.rtio_analyzer = analyzer.Analyzer(self.rtio_tsc, self.local_io.cri,
+                                                          self.ps7.s_axi_hp1)
+        self.csr_devices.append("rtio_analyzer")
+
         self.submodules.routing_table = rtio.RoutingTableAccess(self.cri_con)
         self.csr_devices.append("routing_table")
 
@@ -562,12 +592,16 @@ class _NIST_QC2_RTIO:
         platform.add_extension(pmod1_33)
 
         rtio_channels = []
+        edge_counter_phy = []
 
         # All TTL channels are In+Out capable
         for i in range(40):
             phy = ttl_serdes_7series.InOut_8X(platform.request("ttl", i))
             self.submodules += phy
             rtio_channels.append(rtio.Channel.from_phy(phy, ififo_depth=512))
+            # first four TTLs will also have edge counters
+            if i < 4:
+                edge_counter_phy.append(phy)
 
         # no SMA GPIO, replaced with PMOD1_0
         phy = ttl_serdes_7series.InOut_8X(platform.request("pmod1_33", 0))
@@ -606,6 +640,11 @@ class _NIST_QC2_RTIO:
                 platform.request("dds", backplane_offset), 12, onehot=True)
             self.submodules += phy
             rtio_channels.append(rtio.Channel.from_phy(phy, ififo_depth=4))
+        
+        for phy in edge_counter_phy:
+            counter = edge_counter.SimpleEdgeCounter(phy.input_state)
+            self.submodules += counter
+            rtio_channels.append(rtio.Channel.from_phy(counter))
 
         self.config["RTIO_LOG_CHANNEL"] = len(rtio_channels)
         rtio_channels.append(rtio.LogChannel())
@@ -616,6 +655,7 @@ class _NIST_QC2_RTIO:
 class NIST_CLOCK(ZC706, _NIST_CLOCK_RTIO):
     def __init__(self, acpki, drtio100mhz):
         ZC706.__init__(self, acpki)
+        self.submodules += SMAClkinForward(self.platform)
         _NIST_CLOCK_RTIO.__init__(self)
 
 class NIST_CLOCK_Master(_MasterBase, _NIST_CLOCK_RTIO):
@@ -631,6 +671,7 @@ class NIST_CLOCK_Satellite(_SatelliteBase, _NIST_CLOCK_RTIO):
 class NIST_QC2(ZC706, _NIST_QC2_RTIO):
     def __init__(self, acpki, drtio100mhz):
         ZC706.__init__(self, acpki)
+        self.submodules += SMAClkinForward(self.platform)
         _NIST_QC2_RTIO.__init__(self)
 
 class NIST_QC2_Master(_MasterBase, _NIST_QC2_RTIO):
@@ -646,27 +687,6 @@ class NIST_QC2_Satellite(_SatelliteBase, _NIST_QC2_RTIO):
 VARIANTS = {cls.__name__.lower(): cls for cls in [NIST_CLOCK, NIST_CLOCK_Master, NIST_CLOCK_Satellite,
                                                   NIST_QC2, NIST_QC2_Master, NIST_QC2_Satellite]}
 
-
-def write_csr_file(soc, filename):
-    with open(filename, "w") as f:
-        f.write(cpu_interface.get_csr_rust(
-            soc.get_csr_regions(), soc.get_csr_groups(), soc.get_constants()))
-
-def write_mem_file(soc, filename):
-    with open(filename, "w") as f:
-        f.write(cpu_interface.get_mem_rust(
-            soc.get_memory_regions(), soc.get_memory_groups(), None))
-
-
-def write_rustc_cfg_file(soc, filename):
-    with open(filename, "w") as f:
-        for k, v in sorted(soc.rustc_cfg.items(), key=itemgetter(0)):
-            if v is None:
-                f.write("{}\n".format(k))
-            else:
-                f.write("{}=\"{}\"\n".format(k, v))
-
-
 def main():
     parser = argparse.ArgumentParser(
         description="ARTIQ port to the ZC706 Zynq development kit")

src/gateware/zynq_clocking.py

@@ -0,0 +1,154 @@
+from migen import *
+from migen.genlib.cdc import MultiReg
+from migen.genlib.resetsync import AsyncResetSynchronizer
+from misoc.interconnect.csr import *
+
+
+class ClockSwitchFSM(Module):
+    def __init__(self):
+        self.i_clk_sw = Signal()
+
+        self.o_clk_sw = Signal()
+        self.o_reset = Signal()
+
+        ###
+
+        i_switch = Signal()
+        o_switch = Signal()
+        reset = Signal()
+
+        # at 125MHz bootstrap cd, will get around 0.5ms
+        delay_counter = Signal(16, reset=0xFFFF)
+
+        # register to prevent glitches
+        self.sync.bootstrap += [
+            self.o_clk_sw.eq(o_switch),
+            self.o_reset.eq(reset),
+        ]
+
+        self.o_clk_sw.attr.add("no_retiming")
+        self.o_reset.attr.add("no_retiming")
+        self.i_clk_sw.attr.add("no_retiming")
+        i_switch.attr.add("no_retiming")
+
+        self.specials += MultiReg(self.i_clk_sw, i_switch, "bootstrap")
+
+        fsm = ClockDomainsRenamer("bootstrap")(FSM(reset_state="START"))
+
+        self.submodules += fsm
+
+        fsm.act("START",
+            If(i_switch & ~o_switch,
+                NextState("RESET_START"))
+        )
+        
+        fsm.act("RESET_START",
+            reset.eq(1),
+            If(delay_counter == 0,
+                NextValue(delay_counter, 0xFFFF),
+                NextState("CLOCK_SWITCH")
+            ).Else(
+                NextValue(delay_counter, delay_counter-1),
+            )
+        )
+
+        fsm.act("CLOCK_SWITCH",
+            reset.eq(1),
+            NextValue(o_switch, 1),
+            NextValue(delay_counter, delay_counter-1),
+            If(delay_counter == 0,
+                NextState("END"))
+        )
+        fsm.act("END",
+            NextValue(o_switch, 1),
+            reset.eq(0))
+
+
+class SYSCRG(Module, AutoCSR):
+    def __init__(self, platform, ps7, main_clk, clk_sw=None, clk_sw_status=None, freq=125e6, ext_async_rst=None, ):
+        # assumes bootstrap clock is same freq as main and sys output
+        self.clock_domains.cd_sys = ClockDomain()
+        self.clock_domains.cd_sys4x = ClockDomain(reset_less=True)
+        self.clock_domains.cd_sys5x = ClockDomain(reset_less=True)
+        self.clock_domains.cd_clk200 = ClockDomain()
+
+        self.current_clock = CSRStatus()
+
+        self.cd_sys.clk.attr.add("keep")
+
+        bootstrap_clk = ClockSignal("bootstrap")
+
+        period = 1e9/freq
+
+        self.submodules.clk_sw_fsm = ClockSwitchFSM()
+
+        if clk_sw is None:
+            self.clock_switch = CSRStorage()
+            self.comb += self.clk_sw_fsm.i_clk_sw.eq(self.clock_switch.storage)
+        else:
+            self.comb += self.clk_sw_fsm.i_clk_sw.eq(clk_sw)
+
+        self.mmcm_locked = Signal()
+        mmcm_sys = Signal()
+        mmcm_sys4x = Signal()
+        mmcm_sys5x = Signal()
+        mmcm_clk208 = Signal()
+        mmcm_fb_clk = Signal()
+        self.specials += [
+            Instance("MMCME2_ADV",
+                p_STARTUP_WAIT="FALSE", o_LOCKED=self.mmcm_locked,
+                p_BANDWIDTH="HIGH",
+                p_REF_JITTER1=0.001,
+                p_CLKIN1_PERIOD=period, i_CLKIN1=main_clk,
+                p_CLKIN2_PERIOD=period, i_CLKIN2=bootstrap_clk,
+                i_CLKINSEL=self.clk_sw_fsm.o_clk_sw,
+
+                # VCO @ 1.25GHz
+                p_CLKFBOUT_MULT_F=10, p_DIVCLK_DIVIDE=1,
+                i_CLKFBIN=mmcm_fb_clk,
+                i_RST=self.clk_sw_fsm.o_reset,
+
+                o_CLKFBOUT=mmcm_fb_clk,
+
+                p_CLKOUT0_DIVIDE_F=2.5, p_CLKOUT0_PHASE=0.0, o_CLKOUT0=mmcm_sys4x,
+
+                # 125MHz
+                p_CLKOUT1_DIVIDE=10, p_CLKOUT1_PHASE=0.0, o_CLKOUT1=mmcm_sys,
+
+                # 625MHz
+                p_CLKOUT2_DIVIDE=2, p_CLKOUT2_PHASE=0.0, o_CLKOUT2=mmcm_sys5x,
+
+                # 208MHz
+                p_CLKOUT3_DIVIDE=6, p_CLKOUT3_PHASE=0.0, o_CLKOUT3=mmcm_clk208,
+            ),
+            Instance("BUFG", i_I=mmcm_sys5x, o_O=self.cd_sys5x.clk),
+            Instance("BUFG", i_I=mmcm_sys, o_O=self.cd_sys.clk),
+            Instance("BUFG", i_I=mmcm_sys4x, o_O=self.cd_sys4x.clk),
+            Instance("BUFG", i_I=mmcm_clk208, o_O=self.cd_clk200.clk),
+        ]
+
+        if ext_async_rst is not None:
+            self.specials += [
+                AsyncResetSynchronizer(self.cd_sys, ~self.mmcm_locked | ext_async_rst),
+                AsyncResetSynchronizer(self.cd_clk200, ~self.mmcm_locked | ext_async_rst),
+            ]
+        else:
+            self.specials += [
+                AsyncResetSynchronizer(self.cd_sys, ~self.mmcm_locked),
+                AsyncResetSynchronizer(self.cd_clk200, ~self.mmcm_locked),
+            ]
+
+        reset_counter = Signal(4, reset=15)
+        ic_reset = Signal(reset=1)
+        self.sync.clk200 += \
+            If(reset_counter != 0,
+                reset_counter.eq(reset_counter - 1)
+            ).Else(
+                ic_reset.eq(0)
+            )
+        self.specials += Instance("IDELAYCTRL", i_REFCLK=ClockSignal("clk200"), i_RST=ic_reset)
+
+        if clk_sw_status is None:
+            self.comb += self.current_clock.status.eq(self.clk_sw_fsm.o_clk_sw)
+        else:
+            self.comb += self.current_clock.status.eq(clk_sw_status)

src/libboard_artiq/Cargo.toml.tpl

@@ -10,6 +10,8 @@ name = "libboard_artiq"
 [features]
 target_zc706 = ["libboard_zynq/target_zc706", "libconfig/target_zc706"]
 target_kasli_soc = ["libboard_zynq/target_kasli_soc", "libconfig/target_kasli_soc"]
+target_ebaz4205 = ["libboard_zynq/target_ebaz4205", "libconfig/target_ebaz4205"]
+calibrate_wrpll_skew = []
 
 [build-dependencies]
 build_zynq = { path = "../libbuild_zynq" }
@@ -24,8 +26,9 @@ nb = "1.0"
 void = { version = "1", default-features = false }
 
 io = { path = "../libio", features = ["byteorder"] }
-libboard_zynq = { git = "https://git.m-labs.hk/M-Labs/zynq-rs.git"}
+libboard_zynq = { path = "@@ZYNQ_RS@@/libboard_zynq" }
-libregister = { git = "https://git.m-labs.hk/M-Labs/zynq-rs.git" }
+libsupport_zynq = { path = "@@ZYNQ_RS@@/libsupport_zynq", default-features = false, features = ["alloc_core"] }
-libconfig = { git = "https://git.m-labs.hk/M-Labs/zynq-rs.git", features = ["fat_lfn"] }
+libregister = { path = "@@ZYNQ_RS@@/libregister" }
-libcortex_a9 = { git = "https://git.m-labs.hk/M-Labs/zynq-rs.git" }
+libconfig = { path = "@@ZYNQ_RS@@/libconfig", features = ["fat_lfn"] }
-libasync = { git = "https://git.m-labs.hk/M-Labs/zynq-rs.git" }
+libcortex_a9 = { path = "@@ZYNQ_RS@@/libcortex_a9" }
+libasync = { path = "@@ZYNQ_RS@@/libasync" }

src/libboard_artiq/src/drtio_eem.rs

@@ -0,0 +1,245 @@
+use embedded_hal::prelude::_embedded_hal_blocking_delay_DelayUs;
+use libboard_zynq::timer::GlobalTimer;
+use libconfig::Config;
+use libsupport_zynq::alloc::format;
+use log::{debug, error, info};
+
+use crate::pl;
+
+struct SerdesConfig {
+    pub delay: [u8; 4],
+}
+
+impl SerdesConfig {
+    pub fn as_bytes(&self) -> &[u8] {
+        unsafe {
+            core::slice::from_raw_parts(
+                (self as *const SerdesConfig) as *const u8,
+                core::mem::size_of::<SerdesConfig>(),
+            )
+        }
+    }
+}
+
+fn select_lane(lane_no: u8) {
+    unsafe {
+        pl::csr::eem_transceiver::lane_sel_write(lane_no);
+    }
+}
+
+fn apply_delay(tap: u8, timer: &mut GlobalTimer) {
+    unsafe {
+        pl::csr::eem_transceiver::dly_cnt_in_write(tap);
+        pl::csr::eem_transceiver::dly_ld_write(1);
+        timer.delay_us(1);
+        assert!(tap as u8 == pl::csr::eem_transceiver::dly_cnt_out_read());
+    }
+}
+
+fn apply_config(config: &SerdesConfig, timer: &mut GlobalTimer) {
+    for lane_no in 0..4 {
+        select_lane(lane_no as u8);
+        apply_delay(config.delay[lane_no], timer);
+    }
+}
+
+unsafe fn assign_delay(timer: &mut GlobalTimer) -> SerdesConfig {
+    // Select an appropriate delay for lane 0
+    select_lane(0);
+
+    //
+
+    let mut best_dly = None;
+
+    loop {
+        let mut prev = None;
+        for curr_dly in 0..32 {
+            //let read_align = read_align_fn(curr_dly, timer);
+            let curr_low_rate = read_align(curr_dly, timer);
+
+            if let Some(prev_low_rate) = prev {
+                // This is potentially a crossover position
+                if prev_low_rate <= curr_low_rate && curr_low_rate >= 0.5 {
+                    let prev_dev = 0.5 - prev_low_rate;
+                    let curr_dev = curr_low_rate - 0.5;
+                    let selected_idx = if prev_dev < curr_dev { curr_dly - 1 } else { curr_dly };
+
+                    // The setup setup/hold calibration timing (even with
+                    // tolerance) might be invalid in other lanes due to skew.
+                    // 5 taps is very conservative, generally it is 1 or 2
+                    if selected_idx < 5 {
+                        prev = None;
+                        continue;
+                    } else {
+                        best_dly = Some(selected_idx);
+                        break;
+                    }
+                }
+            }
+
+            // Only rising slope from <= 0.5 can result in a rising low rate
+            // crossover at 50%.
+            if curr_low_rate <= 0.5 {
+                prev = Some(curr_low_rate);
+            }
+        }
+
+        if best_dly.is_none() {
+            error!("setup/hold timing calibration failed, retry in 1s...");
+            timer.delay_us(1_000_000);
+        } else {
+            break;
+        }
+    }
+
+    let best_dly = best_dly.unwrap();
+
+    apply_delay(best_dly, timer);
+    let mut delay_list = [best_dly; 4];
+
+    // Assign delay for other lanes
+    for lane_no in 1..=3 {
+        select_lane(lane_no as u8);
+
+        let mut min_deviation = 0.5;
+        let mut min_idx = 0;
+        for dly_delta in -3..=3 {
+            let index = (best_dly as isize + dly_delta) as u8;
+            let low_rate = read_align(index, timer);
+            // abs() from f32 is not available in core library
+            let deviation = if low_rate < 0.5 { 0.5 - low_rate } else { low_rate - 0.5 };
+
+            if deviation < min_deviation {
+                min_deviation = deviation;
+                min_idx = index;
+            }
+        }
+
+        apply_delay(min_idx, timer);
+        delay_list[lane_no] = min_idx;
+    }
+
+    debug!("setup/hold timing calibration: {:?}", delay_list);
+
+    SerdesConfig { delay: delay_list }
+}
+
+fn read_align(dly: u8, timer: &mut GlobalTimer) -> f32 {
+    unsafe {
+        apply_delay(dly, timer);
+        pl::csr::eem_transceiver::counter_reset_write(1);
+
+        pl::csr::eem_transceiver::counter_enable_write(1);
+        timer.delay_us(2000);
+        pl::csr::eem_transceiver::counter_enable_write(0);
+
+        let (high, low) = (
+            pl::csr::eem_transceiver::counter_high_count_read(),
+            pl::csr::eem_transceiver::counter_low_count_read(),
+        );
+        if pl::csr::eem_transceiver::counter_overflow_read() == 1 {
+            panic!("Unexpected phase detector counter overflow");
+        }
+
+        low as f32 / (low + high) as f32
+    }
+}
+
+unsafe fn align_comma(timer: &mut GlobalTimer) {
+    loop {
+        for slip in 1..=10 {
+            // The soft transceiver has 2 8b10b decoders, which receives lane
+            // 0/1 and lane 2/3 respectively. The decoder are time-multiplexed
+            // to decode exactly 1 lane each sysclk cycle.
+            //
+            // The decoder decodes lane 0/2 data on odd sysclk cycles, buffer
+            // on even cycles, and vice versa for lane 1/3. Data/Clock latency
+            // could change timing. The extend bit flips the decoding timing,
+            // so lane 0/2 data are decoded on even cycles, and lane 1/3 data
+            // are decoded on odd cycles.
+            //
+            // This is needed because transmitting/receiving a 8b10b character
+            // takes 2 sysclk cycles. Adjusting bitslip only via ISERDES
+            // limits the range to 1 cycle. The wordslip bit extends the range
+            // to 2 sysclk cycles.
+            pl::csr::eem_transceiver::wordslip_write((slip > 5) as u8);
+
+            // Apply a double bitslip since the ISERDES is 2x oversampled.
+            // Bitslip is used for comma alignment purposes once setup/hold
+            // timing is met.
+            pl::csr::eem_transceiver::bitslip_write(1);
+            pl::csr::eem_transceiver::bitslip_write(1);
+            timer.delay_us(1);
+
+            pl::csr::eem_transceiver::comma_align_reset_write(1);
+            timer.delay_us(100);
+
+            if pl::csr::eem_transceiver::comma_read() == 1 {
+                debug!("comma alignment completed after {} bitslips", slip);
+                return;
+            }
+        }
+
+        error!("comma alignment failed, retrying in 1s...");
+        timer.delay_us(1_000_000);
+    }
+}
+
+pub unsafe fn align_wordslip(timer: &mut GlobalTimer, trx_no: u8) -> bool {
+    pl::csr::eem_transceiver::transceiver_sel_write(trx_no);
+
+    for slip in 0..=1 {
+        pl::csr::eem_transceiver::wordslip_write(slip as u8);
+        timer.delay_us(1);
+        pl::csr::eem_transceiver::comma_align_reset_write(1);
+        timer.delay_us(100);
+
+        if pl::csr::eem_transceiver::comma_read() == 1 {
+            debug!("comma alignment completed with {} wordslip", slip);
+            return true;
+        }
+    }
+
+    false
+}
+
+pub fn init(timer: &mut GlobalTimer, cfg: &Config) {
+    for trx_no in 0..pl::csr::CONFIG_EEM_DRTIO_COUNT {
+        unsafe {
+            pl::csr::eem_transceiver::transceiver_sel_write(trx_no as u8);
+        }
+
+        let key = format!("eem_drtio_delay{}", trx_no);
+
+        let cfg_read = cfg.read(&key);
+        match cfg_read {
+            Ok(record) => {
+                info!("loading calibrated timing values from sd card");
+                unsafe {
+                    apply_config(&*(record.as_ptr() as *const SerdesConfig), timer);
+                }
+            }
+            Err(_) => {
+                info!("calibrating...");
+                let config = unsafe { assign_delay(timer) };
+
+                match cfg.write(&key, config.as_bytes().to_vec()) {
+                    Ok(()) => {
+                        info!("storing calibration timing values into sd card");
+                    }
+                    Err(e) => {
+                        error!(
+                            "calibration successful but calibration timing values cannot be stored into sd card. \
+                             Error:{}",
+                            e
+                        );
+                    }
+                };
+            }
+        }
+
+        unsafe {
+            align_comma(timer);
+        }
+    }
+}

src/libboard_artiq/src/drtio_routing.rs

@@ -1,9 +1,10 @@
-use libconfig::Config;
-#[cfg(has_drtio_routing)]
-use crate::pl::csr;
 use core::fmt;
 
-use log::{warn, info};
+use libconfig::Config;
+use log::{info, warn};
+
+#[cfg(has_drtio_routing)]
+use crate::pl::csr;
 
 #[cfg(has_drtio_routing)]
 pub const DEST_COUNT: usize = 256;
@@ -18,7 +19,7 @@ impl RoutingTable {
     // default routing table is for star topology with no repeaters
     pub fn default_master(default_n_links: usize) -> RoutingTable {
         let mut ret = RoutingTable([[INVALID_HOP; MAX_HOPS]; DEST_COUNT]);
-        let n_entries = default_n_links + 1;  // include local RTIO
+        let n_entries = default_n_links + 1; // include local RTIO
         for i in 0..n_entries {
             ret.0[i][0] = i as u8;
         }
@@ -58,10 +59,10 @@ impl fmt::Display for RoutingTable {
 pub fn config_routing_table(default_n_links: usize, cfg: &Config) -> RoutingTable {
     let mut ret = RoutingTable::default_master(default_n_links);
     if let Ok(data) = cfg.read("routing_table") {
-        if data.len() == DEST_COUNT*MAX_HOPS {
+        if data.len() == DEST_COUNT * MAX_HOPS {
             for i in 0..DEST_COUNT {
                 for j in 0..MAX_HOPS {
-                    ret.0[i][j] = data[i*MAX_HOPS+j];
+                    ret.0[i][j] = data[i * MAX_HOPS + j];
                 }
             }
         } else {

src/libboard_artiq/src/drtioaux.rs

@@ -1,14 +1,13 @@
-use crc;
+use core::slice;
 
-use core_io::{ErrorKind as IoErrorKind, Error as IoError};
+use core_io::{Error as IoError, ErrorKind as IoErrorKind};
-use io::{proto::ProtoRead, proto::ProtoWrite, Cursor};
+use crc;
-use libboard_zynq::{timer::GlobalTimer, time::Milliseconds};
+use io::{proto::{ProtoRead, ProtoWrite},
-use libcortex_a9::asm::dmb;
+         Cursor};
-use crate::mem::mem::DRTIOAUX_MEM;
+use libboard_zynq::{time::Milliseconds, timer::GlobalTimer};
-use crate::pl::csr::DRTIOAUX;
-use crate::drtioaux_proto::Error as ProtocolError;
 
 pub use crate::drtioaux_proto::Packet;
+use crate::{drtioaux_proto::Error as ProtocolError, mem::mem::DRTIOAUX_MEM, pl::csr::DRTIOAUX};
 
 #[derive(Debug)]
 pub enum Error {
@@ -21,7 +20,7 @@ pub enum Error {
 
     RoutingError,
 
-    Protocol(ProtocolError)
+    Protocol(ProtocolError),
 }
 
 impl From<ProtocolError> for Error {
@@ -58,31 +57,14 @@ pub fn has_rx_error(linkno: u8) -> bool {
     }
 }
 
-pub fn copy_work_buffer(src: *mut u32, dst: *mut u32, len: isize) {
-    // AXI writes must be 4-byte aligned (drtio proto doesn't care for that),
-    // and AXI burst reads/writes are not implemented yet in gateware
-    // thus the need for a work buffer for transmitting and copying it over
-    unsafe {
-        for i in 0..(len/4) {
-            *dst.offset(i) = *src.offset(i);
-            //data memory barrier to prevent bursts
-            dmb();
-        }
-    }
-}
-
 fn receive<F, T>(linkno: u8, f: F) -> Result<Option<T>, Error>
-    where F: FnOnce(&[u8]) -> Result<T, Error>
+where F: FnOnce(&[u8]) -> Result<T, Error> {
-{
     let linkidx = linkno as usize;
     unsafe {
         if (DRTIOAUX[linkidx].aux_rx_present_read)() == 1 {
-            let ptr = (DRTIOAUX_MEM[linkidx].base + DRTIOAUX_MEM[linkidx].size / 2) as *mut u32;
+            let read_ptr = (DRTIOAUX[linkidx].aux_read_pointer_read)() as usize;
-            let len = (DRTIOAUX[linkidx].aux_rx_length_read)() as usize;
+            let ptr = (DRTIOAUX_MEM[linkidx].base + DRTIOAUX_MEM[linkidx].size / 2 + read_ptr * 0x400) as *mut u32;
-            // work buffer to accomodate axi burst reads
+            let result = f(slice::from_raw_parts(ptr as *mut u8, 0x400 as usize));
-            let mut buf: [u8; 1024] = [0; 1024];
-            copy_work_buffer(ptr, buf.as_mut_ptr() as *mut u32, len as isize);
-            let result = f(&buf[0..len]);
             (DRTIOAUX[linkidx].aux_rx_present_write)(1);
             Ok(Some(result?))
         } else {
@@ -93,31 +75,29 @@ fn receive<F, T>(linkno: u8, f: F) -> Result<Option<T>, Error>
 
 pub fn recv(linkno: u8) -> Result<Option<Packet>, Error> {
     if has_rx_error(linkno) {
-        return Err(Error::GatewareError)
+        return Err(Error::GatewareError);
     }
 
     receive(linkno, |buffer| {
         if buffer.len() < 8 {
-            return Err(IoError::new(IoErrorKind::UnexpectedEof, "Unexpected end").into())
+            return Err(IoError::new(IoErrorKind::UnexpectedEof, "Unexpected end").into());
         }
 
         let mut reader = Cursor::new(buffer);
 
-        let checksum_at = buffer.len() - 4;
+        let packet = Packet::read_from(&mut reader)?;
+        let padding = (12 - (reader.position() % 8)) % 8;
+        let checksum_at = reader.position() + padding;
         let checksum = crc::crc32::checksum_ieee(&reader.get_ref()[0..checksum_at]);
         reader.set_position(checksum_at);
         if reader.read_u32()? != checksum {
-            return Err(Error::CorruptedPacket)
+            return Err(Error::CorruptedPacket);
         }
-        reader.set_position(0);
+        Ok(packet)
-
-        Ok(Packet::read_from(&mut reader)?)
     })
 }
 
-pub fn recv_timeout(linkno: u8, timeout_ms: Option<u64>,
+pub fn recv_timeout(linkno: u8, timeout_ms: Option<u64>, timer: GlobalTimer) -> Result<Packet, Error> {
-    timer: GlobalTimer) -> Result<Packet, Error> 
-{
     let timeout_ms = Milliseconds(timeout_ms.unwrap_or(10));
     let limit = timer.get_time() + timeout_ms;
     while timer.get_time() < limit {
@@ -130,17 +110,12 @@ pub fn recv_timeout(linkno: u8, timeout_ms: Option<u64>,
 }
 
 fn transmit<F>(linkno: u8, f: F) -> Result<(), Error>
-    where F: FnOnce(&mut [u8]) -> Result<usize, Error>
+where F: FnOnce(&mut [u8]) -> Result<usize, Error> {
-{
     let linkno = linkno as usize;
     unsafe {
         while (DRTIOAUX[linkno].aux_tx_read)() != 0 {}
         let ptr = DRTIOAUX_MEM[linkno].base as *mut u32;
-        let len = DRTIOAUX_MEM[linkno].size / 2;
+        let len = f(slice::from_raw_parts_mut(ptr as *mut u8, 0x400 as usize))?;
-        // work buffer, works with unaligned mem access
-        let mut buf: [u8; 1024] = [0; 1024]; 
-        let len = f(&mut buf[0..len])?;
-        copy_work_buffer(buf.as_mut_ptr() as *mut u32, ptr, len as isize);
         (DRTIOAUX[linkno].aux_tx_length_write)(len as u16);
         (DRTIOAUX[linkno].aux_tx_write)(1);
         Ok(())
@@ -152,7 +127,7 @@ pub fn send(linkno: u8, packet: &Packet) -> Result<(), Error> {
         let mut writer = Cursor::new(buffer);
 
         packet.write_to(&mut writer)?;
-        
+
         // Pad till offset 4, insert checksum there
         let padding = (12 - (writer.position() % 8)) % 8;
         for _ in 0..padding {

src/libboard_artiq/src/drtioaux_async.rs

@@ -1,18 +1,18 @@
+use core::slice;
+
+use core_io::{Error as IoError, ErrorKind as IoErrorKind};
 use crc;
-
+use io::{proto::{ProtoRead, ProtoWrite},
-use core_io::{ErrorKind as IoErrorKind, Error as IoError};
+         Cursor};
-use void::Void;
+use libasync::{block_async, task};
+use libboard_zynq::{time::Milliseconds, timer::GlobalTimer};
 use nb;
-
+use void::Void;
-use libboard_zynq::{timer::GlobalTimer, time::Milliseconds};
-use libasync::{task, block_async};
-
-use io::{proto::ProtoRead, proto::ProtoWrite, Cursor};
-use crate::mem::mem::DRTIOAUX_MEM;
-use crate::pl::csr::DRTIOAUX;
-use crate::drtioaux::{Error, has_rx_error, copy_work_buffer};
 
 pub use crate::drtioaux_proto::Packet;
+use crate::{drtioaux::{has_rx_error, Error},
+            mem::mem::DRTIOAUX_MEM,
+            pl::csr::DRTIOAUX};
 
 pub async fn reset(linkno: u8) {
     let linkno = linkno as usize;
@@ -29,25 +29,20 @@ fn tx_ready(linkno: usize) -> nb::Result<(), Void> {
     unsafe {
         if (DRTIOAUX[linkno].aux_tx_read)() != 0 {
             Err(nb::Error::WouldBlock)
-        }
+        } else {
-        else {
             Ok(())
         }
     }
 }
 
 async fn receive<F, T>(linkno: u8, f: F) -> Result<Option<T>, Error>
-    where F: FnOnce(&[u8]) -> Result<T, Error>
+where F: FnOnce(&[u8]) -> Result<T, Error> {
-{
     let linkidx = linkno as usize;
     unsafe {
         if (DRTIOAUX[linkidx].aux_rx_present_read)() == 1 {
-            let ptr = (DRTIOAUX_MEM[linkidx].base + DRTIOAUX_MEM[linkidx].size / 2) as *mut u32;
+            let read_ptr = (DRTIOAUX[linkidx].aux_read_pointer_read)() as usize;
-            let len = (DRTIOAUX[linkidx].aux_rx_length_read)() as usize;
+            let ptr = (DRTIOAUX_MEM[linkidx].base + DRTIOAUX_MEM[linkidx].size / 2 + read_ptr * 0x400) as *mut u32;
-            // work buffer to accomodate axi burst reads
+            let result = f(slice::from_raw_parts(ptr as *mut u8, 0x400 as usize));
-            let mut buf: [u8; 1024] = [0; 1024];
-            copy_work_buffer(ptr, buf.as_mut_ptr() as *mut u32, len as isize);
-            let result = f(&buf[0..len]);
             (DRTIOAUX[linkidx].aux_rx_present_write)(1);
             Ok(Some(result?))
         } else {
@@ -58,31 +53,30 @@ async fn receive<F, T>(linkno: u8, f: F) -> Result<Option<T>, Error>
 
 pub async fn recv(linkno: u8) -> Result<Option<Packet>, Error> {
     if has_rx_error(linkno) {
-        return Err(Error::GatewareError)
+        return Err(Error::GatewareError);
     }
 
     receive(linkno, |buffer| {
         if buffer.len() < 8 {
-            return Err(IoError::new(IoErrorKind::UnexpectedEof, "Unexpected end").into())
+            return Err(IoError::new(IoErrorKind::UnexpectedEof, "Unexpected end").into());
         }
 
         let mut reader = Cursor::new(buffer);
 
-        let checksum_at = buffer.len() - 4;
+        let packet = Packet::read_from(&mut reader)?;
+        let padding = (12 - (reader.position() % 8)) % 8;
+        let checksum_at = reader.position() + padding;
         let checksum = crc::crc32::checksum_ieee(&reader.get_ref()[0..checksum_at]);
         reader.set_position(checksum_at);
         if reader.read_u32()? != checksum {
-            return Err(Error::CorruptedPacket)
+            return Err(Error::CorruptedPacket);
         }
-        reader.set_position(0);
+        Ok(packet)
-
+    })
-        Ok(Packet::read_from(&mut reader)?)
+    .await
-    }).await
 }
 
-pub async fn recv_timeout(linkno: u8, timeout_ms: Option<u64>,
+pub async fn recv_timeout(linkno: u8, timeout_ms: Option<u64>, timer: GlobalTimer) -> Result<Packet, Error> {
-    timer: GlobalTimer) -> Result<Packet, Error> 
-{
     let timeout_ms = Milliseconds(timeout_ms.unwrap_or(10));
     let limit = timer.get_time() + timeout_ms;
     let mut would_block = false;
@@ -93,7 +87,9 @@ pub async fn recv_timeout(linkno: u8, timeout_ms: Option<u64>,
             task::r#yield().await;
         }
         match recv(linkno).await? {
-            None => { would_block = true; },
+            None => {
+                would_block = true;
+            }
             Some(packet) => return Ok(packet),
         }
     }
@@ -101,17 +97,12 @@ pub async fn recv_timeout(linkno: u8, timeout_ms: Option<u64>,
 }
 
 async fn transmit<F>(linkno: u8, f: F) -> Result<(), Error>
-    where F: FnOnce(&mut [u8]) -> Result<usize, Error>
+where F: FnOnce(&mut [u8]) -> Result<usize, Error> {
-{
     let linkno = linkno as usize;
     unsafe {
         let _ = block_async!(tx_ready(linkno)).await;
         let ptr = DRTIOAUX_MEM[linkno].base as *mut u32;
-        let len = DRTIOAUX_MEM[linkno].size / 2;
+        let len = f(slice::from_raw_parts_mut(ptr as *mut u8, 0x400 as usize))?;
-        // work buffer, works with unaligned mem access
-        let mut buf: [u8; 1024] = [0; 1024]; 
-        let len = f(&mut buf[0..len])?;
-        copy_work_buffer(buf.as_mut_ptr() as *mut u32, ptr, len as isize);
         (DRTIOAUX[linkno].aux_tx_length_write)(len as u16);
         (DRTIOAUX[linkno].aux_tx_write)(1);
         Ok(())
@@ -123,7 +114,7 @@ pub async fn send(linkno: u8, packet: &Packet) -> Result<(), Error> {
         let mut writer = Cursor::new(buffer);
 
         packet.write_to(&mut writer)?;
-        
+
         // Pad till offset 4, insert checksum there
         let padding = (12 - (writer.position() % 8)) % 8;
         for _ in 0..padding {
@@ -134,5 +125,6 @@ pub async fn send(linkno: u8, packet: &Packet) -> Result<(), Error> {
         writer.write_u32(checksum)?;
 
         Ok(writer.position())
-    }).await
+    })
+    .await
 }

src/libboard_artiq/src/fiq.rs

@@ -0,0 +1,22 @@
+use libboard_zynq::{println, stdio};
+use libcortex_a9::{interrupt_handler, regs::MPIDR};
+use libregister::RegisterR;
+
+#[cfg(has_si549)]
+use crate::si549;
+
+interrupt_handler!(FIQ, fiq, __irq_stack0_start, __irq_stack1_start, {
+    match MPIDR.read().cpu_id() {
+        0 => {
+            // nFIQ is driven directly and bypass GIC
+            #[cfg(has_si549)]
+            si549::wrpll::interrupt_handler();
+            return;
+        }
+        _ => {}
+    };
+
+    stdio::drop_uart();
+    println!("FIQ");
+    loop {}
+});

src/libboard_artiq/src/grabber.rs

@@ -0,0 +1,163 @@
+use log::info;
+
+use crate::pl::csr;
+
+#[derive(PartialEq, Clone, Copy)]
+enum State {
+    Reset,
+    ExitReset,
+    Lock,
+    Align,
+    Watch,
+}
+
+#[derive(Clone, Copy)]
+struct Info {
+    state: State,
+    frame_size: (u16, u16),
+}
+
+static mut INFO: [Info; csr::GRABBER_LEN] = [Info {
+    state: State::Reset,
+    frame_size: (0, 0),
+}; csr::GRABBER_LEN];
+
+fn get_pll_reset(g: usize) -> bool {
+    unsafe { (csr::GRABBER[g].pll_reset_read)() != 0 }
+}
+
+fn set_pll_reset(g: usize, reset: bool) {
+    let val = if reset { 1 } else { 0 };
+    unsafe { (csr::GRABBER[g].pll_reset_write)(val) }
+}
+
+fn pll_locked(g: usize) -> bool {
+    unsafe { (csr::GRABBER[g].pll_locked_read)() != 0 }
+}
+
+fn clock_pattern_ok(g: usize) -> bool {
+    unsafe { (csr::GRABBER[g].clk_sampled_read)() == 0b1100011 }
+}
+
+fn clock_pattern_ok_filter(g: usize) -> bool {
+    for _ in 0..128 {
+        if !clock_pattern_ok(g) {
+            return false;
+        }
+    }
+    true
+}
+
+fn phase_shift(g: usize, direction: u8) {
+    unsafe {
+        (csr::GRABBER[g].phase_shift_write)(direction);
+        while (csr::GRABBER[g].phase_shift_done_read)() == 0 {}
+    }
+}
+
+fn clock_align(g: usize) -> bool {
+    while clock_pattern_ok_filter(g) {
+        phase_shift(g, 1);
+    }
+    phase_shift(g, 1);
+
+    let mut count = 0;
+    while !clock_pattern_ok_filter(g) {
+        phase_shift(g, 1);
+        count += 1;
+        if count > 1024 {
+            return false;
+        }
+    }
+
+    let mut window = 1;
+    phase_shift(g, 1);
+    while clock_pattern_ok_filter(g) {
+        phase_shift(g, 1);
+        window += 1;
+    }
+
+    for _ in 0..window / 2 {
+        phase_shift(g, 0);
+    }
+
+    true
+}
+
+fn get_last_pixels(g: usize) -> (u16, u16) {
+    unsafe { ((csr::GRABBER[g].last_x_read)(), (csr::GRABBER[g].last_y_read)()) }
+}
+
+fn get_video_clock(g: usize) -> u32 {
+    let freq_count = unsafe { (csr::GRABBER[g].freq_count_read)() } as u32;
+    2 * freq_count * (csr::CONFIG_CLOCK_FREQUENCY / 1000) / (511 * 1000)
+}
+
+pub fn tick() {
+    for g in 0..csr::GRABBER.len() {
+        let next = match unsafe { INFO[g].state } {
+            State::Reset => {
+                set_pll_reset(g, true);
+                unsafe {
+                    INFO[g].frame_size = (0, 0);
+                }
+                State::ExitReset
+            }
+            State::ExitReset => {
+                if get_pll_reset(g) {
+                    set_pll_reset(g, false);
+                    State::Lock
+                } else {
+                    State::ExitReset
+                }
+            }
+            State::Lock => {
+                if pll_locked(g) {
+                    info!("grabber{} locked: {}MHz", g, get_video_clock(g));
+                    State::Align
+                } else {
+                    State::Lock
+                }
+            }
+            State::Align => {
+                if pll_locked(g) {
+                    if clock_align(g) {
+                        info!("grabber{} alignment success", g);
+                        State::Watch
+                    } else {
+                        info!("grabber{} alignment failure", g);
+                        State::Reset
+                    }
+                } else {
+                    info!("grabber{} lock lost", g);
+                    State::Reset
+                }
+            }
+            State::Watch => {
+                if pll_locked(g) {
+                    if clock_pattern_ok(g) {
+                        let last_xy = get_last_pixels(g);
+                        if last_xy != unsafe { INFO[g].frame_size } {
+                            // x capture is on ~LVAL which is after
+                            // the last increment on DVAL
+                            // y capture is on ~FVAL which coincides with the
+                            // last increment on ~LVAL
+                            info!("grabber{} frame size: {}x{}", g, last_xy.0, last_xy.1 + 1);
+                            unsafe { INFO[g].frame_size = last_xy }
+                        }
+                        State::Watch
+                    } else {
+                        info!("grabber{} alignment lost", g);
+                        State::Reset
+                    }
+                } else {
+                    info!("grabber{} lock lost", g);
+                    State::Reset
+                }
+            }
+        };
+        unsafe {
+            INFO[g].state = next;
+        }
+    }
+}

src/libboard_artiq/src/io_expander.rs

@@ -0,0 +1,183 @@
+use libboard_zynq::i2c;
+use log::info;
+
+#[cfg(has_virtual_leds)]
+use crate::pl::csr;
+
+// Only the bare minimum registers. Bits/IO connections equivalent between IC types.
+struct Registers {
+    // PCA9539 equivalent register names in comments
+    iodira: u8, // Configuration Port 0
+    iodirb: u8, // Configuration Port 1
+    gpioa: u8,  // Output Port 0
+    gpiob: u8,  // Output Port 1
+}
+
+//IO expanders pins
+const IODIR_OUT_SFP_TX_DISABLE: u8 = 0x02;
+const IODIR_OUT_SFP_LED: u8 = 0x40;
+#[cfg(hw_rev = "v1.0")]
+const IODIR_OUT_SFP0_LED: u8 = 0x40;
+#[cfg(hw_rev = "v1.1")]
+const IODIR_OUT_SFP0_LED: u8 = 0x80;
+#[cfg(has_si549)]
+const IODIR_CLK_SEL: u8 = 0x80; // out
+#[cfg(has_si5324)]
+const IODIR_CLK_SEL: u8 = 0x00; // in
+
+//IO expander port direction
+const IODIR0: [u8; 2] = [
+    0xFF & !IODIR_OUT_SFP_TX_DISABLE & !IODIR_OUT_SFP0_LED,
+    0xFF & !IODIR_OUT_SFP_TX_DISABLE & !IODIR_OUT_SFP_LED & !IODIR_CLK_SEL,
+];
+
+const IODIR1: [u8; 2] = [
+    0xFF & !IODIR_OUT_SFP_TX_DISABLE & !IODIR_OUT_SFP_LED,
+    0xFF & !IODIR_OUT_SFP_TX_DISABLE & !IODIR_OUT_SFP_LED,
+];
+
+pub struct IoExpander {
+    address: u8,
+    #[cfg(has_virtual_leds)]
+    virtual_led_mapping: &'static [(u8, u8, u8)],
+    iodir: [u8; 2],
+    out_current: [u8; 2],
+    out_target: [u8; 2],
+    registers: Registers,
+}
+
+impl IoExpander {
+    pub fn new(i2c: &mut i2c::I2c, index: u8) -> Result<Self, &'static str> {
+        #[cfg(all(hw_rev = "v1.0", has_virtual_leds))]
+        const VIRTUAL_LED_MAPPING0: [(u8, u8, u8); 2] = [(0, 0, 6), (1, 1, 6)];
+        #[cfg(all(hw_rev = "v1.1", has_virtual_leds))]
+        const VIRTUAL_LED_MAPPING0: [(u8, u8, u8); 2] = [(0, 0, 7), (1, 1, 6)];
+        #[cfg(has_virtual_leds)]
+        const VIRTUAL_LED_MAPPING1: [(u8, u8, u8); 2] = [(2, 0, 6), (3, 1, 6)];
+
+        // Both expanders on SHARED I2C bus
+        let mut io_expander = match index {
+            0 => IoExpander {
+                address: 0x40,
+                #[cfg(has_virtual_leds)]
+                virtual_led_mapping: &VIRTUAL_LED_MAPPING0,
+                iodir: IODIR0,
+                out_current: [0; 2],
+                out_target: [0; 2],
+                registers: Registers {
+                    iodira: 0x00,
+                    iodirb: 0x01,
+                    gpioa: 0x12,
+                    gpiob: 0x13,
+                },
+            },
+            1 => IoExpander {
+                address: 0x42,
+                #[cfg(has_virtual_leds)]
+                virtual_led_mapping: &VIRTUAL_LED_MAPPING1,
+                iodir: IODIR1,
+                out_current: [0; 2],
+                out_target: [0; 2],
+                registers: Registers {
+                    iodira: 0x00,
+                    iodirb: 0x01,
+                    gpioa: 0x12,
+                    gpiob: 0x13,
+                },
+            },
+            _ => return Err("incorrect I/O expander index"),
+        };
+        if !io_expander.check_ack(i2c)? {
+            info!("MCP23017 io expander {} not found. Checking for PCA9539.", index);
+            io_expander.address += 0xa8; // translate to PCA9539 addresses (see schematic)
+            io_expander.registers = Registers {
+                iodira: 0x06,
+                iodirb: 0x07,
+                gpioa: 0x02,
+                gpiob: 0x03,
+            };
+            if !io_expander.check_ack(i2c)? {
+                return Err("Neither MCP23017 nor PCA9539 io expander found.");
+            };
+        }
+        Ok(io_expander)
+    }
+
+    fn select(&self, i2c: &mut i2c::I2c) -> Result<(), &'static str> {
+        i2c.pca954x_select(0x70, None)?;
+        i2c.pca954x_select(0x71, Some(3))?;
+        Ok(())
+    }
+
+    fn write(&self, i2c: &mut i2c::I2c, addr: u8, value: u8) -> Result<(), &'static str> {
+        i2c.start()?;
+        i2c.write(self.address)?;
+        i2c.write(addr)?;
+        i2c.write(value)?;
+        i2c.stop()?;
+        Ok(())
+    }
+
+    fn check_ack(&self, i2c: &mut i2c::I2c) -> Result<bool, &'static str> {
+        // Check for ack from io expander
+        self.select(i2c)?;
+        i2c.start()?;
+        let ack = i2c.write(self.address)?;
+        i2c.stop()?;
+        Ok(ack)
+    }
+
+    fn update_iodir(&self, i2c: &mut i2c::I2c) -> Result<(), &'static str> {
+        self.write(i2c, self.registers.iodira, self.iodir[0])?;
+        self.write(i2c, self.registers.iodirb, self.iodir[1])?;
+        Ok(())
+    }
+
+    pub fn init(&mut self, i2c: &mut i2c::I2c) -> Result<(), &'static str> {
+        self.select(i2c)?;
+
+        self.update_iodir(i2c)?;
+
+        self.out_current[0] = 0x00;
+        self.write(i2c, self.registers.gpioa, 0x00)?;
+        self.out_current[1] = 0x00;
+        self.write(i2c, self.registers.gpiob, 0x00)?;
+        Ok(())
+    }
+
+    pub fn set_oe(&mut self, i2c: &mut i2c::I2c, port: u8, outputs: u8) -> Result<(), &'static str> {
+        self.iodir[port as usize] &= !outputs;
+        self.update_iodir(i2c)?;
+        Ok(())
+    }
+
+    pub fn set(&mut self, port: u8, bit: u8, high: bool) {
+        if high {
+            self.out_target[port as usize] |= 1 << bit;
+        } else {
+            self.out_target[port as usize] &= !(1 << bit);
+        }
+    }
+
+    pub fn service(&mut self, i2c: &mut i2c::I2c) -> Result<(), &'static str> {
+        #[cfg(has_virtual_leds)]
+        for (led, port, bit) in self.virtual_led_mapping.iter() {
+            let level = unsafe { csr::virtual_leds::status_read() >> led & 1 };
+            self.set(*port, *bit, level != 0);
+        }
+
+        if self.out_target != self.out_current {
+            self.select(i2c)?;
+            if self.out_target[0] != self.out_current[0] {
+                self.write(i2c, self.registers.gpioa, self.out_target[0])?;
+                self.out_current[0] = self.out_target[0];
+            }
+            if self.out_target[1] != self.out_current[1] {
+                self.write(i2c, self.registers.gpiob, self.out_target[1])?;
+                self.out_current[1] = self.out_target[1];
+            }
+        }
+
+        Ok(())
+    }
+}

src/libboard_artiq/src/lib.rs

@@ -1,36 +1,46 @@
 #![no_std]
 #![feature(never_type)]
+#![feature(naked_functions)]
+#![feature(asm)]
 
-extern crate log;
+extern crate core_io;
 extern crate crc;
 extern crate embedded_hal;
-extern crate core_io;
 extern crate io;
+extern crate libasync;
 extern crate libboard_zynq;
-extern crate libregister;
 extern crate libconfig;
 extern crate libcortex_a9;
-extern crate libasync;
+extern crate libregister;
+extern crate log;
 extern crate log_buffer;
 
-#[path = "../../../build/pl.rs"]
-pub mod pl;
-pub mod drtioaux_proto;
 pub mod drtio_routing;
-pub mod logger;
-#[cfg(has_si5324)]
-pub mod si5324;
 #[cfg(has_drtio)]
 pub mod drtioaux;
 #[cfg(has_drtio)]
 pub mod drtioaux_async;
+pub mod drtioaux_proto;
+pub mod fiq;
+#[cfg(feature = "target_kasli_soc")]
+pub mod io_expander;
+pub mod logger;
 #[cfg(has_drtio)]
+#[rustfmt::skip]
 #[path = "../../../build/mem.rs"]
 pub mod mem;
-
+#[rustfmt::skip]
+#[path = "../../../build/pl.rs"]
+pub mod pl;
+#[cfg(has_drtio_eem)]
+pub mod drtio_eem;
+#[cfg(has_grabber)]
+pub mod grabber;
+#[cfg(has_si5324)]
+pub mod si5324;
+#[cfg(has_si549)]
+pub mod si549;
 use core::{cmp, str};
-use libboard_zynq::slcr;
-use libregister::RegisterW;
 
 pub fn identifier_read(buf: &mut [u8]) -> &str {
     unsafe {
@@ -44,26 +54,3 @@ pub fn identifier_read(buf: &mut [u8]) -> &str {
         str::from_utf8_unchecked(&buf[..len as usize])
     }
 }
-
-pub fn init_gateware() {
-    // Set up PS->PL clocks
-    slcr::RegisterBlock::unlocked(|slcr| {
-        // As we are touching the mux, the clock may glitch, so reset the PL.
-        slcr.fpga_rst_ctrl.write(
-            slcr::FpgaRstCtrl::zeroed()
-                .fpga0_out_rst(true)
-                .fpga1_out_rst(true)
-                .fpga2_out_rst(true)
-                .fpga3_out_rst(true)
-        );
-        slcr.fpga0_clk_ctrl.write(
-            slcr::Fpga0ClkCtrl::zeroed()
-                .src_sel(slcr::PllSource::IoPll)
-                .divisor0(8)
-                .divisor1(1)
-        );
-        slcr.fpga_rst_ctrl.write(
-            slcr::FpgaRstCtrl::zeroed()
-        );
-    });
-}

src/libboard_artiq/src/logger.rs

@@ -1,13 +1,13 @@
-use core::cell::Cell;
+use core::{cell::Cell, fmt::Write};
-use core::fmt::Write;
+
-use log::{Log, LevelFilter};
-use log_buffer::LogBuffer;
-use libcortex_a9::mutex::{Mutex, MutexGuard};
 use libboard_zynq::{println, timer::GlobalTimer};
+use libcortex_a9::mutex::{Mutex, MutexGuard};
+use log::{LevelFilter, Log};
+use log_buffer::LogBuffer;
 
 pub struct LogBufferRef<'a> {
-    buffer:        MutexGuard<'a, LogBuffer<&'static mut [u8]>>,
+    buffer: MutexGuard<'a, LogBuffer<&'static mut [u8]>>,
-    old_log_level: LevelFilter
+    old_log_level: LevelFilter,
 }
 
 impl<'a> LogBufferRef<'a> {
@@ -37,7 +37,7 @@ impl<'a> Drop for LogBufferRef<'a> {
 }
 
 pub struct BufferLogger {
-    buffer:      Mutex<LogBuffer<&'static mut [u8]>>,
+    buffer: Mutex<LogBuffer<&'static mut [u8]>>,
     uart_filter: Cell<LevelFilter>,
     buffer_filter: Cell<LevelFilter>,
 }
@@ -56,8 +56,7 @@ impl BufferLogger {
     pub fn register(self) {
         unsafe {
             LOGGER = Some(self);
-            log::set_logger(LOGGER.as_ref().unwrap())
+            log::set_logger(LOGGER.as_ref().unwrap()).expect("global logger can only be initialized once");
-                .expect("global logger can only be initialized once");
         }
     }
 
@@ -66,9 +65,7 @@ impl BufferLogger {
     }
 
     pub fn buffer<'a>(&'a self) -> Option<LogBufferRef<'a>> {
-        self.buffer
+        self.buffer.try_lock().map(LogBufferRef::new)
-            .try_lock()
-            .map(LogBufferRef::new)
     }
 
     pub fn uart_log_level(&self) -> LevelFilter {
@@ -99,25 +96,36 @@ impl Log for BufferLogger {
 
     fn log(&self, record: &log::Record) {
         if self.enabled(record.metadata()) {
-            let timestamp = unsafe {
+            let timestamp = unsafe { GlobalTimer::get() }.get_us().0;
-                GlobalTimer::get()
+            let seconds = timestamp / 1_000_000;
-            }.get_us().0;
+            let micros = timestamp % 1_000_000;
-            let seconds   = timestamp / 1_000_000;
-            let micros    = timestamp % 1_000_000;
 
             if record.level() <= self.buffer_log_level() {
                 let mut buffer = self.buffer.lock();
-                writeln!(buffer, "[{:6}.{:06}s] {:>5}({}): {}", seconds, micros,
+                writeln!(
-                         record.level(), record.target(), record.args()).unwrap();
+                    buffer,
+                    "[{:6}.{:06}s] {:>5}({}): {}",
+                    seconds,
+                    micros,
+                    record.level(),
+                    record.target(),
+                    record.args()
+                )
+                .unwrap();
             }
 
             if record.level() <= self.uart_log_level() {
-                println!("[{:6}.{:06}s] {:>5}({}): {}", seconds, micros,
+                println!(
-                         record.level(), record.target(), record.args());
+                    "[{:6}.{:06}s] {:>5}({}): {}",
+                    seconds,
+                    micros,
+                    record.level(),
+                    record.target(),
+                    record.args()
+                );
             }
         }
     }
 
-    fn flush(&self) {
+    fn flush(&self) {}
-    }
 }

src/libboard_artiq/src/si5324.rs

@@ -1,7 +1,9 @@
 use core::result;
-use log::info;
+
-use libboard_zynq::{i2c::I2c, timer::GlobalTimer, time::Milliseconds};
 use embedded_hal::blocking::delay::DelayUs;
+use libboard_zynq::{i2c::I2c, time::Milliseconds, timer::GlobalTimer};
+use log::info;
+
 #[cfg(not(si5324_soft_reset))]
 use crate::pl::csr;
 
@@ -11,9 +13,13 @@ const ADDRESS: u8 = 0x68;
 
 #[cfg(not(si5324_soft_reset))]
 fn hard_reset(timer: &mut GlobalTimer) {
-    unsafe { csr::si5324_rst_n::out_write(0); }
+    unsafe {
+        csr::si5324_rst_n::out_write(0);
+    }
     timer.delay_us(1_000);
-    unsafe { csr::si5324_rst_n::out_write(1); }
+    unsafe {
+        csr::si5324_rst_n::out_write(1);
+    }
     timer.delay_us(10_000);
 }
 
@@ -29,7 +35,7 @@ pub struct FrequencySettings {
     pub n31: u32,
     pub n32: u32,
     pub bwsel: u8,
-    pub crystal_ref: bool
+    pub crystal_as_ckin2: bool,
 }
 
 pub enum Input {
@@ -39,52 +45,52 @@ pub enum Input {
 
 fn map_frequency_settings(settings: &FrequencySettings) -> Result<FrequencySettings> {
     if settings.nc1_ls != 0 && (settings.nc1_ls % 2) == 1 {
-        return Err("NC1_LS must be 0 or even")
+        return Err("NC1_LS must be 0 or even");
     }
     if settings.nc1_ls > (1 << 20) {
-        return Err("NC1_LS is too high")
+        return Err("NC1_LS is too high");
     }
     if (settings.n2_ls % 2) == 1 {
-        return Err("N2_LS must be even")
+        return Err("N2_LS must be even");
     }
     if settings.n2_ls > (1 << 20) {
-        return Err("N2_LS is too high")
+        return Err("N2_LS is too high");
     }
     if settings.n31 > (1 << 19) {
-        return Err("N31 is too high")
+        return Err("N31 is too high");
     }
     if settings.n32 > (1 << 19) {
-        return Err("N32 is too high")
+        return Err("N32 is too high");
     }
     let r = FrequencySettings {
         n1_hs: match settings.n1_hs {
-            4  => 0b000,
+            4 => 0b000,
-            5  => 0b001,
+            5 => 0b001,
-            6  => 0b010,
+            6 => 0b010,
-            7  => 0b011,
+            7 => 0b011,
-            8  => 0b100,
+            8 => 0b100,
-            9  => 0b101,
+            9 => 0b101,
             10 => 0b110,
             11 => 0b111,
-            _  => return Err("N1_HS has an invalid value")
+            _ => return Err("N1_HS has an invalid value"),
         },
         nc1_ls: settings.nc1_ls - 1,
         n2_hs: match settings.n2_hs {
-            4  => 0b000,
+            4 => 0b000,
-            5  => 0b001,
+            5 => 0b001,
-            6  => 0b010,
+            6 => 0b010,
-            7  => 0b011,
+            7 => 0b011,
-            8  => 0b100,
+            8 => 0b100,
-            9  => 0b101,
+            9 => 0b101,
             10 => 0b110,
             11 => 0b111,
-            _  => return Err("N2_HS has an invalid value")
+            _ => return Err("N2_HS has an invalid value"),
         },
         n2_ls: settings.n2_ls - 1,
         n31: settings.n31 - 1,
         n32: settings.n32 - 1,
         bwsel: settings.bwsel,
-        crystal_ref: settings.crystal_ref
+        crystal_as_ckin2: settings.crystal_as_ckin2,
     };
     Ok(r)
 }
@@ -92,13 +98,13 @@ fn map_frequency_settings(settings: &FrequencySettings) -> Result<FrequencySetti
 fn write(i2c: &mut I2c, reg: u8, val: u8) -> Result<()> {
     i2c.start().unwrap();
     if !i2c.write(ADDRESS << 1).unwrap() {
-        return Err("Si5324 failed to ack write address")
+        return Err("Si5324 failed to ack write address");
     }
     if !i2c.write(reg).unwrap() {
-        return Err("Si5324 failed to ack register")
+        return Err("Si5324 failed to ack register");
     }
     if !i2c.write(val).unwrap() {
-        return Err("Si5324 failed to ack value")
+        return Err("Si5324 failed to ack value");
     }
     i2c.stop().unwrap();
     Ok(())
@@ -108,10 +114,10 @@ fn write(i2c: &mut I2c, reg: u8, val: u8) -> Result<()> {
 fn write_no_ack_value(i2c: &mut I2c, reg: u8, val: u8) -> Result<()> {
     i2c.start().unwrap();
     if !i2c.write(ADDRESS << 1).unwrap() {
-        return Err("Si5324 failed to ack write address")
+        return Err("Si5324 failed to ack write address");
     }
     if !i2c.write(reg).unwrap() {
-        return Err("Si5324 failed to ack register")
+        return Err("Si5324 failed to ack register");
     }
     i2c.write(val).unwrap();
     i2c.stop().unwrap();
@@ -121,22 +127,22 @@ fn write_no_ack_value(i2c: &mut I2c, reg: u8, val: u8) -> Result<()> {
 fn read(i2c: &mut I2c, reg: u8) -> Result<u8> {
     i2c.start().unwrap();
     if !i2c.write(ADDRESS << 1).unwrap() {
-        return Err("Si5324 failed to ack write address")
+        return Err("Si5324 failed to ack write address");
     }
     if !i2c.write(reg).unwrap() {
-        return Err("Si5324 failed to ack register")
+        return Err("Si5324 failed to ack register");
     }
     i2c.restart().unwrap();
     if !i2c.write((ADDRESS << 1) | 1).unwrap() {
-        return Err("Si5324 failed to ack read address")
+        return Err("Si5324 failed to ack read address");
     }
     let val = i2c.read(false).unwrap();
     i2c.stop().unwrap();
     Ok(val)
 }
 
-fn rmw<F>(i2c: &mut I2c, reg: u8, f: F) -> Result<()> where
+fn rmw<F>(i2c: &mut I2c, reg: u8, f: F) -> Result<()>
-        F: Fn(u8) -> u8 {
+where F: Fn(u8) -> u8 {
     let value = read(i2c, reg)?;
     write(i2c, reg, f(value))?;
     Ok(())
@@ -155,18 +161,18 @@ fn soft_reset(i2c: &mut I2c, timer: &mut GlobalTimer) -> Result<()> {
 }
 
 fn has_xtal(i2c: &mut I2c) -> Result<bool> {
-    Ok((read(i2c, 129)? & 0x01) == 0)  // LOSX_INT=0
+    Ok((read(i2c, 129)? & 0x01) == 0) // LOSX_INT=0
 }
 
 fn has_ckin(i2c: &mut I2c, input: Input) -> Result<bool> {
     match input {
-        Input::Ckin1 => Ok((read(i2c, 129)? & 0x02) == 0),  // LOS1_INT=0
+        Input::Ckin1 => Ok((read(i2c, 129)? & 0x02) == 0), // LOS1_INT=0
-        Input::Ckin2 => Ok((read(i2c, 129)? & 0x04) == 0),  // LOS2_INT=0
+        Input::Ckin2 => Ok((read(i2c, 129)? & 0x04) == 0), // LOS2_INT=0
     }
 }
 
 fn locked(i2c: &mut I2c) -> Result<bool> {
-    Ok((read(i2c, 130)? & 0x01) == 0)  // LOL_INT=0
+    Ok((read(i2c, 130)? & 0x01) == 0) // LOL_INT=0
 }
 
 fn monitor_lock(i2c: &mut I2c, timer: &mut GlobalTimer) -> Result<()> {
@@ -211,11 +217,11 @@ pub fn bypass(i2c: &mut I2c, input: Input, timer: &mut GlobalTimer) -> Result<()
         Input::Ckin2 => 0b01,
     };
     init(i2c, timer)?;
-    rmw(i2c, 21,  |v| v & 0xfe)?;                        // CKSEL_PIN=0
+    rmw(i2c, 21, |v| v & 0xfe)?; // CKSEL_PIN=0
-    rmw(i2c, 3,   |v| (v & 0x3f) | (cksel_reg << 6))?;   // CKSEL_REG
+    rmw(i2c, 3, |v| (v & 0x3f) | (cksel_reg << 6))?; // CKSEL_REG
-    rmw(i2c, 4,   |v| (v & 0x3f) | (0b00 << 6))?;        // AUTOSEL_REG=b00
+    rmw(i2c, 4, |v| (v & 0x3f) | (0b00 << 6))?; // AUTOSEL_REG=b00
-    rmw(i2c, 6,   |v| (v & 0xc0) | 0b111111)?;           // SFOUT2_REG=b111 SFOUT1_REG=b111
+    rmw(i2c, 6, |v| (v & 0xc0) | 0b111111)?; // SFOUT2_REG=b111 SFOUT1_REG=b111
-    rmw(i2c, 0,   |v| (v & 0xfd) | 0x02)?;               // BYPASS_REG=1
+    rmw(i2c, 0, |v| (v & 0xfd) | 0x02)?; // BYPASS_REG=1
     Ok(())
 }
 
@@ -227,32 +233,32 @@ pub fn setup(i2c: &mut I2c, settings: &FrequencySettings, input: Input, timer: &
     };
 
     init(i2c, timer)?;
-    if settings.crystal_ref {
+    if settings.crystal_as_ckin2 {
-        rmw(i2c, 0,   |v| v | 0x40)?;                     // FREE_RUN=1
+        rmw(i2c, 0, |v| v | 0x40)?; // FREE_RUN=1
     }
-    rmw(i2c, 2,   |v| (v & 0x0f) | (s.bwsel << 4))?;
+    rmw(i2c, 2, |v| (v & 0x0f) | (s.bwsel << 4))?;
-    rmw(i2c, 21,  |v| v & 0xfe)?;                        // CKSEL_PIN=0
+    rmw(i2c, 21, |v| v & 0xfe)?; // CKSEL_PIN=0
-    rmw(i2c, 3,   |v| (v & 0x2f) | (cksel_reg << 6) | 0x10)?;  // CKSEL_REG, SQ_ICAL=1
+    rmw(i2c, 3, |v| (v & 0x2f) | (cksel_reg << 6) | 0x10)?; // CKSEL_REG, SQ_ICAL=1
-    rmw(i2c, 4,   |v| (v & 0x3f) | (0b00 << 6))?;        // AUTOSEL_REG=b00
+    rmw(i2c, 4, |v| (v & 0x3f) | (0b00 << 6))?; // AUTOSEL_REG=b00
-    rmw(i2c, 6,   |v| (v & 0xc0) | 0b111111)?;           // SFOUT2_REG=b111 SFOUT1_REG=b111
+    rmw(i2c, 6, |v| (v & 0xc0) | 0b111111)?; // SFOUT2_REG=b111 SFOUT1_REG=b111
-    write(i2c, 25,  (s.n1_hs  << 5 ) as u8)?;
+    write(i2c, 25, (s.n1_hs << 5) as u8)?;
-    write(i2c, 31,  (s.nc1_ls >> 16) as u8)?;
+    write(i2c, 31, (s.nc1_ls >> 16) as u8)?;
-    write(i2c, 32,  (s.nc1_ls >> 8 ) as u8)?;
+    write(i2c, 32, (s.nc1_ls >> 8) as u8)?;
-    write(i2c, 33,  (s.nc1_ls)       as u8)?;
+    write(i2c, 33, (s.nc1_ls) as u8)?;
-    write(i2c, 34,  (s.nc1_ls >> 16) as u8)?;            // write to NC2_LS as well
+    write(i2c, 34, (s.nc1_ls >> 16) as u8)?; // write to NC2_LS as well
-    write(i2c, 35,  (s.nc1_ls >> 8 ) as u8)?;
+    write(i2c, 35, (s.nc1_ls >> 8) as u8)?;
-    write(i2c, 36,  (s.nc1_ls)       as u8)?;
+    write(i2c, 36, (s.nc1_ls) as u8)?;
-    write(i2c, 40,  (s.n2_hs  << 5 ) as u8 | (s.n2_ls  >> 16) as u8)?;
+    write(i2c, 40, (s.n2_hs << 5) as u8 | (s.n2_ls >> 16) as u8)?;
-    write(i2c, 41,  (s.n2_ls  >> 8 ) as u8)?;
+    write(i2c, 41, (s.n2_ls >> 8) as u8)?;
-    write(i2c, 42,  (s.n2_ls)        as u8)?;
+    write(i2c, 42, (s.n2_ls) as u8)?;
-    write(i2c, 43,  (s.n31    >> 16) as u8)?;
+    write(i2c, 43, (s.n31 >> 16) as u8)?;
-    write(i2c, 44,  (s.n31    >> 8)  as u8)?;
+    write(i2c, 44, (s.n31 >> 8) as u8)?;
-    write(i2c, 45,  (s.n31)          as u8)?;
+    write(i2c, 45, (s.n31) as u8)?;
-    write(i2c, 46,  (s.n32    >> 16) as u8)?;
+    write(i2c, 46, (s.n32 >> 16) as u8)?;
-    write(i2c, 47,  (s.n32    >> 8)  as u8)?;
+    write(i2c, 47, (s.n32 >> 8) as u8)?;
-    write(i2c, 48,  (s.n32)          as u8)?;
+    write(i2c, 48, (s.n32) as u8)?;
-    rmw(i2c, 137, |v| v | 0x01)?;                       // FASTLOCK=1
+    rmw(i2c, 137, |v| v | 0x01)?; // FASTLOCK=1
-    rmw(i2c, 136, |v| v | 0x40)?;                       // ICAL=1
+    rmw(i2c, 136, |v| v | 0x40)?; // ICAL=1
 
     if !has_xtal(i2c)? {
         return Err("Si5324 misses XA/XB signal");
@@ -270,7 +276,7 @@ pub fn select_input(i2c: &mut I2c, input: Input, timer: &mut GlobalTimer) -> Res
         Input::Ckin1 => 0b00,
         Input::Ckin2 => 0b01,
     };
-    rmw(i2c, 3,   |v| (v & 0x3f) | (cksel_reg << 6))?;
+    rmw(i2c, 3, |v| (v & 0x3f) | (cksel_reg << 6))?;
     if !has_ckin(i2c, input)? {
         return Err("Si5324 misses clock input signal");
     }
@@ -285,12 +291,12 @@ pub mod siphaser {
 
     pub fn select_recovered_clock(i2c: &mut I2c, rc: bool, timer: &mut GlobalTimer) -> Result<()> {
         let val = read(i2c, 3)?;
-        write(i2c, 3,   (val & 0xdf) | (1 << 5))?;  // DHOLD=1
+        write(i2c, 3, (val & 0xdf) | (1 << 5))?; // DHOLD=1
         unsafe {
             csr::siphaser::switch_clocks_write(if rc { 1 } else { 0 });
         }
         let val = read(i2c, 3)?;
-        write(i2c, 3,   (val & 0xdf) | (0 << 5))?;  // DHOLD=0
+        write(i2c, 3, (val & 0xdf) | (0 << 5))?; // DHOLD=0
         monitor_lock(i2c, timer)?;
         Ok(())
     }
@@ -309,9 +315,7 @@ pub mod siphaser {
             csr::siphaser::error_write(1);
         }
         timer.delay_us(5_000);
-        unsafe {
+        unsafe { csr::siphaser::error_read() != 0 }
-            csr::siphaser::error_read() != 0
-        }
     }
 
     fn find_edge(target: bool, timer: &mut GlobalTimer) -> Result<u32> {
@@ -340,14 +344,19 @@ pub mod siphaser {
         }
         let width = find_edge(true, timer)? + jitter_margin;
         // width is 360 degrees (one full rotation of the phase between s/h limits) minus jitter
-        info!("calibration successful, lead: {}, width: {} ({}deg)", lead, width, width*360/(56*8));
+        info!(
+            "calibration successful, lead: {}, width: {} ({}deg)",
+            lead,
+            width,
+            width * 360 / (56 * 8)
+        );
 
         // Apply reverse phase shift for half the width to get into the
         // middle of the working region.
-        for _ in 0..width/2 {
+        for _ in 0..width / 2 {
             phase_shift(0, timer);
         }
 
         Ok(())
     }
-}
+}

src/libboard_artiq/src/si549.rs

@@ -0,0 +1,854 @@
+use embedded_hal::prelude::_embedded_hal_blocking_delay_DelayUs;
+use libboard_zynq::timer::GlobalTimer;
+use log::info;
+
+use crate::pl::csr;
+
+#[cfg(feature = "target_kasli_soc")]
+const ADDRESS: u8 = 0x67;
+
+const ADPLL_MAX: i32 = (950.0 / 0.0001164) as i32;
+
+pub struct DividerConfig {
+    pub hsdiv: u16,
+    pub lsdiv: u8,
+    pub fbdiv: u64,
+}
+
+pub struct FrequencySetting {
+    pub main: DividerConfig,
+    pub helper: DividerConfig,
+}
+
+mod i2c {
+    use super::*;
+
+    #[derive(Clone, Copy)]
+    pub enum DCXO {
+        Main,
+        Helper,
+    }
+
+    fn half_period(timer: &mut GlobalTimer) {
+        timer.delay_us(1)
+    }
+
+    fn sda_i(dcxo: DCXO) -> bool {
+        match dcxo {
+            DCXO::Main => unsafe { csr::wrpll::main_dcxo_sda_in_read() == 1 },
+            DCXO::Helper => unsafe { csr::wrpll::helper_dcxo_sda_in_read() == 1 },
+        }
+    }
+
+    fn sda_oe(dcxo: DCXO, oe: bool) {
+        let val = if oe { 1 } else { 0 };
+        match dcxo {
+            DCXO::Main => unsafe { csr::wrpll::main_dcxo_sda_oe_write(val) },
+            DCXO::Helper => unsafe { csr::wrpll::helper_dcxo_sda_oe_write(val) },
+        };
+    }
+
+    fn sda_o(dcxo: DCXO, o: bool) {
+        let val = if o { 1 } else { 0 };
+        match dcxo {
+            DCXO::Main => unsafe { csr::wrpll::main_dcxo_sda_out_write(val) },
+            DCXO::Helper => unsafe { csr::wrpll::helper_dcxo_sda_out_write(val) },
+        };
+    }
+
+    fn scl_oe(dcxo: DCXO, oe: bool) {
+        let val = if oe { 1 } else { 0 };
+        match dcxo {
+            DCXO::Main => unsafe { csr::wrpll::main_dcxo_scl_oe_write(val) },
+            DCXO::Helper => unsafe { csr::wrpll::helper_dcxo_scl_oe_write(val) },
+        };
+    }
+
+    fn scl_o(dcxo: DCXO, o: bool) {
+        let val = if o { 1 } else { 0 };
+        match dcxo {
+            DCXO::Main => unsafe { csr::wrpll::main_dcxo_scl_out_write(val) },
+            DCXO::Helper => unsafe { csr::wrpll::helper_dcxo_scl_out_write(val) },
+        };
+    }
+
+    pub fn init(dcxo: DCXO, timer: &mut GlobalTimer) -> Result<(), &'static str> {
+        // Set SCL as output, and high level
+        scl_o(dcxo, true);
+        scl_oe(dcxo, true);
+        // Prepare a zero level on SDA so that sda_oe pulls it down
+        sda_o(dcxo, false);
+        // Release SDA
+        sda_oe(dcxo, false);
+
+        // Check the I2C bus is ready
+        half_period(timer);
+        half_period(timer);
+        if !sda_i(dcxo) {
+            // Try toggling SCL a few times
+            for _bit in 0..8 {
+                scl_o(dcxo, false);
+                half_period(timer);
+                scl_o(dcxo, true);
+                half_period(timer);
+            }
+        }
+
+        if !sda_i(dcxo) {
+            return Err("SDA is stuck low and doesn't get unstuck");
+        }
+        Ok(())
+    }
+
+    pub fn start(dcxo: DCXO, timer: &mut GlobalTimer) {
+        // Set SCL high then SDA low
+        scl_o(dcxo, true);
+        half_period(timer);
+        sda_oe(dcxo, true);
+        half_period(timer);
+    }
+
+    pub fn stop(dcxo: DCXO, timer: &mut GlobalTimer) {
+        // First, make sure SCL is low, so that the target releases the SDA line
+        scl_o(dcxo, false);
+        half_period(timer);
+        // Set SCL high then SDA high
+        sda_oe(dcxo, true);
+        scl_o(dcxo, true);
+        half_period(timer);
+        sda_oe(dcxo, false);
+        half_period(timer);
+    }
+
+    pub fn write(dcxo: DCXO, data: u8, timer: &mut GlobalTimer) -> bool {
+        // MSB first
+        for bit in (0..8).rev() {
+            // Set SCL low and set our bit on SDA
+            scl_o(dcxo, false);
+            sda_oe(dcxo, data & (1 << bit) == 0);
+            half_period(timer);
+            // Set SCL high ; data is shifted on the rising edge of SCL
+            scl_o(dcxo, true);
+            half_period(timer);
+        }
+        // Check ack
+        // Set SCL low, then release SDA so that the I2C target can respond
+        scl_o(dcxo, false);
+        half_period(timer);
+        sda_oe(dcxo, false);
+        // Set SCL high and check for ack
+        scl_o(dcxo, true);
+        half_period(timer);
+        // returns true if acked (I2C target pulled SDA low)
+        !sda_i(dcxo)
+    }
+
+    pub fn read(dcxo: DCXO, ack: bool, timer: &mut GlobalTimer) -> u8 {
+        // Set SCL low first, otherwise setting SDA as input may cause a transition
+        // on SDA with SCL high which will be interpreted as START/STOP condition.
+        scl_o(dcxo, false);
+        half_period(timer); // make sure SCL has settled low
+        sda_oe(dcxo, false);
+
+        let mut data: u8 = 0;
+
+        // MSB first
+        for bit in (0..8).rev() {
+            scl_o(dcxo, false);
+            half_period(timer);
+            // Set SCL high and shift data
+            scl_o(dcxo, true);
+            half_period(timer);
+            if sda_i(dcxo) {
+                data |= 1 << bit
+            }
+        }
+        // Send ack
+        // Set SCL low and pull SDA low when acking
+        scl_o(dcxo, false);
+        if ack {
+            sda_oe(dcxo, true)
+        }
+        half_period(timer);
+        // then set SCL high
+        scl_o(dcxo, true);
+        half_period(timer);
+
+        data
+    }
+}
+
+fn write(dcxo: i2c::DCXO, reg: u8, val: u8, timer: &mut GlobalTimer) -> Result<(), &'static str> {
+    i2c::start(dcxo, timer);
+    if !i2c::write(dcxo, ADDRESS << 1, timer) {
+        return Err("Si549 failed to ack write address");
+    }
+    if !i2c::write(dcxo, reg, timer) {
+        return Err("Si549 failed to ack register");
+    }
+    if !i2c::write(dcxo, val, timer) {
+        return Err("Si549 failed to ack value");
+    }
+    i2c::stop(dcxo, timer);
+    Ok(())
+}
+
+fn read(dcxo: i2c::DCXO, reg: u8, timer: &mut GlobalTimer) -> Result<u8, &'static str> {
+    i2c::start(dcxo, timer);
+    if !i2c::write(dcxo, ADDRESS << 1, timer) {
+        return Err("Si549 failed to ack write address");
+    }
+    if !i2c::write(dcxo, reg, timer) {
+        return Err("Si549 failed to ack register");
+    }
+    i2c::stop(dcxo, timer);
+
+    i2c::start(dcxo, timer);
+    if !i2c::write(dcxo, (ADDRESS << 1) | 1, timer) {
+        return Err("Si549 failed to ack read address");
+    }
+    let val = i2c::read(dcxo, false, timer);
+    i2c::stop(dcxo, timer);
+    Ok(val)
+}
+
+fn setup(dcxo: i2c::DCXO, config: &DividerConfig, timer: &mut GlobalTimer) -> Result<(), &'static str> {
+    i2c::init(dcxo, timer)?;
+
+    write(dcxo, 255, 0x00, timer)?; // PAGE
+    write(dcxo, 69, 0x00, timer)?; // Disable FCAL override.
+    write(dcxo, 17, 0x00, timer)?; // Synchronously disable output
+
+    // The Si549 has no ID register, so we check that it responds correctly
+    // by writing values to a RAM-like register and reading them back.
+    for test_value in 0..255 {
+        write(dcxo, 23, test_value, timer)?;
+        let readback = read(dcxo, 23, timer)?;
+        if readback != test_value {
+            return Err("Si549 detection failed");
+        }
+    }
+
+    write(dcxo, 23, config.hsdiv as u8, timer)?;
+    write(dcxo, 24, (config.hsdiv >> 8) as u8 | (config.lsdiv << 4), timer)?;
+    write(dcxo, 26, config.fbdiv as u8, timer)?;
+    write(dcxo, 27, (config.fbdiv >> 8) as u8, timer)?;
+    write(dcxo, 28, (config.fbdiv >> 16) as u8, timer)?;
+    write(dcxo, 29, (config.fbdiv >> 24) as u8, timer)?;
+    write(dcxo, 30, (config.fbdiv >> 32) as u8, timer)?;
+    write(dcxo, 31, (config.fbdiv >> 40) as u8, timer)?;
+
+    write(dcxo, 7, 0x08, timer)?; // Start FCAL
+    timer.delay_us(30_000); // Internal FCAL VCO calibration
+    write(dcxo, 17, 0x01, timer)?; // Synchronously enable output
+
+    Ok(())
+}
+
+pub fn main_setup(timer: &mut GlobalTimer, settings: &FrequencySetting) -> Result<(), &'static str> {
+    unsafe {
+        csr::wrpll::main_dcxo_bitbang_enable_write(1);
+        csr::wrpll::main_dcxo_i2c_address_write(ADDRESS);
+    }
+
+    setup(i2c::DCXO::Main, &settings.main, timer)?;
+
+    // Si549 maximum settling time for large frequency change.
+    timer.delay_us(40_000);
+
+    unsafe {
+        csr::wrpll::main_dcxo_bitbang_enable_write(0);
+    }
+
+    info!("Main Si549 started");
+    Ok(())
+}
+
+pub fn helper_setup(timer: &mut GlobalTimer, settings: &FrequencySetting) -> Result<(), &'static str> {
+    unsafe {
+        csr::wrpll::helper_reset_write(1);
+        csr::wrpll::helper_dcxo_bitbang_enable_write(1);
+        csr::wrpll::helper_dcxo_i2c_address_write(ADDRESS);
+    }
+
+    setup(i2c::DCXO::Helper, &settings.helper, timer)?;
+
+    // Si549 maximum settling time for large frequency change.
+    timer.delay_us(40_000);
+
+    unsafe {
+        csr::wrpll::helper_reset_write(0);
+        csr::wrpll::helper_dcxo_bitbang_enable_write(0);
+    }
+    info!("Helper Si549 started");
+    Ok(())
+}
+
+fn set_adpll(dcxo: i2c::DCXO, adpll: i32) -> Result<(), &'static str> {
+    if adpll.abs() > ADPLL_MAX {
+        return Err("adpll is too large");
+    }
+
+    match dcxo {
+        i2c::DCXO::Main => unsafe {
+            if csr::wrpll::main_dcxo_bitbang_enable_read() == 1 {
+                return Err("Main si549 bitbang mode is active when using gateware i2c");
+            }
+
+            while csr::wrpll::main_dcxo_adpll_busy_read() == 1 {}
+            if csr::wrpll::main_dcxo_nack_read() == 1 {
+                return Err("Main si549 failed to ack adpll write");
+            }
+
+            csr::wrpll::main_dcxo_i2c_address_write(ADDRESS);
+            csr::wrpll::main_dcxo_adpll_write(adpll as u32);
+
+            csr::wrpll::main_dcxo_adpll_stb_write(1);
+        },
+        i2c::DCXO::Helper => unsafe {
+            if csr::wrpll::helper_dcxo_bitbang_enable_read() == 1 {
+                return Err("Helper si549 bitbang mode is active when using gateware i2c");
+            }
+
+            while csr::wrpll::helper_dcxo_adpll_busy_read() == 1 {}
+            if csr::wrpll::helper_dcxo_nack_read() == 1 {
+                return Err("Helper si549 failed to ack adpll write");
+            }
+
+            csr::wrpll::helper_dcxo_i2c_address_write(ADDRESS);
+            csr::wrpll::helper_dcxo_adpll_write(adpll as u32);
+
+            csr::wrpll::helper_dcxo_adpll_stb_write(1);
+        },
+    };
+
+    Ok(())
+}
+
+#[cfg(has_wrpll)]
+pub mod wrpll {
+
+    use super::*;
+
+    const BEATING_PERIOD: i32 = 0x8000;
+    const BEATING_HALFPERIOD: i32 = 0x4000;
+    const COUNTER_WIDTH: u32 = 24;
+    const DIV_WIDTH: u32 = 2;
+
+    // y[n] = b0*x[n] + b1*x[n-1] + b2*x[n-2] - a1*y[n-1] - a2*y[n-2]
+    struct FilterParameters {
+        pub b0: f64,
+        pub b1: f64,
+        pub b2: f64,
+        pub a1: f64,
+        pub a2: f64,
+    }
+
+    #[cfg(rtio_frequency = "100.0")]
+    const LPF: FilterParameters = FilterParameters {
+        b0: 0.03967479060647884,
+        b1: 0.07934958121295768,
+        b2: 0.03967479060647884,
+        a1: -1.3865593741228928,
+        a2: 0.5452585365488082,
+    };
+
+    #[cfg(rtio_frequency = "125.0")]
+    const LPF: FilterParameters = FilterParameters {
+        b0: 0.07209205036273991,
+        b1: 0.14418410072547982,
+        b2: 0.07209205036273991,
+        a1: -0.6114078511562919,
+        a2: -0.10022394739274834,
+    };
+
+    static mut H_ADPLL1: i32 = 0;
+    static mut H_ADPLL2: i32 = 0;
+    static mut PERIOD_ERR1: i32 = 0;
+    static mut PERIOD_ERR2: i32 = 0;
+
+    static mut M_ADPLL1: i32 = 0;
+    static mut M_ADPLL2: i32 = 0;
+    static mut PHASE_ERR1: i32 = 0;
+    static mut PHASE_ERR2: i32 = 0;
+
+    static mut BASE_ADPLL: i32 = 0;
+
+    #[derive(Clone, Copy)]
+    pub enum ISR {
+        RefTag,
+        MainTag,
+    }
+
+    mod tag_collector {
+        use super::*;
+
+        #[cfg(wrpll_ref_clk = "GT_CDR")]
+        static mut TAG_OFFSET: u32 = 8382;
+        #[cfg(wrpll_ref_clk = "SMA_CLKIN")]
+        static mut TAG_OFFSET: u32 = 0;
+        static mut REF_TAG: u32 = 0;
+        static mut REF_TAG_READY: bool = false;
+        static mut MAIN_TAG: u32 = 0;
+        static mut MAIN_TAG_READY: bool = false;
+
+        pub fn reset() {
+            clear_phase_diff_ready();
+            unsafe {
+                REF_TAG = 0;
+                MAIN_TAG = 0;
+            }
+        }
+
+        pub fn clear_phase_diff_ready() {
+            unsafe {
+                REF_TAG_READY = false;
+                MAIN_TAG_READY = false;
+            }
+        }
+
+        pub fn collect_tags(interrupt: ISR) {
+            match interrupt {
+                ISR::RefTag => unsafe {
+                    REF_TAG = csr::wrpll::ref_tag_read();
+                    REF_TAG_READY = true;
+                },
+                ISR::MainTag => unsafe {
+                    MAIN_TAG = csr::wrpll::main_tag_read();
+                    MAIN_TAG_READY = true;
+                },
+            }
+        }
+
+        pub fn phase_diff_ready() -> bool {
+            unsafe { REF_TAG_READY && MAIN_TAG_READY }
+        }
+
+        #[cfg(feature = "calibrate_wrpll_skew")]
+        pub fn set_tag_offset(offset: u32) {
+            unsafe {
+                TAG_OFFSET = offset;
+            }
+        }
+
+        #[cfg(feature = "calibrate_wrpll_skew")]
+        pub fn get_tag_offset() -> u32 {
+            unsafe { TAG_OFFSET }
+        }
+
+        pub fn get_period_error() -> i32 {
+            // n * BEATING_PERIOD - REF_TAG(n) mod BEATING_PERIOD
+            let mut period_error = unsafe { REF_TAG.overflowing_neg().0.rem_euclid(BEATING_PERIOD as u32) as i32 };
+            // mapping tags from [0, 2π] -> [-π, π]
+            if period_error > BEATING_HALFPERIOD {
+                period_error -= BEATING_PERIOD
+            }
+            period_error
+        }
+
+        pub fn get_phase_error() -> i32 {
+            // MAIN_TAG(n) - REF_TAG(n) - TAG_OFFSET mod BEATING_PERIOD
+            let mut phase_error = unsafe {
+                MAIN_TAG
+                    .overflowing_sub(REF_TAG + TAG_OFFSET)
+                    .0
+                    .rem_euclid(BEATING_PERIOD as u32) as i32
+            };
+
+            // mapping tags from [0, 2π] -> [-π, π]
+            if phase_error > BEATING_HALFPERIOD {
+                phase_error -= BEATING_PERIOD
+            }
+            phase_error
+        }
+    }
+
+    fn set_isr(en: bool) {
+        let val = if en { 1 } else { 0 };
+        unsafe {
+            csr::wrpll::ref_tag_ev_enable_write(val);
+            csr::wrpll::main_tag_ev_enable_write(val);
+        }
+    }
+
+    fn set_base_adpll() -> Result<(), &'static str> {
+        let count2adpll =
+            |error: i32| ((error as f64 * 1e6) / (0.0001164 * (1 << (COUNTER_WIDTH - DIV_WIDTH)) as f64)) as i32;
+
+        let (ref_count, main_count) = get_freq_counts();
+        unsafe {
+            BASE_ADPLL = count2adpll(ref_count as i32 - main_count as i32);
+            set_adpll(i2c::DCXO::Main, BASE_ADPLL)?;
+            set_adpll(i2c::DCXO::Helper, BASE_ADPLL)?;
+        }
+        Ok(())
+    }
+
+    fn get_freq_counts() -> (u32, u32) {
+        unsafe {
+            csr::wrpll::frequency_counter_update_write(1);
+            while csr::wrpll::frequency_counter_busy_read() == 1 {}
+            #[cfg(wrpll_ref_clk = "GT_CDR")]
+            let ref_count = csr::wrpll::frequency_counter_counter_rtio_rx0_read();
+            #[cfg(wrpll_ref_clk = "SMA_CLKIN")]
+            let ref_count = csr::wrpll::frequency_counter_counter_ref_read();
+            let main_count = csr::wrpll::frequency_counter_counter_sys_read();
+
+            (ref_count, main_count)
+        }
+    }
+
+    fn reset_plls(timer: &mut GlobalTimer) -> Result<(), &'static str> {
+        unsafe {
+            H_ADPLL1 = 0;
+            H_ADPLL2 = 0;
+            PERIOD_ERR1 = 0;
+            PERIOD_ERR2 = 0;
+            M_ADPLL1 = 0;
+            M_ADPLL2 = 0;
+            PHASE_ERR1 = 0;
+            PHASE_ERR2 = 0;
+        }
+        set_adpll(i2c::DCXO::Main, 0)?;
+        set_adpll(i2c::DCXO::Helper, 0)?;
+        // wait for adpll to transfer and DCXO to settle
+        timer.delay_us(200);
+        Ok(())
+    }
+
+    fn clear_pending(interrupt: ISR) {
+        match interrupt {
+            ISR::RefTag => unsafe { csr::wrpll::ref_tag_ev_pending_write(1) },
+            ISR::MainTag => unsafe { csr::wrpll::main_tag_ev_pending_write(1) },
+        };
+    }
+
+    fn is_pending(interrupt: ISR) -> bool {
+        match interrupt {
+            ISR::RefTag => unsafe { csr::wrpll::ref_tag_ev_pending_read() == 1 },
+            ISR::MainTag => unsafe { csr::wrpll::main_tag_ev_pending_read() == 1 },
+        }
+    }
+
+    pub fn interrupt_handler() {
+        if is_pending(ISR::RefTag) {
+            tag_collector::collect_tags(ISR::RefTag);
+            clear_pending(ISR::RefTag);
+            helper_pll().expect("failed to run helper DCXO PLL");
+        }
+
+        if is_pending(ISR::MainTag) {
+            tag_collector::collect_tags(ISR::MainTag);
+            clear_pending(ISR::MainTag);
+        }
+
+        if tag_collector::phase_diff_ready() {
+            main_pll().expect("failed to run main DCXO PLL");
+            tag_collector::clear_phase_diff_ready();
+        }
+    }
+
+    fn helper_pll() -> Result<(), &'static str> {
+        let period_err = tag_collector::get_period_error();
+        unsafe {
+            let adpll = ((LPF.b0 * period_err as f64) + (LPF.b1 * PERIOD_ERR1 as f64) + (LPF.b2 * PERIOD_ERR2 as f64)
+                - (LPF.a1 * H_ADPLL1 as f64)
+                - (LPF.a2 * H_ADPLL2 as f64)) as i32;
+            set_adpll(i2c::DCXO::Helper, BASE_ADPLL + adpll)?;
+            H_ADPLL2 = H_ADPLL1;
+            PERIOD_ERR2 = PERIOD_ERR1;
+            H_ADPLL1 = adpll;
+            PERIOD_ERR1 = period_err;
+        };
+        Ok(())
+    }
+
+    fn main_pll() -> Result<(), &'static str> {
+        let phase_err = tag_collector::get_phase_error();
+        unsafe {
+            let adpll = ((LPF.b0 * phase_err as f64) + (LPF.b1 * PHASE_ERR1 as f64) + (LPF.b2 * PHASE_ERR2 as f64)
+                - (LPF.a1 * M_ADPLL1 as f64)
+                - (LPF.a2 * M_ADPLL2 as f64)) as i32;
+            set_adpll(i2c::DCXO::Main, BASE_ADPLL + adpll)?;
+            M_ADPLL2 = M_ADPLL1;
+            PHASE_ERR2 = PHASE_ERR1;
+            M_ADPLL1 = adpll;
+            PHASE_ERR1 = phase_err;
+        };
+        Ok(())
+    }
+
+    #[cfg(wrpll_ref_clk = "GT_CDR")]
+    fn test_skew(timer: &mut GlobalTimer) -> Result<(), &'static str> {
+        // wait for PLL to stabilize
+        timer.delay_us(20_000);
+
+        info!("testing the skew of SYS CLK...");
+        if has_timing_error(timer) {
+            return Err("the skew cannot satisfy setup/hold time constraint of RX synchronizer");
+        }
+        info!("the skew of SYS CLK met the timing constraint");
+        Ok(())
+    }
+
+    #[cfg(wrpll_ref_clk = "GT_CDR")]
+    fn has_timing_error(timer: &mut GlobalTimer) -> bool {
+        unsafe {
+            csr::wrpll_skewtester::error_write(1);
+        }
+        timer.delay_us(5_000);
+        unsafe { csr::wrpll_skewtester::error_read() == 1 }
+    }
+
+    #[cfg(feature = "calibrate_wrpll_skew")]
+    fn find_edge(target: bool, timer: &mut GlobalTimer) -> Result<u32, &'static str> {
+        const STEP: u32 = 8;
+        const STABLE_THRESHOLD: u32 = 10;
+
+        enum FSM {
+            Init,
+            WaitEdge,
+            GotEdge,
+        }
+
+        let mut state: FSM = FSM::Init;
+        let mut offset: u32 = tag_collector::get_tag_offset();
+        let mut median_edge: u32 = 0;
+        let mut stable_counter: u32 = 0;
+
+        for _ in 0..(BEATING_PERIOD as u32 / STEP) as usize {
+            tag_collector::set_tag_offset(offset);
+            offset += STEP;
+            // wait for PLL to stabilize
+            timer.delay_us(20_000);
+
+            let error = has_timing_error(timer);
+            // A median edge deglitcher
+            match state {
+                FSM::Init => {
+                    if error != target {
+                        stable_counter += 1;
+                    } else {
+                        stable_counter = 0;
+                    }
+
+                    if stable_counter >= STABLE_THRESHOLD {
+                        state = FSM::WaitEdge;
+                        stable_counter = 0;
+                    }
+                }
+                FSM::WaitEdge => {
+                    if error == target {
+                        state = FSM::GotEdge;
+                        median_edge = offset;
+                    }
+                }
+                FSM::GotEdge => {
+                    if error != target {
+                        median_edge += STEP;
+                        stable_counter = 0;
+                    } else {
+                        stable_counter += 1;
+                    }
+
+                    if stable_counter >= STABLE_THRESHOLD {
+                        return Ok(median_edge);
+                    }
+                }
+            }
+        }
+        return Err("failed to find timing error edge");
+    }
+
+    #[cfg(feature = "calibrate_wrpll_skew")]
+    fn calibrate_skew(timer: &mut GlobalTimer) -> Result<(), &'static str> {
+        info!("calibrating skew to meet timing constraint...");
+
+        // clear calibrated value
+        tag_collector::set_tag_offset(0);
+        let rising = find_edge(true, timer)? as i32;
+        let falling = find_edge(false, timer)? as i32;
+
+        let width = BEATING_PERIOD - (falling - rising);
+        let result = falling + width / 2;
+        tag_collector::set_tag_offset(result as u32);
+
+        info!(
+            "calibration successful, error zone: {} -> {}, width: {} ({}deg), middle of working region: {}",
+            rising,
+            falling,
+            width,
+            360 * width / BEATING_PERIOD,
+            result,
+        );
+
+        Ok(())
+    }
+
+    pub fn select_recovered_clock(rc: bool, timer: &mut GlobalTimer) {
+        set_isr(false);
+
+        if rc {
+            tag_collector::reset();
+            reset_plls(timer).expect("failed to reset main and helper PLL");
+
+            // get within capture range
+            set_base_adpll().expect("failed to set base adpll");
+
+            // clear gateware pending flag
+            clear_pending(ISR::RefTag);
+            clear_pending(ISR::MainTag);
+
+            // use nFIQ to avoid IRQ being disabled by mutex lock and mess up PLL
+            set_isr(true);
+            info!("WRPLL interrupt enabled");
+
+            #[cfg(feature = "calibrate_wrpll_skew")]
+            calibrate_skew(timer).expect("failed to set the correct skew");
+
+            #[cfg(wrpll_ref_clk = "GT_CDR")]
+            test_skew(timer).expect("skew test failed");
+        }
+    }
+}
+
+#[cfg(has_wrpll_refclk)]
+pub mod wrpll_refclk {
+    use super::*;
+
+    pub struct MmcmSetting {
+        pub clkout0_reg1: u16,  //0x08
+        pub clkout0_reg2: u16,  //0x09
+        pub clkfbout_reg1: u16, //0x14
+        pub clkfbout_reg2: u16, //0x15
+        pub div_reg: u16,       //0x16
+        pub lock_reg1: u16,     //0x18
+        pub lock_reg2: u16,     //0x19
+        pub lock_reg3: u16,     //0x1A
+        pub power_reg: u16,     //0x28
+        pub filt_reg1: u16,     //0x4E
+        pub filt_reg2: u16,     //0x4F
+    }
+
+    fn one_clock_cycle() {
+        unsafe {
+            csr::wrpll_refclk::mmcm_dclk_write(1);
+            csr::wrpll_refclk::mmcm_dclk_write(0);
+        }
+    }
+
+    fn set_addr(address: u8) {
+        unsafe {
+            csr::wrpll_refclk::mmcm_daddr_write(address);
+        }
+    }
+
+    fn set_data(value: u16) {
+        unsafe {
+            csr::wrpll_refclk::mmcm_din_write(value);
+        }
+    }
+
+    fn set_enable(en: bool) {
+        unsafe {
+            let val = if en { 1 } else { 0 };
+            csr::wrpll_refclk::mmcm_den_write(val);
+        }
+    }
+
+    fn set_write_enable(en: bool) {
+        unsafe {
+            let val = if en { 1 } else { 0 };
+            csr::wrpll_refclk::mmcm_dwen_write(val);
+        }
+    }
+
+    fn get_data() -> u16 {
+        unsafe { csr::wrpll_refclk::mmcm_dout_read() }
+    }
+
+    fn drp_ready() -> bool {
+        unsafe { csr::wrpll_refclk::mmcm_dready_read() == 1 }
+    }
+
+    #[allow(dead_code)]
+    fn read(address: u8) -> u16 {
+        set_addr(address);
+        set_enable(true);
+        // Set DADDR on the mmcm and assert DEN for one clock cycle
+        one_clock_cycle();
+
+        set_enable(false);
+        while !drp_ready() {
+            // keep the clock signal until data is ready
+            one_clock_cycle();
+        }
+        get_data()
+    }
+
+    fn write(address: u8, value: u16) {
+        set_addr(address);
+        set_data(value);
+        set_write_enable(true);
+        set_enable(true);
+        // Set DADDR, DI on the mmcm and assert DWE, DEN for one clock cycle
+        one_clock_cycle();
+
+        set_write_enable(false);
+        set_enable(false);
+        while !drp_ready() {
+            // keep the clock signal until write is finished
+            one_clock_cycle();
+        }
+    }
+
+    fn reset(rst: bool) {
+        unsafe {
+            let val = if rst { 1 } else { 0 };
+            csr::wrpll_refclk::mmcm_reset_write(val)
+        }
+    }
+
+    pub fn setup(timer: &mut GlobalTimer, settings: MmcmSetting, mmcm_bypass: bool) -> Result<(), &'static str> {
+        unsafe {
+            csr::wrpll_refclk::refclk_reset_write(1);
+        }
+
+        if mmcm_bypass {
+            info!("Bypassing mmcm");
+            unsafe {
+                csr::wrpll_refclk::mmcm_bypass_write(1);
+            }
+        } else {
+            // Based on "DRP State Machine" from XAPP888
+            // hold reset HIGH during mmcm config
+            reset(true);
+            write(0x08, settings.clkout0_reg1);
+            write(0x09, settings.clkout0_reg2);
+            write(0x14, settings.clkfbout_reg1);
+            write(0x15, settings.clkfbout_reg2);
+            write(0x16, settings.div_reg);
+            write(0x18, settings.lock_reg1);
+            write(0x19, settings.lock_reg2);
+            write(0x1A, settings.lock_reg3);
+            write(0x28, settings.power_reg);
+            write(0x4E, settings.filt_reg1);
+            write(0x4F, settings.filt_reg2);
+            reset(false);
+
+            // wait for the mmcm to lock
+            timer.delay_us(100);
+
+            let locked = unsafe { csr::wrpll_refclk::mmcm_locked_read() == 1 };
+            if !locked {
+                return Err("mmcm failed to generate 125MHz ref clock from SMA CLKIN");
+            }
+        }
+
+        unsafe {
+            csr::wrpll_refclk::refclk_reset_write(0);
+        }
+
+        Ok(())
+    }
+}

src/libbuild_zynq/lib.rs

@@ -1,8 +1,7 @@
-use std::env;
+use std::{env,
-use std::fs::File;
+          fs::File,
-use std::io::{BufRead, BufReader, Write};
+          io::{BufRead, BufReader, Write},
-use std::path::PathBuf;
+          path::PathBuf};
-
 
 pub fn add_linker_script() {
     // Put the linker script somewhere the linker can find it

src/libbuild_zynq/link.x

@@ -10,7 +10,9 @@ SECTIONS
     __text_start = .;
     .text :
     {
+        __exceptions_start = .;
         KEEP(*(.text.exceptions));
+        __exceptions_end = .;
         *(.text.boot);
         *(.text .text.*);
     } > SDRAM

src/libc/Cargo.toml.tpl

@@ -6,7 +6,7 @@ edition = "2018"
 build = "build.rs"
 
 [dependencies]
-libboard_zynq = { git = "https://git.m-labs.hk/M-Labs/zynq-rs.git" }
+libboard_zynq = { path = "@@ZYNQ_RS@@/libboard_zynq" }
 
 [build-dependencies]
 cc = { version = "1.0.1" }

src/libc/build.rs

@@ -4,8 +4,7 @@ fn main() {
 }
 
 mod libc {
-    use std::path::Path;
+    use std::{env, path::Path};
-    use std::env;
 
     pub fn compile() {
         let cfg = &mut cc::Build::new();
@@ -32,9 +31,7 @@ mod libc {
         cfg.flag("-U_FORTIFY_SOURCE");
         cfg.define("_FORTIFY_SOURCE", Some("0"));
 
-        let sources = vec![
+        let sources = vec!["printf.c"];
-            "printf.c"
-        ];
 
         let root = Path::new("./");
         for src in sources {

src/libdwarf/src/eh.rs

@@ -11,10 +11,12 @@
 #![allow(non_upper_case_globals)]
 #![allow(unused)]
 
-use crate::DwarfReader;
 use core::mem;
+
 use cslice::CSlice;
 
+use crate::DwarfReader;
+
 pub const DW_EH_PE_omit: u8 = 0xFF;
 pub const DW_EH_PE_absptr: u8 = 0x00;
 
@@ -83,10 +85,7 @@ unsafe fn get_ttype_entry(
         encoding | DW_EH_PE_pcrel,
         ttype_base,
     )
-    .map(|v| match v {
+    .map(|v| (v != ttype_base).then(|| v as *const u8))
-        ttype_base => None,
-        ttype_entry => Some(ttype_entry as *const u8),
-    })
 }
 
 pub unsafe fn find_eh_action(
@@ -160,15 +159,11 @@ pub unsafe fn find_eh_action(
                         if ar_filter == 0 {
                             saw_cleanup = true;
                         } else if ar_filter > 0 {
-                            let catch_type = get_ttype_entry(
+                            let catch_type =
-                                ar_filter as usize,
+                                get_ttype_entry(ar_filter as usize, ttype_encoding, ttype_base, ttype_table)?;
-                                ttype_encoding,
-                                ttype_base,
-                                ttype_table,
-                            )?;
                             match catch_type {
                                 Some(clause_ptr) if *(clause_ptr as *const u32) == id => {
-                                    return Ok(EHAction::Catch(lpad))
+                                    return Ok(EHAction::Catch(lpad));
                                 }
                                 None => return Ok(EHAction::Catch(lpad)),
                                 _ => {}
@@ -251,19 +246,11 @@ fn get_base(encoding: u8, context: &EHContext<'_>) -> Result<usize, ()> {
     }
 }
 
-unsafe fn read_encoded_pointer(
+unsafe fn read_encoded_pointer(reader: &mut DwarfReader, context: &EHContext<'_>, encoding: u8) -> Result<usize, ()> {
-    reader: &mut DwarfReader,
-    context: &EHContext<'_>,
-    encoding: u8,
-) -> Result<usize, ()> {
     read_encoded_pointer_with_base(reader, encoding, get_base(encoding, context)?)
 }
 
-unsafe fn read_encoded_pointer_with_base(
+unsafe fn read_encoded_pointer_with_base(reader: &mut DwarfReader, encoding: u8, base: usize) -> Result<usize, ()> {
-    reader: &mut DwarfReader,
-    encoding: u8,
-    base: usize,
-) -> Result<usize, ()> {
     if encoding == DW_EH_PE_omit {
         return Err(());
     }

src/libdyld/Cargo.toml.tpl

@@ -8,4 +8,4 @@ name = "dyld"
 
 [dependencies]
 log = "0.4"
-libcortex_a9 = { git = "https://git.m-labs.hk/M-Labs/zynq-rs.git" }
+libcortex_a9 = { path = "@@ZYNQ_RS@@/libcortex_a9" }

src/libdyld/src/elf.rs

@@ -1451,8 +1451,7 @@ pub const R_AARCH64_TLSDESC_CALL: usize = 569;
 pub const R_AARCH64_TLSLE_LDST128_TPREL_LO12: usize = 570;
 pub const R_AARCH64_TLSLE_LDST128_TPREL_LO12_NC: usize = 571;
 pub const R_AARCH64_TLSLD_LDST128_DTPREL_LO12: usize = 572;
-pub const R_AARCH64_TLSLD_LDST128_DTPREL_LO12_NC: usize =
+pub const R_AARCH64_TLSLD_LDST128_DTPREL_LO12_NC: usize = 573;
-    573;
 pub const R_AARCH64_COPY: usize = 1024;
 pub const R_AARCH64_GLOB_DAT: usize = 1025;
 pub const R_AARCH64_JUMP_SLOT: usize = 1026;
@@ -2267,7 +2266,9 @@ pub struct Elf32_Ehdr {
     pub e_shstrndx: Elf32_Half,
 }
 impl Clone for Elf32_Ehdr {
-    fn clone(&self) -> Self { *self }
+    fn clone(&self) -> Self {
+        *self
+    }
 }
 #[repr(C)]
 #[derive(Debug, Copy)]
@@ -2288,7 +2289,9 @@ pub struct Elf64_Ehdr {
     pub e_shstrndx: Elf64_Half,
 }
 impl Clone for Elf64_Ehdr {
-    fn clone(&self) -> Self { *self }
+    fn clone(&self) -> Self {
+        *self
+    }
 }
 #[repr(C)]
 #[derive(Debug, Copy)]
@@ -2305,7 +2308,9 @@ pub struct Elf32_Shdr {
     pub sh_entsize: Elf32_Word,
 }
 impl Clone for Elf32_Shdr {
-    fn clone(&self) -> Self { *self }
+    fn clone(&self) -> Self {
+        *self
+    }
 }
 #[repr(C)]
 #[derive(Debug, Copy)]
@@ -2322,7 +2327,9 @@ pub struct Elf64_Shdr {
     pub sh_entsize: Elf64_Xword,
 }
 impl Clone for Elf64_Shdr {
-    fn clone(&self) -> Self { *self }
+    fn clone(&self) -> Self {
+        *self
+    }
 }
 #[repr(C)]
 #[derive(Debug, Copy)]
@@ -2335,7 +2342,9 @@ pub struct Elf32_Sym {
     pub st_shndx: Elf32_Section,
 }
 impl Clone for Elf32_Sym {
-    fn clone(&self) -> Self { *self }
+    fn clone(&self) -> Self {
+        *self
+    }
 }
 #[repr(C)]
 #[derive(Debug, Copy)]
@@ -2348,7 +2357,9 @@ pub struct Elf64_Sym {
     pub st_size: Elf64_Xword,
 }
 impl Clone for Elf64_Sym {
-    fn clone(&self) -> Self { *self }
+    fn clone(&self) -> Self {
+        *self
+    }
 }
 #[repr(C)]
 #[derive(Debug, Copy)]
@@ -2357,7 +2368,9 @@ pub struct Elf32_Syminfo {
     pub si_flags: Elf32_Half,
 }
 impl Clone for Elf32_Syminfo {
-    fn clone(&self) -> Self { *self }
+    fn clone(&self) -> Self {
+        *self
+    }
 }
 #[repr(C)]
 #[derive(Debug, Copy)]
@@ -2366,7 +2379,9 @@ pub struct Elf64_Syminfo {
     pub si_flags: Elf64_Half,
 }
 impl Clone for Elf64_Syminfo {
-    fn clone(&self) -> Self { *self }
+    fn clone(&self) -> Self {
+        *self
+    }
 }
 #[repr(C)]
 #[derive(Debug, Copy)]
@@ -2375,7 +2390,9 @@ pub struct Elf32_Rel {
     pub r_info: Elf32_Word,
 }
 impl Clone for Elf32_Rel {
-    fn clone(&self) -> Self { *self }
+    fn clone(&self) -> Self {
+        *self
+    }
 }
 #[repr(C)]
 #[derive(Debug, Copy)]
@@ -2384,7 +2401,9 @@ pub struct Elf64_Rel {
     pub r_info: Elf64_Xword,
 }
 impl Clone for Elf64_Rel {
-    fn clone(&self) -> Self { *self }
+    fn clone(&self) -> Self {
+        *self
+    }
 }
 #[repr(C)]
 #[derive(Debug, Copy)]
@@ -2394,7 +2413,9 @@ pub struct Elf32_Rela {
     pub r_addend: Elf32_Sword,
 }
 impl Clone for Elf32_Rela {
-    fn clone(&self) -> Self { *self }
+    fn clone(&self) -> Self {
+        *self
+    }
 }
 #[repr(C)]
 #[derive(Debug, Copy)]
@@ -2404,7 +2425,9 @@ pub struct Elf64_Rela {
     pub r_addend: Elf64_Sxword,
 }
 impl Clone for Elf64_Rela {
-    fn clone(&self) -> Self { *self }
+    fn clone(&self) -> Self {
+        *self
+    }
 }
 #[repr(C)]
 #[derive(Debug, Copy)]
@@ -2419,7 +2442,9 @@ pub struct Elf32_Phdr {
     pub p_align: Elf32_Word,
 }
 impl Clone for Elf32_Phdr {
-    fn clone(&self) -> Self { *self }
+    fn clone(&self) -> Self {
+        *self
+    }
 }
 #[repr(C)]
 #[derive(Debug, Copy)]
@@ -2434,7 +2459,9 @@ pub struct Elf64_Phdr {
     pub p_align: Elf64_Xword,
 }
 impl Clone for Elf64_Phdr {
-    fn clone(&self) -> Self { *self }
+    fn clone(&self) -> Self {
+        *self
+    }
 }
 #[repr(C)]
 #[derive(Copy)]
@@ -2449,10 +2476,14 @@ pub union Elf32_Dyn__bindgen_ty_1 {
     pub d_ptr: Elf32_Addr,
 }
 impl Clone for Elf32_Dyn__bindgen_ty_1 {
-    fn clone(&self) -> Self { *self }
+    fn clone(&self) -> Self {
+        *self
+    }
 }
 impl Clone for Elf32_Dyn {
-    fn clone(&self) -> Self { *self }
+    fn clone(&self) -> Self {
+        *self
+    }
 }
 #[repr(C)]
 #[derive(Copy)]
@@ -2467,10 +2498,14 @@ pub union Elf64_Dyn__bindgen_ty_1 {
     pub d_ptr: Elf64_Addr,
 }
 impl Clone for Elf64_Dyn__bindgen_ty_1 {
-    fn clone(&self) -> Self { *self }
+    fn clone(&self) -> Self {
+        *self
+    }
 }
 impl Clone for Elf64_Dyn {
-    fn clone(&self) -> Self { *self }
+    fn clone(&self) -> Self {
+        *self
+    }
 }
 #[repr(C)]
 #[derive(Debug, Copy)]
@@ -2484,7 +2519,9 @@ pub struct Elf32_Verdef {
     pub vd_next: Elf32_Word,
 }
 impl Clone for Elf32_Verdef {
-    fn clone(&self) -> Self { *self }
+    fn clone(&self) -> Self {
+        *self
+    }
 }
 #[repr(C)]
 #[derive(Debug, Copy)]
@@ -2498,7 +2535,9 @@ pub struct Elf64_Verdef {
     pub vd_next: Elf64_Word,
 }
 impl Clone for Elf64_Verdef {
-    fn clone(&self) -> Self { *self }
+    fn clone(&self) -> Self {
+        *self
+    }
 }
 #[repr(C)]
 #[derive(Debug, Copy)]
@@ -2507,7 +2546,9 @@ pub struct Elf32_Verdaux {
     pub vda_next: Elf32_Word,
 }
 impl Clone for Elf32_Verdaux {
-    fn clone(&self) -> Self { *self }
+    fn clone(&self) -> Self {
+        *self
+    }
 }
 #[repr(C)]
 #[derive(Debug, Copy)]
@@ -2516,7 +2557,9 @@ pub struct Elf64_Verdaux {
     pub vda_next: Elf64_Word,
 }
 impl Clone for Elf64_Verdaux {
-    fn clone(&self) -> Self { *self }
+    fn clone(&self) -> Self {
+        *self
+    }
 }
 #[repr(C)]
 #[derive(Debug, Copy)]
@@ -2528,7 +2571,9 @@ pub struct Elf32_Verneed {
     pub vn_next: Elf32_Word,
 }
 impl Clone for Elf32_Verneed {
-    fn clone(&self) -> Self { *self }
+    fn clone(&self) -> Self {
+        *self
+    }
 }
 #[repr(C)]
 #[derive(Debug, Copy)]
@@ -2540,7 +2585,9 @@ pub struct Elf64_Verneed {
     pub vn_next: Elf64_Word,
 }
 impl Clone for Elf64_Verneed {
-    fn clone(&self) -> Self { *self }
+    fn clone(&self) -> Self {
+        *self
+    }
 }
 #[repr(C)]
 #[derive(Debug, Copy)]
@@ -2552,7 +2599,9 @@ pub struct Elf32_Vernaux {
     pub vna_next: Elf32_Word,
 }
 impl Clone for Elf32_Vernaux {
-    fn clone(&self) -> Self { *self }
+    fn clone(&self) -> Self {
+        *self
+    }
 }
 #[repr(C)]
 #[derive(Debug, Copy)]
@@ -2564,7 +2613,9 @@ pub struct Elf64_Vernaux {
     pub vna_next: Elf64_Word,
 }
 impl Clone for Elf64_Vernaux {
-    fn clone(&self) -> Self { *self }
+    fn clone(&self) -> Self {
+        *self
+    }
 }
 #[repr(C)]
 #[derive(Copy)]
@@ -2578,10 +2629,14 @@ pub union Elf32_auxv_t__bindgen_ty_1 {
     pub a_val: u32,
 }
 impl Clone for Elf32_auxv_t__bindgen_ty_1 {
-    fn clone(&self) -> Self { *self }
+    fn clone(&self) -> Self {
+        *self
+    }
 }
 impl Clone for Elf32_auxv_t {
-    fn clone(&self) -> Self { *self }
+    fn clone(&self) -> Self {
+        *self
+    }
 }
 #[repr(C)]
 #[derive(Copy)]
@@ -2595,10 +2650,14 @@ pub union Elf64_auxv_t__bindgen_ty_1 {
     pub a_val: u64,
 }
 impl Clone for Elf64_auxv_t__bindgen_ty_1 {
-    fn clone(&self) -> Self { *self }
+    fn clone(&self) -> Self {
+        *self
+    }
 }
 impl Clone for Elf64_auxv_t {
-    fn clone(&self) -> Self { *self }
+    fn clone(&self) -> Self {
+        *self
+    }
 }
 #[repr(C)]
 #[derive(Debug, Copy)]
@@ -2608,7 +2667,9 @@ pub struct Elf32_Nhdr {
     pub n_type: Elf32_Word,
 }
 impl Clone for Elf32_Nhdr {
-    fn clone(&self) -> Self { *self }
+    fn clone(&self) -> Self {
+        *self
+    }
 }
 #[repr(C)]
 #[derive(Debug, Copy)]
@@ -2618,7 +2679,9 @@ pub struct Elf64_Nhdr {
     pub n_type: Elf64_Word,
 }
 impl Clone for Elf64_Nhdr {
-    fn clone(&self) -> Self { *self }
+    fn clone(&self) -> Self {
+        *self
+    }
 }
 #[repr(C)]
 #[derive(Debug, Copy)]
@@ -2630,7 +2693,9 @@ pub struct Elf32_Move {
     pub m_stride: Elf32_Half,
 }
 impl Clone for Elf32_Move {
-    fn clone(&self) -> Self { *self }
+    fn clone(&self) -> Self {
+        *self
+    }
 }
 #[repr(C)]
 #[derive(Debug, Copy)]
@@ -2642,7 +2707,9 @@ pub struct Elf64_Move {
     pub m_stride: Elf64_Half,
 }
 impl Clone for Elf64_Move {
-    fn clone(&self) -> Self { *self }
+    fn clone(&self) -> Self {
+        *self
+    }
 }
 #[repr(C)]
 #[derive(Copy)]
@@ -2657,7 +2724,9 @@ pub struct Elf32_gptab__bindgen_ty_1 {
     pub gt_unused: Elf32_Word,
 }
 impl Clone for Elf32_gptab__bindgen_ty_1 {
-    fn clone(&self) -> Self { *self }
+    fn clone(&self) -> Self {
+        *self
+    }
 }
 #[repr(C)]
 #[derive(Debug, Copy)]
@@ -2666,10 +2735,14 @@ pub struct Elf32_gptab__bindgen_ty_2 {
     pub gt_bytes: Elf32_Word,
 }
 impl Clone for Elf32_gptab__bindgen_ty_2 {
-    fn clone(&self) -> Self { *self }
+    fn clone(&self) -> Self {
+        *self
+    }
 }
 impl Clone for Elf32_gptab {
-    fn clone(&self) -> Self { *self }
+    fn clone(&self) -> Self {
+        *self
+    }
 }
 #[repr(C)]
 #[derive(Debug, Copy)]
@@ -2679,7 +2752,9 @@ pub struct Elf32_RegInfo {
     pub ri_gp_value: Elf32_Sword,
 }
 impl Clone for Elf32_RegInfo {
-    fn clone(&self) -> Self { *self }
+    fn clone(&self) -> Self {
+        *self
+    }
 }
 #[repr(C)]
 #[derive(Debug, Copy)]
@@ -2690,7 +2765,9 @@ pub struct Elf_Options {
     pub info: Elf32_Word,
 }
 impl Clone for Elf_Options {
-    fn clone(&self) -> Self { *self }
+    fn clone(&self) -> Self {
+        *self
+    }
 }
 #[repr(C)]
 #[derive(Debug, Copy)]
@@ -2699,7 +2776,9 @@ pub struct Elf_Options_Hw {
     pub hwp_flags2: Elf32_Word,
 }
 impl Clone for Elf_Options_Hw {
-    fn clone(&self) -> Self { *self }
+    fn clone(&self) -> Self {
+        *self
+    }
 }
 #[repr(C)]
 #[derive(Debug, Copy)]
@@ -2711,7 +2790,9 @@ pub struct Elf32_Lib {
     pub l_flags: Elf32_Word,
 }
 impl Clone for Elf32_Lib {
-    fn clone(&self) -> Self { *self }
+    fn clone(&self) -> Self {
+        *self
+    }
 }
 #[repr(C)]
 #[derive(Debug, Copy)]
@@ -2723,17 +2804,31 @@ pub struct Elf64_Lib {
     pub l_flags: Elf64_Word,
 }
 impl Clone for Elf64_Lib {
-    fn clone(&self) -> Self { *self }
+    fn clone(&self) -> Self {
+        *self
+    }
 }
 pub type Elf32_Conflict = Elf32_Addr;
 #[repr(C)]
 #[derive(Clone, Copy)]
 pub struct EXIDX_Entry(u32, u32);
 
-pub fn ELF32_R_SYM(info: Elf32_Word) -> Elf32_Word { info >> 8 }
+pub fn ELF32_R_SYM(info: Elf32_Word) -> Elf32_Word {
-pub fn ELF32_R_TYPE(info: Elf32_Word) -> u8 { info as u8 }
+    info >> 8
-pub fn ELF32_R_INFO(sym: Elf32_Word, ty: u8) -> Elf32_Word { sym << 8 | ty as Elf32_Word }
+}
+pub fn ELF32_R_TYPE(info: Elf32_Word) -> u8 {
+    info as u8
+}
+pub fn ELF32_R_INFO(sym: Elf32_Word, ty: u8) -> Elf32_Word {
+    sym << 8 | ty as Elf32_Word
+}
 
-pub fn ELF32_ST_BIND(info: u8) -> u8 { info >> 4 }
+pub fn ELF32_ST_BIND(info: u8) -> u8 {
-pub fn ELF32_ST_TYPE(info: u8) -> u8 { info & 0xf }
+    info >> 4
-pub fn ELF32_ST_INFO(bind: u8, ty: u8) -> u8 { (bind << 4) | (ty & 0xf) }
+}
+pub fn ELF32_ST_TYPE(info: u8) -> u8 {
+    info & 0xf
+}
+pub fn ELF32_ST_INFO(bind: u8, ty: u8) -> u8 {
+    (bind << 4) | (ty & 0xf)
+}

src/libdyld/src/file.rs

@@ -1,8 +1,8 @@
-use core::{mem, ptr, ops::{Deref, Range}};
+use core::{mem,
-use super::{
+           ops::{Deref, Range},
-    Arch,
+           ptr};
-    elf::*,
+
-};
+use super::{elf::*, Arch};
 
 fn read_unaligned<T: Copy>(data: &[u8], offset: usize) -> Option<T> {
     if data.len() < offset + mem::size_of::<T>() {
@@ -31,14 +31,40 @@ impl<'a> File<'a> {
 
     pub fn arch(&self) -> Option<Arch> {
         const IDENT_OPENRISC: [u8; EI_NIDENT] = [
-            ELFMAG0,    ELFMAG1,     ELFMAG2,    ELFMAG3,
+            ELFMAG0,
-            ELFCLASS32, ELFDATA2MSB, EV_CURRENT, ELFOSABI_NONE,
+            ELFMAG1,
-            /* ABI version */ 0, /* padding */ 0, 0, 0, 0, 0, 0, 0
+            ELFMAG2,
+            ELFMAG3,
+            ELFCLASS32,
+            ELFDATA2MSB,
+            EV_CURRENT,
+            ELFOSABI_NONE,
+            /* ABI version */ 0,
+            /* padding */ 0,
+            0,
+            0,
+            0,
+            0,
+            0,
+            0,
         ];
         const IDENT_ARM: [u8; EI_NIDENT] = [
-            ELFMAG0,    ELFMAG1,     ELFMAG2,    ELFMAG3,
+            ELFMAG0,
-            ELFCLASS32, ELFDATA2LSB, EV_CURRENT, ELFOSABI_NONE,
+            ELFMAG1,
-            /* ABI version */ 0, /* padding */ 0, 0, 0, 0, 0, 0, 0
+            ELFMAG2,
+            ELFMAG3,
+            ELFCLASS32,
+            ELFDATA2LSB,
+            EV_CURRENT,
+            ELFOSABI_NONE,
+            /* ABI version */ 0,
+            /* padding */ 0,
+            0,
+            0,
+            0,
+            0,
+            0,
+            0,
         ];
 
         match (self.ehdr.e_ident, self.ehdr.e_machine) {
@@ -48,16 +74,14 @@ impl<'a> File<'a> {
         }
     }
 
-    pub fn program_headers<'b>(&'b self) -> impl Iterator<Item = Option<Elf32_Phdr>> + 'b
+    pub fn program_headers<'b>(&'b self) -> impl Iterator<Item = Option<Elf32_Phdr>> + 'b {
-    {
         (0..self.ehdr.e_phnum).map(move |i| {
             let phdr_off = self.ehdr.e_phoff as usize + mem::size_of::<Elf32_Phdr>() * i as usize;
             self.read_unaligned::<Elf32_Phdr>(phdr_off)
         })
     }
 
-    pub fn section_headers<'b>(&'b self) -> impl Iterator<Item = Option<Elf32_Shdr>> + 'b
+    pub fn section_headers<'b>(&'b self) -> impl Iterator<Item = Option<Elf32_Shdr>> + 'b {
-    {
         (0..self.ehdr.e_shnum).map(move |i| {
             let shdr_off = self.ehdr.e_shoff as usize + mem::size_of::<Elf32_Shdr>() * i as usize;
             self.read_unaligned::<Elf32_Shdr>(shdr_off)

src/libdyld/src/image.rs

@@ -1,13 +1,9 @@
-use core::{
-    ops::{Deref, DerefMut, Range},
-    mem,
-    slice,
-};
 use alloc::alloc::{alloc_zeroed, dealloc, Layout, LayoutError};
-use super::{
+use core::{mem,
-    elf::*,
+           ops::{Deref, DerefMut, Range},
-    Error,
+           slice};
-};
+
+use super::{elf::*, Error};
 
 pub struct DynamicSection {
     pub strtab: Range<usize>,
@@ -34,17 +30,12 @@ impl Image {
             slice::from_raw_parts_mut(ptr, size)
         };
 
-        Ok(Image {
+        Ok(Image { layout, data })
-            layout,
-            data,
-        })
     }
 
     /// assumes that self.data is properly aligned
     pub(crate) fn get_ref<T>(&self, offset: usize) -> Option<&T>
-    where
+    where T: Copy {
-        T: Copy,
-    {
         if self.data.len() < offset + mem::size_of::<T>() {
             None
         } else if (self.data.as_ptr() as usize + offset) & (mem::align_of::<T>() - 1) != 0 {
@@ -66,55 +57,53 @@ impl Image {
         unsafe { slice::from_raw_parts(ptr, len) }
     }
 
-    fn dyn_headers<'a>(&'a self, range: Range<usize>) ->
+    fn dyn_headers<'a>(&'a self, range: Range<usize>) -> impl Iterator<Item = &'a Elf32_Dyn> + 'a {
-        impl Iterator<Item = &'a Elf32_Dyn> + 'a
-    {
         range
             .step_by(mem::size_of::<Elf32_Dyn>())
-            .filter_map(move |offset| {
+            .filter_map(move |offset| self.get_ref::<Elf32_Dyn>(offset))
-                self.get_ref::<Elf32_Dyn>(offset)
-            })
             .take_while(|d| unsafe { d.d_un.d_val } as i32 != DT_NULL)
     }
 
     pub fn dyn_section(&self, range: Range<usize>) -> Result<DynamicSection, Error> {
         let (mut strtab_off, mut strtab_sz) = (0, 0);
-        let (mut rel_off,    mut rel_sz)    = (0, 0);
+        let (mut rel_off, mut rel_sz) = (0, 0);
-        let (mut rela_off,   mut rela_sz)   = (0, 0);
+        let (mut rela_off, mut rela_sz) = (0, 0);
         let (mut pltrel_off, mut pltrel_sz) = (0, 0);
-        let (mut hash_off,   mut hash_sz)   = (0, 0);
+        let (mut hash_off, mut hash_sz) = (0, 0);
         let mut symtab_off = 0;
-        let mut sym_ent    = 0;
+        let mut sym_ent = 0;
-        let mut rel_ent    = 0;
+        let mut rel_ent = 0;
-        let mut rela_ent   = 0;
+        let mut rela_ent = 0;
-        let mut nbucket    = 0;
+        let mut nbucket = 0;
-        let mut nchain     = 0;
+        let mut nchain = 0;
 
         for dyn_header in self.dyn_headers(range) {
             let val = unsafe { dyn_header.d_un.d_val } as usize;
             match dyn_header.d_tag {
-                DT_NULL     => break,
+                DT_NULL => break,
-                DT_STRTAB   => strtab_off = val,
+                DT_STRTAB => strtab_off = val,
-                DT_STRSZ    => strtab_sz  = val,
+                DT_STRSZ => strtab_sz = val,
-                DT_SYMTAB   => symtab_off = val,
+                DT_SYMTAB => symtab_off = val,
-                DT_SYMENT   => sym_ent    = val,
+                DT_SYMENT => sym_ent = val,
-                DT_REL      => rel_off    = val,
+                DT_REL => rel_off = val,
-                DT_RELSZ    => rel_sz     = val,
+                DT_RELSZ => rel_sz = val,
-                DT_RELENT   => rel_ent    = val,
+                DT_RELENT => rel_ent = val,
-                DT_RELA     => rela_off   = val,
+                DT_RELA => rela_off = val,
-                DT_RELASZ   => rela_sz    = val,
+                DT_RELASZ => rela_sz = val,
-                DT_RELAENT  => rela_ent   = val,
+                DT_RELAENT => rela_ent = val,
-                DT_JMPREL   => pltrel_off = val,
+                DT_JMPREL => pltrel_off = val,
-                DT_PLTRELSZ => pltrel_sz  = val,
+                DT_PLTRELSZ => pltrel_sz = val,
-                DT_HASH     => {
+                DT_HASH => {
-                    nbucket  = *self.get_ref::<Elf32_Word>(val + 0)
+                    nbucket = *self
+                        .get_ref::<Elf32_Word>(val + 0)
                         .ok_or("cannot read hash bucket count")? as usize;
-                    nchain   = *self.get_ref::<Elf32_Word>(val + 4)
+                    nchain = *self
+                        .get_ref::<Elf32_Word>(val + 4)
                         .ok_or("cannot read hash chain count")? as usize;
                     hash_off = val + 8;
-                    hash_sz  = (nbucket + nchain) * mem::size_of::<Elf32_Word>();
+                    hash_sz = (nbucket + nchain) * mem::size_of::<Elf32_Word>();
                 }
-                _ => ()
+                _ => (),
             }
         }
 
@@ -123,28 +112,28 @@ impl Image {
         let symtab_sz = nchain * mem::size_of::<Elf32_Sym>();
 
         if strtab_off + strtab_sz > self.data.len() {
-            return Err("invalid strtab offset/size")?
+            return Err("invalid strtab offset/size")?;
         }
         if symtab_off + symtab_sz > self.data.len() {
-            return Err("invalid symtab offset/size")?
+            return Err("invalid symtab offset/size")?;
         }
         if sym_ent != mem::size_of::<Elf32_Sym>() {
-            return Err("incorrect symbol entry size")?
+            return Err("incorrect symbol entry size")?;
         }
         if rel_off + rel_sz > self.data.len() {
-            return Err("invalid rel offset/size")?
+            return Err("invalid rel offset/size")?;
         }
         if rel_ent != 0 && rel_ent != mem::size_of::<Elf32_Rel>() {
-            return Err("incorrect relocation entry size")?
+            return Err("incorrect relocation entry size")?;
         }
         if rela_off + rela_sz > self.data.len() {
-            return Err("invalid rela offset/size")?
+            return Err("invalid rela offset/size")?;
         }
         if rela_ent != 0 && rela_ent != mem::size_of::<Elf32_Rela>() {
-            return Err("incorrect relocation entry size")?
+            return Err("incorrect relocation entry size")?;
         }
         if pltrel_off + pltrel_sz > self.data.len() {
-            return Err("invalid pltrel offset/size")?
+            return Err("invalid pltrel offset/size")?;
         }
 
         Ok(DynamicSection {
@@ -165,7 +154,7 @@ impl Image {
 
     pub fn write(&self, offset: usize, value: Elf32_Word) -> Result<(), Error> {
         if offset + mem::size_of::<Elf32_Addr>() > self.data.len() {
-            return Err("relocation out of image bounds")?
+            return Err("relocation out of image bounds")?;
         }
 
         let ptr = (self.data.as_ptr() as usize + offset) as *mut Elf32_Addr;

src/libdyld/src/lib.rs

@@ -1,13 +1,14 @@
 #![no_std]
 
 extern crate alloc;
-extern crate log;
 extern crate libcortex_a9;
+extern crate log;
 
-use core::{convert, fmt, ops::Range, str};
 use alloc::string::String;
-use log::{debug, trace};
+use core::{convert, fmt, ops::Range, str};
+
 use elf::*;
+use log::{debug, trace};
 
 pub mod elf;
 mod file;
@@ -21,11 +22,10 @@ pub enum Arch {
     OpenRisc,
 }
 
-
 #[derive(Debug)]
 pub enum Error {
     Parsing(&'static str),
-    Lookup(String)
+    Lookup(String),
 }
 
 impl convert::From<&'static str> for Error {
@@ -37,10 +37,8 @@ impl convert::From<&'static str> for Error {
 impl fmt::Display for Error {
     fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
         match self {
-            &Error::Parsing(desc) =>
+            &Error::Parsing(desc) => write!(f, "parse error: {}", desc),
-                write!(f, "parse error: {}", desc),
+            &Error::Lookup(ref sym) => write!(f, "symbol lookup error: {}", sym),
-            &Error::Lookup(ref sym) =>
-                write!(f, "symbol lookup error: {}", sym),
         }
     }
 }
@@ -103,20 +101,22 @@ impl Library {
         let mut index = self.hash_bucket()[hash as usize % self.hash_bucket().len()] as usize;
 
         loop {
-            if index == STN_UNDEF { return None }
+            if index == STN_UNDEF {
+                return None;
+            }
 
             let sym = &self.symtab()[index];
             let sym_name_off = sym.st_name as usize;
             match self.strtab().get(sym_name_off..sym_name_off + name.len()) {
                 Some(sym_name) if sym_name == name => {
                     if ELF32_ST_BIND(sym.st_info) & STB_GLOBAL == 0 {
-                        return None
+                        return None;
                     }
 
                     match sym.st_shndx {
                         SHN_UNDEF => return None,
                         SHN_ABS => return Some(self.image.ptr() as u32 + sym.st_value),
-                        _ => return Some(self.image.ptr() as u32 + sym.st_value)
+                        _ => return Some(self.image.ptr() as u32 + sym.st_value),
                     }
                 }
                 _ => (),
@@ -127,10 +127,16 @@ impl Library {
     }
 
     pub fn name_starting_at(&self, offset: usize) -> Result<&[u8], Error> {
-        let size = self.strtab().iter().skip(offset).position(|&x| x == 0)
+        let size = self
-                              .ok_or("symbol in symbol table not null-terminated")?;
+            .strtab()
-        Ok(self.strtab().get(offset..offset + size)
+            .iter()
-           .ok_or("cannot read symbol name")?)
+            .skip(offset)
+            .position(|&x| x == 0)
+            .ok_or("symbol in symbol table not null-terminated")?;
+        Ok(self
+            .strtab()
+            .get(offset..offset + size)
+            .ok_or("cannot read symbol name")?)
     }
 
     /// Rebind Rela by `name` to a new `addr`
@@ -143,53 +149,59 @@ impl Library {
     }
 }
 
-pub fn load(
+pub fn load(data: &[u8], resolve: &dyn Fn(&[u8]) -> Option<Elf32_Word>) -> Result<Library, Error> {
-    data: &[u8],
-    resolve: &dyn Fn(&[u8]) -> Option<Elf32_Word>
-) -> Result<Library, Error> {
     // validate ELF file
-    let file = file::File::new(data)
+    let file = file::File::new(data).ok_or("cannot read ELF header")?;
-        .ok_or("cannot read ELF header")?;
     if file.ehdr.e_type != ET_DYN {
-        return Err("not a shared library")?
+        return Err("not a shared library")?;
     }
-    let arch = file.arch()
+    let arch = file.arch().ok_or("not for a supported architecture")?;
-        .ok_or("not for a supported architecture")?;
 
     // prepare target memory
-    let image_size = file.program_headers()
+    let image_size = file
+        .program_headers()
         .filter_map(|phdr| phdr.map(|phdr| phdr.p_vaddr + phdr.p_memsz))
         .max()
         .unwrap_or(0) as usize;
-    let image_align = file.program_headers()
+    let image_align = file
-        .filter_map(|phdr| phdr.and_then(|phdr| {
+        .program_headers()
-            if phdr.p_type == PT_LOAD {
+        .filter_map(|phdr| {
-                Some(phdr.p_align)
+            phdr.and_then(|phdr| {
-            } else {
+                if phdr.p_type == PT_LOAD {
-                None
+                    Some(phdr.p_align)
-            }
+                } else {
-        }))
+                    None
+                }
+            })
+        })
         .max()
         .unwrap_or(4) as usize;
     // 1 image for all segments
-    let mut image = image::Image::new(image_size, image_align)
+    let mut image = image::Image::new(image_size, image_align).map_err(|_| "cannot allocate target image")?;
-        .map_err(|_| "cannot allocate target image")?;
+    debug!(
-    debug!("ELF target: {} bytes, align to {:X}, allocated at {:08X}", image_size, image_align, image.ptr() as usize);
+        "ELF target: {} bytes, align to {:X}, allocated at {:08X}",
+        image_size,
+        image_align,
+        image.ptr() as usize
+    );
 
     // LOAD
     for phdr in file.program_headers() {
         let phdr = phdr.ok_or("cannot read program header")?;
-        trace!("Program header: {:08X}+{:08X} to {:08X}",
+        trace!(
-              phdr.p_offset, phdr.p_filesz,
+            "Program header: {:08X}+{:08X} to {:08X}",
-              image.ptr() as u32
+            phdr.p_offset,
+            phdr.p_filesz,
+            image.ptr() as u32
         );
         let file_range = phdr.p_offset as usize..(phdr.p_offset + phdr.p_filesz) as usize;
         match phdr.p_type {
             PT_LOAD => {
-                let src = file.get(file_range)
+                let src = file
+                    .get(file_range)
                     .ok_or("program header requests an out of bounds load (in file)")?;
-                let dst = image.get_mut(phdr.p_vaddr as usize..
+                let dst = image
-                                        (phdr.p_vaddr + phdr.p_filesz) as usize)
+                    .get_mut(phdr.p_vaddr as usize..(phdr.p_vaddr + phdr.p_filesz) as usize)
                     .ok_or("program header requests an out of bounds load (in target)")?;
                 dst.copy_from_slice(src);
             }
@@ -203,9 +215,9 @@ pub fn load(
         let shdr = shdr.ok_or("cannot read section header")?;
         match shdr.sh_type as usize {
             SHT_ARM_EXIDX => {
-                let range = shdr.sh_addr as usize..
+                let range = shdr.sh_addr as usize..(shdr.sh_addr + shdr.sh_size) as usize;
-                    (shdr.sh_addr + shdr.sh_size) as usize;
+                let _ = image
-                let _ = image.get(range.clone())
+                    .get(range.clone())
                     .ok_or("section header specifies EXIDX outside of image (in target)")?;
                 exidx = Some(range);
             }
@@ -214,11 +226,14 @@ pub fn load(
     }
 
     // relocate DYNAMIC
-    let dyn_range = file.dyn_header_vaddr()
+    let dyn_range = file.dyn_header_vaddr().ok_or("cannot find a dynamic header")?;
-        .ok_or("cannot find a dynamic header")?;
     let dyn_section = image.dyn_section(dyn_range.clone())?;
-    debug!("Relocating {} rela, {} rel, {} pltrel",
+    debug!(
-           dyn_section.rela.len(), dyn_section.rel.len(), dyn_section.pltrel.len());
+        "Relocating {} rela, {} rel, {} pltrel",
+        dyn_section.rela.len(),
+        dyn_section.rel.len(),
+        dyn_section.pltrel.len()
+    );
     let lib = Library {
         arch,
         image,

src/libdyld/src/reloc.rs

@@ -1,16 +1,10 @@
 use alloc::string::String;
+
+use libcortex_a9::{asm::{dsb, isb},
+                   cache::{bpiall, dcci_slice, iciallu}};
 use log::trace;
-use super::{
+
-    Arch,
+use super::{elf::*, image::Image, Arch, Error, Library};
-    elf::*,
-    Error,
-    image::Image,
-    Library,
-};
-use libcortex_a9::{
-    cache::{dcci_slice, iciallu, bpiall},
-    asm::{dsb, isb},
-};
 
 pub trait Relocatable {
     fn offset(&self) -> usize;
@@ -66,25 +60,18 @@ enum RelType {
 impl RelType {
     pub fn new(arch: Arch, type_info: u8) -> Option<Self> {
         match type_info {
-            R_OR1K_NONE if arch == Arch::OpenRisc =>
+            R_OR1K_NONE if arch == Arch::OpenRisc => Some(RelType::None),
-                Some(RelType::None),
+            R_ARM_NONE if arch == Arch::Arm => Some(RelType::None),
-            R_ARM_NONE if arch == Arch::Arm =>
-                Some(RelType::None),
 
-            R_OR1K_RELATIVE if arch == Arch::OpenRisc =>
+            R_OR1K_RELATIVE if arch == Arch::OpenRisc => Some(RelType::Relative),
-                Some(RelType::Relative),
+            R_ARM_RELATIVE if arch == Arch::Arm => Some(RelType::Relative),
-            R_ARM_RELATIVE if arch == Arch::Arm =>
-                Some(RelType::Relative),
 
-            R_OR1K_32 | R_OR1K_GLOB_DAT | R_OR1K_JMP_SLOT
+            R_OR1K_32 | R_OR1K_GLOB_DAT | R_OR1K_JMP_SLOT if arch == Arch::OpenRisc => Some(RelType::LookupAbs),
-                if arch == Arch::OpenRisc => Some(RelType::LookupAbs),
+            R_ARM_GLOB_DAT | R_ARM_JUMP_SLOT | R_ARM_ABS32 if arch == Arch::Arm => Some(RelType::LookupAbs),
-            R_ARM_GLOB_DAT | R_ARM_JUMP_SLOT | R_ARM_ABS32
-                if arch == Arch::Arm => Some(RelType::LookupAbs),
 
             R_ARM_PREL31 if arch == Arch::Arm => Some(RelType::LookupRel),
 
-            _ =>
+            _ => None,
-                None
         }
     }
 }
@@ -96,22 +83,25 @@ fn format_sym_name(sym_name: &[u8]) -> String {
 }
 
 pub fn relocate<R: Relocatable>(
-    arch: Arch, lib: &Library,
+    arch: Arch,
-    rel: &R, resolve: &dyn Fn(&[u8]) -> Option<Elf32_Word>
+    lib: &Library,
+    rel: &R,
+    resolve: &dyn Fn(&[u8]) -> Option<Elf32_Word>,
 ) -> Result<(), Error> {
     let sym;
     if rel.sym_info() == 0 {
         sym = None;
     } else {
-        sym = Some(lib.symtab().get(rel.sym_info() as usize)
+        sym = Some(
-                   .ok_or("symbol out of bounds of symbol table")?)
+            lib.symtab()
+                .get(rel.sym_info() as usize)
+                .ok_or("symbol out of bounds of symbol table")?,
+        )
     }
 
-    let rel_type = RelType::new(arch, rel.type_info())
+    let rel_type = RelType::new(arch, rel.type_info()).ok_or("unsupported relocation type")?;
-        .ok_or("unsupported relocation type")?;
     let value = match rel_type {
-        RelType::None =>
+        RelType::None => return Ok(()),
-            return Ok(()),
 
         RelType::Relative => {
             let addend = rel.addend(&lib.image);
@@ -132,42 +122,48 @@ pub fn relocate<R: Relocatable>(
                 addr
             } else {
                 // We couldn't find it anywhere.
-                return Err(Error::Lookup(format_sym_name(sym_name)))
+                return Err(Error::Lookup(format_sym_name(sym_name)));
             };
 
             match rel_type {
                 RelType::LookupAbs => sym_addr,
-                RelType::LookupRel =>
+                RelType::LookupRel => {
-                    sym_addr.wrapping_sub(
+                    sym_addr.wrapping_sub(lib.image.ptr().wrapping_offset(rel.offset() as isize) as Elf32_Addr)
-                        lib.image.ptr().wrapping_offset(rel.offset() as isize) as Elf32_Addr),
+                }
-                _ => unreachable!()
+                _ => unreachable!(),
             }
         }
     };
 
     match rel.type_info() {
         R_ARM_PREL31 => {
-            let reloc_word = lib.image.get_ref::<Elf32_Word>(rel.offset())
+            let reloc_word = lib
-                                .ok_or("relocation offset cannot be read")?;
+                .image
-            lib.image.write(rel.offset(), (reloc_word & 0x80000000) | (value & 0x7FFFFFFF))
+                .get_ref::<Elf32_Word>(rel.offset())
-        },
+                .ok_or("relocation offset cannot be read")?;
+            lib.image
+                .write(rel.offset(), (reloc_word & 0x80000000) | (value & 0x7FFFFFFF))
+        }
 
         _ => lib.image.write(rel.offset(), value),
     }
 }
 
-pub fn rebind(
+pub fn rebind(arch: Arch, lib: &Library, name: &[u8], value: Elf32_Word) -> Result<(), Error> {
-    arch: Arch, lib: &Library, name: &[u8], value: Elf32_Word
-) -> Result<(), Error> {
     fn rebind_symbol_to_value<R: Relocatable>(
-        arch: Arch, lib: &Library,name: &[u8], value: Elf32_Word, relocs: &[R]
+        arch: Arch,
+        lib: &Library,
+        name: &[u8],
+        value: Elf32_Word,
+        relocs: &[R],
     ) -> Result<(), Error> {
         for reloc in relocs {
-            let rel_type = RelType::new(arch, reloc.type_info())
+            let rel_type = RelType::new(arch, reloc.type_info()).ok_or("unsupported relocation type")?;
-                .ok_or("unsupported relocation type")?;
             match rel_type {
                 RelType::LookupAbs => {
-                    let sym = lib.symtab().get(reloc.sym_info() as usize)
+                    let sym = lib
+                        .symtab()
+                        .get(reloc.sym_info() as usize)
                         .ok_or("symbol out of bounds of symbol table")?;
                     let sym_name = lib.name_starting_at(sym.st_name as usize)?;
 

src/libio/Cargo.toml.tpl

@@ -11,7 +11,7 @@ path = "lib.rs"
 core_io = { version = "0.1", features = ["collections"] }
 byteorder = { version = "1.0", default-features = false, optional = true }
 
-libsupport_zynq = { default-features = false, features = ["alloc_core"], git = "https://git.m-labs.hk/M-Labs/zynq-rs.git" }
+libsupport_zynq = { path = "@@ZYNQ_RS@@/libsupport_zynq", default-features = false, features = ["alloc_core"] }
 
 [features]
 alloc = []

src/libio/cursor.rs

@@ -1,9 +1,12 @@
-use core_io::{Read, Write, Error as IoError};
+#[cfg(feature = "alloc")]
+use alloc::vec::Vec;
+
+use core_io::{Error as IoError, Read, Write};
 
 #[derive(Debug, Clone)]
 pub struct Cursor<T> {
     inner: T,
-    pos:   usize
+    pos: usize,
 }
 
 impl<T> Cursor<T> {
@@ -39,22 +42,25 @@ impl<T> Cursor<T> {
 }
 
 impl<T: AsRef<[u8]>> Read for Cursor<T> {
-
     fn read(&mut self, buf: &mut [u8]) -> Result<usize, IoError> {
         let data = &self.inner.as_ref()[self.pos..];
         let len = buf.len().min(data.len());
-        buf[..len].copy_from_slice(&data[..len]);
+        // ``copy_from_slice`` generates AXI bursts, use a regular loop instead
+        for i in 0..len {
+            buf[i] = data[i];
+        }
         self.pos += len;
         Ok(len)
     }
 }
 
 impl Write for Cursor<&mut [u8]> {
-
     fn write(&mut self, buf: &[u8]) -> Result<usize, IoError> {
         let data = &mut self.inner[self.pos..];
-        let len  = buf.len().min(data.len());
+        let len = buf.len().min(data.len());
-        data[..len].copy_from_slice(&buf[..len]);
+        for i in 0..len {
+            data[i] = buf[i];
+        }
         self.pos += len;
         Ok(len)
     }
@@ -66,9 +72,7 @@ impl Write for Cursor<&mut [u8]> {
 }
 
 #[cfg(feature = "alloc")]
-impl Write for Cursor<::alloc::Vec<u8>> {
+impl Write for Cursor<Vec<u8>> {
-
-    #[inline]
     fn write(&mut self, buf: &[u8]) -> Result<usize, IoError> {
         self.inner.extend_from_slice(buf);
         Ok(buf.len())

src/libio/lib.rs

@@ -1,13 +1,10 @@
 #![no_std]
 #![feature(never_type)]
-#![cfg_attr(feature = "alloc", feature(alloc))]
 
+#[cfg(feature = "alloc")]
 extern crate alloc;
 extern crate core_io;
 
-#[cfg(feature = "alloc")]
-#[macro_use]
-use alloc;
 #[cfg(feature = "byteorder")]
 extern crate byteorder;
 
@@ -16,7 +13,7 @@ pub mod cursor;
 pub mod proto;
 
 pub use cursor::Cursor;
+#[cfg(all(feature = "byteorder", feature = "alloc"))]
+pub use proto::ReadStringError;
 #[cfg(feature = "byteorder")]
 pub use proto::{ProtoRead, ProtoWrite};
-#[cfg(all(feature = "byteorder", feature = "alloc"))]
-pub use proto::ReadStringError;

src/libio/proto.rs

@@ -1,15 +1,15 @@
+#[cfg(feature = "alloc")]
+use alloc::{string::String, vec};
 use core::str::Utf8Error;
-use byteorder::{ByteOrder, NativeEndian};
-use alloc::vec;
-use alloc::string::String;
 
-use core_io::{Read, Write, Error as IoError};
+use byteorder::{ByteOrder, NativeEndian};
+use core_io::{Error as IoError, Read, Write};
 
 #[allow(dead_code)]
 #[derive(Debug, Clone, PartialEq)]
 pub enum ReadStringError<T> {
     Utf8(Utf8Error),
-    Other(T)
+    Other(T),
 }
 
 pub trait ProtoRead {
@@ -51,7 +51,8 @@ pub trait ProtoRead {
     }
 
     #[inline]
-    fn read_bytes(&mut self) -> Result<::alloc::vec::Vec<u8>, Self::ReadError> {
+    #[cfg(feature = "alloc")]
+    fn read_bytes(&mut self) -> Result<vec::Vec<u8>, Self::ReadError> {
         let length = self.read_u32()?;
         let mut value = vec![0; length as usize];
         self.read_exact(&mut value)?;
@@ -59,7 +60,8 @@ pub trait ProtoRead {
     }
 
     #[inline]
-    fn read_string(&mut self) -> Result<::alloc::string::String, ReadStringError<Self::ReadError>> {
+    #[cfg(feature = "alloc")]
+    fn read_string(&mut self) -> Result<String, ReadStringError<Self::ReadError>> {
         let bytes = self.read_bytes().map_err(ReadStringError::Other)?;
         String::from_utf8(bytes).map_err(|err| ReadStringError::Utf8(err.utf8_error()))
     }
@@ -136,12 +138,15 @@ pub trait ProtoWrite {
     }
 
     #[inline]
+    #[cfg(feature = "alloc")]
     fn write_string(&mut self, value: &str) -> Result<(), Self::WriteError> {
         self.write_bytes(value.as_bytes())
     }
 }
 
-impl<T> ProtoRead for T where T: Read + ?Sized {
+impl<T> ProtoRead for T
+where T: Read + ?Sized
+{
     type ReadError = IoError;
 
     fn read_exact(&mut self, buf: &mut [u8]) -> Result<(), Self::ReadError> {
@@ -149,7 +154,9 @@ impl<T> ProtoRead for T where T: Read + ?Sized {
     }
 }
 
-impl<T> ProtoWrite for T where T: Write + ?Sized {
+impl<T> ProtoWrite for T
+where T: Write + ?Sized
+{
     type WriteError = IoError;
 
     fn write_all(&mut self, buf: &[u8]) -> Result<(), Self::WriteError> {

src/libksupport/Cargo.toml.tpl

@@ -0,0 +1,40 @@
+[package]
+name = "ksupport"
+description = "Kernel support for Zynq-based platforms"
+version = "0.1.0"
+authors = ["M-Labs"]
+edition = "2018"
+
+[build-dependencies]
+build_zynq = { path = "../libbuild_zynq" }
+
+[dependencies]
+cslice = "0.3"
+log = "0.4"
+nb = "0.1"
+core_io = { version = "0.1", features = ["collections"] }
+byteorder = { version = "1.3", default-features = false }
+void = { version = "1", default-features = false }
+log_buffer = { version = "1.2" }
+libm = { version = "0.2", features = ["unstable"] }
+vcell = "0.1"
+
+libboard_zynq = { path = "@@ZYNQ_RS@@/libboard_zynq", features = ["ipv6"]}
+libsupport_zynq = { path = "@@ZYNQ_RS@@/libsupport_zynq", default-features = false, features = ["alloc_core"] }
+libcortex_a9 = { path = "@@ZYNQ_RS@@/libcortex_a9" }
+libasync = { path = "@@ZYNQ_RS@@/libasync" }
+libregister = { path = "@@ZYNQ_RS@@/libregister" }
+libconfig = { path = "@@ZYNQ_RS@@/libconfig", features = ["fat_lfn", "ipv6"] }
+
+dyld = { path = "../libdyld" }
+dwarf = { path = "../libdwarf" }
+unwind = { path = "../libunwind" }
+libc = { path = "../libc" }
+io = { path = "../libio" }
+libboard_artiq = { path = "../libboard_artiq" }
+
+[dependencies.nalgebra]
+git = "https://git.m-labs.hk/M-Labs/nalgebra.git"
+rev = "dd00f9b"
+default-features = false
+features = ["libm", "alloc"]

src/libksupport/build.rs

@@ -0,0 +1,5 @@
+extern crate build_zynq;
+
+fn main() {
+    build_zynq::cfg();
+}

src/libksupport/src/eh_artiq.rs

@@ -13,14 +13,16 @@
 #![allow(non_camel_case_types)]
 
 use core::mem;
-use cslice::CSlice;
-use unwind as uw;
-use libc::{c_int, c_void, uintptr_t};
-use log::{trace, error};
-use crate::kernel::KERNEL_IMAGE;
 
+use core_io::Error as ReadError;
+use cslice::{AsCSlice, CSlice};
 use dwarf::eh::{self, EHAction, EHContext};
+use io::{Cursor, ProtoRead};
+use libc::{c_int, c_void, uintptr_t};
+use log::{error, trace};
+use unwind as uw;
 
+use crate::kernel::KERNEL_IMAGE;
 
 const EXCEPTION_CLASS: uw::_Unwind_Exception_Class = 0x4d_4c_42_53_41_52_54_51; /* 'MLBSARTQ' */
 
@@ -32,13 +34,13 @@ const UNWIND_DATA_REG: (i32, i32) = (0, 1); // R0, R1
 #[repr(C)]
 #[derive(Clone, Copy)]
 pub struct Exception<'a> {
-    pub id:       u32,
+    pub id: u32,
-    pub file:     CSlice<'a, u8>,
+    pub file: CSlice<'a, u8>,
-    pub line:     u32,
+    pub line: u32,
-    pub column:   u32,
+    pub column: u32,
     pub function: CSlice<'a, u8>,
-    pub message:  CSlice<'a, u8>,
+    pub message: CSlice<'a, u8>,
-    pub param:    [i64; 3]
+    pub param: [i64; 3],
 }
 
 fn str_err(_: core::str::Utf8Error) -> core::fmt::Error {
@@ -55,12 +57,16 @@ fn exception_str<'a>(s: &'a CSlice<'a, u8>) -> Result<&'a str, core::str::Utf8Er
 
 impl<'a> core::fmt::Debug for Exception<'a> {
     fn fmt(&self, f: &mut core::fmt::Formatter<'_>) -> core::fmt::Result {
-        write!(f, "Exception {} from {} in {}:{}:{}, message: {}",
+        write!(
+            f,
+            "Exception {} from {} in {}:{}:{}, message: {}",
             self.id,
             exception_str(&self.function).map_err(str_err)?,
             exception_str(&self.file).map_err(str_err)?,
-            self.line, self.column,
+            self.line,
-            exception_str(&self.message).map_err(str_err)?)
+            self.column,
+            exception_str(&self.message).map_err(str_err)?
+        )
     }
 }
 
@@ -91,9 +97,9 @@ struct ExceptionBuffer {
 
 static mut EXCEPTION_BUFFER: ExceptionBuffer = ExceptionBuffer {
     uw_exceptions: [uw::_Unwind_Exception {
-        exception_class:   EXCEPTION_CLASS,
+        exception_class: EXCEPTION_CLASS,
         exception_cleanup: cleanup,
-        private:           [0; uw::unwinder_private_data_size],
+        private: [0; uw::unwinder_private_data_size],
     }; MAX_INFLIGHT_EXCEPTIONS],
     exceptions: [None; MAX_INFLIGHT_EXCEPTIONS + 1],
     exception_stack: [-1; MAX_INFLIGHT_EXCEPTIONS + 1],
@@ -102,17 +108,17 @@ static mut EXCEPTION_BUFFER: ExceptionBuffer = ExceptionBuffer {
     stack_pointers: [StackPointerBacktrace {
         stack_pointer: 0,
         initial_backtrace_size: 0,
-        current_backtrace_size: 0
+        current_backtrace_size: 0,
     }; MAX_INFLIGHT_EXCEPTIONS + 1],
-    exception_count: 0
+    exception_count: 0,
 };
 
-pub unsafe extern fn reset_exception_buffer() {
+pub unsafe extern "C" fn reset_exception_buffer() {
     trace!("reset exception buffer");
     EXCEPTION_BUFFER.uw_exceptions = [uw::_Unwind_Exception {
-        exception_class:   EXCEPTION_CLASS,
+        exception_class: EXCEPTION_CLASS,
         exception_cleanup: cleanup,
-        private:           [0; uw::unwinder_private_data_size],
+        private: [0; uw::unwinder_private_data_size],
     }; MAX_INFLIGHT_EXCEPTIONS];
     EXCEPTION_BUFFER.exceptions = [None; MAX_INFLIGHT_EXCEPTIONS + 1];
     EXCEPTION_BUFFER.exception_stack = [-1; MAX_INFLIGHT_EXCEPTIONS + 1];
@@ -120,26 +126,25 @@ pub unsafe extern fn reset_exception_buffer() {
     EXCEPTION_BUFFER.exception_count = 0;
 }
 
-type _Unwind_Stop_Fn = extern "C" fn(version: c_int,
+type _Unwind_Stop_Fn = extern "C" fn(
-                                     actions: i32,
+    version: c_int,
-                                     exception_class: uw::_Unwind_Exception_Class,
+    actions: i32,
-                                     exception_object: *mut uw::_Unwind_Exception,
+    exception_class: uw::_Unwind_Exception_Class,
-                                     context: *mut uw::_Unwind_Context,
+    exception_object: *mut uw::_Unwind_Exception,
-                                     stop_parameter: *mut c_void)
+    context: *mut uw::_Unwind_Context,
-                                    -> uw::_Unwind_Reason_Code;
+    stop_parameter: *mut c_void,
+) -> uw::_Unwind_Reason_Code;
 
-extern {
+extern "C" {
     // not defined in EHABI, but LLVM added it and is useful to us
-    fn _Unwind_ForcedUnwind(exception: *mut uw::_Unwind_Exception,
+    fn _Unwind_ForcedUnwind(
-                            stop_fn: _Unwind_Stop_Fn,
+        exception: *mut uw::_Unwind_Exception,
-                            stop_parameter: *mut c_void) -> uw::_Unwind_Reason_Code;
+        stop_fn: _Unwind_Stop_Fn,
+        stop_parameter: *mut c_void,
+    ) -> uw::_Unwind_Reason_Code;
 }
 
-unsafe fn find_eh_action(
+unsafe fn find_eh_action(context: *mut uw::_Unwind_Context, foreign_exception: bool, id: u32) -> Result<EHAction, ()> {
-    context: *mut uw::_Unwind_Context,
-    foreign_exception: bool,
-    id: u32,
-) -> Result<EHAction, ()> {
     let lsda = uw::_Unwind_GetLanguageSpecificData(context) as *const u8;
     let mut ip_before_instr: c_int = 0;
     let ip = uw::_Unwind_GetIPInfo(context, &mut ip_before_instr);
@@ -154,10 +159,11 @@ unsafe fn find_eh_action(
     eh::find_eh_action(lsda, &eh_context, foreign_exception, id)
 }
 
-pub unsafe fn artiq_personality(_state: uw::_Unwind_State,
+pub unsafe fn artiq_personality(
-                                exception_object: *mut uw::_Unwind_Exception,
+    _state: uw::_Unwind_State,
-                                context: *mut uw::_Unwind_Context)
+    exception_object: *mut uw::_Unwind_Exception,
-                                -> uw::_Unwind_Reason_Code {
+    context: *mut uw::_Unwind_Context,
+) -> uw::_Unwind_Reason_Code {
     // we will only do phase 2 forced unwinding now
     // The DWARF unwinder assumes that _Unwind_Context holds things like the function
     // and LSDA pointers, however ARM EHABI places them into the exception object.
@@ -165,9 +171,7 @@ pub unsafe fn artiq_personality(_state: uw::_Unwind_State,
     // take only the context pointer, GCC personality routines stash a pointer to
     // exception_object in the context, using location reserved for ARM's
     // "scratch register" (r12).
-    uw::_Unwind_SetGR(context,
+    uw::_Unwind_SetGR(context, uw::UNWIND_POINTER_REG, exception_object as uw::_Unwind_Ptr);
-                      uw::UNWIND_POINTER_REG,
-                      exception_object as uw::_Unwind_Ptr);
     // ...A more principled approach would be to provide the full definition of ARM's
     // _Unwind_Context in our libunwind bindings and fetch the required data from there
     // directly, bypassing DWARF compatibility functions.
@@ -186,10 +190,8 @@ pub unsafe fn artiq_personality(_state: uw::_Unwind_State,
     };
     match eh_action {
         EHAction::None => return continue_unwind(exception_object, context),
-        EHAction::Cleanup(lpad) |
+        EHAction::Cleanup(lpad) | EHAction::Catch(lpad) => {
-        EHAction::Catch(lpad) => {
+            uw::_Unwind_SetGR(context, UNWIND_DATA_REG.0, exception_object as uintptr_t);
-            uw::_Unwind_SetGR(context, UNWIND_DATA_REG.0,
-                              exception_object as uintptr_t);
             uw::_Unwind_SetGR(context, UNWIND_DATA_REG.1, exception as *const _ as uw::_Unwind_Word);
             uw::_Unwind_SetIP(context, lpad);
             return uw::_URC_INSTALL_CONTEXT;
@@ -199,9 +201,10 @@ pub unsafe fn artiq_personality(_state: uw::_Unwind_State,
 
     // On ARM EHABI the personality routine is responsible for actually
     // unwinding a single stack frame before returning (ARM EHABI Sec. 6.1).
-    unsafe fn continue_unwind(exception_object: *mut uw::_Unwind_Exception,
+    unsafe fn continue_unwind(
-                              context: *mut uw::_Unwind_Context)
+        exception_object: *mut uw::_Unwind_Exception,
-                              -> uw::_Unwind_Reason_Code {
+        context: *mut uw::_Unwind_Context,
+    ) -> uw::_Unwind_Reason_Code {
         let reason = __gnu_unwind_frame(exception_object, context);
         if reason == uw::_URC_NO_REASON {
             uw::_URC_CONTINUE_UNWIND
@@ -211,15 +214,14 @@ pub unsafe fn artiq_personality(_state: uw::_Unwind_State,
     }
     // defined in libgcc
     extern "C" {
-        fn __gnu_unwind_frame(exception_object: *mut uw::_Unwind_Exception,
+        fn __gnu_unwind_frame(
-                              context: *mut uw::_Unwind_Context)
+            exception_object: *mut uw::_Unwind_Exception,
-                              -> uw::_Unwind_Reason_Code;
+            context: *mut uw::_Unwind_Context,
+        ) -> uw::_Unwind_Reason_Code;
     }
 }
 
-pub unsafe extern fn raise(exception: *const Exception) -> ! {
+pub unsafe extern "C" fn raise(exception: *const Exception) -> ! {
-    use cslice::AsCSlice;
-
     let count = EXCEPTION_BUFFER.exception_count;
     let stack = &mut EXCEPTION_BUFFER.exception_stack;
     let diff = exception as isize - EXCEPTION_BUFFER.exceptions.as_ptr() as isize;
@@ -244,8 +246,11 @@ pub unsafe extern fn raise(exception: *const Exception) -> ! {
             }
         }
         assert!(found);
-        let _result = _Unwind_ForcedUnwind(&mut EXCEPTION_BUFFER.uw_exceptions[stack[count - 1] as usize],
+        let _result = _Unwind_ForcedUnwind(
-                                           stop_fn, core::ptr::null_mut());
+            &mut EXCEPTION_BUFFER.uw_exceptions[stack[count - 1] as usize],
+            stop_fn,
+            core::ptr::null_mut(),
+        );
     } else {
         if count < MAX_INFLIGHT_EXCEPTIONS {
             trace!("raising exception at level {}", count);
@@ -253,34 +258,33 @@ pub unsafe extern fn raise(exception: *const Exception) -> ! {
             for (i, slot) in EXCEPTION_BUFFER.exceptions.iter_mut().enumerate() {
                 // we should always be able to find a slot
                 if slot.is_none() {
-                    *slot = Some(
+                    *slot = Some(*mem::transmute::<*const Exception, *const Exception<'static>>(
-                        *mem::transmute::<*const Exception, *const Exception<'static>>
+                        exception,
-                        (exception));
+                    ));
                     EXCEPTION_BUFFER.exception_stack[count] = i as isize;
-                    EXCEPTION_BUFFER.uw_exceptions[i].private =
+                    EXCEPTION_BUFFER.uw_exceptions[i].private = [0; uw::unwinder_private_data_size];
-                        [0; uw::unwinder_private_data_size];
                     EXCEPTION_BUFFER.stack_pointers[i] = StackPointerBacktrace {
                         stack_pointer: 0,
                         initial_backtrace_size: EXCEPTION_BUFFER.backtrace_size,
                         current_backtrace_size: 0,
                     };
                     EXCEPTION_BUFFER.exception_count += 1;
-                    let _result = _Unwind_ForcedUnwind(&mut EXCEPTION_BUFFER.uw_exceptions[i],
+                    let _result =
-                                                       stop_fn, core::ptr::null_mut());
+                        _Unwind_ForcedUnwind(&mut EXCEPTION_BUFFER.uw_exceptions[i], stop_fn, core::ptr::null_mut());
                 }
             }
         } else {
             error!("too many nested exceptions");
             // TODO: better reporting?
             let exception = Exception {
-                id:       get_exception_id("RuntimeError"),
+                id: get_exception_id("RuntimeError"),
-                file:     file!().as_c_slice(),
+                file: file!().as_c_slice(),
-                line:     line!(),
+                line: line!(),
-                column:   column!(),
+                column: column!(),
                 // https://github.com/rust-lang/rfcs/pull/1719
                 function: "__artiq_raise".as_c_slice(),
-                message:  "too many nested exceptions".as_c_slice(),
+                message: "too many nested exceptions".as_c_slice(),
-                param:    [0, 0, 0]
+                param: [0, 0, 0],
             };
             EXCEPTION_BUFFER.exceptions[MAX_INFLIGHT_EXCEPTIONS] = Some(mem::transmute(exception));
             EXCEPTION_BUFFER.stack_pointers[MAX_INFLIGHT_EXCEPTIONS] = Default::default();
@@ -291,17 +295,74 @@ pub unsafe extern fn raise(exception: *const Exception) -> ! {
     unreachable!();
 }
 
-pub unsafe extern fn resume() -> ! {
+fn read_exception_string<'a>(reader: &mut Cursor<&[u8]>) -> Result<CSlice<'a, u8>, ReadError> {
+    let len = reader.read_u32()? as usize;
+    if len == usize::MAX {
+        let data = reader.read_u32()?;
+        Ok(unsafe { CSlice::new(data as *const u8, len) })
+    } else {
+        let pos = reader.position();
+        let slice = unsafe {
+            let ptr = reader.get_ref().as_ptr().offset(pos as isize);
+            CSlice::new(ptr, len)
+        };
+        reader.set_position(pos + len);
+        Ok(slice)
+    }
+}
+
+fn read_exception(raw_exception: &[u8]) -> Result<Exception, ReadError> {
+    let mut reader = Cursor::new(raw_exception);
+
+    let mut byte = reader.read_u8()?;
+    // to sync
+    while byte != 0x5a {
+        byte = reader.read_u8()?;
+    }
+    // skip sync bytes, 0x09 indicates exception
+    while byte != 0x09 {
+        byte = reader.read_u8()?;
+    }
+    let _len = reader.read_u32()?;
+    // ignore the remaining exceptions, stack traces etc. - unwinding from another device would be unwise anyway
+    Ok(Exception {
+        id: reader.read_u32()?,
+        message: read_exception_string(&mut reader)?,
+        param: [
+            reader.read_u64()? as i64,
+            reader.read_u64()? as i64,
+            reader.read_u64()? as i64,
+        ],
+        file: read_exception_string(&mut reader)?,
+        line: reader.read_u32()?,
+        column: reader.read_u32()?,
+        function: read_exception_string(&mut reader)?,
+    })
+}
+
+pub fn raise_raw(raw_exception: &[u8]) -> ! {
+    use crate::artiq_raise;
+    if let Ok(exception) = read_exception(raw_exception) {
+        unsafe { raise(&exception) };
+    } else {
+        artiq_raise!("SubkernelError", "Error passing exception");
+    }
+}
+
+pub unsafe extern "C" fn resume() -> ! {
     trace!("resume");
     assert!(EXCEPTION_BUFFER.exception_count != 0);
     let i = EXCEPTION_BUFFER.exception_stack[EXCEPTION_BUFFER.exception_count - 1];
     assert!(i != -1);
-    let _result = _Unwind_ForcedUnwind(&mut EXCEPTION_BUFFER.uw_exceptions[i as usize],
+    let _result = _Unwind_ForcedUnwind(
-                                       stop_fn, core::ptr::null_mut());
+        &mut EXCEPTION_BUFFER.uw_exceptions[i as usize],
+        stop_fn,
+        core::ptr::null_mut(),
+    );
     unreachable!()
 }
 
-pub unsafe extern fn end_catch() {
+pub unsafe extern "C" fn end_catch() {
     let mut count = EXCEPTION_BUFFER.exception_count;
     assert!(count != 0);
     // we remove all exceptions with SP <= current exception SP
@@ -309,8 +370,7 @@ pub unsafe extern fn end_catch() {
     let index = EXCEPTION_BUFFER.exception_stack[count - 1] as usize;
     EXCEPTION_BUFFER.exception_stack[count - 1] = -1;
     EXCEPTION_BUFFER.exceptions[index] = None;
-    let outer_sp = EXCEPTION_BUFFER.stack_pointers
+    let outer_sp = EXCEPTION_BUFFER.stack_pointers[index].stack_pointer;
-        [index].stack_pointer;
     count -= 1;
     for i in (0..count).rev() {
         let index = EXCEPTION_BUFFER.exception_stack[i];
@@ -334,8 +394,7 @@ pub unsafe extern fn end_catch() {
     };
 }
 
-extern fn cleanup(_unwind_code: uw::_Unwind_Reason_Code,
+extern "C" fn cleanup(_unwind_code: uw::_Unwind_Reason_Code, _uw_exception: *mut uw::_Unwind_Exception) {
-                  _uw_exception: *mut uw::_Unwind_Exception) {
     unimplemented!()
 }
 
@@ -345,18 +404,26 @@ fn uncaught_exception() -> ! {
         for i in 0..EXCEPTION_BUFFER.exception_count {
             if EXCEPTION_BUFFER.exception_stack[i] != i as isize {
                 // find the correct index
-                let index = EXCEPTION_BUFFER.exception_stack
+                let index = EXCEPTION_BUFFER
+                    .exception_stack
                     .iter()
-                    .position(|v| *v == i as isize).unwrap();
+                    .position(|v| *v == i as isize)
+                    .unwrap();
                 let a = EXCEPTION_BUFFER.exception_stack[index];
                 let b = EXCEPTION_BUFFER.exception_stack[i];
                 assert!(a != -1 && b != -1);
-                core::mem::swap(&mut EXCEPTION_BUFFER.exception_stack[index],
+                core::mem::swap(
-                                &mut EXCEPTION_BUFFER.exception_stack[i]);
+                    &mut EXCEPTION_BUFFER.exception_stack[index],
-                core::mem::swap(&mut EXCEPTION_BUFFER.exceptions[a as usize],
+                    &mut EXCEPTION_BUFFER.exception_stack[i],
-                                &mut EXCEPTION_BUFFER.exceptions[b as usize]);
+                );
-                core::mem::swap(&mut EXCEPTION_BUFFER.stack_pointers[a as usize],
+                core::mem::swap(
-                                &mut EXCEPTION_BUFFER.stack_pointers[b as usize]);
+                    &mut EXCEPTION_BUFFER.exceptions[a as usize],
+                    &mut EXCEPTION_BUFFER.exceptions[b as usize],
+                );
+                core::mem::swap(
+                    &mut EXCEPTION_BUFFER.stack_pointers[a as usize],
+                    &mut EXCEPTION_BUFFER.stack_pointers[b as usize],
+                );
             }
         }
     }
@@ -364,17 +431,20 @@ fn uncaught_exception() -> ! {
         crate::kernel::core1::terminate(
             EXCEPTION_BUFFER.exceptions[..EXCEPTION_BUFFER.exception_count].as_ref(),
             EXCEPTION_BUFFER.stack_pointers[..EXCEPTION_BUFFER.exception_count].as_ref(),
-            EXCEPTION_BUFFER.backtrace[..EXCEPTION_BUFFER.backtrace_size].as_mut())
+            EXCEPTION_BUFFER.backtrace[..EXCEPTION_BUFFER.backtrace_size].as_mut(),
+        )
     }
 }
 
 // stop function which would be executed when we unwind each frame
-extern fn stop_fn(_version: c_int,
+extern "C" fn stop_fn(
-                  actions: i32,
+    _version: c_int,
-                  _uw_exception_class: uw::_Unwind_Exception_Class,
+    actions: i32,
-                  _uw_exception: *mut uw::_Unwind_Exception,
+    _uw_exception_class: uw::_Unwind_Exception_Class,
-                  context: *mut uw::_Unwind_Context,
+    _uw_exception: *mut uw::_Unwind_Exception,
-                  _stop_parameter: *mut c_void) -> uw::_Unwind_Reason_Code {
+    context: *mut uw::_Unwind_Context,
+    _stop_parameter: *mut c_void,
+) -> uw::_Unwind_Reason_Code {
     unsafe {
         let load_addr = KERNEL_IMAGE.as_ref().unwrap().get_load_addr();
         let backtrace_size = EXCEPTION_BUFFER.backtrace_size;
@@ -405,25 +475,36 @@ extern fn stop_fn(_version: c_int,
     }
 }
 
-// Must be kept in sync with preallocate_runtime_exception_names() in artiq/language/embedding_map.py
+// Must be kept in sync with preallocate_runtime_exception_names() in `artiq.compiler.embedding`
-static EXCEPTION_ID_LOOKUP: [(&str, u32); 11] = [
+static EXCEPTION_ID_LOOKUP: [(&str, u32); 22] = [
-    ("RuntimeError", 0),
+    ("RTIOUnderflow", 0),
-    ("RTIOUnderflow", 1),
+    ("RTIOOverflow", 1),
-    ("RTIOOverflow", 2),
+    ("RTIODestinationUnreachable", 2),
-    ("RTIODestinationUnreachable", 3),
+    ("DMAError", 3),
-    ("DMAError", 4),
+    ("I2CError", 4),
-    ("I2CError", 5),
+    ("CacheError", 5),
-    ("CacheError", 6),
+    ("SPIError", 6),
-    ("SPIError", 7),
+    ("SubkernelError", 7),
-    ("ZeroDivisionError", 8),
+    ("AssertionError", 8),
-    ("IndexError", 9),
+    ("AttributeError", 9),
-    ("UnwrapNoneError", 10),
+    ("IndexError", 10),
+    ("IOError", 11),
+    ("KeyError", 12),
+    ("NotImplementedError", 13),
+    ("OverflowError", 14),
+    ("RuntimeError", 15),
+    ("TimeoutError", 16),
+    ("TypeError", 17),
+    ("ValueError", 18),
+    ("ZeroDivisionError", 19),
+    ("LinAlgError", 20),
+    ("UnwrapNoneError", 21),
 ];
 
 pub fn get_exception_id(name: &str) -> u32 {
     for (n, id) in EXCEPTION_ID_LOOKUP.iter() {
         if *n == name {
-            return *id
+            return *id;
         }
     }
     unimplemented!("unallocated internal exception id")
@@ -431,25 +512,50 @@ pub fn get_exception_id(name: &str) -> u32 {
 
 #[macro_export]
 macro_rules! artiq_raise {
-    ($name:expr, $message:expr, $param0:expr, $param1:expr, $param2:expr) => ({
+    ($name:expr, $message:expr, $param0:expr, $param1:expr, $param2:expr) => {{
         use cslice::AsCSlice;
         let name_id = $crate::eh_artiq::get_exception_id($name);
+        let message_cl = $message.clone();
         let exn = $crate::eh_artiq::Exception {
-            id:       name_id,
+            id: name_id,
-            file:     file!().as_c_slice(),
+            file: file!().as_c_slice(),
-            line:     line!(),
+            line: line!(),
-            column:   column!(),
+            column: column!(),
             // https://github.com/rust-lang/rfcs/pull/1719
             function: "(Rust function)".as_c_slice(),
-            message:  $message.as_c_slice(),
+            message: message_cl.as_c_slice(),
-            param:    [$param0, $param1, $param2]
+            param: [$param0, $param1, $param2],
         };
         #[allow(unused_unsafe)]
         unsafe {
             $crate::eh_artiq::raise(&exn)
         }
-    });
+    }};
-    ($name:expr, $message:expr) => ({
+    ($name:expr, $message:expr) => {{ artiq_raise!($name, $message, 0, 0, 0) }};
-        artiq_raise!($name, $message, 0, 0, 0)
+}
-    });
+
+/// Takes as input exception id from host
+/// Generates a new exception with:
+///   * `id` set to `exn_id`
+///   * `message` set to corresponding exception name from `EXCEPTION_ID_LOOKUP`
+///
+/// The message is matched on host to ensure correct exception is being referred
+/// This test checks the synchronization of exception ids for runtime errors
+#[no_mangle]
+pub extern "C" fn test_exception_id_sync(exn_id: u32) {
+    let message = EXCEPTION_ID_LOOKUP
+        .iter()
+        .find_map(|&(name, id)| if id == exn_id { Some(name) } else { None })
+        .unwrap_or("unallocated internal exception id");
+
+    let exn = Exception {
+        id: exn_id,
+        file: file!().as_c_slice(),
+        line: 0,
+        column: 0,
+        function: "test_exception_id_sync".as_c_slice(),
+        message: message.as_c_slice(),
+        param: [0, 0, 0],
+    };
+    unsafe { raise(&exn) };
 }

src/libksupport/src/i2c.rs

@@ -1,9 +1,10 @@
 use libboard_zynq;
+
 use crate::artiq_raise;
 
 pub static mut I2C_BUS: Option<libboard_zynq::i2c::I2c> = None;
 
-pub extern fn start(busno: i32) {
+pub extern "C" fn start(busno: i32) {
     if busno > 0 {
         artiq_raise!("I2CError", "I2C bus could not be accessed");
     }
@@ -14,7 +15,7 @@ pub extern fn start(busno: i32) {
     }
 }
 
-pub extern fn restart(busno: i32) {
+pub extern "C" fn restart(busno: i32) {
     if busno > 0 {
         artiq_raise!("I2CError", "I2C bus could not be accessed");
     }
@@ -25,7 +26,7 @@ pub extern fn restart(busno: i32) {
     }
 }
 
-pub extern fn stop(busno: i32) {
+pub extern "C" fn stop(busno: i32) {
     if busno > 0 {
         artiq_raise!("I2CError", "I2C bus could not be accessed");
     }
@@ -36,7 +37,7 @@ pub extern fn stop(busno: i32) {
     }
 }
 
-pub extern fn write(busno: i32, data: i32) -> bool {
+pub extern "C" fn write(busno: i32, data: i32) -> bool {
     if busno > 0 {
         artiq_raise!("I2CError", "I2C bus could not be accessed");
     }
@@ -48,7 +49,7 @@ pub extern fn write(busno: i32, data: i32) -> bool {
     }
 }
 
-pub extern fn read(busno: i32, ack: bool) -> i32 {
+pub extern "C" fn read(busno: i32, ack: bool) -> i32 {
     if busno > 0 {
         artiq_raise!("I2CError", "I2C bus could not be accessed");
     }
@@ -60,11 +61,12 @@ pub extern fn read(busno: i32, ack: bool) -> i32 {
     }
 }
 
-pub extern fn switch_select(busno: i32, address: i32, mask: i32) {
+pub extern "C" fn switch_select(busno: i32, address: i32, mask: i32) {
     if busno > 0 {
         artiq_raise!("I2CError", "I2C bus could not be accessed");
     }
-    let ch = match mask { //decode from mainline, PCA9548-centric API
+    let ch = match mask {
+        //decode from mainline, PCA9548-centric API
         0x00 => None,
         0x01 => Some(0),
         0x02 => Some(1),
@@ -74,10 +76,15 @@ pub extern fn switch_select(busno: i32, address: i32, mask: i32) {
         0x20 => Some(5),
         0x40 => Some(6),
         0x80 => Some(7),
-        _ => artiq_raise!("I2CError", "switch select supports only one channel")
+        _ => artiq_raise!("I2CError", "switch select supports only one channel"),
     };
     unsafe {
-        if (&mut I2C_BUS).as_mut().unwrap().pca954x_select(address as u8, ch).is_err() {
+        if (&mut I2C_BUS)
+            .as_mut()
+            .unwrap()
+            .pca954x_select(address as u8, ch)
+            .is_err()
+        {
             artiq_raise!("I2CError", "switch select failed");
         }
     }

src/libksupport/src/irq.rs

@@ -1,12 +1,9 @@
-use libboard_zynq::{gic, mpcore, println, stdio};
-use libcortex_a9::{
-    asm, interrupt_handler,
-    regs::MPIDR,
-    spin_lock_yield, notify_spin_lock
-};
-use libregister::RegisterR;
 use core::sync::atomic::{AtomicBool, Ordering};
 
+use libboard_zynq::{gic, mpcore, println, stdio};
+use libcortex_a9::{asm, interrupt_handler, notify_spin_lock, regs::MPIDR, spin_lock_yield};
+use libregister::RegisterR;
+
 extern "C" {
     static mut __stack1_start: u32;
     fn main_core1() -> !;

src/libksupport/src/kernel/api.rs

@@ -1,29 +1,27 @@
-use core::ffi::VaList;
+use alloc::vec;
-use core::ptr;
+use core::{ffi::VaList, ptr, str};
-use core::str;
+
 use libc::{c_char, c_int, size_t};
 use libm;
 use log::{info, warn};
 
-use alloc::vec;
+#[cfg(has_drtio)]
-
+use super::subkernel;
-use crate::eh_artiq;
+use super::{cache,
-use crate::rtio;
+            core1::rtio_get_destination_status,
-use crate::i2c;
+            dma, linalg,
-use super::rpc::{rpc_send, rpc_send_async, rpc_recv};
+            rpc::{rpc_recv, rpc_send, rpc_send_async}};
-use super::dma;
+use crate::{eh_artiq, i2c, rtio};
-use super::cache;
-use super::core1::rtio_get_destination_status;
 
 extern "C" {
     fn vsnprintf_(buffer: *mut c_char, count: size_t, format: *const c_char, va: VaList) -> c_int;
 }
 
-unsafe extern fn core_log(fmt: *const c_char, mut args: ...) {
+unsafe extern "C" fn core_log(fmt: *const c_char, mut args: ...) {
     let size = vsnprintf_(ptr::null_mut(), 0, fmt, args.as_va_list()) as usize;
     let mut buf = vec![0; size + 1];
     vsnprintf_(buf.as_mut_ptr() as *mut i8, size + 1, fmt, args.as_va_list());
-    let buf: &[u8] = &buf.as_slice()[..size-1]; // strip \n and NUL
+    let buf: &[u8] = &buf.as_slice()[..size - 1]; // strip \n and NUL
     match str::from_utf8(buf) {
         Ok(s) => info!("kernel: {}", s),
         Err(e) => {
@@ -33,14 +31,13 @@ unsafe extern fn core_log(fmt: *const c_char, mut args: ...) {
     }
 }
 
-unsafe extern fn rtio_log(fmt: *const c_char, mut args: ...) {
+unsafe extern "C" fn rtio_log(fmt: *const c_char, mut args: ...) {
     let size = vsnprintf_(ptr::null_mut(), 0, fmt, args.as_va_list()) as usize;
     let mut buf = vec![0; size + 1];
     vsnprintf_(buf.as_mut_ptr(), size + 1, fmt, args.as_va_list());
     rtio::write_log(buf.as_slice());
 }
 
-
 macro_rules! api {
     ($i:ident) => ({
         extern { static $i: u8; }
@@ -56,24 +53,25 @@ macro_rules! api {
 }
 
 macro_rules! api_libm_f64f64 {
-    ($i:ident) => ({
+    ($i:ident) => {{
-        extern fn $i(x: f64) -> f64 {
+        extern "C" fn $i(x: f64) -> f64 {
             libm::$i(x)
         }
         api!($i = $i)
-    })
+    }};
 }
 
 macro_rules! api_libm_f64f64f64 {
-    ($i:ident) => ({
+    ($i:ident) => {{
-        extern fn $i(x: f64, y: f64) -> f64 {
+        extern "C" fn $i(x: f64, y: f64) -> f64 {
             libm::$i(x, y)
         }
         api!($i = $i)
-    })
+    }};
 }
 
 pub fn resolve(required: &[u8]) -> Option<u32> {
+    #[rustfmt::skip]
     let api = &[
         // timing
         api!(now_mu = rtio::now_mu),
@@ -118,12 +116,23 @@ pub fn resolve(required: &[u8]) -> Option<u32> {
         api!(i2c_read = i2c::read),
         api!(i2c_switch_select = i2c::switch_select),
 
+        // subkernel
+        #[cfg(has_drtio)]
+        api!(subkernel_load_run = subkernel::load_run),
+        #[cfg(has_drtio)]
+        api!(subkernel_await_finish = subkernel::await_finish),
+        #[cfg(has_drtio)]
+        api!(subkernel_send_message = subkernel::send_message),
+        #[cfg(has_drtio)]
+        api!(subkernel_await_message = subkernel::await_message),
+
         // Double-precision floating-point arithmetic helper functions
         // RTABI chapter 4.1.2, Table 2
         api!(__aeabi_dadd),
         api!(__aeabi_ddiv),
         api!(__aeabi_dmul),
         api!(__aeabi_dsub),
+
         // Double-precision floating-point comparison helper functions
         // RTABI chapter 4.1.2, Table 3
         api!(__aeabi_dcmpeq),
@@ -133,12 +142,14 @@ pub fn resolve(required: &[u8]) -> Option<u32> {
         api!(__aeabi_dcmpge),
         api!(__aeabi_dcmpgt),
         api!(__aeabi_dcmpun),
+
         // Single-precision floating-point arithmetic helper functions
         // RTABI chapter 4.1.2, Table 4
         api!(__aeabi_fadd),
         api!(__aeabi_fdiv),
         api!(__aeabi_fmul),
         api!(__aeabi_fsub),
+
         // Single-precision floating-point comparison helper functions
         // RTABI chapter 4.1.2, Table 5
         api!(__aeabi_fcmpeq),
@@ -148,6 +159,7 @@ pub fn resolve(required: &[u8]) -> Option<u32> {
         api!(__aeabi_fcmpge),
         api!(__aeabi_fcmpgt),
         api!(__aeabi_fcmpun),
+
         // Floating-point to integer conversions.
         // RTABI chapter 4.1.2, Table 6
         api!(__aeabi_d2iz),
@@ -158,9 +170,11 @@ pub fn resolve(required: &[u8]) -> Option<u32> {
         api!(__aeabi_f2uiz),
         api!(__aeabi_f2lz),
         api!(__aeabi_f2ulz),
+
         // Conversions between floating types.
         // RTABI chapter 4.1.2, Table 7
         api!(__aeabi_f2d),
+
         // Integer to floating-point conversions.
         // RTABI chapter 4.1.2, Table 8
         api!(__aeabi_i2d),
@@ -171,12 +185,14 @@ pub fn resolve(required: &[u8]) -> Option<u32> {
         api!(__aeabi_ui2f),
         api!(__aeabi_l2f),
         api!(__aeabi_ul2f),
+
         // Long long helper functions
         // RTABI chapter 4.2, Table 9
         api!(__aeabi_lmul),
         api!(__aeabi_llsl),
         api!(__aeabi_llsr),
         api!(__aeabi_lasr),
+
         // Integer division functions
         // RTABI chapter 4.3.1
         api!(__aeabi_idiv),
@@ -184,6 +200,7 @@ pub fn resolve(required: &[u8]) -> Option<u32> {
         api!(__aeabi_idivmod),
         api!(__aeabi_uidiv),
         api!(__aeabi_uldivmod),
+
         // 4.3.4 Memory copying, clearing, and setting
         api!(__aeabi_memcpy8),
         api!(__aeabi_memcpy4),
@@ -199,10 +216,30 @@ pub fn resolve(required: &[u8]) -> Option<u32> {
         api!(__aeabi_memclr),
 
         // libc
-        api!(memcpy, extern { fn memcpy(dest: *mut u8, src: *const u8, n: usize) -> *mut u8; }),
+        api!(
-        api!(memmove, extern { fn memmove(dest: *mut u8, src: *const u8, n: usize) -> *mut u8; }),
+            memcpy,
-        api!(memset, extern { fn memset(s: *mut u8, c: i32, n: usize) -> *mut u8; }),
+            extern "C" {
-        api!(memcmp, extern { fn memcmp(s1: *const u8, s2: *const u8, n: usize) -> i32; }),
+                fn memcpy(dest: *mut u8, src: *const u8, n: usize) -> *mut u8;
+            }
+        ),
+        api!(
+            memmove,
+            extern "C" {
+                fn memmove(dest: *mut u8, src: *const u8, n: usize) -> *mut u8;
+            }
+        ),
+        api!(
+            memset,
+            extern "C" {
+                fn memset(s: *mut u8, c: i32, n: usize) -> *mut u8;
+            }
+        ),
+        api!(
+            memcmp,
+            extern "C" {
+                fn memcmp(s1: *const u8, s2: *const u8, n: usize) -> i32;
+            }
+        ),
 
         // exceptions
         api!(_Unwind_Resume = unwind::_Unwind_Resume),
@@ -210,6 +247,7 @@ pub fn resolve(required: &[u8]) -> Option<u32> {
         api!(__nac3_raise = eh_artiq::raise),
         api!(__nac3_resume = eh_artiq::resume),
         api!(__nac3_end_catch = eh_artiq::end_catch),
+
         // legacy exception symbols
         api!(__artiq_personality = eh_artiq::artiq_personality),
         api!(__artiq_raise = eh_artiq::raise),
@@ -241,7 +279,7 @@ pub fn resolve(required: &[u8]) -> Option<u32> {
         api_libm_f64f64!(fabs),
         api_libm_f64f64!(floor),
         {
-            extern fn fma(x: f64, y: f64, z: f64) -> f64 {
+            extern "C" fn fma(x: f64, y: f64, z: f64) -> f64 {
                 libm::fma(x, y, z)
             }
             api!(fma = fma)
@@ -253,7 +291,7 @@ pub fn resolve(required: &[u8]) -> Option<u32> {
         api_libm_f64f64!(j0),
         api_libm_f64f64!(j1),
         {
-            extern fn jn(n: i32, x: f64) -> f64 {
+            extern "C" fn jn(n: i32, x: f64) -> f64 {
                 libm::jn(n, x)
             }
             api!(jn = jn)
@@ -265,6 +303,7 @@ pub fn resolve(required: &[u8]) -> Option<u32> {
         api_libm_f64f64f64!(nextafter),
         api_libm_f64f64f64!(pow),
         api_libm_f64f64!(round),
+        api_libm_f64f64!(rint),
         api_libm_f64f64!(sin),
         api_libm_f64f64!(sinh),
         api_libm_f64f64!(sqrt),
@@ -275,13 +314,33 @@ pub fn resolve(required: &[u8]) -> Option<u32> {
         api_libm_f64f64!(y0),
         api_libm_f64f64!(y1),
         {
-            extern fn yn(n: i32, x: f64) -> f64 {
+            extern "C" fn yn(n: i32, x: f64) -> f64 {
                 libm::yn(n, x)
             }
             api!(yn = yn)
         },
+
+        // linalg
+        api!(np_linalg_cholesky = linalg::np_linalg_cholesky),
+        api!(np_linalg_qr = linalg::np_linalg_qr),
+        api!(np_linalg_svd = linalg::np_linalg_svd),
+        api!(np_linalg_inv = linalg::np_linalg_inv),
+        api!(np_linalg_pinv = linalg::np_linalg_pinv),
+        api!(np_linalg_matrix_power = linalg::np_linalg_matrix_power),
+        api!(np_linalg_det = linalg::np_linalg_det),
+        api!(sp_linalg_lu = linalg::sp_linalg_lu),
+        api!(sp_linalg_schur = linalg::sp_linalg_schur),
+        api!(sp_linalg_hessenberg = linalg::sp_linalg_hessenberg),
+
+        /*
+         * syscall for unit tests
+         * Used in `artiq.tests.coredevice.test_exceptions.ExceptionTest.test_raise_exceptions_kernel`
+         * This syscall checks that the exception IDs used in the Python `EmbeddingMap` (in `artiq.language.embedding`)
+         * match the `EXCEPTION_ID_LOOKUP` defined in the firmware (`libksupport::src::eh_artiq`)
+         */
+        api!(test_exception_id_sync = eh_artiq::test_exception_id_sync)
     ];
     api.iter()
-       .find(|&&(exported, _)| exported.as_bytes() == required)
+        .find(|&&(exported, _)| exported.as_bytes() == required)
-       .map(|&(_, ptr)| ptr as u32)
+        .map(|&(_, ptr)| ptr as u32)
 }

src/libksupport/src/kernel/cache.rs

@@ -1,12 +1,17 @@
-use alloc::{string::String, boxed::Box};
+use alloc::{boxed::Box, string::String};
-use cslice::{CSlice, AsCSlice};
+use core::mem::{forget, transmute};
-use core::mem::{transmute, forget};
-use super::{KERNEL_CHANNEL_0TO1, KERNEL_CHANNEL_1TO0, Message};
 
-pub extern fn get(key: CSlice<u8>) -> &CSlice<'static, i32> {
+use cslice::{AsCSlice, CSlice};
+
+use super::{Message, KERNEL_CHANNEL_0TO1, KERNEL_CHANNEL_1TO0};
+
+pub extern "C" fn get(key: CSlice<u8>) -> &CSlice<'static, i32> {
     let key = String::from_utf8(key.as_ref().to_vec()).unwrap();
     unsafe {
-        KERNEL_CHANNEL_1TO0.as_mut().unwrap().send(Message::CacheGetRequest(key));
+        KERNEL_CHANNEL_1TO0
+            .as_mut()
+            .unwrap()
+            .send(Message::CacheGetRequest(key));
         let msg = KERNEL_CHANNEL_0TO1.as_mut().unwrap().recv();
         if let Message::CacheGetReply(v) = msg {
             let leaked = Box::new(v.as_c_slice());
@@ -20,11 +25,13 @@ pub extern fn get(key: CSlice<u8>) -> &CSlice<'static, i32> {
     }
 }
 
-pub extern fn put(key: CSlice<u8>, list: &CSlice<i32>) {
+pub extern "C" fn put(key: CSlice<u8>, list: &CSlice<i32>) {
     let key = String::from_utf8(key.as_ref().to_vec()).unwrap();
     let value = list.as_ref().to_vec();
     unsafe {
-        KERNEL_CHANNEL_1TO0.as_mut().unwrap().send(Message::CachePutRequest(key, value));
+        KERNEL_CHANNEL_1TO0
+            .as_mut()
+            .unwrap()
+            .send(Message::CachePutRequest(key, value));
     }
 }
-

src/libksupport/src/kernel/control.rs

@@ -1,11 +1,11 @@
-use libcortex_a9::sync_channel::{Sender, Receiver};
+use core::mem::{forget, replace};
+
+use libcortex_a9::sync_channel::{Receiver, Sender};
 use libsupport_zynq::boot::Core1;
 
-use super::{CHANNEL_0TO1, CHANNEL_1TO0, CHANNEL_SEM, INIT_LOCK, Message};
+use super::{Message, CHANNEL_0TO1, CHANNEL_1TO0, CHANNEL_SEM, INIT_LOCK};
 use crate::irq::restart_core1;
 
-use core::mem::{forget, replace};
-
 pub struct Control {
     pub tx: Sender<'static, Message>,
     pub rx: Receiver<'static, Message>,
@@ -53,4 +53,3 @@ impl Control {
         forget(replace(&mut self.rx, core0_rx));
     }
 }
-

src/libksupport/src/kernel/core1.rs

@@ -1,31 +1,20 @@
 //! Kernel prologue/epilogue that runs on the 2nd CPU core
 
-use core::{mem, ptr, cell::UnsafeCell};
 use alloc::borrow::ToOwned;
-use log::{debug, info, error};
+use core::{cell::UnsafeCell, mem, ptr};
-use cslice::CSlice;
 
-use libcortex_a9::{
+use cslice::CSlice;
-    enable_fpu,
+use dyld::{self, elf::EXIDX_Entry, Library};
-    cache::{dcci_slice, iciallu, bpiall},
+use libboard_zynq::{gic, mpcore};
-    asm::{dsb, isb},
+use libcortex_a9::{asm::{dsb, isb},
-    sync_channel,
+                   cache::{bpiall, dcci_slice, iciallu},
-};
+                   enable_fpu, sync_channel};
-use libboard_zynq::{mpcore, gic};
 use libsupport_zynq::ram;
-use dyld::{self, Library, elf::EXIDX_Entry};
+use log::{debug, error, info};
+
+use super::{api::resolve, dma, rpc::rpc_send_async, Message, CHANNEL_0TO1, CHANNEL_1TO0, CHANNEL_SEM, INIT_LOCK,
+            KERNEL_CHANNEL_0TO1, KERNEL_CHANNEL_1TO0, KERNEL_IMAGE};
 use crate::{eh_artiq, get_async_errors, rtio};
-use super::{
-    api::resolve,
-    rpc::rpc_send_async,
-    INIT_LOCK,
-    CHANNEL_0TO1, CHANNEL_1TO0,
-    CHANNEL_SEM,
-    KERNEL_CHANNEL_0TO1, KERNEL_CHANNEL_1TO0,
-    KERNEL_IMAGE,
-    Message,
-    dma,
-};
 
 // linker symbols
 extern "C" {
@@ -38,13 +27,13 @@ extern "C" {
 unsafe fn attribute_writeback(typeinfo: *const ()) {
     struct Attr {
         offset: usize,
-        tag:    CSlice<'static, u8>,
+        tag: CSlice<'static, u8>,
-        name:   CSlice<'static, u8>
+        name: CSlice<'static, u8>,
     }
 
     struct Type {
         attributes: *const *const Attr,
-        objects:    *const *const ()
+        objects: *const *const (),
     }
 
     let mut tys = typeinfo as *const *const Type;
@@ -63,11 +52,16 @@ unsafe fn attribute_writeback(typeinfo: *const ()) {
                 attributes = attributes.offset(1);
 
                 if (*attribute).tag.len() > 0 {
-                    rpc_send_async(0, &(*attribute).tag, [
+                    rpc_send_async(
-                        &object as *const _ as *const (),
+                        0,
-                        &(*attribute).name as *const _ as *const (),
+                        &(*attribute).tag,
-                        (object as usize + (*attribute).offset) as *const ()
+                        [
-                    ].as_ptr());
+                            &object as *const _ as *const (),
+                            &(*attribute).name as *const _ as *const (),
+                            (object as usize + (*attribute).offset) as *const (),
+                        ]
+                        .as_ptr(),
+                    );
                 }
             }
         }
@@ -82,7 +76,8 @@ pub struct KernelImage {
 
 impl KernelImage {
     pub fn new(library: Library) -> Result<Self, dyld::Error> {
-        let __modinit__ = library.lookup(b"__modinit__")
+        let __modinit__ = library
+            .lookup(b"__modinit__")
             .ok_or(dyld::Error::Lookup("__modinit__".to_owned()))?;
         let typeinfo = library.lookup(b"typeinfo");
 
@@ -90,8 +85,7 @@ impl KernelImage {
         let bss_start = library.lookup(b"__bss_start");
         let end = library.lookup(b"_end");
         if let Some(bss_start) = bss_start {
-            let end = end
+            let end = end.ok_or(dyld::Error::Lookup("_end".to_owned()))?;
-                .ok_or(dyld::Error::Lookup("_end".to_owned()))?;
             unsafe {
                 ptr::write_bytes(bss_start as *mut u8, 0, (end - bss_start) as usize);
             }
@@ -126,9 +120,7 @@ impl KernelImage {
     }
 
     pub fn get_load_addr(&self) -> usize {
-        unsafe {
+        unsafe { self.library.get().as_ref().unwrap().image.as_ptr() as usize }
-            self.library.get().as_ref().unwrap().image.as_ptr() as usize
-        }
     }
 }
 
@@ -164,20 +156,19 @@ pub extern "C" fn main_core1() {
         let message = core1_rx.recv();
         match message {
             Message::LoadRequest(data) => {
-                let result = dyld::load(&data, &resolve)
+                let result = dyld::load(&data, &resolve).and_then(KernelImage::new);
-                    .and_then(KernelImage::new);
                 match result {
                     Ok(kernel) => {
                         loaded_kernel = Some(kernel);
                         debug!("kernel loaded");
                         core1_tx.send(Message::LoadCompleted);
-                    },
+                    }
                     Err(error) => {
                         error!("failed to load shared library: {}", error);
                         core1_tx.send(Message::LoadFailed);
                     }
                 }
-            },
+            }
             Message::StartRequest => {
                 info!("kernel starting");
                 if let Some(kernel) = loaded_kernel.take() {
@@ -202,9 +193,11 @@ pub extern "C" fn main_core1() {
 }
 
 /// Called by eh_artiq
-pub fn terminate(exceptions: &'static [Option<eh_artiq::Exception<'static>>],
+pub fn terminate(
-                 stack_pointers: &'static [eh_artiq::StackPointerBacktrace],
+    exceptions: &'static [Option<eh_artiq::Exception<'static>>],
-                 backtrace: &'static mut [(usize, usize)]) -> ! {
+    stack_pointers: &'static [eh_artiq::StackPointerBacktrace],
+    backtrace: &'static mut [(usize, usize)],
+) -> ! {
     {
         let core1_tx = unsafe { KERNEL_CHANNEL_1TO0.as_mut().unwrap() };
         let errors = unsafe { get_async_errors() };
@@ -215,26 +208,34 @@ pub fn terminate(exceptions: &'static [Option<eh_artiq::Exception<'static>>],
 
 /// Called by llvm_libunwind
 #[no_mangle]
-extern fn dl_unwind_find_exidx(pc: *const u32, len_ptr: *mut u32) -> *const u32 {
+extern "C" fn dl_unwind_find_exidx(pc: *const u32, len_ptr: *mut u32) -> *const u32 {
     let length;
     let start: *const EXIDX_Entry;
     unsafe {
         if &__text_start as *const u32 <= pc && pc < &__text_end as *const u32 {
             length = (&__exidx_end as *const EXIDX_Entry).offset_from(&__exidx_start) as u32;
             start = &__exidx_start;
-        } else {
+        } else if KERNEL_IMAGE != ptr::null() {
-            let exidx = KERNEL_IMAGE.as_ref()
+            let exidx = KERNEL_IMAGE
+                .as_ref()
                 .expect("dl_unwind_find_exidx kernel image")
-                .library.get().as_ref().unwrap().exidx();
+                .library
+                .get()
+                .as_ref()
+                .unwrap()
+                .exidx();
             length = exidx.len() as u32;
             start = exidx.as_ptr();
+        } else {
+            length = 0;
+            start = ptr::null();
         }
         *len_ptr = length;
     }
     start as *const u32
 }
 
-pub extern fn rtio_get_destination_status(destination: i32) -> bool {
+pub extern "C" fn rtio_get_destination_status(destination: i32) -> bool {
     #[cfg(has_drtio)]
     if destination > 0 && destination < 255 {
         let reply = unsafe {
@@ -245,9 +246,9 @@ pub extern fn rtio_get_destination_status(destination: i32) -> bool {
         };
         return match reply {
             Message::UpDestinationsReply(x) => x,
-            _ => panic!("received unexpected reply to UpDestinationsRequest: {:?}", reply)
+            _ => panic!("received unexpected reply to UpDestinationsRequest: {:?}", reply),
         };
-    }    
+    }
 
     destination == 0
-}
+}

src/libksupport/src/kernel/dma.rs

@@ -0,0 +1,255 @@
+use alloc::{string::String, vec::Vec};
+use core::mem;
+
+use cslice::CSlice;
+
+use super::{Message, KERNEL_CHANNEL_0TO1, KERNEL_CHANNEL_1TO0, KERNEL_IMAGE};
+use crate::{artiq_raise, pl::csr, rtio};
+
+#[repr(C)]
+pub struct DmaTrace {
+    duration: i64,
+    address: i32,
+    uses_ddma: bool,
+}
+
+#[derive(Clone, Debug)]
+pub struct DmaRecorder {
+    pub name: String,
+    pub buffer: Vec<u8>,
+    pub duration: i64,
+    pub enable_ddma: bool,
+}
+
+static mut RECORDER: Option<DmaRecorder> = None;
+
+pub unsafe fn init_dma_recorder() {
+    // as static would remain after restart, we have to reset it,
+    // without running its destructor.
+    mem::forget(mem::replace(&mut RECORDER, None));
+}
+
+pub extern "C" fn dma_record_start(name: CSlice<u8>) {
+    let name = String::from_utf8(name.as_ref().to_vec()).unwrap();
+    unsafe {
+        KERNEL_CHANNEL_1TO0
+            .as_mut()
+            .unwrap()
+            .send(Message::DmaEraseRequest(name.clone()));
+    }
+    unsafe {
+        if RECORDER.is_some() {
+            artiq_raise!("DMAError", "DMA is already recording")
+        }
+
+        let library = KERNEL_IMAGE.as_ref().unwrap();
+        library.rebind(b"rtio_output", dma_record_output as *const ()).unwrap();
+        library
+            .rebind(b"rtio_output_wide", dma_record_output_wide as *const ())
+            .unwrap();
+
+        RECORDER = Some(DmaRecorder {
+            name,
+            buffer: Vec::new(),
+            duration: 0,
+            enable_ddma: false,
+        });
+    }
+}
+
+pub extern "C" fn dma_record_stop(duration: i64, enable_ddma: bool) {
+    unsafe {
+        if RECORDER.is_none() {
+            artiq_raise!("DMAError", "DMA is not recording")
+        }
+
+        let library = KERNEL_IMAGE.as_ref().unwrap();
+        library.rebind(b"rtio_output", rtio::output as *const ()).unwrap();
+        library
+            .rebind(b"rtio_output_wide", rtio::output_wide as *const ())
+            .unwrap();
+
+        let mut recorder = RECORDER.take().unwrap();
+        recorder.duration = duration;
+        recorder.enable_ddma = enable_ddma;
+        KERNEL_CHANNEL_1TO0
+            .as_mut()
+            .unwrap()
+            .send(Message::DmaPutRequest(recorder));
+    }
+}
+
+#[inline(always)]
+unsafe fn dma_record_output_prepare(timestamp: i64, target: i32, words: usize) {
+    // See gateware/rtio/dma.py.
+    const HEADER_LENGTH: usize = /*length*/1 + /*channel*/3 + /*timestamp*/8 + /*address*/1;
+    let length = HEADER_LENGTH + /*data*/words * 4;
+
+    let buffer = &mut RECORDER.as_mut().unwrap().buffer;
+    buffer.reserve(length);
+    buffer.extend_from_slice(&[
+        (length >> 0) as u8,
+        (target >> 8) as u8,
+        (target >> 16) as u8,
+        (target >> 24) as u8,
+        (timestamp >> 0) as u8,
+        (timestamp >> 8) as u8,
+        (timestamp >> 16) as u8,
+        (timestamp >> 24) as u8,
+        (timestamp >> 32) as u8,
+        (timestamp >> 40) as u8,
+        (timestamp >> 48) as u8,
+        (timestamp >> 56) as u8,
+        (target >> 0) as u8,
+    ]);
+}
+
+pub extern "C" fn dma_record_output(target: i32, word: i32) {
+    unsafe {
+        let timestamp = rtio::now_mu();
+        dma_record_output_prepare(timestamp, target, 1);
+        RECORDER.as_mut().unwrap().buffer.extend_from_slice(&[
+            (word >> 0) as u8,
+            (word >> 8) as u8,
+            (word >> 16) as u8,
+            (word >> 24) as u8,
+        ]);
+    }
+}
+
+pub extern "C" fn dma_record_output_wide(target: i32, words: &CSlice<i32>) {
+    assert!(words.len() <= 16); // enforce the hardware limit
+
+    unsafe {
+        let timestamp = rtio::now_mu();
+        dma_record_output_prepare(timestamp, target, words.len());
+        let buffer = &mut RECORDER.as_mut().unwrap().buffer;
+        for word in words.as_ref().iter() {
+            buffer.extend_from_slice(&[
+                (word >> 0) as u8,
+                (word >> 8) as u8,
+                (word >> 16) as u8,
+                (word >> 24) as u8,
+            ]);
+        }
+    }
+}
+
+pub extern "C" fn dma_erase(name: CSlice<u8>) {
+    let name = String::from_utf8(name.as_ref().to_vec()).unwrap();
+    unsafe {
+        KERNEL_CHANNEL_1TO0
+            .as_mut()
+            .unwrap()
+            .send(Message::DmaEraseRequest(name));
+    }
+}
+
+pub extern "C" fn dma_retrieve(name: CSlice<u8>) -> DmaTrace {
+    let name = String::from_utf8(name.as_ref().to_vec()).unwrap();
+    unsafe {
+        KERNEL_CHANNEL_1TO0.as_mut().unwrap().send(Message::DmaGetRequest(name));
+    }
+    match unsafe { KERNEL_CHANNEL_0TO1.as_mut().unwrap() }.recv() {
+        Message::DmaGetReply(None) => (),
+        Message::DmaGetReply(Some((address, duration, uses_ddma))) => {
+            return DmaTrace {
+                address,
+                duration,
+                uses_ddma,
+            };
+        }
+        _ => panic!("Expected DmaGetReply after DmaGetRequest!"),
+    }
+    // we have to defer raising error as we have to drop the message first...
+    artiq_raise!("DMAError", "DMA trace not found");
+}
+
+pub extern "C" fn dma_playback(timestamp: i64, ptr: i32, _uses_ddma: bool) {
+    unsafe {
+        csr::rtio_dma::base_address_write(ptr as u32);
+        csr::rtio_dma::time_offset_write(timestamp as u64);
+
+        let old_cri_master = csr::cri_con::selected_read();
+        csr::cri_con::selected_write(1);
+        csr::rtio_dma::enable_write(1);
+        #[cfg(has_drtio)]
+        if _uses_ddma {
+            KERNEL_CHANNEL_1TO0
+                .as_mut()
+                .unwrap()
+                .send(Message::DmaStartRemoteRequest {
+                    id: ptr,
+                    timestamp: timestamp,
+                });
+        }
+        while csr::rtio_dma::enable_read() != 0 {}
+        csr::cri_con::selected_write(old_cri_master);
+
+        let error = csr::rtio_dma::error_read();
+        if error != 0 {
+            let timestamp = csr::rtio_dma::error_timestamp_read();
+            let channel = csr::rtio_dma::error_channel_read();
+            csr::rtio_dma::error_write(1);
+            if error & 1 != 0 {
+                artiq_raise!(
+                    "RTIOUnderflow",
+                    "RTIO underflow at {1} mu, channel {rtio_channel_info:0}",
+                    channel as i64,
+                    timestamp as i64,
+                    0
+                );
+            }
+            if error & 2 != 0 {
+                artiq_raise!(
+                    "RTIODestinationUnreachable",
+                    "RTIO destination unreachable, output, at {1} mu, channel {rtio_channel_info:0}",
+                    channel as i64,
+                    timestamp as i64,
+                    0
+                );
+            }
+        }
+        #[cfg(has_drtio)]
+        if _uses_ddma {
+            KERNEL_CHANNEL_1TO0
+                .as_mut()
+                .unwrap()
+                .send(Message::DmaAwaitRemoteRequest(ptr));
+            match KERNEL_CHANNEL_0TO1.as_mut().unwrap().recv() {
+                Message::DmaAwaitRemoteReply {
+                    timeout,
+                    error,
+                    channel,
+                    timestamp,
+                } => {
+                    if timeout {
+                        artiq_raise!(
+                            "DMAError",
+                            "Error running DMA on satellite device, timed out waiting for results"
+                        );
+                    }
+                    if error & 1 != 0 {
+                        artiq_raise!(
+                            "RTIOUnderflow",
+                            "RTIO underflow at {1} mu, channel {rtio_channel_info:0}",
+                            channel as i64,
+                            timestamp as i64,
+                            0
+                        );
+                    }
+                    if error & 2 != 0 {
+                        artiq_raise!(
+                            "RTIODestinationUnreachable",
+                            "RTIO destination unreachable, output, at {1} mu, channel {rtio_channel_info:0}",
+                            channel as i64,
+                            timestamp as i64,
+                            0
+                        );
+                    }
+                }
+                _ => panic!("Expected DmaAwaitRemoteReply after DmaAwaitRemoteRequest!"),
+            }
+        }
+    }
+}

src/libksupport/src/kernel/linalg.rs

@@ -0,0 +1,440 @@
+// Uses `nalgebra` crate to invoke `np_linalg` and `sp_linalg` functions
+// When converting between `nalgebra::Matrix` and `NDArray` following considerations are necessary
+//
+// * Both `nalgebra::Matrix` and `NDArray` require their content to be stored in row-major order
+// * `NDArray` data pointer can be directly read and converted to `nalgebra::Matrix` (row and column number must be known)
+// * `nalgebra::Matrix::as_slice` returns the content of matrix in column-major order and initial data needs to be transposed before storing it in `NDArray` data pointer
+
+use alloc::vec::Vec;
+use core::slice;
+
+use nalgebra::DMatrix;
+
+use crate::artiq_raise;
+
+pub struct InputMatrix {
+    pub ndims: usize,
+    pub dims: *const usize,
+    pub data: *mut f64,
+}
+
+impl InputMatrix {
+    fn get_dims(&mut self) -> Vec<usize> {
+        let dims = unsafe { slice::from_raw_parts(self.dims, self.ndims) };
+        dims.to_vec()
+    }
+}
+
+/// # Safety
+///
+/// `mat1` should point to a valid 2DArray of `f64` floats in row-major order
+#[no_mangle]
+pub unsafe extern "C" fn np_linalg_cholesky(mat1: *mut InputMatrix, out: *mut InputMatrix) {
+    let mat1 = mat1.as_mut().unwrap();
+    let out = out.as_mut().unwrap();
+
+    if mat1.ndims != 2 {
+        artiq_raise!(
+            "ValueError",
+            "expected 2D Vector Input, but received {1}D input)",
+            0,
+            mat1.ndims as i64,
+            0
+        );
+    }
+
+    let dim1 = (*mat1).get_dims();
+    if dim1[0] != dim1[1] {
+        artiq_raise!(
+            "ValueError",
+            "last 2 dimensions of the array must be square: {1} != {2}",
+            0,
+            dim1[0] as i64,
+            dim1[1] as i64
+        );
+    }
+
+    let outdim = out.get_dims();
+    let out_slice = slice::from_raw_parts_mut(out.data, outdim[0] * outdim[1]);
+    let data_slice1 = slice::from_raw_parts_mut(mat1.data, dim1[0] * dim1[1]);
+
+    let matrix1 = DMatrix::from_row_slice(dim1[0], dim1[1], data_slice1);
+    let result = matrix1.cholesky();
+    match result {
+        Some(res) => {
+            out_slice.copy_from_slice(res.unpack().transpose().as_slice());
+        }
+        None => {
+            artiq_raise!("LinAlgError", "Matrix is not positive definite");
+        }
+    };
+}
+
+/// # Safety
+///
+/// `mat1` should point to a valid 2DArray of `f64` floats in row-major order
+#[no_mangle]
+pub unsafe extern "C" fn np_linalg_qr(mat1: *mut InputMatrix, out_q: *mut InputMatrix, out_r: *mut InputMatrix) {
+    let mat1 = mat1.as_mut().unwrap();
+    let out_q = out_q.as_mut().unwrap();
+    let out_r = out_r.as_mut().unwrap();
+
+    if mat1.ndims != 2 {
+        artiq_raise!(
+            "ValueError",
+            "expected 2D Vector Input, but received {1}D input)",
+            0,
+            mat1.ndims as i64,
+            0
+        );
+    }
+
+    let dim1 = (*mat1).get_dims();
+    let outq_dim = (*out_q).get_dims();
+    let outr_dim = (*out_r).get_dims();
+
+    let data_slice1 = slice::from_raw_parts_mut(mat1.data, dim1[0] * dim1[1]);
+    let out_q_slice = slice::from_raw_parts_mut(out_q.data, outq_dim[0] * outq_dim[1]);
+    let out_r_slice = slice::from_raw_parts_mut(out_r.data, outr_dim[0] * outr_dim[1]);
+
+    // Refer to https://github.com/dimforge/nalgebra/issues/735
+    let matrix1 = DMatrix::from_row_slice(dim1[0], dim1[1], data_slice1);
+
+    let res = matrix1.qr();
+    let (q, r) = res.unpack();
+
+    // Uses different algo need to match numpy
+    out_q_slice.copy_from_slice(q.transpose().as_slice());
+    out_r_slice.copy_from_slice(r.transpose().as_slice());
+}
+
+/// # Safety
+///
+/// `mat1` should point to a valid 2DArray of `f64` floats in row-major order
+#[no_mangle]
+pub unsafe extern "C" fn np_linalg_svd(
+    mat1: *mut InputMatrix,
+    outu: *mut InputMatrix,
+    outs: *mut InputMatrix,
+    outvh: *mut InputMatrix,
+) {
+    let mat1 = mat1.as_mut().unwrap();
+    let outu = outu.as_mut().unwrap();
+    let outs = outs.as_mut().unwrap();
+    let outvh = outvh.as_mut().unwrap();
+
+    if mat1.ndims != 2 {
+        artiq_raise!(
+            "ValueError",
+            "expected 2D Vector Input, but received {1}D input)",
+            0,
+            mat1.ndims as i64,
+            0
+        );
+    }
+
+    let dim1 = (*mat1).get_dims();
+    let outu_dim = (*outu).get_dims();
+    let outs_dim = (*outs).get_dims();
+    let outvh_dim = (*outvh).get_dims();
+
+    let data_slice1 = slice::from_raw_parts_mut(mat1.data, dim1[0] * dim1[1]);
+    let out_u_slice = slice::from_raw_parts_mut(outu.data, outu_dim[0] * outu_dim[1]);
+    let out_s_slice = slice::from_raw_parts_mut(outs.data, outs_dim[0]);
+    let out_vh_slice = slice::from_raw_parts_mut(outvh.data, outvh_dim[0] * outvh_dim[1]);
+
+    let matrix = DMatrix::from_row_slice(dim1[0], dim1[1], data_slice1);
+    let result = matrix.svd(true, true);
+    out_u_slice.copy_from_slice(result.u.unwrap().transpose().as_slice());
+    out_s_slice.copy_from_slice(result.singular_values.as_slice());
+    out_vh_slice.copy_from_slice(result.v_t.unwrap().transpose().as_slice());
+}
+
+/// # Safety
+///
+/// `mat1` should point to a valid 2DArray of `f64` floats in row-major order
+#[no_mangle]
+pub unsafe extern "C" fn np_linalg_inv(mat1: *mut InputMatrix, out: *mut InputMatrix) {
+    let mat1 = mat1.as_mut().unwrap();
+    let out = out.as_mut().unwrap();
+
+    if mat1.ndims != 2 {
+        artiq_raise!(
+            "ValueError",
+            "expected 2D Vector Input, but received {1}D input)",
+            0,
+            mat1.ndims as i64,
+            0
+        );
+    }
+    let dim1 = (*mat1).get_dims();
+
+    if dim1[0] != dim1[1] {
+        artiq_raise!(
+            "ValueError",
+            "last 2 dimensions of the array must be square: {1} != {2}",
+            0,
+            dim1[0] as i64,
+            dim1[1] as i64
+        );
+    }
+
+    let outdim = out.get_dims();
+    let out_slice = slice::from_raw_parts_mut(out.data, outdim[0] * outdim[1]);
+    let data_slice1 = slice::from_raw_parts_mut(mat1.data, dim1[0] * dim1[1]);
+
+    let matrix = DMatrix::from_row_slice(dim1[0], dim1[1], data_slice1);
+    if !matrix.is_invertible() {
+        artiq_raise!("LinAlgError", "no inverse for Singular Matrix");
+    }
+    let inv = matrix.try_inverse().unwrap();
+    out_slice.copy_from_slice(inv.transpose().as_slice());
+}
+
+/// # Safety
+///
+/// `mat1` should point to a valid 2DArray of `f64` floats in row-major order
+#[no_mangle]
+pub unsafe extern "C" fn np_linalg_pinv(mat1: *mut InputMatrix, out: *mut InputMatrix) {
+    let mat1 = mat1.as_mut().unwrap();
+    let out = out.as_mut().unwrap();
+
+    if mat1.ndims != 2 {
+        artiq_raise!(
+            "ValueError",
+            "expected 2D Vector Input, but received {1}D input)",
+            0,
+            mat1.ndims as i64,
+            0
+        );
+    }
+    let dim1 = (*mat1).get_dims();
+    let outdim = out.get_dims();
+    let out_slice = slice::from_raw_parts_mut(out.data, outdim[0] * outdim[1]);
+    let data_slice1 = slice::from_raw_parts_mut(mat1.data, dim1[0] * dim1[1]);
+
+    let matrix = DMatrix::from_row_slice(dim1[0], dim1[1], data_slice1);
+    let svd = matrix.svd(true, true);
+    let inv = svd.pseudo_inverse(1e-15);
+
+    match inv {
+        Ok(m) => {
+            out_slice.copy_from_slice(m.transpose().as_slice());
+        }
+        Err(_) => {
+            artiq_raise!("LinAlgError", "SVD computation does not converge");
+        }
+    }
+}
+
+/// # Safety
+///
+/// `mat1` should point to a valid 2DArray of `f64` floats in row-major order
+#[no_mangle]
+pub unsafe extern "C" fn np_linalg_matrix_power(mat1: *mut InputMatrix, mat2: *mut InputMatrix, out: *mut InputMatrix) {
+    let mat1 = mat1.as_mut().unwrap();
+    let mat2 = mat2.as_mut().unwrap();
+    let out = out.as_mut().unwrap();
+
+    if mat1.ndims != 2 {
+        artiq_raise!(
+            "ValueError",
+            "expected 2D Vector Input, but received {1}D input)",
+            0,
+            mat1.ndims as i64,
+            0
+        );
+    }
+
+    let dim1 = (*mat1).get_dims();
+    let power = slice::from_raw_parts_mut(mat2.data, 1);
+    let power = power[0];
+    let outdim = out.get_dims();
+    let out_slice = slice::from_raw_parts_mut(out.data, outdim[0] * outdim[1]);
+    let data_slice1 = slice::from_raw_parts_mut(mat1.data, dim1[0] * dim1[1]);
+    let mut abs_power = power;
+    if abs_power < 0.0 {
+        abs_power = abs_power * -1.0;
+    }
+    let matrix1 = DMatrix::from_row_slice(dim1[0], dim1[1], data_slice1);
+    if !matrix1.is_square() {
+        artiq_raise!(
+            "ValueError",
+            "last 2 dimensions of the array must be square: {1} != {2}",
+            0,
+            dim1[0] as i64,
+            dim1[1] as i64
+        );
+    }
+    let mut result = matrix1.pow(abs_power as u32);
+
+    if power < 0.0 {
+        if !matrix1.is_invertible() {
+            artiq_raise!("LinAlgError", "no inverse for Singular Matrix");
+        }
+        result = result.try_inverse().unwrap();
+    }
+    out_slice.copy_from_slice(result.transpose().as_slice());
+}
+
+/// # Safety
+///
+/// `mat1` should point to a valid 2DArray of `f64` floats in row-major order
+#[no_mangle]
+pub unsafe extern "C" fn np_linalg_det(mat1: *mut InputMatrix, out: *mut InputMatrix) {
+    let mat1 = mat1.as_mut().unwrap();
+    let out = out.as_mut().unwrap();
+
+    if mat1.ndims != 2 {
+        artiq_raise!(
+            "ValueError",
+            "expected 2D Vector Input, but received {1}D input)",
+            0,
+            mat1.ndims as i64,
+            0
+        );
+    }
+    let dim1 = (*mat1).get_dims();
+    let out_slice = slice::from_raw_parts_mut(out.data, 1);
+    let data_slice1 = slice::from_raw_parts_mut(mat1.data, dim1[0] * dim1[1]);
+
+    let matrix = DMatrix::from_row_slice(dim1[0], dim1[1], data_slice1);
+    if !matrix.is_square() {
+        artiq_raise!(
+            "ValueError",
+            "last 2 dimensions of the array must be square: {1} != {2}",
+            0,
+            dim1[0] as i64,
+            dim1[1] as i64
+        );
+    }
+    out_slice[0] = matrix.determinant();
+}
+
+/// # Safety
+///
+/// `mat1` should point to a valid 2DArray of `f64` floats in row-major order
+#[no_mangle]
+pub unsafe extern "C" fn sp_linalg_lu(mat1: *mut InputMatrix, out_l: *mut InputMatrix, out_u: *mut InputMatrix) {
+    let mat1 = mat1.as_mut().unwrap();
+    let out_l = out_l.as_mut().unwrap();
+    let out_u = out_u.as_mut().unwrap();
+
+    if mat1.ndims != 2 {
+        artiq_raise!(
+            "ValueError",
+            "expected 2D Vector Input, but received {1}D input)",
+            0,
+            mat1.ndims as i64,
+            0
+        );
+    }
+
+    let dim1 = (*mat1).get_dims();
+    let outl_dim = (*out_l).get_dims();
+    let outu_dim = (*out_u).get_dims();
+
+    let data_slice1 = slice::from_raw_parts_mut(mat1.data, dim1[0] * dim1[1]);
+    let out_l_slice = slice::from_raw_parts_mut(out_l.data, outl_dim[0] * outl_dim[1]);
+    let out_u_slice = slice::from_raw_parts_mut(out_u.data, outu_dim[0] * outu_dim[1]);
+
+    let matrix = DMatrix::from_row_slice(dim1[0], dim1[1], data_slice1);
+    let (_, l, u) = matrix.lu().unpack();
+
+    out_l_slice.copy_from_slice(l.transpose().as_slice());
+    out_u_slice.copy_from_slice(u.transpose().as_slice());
+}
+
+/// # Safety
+///
+/// `mat1` should point to a valid 2DArray of `f64` floats in row-major order
+#[no_mangle]
+pub unsafe extern "C" fn sp_linalg_schur(mat1: *mut InputMatrix, out_t: *mut InputMatrix, out_z: *mut InputMatrix) {
+    let mat1 = mat1.as_mut().unwrap();
+    let out_t = out_t.as_mut().unwrap();
+    let out_z = out_z.as_mut().unwrap();
+
+    if mat1.ndims != 2 {
+        artiq_raise!(
+            "ValueError",
+            "expected 2D Vector Input, but received {1}D input)",
+            0,
+            mat1.ndims as i64,
+            0
+        );
+    }
+
+    let dim1 = (*mat1).get_dims();
+
+    if dim1[0] != dim1[1] {
+        artiq_raise!(
+            "ValueError",
+            "last 2 dimensions of the array must be square: {1} != {2}",
+            0,
+            dim1[0] as i64,
+            dim1[1] as i64
+        );
+    }
+
+    let out_t_dim = (*out_t).get_dims();
+    let out_z_dim = (*out_z).get_dims();
+
+    let data_slice1 = slice::from_raw_parts_mut(mat1.data, dim1[0] * dim1[1]);
+    let out_t_slice = slice::from_raw_parts_mut(out_t.data, out_t_dim[0] * out_t_dim[1]);
+    let out_z_slice = slice::from_raw_parts_mut(out_z.data, out_z_dim[0] * out_z_dim[1]);
+
+    let matrix = DMatrix::from_row_slice(dim1[0], dim1[1], data_slice1);
+    let (z, t) = matrix.schur().unpack();
+
+    out_t_slice.copy_from_slice(t.transpose().as_slice());
+    out_z_slice.copy_from_slice(z.transpose().as_slice());
+}
+
+/// # Safety
+///
+/// `mat1` should point to a valid 2DArray of `f64` floats in row-major order
+#[no_mangle]
+pub unsafe extern "C" fn sp_linalg_hessenberg(
+    mat1: *mut InputMatrix,
+    out_h: *mut InputMatrix,
+    out_q: *mut InputMatrix,
+) {
+    let mat1 = mat1.as_mut().unwrap();
+    let out_h = out_h.as_mut().unwrap();
+    let out_q = out_q.as_mut().unwrap();
+
+    if mat1.ndims != 2 {
+        artiq_raise!(
+            "ValueError",
+            "expected 2D Vector Input, but received {1}D input)",
+            0,
+            mat1.ndims as i64,
+            0
+        );
+    }
+
+    let dim1 = (*mat1).get_dims();
+
+    if dim1[0] != dim1[1] {
+        artiq_raise!(
+            "ValueError",
+            "last 2 dimensions of the array must be square: {1} != {2}",
+            0,
+            dim1[0] as i64,
+            dim1[1] as i64
+        );
+    }
+
+    let out_h_dim = (*out_h).get_dims();
+    let out_q_dim = (*out_q).get_dims();
+
+    let data_slice1 = slice::from_raw_parts_mut(mat1.data, dim1[0] * dim1[1]);
+    let out_h_slice = slice::from_raw_parts_mut(out_h.data, out_h_dim[0] * out_h_dim[1]);
+    let out_q_slice = slice::from_raw_parts_mut(out_q.data, out_q_dim[0] * out_q_dim[1]);
+
+    let matrix = DMatrix::from_row_slice(dim1[0], dim1[1], data_slice1);
+    let (q, h) = matrix.hessenberg().unpack();
+
+    out_h_slice.copy_from_slice(h.transpose().as_slice());
+    out_q_slice.copy_from_slice(q.transpose().as_slice());
+}

src/libksupport/src/kernel/mod.rs

@@ -0,0 +1,128 @@
+use alloc::{string::String, vec::Vec};
+use core::ptr;
+
+use libcortex_a9::{mutex::Mutex, semaphore::Semaphore, sync_channel};
+
+use crate::{eh_artiq, RPCException};
+
+mod control;
+pub use control::Control;
+mod api;
+pub mod core1;
+mod dma;
+mod rpc;
+pub use dma::DmaRecorder;
+mod cache;
+mod linalg;
+#[cfg(has_drtio)]
+mod subkernel;
+
+#[cfg(has_drtio)]
+#[derive(Debug, Clone)]
+pub enum SubkernelStatus {
+    NoError,
+    Timeout,
+    IncorrectState,
+    CommLost,
+    Exception(Vec<u8>),
+    OtherError,
+}
+
+#[derive(Debug, Clone)]
+pub enum Message {
+    LoadRequest(Vec<u8>),
+    LoadCompleted,
+    LoadFailed,
+    StartRequest,
+    KernelFinished(u8),
+    KernelException(
+        &'static [Option<eh_artiq::Exception<'static>>],
+        &'static [eh_artiq::StackPointerBacktrace],
+        &'static [(usize, usize)],
+        u8,
+    ),
+    RpcSend {
+        is_async: bool,
+        data: Vec<u8>,
+    },
+    RpcRecvRequest(*mut ()),
+    RpcRecvReply(Result<usize, RPCException>),
+
+    CacheGetRequest(String),
+    CacheGetReply(Vec<i32>),
+    CachePutRequest(String, Vec<i32>),
+
+    DmaPutRequest(DmaRecorder),
+    DmaEraseRequest(String),
+    DmaGetRequest(String),
+    DmaGetReply(Option<(i32, i64, bool)>),
+    #[cfg(has_drtio)]
+    DmaStartRemoteRequest {
+        id: i32,
+        timestamp: i64,
+    },
+    #[cfg(has_drtio)]
+    DmaAwaitRemoteRequest(i32),
+    #[cfg(has_drtio)]
+    DmaAwaitRemoteReply {
+        timeout: bool,
+        error: u8,
+        channel: u32,
+        timestamp: u64,
+    },
+
+    #[cfg(has_drtio)]
+    UpDestinationsRequest(i32),
+    #[cfg(has_drtio)]
+    UpDestinationsReply(bool),
+
+    #[cfg(has_drtio)]
+    SubkernelLoadRunRequest {
+        id: u32,
+        destination: u8,
+        run: bool,
+        timestamp: u64,
+    },
+    #[cfg(has_drtio)]
+    SubkernelLoadRunReply {
+        succeeded: bool,
+    },
+    #[cfg(has_drtio)]
+    SubkernelAwaitFinishRequest {
+        id: u32,
+        timeout: i64,
+    },
+    #[cfg(has_drtio)]
+    SubkernelAwaitFinishReply,
+    #[cfg(has_drtio)]
+    SubkernelMsgSend {
+        id: u32,
+        destination: Option<u8>,
+        data: Vec<u8>,
+    },
+    #[cfg(has_drtio)]
+    SubkernelMsgSent,
+    #[cfg(has_drtio)]
+    SubkernelMsgRecvRequest {
+        id: i32,
+        timeout: i64,
+        tags: Vec<u8>,
+    },
+    #[cfg(has_drtio)]
+    SubkernelMsgRecvReply {
+        count: u8,
+    },
+    #[cfg(has_drtio)]
+    SubkernelError(SubkernelStatus),
+}
+
+static CHANNEL_0TO1: Mutex<Option<sync_channel::Sender<'static, Message>>> = Mutex::new(None);
+static CHANNEL_1TO0: Mutex<Option<sync_channel::Receiver<'static, Message>>> = Mutex::new(None);
+static CHANNEL_SEM: Semaphore = Semaphore::new(0, 1);
+
+static mut KERNEL_CHANNEL_0TO1: Option<sync_channel::Receiver<'static, Message>> = None;
+static mut KERNEL_CHANNEL_1TO0: Option<sync_channel::Sender<'static, Message>> = None;
+
+pub static mut KERNEL_IMAGE: *const core1::KernelImage = ptr::null();
+
+static INIT_LOCK: Mutex<()> = Mutex::new(());

src/libksupport/src/kernel/rpc.rs

@@ -1,31 +1,28 @@
 //! Kernel-side RPC API
 
 use alloc::vec::Vec;
+
 use cslice::CSlice;
 
-use crate::eh_artiq;
+use super::{Message, KERNEL_CHANNEL_0TO1, KERNEL_CHANNEL_1TO0};
-use crate::rpc::send_args;
+use crate::{eh_artiq, rpc::send_args};
-use super::{
-    KERNEL_CHANNEL_0TO1, KERNEL_CHANNEL_1TO0,
-    Message,
-};
 
 fn rpc_send_common(is_async: bool, service: u32, tag: &CSlice<u8>, data: *const *const ()) {
     let core1_tx = unsafe { KERNEL_CHANNEL_1TO0.as_mut().unwrap() };
     let mut buffer = Vec::<u8>::new();
-    send_args(&mut buffer, service, tag.as_ref(), data).expect("RPC encoding failed");
+    send_args(&mut buffer, service, tag.as_ref(), data, true).expect("RPC encoding failed");
     core1_tx.send(Message::RpcSend { is_async, data: buffer });
 }
 
-pub extern fn rpc_send(service: u32, tag: &CSlice<u8>, data: *const *const ()) {
+pub extern "C" fn rpc_send(service: u32, tag: &CSlice<u8>, data: *const *const ()) {
     rpc_send_common(false, service, tag, data);
 }
 
-pub extern fn rpc_send_async(service: u32, tag: &CSlice<u8>, data: *const *const ()) {
+pub extern "C" fn rpc_send_async(service: u32, tag: &CSlice<u8>, data: *const *const ()) {
     rpc_send_common(true, service, tag, data);
 }
 
-pub extern fn rpc_recv(slot: *mut ()) -> usize {
+pub extern "C" fn rpc_recv(slot: *mut ()) -> usize {
     let reply = unsafe {
         let core1_rx = KERNEL_CHANNEL_0TO1.as_mut().unwrap();
         let core1_tx = KERNEL_CHANNEL_1TO0.as_mut().unwrap();
@@ -36,15 +33,15 @@ pub extern fn rpc_recv(slot: *mut ()) -> usize {
         Message::RpcRecvReply(Ok(alloc_size)) => alloc_size,
         Message::RpcRecvReply(Err(exception)) => unsafe {
             eh_artiq::raise(&eh_artiq::Exception {
-                id:       exception.id,
+                id: exception.id,
-                file:     CSlice::new(exception.file as *const u8, usize::MAX),
+                file: CSlice::new(exception.file as *const u8, usize::MAX),
-                line:     exception.line as u32,
+                line: exception.line as u32,
-                column:   exception.column as u32,
+                column: exception.column as u32,
                 function: CSlice::new(exception.function as *const u8, usize::MAX),
-                message:  CSlice::new(exception.message as *const u8, usize::MAX),
+                message: CSlice::new(exception.message as *const u8, usize::MAX),
-                param:    exception.param
+                param: exception.param,
             })
         },
-        _ => panic!("received unexpected reply to RpcRecvRequest: {:?}", reply)
+        _ => panic!("received unexpected reply to RpcRecvRequest: {:?}", reply),
     }
 }

src/libksupport/src/kernel/subkernel.rs

@@ -0,0 +1,112 @@
+use alloc::vec::Vec;
+
+use cslice::CSlice;
+
+use super::{Message, SubkernelStatus, KERNEL_CHANNEL_0TO1, KERNEL_CHANNEL_1TO0};
+use crate::{artiq_raise, eh_artiq, rpc::send_args, rtio::now_mu};
+
+pub extern "C" fn load_run(id: u32, destination: u8, run: bool) {
+    unsafe {
+        KERNEL_CHANNEL_1TO0
+            .as_mut()
+            .unwrap()
+            .send(Message::SubkernelLoadRunRequest {
+                id: id,
+                destination: destination,
+                run: run,
+                timestamp: now_mu() as u64,
+            });
+    }
+    match unsafe { KERNEL_CHANNEL_0TO1.as_mut().unwrap() }.recv() {
+        Message::SubkernelLoadRunReply { succeeded: true } => (),
+        Message::SubkernelLoadRunReply { succeeded: false } => {
+            artiq_raise!("SubkernelError", "Error loading or running the subkernel")
+        }
+        _ => panic!("Expected SubkernelLoadRunReply after SubkernelLoadRunRequest!"),
+    }
+}
+
+pub extern "C" fn await_finish(id: u32, timeout: i64) {
+    unsafe {
+        KERNEL_CHANNEL_1TO0
+            .as_mut()
+            .unwrap()
+            .send(Message::SubkernelAwaitFinishRequest {
+                id: id,
+                timeout: timeout,
+            });
+    }
+    match unsafe { KERNEL_CHANNEL_0TO1.as_mut().unwrap() }.recv() {
+        Message::SubkernelAwaitFinishReply => (),
+        Message::SubkernelError(SubkernelStatus::IncorrectState) => {
+            artiq_raise!("SubkernelError", "Subkernel not running")
+        }
+        Message::SubkernelError(SubkernelStatus::Timeout) => artiq_raise!("SubkernelError", "Subkernel timed out"),
+        Message::SubkernelError(SubkernelStatus::CommLost) => {
+            artiq_raise!("SubkernelError", "Lost communication with satellite")
+        }
+        Message::SubkernelError(SubkernelStatus::OtherError) => {
+            artiq_raise!("SubkernelError", "An error occurred during subkernel operation")
+        }
+        Message::SubkernelError(SubkernelStatus::Exception(raw_exception)) => eh_artiq::raise_raw(&raw_exception),
+        _ => panic!("expected SubkernelAwaitFinishReply after SubkernelAwaitFinishRequest"),
+    }
+}
+
+pub extern "C" fn send_message(
+    id: u32,
+    is_return: bool,
+    destination: u8,
+    count: u8,
+    tag: &CSlice<u8>,
+    data: *const *const (),
+) {
+    let mut buffer = Vec::<u8>::new();
+    send_args(&mut buffer, 0, tag.as_ref(), data, false).expect("RPC encoding failed");
+    // overwrite service tag, include how many tags are in the message
+    buffer[3] = count;
+    unsafe {
+        KERNEL_CHANNEL_1TO0.as_mut().unwrap().send(Message::SubkernelMsgSend {
+            id: id,
+            destination: if is_return { None } else { Some(destination) },
+            data: buffer[3..].to_vec(),
+        });
+    }
+    match unsafe { KERNEL_CHANNEL_0TO1.as_mut().unwrap() }.recv() {
+        Message::SubkernelMsgSent => (),
+        _ => panic!("expected SubkernelMsgSent after SubkernelMsgSend"),
+    }
+}
+
+pub extern "C" fn await_message(id: i32, timeout: i64, tags: &CSlice<u8>, min: u8, max: u8) {
+    unsafe {
+        KERNEL_CHANNEL_1TO0
+            .as_mut()
+            .unwrap()
+            .send(Message::SubkernelMsgRecvRequest {
+                id: id,
+                timeout: timeout,
+                tags: tags.as_ref().to_vec(),
+            });
+    }
+    match unsafe { KERNEL_CHANNEL_0TO1.as_mut().unwrap() }.recv() {
+        Message::SubkernelMsgRecvReply { count } => {
+            if min > count || count > max {
+                artiq_raise!("SubkernelError", "Received more or less arguments than required")
+            }
+        }
+        Message::SubkernelError(SubkernelStatus::IncorrectState) => {
+            artiq_raise!("SubkernelError", "Subkernel not running")
+        }
+        Message::SubkernelError(SubkernelStatus::Timeout) => artiq_raise!("SubkernelError", "Subkernel timed out"),
+        Message::SubkernelError(SubkernelStatus::CommLost) => {
+            artiq_raise!("SubkernelError", "Lost communication with satellite")
+        }
+        Message::SubkernelError(SubkernelStatus::OtherError) => {
+            artiq_raise!("SubkernelError", "An error occurred during subkernel operation")
+        }
+        Message::SubkernelError(SubkernelStatus::Exception(raw_exception)) => eh_artiq::raise_raw(&raw_exception),
+        _ => panic!("expected SubkernelMsgRecvReply after SubkernelMsgRecvRequest"),
+    }
+    // RpcRecvRequest should be called after this to receive message data
+}

src/libksupport/src/lib.rs

@@ -0,0 +1,163 @@
+#![no_std]
+#![feature(c_variadic)]
+#![feature(const_btree_new)]
+#![feature(const_in_array_repeat_expressions)]
+#![feature(naked_functions)]
+#![feature(asm)]
+
+#[macro_use]
+extern crate alloc;
+
+use alloc::{collections::BTreeMap, string::String};
+
+use io::{Cursor, ProtoRead};
+use libasync::block_async;
+use libconfig::Config;
+use log::{error, warn};
+#[cfg(has_drtiosat)]
+pub use pl::csr::drtiosat as rtio_core;
+#[cfg(has_rtio_core)]
+pub use pl::csr::rtio_core;
+use void::Void;
+
+pub mod eh_artiq;
+pub mod i2c;
+pub mod irq;
+pub mod kernel;
+pub mod rpc;
+#[cfg(ki_impl = "csr")]
+#[path = "rtio_csr.rs"]
+pub mod rtio;
+#[cfg(ki_impl = "acp")]
+#[path = "rtio_acp.rs"]
+pub mod rtio;
+#[rustfmt::skip]
+#[path = "../../../build/pl.rs"]
+pub mod pl;
+
+
+#[derive(Debug, Clone)]
+pub struct RPCException {
+    pub id: u32,
+    pub message: u32,
+    pub param: [i64; 3],
+    pub file: u32,
+    pub line: i32,
+    pub column: i32,
+    pub function: u32,
+}
+
+pub static mut SEEN_ASYNC_ERRORS: u8 = 0;
+
+pub const ASYNC_ERROR_COLLISION: u8 = 1 << 0;
+pub const ASYNC_ERROR_BUSY: u8 = 1 << 1;
+pub const ASYNC_ERROR_SEQUENCE_ERROR: u8 = 1 << 2;
+
+pub unsafe fn get_async_errors() -> u8 {
+    let errors = SEEN_ASYNC_ERRORS;
+    SEEN_ASYNC_ERRORS = 0;
+    errors
+}
+
+fn wait_for_async_rtio_error() -> nb::Result<(), Void> {
+    unsafe {
+        #[cfg(has_rtio_core)]
+        let errors = rtio_core::async_error_read();
+        #[cfg(has_drtiosat)]
+        let errors = rtio_core::protocol_error_read();
+        if errors != 0 {
+            Ok(())
+        } else {
+            Err(nb::Error::WouldBlock)
+        }
+    }
+}
+
+pub async fn report_async_rtio_errors() {
+    loop {
+        let _ = block_async!(wait_for_async_rtio_error()).await;
+        unsafe {
+            #[cfg(has_rtio_core)]
+            let errors = rtio_core::async_error_read();
+            #[cfg(has_drtiosat)]
+            let errors = rtio_core::protocol_error_read();
+            if errors & ASYNC_ERROR_COLLISION != 0 {
+                let channel = rtio_core::collision_channel_read();
+                error!(
+                    "RTIO collision involving channel 0x{:04x}:{}",
+                    channel,
+                    resolve_channel_name(channel as u32)
+                );
+            }
+            if errors & ASYNC_ERROR_BUSY != 0 {
+                let channel = rtio_core::busy_channel_read();
+                error!(
+                    "RTIO busy error involving channel 0x{:04x}:{}",
+                    channel,
+                    resolve_channel_name(channel as u32)
+                );
+            }
+            if errors & ASYNC_ERROR_SEQUENCE_ERROR != 0 {
+                let channel = rtio_core::sequence_error_channel_read();
+                error!(
+                    "RTIO sequence error involving channel 0x{:04x}:{}",
+                    channel,
+                    resolve_channel_name(channel as u32)
+                );
+            }
+            SEEN_ASYNC_ERRORS = errors;
+            #[cfg(has_rtio_core)]
+            rtio_core::async_error_write(errors);
+            #[cfg(has_drtiosat)]
+            rtio_core::protocol_error_write(errors);
+        }
+    }
+}
+
+static mut RTIO_DEVICE_MAP: BTreeMap<u32, String> = BTreeMap::new();
+
+fn read_device_map(cfg: &Config) -> BTreeMap<u32, String> {
+    let mut device_map: BTreeMap<u32, String> = BTreeMap::new();
+    let _ = cfg
+        .read("device_map")
+        .and_then(|raw_bytes| {
+            let mut bytes_cr = Cursor::new(raw_bytes);
+            let size = bytes_cr.read_u32().unwrap();
+            for _ in 0..size {
+                let channel = bytes_cr.read_u32().unwrap();
+                let device_name = bytes_cr.read_string().unwrap();
+                if let Some(old_entry) = device_map.insert(channel, device_name.clone()) {
+                    warn!(
+                        "conflicting device map entries for RTIO channel {}: '{}' and '{}'",
+                        channel, old_entry, device_name
+                    );
+                }
+            }
+            Ok(())
+        })
+        .or_else(|err| {
+            warn!(
+                "error reading device map ({}), device names will not be available in RTIO error messages",
+                err
+            );
+            Err(err)
+        });
+    device_map
+}
+
+fn _resolve_channel_name(channel: u32, device_map: &BTreeMap<u32, String>) -> String {
+    match device_map.get(&channel) {
+        Some(val) => val.clone(),
+        None => String::from("unknown"),
+    }
+}
+
+pub fn resolve_channel_name(channel: u32) -> String {
+    _resolve_channel_name(channel, unsafe { &RTIO_DEVICE_MAP })
+}
+
+pub fn setup_device_map(cfg: &Config) {
+    unsafe {
+        RTIO_DEVICE_MAP = read_device_map(cfg);
+    }
+}

src/libksupport/src/rpc.rs

@@ -0,0 +1,591 @@
+use core::str;
+
+use byteorder::{ByteOrder, NativeEndian};
+use core_io::{Error, Read, Write};
+use cslice::{CMutSlice, CSlice};
+use io::{ProtoRead, ProtoWrite};
+use log::trace;
+
+use self::tag::{split_tag, Tag, TagIterator};
+
+#[inline]
+pub fn round_up(val: usize, power_of_two: usize) -> usize {
+    assert!(power_of_two.is_power_of_two());
+    let max_rem = power_of_two - 1;
+    (val + max_rem) & (!max_rem)
+}
+
+#[inline]
+pub unsafe fn round_up_mut<T>(ptr: *mut T, power_of_two: usize) -> *mut T {
+    round_up(ptr as usize, power_of_two) as *mut T
+}
+
+#[inline]
+pub unsafe fn round_up_const<T>(ptr: *const T, power_of_two: usize) -> *const T {
+    round_up(ptr as usize, power_of_two) as *const T
+}
+
+#[inline]
+pub unsafe fn align_ptr<T>(ptr: *const ()) -> *const T {
+    round_up_const(ptr, core::mem::align_of::<T>()) as *const T
+}
+
+#[inline]
+pub unsafe fn align_ptr_mut<T>(ptr: *mut ()) -> *mut T {
+    round_up_mut(ptr, core::mem::align_of::<T>()) as *mut T
+}
+
+// versions for reader rather than TcpStream
+// they will be made into sync for satellite subkernels later
+unsafe fn recv_elements<F, R>(
+    reader: &mut R,
+    elt_tag: Tag,
+    length: usize,
+    storage: *mut (),
+    alloc: &mut F,
+) -> Result<(), Error>
+where
+    F: FnMut(usize) -> *mut (),
+    R: Read + ?Sized,
+{
+    match elt_tag {
+        Tag::Bool => {
+            let dest = core::slice::from_raw_parts_mut(storage as *mut u8, length);
+            reader.read_exact(dest)?;
+        }
+        Tag::Int32 => {
+            let ptr = storage as *mut u32;
+            let dest = core::slice::from_raw_parts_mut(ptr as *mut u8, length * 4);
+            reader.read_exact(dest)?;
+            drop(dest);
+            let dest = core::slice::from_raw_parts_mut(ptr, length);
+            NativeEndian::from_slice_u32(dest);
+        }
+        Tag::Int64 | Tag::Float64 => {
+            let ptr = storage as *mut u64;
+            let dest = core::slice::from_raw_parts_mut(ptr as *mut u8, length * 8);
+            reader.read_exact(dest)?;
+            drop(dest);
+            let dest = core::slice::from_raw_parts_mut(ptr, length);
+            NativeEndian::from_slice_u64(dest);
+        }
+        _ => {
+            let mut data = storage;
+            for _ in 0..length {
+                recv_value(reader, elt_tag, &mut data, alloc)?
+            }
+        }
+    }
+    Ok(())
+}
+
+unsafe fn recv_value<F, R>(reader: &mut R, tag: Tag, data: &mut *mut (), alloc: &mut F) -> Result<(), Error>
+where
+    F: FnMut(usize) -> *mut (),
+    R: Read + ?Sized,
+{
+    macro_rules! consume_value {
+        ($ty:ty, | $ptr:ident | $map:expr) => {{
+            let $ptr = align_ptr_mut::<$ty>(*data);
+            *data = $ptr.offset(1) as *mut ();
+            $map
+        }};
+    }
+
+    match tag {
+        Tag::None => Ok(()),
+        Tag::Bool => consume_value!(i8, |ptr| {
+            *ptr = reader.read_u8()? as i8;
+            Ok(())
+        }),
+        Tag::Int32 => consume_value!(i32, |ptr| {
+            *ptr = reader.read_u32()? as i32;
+            Ok(())
+        }),
+        Tag::Int64 | Tag::Float64 => consume_value!(i64, |ptr| {
+            *ptr = reader.read_u64()? as i64;
+            Ok(())
+        }),
+        Tag::String | Tag::Bytes | Tag::ByteArray => {
+            consume_value!(CMutSlice<u8>, |ptr| {
+                let length = reader.read_u32()? as usize;
+                *ptr = CMutSlice::new(alloc(length) as *mut u8, length);
+                reader.read_exact((*ptr).as_mut())?;
+                Ok(())
+            })
+        }
+        Tag::Tuple(it, arity) => {
+            let alignment = tag.alignment();
+            *data = round_up_mut(*data, alignment);
+            let mut it = it.clone();
+            for _ in 0..arity {
+                let tag = it.next().expect("truncated tag");
+                recv_value(reader, tag, data, alloc)?
+            }
+            *data = round_up_mut(*data, alignment);
+            Ok(())
+        }
+        Tag::List(it) => {
+            #[repr(C)]
+            struct List {
+                elements: *mut (),
+                length: usize,
+            }
+            consume_value!(*mut List, |ptr_to_list| {
+                let tag = it.clone().next().expect("truncated tag");
+                let length = reader.read_u32()? as usize;
+
+                let list_size = 4 + 4;
+                let storage_offset = round_up(list_size, tag.alignment());
+                let storage_size = tag.size() * length;
+
+                let allocation = alloc(storage_offset + storage_size) as *mut u8;
+                *ptr_to_list = allocation as *mut List;
+                let storage = allocation.offset(storage_offset as isize) as *mut ();
+
+                (**ptr_to_list).length = length;
+                (**ptr_to_list).elements = storage;
+                recv_elements(reader, tag, length, storage, alloc)
+            })
+        }
+        Tag::Array(it, num_dims) => {
+            consume_value!(*mut (), |buffer| {
+                let mut total_len: usize = 1;
+                for _ in 0..num_dims {
+                    let len = reader.read_u32()? as usize;
+                    total_len *= len;
+                    consume_value!(usize, |ptr| *ptr = len)
+                }
+
+                let elt_tag = it.clone().next().expect("truncated tag");
+                *buffer = alloc(elt_tag.size() * total_len);
+                recv_elements(reader, elt_tag, total_len, *buffer, alloc)
+            })
+        }
+        Tag::Range(it) => {
+            *data = round_up_mut(*data, tag.alignment());
+            let tag = it.clone().next().expect("truncated tag");
+            recv_value(reader, tag, data, alloc)?;
+            recv_value(reader, tag, data, alloc)?;
+            recv_value(reader, tag, data, alloc)?;
+            Ok(())
+        }
+        Tag::Keyword(_) => unreachable!(),
+        Tag::Object => unreachable!(),
+    }
+}
+
+pub fn recv_return<'a, F, R>(
+    reader: &mut R,
+    tag_bytes: &'a [u8],
+    data: *mut (),
+    alloc: &mut F,
+) -> Result<&'a [u8], Error>
+where
+    F: FnMut(usize) -> *mut (),
+    R: Read + ?Sized,
+{
+    let mut it = TagIterator::new(tag_bytes);
+    trace!("recv ...->{}", it);
+
+    let tag = it.next().expect("truncated tag");
+    let mut data = data;
+    unsafe { recv_value(reader, tag, &mut data, alloc)? };
+
+    Ok(it.data)
+}
+
+unsafe fn send_elements<W>(
+    writer: &mut W,
+    elt_tag: Tag,
+    length: usize,
+    data: *const (),
+    write_tags: bool,
+) -> Result<(), Error>
+where
+    W: Write + ?Sized,
+{
+    if write_tags {
+        writer.write_u8(elt_tag.as_u8())?;
+    }
+    match elt_tag {
+        // we cannot use NativeEndian::from_slice_i32 as the data is not mutable,
+        // and that is not needed as the data is already in native endian
+        Tag::Bool => {
+            let slice = core::slice::from_raw_parts(data as *const u8, length);
+            writer.write_all(slice)?;
+        }
+        Tag::Int32 => {
+            let slice = core::slice::from_raw_parts(data as *const u8, length * 4);
+            writer.write_all(slice)?;
+        }
+        Tag::Int64 | Tag::Float64 => {
+            let slice = core::slice::from_raw_parts(data as *const u8, length * 8);
+            writer.write_all(slice)?;
+        }
+        _ => {
+            let mut data = data;
+            for _ in 0..length {
+                send_value(writer, elt_tag, &mut data, write_tags)?;
+            }
+        }
+    }
+    Ok(())
+}
+
+unsafe fn send_value<W>(writer: &mut W, tag: Tag, data: &mut *const (), write_tags: bool) -> Result<(), Error>
+where W: Write + ?Sized {
+    macro_rules! consume_value {
+        ($ty:ty, | $ptr:ident | $map:expr) => {{
+            let $ptr = align_ptr::<$ty>(*data);
+            *data = $ptr.offset(1) as *const ();
+            $map
+        }};
+    }
+
+    if write_tags {
+        writer.write_u8(tag.as_u8())?;
+    }
+    match tag {
+        Tag::None => Ok(()),
+        Tag::Bool => consume_value!(u8, |ptr| writer.write_u8(*ptr)),
+        Tag::Int32 => consume_value!(u32, |ptr| writer.write_u32(*ptr)),
+        Tag::Int64 | Tag::Float64 => consume_value!(u64, |ptr| writer.write_u64(*ptr)),
+        Tag::String => consume_value!(CSlice<u8>, |ptr| {
+            writer.write_string(str::from_utf8((*ptr).as_ref()).unwrap())
+        }),
+        Tag::Bytes | Tag::ByteArray => consume_value!(CSlice<u8>, |ptr| writer.write_bytes((*ptr).as_ref())),
+        Tag::Tuple(it, arity) => {
+            let mut it = it.clone();
+            if write_tags {
+                writer.write_u8(arity)?;
+            }
+            let mut max_alignment = 0;
+            for _ in 0..arity {
+                let tag = it.next().expect("truncated tag");
+                max_alignment = core::cmp::max(max_alignment, tag.alignment());
+                send_value(writer, tag, data, write_tags)?
+            }
+            *data = round_up_const(*data, max_alignment);
+            Ok(())
+        }
+        Tag::List(it) => {
+            #[repr(C)]
+            struct List {
+                elements: *const (),
+                length: u32,
+            }
+            consume_value!(&List, |ptr| {
+                let length = (**ptr).length as usize;
+                writer.write_u32((*ptr).length)?;
+                let tag = it.clone().next().expect("truncated tag");
+                send_elements(writer, tag, length, (**ptr).elements, write_tags)
+            })
+        }
+        Tag::Array(it, num_dims) => {
+            if write_tags {
+                writer.write_u8(num_dims)?;
+            }
+            consume_value!(*const (), |buffer| {
+                let elt_tag = it.clone().next().expect("truncated tag");
+
+                let mut total_len = 1;
+                for _ in 0..num_dims {
+                    consume_value!(u32, |len| {
+                        writer.write_u32(*len)?;
+                        total_len *= *len;
+                    })
+                }
+                let length = total_len as usize;
+                send_elements(writer, elt_tag, length, *buffer, write_tags)
+            })
+        }
+        Tag::Range(it) => {
+            let tag = it.clone().next().expect("truncated tag");
+            send_value(writer, tag, data, write_tags)?;
+            send_value(writer, tag, data, write_tags)?;
+            send_value(writer, tag, data, write_tags)?;
+            Ok(())
+        }
+        Tag::Keyword(it) => {
+            #[repr(C)]
+            struct Keyword<'a> {
+                name: CSlice<'a, u8>,
+            }
+            consume_value!(Keyword, |ptr| {
+                writer.write_string(str::from_utf8((*ptr).name.as_ref()).unwrap())?;
+                let tag = it.clone().next().expect("truncated tag");
+                let mut data = ptr.offset(1) as *const ();
+                send_value(writer, tag, &mut data, write_tags)
+            })
+            // Tag::Keyword never appears in composite types, so we don't have
+            // to accurately advance data.
+        }
+        Tag::Object => {
+            #[repr(C)]
+            struct Object {
+                id: u32,
+            }
+            consume_value!(*const Object, |ptr| writer.write_u32((**ptr).id))
+        }
+    }
+}
+
+pub fn send_args<W>(
+    writer: &mut W,
+    service: u32,
+    tag_bytes: &[u8],
+    data: *const *const (),
+    write_tags: bool,
+) -> Result<(), Error>
+where
+    W: Write + ?Sized,
+{
+    let (arg_tags_bytes, return_tag_bytes) = split_tag(tag_bytes);
+
+    let mut args_it = TagIterator::new(arg_tags_bytes);
+    let return_it = TagIterator::new(return_tag_bytes);
+    trace!("send<{}>({})->{}", service, args_it, return_it);
+
+    writer.write_u32(service)?;
+    for index in 0.. {
+        if let Some(arg_tag) = args_it.next() {
+            let mut data = unsafe { *data.offset(index) };
+            unsafe { send_value(writer, arg_tag, &mut data, write_tags)? };
+        } else {
+            break;
+        }
+    }
+    writer.write_u8(0)?;
+    writer.write_bytes(return_tag_bytes)?;
+
+    Ok(())
+}
+
+pub mod tag {
+    use core::fmt;
+
+    pub fn split_tag(tag_bytes: &[u8]) -> (&[u8], &[u8]) {
+        let tag_separator = tag_bytes
+            .iter()
+            .position(|&b| b == b':')
+            .expect("tag without a return separator");
+        let (arg_tags_bytes, rest) = tag_bytes.split_at(tag_separator);
+        let return_tag_bytes = &rest[1..];
+        (arg_tags_bytes, return_tag_bytes)
+    }
+
+    #[derive(Debug, Clone, Copy)]
+    pub enum Tag<'a> {
+        None,
+        Bool,
+        Int32,
+        Int64,
+        Float64,
+        String,
+        Bytes,
+        ByteArray,
+        Tuple(TagIterator<'a>, u8),
+        List(TagIterator<'a>),
+        Array(TagIterator<'a>, u8),
+        Range(TagIterator<'a>),
+        Keyword(TagIterator<'a>),
+        Object,
+    }
+
+    impl<'a> Tag<'a> {
+        pub fn as_u8(self) -> u8 {
+            match self {
+                Tag::None => b'n',
+                Tag::Bool => b'b',
+                Tag::Int32 => b'i',
+                Tag::Int64 => b'I',
+                Tag::Float64 => b'f',
+                Tag::String => b's',
+                Tag::Bytes => b'B',
+                Tag::ByteArray => b'A',
+                Tag::Tuple(_, _) => b't',
+                Tag::List(_) => b'l',
+                Tag::Array(_, _) => b'a',
+                Tag::Range(_) => b'r',
+                Tag::Keyword(_) => b'k',
+                Tag::Object => b'O',
+            }
+        }
+
+        pub fn alignment(self) -> usize {
+            use cslice::CSlice;
+            match self {
+                Tag::None => 1,
+                Tag::Bool => core::mem::align_of::<u8>(),
+                Tag::Int32 => core::mem::align_of::<i32>(),
+                Tag::Int64 => core::mem::align_of::<i64>(),
+                Tag::Float64 => core::mem::align_of::<f64>(),
+                // struct type: align to largest element
+                Tag::Tuple(it, arity) => {
+                    let it = it.clone();
+                    it.take(arity.into()).map(|t| t.alignment()).max().unwrap()
+                }
+                Tag::Range(it) => {
+                    let it = it.clone();
+                    it.take(3).map(|t| t.alignment()).max().unwrap()
+                }
+                // the ptr/length(s) pair is basically CSlice
+                Tag::Bytes | Tag::String | Tag::ByteArray | Tag::List(_) | Tag::Array(_, _) => {
+                    core::mem::align_of::<CSlice<()>>()
+                }
+                Tag::Keyword(_) => unreachable!("Tag::Keyword should not appear in composite types"),
+                Tag::Object => core::mem::align_of::<u32>(),
+            }
+        }
+
+        pub fn size(self) -> usize {
+            match self {
+                Tag::None => 0,
+                Tag::Bool => 1,
+                Tag::Int32 => 4,
+                Tag::Int64 => 8,
+                Tag::Float64 => 8,
+                Tag::String => 8,
+                Tag::Bytes => 8,
+                Tag::ByteArray => 8,
+                Tag::Tuple(it, arity) => {
+                    let mut size = 0;
+                    let mut max_alignment = 0;
+                    let mut it = it.clone();
+                    for _ in 0..arity {
+                        let tag = it.next().expect("truncated tag");
+                        let alignment = tag.alignment();
+                        max_alignment = core::cmp::max(max_alignment, alignment);
+                        size = super::round_up(size, alignment);
+                        size += tag.size();
+                    }
+                    // Take into account any tail padding (if element(s) with largest
+                    // alignment are not at the end).
+                    size = super::round_up(size, max_alignment);
+                    size
+                }
+                Tag::List(_) => 4,
+                Tag::Array(_, num_dims) => 4 * (1 + num_dims as usize),
+                Tag::Range(it) => {
+                    let tag = it.clone().next().expect("truncated tag");
+                    tag.size() * 3
+                }
+                Tag::Keyword(_) => unreachable!(),
+                Tag::Object => unreachable!(),
+            }
+        }
+    }
+
+    #[derive(Debug, Clone, Copy)]
+    pub struct TagIterator<'a> {
+        pub data: &'a [u8],
+    }
+
+    impl<'a> TagIterator<'a> {
+        pub fn new(data: &'a [u8]) -> TagIterator<'a> {
+            TagIterator { data }
+        }
+
+        fn sub(&mut self, count: u8) -> TagIterator<'a> {
+            let data = self.data;
+            for _ in 0..count {
+                self.next().expect("truncated tag");
+            }
+            TagIterator {
+                data: &data[..(data.len() - self.data.len())],
+            }
+        }
+    }
+
+    impl<'a> core::iter::Iterator for TagIterator<'a> {
+        type Item = Tag<'a>;
+
+        fn next(&mut self) -> Option<Tag<'a>> {
+            if self.data.len() == 0 {
+                return None;
+            }
+
+            let tag_byte = self.data[0];
+            self.data = &self.data[1..];
+            Some(match tag_byte {
+                b'n' => Tag::None,
+                b'b' => Tag::Bool,
+                b'i' => Tag::Int32,
+                b'I' => Tag::Int64,
+                b'f' => Tag::Float64,
+                b's' => Tag::String,
+                b'B' => Tag::Bytes,
+                b'A' => Tag::ByteArray,
+                b't' => {
+                    let count = self.data[0];
+                    self.data = &self.data[1..];
+                    Tag::Tuple(self.sub(count), count)
+                }
+                b'l' => Tag::List(self.sub(1)),
+                b'a' => {
+                    let count = self.data[0];
+                    self.data = &self.data[1..];
+                    Tag::Array(self.sub(1), count)
+                }
+                b'r' => Tag::Range(self.sub(1)),
+                b'k' => Tag::Keyword(self.sub(1)),
+                b'O' => Tag::Object,
+                _ => unreachable!(),
+            })
+        }
+    }
+
+    impl<'a> fmt::Display for TagIterator<'a> {
+        fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
+            let mut it = self.clone();
+            let mut first = true;
+            while let Some(tag) = it.next() {
+                if first {
+                    first = false
+                } else {
+                    write!(f, ", ")?
+                }
+
+                match tag {
+                    Tag::None => write!(f, "None")?,
+                    Tag::Bool => write!(f, "Bool")?,
+                    Tag::Int32 => write!(f, "Int32")?,
+                    Tag::Int64 => write!(f, "Int64")?,
+                    Tag::Float64 => write!(f, "Float64")?,
+                    Tag::String => write!(f, "String")?,
+                    Tag::Bytes => write!(f, "Bytes")?,
+                    Tag::ByteArray => write!(f, "ByteArray")?,
+                    Tag::Tuple(it, _) => {
+                        write!(f, "Tuple(")?;
+                        it.fmt(f)?;
+                        write!(f, ")")?;
+                    }
+                    Tag::List(it) => {
+                        write!(f, "List(")?;
+                        it.fmt(f)?;
+                        write!(f, ")")?;
+                    }
+                    Tag::Array(it, num_dims) => {
+                        write!(f, "Array(")?;
+                        it.fmt(f)?;
+                        write!(f, ", {})", num_dims)?;
+                    }
+                    Tag::Range(it) => {
+                        write!(f, "Range(")?;
+                        it.fmt(f)?;
+                        write!(f, ")")?;
+                    }
+                    Tag::Keyword(it) => {
+                        write!(f, "Keyword(")?;
+                        it.fmt(f)?;
+                        write!(f, ")")?;
+                    }
+                    Tag::Object => write!(f, "Object")?,
+                }
+            }
+
+            Ok(())
+        }
+    }
+}

src/libksupport/src/rtio_acp.rs

@@ -1,18 +1,19 @@
-use cslice::CSlice;
-use vcell::VolatileCell;
-use libcortex_a9::asm;
-use crate::artiq_raise;
 use core::sync::atomic::{fence, Ordering};
 
-use crate::pl::csr;
+use cslice::CSlice;
+use libcortex_a9::asm;
+use vcell::VolatileCell;
 
-pub const RTIO_O_STATUS_WAIT:                      i32 = 1;
+use crate::{artiq_raise, pl::csr, resolve_channel_name, rtio_core};
-pub const RTIO_O_STATUS_UNDERFLOW:                 i32 = 2;
+
-pub const RTIO_O_STATUS_DESTINATION_UNREACHABLE:   i32 = 4;
+pub const RTIO_O_STATUS_WAIT: i32 = 1;
-pub const RTIO_I_STATUS_WAIT_EVENT:                i32 = 1;
+pub const RTIO_O_STATUS_UNDERFLOW: i32 = 2;
-pub const RTIO_I_STATUS_OVERFLOW:                  i32 = 2;
+pub const RTIO_O_STATUS_DESTINATION_UNREACHABLE: i32 = 4;
-pub const RTIO_I_STATUS_WAIT_STATUS:               i32 = 4; // TODO
+pub const RTIO_I_STATUS_WAIT_EVENT: i32 = 1;
-pub const RTIO_I_STATUS_DESTINATION_UNREACHABLE:   i32 = 8;
+pub const RTIO_I_STATUS_OVERFLOW: i32 = 2;
+#[allow(unused)]
+pub const RTIO_I_STATUS_WAIT_STATUS: i32 = 4; // TODO
+pub const RTIO_I_STATUS_DESTINATION_UNREACHABLE: i32 = 8;
 
 #[repr(C)]
 pub struct TimestampedData {
@@ -46,18 +47,18 @@ static mut TRANSACTION_BUFFER: Transaction = Transaction {
     reply_timestamp: VolatileCell::new(0),
     padding0: [0; 2],
     padding1: [0; 2],
-    padding2: [0; 2]
+    padding2: [0; 2],
 };
 
-pub extern fn init() {
+pub extern "C" fn init() {
     unsafe {
-        csr::rtio_core::reset_write(1);
+        rtio_core::reset_write(1);
         csr::rtio::engine_addr_base_write(&TRANSACTION_BUFFER as *const Transaction as u32);
         csr::rtio::enable_write(1);
     }
 }
 
-pub extern fn get_counter() -> i64 {
+pub extern "C" fn get_counter() -> i64 {
     unsafe {
         csr::rtio::counter_update_write(1);
         csr::rtio::counter_read() as i64
@@ -66,15 +67,15 @@ pub extern fn get_counter() -> i64 {
 
 static mut NOW: i64 = 0;
 
-pub extern fn now_mu() -> i64 {
+pub extern "C" fn now_mu() -> i64 {
     unsafe { NOW }
 }
 
-pub extern fn at_mu(t: i64) {
+pub extern "C" fn at_mu(t: i64) {
     unsafe { NOW = t }
 }
 
-pub extern fn delay_mu(dt: i64) {
+pub extern "C" fn delay_mu(dt: i64) {
     unsafe { NOW += dt }
 }
 
@@ -86,18 +87,34 @@ unsafe fn process_exceptional_status(channel: i32, status: i32) {
         while csr::rtio::o_status_read() as i32 & RTIO_O_STATUS_WAIT != 0 {}
     }
     if status & RTIO_O_STATUS_UNDERFLOW != 0 {
-        artiq_raise!("RTIOUnderflow",
+        artiq_raise!(
-            "RTIO underflow at {0} mu, channel {1}, slack {2} mu",
+            "RTIOUnderflow",
-            timestamp, channel as i64, timestamp - get_counter());
+            format!(
+                "RTIO underflow at {{1}} mu, channel 0x{:04x}:{}, slack {{2}} mu",
+                channel,
+                resolve_channel_name(channel as u32)
+            ),
+            channel as i64,
+            timestamp,
+            timestamp - get_counter()
+        );
     }
     if status & RTIO_O_STATUS_DESTINATION_UNREACHABLE != 0 {
-        artiq_raise!("RTIODestinationUnreachable",
+        artiq_raise!(
-            "RTIO destination unreachable, output, at {0} mu, channel {1}",
+            "RTIODestinationUnreachable",
-            timestamp, channel as i64, 0);
+            format!(
+                "RTIO destination unreachable, output, at {{0}} mu, channel 0x{:04x}:{}",
+                channel,
+                resolve_channel_name(channel as u32)
+            ),
+            timestamp,
+            channel as i64,
+            0
+        );
     }
 }
 
-pub extern fn output(target: i32, data: i32) {
+pub extern "C" fn output(target: i32, data: i32) {
     unsafe {
         // Clear status so we can observe response
         TRANSACTION_BUFFER.reply_status.set(0);
@@ -125,7 +142,7 @@ pub extern fn output(target: i32, data: i32) {
     }
 }
 
-pub extern fn output_wide(target: i32, data: CSlice<i32>) {
+pub extern "C" fn output_wide(target: i32, data: CSlice<i32>) {
     unsafe {
         // Clear status so we can observe response
         TRANSACTION_BUFFER.reply_status.set(0);
@@ -142,7 +159,7 @@ pub extern fn output_wide(target: i32, data: CSlice<i32>) {
         loop {
             status = TRANSACTION_BUFFER.reply_status.get();
             if status != 0 {
-                break
+                break;
             }
         }
 
@@ -153,8 +170,8 @@ pub extern fn output_wide(target: i32, data: CSlice<i32>) {
     }
 }
 
-pub extern fn input_timestamp(timeout: i64, channel: i32) -> i64 {
+pub extern "C" fn input_timestamp(timeout: i64, channel: i32) -> i64 {
-   unsafe {
+    unsafe {
         // Clear status so we can observe response
         TRANSACTION_BUFFER.reply_status.set(0);
 
@@ -170,29 +187,45 @@ pub extern fn input_timestamp(timeout: i64, channel: i32) -> i64 {
         loop {
             status = TRANSACTION_BUFFER.reply_status.get();
             if status != 0 {
-                break
+                break;
             }
         }
 
         if status & RTIO_I_STATUS_OVERFLOW != 0 {
-            artiq_raise!("RTIOOverflow",
+            artiq_raise!(
-                         "RTIO input overflow on channel {0}",
+                "RTIOOverflow",
-                         channel as i64, 0, 0);
+                format!(
+                    "RTIO input overflow on channel 0x{:04x}:{}",
+                    channel,
+                    resolve_channel_name(channel as u32)
+                ),
+                channel as i64,
+                0,
+                0
+            );
         }
         if status & RTIO_I_STATUS_WAIT_EVENT != 0 {
-            return -1
+            return -1;
         }
         if status & RTIO_I_STATUS_DESTINATION_UNREACHABLE != 0 {
-            artiq_raise!("RTIODestinationUnreachable",
+            artiq_raise!(
-                         "RTIO destination unreachable, input, on channel {0}",
+                "RTIODestinationUnreachable",
-                         channel as i64, 0, 0);
+                format!(
+                    "RTIO destination unreachable, input, on channel 0x{:04x}:{}",
+                    channel,
+                    resolve_channel_name(channel as u32)
+                ),
+                channel as i64,
+                0,
+                0
+            );
         }
 
         TRANSACTION_BUFFER.reply_timestamp.get()
     }
 }
 
-pub extern fn input_data(channel: i32) -> i32 {
+pub extern "C" fn input_data(channel: i32) -> i32 {
     unsafe {
         TRANSACTION_BUFFER.reply_status.set(0);
 
@@ -208,26 +241,42 @@ pub extern fn input_data(channel: i32) -> i32 {
         loop {
             status = TRANSACTION_BUFFER.reply_status.get();
             if status != 0 {
-                break
+                break;
             }
         }
 
         if status & RTIO_I_STATUS_OVERFLOW != 0 {
-            artiq_raise!("RTIOOverflow",
+            artiq_raise!(
-                         "RTIO input overflow on channel {0}",
+                "RTIOOverflow",
-                         channel as i64, 0, 0);
+                format!(
+                    "RTIO input overflow on channel 0x{:04x}:{}",
+                    channel,
+                    resolve_channel_name(channel as u32)
+                ),
+                channel as i64,
+                0,
+                0
+            );
         }
         if status & RTIO_I_STATUS_DESTINATION_UNREACHABLE != 0 {
-            artiq_raise!("RTIODestinationUnreachable",
+            artiq_raise!(
-                         "RTIO destination unreachable, input, on channel {0}",
+                "RTIODestinationUnreachable",
-                         channel as i64, 0, 0);
+                format!(
+                    "RTIO destination unreachable, input, on channel 0x{:04x}:{}",
+                    channel,
+                    resolve_channel_name(channel as u32)
+                ),
+                channel as i64,
+                0,
+                0
+            );
         }
 
         TRANSACTION_BUFFER.reply_data.get()
     }
 }
 
-pub extern fn input_timestamped_data(timeout: i64, channel: i32) -> TimestampedData {
+pub extern "C" fn input_timestamped_data(timeout: i64, channel: i32) -> TimestampedData {
     unsafe {
         TRANSACTION_BUFFER.reply_status.set(0);
 
@@ -243,19 +292,35 @@ pub extern fn input_timestamped_data(timeout: i64, channel: i32) -> TimestampedD
         loop {
             status = TRANSACTION_BUFFER.reply_status.get();
             if status != 0 {
-                break
+                break;
             }
         }
 
         if status & RTIO_I_STATUS_OVERFLOW != 0 {
-            artiq_raise!("RTIOOverflow",
+            artiq_raise!(
-                         "RTIO input overflow on channel {0}",
+                "RTIOOverflow",
-                         channel as i64, 0, 0);
+                format!(
+                    "RTIO input overflow on channel 0x{:04x}:{}",
+                    channel,
+                    resolve_channel_name(channel as u32)
+                ),
+                channel as i64,
+                0,
+                0
+            );
         }
         if status & RTIO_I_STATUS_DESTINATION_UNREACHABLE != 0 {
-            artiq_raise!("RTIODestinationUnreachable",
+            artiq_raise!(
-                         "RTIO destination unreachable, input, on channel {0}",
+                "RTIODestinationUnreachable",
-                         channel as i64, 0, 0);
+                format!(
+                    "RTIO destination unreachable, input, on channel 0x{:04x}:{}",
+                    channel,
+                    resolve_channel_name(channel as u32)
+                ),
+                channel as i64,
+                0,
+                0
+            );
         }
 
         TimestampedData {

src/libksupport/src/rtio_csr.rs

@@ -0,0 +1,274 @@
+use core::ptr::{read_volatile, write_volatile};
+
+use cslice::CSlice;
+
+use crate::{artiq_raise, pl::csr, resolve_channel_name, rtio_core};
+
+pub const RTIO_O_STATUS_WAIT: u8 = 1;
+pub const RTIO_O_STATUS_UNDERFLOW: u8 = 2;
+pub const RTIO_O_STATUS_DESTINATION_UNREACHABLE: u8 = 4;
+pub const RTIO_I_STATUS_WAIT_EVENT: u8 = 1;
+pub const RTIO_I_STATUS_OVERFLOW: u8 = 2;
+pub const RTIO_I_STATUS_WAIT_STATUS: u8 = 4;
+pub const RTIO_I_STATUS_DESTINATION_UNREACHABLE: u8 = 8;
+
+#[repr(C)]
+pub struct TimestampedData {
+    timestamp: i64,
+    data: i32,
+}
+
+pub extern "C" fn init() {
+    unsafe {
+        rtio_core::reset_write(1);
+    }
+}
+
+pub extern "C" fn get_counter() -> i64 {
+    unsafe {
+        csr::rtio::counter_update_write(1);
+        csr::rtio::counter_read() as i64
+    }
+}
+
+pub extern "C" fn now_mu() -> i64 {
+    unsafe { csr::rtio::now_read() as i64 }
+}
+
+pub extern "C" fn at_mu(t: i64) {
+    unsafe {
+        csr::rtio::now_write(t as u64);
+    }
+}
+
+pub extern "C" fn delay_mu(dt: i64) {
+    unsafe {
+        csr::rtio::now_write(csr::rtio::now_read() + dt as u64);
+    }
+}
+
+// writing the LSB of o_data (offset=0) triggers the RTIO write
+#[inline(always)]
+pub unsafe fn rtio_o_data_write(offset: usize, data: u32) {
+    write_volatile(
+        csr::rtio::O_DATA_ADDR.offset((csr::rtio::O_DATA_SIZE - 1 - offset) as isize),
+        data,
+    );
+}
+
+#[inline(always)]
+pub unsafe fn rtio_i_data_read(offset: usize) -> u32 {
+    read_volatile(csr::rtio::I_DATA_ADDR.offset((csr::rtio::I_DATA_SIZE - 1 - offset) as isize))
+}
+
+#[inline(never)]
+unsafe fn process_exceptional_status(channel: i32, status: u8) {
+    let timestamp = csr::rtio::now_read() as i64;
+    if status & RTIO_O_STATUS_WAIT != 0 {
+        while csr::rtio::o_status_read() & RTIO_O_STATUS_WAIT != 0 {}
+    }
+    if status & RTIO_O_STATUS_UNDERFLOW != 0 {
+        artiq_raise!(
+            "RTIOUnderflow",
+            format!(
+                "RTIO underflow at {{1}} mu, channel 0x{:04x}:{}, slack {{2}} mu",
+                channel,
+                resolve_channel_name(channel as u32)
+            ),
+            channel as i64,
+            timestamp,
+            timestamp - get_counter()
+        );
+    }
+    if status & RTIO_O_STATUS_DESTINATION_UNREACHABLE != 0 {
+        artiq_raise!(
+            "RTIODestinationUnreachable",
+            format!(
+                "RTIO destination unreachable, output, at {{0}} mu, channel 0x{:04x}:{}",
+                channel,
+                resolve_channel_name(channel as u32)
+            ),
+            timestamp,
+            channel as i64,
+            0
+        );
+    }
+}
+
+pub extern "C" fn output(target: i32, data: i32) {
+    unsafe {
+        csr::rtio::target_write(target as u32);
+        // writing target clears o_data
+        rtio_o_data_write(0, data as _);
+        let status = csr::rtio::o_status_read();
+        if status != 0 {
+            process_exceptional_status(target >> 8, status);
+        }
+    }
+}
+
+pub extern "C" fn output_wide(target: i32, data: &CSlice<i32>) {
+    unsafe {
+        csr::rtio::target_write(target as u32);
+        // writing target clears o_data
+        for i in (0..data.len()).rev() {
+            rtio_o_data_write(i, data[i] as _)
+        }
+        let status = csr::rtio::o_status_read();
+        if status != 0 {
+            process_exceptional_status(target >> 8, status);
+        }
+    }
+}
+
+pub extern "C" fn input_timestamp(timeout: i64, channel: i32) -> i64 {
+    unsafe {
+        csr::rtio::target_write((channel as u32) << 8);
+        csr::rtio::i_timeout_write(timeout as u64);
+
+        let mut status = RTIO_I_STATUS_WAIT_STATUS;
+        while status & RTIO_I_STATUS_WAIT_STATUS != 0 {
+            status = csr::rtio::i_status_read();
+        }
+
+        if status & RTIO_I_STATUS_OVERFLOW != 0 {
+            artiq_raise!(
+                "RTIOOverflow",
+                format!(
+                    "RTIO input overflow on channel 0x{:04x}:{}",
+                    channel,
+                    resolve_channel_name(channel as u32)
+                ),
+                channel as i64,
+                0,
+                0
+            );
+        }
+        if status & RTIO_I_STATUS_WAIT_EVENT != 0 {
+            return -1;
+        }
+        if status & RTIO_I_STATUS_DESTINATION_UNREACHABLE != 0 {
+            artiq_raise!(
+                "RTIODestinationUnreachable",
+                format!(
+                    "RTIO destination unreachable, input, on channel 0x{:04x}:{}",
+                    channel,
+                    resolve_channel_name(channel as u32)
+                ),
+                channel as i64,
+                0,
+                0
+            );
+        }
+
+        csr::rtio::i_timestamp_read() as i64
+    }
+}
+
+pub extern "C" fn input_data(channel: i32) -> i32 {
+    unsafe {
+        csr::rtio::target_write((channel as u32) << 8);
+        csr::rtio::i_timeout_write(0xffffffff_ffffffff);
+
+        let mut status = RTIO_I_STATUS_WAIT_STATUS;
+        while status & RTIO_I_STATUS_WAIT_STATUS != 0 {
+            status = csr::rtio::i_status_read();
+        }
+
+        if status & RTIO_I_STATUS_OVERFLOW != 0 {
+            artiq_raise!(
+                "RTIOOverflow",
+                format!(
+                    "RTIO input overflow on channel 0x{:04x}:{}",
+                    channel,
+                    resolve_channel_name(channel as u32)
+                ),
+                channel as i64,
+                0,
+                0
+            );
+        }
+        if status & RTIO_I_STATUS_DESTINATION_UNREACHABLE != 0 {
+            artiq_raise!(
+                "RTIODestinationUnreachable",
+                format!(
+                    "RTIO destination unreachable, input, on channel 0x{:04x}:{}",
+                    channel,
+                    resolve_channel_name(channel as u32)
+                ),
+                channel as i64,
+                0,
+                0
+            );
+        }
+
+        rtio_i_data_read(0) as i32
+    }
+}
+
+pub extern "C" fn input_timestamped_data(timeout: i64, channel: i32) -> TimestampedData {
+    unsafe {
+        csr::rtio::target_write((channel as u32) << 8);
+        csr::rtio::i_timeout_write(timeout as u64);
+
+        let mut status = RTIO_I_STATUS_WAIT_STATUS;
+        while status & RTIO_I_STATUS_WAIT_STATUS != 0 {
+            status = csr::rtio::i_status_read();
+        }
+
+        if status & RTIO_I_STATUS_OVERFLOW != 0 {
+            artiq_raise!(
+                "RTIOOverflow",
+                format!(
+                    "RTIO input overflow on channel 0x{:04x}:{}",
+                    channel,
+                    resolve_channel_name(channel as u32)
+                ),
+                channel as i64,
+                0,
+                0
+            );
+        }
+        if status & RTIO_I_STATUS_WAIT_EVENT != 0 {
+            return TimestampedData { timestamp: -1, data: 0 };
+        }
+        if status & RTIO_I_STATUS_DESTINATION_UNREACHABLE != 0 {
+            artiq_raise!(
+                "RTIODestinationUnreachable",
+                format!(
+                    "RTIO destination unreachable, input, on channel 0x{:04x}:{}",
+                    channel,
+                    resolve_channel_name(channel as u32)
+                ),
+                channel as i64,
+                0,
+                0
+            );
+        }
+
+        TimestampedData {
+            timestamp: csr::rtio::i_timestamp_read() as i64,
+            data: rtio_i_data_read(0) as i32,
+        }
+    }
+}
+
+pub fn write_log(data: &[i8]) {
+    unsafe {
+        csr::rtio::target_write(csr::CONFIG_RTIO_LOG_CHANNEL << 8);
+
+        let mut word: u32 = 0;
+        for i in 0..data.len() {
+            word <<= 8;
+            word |= data[i] as u32;
+            if i % 4 == 3 {
+                rtio_o_data_write(0, word);
+                word = 0;
+            }
+        }
+
+        if word != 0 {
+            rtio_o_data_write(0, word);
+        }
+    }
+}

src/libunwind/backtrace.rs

@@ -1,27 +1,25 @@
-use libc::{c_void, c_int};
+use libc::{c_int, c_void};
+
 use crate::libunwind as uw;
 
 const UW_REG_SP: c_int = 13;
 
 pub fn backtrace<F>(f: F) -> Result<(), uw::_Unwind_Reason_Code>
-    where F: FnMut(usize) -> ()
+where F: FnMut(usize) -> () {
-{
     struct TraceContext<F> {
         step_fn: F,
-        prev_sp: uw::_Unwind_Word
+        prev_sp: uw::_Unwind_Word,
     }
 
-    extern fn trace<F>(context: *mut uw::_Unwind_Context, arg: *mut c_void)
+    extern "C" fn trace<F>(context: *mut uw::_Unwind_Context, arg: *mut c_void) -> uw::_Unwind_Reason_Code
-                      -> uw::_Unwind_Reason_Code
+    where F: FnMut(usize) -> () {
-        where F: FnMut(usize) -> ()
-    {
         unsafe {
             let trace_context = &mut *(arg as *mut TraceContext<F>);
 
             // Detect the root of a libfringe thread
             let cur_sp = uw::_Unwind_GetGR(context, UW_REG_SP);
             if cur_sp == trace_context.prev_sp {
-                return uw::_URC_END_OF_STACK
+                return uw::_URC_END_OF_STACK;
             } else {
                 trace_context.prev_sp = cur_sp;
             }
@@ -35,7 +33,7 @@ pub fn backtrace<F>(f: F) -> Result<(), uw::_Unwind_Reason_Code>
         let mut trace_context = TraceContext { step_fn: f, prev_sp: 0 };
         match uw::_Unwind_Backtrace(trace::<F>, &mut trace_context as *mut _ as *mut c_void) {
             uw::_URC_NO_REASON => Ok(()),
-            err => Err(err)
+            err => Err(err),
         }
     }
 }

src/libunwind/build.rs

@@ -5,8 +5,7 @@ fn main() {
 }
 
 mod llvm_libunwind {
-    use std::path::Path;
+    use std::{env, path::Path};
-    use std::env;
 
     fn setup_options(cfg: &mut cc::Build) {
         cfg.no_default_flags(true);
@@ -82,11 +81,7 @@ mod llvm_libunwind {
         cfg.flag("-fvisibility=hidden");
         cfg.flag_if_supported("-fvisibility-global-new-delete-hidden");
 
-        let unwind_sources = vec![
+        let unwind_sources = vec!["Unwind-EHABI.cpp", "Unwind-seh.cpp", "libunwind.cpp"];
-            "Unwind-EHABI.cpp",
-            "Unwind-seh.cpp",
-            "libunwind.cpp"
-        ];
 
         let root = Path::new("../llvm_libunwind");
         cfg.include(root.join("include"));

src/libunwind/libunwind.rs

@@ -21,8 +21,7 @@ pub use _Unwind_Reason_Code::*;
 pub type _Unwind_Exception_Class = u64;
 pub type _Unwind_Word = uintptr_t;
 pub type _Unwind_Ptr = uintptr_t;
-pub type _Unwind_Trace_Fn =
+pub type _Unwind_Trace_Fn = extern "C" fn(ctx: *mut _Unwind_Context, arg: *mut c_void) -> _Unwind_Reason_Code;
-    extern "C" fn(ctx: *mut _Unwind_Context, arg: *mut c_void) -> _Unwind_Reason_Code;
 
 #[cfg(target_arch = "x86")]
 pub const unwinder_private_data_size: usize = 5;
@@ -279,7 +278,6 @@ if #[cfg(all(windows, target_arch = "x86_64", target_env = "gnu"))] {
 } // cfg_if!
 
 #[no_mangle]
-extern fn abort() {
+extern "C" fn abort() {
     panic!("Abort!");
 }
-

src/runtime/Cargo.toml.tpl

@@ -8,6 +8,7 @@ edition = "2018"
 [features]
 target_zc706 = ["libboard_zynq/target_zc706", "libsupport_zynq/target_zc706", "libconfig/target_zc706", "libboard_artiq/target_zc706"]
 target_kasli_soc = ["libboard_zynq/target_kasli_soc", "libsupport_zynq/target_kasli_soc", "libconfig/target_kasli_soc", "libboard_artiq/target_kasli_soc"]
+target_ebaz4205 = ["libboard_zynq/target_ebaz4205", "libsupport_zynq/target_ebaz4205", "libconfig/target_ebaz4205", "libboard_artiq/target_ebaz4205"]
 default = ["target_zc706"]
 
 [build-dependencies]
@@ -18,27 +19,31 @@ num-traits = { version = "0.2", default-features = false }
 num-derive = "0.3"
 cslice = "0.3"
 log = "0.4"
-nb = "0.1"
 embedded-hal = "0.2"
 core_io = { version = "0.1", features = ["collections"] }
+crc = { version = "1.7", default-features = false }
 byteorder = { version = "1.3", default-features = false }
 void = { version = "1", default-features = false }
 futures = { version = "0.3", default-features = false, features = ["async-await"] }
 async-recursion = "0.3"
 log_buffer = { version = "1.2" }
-libm = { version = "0.2", features = ["unstable"] }
 vcell = "0.1"
 
-libboard_zynq = { git = "https://git.m-labs.hk/M-Labs/zynq-rs.git", features = ["ipv6"]}
+libboard_zynq = { path = "@@ZYNQ_RS@@/libboard_zynq", features = ["ipv6"]}
-libsupport_zynq = { default-features = false, features = ["alloc_core"], git = "https://git.m-labs.hk/M-Labs/zynq-rs.git" }
+libsupport_zynq = { path = "@@ZYNQ_RS@@/libsupport_zynq", default-features = false, features = ["alloc_core"] }
-libcortex_a9 = { git = "https://git.m-labs.hk/M-Labs/zynq-rs.git" }
+libcortex_a9 = { path = "@@ZYNQ_RS@@/libcortex_a9" }
-libasync = { git = "https://git.m-labs.hk/M-Labs/zynq-rs.git" }
+libasync = { path = "@@ZYNQ_RS@@/libasync" }
-libregister = { git = "https://git.m-labs.hk/M-Labs/zynq-rs.git" }
+libregister = { path = "@@ZYNQ_RS@@/libregister" }
-libconfig = { git = "https://git.m-labs.hk/M-Labs/zynq-rs.git", features = ["fat_lfn", "ipv6"] }
+libconfig = { path = "@@ZYNQ_RS@@/libconfig", features = ["fat_lfn", "ipv6"] }
 
 dyld = { path = "../libdyld" }
 dwarf = { path = "../libdwarf" }
 unwind = { path = "../libunwind" }
 libc = { path = "../libc" }
-io = { path = "../libio" }
+io = { path = "../libio", features = ["alloc"] }
-libboard_artiq = { path = "../libboard_artiq" }
+ksupport = { path = "../libksupport" }
+libboard_artiq = { path = "../libboard_artiq" }
+
+[dependencies.tar-no-std]
+git = "https://git.m-labs.hk/M-Labs/tar-no-std"
+rev = "2ab6dc5"

src/runtime/src/analyzer.rs

@@ -1,10 +1,15 @@
+use alloc::rc::Rc;
+#[cfg(has_drtio)]
+use alloc::vec::Vec;
+use core::cell::RefCell;
+
 use libasync::{smoltcp::TcpStream, task};
-use libboard_zynq::smoltcp::Error;
+use libboard_artiq::drtio_routing;
-use libcortex_a9::cache;
+use libboard_zynq::{smoltcp::Error, timer::GlobalTimer};
+use libcortex_a9::{cache, mutex::Mutex};
 use log::{debug, info, warn};
 
-use crate::proto_async::*;
+use crate::{pl, proto_async::*};
-use crate::pl;
 
 const BUFFER_SIZE: usize = 512 * 1024;
 
@@ -13,9 +18,7 @@ struct Buffer {
     data: [u8; BUFFER_SIZE],
 }
 
-static mut BUFFER: Buffer = Buffer {
+static mut BUFFER: Buffer = Buffer { data: [0; BUFFER_SIZE] };
-    data: [0; BUFFER_SIZE]
-};
 
 fn arm() {
     debug!("arming RTIO analyzer");
@@ -40,13 +43,57 @@ fn disarm() {
     debug!("RTIO analyzer disarmed");
 }
 
+#[cfg(has_drtio)]
+pub mod remote_analyzer {
+    use super::*;
+    use crate::rtio_mgt::drtio;
+
+    pub struct RemoteBuffer {
+        pub total_byte_count: u64,
+        pub sent_bytes: u32,
+        pub error: bool,
+        pub data: Vec<u8>,
+    }
+
+    pub async fn get_data(
+        aux_mutex: &Rc<Mutex<bool>>,
+        routing_table: &drtio_routing::RoutingTable,
+        up_destinations: &Rc<RefCell<[bool; drtio_routing::DEST_COUNT]>>,
+        timer: GlobalTimer,
+    ) -> Result<RemoteBuffer, drtio::Error> {
+        // gets data from satellites and returns consolidated data
+        let mut remote_data: Vec<u8> = Vec::new();
+        let mut remote_error = false;
+        let mut remote_sent_bytes = 0;
+        let mut remote_total_bytes = 0;
+
+        let data_vec = match drtio::analyzer_query(aux_mutex, routing_table, up_destinations, timer).await {
+            Ok(data_vec) => data_vec,
+            Err(e) => return Err(e),
+        };
+        for data in data_vec {
+            remote_total_bytes += data.total_byte_count;
+            remote_sent_bytes += data.sent_bytes;
+            remote_error |= data.error;
+            remote_data.extend(data.data);
+        }
+
+        Ok(RemoteBuffer {
+            total_byte_count: remote_total_bytes,
+            sent_bytes: remote_sent_bytes,
+            error: remote_error,
+            data: remote_data,
+        })
+    }
+}
+
 #[derive(Debug)]
 struct Header {
     sent_bytes: u32,
     total_byte_count: u64,
     error_occurred: bool,
     log_channel: u8,
-    dds_onehot_sel: bool
+    dds_onehot_sel: bool,
 }
 
 async fn write_header(stream: &mut TcpStream, header: &Header) -> Result<(), Error> {
@@ -59,7 +106,13 @@ async fn write_header(stream: &mut TcpStream, header: &Header) -> Result<(), Err
     Ok(())
 }
 
-async fn handle_connection(stream: &mut TcpStream) -> Result<(), Error> {
+async fn handle_connection(
+    stream: &mut TcpStream,
+    _aux_mutex: &Rc<Mutex<bool>>,
+    _routing_table: &drtio_routing::RoutingTable,
+    _up_destinations: &Rc<RefCell<[bool; drtio_routing::DEST_COUNT]>>,
+    _timer: GlobalTimer,
+) -> Result<(), Error> {
     info!("received connection");
 
     let data = unsafe { &BUFFER.data[..] };
@@ -68,6 +121,11 @@ async fn handle_connection(stream: &mut TcpStream) -> Result<(), Error> {
     let total_byte_count = unsafe { pl::csr::rtio_analyzer::dma_byte_count_read() as u64 };
     let pointer = (total_byte_count % BUFFER_SIZE as u64) as usize;
     let wraparound = total_byte_count >= BUFFER_SIZE as u64;
+    let sent_bytes = if wraparound {
+        BUFFER_SIZE as u32
+    } else {
+        total_byte_count as u32
+    };
 
     if overflow_occurred {
         warn!("overflow occured");
@@ -76,12 +134,42 @@ async fn handle_connection(stream: &mut TcpStream) -> Result<(), Error> {
         warn!("bus error occured");
     }
 
+    #[cfg(has_drtio)]
+    let remote = remote_analyzer::get_data(_aux_mutex, _routing_table, _up_destinations, _timer).await;
+    #[cfg(has_drtio)]
+    let (header, remote_data) = match remote {
+        Ok(remote) => (
+            Header {
+                total_byte_count: total_byte_count + remote.total_byte_count,
+                sent_bytes: sent_bytes + remote.sent_bytes,
+                error_occurred: overflow_occurred | bus_error_occurred | remote.error,
+                log_channel: pl::csr::CONFIG_RTIO_LOG_CHANNEL as u8,
+                dds_onehot_sel: true,
+            },
+            remote.data,
+        ),
+        Err(e) => {
+            warn!("Error getting remote analyzer data: {}", e);
+            (
+                Header {
+                    total_byte_count: total_byte_count,
+                    sent_bytes: sent_bytes,
+                    error_occurred: true,
+                    log_channel: pl::csr::CONFIG_RTIO_LOG_CHANNEL as u8,
+                    dds_onehot_sel: true,
+                },
+                Vec::new(),
+            )
+        }
+    };
+
+    #[cfg(not(has_drtio))]
     let header = Header {
         total_byte_count: total_byte_count,
-        sent_bytes: if wraparound { BUFFER_SIZE as u32 } else { total_byte_count as u32 },
+        sent_bytes: sent_bytes,
         error_occurred: overflow_occurred | bus_error_occurred,
         log_channel: pl::csr::CONFIG_RTIO_LOG_CHANNEL as u8,
-        dds_onehot_sel: true  // kept for backward compatibility of analyzer dumps
+        dds_onehot_sel: true, // kept for backward compatibility of analyzer dumps
     };
     debug!("{:?}", header);
 
@@ -92,17 +180,28 @@ async fn handle_connection(stream: &mut TcpStream) -> Result<(), Error> {
     } else {
         stream.send(data[..pointer].iter().copied()).await?;
     }
+    #[cfg(has_drtio)]
+    stream.send(remote_data.iter().copied()).await?;
 
     Ok(())
 }
 
-pub fn start() {
+pub fn start(
+    aux_mutex: &Rc<Mutex<bool>>,
+    routing_table: &Rc<RefCell<drtio_routing::RoutingTable>>,
+    up_destinations: &Rc<RefCell<[bool; drtio_routing::DEST_COUNT]>>,
+    timer: GlobalTimer,
+) {
+    let aux_mutex = aux_mutex.clone();
+    let routing_table = routing_table.clone();
+    let up_destinations = up_destinations.clone();
     task::spawn(async move {
         loop {
             arm();
             let mut stream = TcpStream::accept(1382, 2048, 2048).await.unwrap();
             disarm();
-            let _ = handle_connection(&mut stream)
+            let routing_table = routing_table.borrow();
+            let _ = handle_connection(&mut stream, &aux_mutex, &routing_table, &up_destinations, timer)
                 .await
                 .map_err(|e| warn!("connection terminated: {:?}", e));
             let _ = stream.flush().await;

src/runtime/src/comms.rs

@@ -1,44 +1,57 @@
-use core::fmt;
+use alloc::{collections::BTreeMap, rc::Rc, string::String, vec, vec::Vec};
-use core::cell::RefCell;
+use core::{cell::RefCell, fmt, slice, str};
-use alloc::{vec, vec::Vec, string::String, collections::BTreeMap, rc::Rc};
-use log::{info, warn, error};
-use cslice::CSlice;
 
+use core_io::Error as IoError;
+use cslice::CSlice;
+use dyld::elf;
+use futures::{future::FutureExt, select_biased};
+#[cfg(has_drtio)]
+use io::Cursor;
+#[cfg(has_drtio)]
+use ksupport::rpc;
+use ksupport::{kernel, resolve_channel_name};
+#[cfg(has_drtio)]
+use libasync::delay;
+use libasync::{smoltcp::{Sockets, TcpStream},
+               task};
+use libboard_artiq::drtio_routing;
+#[cfg(feature = "target_kasli_soc")]
+use libboard_zynq::error_led::ErrorLED;
+#[cfg(has_drtio)]
+use libboard_zynq::time::Milliseconds;
+use libboard_zynq::{self as zynq,
+                    smoltcp::{self,
+                              iface::{EthernetInterfaceBuilder, NeighborCache},
+                              time::Instant,
+                              wire::IpCidr},
+                    timer::GlobalTimer};
+use libconfig::{net_settings, Config};
+use libcortex_a9::{mutex::Mutex,
+                   semaphore::Semaphore,
+                   sync_channel::{Receiver, Sender}};
+use log::{error, info, warn};
 use num_derive::{FromPrimitive, ToPrimitive};
 use num_traits::{FromPrimitive, ToPrimitive};
+#[cfg(has_drtio)]
+use tar_no_std::TarArchiveRef;
 
-use libboard_zynq::{
-    self as zynq,
-    smoltcp::{
-        self,
-        wire::IpCidr,
-        iface::{NeighborCache, EthernetInterfaceBuilder},
-        time::Instant,
-    },
-    timer::GlobalTimer,
-};
-use libcortex_a9::{semaphore::Semaphore, mutex::Mutex, sync_channel::{Sender, Receiver}};
-use futures::{select_biased, future::FutureExt};
-use libasync::{smoltcp::{Sockets, TcpStream}, task};
-use libconfig::{Config, net_settings};
-use libboard_artiq::drtio_routing;
-
-use crate::proto_async::*;
-use crate::kernel;
-use crate::rpc;
-use crate::moninj;
-use crate::mgmt;
-use crate::analyzer;
-use crate::rtio_mgt;
 #[cfg(has_drtio)]
 use crate::pl;
+use crate::{analyzer, mgmt, moninj, proto_async::*, rpc_async, rtio_dma, rtio_mgt};
+#[cfg(has_drtio)]
+use crate::{subkernel, subkernel::Error as SubkernelError};
 
 #[derive(Debug, Clone, Copy, PartialEq, Eq)]
 pub enum Error {
     NetworkError(smoltcp::Error),
+    IoError,
     UnexpectedPattern,
     UnrecognizedPacket,
     BufferExhausted,
+    #[cfg(has_drtio)]
+    SubkernelError(subkernel::Error),
+    #[cfg(has_drtio)]
+    DestinationDown,
 }
 
 pub type Result<T> = core::result::Result<T, Error>;
@@ -47,9 +60,14 @@ impl fmt::Display for Error {
     fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
         match self {
             Error::NetworkError(error) => write!(f, "network error: {}", error),
-            Error::UnexpectedPattern   => write!(f, "unexpected pattern"),
+            Error::IoError => write!(f, "io error"),
-            Error::UnrecognizedPacket  => write!(f, "unrecognized packet"),
+            Error::UnexpectedPattern => write!(f, "unexpected pattern"),
-            Error::BufferExhausted     => write!(f, "buffer exhausted"),
+            Error::UnrecognizedPacket => write!(f, "unrecognized packet"),
+            Error::BufferExhausted => write!(f, "buffer exhausted"),
+            #[cfg(has_drtio)]
+            Error::SubkernelError(error) => write!(f, "subkernel error: {:?}", error),
+            #[cfg(has_drtio)]
+            Error::DestinationDown => write!(f, "subkernel destination down"),
         }
     }
 }
@@ -60,6 +78,19 @@ impl From<smoltcp::Error> for Error {
     }
 }
 
+impl From<IoError> for Error {
+    fn from(_error: IoError) -> Self {
+        Error::IoError
+    }
+}
+
+#[cfg(has_drtio)]
+impl From<subkernel::Error> for Error {
+    fn from(error: subkernel::Error) -> Self {
+        Error::SubkernelError(error)
+    }
+}
+
 #[derive(Debug, FromPrimitive, ToPrimitive)]
 enum Request {
     SystemInfo = 3,
@@ -67,6 +98,7 @@ enum Request {
     RunKernel = 6,
     RPCReply = 7,
     RPCException = 8,
+    UploadSubkernel = 9,
 }
 
 #[derive(Debug, FromPrimitive, ToPrimitive)]
@@ -83,18 +115,18 @@ enum Reply {
 }
 
 static CACHE_STORE: Mutex<BTreeMap<String, Vec<i32>>> = Mutex::new(BTreeMap::new());
-static DMA_RECORD_STORE: Mutex<BTreeMap<String, (Vec<u8>, i64)>> = Mutex::new(BTreeMap::new());
 
 async fn write_header(stream: &TcpStream, reply: Reply) -> Result<()> {
-    stream.send_slice(&[0x5a, 0x5a, 0x5a, 0x5a, reply.to_u8().unwrap()]).await?;
+    stream
+        .send_slice(&[0x5a, 0x5a, 0x5a, 0x5a, reply.to_u8().unwrap()])
+        .await?;
     Ok(())
 }
 
 async fn read_request(stream: &TcpStream, allow_close: bool) -> Result<Option<Request>> {
     match expect(stream, &[0x5a, 0x5a, 0x5a, 0x5a]).await {
         Ok(true) => {}
-        Ok(false) =>
+        Ok(false) => return Err(Error::UnexpectedPattern),
-            return Err(Error::UnexpectedPattern),
         Err(smoltcp::Error::Finished) => {
             if allow_close {
                 info!("peer closed connection");
@@ -103,11 +135,12 @@ async fn read_request(stream: &TcpStream, allow_close: bool) -> Result<Option<Re
                 error!("peer unexpectedly closed connection");
                 return Err(smoltcp::Error::Finished)?;
             }
-        },
+        }
-        Err(e) =>
+        Err(e) => return Err(e)?,
-            return Err(e)?,
     }
-    Ok(Some(FromPrimitive::from_i8(read_i8(&stream).await?).ok_or(Error::UnrecognizedPacket)?))
+    Ok(Some(
+        FromPrimitive::from_i8(read_i8(&stream).await?).ok_or(Error::UnrecognizedPacket)?,
+    ))
 }
 
 async fn read_bytes(stream: &TcpStream, max_length: usize) -> Result<Vec<u8>> {
@@ -126,9 +159,7 @@ async fn fast_send(sender: &mut Sender<'_, kernel::Message>, content: kernel::Me
     let mut content = content;
     for _ in 0..RETRY_LIMIT {
         match sender.try_send(content) {
-            Ok(()) => {
+            Ok(()) => return,
-                return
-            },
             Err(v) => {
                 content = v;
             }
@@ -140,10 +171,8 @@ async fn fast_send(sender: &mut Sender<'_, kernel::Message>, content: kernel::Me
 async fn fast_recv(receiver: &mut Receiver<'_, kernel::Message>) -> kernel::Message {
     for _ in 0..RETRY_LIMIT {
         match receiver.try_recv() {
-            Ok(v) => {
+            Ok(v) => return v,
-                return v;
+            Err(()) => (),
-            },
-            Err(()) => ()
         }
     }
     receiver.async_recv().await
@@ -159,7 +188,14 @@ async fn write_exception_string(stream: &TcpStream, s: CSlice<'static, u8>) -> R
     Ok(())
 }
 
-async fn handle_run_kernel(stream: Option<&TcpStream>, control: &Rc<RefCell<kernel::Control>>, _up_destinations: &Rc<RefCell<[bool; drtio_routing::DEST_COUNT]>>) -> Result<()> {
+async fn handle_run_kernel(
+    stream: Option<&TcpStream>,
+    control: &Rc<RefCell<kernel::Control>>,
+    _up_destinations: &Rc<RefCell<[bool; drtio_routing::DEST_COUNT]>>,
+    aux_mutex: &Rc<Mutex<bool>>,
+    routing_table: &drtio_routing::RoutingTable,
+    timer: GlobalTimer,
+) -> Result<()> {
     control.borrow_mut().tx.async_send(kernel::Message::StartRequest).await;
     loop {
         let reply = control.borrow_mut().rx.async_recv().await;
@@ -167,7 +203,7 @@ async fn handle_run_kernel(stream: Option<&TcpStream>, control: &Rc<RefCell<kern
             kernel::Message::RpcSend { is_async, data } => {
                 if stream.is_none() {
                     error!("Unexpected RPC from startup/idle kernel!");
-                    break
+                    break;
                 }
                 let stream = stream.unwrap();
                 write_header(stream, Reply::RPCRequest).await?;
@@ -182,7 +218,7 @@ async fn handle_run_kernel(stream: Option<&TcpStream>, control: &Rc<RefCell<kern
                                 kernel::Message::RpcRecvRequest(slot) => slot,
                                 other => panic!("expected root value slot from core1, not {:?}", other),
                             };
-                            rpc::recv_return(stream, &tag, slot, &|size| {
+                            rpc_async::recv_return(stream, &tag, slot, &|size| {
                                 let control = control.clone();
                                 async move {
                                     if size == 0 {
@@ -194,46 +230,64 @@ async fn handle_run_kernel(stream: Option<&TcpStream>, control: &Rc<RefCell<kern
                                         fast_send(&mut control.tx, kernel::Message::RpcRecvReply(Ok(size))).await;
                                         match fast_recv(&mut control.rx).await {
                                             kernel::Message::RpcRecvRequest(slot) => slot,
-                                            other => panic!("expected nested value slot from kernel CPU, not {:?}", other),
+                                            other => {
+                                                panic!("expected nested value slot from kernel CPU, not {:?}", other)
+                                            }
                                         }
                                     }
                                 }
-                            }).await?;
+                            })
-                            control.borrow_mut().tx.async_send(kernel::Message::RpcRecvReply(Ok(0))).await;
+                            .await?;
-                        },
+                            control
+                                .borrow_mut()
+                                .tx
+                                .async_send(kernel::Message::RpcRecvReply(Ok(0)))
+                                .await;
+                        }
                         Request::RPCException => {
                             let mut control = control.borrow_mut();
                             match control.rx.async_recv().await {
                                 kernel::Message::RpcRecvRequest(_) => (),
                                 other => panic!("expected (ignored) root value slot from kernel CPU, not {:?}", other),
                             }
-                            let id =       read_i32(stream).await? as u32;
+                            let id = read_i32(stream).await? as u32;
-                            let message =  read_i32(stream).await? as u32;
+                            let message = read_i32(stream).await? as u32;
-                            let param =    [read_i64(stream).await?,
+                            let param = [
-                                            read_i64(stream).await?,
+                                read_i64(stream).await?,
-                                            read_i64(stream).await?];
+                                read_i64(stream).await?,
-                            let file =     read_i32(stream).await? as u32;
+                                read_i64(stream).await?,
-                            let line =     read_i32(stream).await?;
+                            ];
-                            let column =   read_i32(stream).await?;
+                            let file = read_i32(stream).await? as u32;
+                            let line = read_i32(stream).await?;
+                            let column = read_i32(stream).await?;
                             let function = read_i32(stream).await? as u32;
-                            control.tx.async_send(kernel::Message::RpcRecvReply(Err(kernel::RPCException {
+                            control
-                                id, message, param, file, line, column, function
+                                .tx
-                            }))).await;
+                                .async_send(kernel::Message::RpcRecvReply(Err(ksupport::RPCException {
-                        },
+                                    id,
+                                    message,
+                                    param,
+                                    file,
+                                    line,
+                                    column,
+                                    function,
+                                })))
+                                .await;
+                        }
                         _ => {
                             error!("unexpected RPC request from host: {:?}", host_request);
-                            return Err(Error::UnrecognizedPacket)
+                            return Err(Error::UnrecognizedPacket);
                         }
                     }
                 }
-            },
+            }
             kernel::Message::KernelFinished(async_errors) => {
                 if let Some(stream) = stream {
                     write_header(stream, Reply::KernelFinished).await?;
                     write_i8(stream, async_errors as i8).await?;
                 }
                 break;
-            },
+            }
             kernel::Message::KernelException(exceptions, stack_pointers, backtrace, async_errors) => {
                 match stream {
                     Some(stream) => {
@@ -244,7 +298,26 @@ async fn handle_run_kernel(stream: Option<&TcpStream>, control: &Rc<RefCell<kern
                         for exception in exceptions.iter() {
                             let exception = exception.as_ref().unwrap();
                             write_i32(stream, exception.id as i32).await?;
-                            write_exception_string(stream, exception.message).await?;
+
+                            if exception.message.len() == usize::MAX {
+                                // exception with host string
+                                write_exception_string(stream, exception.message).await?;
+                            } else {
+                                let msg = str::from_utf8(unsafe {
+                                    slice::from_raw_parts(exception.message.as_ptr(), exception.message.len())
+                                })
+                                .unwrap()
+                                .replace(
+                                    "{rtio_channel_info:0}",
+                                    &format!(
+                                        "0x{:04x}:{}",
+                                        exception.param[0],
+                                        resolve_channel_name(exception.param[0] as u32)
+                                    ),
+                                );
+                                write_exception_string(stream, unsafe { CSlice::new(msg.as_ptr(), msg.len()) }).await?;
+                            }
+
                             write_i64(stream, exception.param[0] as i64).await?;
                             write_i64(stream, exception.param[1] as i64).await?;
                             write_i64(stream, exception.param[2] as i64).await?;
@@ -264,7 +337,7 @@ async fn handle_run_kernel(stream: Option<&TcpStream>, control: &Rc<RefCell<kern
                             write_i32(stream, sp as i32).await?;
                         }
                         write_i8(stream, async_errors as i8).await?;
-                    },
+                    }
                     None => {
                         error!("Uncaught kernel exceptions: {:?}", exceptions);
                     }
@@ -273,27 +346,184 @@ async fn handle_run_kernel(stream: Option<&TcpStream>, control: &Rc<RefCell<kern
             }
             kernel::Message::CachePutRequest(key, value) => {
                 CACHE_STORE.lock().insert(key, value);
-            },
+            }
             kernel::Message::CacheGetRequest(key) => {
                 const DEFAULT: Vec<i32> = Vec::new();
                 let value = CACHE_STORE.lock().get(&key).unwrap_or(&DEFAULT).clone();
-                control.borrow_mut().tx.async_send(kernel::Message::CacheGetReply(value)).await;
+                control
-            },
+                    .borrow_mut()
+                    .tx
+                    .async_send(kernel::Message::CacheGetReply(value))
+                    .await;
+            }
             kernel::Message::DmaPutRequest(recorder) => {
-                DMA_RECORD_STORE.lock().insert(recorder.name, (recorder.buffer, recorder.duration));
+                let _id = rtio_dma::put_record(aux_mutex, routing_table, timer, recorder).await;
-            },
+                #[cfg(has_drtio)]
+                rtio_dma::remote_dma::upload_traces(aux_mutex, routing_table, timer, _id).await;
+            }
             kernel::Message::DmaEraseRequest(name) => {
                 // prevent possible OOM when we have large DMA record replacement.
-                DMA_RECORD_STORE.lock().remove(&name);
+                rtio_dma::erase(name, aux_mutex, routing_table, timer).await;
-            },
+            }
             kernel::Message::DmaGetRequest(name) => {
-                let result = DMA_RECORD_STORE.lock().get(&name).map(|v| v.clone());
+                let result = rtio_dma::retrieve(name).await;
-                control.borrow_mut().tx.async_send(kernel::Message::DmaGetReply(result)).await;
+                control
-            },
+                    .borrow_mut()
+                    .tx
+                    .async_send(kernel::Message::DmaGetReply(result))
+                    .await;
+            }
+            #[cfg(has_drtio)]
+            kernel::Message::DmaStartRemoteRequest { id, timestamp } => {
+                rtio_dma::remote_dma::playback(aux_mutex, routing_table, timer, id as u32, timestamp as u64).await;
+            }
+            #[cfg(has_drtio)]
+            kernel::Message::DmaAwaitRemoteRequest(id) => {
+                let result = rtio_dma::remote_dma::await_done(id as u32, Some(10_000), timer).await;
+                let reply = match result {
+                    Ok(rtio_dma::remote_dma::RemoteState::PlaybackEnded {
+                        error,
+                        channel,
+                        timestamp,
+                    }) => kernel::Message::DmaAwaitRemoteReply {
+                        timeout: false,
+                        error: error,
+                        channel: channel,
+                        timestamp: timestamp,
+                    },
+                    _ => kernel::Message::DmaAwaitRemoteReply {
+                        timeout: true,
+                        error: 0,
+                        channel: 0,
+                        timestamp: 0,
+                    },
+                };
+                control.borrow_mut().tx.async_send(reply).await;
+            }
+            #[cfg(has_drtio)]
+            kernel::Message::SubkernelLoadRunRequest {
+                id,
+                destination: _,
+                run,
+                timestamp,
+            } => {
+                let succeeded = match subkernel::load(aux_mutex, routing_table, timer, id, run, timestamp).await {
+                    Ok(()) => true,
+                    Err(e) => {
+                        error!("Error loading subkernel: {:?}", e);
+                        false
+                    }
+                };
+                control
+                    .borrow_mut()
+                    .tx
+                    .async_send(kernel::Message::SubkernelLoadRunReply { succeeded: succeeded })
+                    .await;
+            }
+            #[cfg(has_drtio)]
+            kernel::Message::SubkernelAwaitFinishRequest { id, timeout } => {
+                let res = subkernel::await_finish(aux_mutex, routing_table, timer, id, timeout).await;
+                let response = match res {
+                    Ok(res) => {
+                        if res.status == subkernel::FinishStatus::CommLost {
+                            kernel::Message::SubkernelError(kernel::SubkernelStatus::CommLost)
+                        } else if let Some(exception) = res.exception {
+                            kernel::Message::SubkernelError(kernel::SubkernelStatus::Exception(exception))
+                        } else {
+                            kernel::Message::SubkernelAwaitFinishReply
+                        }
+                    }
+                    Err(SubkernelError::Timeout) => kernel::Message::SubkernelError(kernel::SubkernelStatus::Timeout),
+                    Err(SubkernelError::IncorrectState) => {
+                        kernel::Message::SubkernelError(kernel::SubkernelStatus::IncorrectState)
+                    }
+                    Err(_) => kernel::Message::SubkernelError(kernel::SubkernelStatus::OtherError),
+                };
+                control.borrow_mut().tx.async_send(response).await;
+            }
+            #[cfg(has_drtio)]
+            kernel::Message::SubkernelMsgSend { id, destination, data } => {
+                let res =
+                    subkernel::message_send(aux_mutex, routing_table, timer, id, destination.unwrap(), data).await;
+                match res {
+                    Ok(_) => (),
+                    Err(e) => {
+                        error!("error sending subkernel message: {:?}", e)
+                    }
+                };
+                control
+                    .borrow_mut()
+                    .tx
+                    .async_send(kernel::Message::SubkernelMsgSent)
+                    .await;
+            }
+            #[cfg(has_drtio)]
+            kernel::Message::SubkernelMsgRecvRequest { id, timeout, tags } => {
+                let message_received = subkernel::message_await(id as u32, timeout, timer).await;
+                let response = match message_received {
+                    Ok(ref message) => kernel::Message::SubkernelMsgRecvReply { count: message.count },
+                    Err(SubkernelError::Timeout) => kernel::Message::SubkernelError(kernel::SubkernelStatus::Timeout),
+                    Err(SubkernelError::IncorrectState) => {
+                        kernel::Message::SubkernelError(kernel::SubkernelStatus::IncorrectState)
+                    }
+                    Err(SubkernelError::CommLost) => kernel::Message::SubkernelError(kernel::SubkernelStatus::CommLost),
+                    Err(SubkernelError::SubkernelException) => {
+                        // just retrieve the exception
+                        let status = subkernel::await_finish(aux_mutex, routing_table, timer, id as u32, timeout)
+                            .await
+                            .unwrap();
+                        kernel::Message::SubkernelError(kernel::SubkernelStatus::Exception(status.exception.unwrap()))
+                    }
+                    Err(_) => kernel::Message::SubkernelError(kernel::SubkernelStatus::OtherError),
+                };
+                control.borrow_mut().tx.async_send(response).await;
+                if let Ok(message) = message_received {
+                    // receive code almost identical to RPC recv, except we are not reading from a stream
+                    let mut reader = Cursor::new(message.data);
+                    let mut current_tags: &[u8] = &tags;
+                    let mut i = 0;
+                    loop {
+                        // kernel has to consume all arguments in the whole message
+                        let slot = match fast_recv(&mut control.borrow_mut().rx).await {
+                            kernel::Message::RpcRecvRequest(slot) => slot,
+                            other => panic!("expected root value slot from core1, not {:?}", other),
+                        };
+                        let remaining_tags = rpc::recv_return(&mut reader, &current_tags, slot, &mut |size| {
+                            if size == 0 {
+                                0 as *mut ()
+                            } else {
+                                let mut control = control.borrow_mut();
+                                control.tx.send(kernel::Message::RpcRecvReply(Ok(size)));
+                                match control.rx.recv() {
+                                    kernel::Message::RpcRecvRequest(slot) => slot,
+                                    other => {
+                                        panic!("expected nested value slot from kernel CPU, not {:?}", other)
+                                    }
+                                }
+                            }
+                        })?;
+                        control
+                            .borrow_mut()
+                            .tx
+                            .async_send(kernel::Message::RpcRecvReply(Ok(0)))
+                            .await;
+                        i += 1;
+                        if i < message.count {
+                            current_tags = remaining_tags;
+                        } else {
+                            break;
+                        }
+                    }
+                }
+            }
             #[cfg(has_drtio)]
             kernel::Message::UpDestinationsRequest(destination) => {
                 let result = _up_destinations.borrow()[destination as usize];
-                control.borrow_mut().tx.async_send(kernel::Message::UpDestinationsReply(result)).await;
+                control
+                    .borrow_mut()
+                    .tx
+                    .async_send(kernel::Message::UpDestinationsReply(result))
+                    .await;
             }
             _ => {
                 panic!("unexpected message from core1 while kernel was running: {:?}", reply);
@@ -303,11 +533,67 @@ async fn handle_run_kernel(stream: Option<&TcpStream>, control: &Rc<RefCell<kern
     Ok(())
 }
 
+async fn handle_flash_kernel(
+    buffer: &Vec<u8>,
+    control: &Rc<RefCell<kernel::Control>>,
+    _up_destinations: &Rc<RefCell<[bool; drtio_routing::DEST_COUNT]>>,
+    _aux_mutex: &Rc<Mutex<bool>>,
+    _routing_table: &drtio_routing::RoutingTable,
+    _timer: GlobalTimer,
+) -> Result<()> {
+    if buffer[0] == elf::ELFMAG0 && buffer[1] == elf::ELFMAG1 && buffer[2] == elf::ELFMAG2 && buffer[3] == elf::ELFMAG3
+    {
+        // assume ELF file, proceed as before
+        load_kernel(buffer, control, None).await
+    } else {
+        #[cfg(has_drtio)]
+        {
+            let archive = TarArchiveRef::new(buffer.as_ref());
+            let entries = archive.entries();
+            let mut main_lib: Vec<u8> = Vec::new();
+            for entry in entries {
+                if entry.filename().as_str() == "main.elf" {
+                    main_lib = entry.data().to_vec();
+                } else {
+                    // subkernel filename must be in format:
+                    // "<subkernel id> <destination>.elf"
+                    let filename = entry.filename();
+                    let mut iter = filename.as_str().split_whitespace();
+                    let sid: u32 = iter.next().unwrap().parse().unwrap();
+                    let dest: u8 = iter.next().unwrap().strip_suffix(".elf").unwrap().parse().unwrap();
+                    let up = _up_destinations.borrow()[dest as usize];
+                    if up {
+                        let subkernel_lib = entry.data().to_vec();
+                        subkernel::add_subkernel(sid, dest, subkernel_lib).await;
+                        match subkernel::upload(_aux_mutex, _routing_table, _timer, sid).await {
+                            Ok(_) => (),
+                            Err(_) => return Err(Error::UnexpectedPattern),
+                        }
+                    } else {
+                        return Err(Error::DestinationDown);
+                    }
+                }
+            }
+            load_kernel(&main_lib, control, None).await
+        }
+        #[cfg(not(has_drtio))]
+        {
+            panic!("multi-kernel libraries are not supported in standalone systems");
+        }
+    }
+}
 
-async fn load_kernel(buffer: &Vec<u8>, control: &Rc<RefCell<kernel::Control>>, stream: Option<&TcpStream>) -> Result<()> {
+async fn load_kernel(
+    buffer: &Vec<u8>,
+    control: &Rc<RefCell<kernel::Control>>,
+    stream: Option<&TcpStream>,
+) -> Result<()> {
     let mut control = control.borrow_mut();
     control.restart();
-    control.tx.async_send(kernel::Message::LoadRequest(buffer.to_vec())).await;
+    control
+        .tx
+        .async_send(kernel::Message::LoadRequest(buffer.to_vec()))
+        .await;
     let reply = control.rx.async_recv().await;
     match reply {
         kernel::Message::LoadCompleted => {
@@ -315,7 +601,7 @@ async fn load_kernel(buffer: &Vec<u8>, control: &Rc<RefCell<kernel::Control>>, s
                 write_header(stream, Reply::LoadCompleted).await?;
             }
             Ok(())
-        },
+        }
         kernel::Message::LoadFailed => {
             if let Some(stream) = stream {
                 write_header(stream, Reply::LoadFailed).await?;
@@ -324,7 +610,7 @@ async fn load_kernel(buffer: &Vec<u8>, control: &Rc<RefCell<kernel::Control>>, s
                 error!("Kernel load failed");
             }
             Err(Error::UnexpectedPattern)
-        },
+        }
         _ => {
             error!("unexpected message from core1: {:?}", reply);
             if let Some(stream) = stream {
@@ -336,16 +622,27 @@ async fn load_kernel(buffer: &Vec<u8>, control: &Rc<RefCell<kernel::Control>>, s
     }
 }
 
-async fn handle_connection(stream: &mut TcpStream, control: Rc<RefCell<kernel::Control>>, up_destinations: &Rc<RefCell<[bool; drtio_routing::DEST_COUNT]>>) -> Result<()> {
+async fn handle_connection(
+    stream: &mut TcpStream,
+    control: Rc<RefCell<kernel::Control>>,
+    up_destinations: &Rc<RefCell<[bool; drtio_routing::DEST_COUNT]>>,
+    aux_mutex: &Rc<Mutex<bool>>,
+    routing_table: &drtio_routing::RoutingTable,
+    timer: GlobalTimer,
+) -> Result<()> {
     stream.set_ack_delay(None);
 
     if !expect(stream, b"ARTIQ coredev\n").await? {
         return Err(Error::UnexpectedPattern);
     }
     stream.send_slice("e".as_bytes()).await?;
+    #[cfg(has_drtio)]
+    subkernel::clear_subkernels().await;
     loop {
         let request = read_request(stream, true).await?;
         if request.is_none() {
+            #[cfg(has_drtio)]
+            subkernel::clear_subkernels().await;
             return Ok(());
         }
         let request = request.unwrap();
@@ -353,17 +650,48 @@ async fn handle_connection(stream: &mut TcpStream, control: Rc<RefCell<kernel::C
             Request::SystemInfo => {
                 write_header(stream, Reply::SystemInfo).await?;
                 stream.send_slice("ARZQ".as_bytes()).await?;
-            },
+            }
             Request::LoadKernel => {
-                let buffer = read_bytes(stream, 1024*1024).await?;
+                let buffer = read_bytes(stream, 1024 * 1024).await?;
                 load_kernel(&buffer, &control, Some(stream)).await?;
-            },
+            }
             Request::RunKernel => {
-                handle_run_kernel(Some(stream), &control, &up_destinations).await?;
+                handle_run_kernel(
-            },
+                    Some(stream),
+                    &control,
+                    &up_destinations,
+                    aux_mutex,
+                    routing_table,
+                    timer,
+                )
+                .await?;
+            }
+            Request::UploadSubkernel => {
+                #[cfg(has_drtio)]
+                {
+                    let id = read_i32(stream).await? as u32;
+                    let destination = read_i8(stream).await? as u8;
+                    let buffer = read_bytes(stream, 1024 * 1024).await?;
+                    subkernel::add_subkernel(id, destination, buffer).await;
+                    match subkernel::upload(aux_mutex, routing_table, timer, id).await {
+                        Ok(_) => write_header(stream, Reply::LoadCompleted).await?,
+                        Err(_) => {
+                            write_header(stream, Reply::LoadFailed).await?;
+                            write_chunk(stream, b"subkernel failed to load").await?;
+                            return Err(Error::UnexpectedPattern);
+                        }
+                    }
+                }
+                #[cfg(not(has_drtio))]
+                {
+                    write_header(stream, Reply::LoadFailed).await?;
+                    write_chunk(stream, b"No DRTIO on this system, subkernels are not supported").await?;
+                    return Err(Error::UnexpectedPattern);
+                }
+            }
             _ => {
                 error!("unexpected request from host: {:?}", request);
-                return Err(Error::UnrecognizedPacket)
+                return Err(Error::UnrecognizedPacket);
             }
         }
     }
@@ -387,65 +715,102 @@ pub fn main(timer: GlobalTimer, cfg: Config) {
             let ip_addrs = [
                 IpCidr::new(net_addresses.ipv4_addr, 0),
                 IpCidr::new(net_addresses.ipv6_ll_addr, 0),
-                IpCidr::new(addr, 0)
+                IpCidr::new(addr, 0),
             ];
             EthernetInterfaceBuilder::new(&mut eth)
-                       .ethernet_addr(net_addresses.hardware_addr)
+                .ethernet_addr(net_addresses.hardware_addr)
-                       .ip_addrs(ip_addrs)
+                .ip_addrs(ip_addrs)
-                       .neighbor_cache(neighbor_cache)
+                .neighbor_cache(neighbor_cache)
-                       .finalize()
+                .finalize()
         }
         None => {
             let ip_addrs = [
                 IpCidr::new(net_addresses.ipv4_addr, 0),
-                IpCidr::new(net_addresses.ipv6_ll_addr, 0)
+                IpCidr::new(net_addresses.ipv6_ll_addr, 0),
             ];
             EthernetInterfaceBuilder::new(&mut eth)
-                       .ethernet_addr(net_addresses.hardware_addr)
+                .ethernet_addr(net_addresses.hardware_addr)
-                       .ip_addrs(ip_addrs)
+                .ip_addrs(ip_addrs)
-                       .neighbor_cache(neighbor_cache)
+                .neighbor_cache(neighbor_cache)
-                       .finalize()
+                .finalize()
         }
     };
 
     Sockets::init(32);
 
-    // before, mutex was on io, but now that io isn't used...?
     let aux_mutex: Rc<Mutex<bool>> = Rc::new(Mutex::new(false));
     #[cfg(has_drtio)]
-    let drtio_routing_table = Rc::new(RefCell::new(
+    let drtio_routing_table = Rc::new(RefCell::new(drtio_routing::config_routing_table(
-        drtio_routing::config_routing_table(pl::csr::DRTIO.len(), &cfg)));
+        pl::csr::DRTIO.len(),
+        &cfg,
+    )));
     #[cfg(not(has_drtio))]
     let drtio_routing_table = Rc::new(RefCell::new(drtio_routing::RoutingTable::default_empty()));
     let up_destinations = Rc::new(RefCell::new([false; drtio_routing::DEST_COUNT]));
     #[cfg(has_drtio_routing)]
     drtio_routing::interconnect_disable_all();
 
-    rtio_mgt::startup(&aux_mutex, &drtio_routing_table, &up_destinations, timer);
+    rtio_mgt::startup(&aux_mutex, &drtio_routing_table, &up_destinations, &cfg, timer);
+    ksupport::setup_device_map(&cfg);
 
-    analyzer::start();
+    analyzer::start(&aux_mutex, &drtio_routing_table, &up_destinations, timer);
-    moninj::start(timer, aux_mutex, drtio_routing_table);
+    moninj::start(timer, &aux_mutex, &drtio_routing_table);
 
     let control: Rc<RefCell<kernel::Control>> = Rc::new(RefCell::new(kernel::Control::start()));
-    let idle_kernel = Rc::new(cfg.read("idle").ok());
+    if let Ok(buffer) = cfg.read("startup_kernel") {
-    if let Ok(buffer) = cfg.read("startup") {
         info!("Loading startup kernel...");
-        if let Ok(()) = task::block_on(load_kernel(&buffer, &control, None)) {
+        let routing_table = drtio_routing_table.borrow();
+        if let Ok(()) = task::block_on(handle_flash_kernel(
+            &buffer,
+            &control,
+            &up_destinations,
+            &aux_mutex,
+            &routing_table,
+            timer,
+        )) {
             info!("Starting startup kernel...");
-            let _ = task::block_on(handle_run_kernel(None, &control, &up_destinations));
+            let _ = task::block_on(handle_run_kernel(
+                None,
+                &control,
+                &up_destinations,
+                &aux_mutex,
+                &routing_table,
+                timer,
+            ));
             info!("Startup kernel finished!");
         } else {
             error!("Error loading startup kernel!");
         }
     }
 
-    mgmt::start(cfg);
+    let cfg = Rc::new(cfg);
+    let restart_idle = Rc::new(Semaphore::new(1, 1));
+    mgmt::start(
+        cfg.clone(),
+        restart_idle.clone(),
+        Some(mgmt::DrtioContext(
+            aux_mutex.clone(),
+            drtio_routing_table.clone(),
+            timer,
+        )),
+    );
 
     task::spawn(async move {
         let connection = Rc::new(Semaphore::new(1, 1));
         let terminate = Rc::new(Semaphore::new(0, 1));
+        let can_restart_idle = Rc::new(Semaphore::new(1, 1));
+        let restart_idle = restart_idle.clone();
         loop {
-            let mut stream = TcpStream::accept(1381, 0x10_000, 0x10_000).await.unwrap();
+            let control = control.clone();
+            let mut maybe_stream = select_biased! {
+                s = (async {
+                        TcpStream::accept(1381, 0x10_000, 0x10_000).await.unwrap()
+                    }).fuse() => Some(s),
+                _ = (async {
+                        restart_idle.async_wait().await;
+                        can_restart_idle.async_wait().await;
+                    }).fuse() => None
+            };
 
             if connection.try_wait().is_none() {
                 // there is an existing connection
@@ -453,40 +818,116 @@ pub fn main(timer: GlobalTimer, cfg: Config) {
                 connection.async_wait().await;
             }
 
+            let maybe_idle_kernel = cfg.read("idle_kernel").ok();
+            if maybe_idle_kernel.is_none() && maybe_stream.is_none() {
+                control.borrow_mut().restart(); // terminate idle kernel if running
+            }
+
             let control = control.clone();
-            let idle_kernel = idle_kernel.clone();
             let connection = connection.clone();
             let terminate = terminate.clone();
+            let can_restart_idle = can_restart_idle.clone();
             let up_destinations = up_destinations.clone();
+            let aux_mutex = aux_mutex.clone();
+            let routing_table = drtio_routing_table.clone();
 
             // we make sure the value of terminate is 0 before we start
             let _ = terminate.try_wait();
+            let _ = can_restart_idle.try_wait();
             task::spawn(async move {
+                let routing_table = routing_table.borrow();
                 select_biased! {
                     _ = (async {
-                        let _ = handle_connection(&mut stream, control.clone(), &up_destinations)
+                        if let Some(stream) = &mut maybe_stream {
-                            .await
+                            let _ = handle_connection(stream, control.clone(), &up_destinations, &aux_mutex, &routing_table, timer)
-                            .map_err(|e| warn!("connection terminated: {}", e));
+                                .await
-                        if let Some(buffer) = &*idle_kernel {
+                                .map_err(|e| warn!("connection terminated: {}", e));
-                            info!("Loading idle kernel");
+                        }
-                            let _ = load_kernel(&buffer, &control, None)
+                        can_restart_idle.signal();
-                                .await.map_err(|_| warn!("error loading idle kernel"));
+                        match maybe_idle_kernel {
-                            info!("Running idle kernel");
+                            Some(buffer) => {
-                            let _ = handle_run_kernel(None, &control, &up_destinations)
+                                loop {
-                                .await.map_err(|_| warn!("error running idle kernel"));
+                                    info!("loading idle kernel");
-                            info!("Idle kernel terminated");
+                                    match handle_flash_kernel(&buffer, &control, &up_destinations, &aux_mutex, &routing_table, timer).await {
+                                        Ok(_) => {
+                                            info!("running idle kernel");
+                                            match handle_run_kernel(None, &control, &up_destinations, &aux_mutex, &routing_table, timer).await {
+                                                Ok(_) => info!("idle kernel finished"),
+                                                Err(_) => warn!("idle kernel running error")
+                                            }
+                                        },
+                                        Err(_) => warn!("idle kernel loading error")
+                                    }
+                                }
+                            },
+                            None => info!("no idle kernel found")
                         }
                     }).fuse() => (),
                     _ = terminate.async_wait().fuse() => ()
                 }
                 connection.signal();
-                let _ = stream.flush().await;
+                if let Some(stream) = maybe_stream {
-                let _ = stream.abort().await;
+                    let _ = stream.flush().await;
+                    let _ = stream.abort().await;
+                }
             });
         }
     });
 
-    Sockets::run(&mut iface, || {
+    Sockets::run(&mut iface, || Instant::from_millis(timer.get_time().0 as i32));
-        Instant::from_millis(timer.get_time().0 as i32)
+}
-    });
+
+pub fn soft_panic_main(timer: GlobalTimer, cfg: Config) -> ! {
+    let net_addresses = net_settings::get_addresses(&cfg);
+    info!("network addresses: {}", net_addresses);
+
+    let eth = zynq::eth::Eth::eth0(net_addresses.hardware_addr.0.clone());
+    const RX_LEN: usize = 64;
+    // Number of transmission buffers (minimum is two because with
+    // one, duplicate packet transmission occurs)
+    const TX_LEN: usize = 64;
+    let eth = eth.start_rx(RX_LEN);
+    let mut eth = eth.start_tx(TX_LEN);
+
+    let neighbor_cache = NeighborCache::new(alloc::collections::BTreeMap::new());
+    let mut iface = match net_addresses.ipv6_addr {
+        Some(addr) => {
+            let ip_addrs = [
+                IpCidr::new(net_addresses.ipv4_addr, 0),
+                IpCidr::new(net_addresses.ipv6_ll_addr, 0),
+                IpCidr::new(addr, 0),
+            ];
+            EthernetInterfaceBuilder::new(&mut eth)
+                .ethernet_addr(net_addresses.hardware_addr)
+                .ip_addrs(ip_addrs)
+                .neighbor_cache(neighbor_cache)
+                .finalize()
+        }
+        None => {
+            let ip_addrs = [
+                IpCidr::new(net_addresses.ipv4_addr, 0),
+                IpCidr::new(net_addresses.ipv6_ll_addr, 0),
+            ];
+            EthernetInterfaceBuilder::new(&mut eth)
+                .ethernet_addr(net_addresses.hardware_addr)
+                .ip_addrs(ip_addrs)
+                .neighbor_cache(neighbor_cache)
+                .finalize()
+        }
+    };
+
+    Sockets::init(32);
+
+    let dummy = Rc::new(Semaphore::new(0, 1));
+    mgmt::start(Rc::new(cfg), dummy, None);
+
+    // getting eth settings disables the LED as it resets GPIO
+    // need to re-enable it here
+    #[cfg(feature = "target_kasli_soc")]
+    {
+        let mut err_led = ErrorLED::error_led();
+        err_led.toggle(true);
+    }
+
+    Sockets::run(&mut iface, || Instant::from_millis(timer.get_time().0 as i32));
 }

src/runtime/src/kernel/dma.rs

@@ -1,212 +0,0 @@
-use crate::{
-    pl::csr,
-    artiq_raise,
-    rtio,
-};
-use alloc::{vec::Vec, string::String, boxed::Box};
-use cslice::CSlice;
-use super::{KERNEL_IMAGE, KERNEL_CHANNEL_0TO1, KERNEL_CHANNEL_1TO0, Message};
-use core::mem;
-
-use libcortex_a9::cache::dcci_slice;
-
-const ALIGNMENT: usize = 16 * 8;
-
-#[repr(C)]
-pub struct DmaTrace {
-    duration: i64,
-    address:  i32,
-}
-
-#[derive(Clone, Debug)]
-pub struct DmaRecorder {
-    pub name: String,
-    pub buffer: Vec<u8>,
-    pub duration: i64,
-}
-
-static mut RECORDER: Option<DmaRecorder> = None;
-
-pub unsafe fn init_dma_recorder() {
-    // as static would remain after restart, we have to reset it,
-    // without running its destructor.
-    mem::forget(mem::replace(&mut RECORDER, None));
-}
-
-pub extern fn dma_record_start(name: CSlice<u8>) {
-    let name = String::from_utf8(name.as_ref().to_vec()).unwrap();
-    unsafe {
-        KERNEL_CHANNEL_1TO0.as_mut().unwrap().send(Message::DmaEraseRequest(name.clone()));
-    }
-    unsafe {
-        if RECORDER.is_some() {
-            artiq_raise!("DMAError", "DMA is already recording")
-        }
-
-        let library = KERNEL_IMAGE.as_ref().unwrap();
-        library.rebind(b"rtio_output",
-                       dma_record_output as *const ()).unwrap();
-        library.rebind(b"rtio_output_wide",
-                       dma_record_output_wide as *const ()).unwrap();
-
-        RECORDER = Some(DmaRecorder {
-            name,
-            buffer: Vec::new(),
-            duration: 0,
-        });
-    }
-}
-
-pub extern fn dma_record_stop(duration: i64) {
-    unsafe {
-        if RECORDER.is_none() {
-            artiq_raise!("DMAError", "DMA is not recording")
-        }
-
-        let library = KERNEL_IMAGE.as_ref().unwrap();
-        library.rebind(b"rtio_output",
-                       rtio::output as *const ()).unwrap();
-        library.rebind(b"rtio_output_wide",
-                       rtio::output_wide as *const ()).unwrap();
-
-        let mut recorder = RECORDER.take().unwrap();
-        recorder.duration = duration;
-        KERNEL_CHANNEL_1TO0.as_mut().unwrap().send(
-            Message::DmaPutRequest(recorder)
-        );
-    }
-}
-
-#[inline(always)]
-unsafe fn dma_record_output_prepare(timestamp: i64, target: i32,
-                                    words: usize) {
-    // See gateware/rtio/dma.py.
-    const HEADER_LENGTH: usize = /*length*/1 + /*channel*/3 + /*timestamp*/8 + /*address*/1;
-    let length = HEADER_LENGTH + /*data*/words * 4;
-
-    let buffer = &mut RECORDER.as_mut().unwrap().buffer;
-    buffer.reserve(length);
-    buffer.extend_from_slice(&[
-        (length    >>  0) as u8,
-        (target    >>  8) as u8,
-        (target    >>  16) as u8,
-        (target    >>  24) as u8,
-        (timestamp >>  0) as u8,
-        (timestamp >>  8) as u8,
-        (timestamp >> 16) as u8,
-        (timestamp >> 24) as u8,
-        (timestamp >> 32) as u8,
-        (timestamp >> 40) as u8,
-        (timestamp >> 48) as u8,
-        (timestamp >> 56) as u8,
-        (target    >>  0) as u8,
-    ]);
-}
-
-pub extern fn dma_record_output(target: i32, word: i32) {
-    unsafe {
-        let timestamp = rtio::now_mu();
-        dma_record_output_prepare(timestamp, target, 1);
-        RECORDER.as_mut().unwrap().buffer.extend_from_slice(&[
-            (word >>  0) as u8,
-            (word >>  8) as u8,
-            (word >> 16) as u8,
-            (word >> 24) as u8,
-        ]);
-    }
-}
-
-pub extern fn dma_record_output_wide(target: i32, words: CSlice<i32>) {
-    assert!(words.len() <= 16); // enforce the hardware limit
-
-    unsafe {
-        let timestamp = rtio::now_mu();
-        dma_record_output_prepare(timestamp, target, words.len());
-        let buffer = &mut RECORDER.as_mut().unwrap().buffer;
-        for word in words.as_ref().iter() {
-            buffer.extend_from_slice(&[
-                (word >>  0) as u8,
-                (word >>  8) as u8,
-                (word >> 16) as u8,
-                (word >> 24) as u8,
-            ]);
-        }
-    }
-}
-
-pub extern fn dma_erase(name: CSlice<u8>) {
-    let name = String::from_utf8(name.as_ref().to_vec()).unwrap();
-    unsafe {
-        KERNEL_CHANNEL_1TO0.as_mut().unwrap().send(Message::DmaEraseRequest(name));
-    }
-}
-
-pub extern fn dma_retrieve(name: CSlice<u8>) -> DmaTrace {
-    let name = String::from_utf8(name.as_ref().to_vec()).unwrap();
-    unsafe {
-        KERNEL_CHANNEL_1TO0.as_mut().unwrap().send(Message::DmaGetRequest(name));
-    }
-    match unsafe {KERNEL_CHANNEL_0TO1.as_mut().unwrap()}.recv() {
-        Message::DmaGetReply(None) => (),
-        Message::DmaGetReply(Some((mut v, duration))) => {
-            v.reserve(ALIGNMENT - 1);
-            let original_length = v.len();
-            let padding = ALIGNMENT - v.as_ptr() as usize % ALIGNMENT;
-            let padding = if padding == ALIGNMENT { 0 } else { padding };
-            for _ in 0..padding {
-                v.push(0);
-            }
-            // trailing zero to indicate end of buffer
-            v.push(0);
-            v.copy_within(0..original_length, padding);
-            dcci_slice(&v);
-            let v = Box::new(v);
-            let address = Box::into_raw(v) as *mut Vec<u8> as i32;
-            return DmaTrace {
-                address,
-                duration,
-            };
-        },
-        _ => panic!("Expected DmaGetReply after DmaGetRequest!"),
-    }
-    // we have to defer raising error as we have to drop the message first...
-    artiq_raise!("DMAError", "DMA trace not found");
-}
-
-pub extern fn dma_playback(timestamp: i64, ptr: i32) {
-    unsafe {
-        let v = Box::from_raw(ptr as *mut Vec<u8>);
-        let padding = ALIGNMENT - v.as_ptr() as usize % ALIGNMENT;
-        let padding = if padding == ALIGNMENT { 0 } else { padding };
-        let ptr = v.as_ptr().add(padding) as i32;
-
-        csr::rtio_dma::base_address_write(ptr as u32);
-        csr::rtio_dma::time_offset_write(timestamp as u64);
-
-        csr::cri_con::selected_write(1);
-        csr::rtio_dma::enable_write(1);
-        while csr::rtio_dma::enable_read() != 0 {}
-        csr::cri_con::selected_write(0);
-
-        // leave the handle as we may try to do playback for another time.
-        mem::forget(v);
-
-        let error = csr::rtio_dma::error_read();
-        if error != 0 {
-            let timestamp = csr::rtio_dma::error_timestamp_read();
-            let channel = csr::rtio_dma::error_channel_read();
-            csr::rtio_dma::error_write(1);
-            if error & 1 != 0 {
-                artiq_raise!("RTIOUnderflow",
-                    "RTIO underflow at {0} mu, channel {1}",
-                    timestamp as i64, channel as i64, 0);
-            }
-            if error & 2 != 0 {
-                artiq_raise!("RTIODestinationUnreachable",
-                    "RTIO destination unreachable, output, at {0} mu, channel {1}",
-                    timestamp as i64, channel as i64, 0);
-            }
-        }
-    }
-}
-

src/runtime/src/kernel/mod.rs

@@ -1,67 +0,0 @@
-use core::ptr;
-use alloc::{vec::Vec, string::String};
-
-use libcortex_a9::{mutex::Mutex, sync_channel, semaphore::Semaphore};
-use crate::eh_artiq;
-
-mod control;
-pub use control::Control;
-pub mod core1;
-mod api;
-mod rpc;
-mod dma;
-pub use dma::DmaRecorder;
-mod cache;
-
-#[derive(Debug, Clone)]
-pub struct RPCException {
-    pub id: u32,
-    pub message: u32,
-    pub param: [i64; 3],
-    pub file: u32,
-    pub line: i32,
-    pub column: i32,
-    pub function: u32
-}
-
-#[derive(Debug, Clone)]
-pub enum Message {
-    LoadRequest(Vec<u8>),
-    LoadCompleted,
-    LoadFailed,
-    StartRequest,
-    KernelFinished(u8),
-    KernelException(&'static [Option<eh_artiq::Exception<'static>>],
-                    &'static [eh_artiq::StackPointerBacktrace],
-                    &'static [(usize, usize)],
-                    u8),
-    RpcSend { is_async: bool, data: Vec<u8> },
-    RpcRecvRequest(*mut ()),
-    RpcRecvReply(Result<usize, RPCException>),
-
-    CacheGetRequest(String),
-    CacheGetReply(Vec<i32>),
-    CachePutRequest(String, Vec<i32>),
-
-    DmaPutRequest(DmaRecorder),
-    DmaEraseRequest(String),
-    DmaGetRequest(String),
-    DmaGetReply(Option<(Vec<u8>, i64)>),
-
-    #[cfg(has_drtio)]
-    UpDestinationsRequest(i32),
-    #[cfg(has_drtio)]
-    UpDestinationsReply(bool),
-}
-
-static CHANNEL_0TO1: Mutex<Option<sync_channel::Sender<'static, Message>>> = Mutex::new(None);
-static CHANNEL_1TO0: Mutex<Option<sync_channel::Receiver<'static, Message>>> = Mutex::new(None);
-static CHANNEL_SEM: Semaphore = Semaphore::new(0, 1);
-
-static mut KERNEL_CHANNEL_0TO1: Option<sync_channel::Receiver<'static, Message>> = None;
-static mut KERNEL_CHANNEL_1TO0: Option<sync_channel::Sender<'static, Message>> = None;
-
-pub static mut KERNEL_IMAGE: *const core1::KernelImage = ptr::null();
-
-static INIT_LOCK: Mutex<()> = Mutex::new(());
-

src/runtime/src/main.rs

@@ -1,100 +1,94 @@
 #![no_std]
 #![no_main]
-#![recursion_limit="1024"]  // for futures_util::select!
+#![recursion_limit = "1024"] // for futures_util::select!
 #![feature(alloc_error_handler)]
-#![feature(panic_info_message)]
-#![feature(c_variadic)]
 #![feature(const_btree_new)]
-#![feature(const_in_array_repeat_expressions)]
+#![feature(panic_info_message)]
-#![feature(naked_functions)]
-#![feature(asm)]
 
+#[macro_use]
 extern crate alloc;
 
-use log::{info, warn, error};
+#[cfg(all(feature = "target_kasli_soc", has_virtual_leds))]
+use core::cell::RefCell;
 
-use libboard_zynq::{timer::GlobalTimer, mpcore, gic};
+use ksupport;
-use libasync::{task, block_async};
+use libasync::task;
-use libsupport_zynq::ram;
+#[cfg(has_drtio_eem)]
-use nb;
+use libboard_artiq::drtio_eem;
-use void::Void;
+#[cfg(feature = "target_kasli_soc")]
+use libboard_artiq::io_expander;
+use libboard_artiq::{identifier_read, logger, pl};
+use libboard_zynq::{gic, mpcore, timer::GlobalTimer};
 use libconfig::Config;
 use libcortex_a9::l2c::enable_l2_cache;
-use libboard_artiq::{logger, identifier_read, init_gateware, pl};
+use libsupport_zynq::{exception_vectors, ram};
+use log::{info, warn};
 
-mod proto_async;
-mod comms;
-mod rpc;
-#[cfg(ki_impl = "csr")]
-#[path = "rtio_csr.rs"]
-mod rtio;
-#[cfg(ki_impl = "acp")]
-#[path = "rtio_acp.rs"]
-mod rtio;
-mod rtio_mgt;
-mod rtio_clocking;
-mod kernel;
-mod moninj;
-mod eh_artiq;
-mod panic;
-mod mgmt;
 mod analyzer;
-mod irq;
+mod comms;
-mod i2c;
 
-static mut SEEN_ASYNC_ERRORS: u8 = 0;
+mod mgmt;
+mod moninj;
+mod panic;
+mod proto_async;
+mod rpc_async;
+mod rtio_clocking;
+mod rtio_dma;
+mod rtio_mgt;
+#[cfg(has_drtio)]
+mod subkernel;
 
-pub unsafe fn get_async_errors() -> u8 {
+// linker symbols
-    let errors = SEEN_ASYNC_ERRORS;
+extern "C" {
-    SEEN_ASYNC_ERRORS = 0;
+    static __exceptions_start: u32;
-    errors
 }
 
-fn wait_for_async_rtio_error() -> nb::Result<(), Void> {
+#[cfg(all(feature = "target_kasli_soc", has_virtual_leds))]
-    unsafe {
+async fn io_expanders_service(
-        if pl::csr::rtio_core::async_error_read() != 0 {
+    i2c_bus: RefCell<&mut libboard_zynq::i2c::I2c>,
-            Ok(())
+    io_expander0: RefCell<io_expander::IoExpander>,
-        } else {
+    io_expander1: RefCell<io_expander::IoExpander>,
-            Err(nb::Error::WouldBlock)
+) {
-        }
-    }
-}
-
-async fn report_async_rtio_errors() {
     loop {
-        let _ = block_async!(wait_for_async_rtio_error()).await;
+        task::r#yield().await;
-        unsafe {
+        io_expander0
-            let errors = pl::csr::rtio_core::async_error_read();
+            .borrow_mut()
-            if errors & 1 != 0 {
+            .service(&mut i2c_bus.borrow_mut())
-                error!("RTIO collision involving channel {}",
+            .expect("I2C I/O expander #0 service failed");
-                       pl::csr::rtio_core::collision_channel_read());
+        io_expander1
-            }
+            .borrow_mut()
-            if errors & 2 != 0 {
+            .service(&mut i2c_bus.borrow_mut())
-                error!("RTIO busy error involving channel {}",
+            .expect("I2C I/O expander #1 service failed");
-                       pl::csr::rtio_core::busy_channel_read());
+    }
-            }
+}
-            if errors & 4 != 0 {
+
-                error!("RTIO sequence error involving channel {}",
+#[cfg(has_grabber)]
-                       pl::csr::rtio_core::sequence_error_channel_read());
+mod grabber {
-            }
+    use libasync::delay;
-            SEEN_ASYNC_ERRORS = errors;
+    use libboard_artiq::grabber;
-            pl::csr::rtio_core::async_error_write(errors);
+    use libboard_zynq::time::Milliseconds;
+
+    use crate::GlobalTimer;
+    pub async fn grabber_thread(timer: GlobalTimer) {
+        let mut countdown = timer.countdown();
+        loop {
+            grabber::tick();
+            delay(&mut countdown, Milliseconds(200)).await;
         }
     }
 }
 
-
+static mut LOG_BUFFER: [u8; 1 << 17] = [0; 1 << 17];
-
-static mut LOG_BUFFER: [u8; 1<<17] = [0; 1<<17];
 
 #[no_mangle]
 pub fn main_core0() {
+    unsafe {
+        exception_vectors::set_vector_table(&__exceptions_start as *const u32 as u32);
+    }
     enable_l2_cache(0x8);
     let mut timer = GlobalTimer::start();
 
-    let buffer_logger = unsafe {
+    let buffer_logger = unsafe { logger::BufferLogger::new(&mut LOG_BUFFER[..]) };
-        logger::BufferLogger::new(&mut LOG_BUFFER[..])
-    };
     buffer_logger.set_uart_log_level(log::LevelFilter::Info);
     buffer_logger.register();
     log::set_max_level(log::LevelFilter::Info);
@@ -104,10 +98,39 @@ pub fn main_core0() {
     ram::init_alloc_core0();
     gic::InterruptController::gic(mpcore::RegisterBlock::mpcore()).enable_interrupts();
 
-    init_gateware();
+    info!("gateware ident: {}", identifier_read(&mut [0; 64]));
-    info!("detected gateware: {}", identifier_read(&mut [0; 64]));
 
-    i2c::init();
+    ksupport::i2c::init();
+    #[cfg(feature = "target_kasli_soc")]
+    {
+        let i2c_bus = unsafe { (ksupport::i2c::I2C_BUS).as_mut().unwrap() };
+        let mut io_expander0 = io_expander::IoExpander::new(i2c_bus, 0).unwrap();
+        let mut io_expander1 = io_expander::IoExpander::new(i2c_bus, 1).unwrap();
+        io_expander0
+            .init(i2c_bus)
+            .expect("I2C I/O expander #0 initialization failed");
+        io_expander1
+            .init(i2c_bus)
+            .expect("I2C I/O expander #1 initialization failed");
+
+        // Drive CLK_SEL to true
+        #[cfg(has_si549)]
+        io_expander0.set(1, 7, true);
+
+        // Drive TX_DISABLE to false on SFP0..3
+        io_expander0.set(0, 1, false);
+        io_expander1.set(0, 1, false);
+        io_expander0.set(1, 1, false);
+        io_expander1.set(1, 1, false);
+        io_expander0.service(i2c_bus).unwrap();
+        io_expander1.service(i2c_bus).unwrap();
+        #[cfg(has_virtual_leds)]
+        task::spawn(io_expanders_service(
+            RefCell::new(i2c_bus),
+            RefCell::new(io_expander0),
+            RefCell::new(io_expander1),
+        ));
+    }
 
     let cfg = match Config::new() {
         Ok(cfg) => cfg,
@@ -119,7 +142,13 @@ pub fn main_core0() {
 
     rtio_clocking::init(&mut timer, &cfg);
 
-    task::spawn(report_async_rtio_errors());
+    #[cfg(has_drtio_eem)]
+    drtio_eem::init(&mut timer, &cfg);
+
+    #[cfg(has_grabber)]
+    task::spawn(grabber::grabber_thread(timer));
+
+    task::spawn(ksupport::report_async_rtio_errors());
 
     comms::main(timer, cfg);
 }

src/runtime/src/moninj.rs

@@ -1,26 +1,23 @@
-use core::{fmt, cell::RefCell};
 use alloc::{collections::BTreeMap, rc::Rc};
-use log::{debug, info, warn};
+use core::{cell::RefCell, fmt};
-use void::Void;
 
+use futures::{pin_mut, select_biased, FutureExt};
+use libasync::{block_async, nb, smoltcp::TcpStream, task};
 use libboard_artiq::drtio_routing;
-
+use libboard_zynq::{smoltcp, time::Milliseconds, timer::GlobalTimer};
-use libboard_zynq::{smoltcp, timer::GlobalTimer, time::Milliseconds};
-use libasync::{task, smoltcp::TcpStream, block_async, nb};
 use libcortex_a9::mutex::Mutex;
-
+use log::{debug, info, warn};
 use num_derive::{FromPrimitive, ToPrimitive};
 use num_traits::{FromPrimitive, ToPrimitive};
-use futures::{pin_mut, select_biased, FutureExt};
+use void::Void;
 
 use crate::proto_async::*;
 
-
 #[derive(Debug, Clone, Copy, PartialEq, Eq)]
 pub enum Error {
     NetworkError(smoltcp::Error),
     UnexpectedPattern,
-    UnrecognizedPacket
+    UnrecognizedPacket,
 }
 
 pub type Result<T> = core::result::Result<T, Error>;
@@ -29,8 +26,8 @@ impl fmt::Display for Error {
     fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
         match self {
             &Error::NetworkError(error) => write!(f, "network error: {}", error),
-            &Error::UnexpectedPattern   => write!(f, "unexpected pattern"),
+            &Error::UnexpectedPattern => write!(f, "unexpected pattern"),
-            &Error::UnrecognizedPacket  => write!(f, "unrecognized packet"),
+            &Error::UnrecognizedPacket => write!(f, "unrecognized packet"),
         }
     }
 }
@@ -46,60 +43,107 @@ enum HostMessage {
     MonitorProbe = 0,
     MonitorInjection = 3,
     Inject = 1,
-    GetInjectionStatus = 2
+    GetInjectionStatus = 2,
 }
 
 #[derive(Debug, FromPrimitive, ToPrimitive)]
 enum DeviceMessage {
     MonitorStatus = 0,
-    InjectionStatus = 1
+    InjectionStatus = 1,
 }
 
 #[cfg(has_drtio)]
 mod remote_moninj {
-    use super::*;
     use libboard_artiq::drtioaux_async;
-    use crate::rtio_mgt::drtio;
     use log::error;
 
-    pub async fn read_probe(aux_mutex: &Rc<Mutex<bool>>, timer: GlobalTimer, linkno: u8, destination: u8, channel: i32, probe: i8) -> i64 {
+    use super::*;
-        let reply = drtio::aux_transact(aux_mutex, linkno, &drtioaux_async::Packet::MonitorRequest { 
+    use crate::rtio_mgt::{drtio, drtio::Error as DrtioError};
-            destination: destination,
+
-            channel: channel as _,
+    pub async fn read_probe(
-            probe: probe as _},
+        aux_mutex: &Rc<Mutex<bool>>,
-            timer).await;
+        routing_table: &drtio_routing::RoutingTable,
+        timer: GlobalTimer,
+        linkno: u8,
+        destination: u8,
+        channel: i32,
+        probe: i8,
+    ) -> i64 {
+        let reply = drtio::aux_transact(
+            aux_mutex,
+            linkno,
+            routing_table,
+            &drtioaux_async::Packet::MonitorRequest {
+                destination: destination,
+                channel: channel as _,
+                probe: probe as _,
+            },
+            timer,
+        )
+        .await;
         match reply {
             Ok(drtioaux_async::Packet::MonitorReply { value }) => return value as i64,
             Ok(packet) => error!("received unexpected aux packet: {:?}", packet),
-            Err("link went down") => { debug!("link is down"); },
+            Err(DrtioError::LinkDown) => {
-            Err(e) => error!("aux packet error ({})", e)
+                warn!("link is down");
+            }
+            Err(e) => error!("aux packet error ({})", e),
         }
         0
     }
 
-    pub async fn inject(aux_mutex: &Rc<Mutex<bool>>, _timer: GlobalTimer, linkno: u8, destination: u8, channel: i32, overrd: i8, value: i8) {
+    pub async fn inject(
-        let _lock = aux_mutex.lock();
+        aux_mutex: &Rc<Mutex<bool>>,
-        drtioaux_async::send(linkno, &drtioaux_async::Packet::InjectionRequest {
+        _routing_table: &drtio_routing::RoutingTable,
-            destination: destination,
+        _timer: GlobalTimer,
-            channel: channel as _,
+        linkno: u8,
-            overrd: overrd as _,
+        destination: u8,
-            value: value as _
+        channel: i32,
-        }).await.unwrap();
+        overrd: i8,
+        value: i8,
+    ) {
+        let _lock = aux_mutex.async_lock().await;
+        drtioaux_async::send(
+            linkno,
+            &drtioaux_async::Packet::InjectionRequest {
+                destination: destination,
+                channel: channel as _,
+                overrd: overrd as _,
+                value: value as _,
+            },
+        )
+        .await
+        .unwrap();
     }
 
-    pub async fn read_injection_status(aux_mutex: &Rc<Mutex<bool>>, timer: GlobalTimer, linkno: u8, destination: u8, channel: i32, overrd: i8) -> i8 {
+    pub async fn read_injection_status(
-        let reply = drtio::aux_transact(aux_mutex, 
+        aux_mutex: &Rc<Mutex<bool>>,
-            linkno, 
+        routing_table: &drtio_routing::RoutingTable,
+        timer: GlobalTimer,
+        linkno: u8,
+        destination: u8,
+        channel: i32,
+        overrd: i8,
+    ) -> i8 {
+        let reply = drtio::aux_transact(
+            aux_mutex,
+            linkno,
+            routing_table,
             &drtioaux_async::Packet::InjectionStatusRequest {
                 destination: destination,
                 channel: channel as _,
-                overrd: overrd as _},
+                overrd: overrd as _,
-            timer).await;
+            },
+            timer,
+        )
+        .await;
         match reply {
             Ok(drtioaux_async::Packet::InjectionStatusReply { value }) => return value as i8,
             Ok(packet) => error!("received unexpected aux packet: {:?}", packet),
-            Err("link went down") => { debug!("link is down"); },
+            Err(DrtioError::LinkDown) => {
-            Err(e) => error!("aux packet error ({})", e)
+                warn!("link is down");
+            }
+            Err(e) => error!("aux packet error ({})", e),
         }
         0
     }
@@ -144,7 +188,7 @@ macro_rules! dispatch {
             local_moninj::$func(channel.into(), $($param, )*)
         } else {
             let linkno = hop - 1 as u8;
-            remote_moninj::$func($aux_mutex, $timer, linkno, destination, channel, $($param, )*).await
+            remote_moninj::$func($aux_mutex, $routing_table, $timer, linkno, destination, channel, $($param, )*).await
         }
     }}
 }
@@ -157,8 +201,12 @@ macro_rules! dispatch {
     }}
 }
 
-async fn handle_connection(stream: &TcpStream, timer: GlobalTimer, 
+async fn handle_connection(
-        _aux_mutex: &Rc<Mutex<bool>>, _routing_table: &drtio_routing::RoutingTable) -> Result<()> {
+    stream: &TcpStream,
+    timer: GlobalTimer,
+    _aux_mutex: &Rc<Mutex<bool>>,
+    _routing_table: &drtio_routing::RoutingTable,
+) -> Result<()> {
     if !expect(&stream, b"ARTIQ moninj\n").await? {
         return Err(Error::UnexpectedPattern);
     }
@@ -255,7 +303,13 @@ async fn handle_connection(stream: &TcpStream, timer: GlobalTimer,
     }
 }
 
-pub fn start(timer: GlobalTimer, aux_mutex: Rc<Mutex<bool>>, routing_table: Rc<RefCell<drtio_routing::RoutingTable>>) {
+pub fn start(
+    timer: GlobalTimer,
+    aux_mutex: &Rc<Mutex<bool>>,
+    routing_table: &Rc<RefCell<drtio_routing::RoutingTable>>,
+) {
+    let aux_mutex = aux_mutex.clone();
+    let routing_table = routing_table.clone();
     task::spawn(async move {
         loop {
             let aux_mutex = aux_mutex.clone();

src/runtime/src/panic.rs

@@ -1,22 +1,22 @@
-use libboard_zynq::{print, println};
+#[cfg(feature = "target_kasli_soc")]
-use libregister::RegisterR;
+use libboard_zynq::error_led::ErrorLED;
+use libboard_zynq::{print, println, timer::GlobalTimer};
+use libconfig::Config;
 use libcortex_a9::regs::MPIDR;
+use libregister::RegisterR;
+use log::error;
 use unwind::backtrace;
 
+use crate::comms::soft_panic_main;
+
 static mut PANICKED: [bool; 2] = [false; 2];
+static mut SOFT_PANICKED: bool = false;
 
 #[panic_handler]
 fn panic(info: &core::panic::PanicInfo) -> ! {
     let id = MPIDR.read().cpu_id() as usize;
-    print!("Core {} ", id);
+    let soft_panicked = unsafe { SOFT_PANICKED };
-    unsafe {
+    print!("Core {} panic at ", id);
-        if PANICKED[id] {
-            println!("nested panic!");
-            loop {}
-        }
-        PANICKED[id] = true;
-    }
-    print!("panic at ");
     if let Some(location) = info.location() {
         print!("{}:{}:{}", location.file(), location.line(), location.column());
     } else {
@@ -27,6 +27,20 @@ fn panic(info: &core::panic::PanicInfo) -> ! {
     } else {
         println!("");
     }
+    unsafe {
+        // soft panics only allowed for core 0
+        if PANICKED[id] && (SOFT_PANICKED || id == 1) {
+            println!("nested panic!");
+            loop {}
+        }
+        SOFT_PANICKED = true;
+        PANICKED[id] = true;
+    }
+    #[cfg(feature = "target_kasli_soc")]
+    {
+        let mut err_led = ErrorLED::error_led();
+        err_led.toggle(true);
+    }
     println!("Backtrace: ");
     let _ = backtrace(|ip| {
         // Backtrace gives us the return address, i.e. the address after the delay slot,
@@ -34,6 +48,26 @@ fn panic(info: &core::panic::PanicInfo) -> ! {
         print!("{:#08x} ", ip - 2 * 4);
     });
     println!("\nEnd backtrace");
-
+    if !soft_panicked && id == 0 {
+        soft_panic(info);
+    }
     loop {}
 }
+
+fn soft_panic(info: &core::panic::PanicInfo) -> ! {
+    // write panic info to log, so coremgmt can also read it
+    if let Some(location) = info.location() {
+        error!("panic at {}:{}:{}", location.file(), location.line(), location.column());
+    } else {
+        error!("panic at unknown location");
+    }
+    if let Some(message) = info.message() {
+        error!("panic message: {}", message);
+    }
+    let timer = GlobalTimer::start();
+    let cfg = match Config::new() {
+        Ok(cfg) => cfg,
+        Err(_) => Config::new_dummy(),
+    };
+    soft_panic_main(timer, cfg);
+}

src/runtime/src/proto_async.rs

@@ -1,8 +1,7 @@
-use core::cmp::min;
+use core::{cell::RefCell, cmp::min};
-use core::cell::RefCell;
 
-use libboard_zynq::smoltcp;
 use libasync::smoltcp::TcpStream;
+use libboard_zynq::smoltcp;
 
 type Result<T> = core::result::Result<T, smoltcp::Error>;
 
@@ -14,25 +13,27 @@ enum RecvState<T> {
 pub async fn expect(stream: &TcpStream, pattern: &[u8]) -> Result<bool> {
     let mut state = RecvState::NeedsMore(0, true);
     loop {
-        state = stream.recv(|buf| {
+        state = stream
-            let mut consumed = 0;
+            .recv(|buf| {
-            if let RecvState::NeedsMore(mut cur_index, _) = state {
+                let mut consumed = 0;
-                for b in buf.iter() {
+                if let RecvState::NeedsMore(mut cur_index, _) = state {
-                    consumed += 1;
+                    for b in buf.iter() {
-                    if *b == pattern[cur_index] {
+                        consumed += 1;
-                        if cur_index + 1 == pattern.len() {
+                        if *b == pattern[cur_index] {
-                            return (consumed, RecvState::Completed(true));
+                            if cur_index + 1 == pattern.len() {
+                                return (consumed, RecvState::Completed(true));
+                            }
+                        } else {
+                            return (consumed, RecvState::Completed(false));
                         }
-                    } else {
+                        cur_index += 1;
-                        return (consumed, RecvState::Completed(false));
                     }
-                    cur_index += 1;
+                    (consumed, RecvState::NeedsMore(cur_index, true))
+                } else {
+                    unreachable!();
                 }
-                (consumed, RecvState::NeedsMore(cur_index, true))
+            })
-            } else {
+            .await?;
-                unreachable!();
-            }
-        }).await?;
         if let RecvState::Completed(result) = state {
             return Ok(result);
         }
@@ -40,15 +41,11 @@ pub async fn expect(stream: &TcpStream, pattern: &[u8]) -> Result<bool> {
 }
 
 pub async fn read_bool(stream: &TcpStream) -> Result<bool> {
-    Ok(stream.recv(|buf| {
+    Ok(stream.recv(|buf| (1, buf[0] != 0)).await?)
-        (1, buf[0] != 0)
-    }).await?)
 }
 
 pub async fn read_i8(stream: &TcpStream) -> Result<i8> {
-    Ok(stream.recv(|buf| {
+    Ok(stream.recv(|buf| (1, buf[0] as i8)).await?)
-        (1, buf[0] as i8)
-    }).await?)
 }
 
 pub async fn read_i32(stream: &TcpStream) -> Result<i32> {
@@ -68,12 +65,14 @@ pub async fn read_chunk(stream: &TcpStream, destination: &mut [u8]) -> Result<()
     let destination = RefCell::new(destination);
     let mut done = 0;
     while done < total {
-        let count = stream.recv(|buf| {
+        let count = stream
-            let mut destination = destination.borrow_mut();
+            .recv(|buf| {
-            let count = min(total - done, buf.len());
+                let mut destination = destination.borrow_mut();
-            destination[done..done + count].copy_from_slice(&buf[..count]);
+                let count = min(total - done, buf.len());
-            (count, count)
+                destination[done..done + count].copy_from_slice(&buf[..count]);
-        }).await?;
+                (count, count)
+            })
+            .await?;
         done += count;
     }
     Ok(())

src/runtime/src/rpc.rs

@@ -1,614 +0,0 @@
-use core::str;
-use core::future::Future;
-use cslice::{CSlice, CMutSlice};
-use log::trace;
-use byteorder::{NativeEndian, ByteOrder};
-
-use core_io::{Write, Error};
-use libboard_zynq::smoltcp;
-use libasync::smoltcp::TcpStream;
-use alloc::boxed::Box;
-use async_recursion::async_recursion;
-
-use io::proto::ProtoWrite;
-use crate::proto_async;
-use self::tag::{Tag, TagIterator, split_tag};
-
-#[inline]
-fn alignment_offset(alignment: isize, ptr: isize) -> isize {
-    (alignment - ptr % alignment) % alignment
-}
-
-unsafe fn align_ptr<T>(ptr: *const ()) -> *const T {
-    let alignment = core::mem::align_of::<T>() as isize;
-    let fix = alignment_offset(alignment, ptr as isize);
-    ((ptr as isize) + fix) as *const T
-}
-
-unsafe fn align_ptr_mut<T>(ptr: *mut ()) -> *mut T {
-    let alignment = core::mem::align_of::<T>() as isize;
-    let fix = alignment_offset(alignment, ptr as isize);
-    ((ptr as isize) + fix) as *mut T
-}
-
-#[async_recursion(?Send)]
-async unsafe fn recv_value<F>(stream: &TcpStream, tag: Tag<'async_recursion>, data: &mut *mut (),
-                              alloc: &(impl Fn(usize) -> F + 'async_recursion))
-                             -> Result<(), smoltcp::Error>
-                          where F: Future<Output=*mut ()>
-{
-    macro_rules! consume_value {
-        ($ty:ty, |$ptr:ident| $map:expr) => ({
-            let $ptr = align_ptr_mut::<$ty>(*data);
-            *data = $ptr.offset(1) as *mut ();
-            $map
-        })
-    }
-
-    match tag {
-        Tag::None => Ok(()),
-        Tag::Bool =>
-            consume_value!(i8, |ptr| {
-                *ptr = proto_async::read_i8(stream).await?;
-                Ok(())
-            }),
-        Tag::Int32 =>
-            consume_value!(i32, |ptr| {
-                *ptr = proto_async::read_i32(stream).await?;
-                Ok(())
-            }),
-        Tag::Int64 | Tag::Float64 =>
-            consume_value!(i64, |ptr| {
-                *ptr = proto_async::read_i64(stream).await?;
-                Ok(())
-            }),
-        Tag::String | Tag::Bytes | Tag::ByteArray => {
-            consume_value!(CMutSlice<u8>, |ptr| {
-                let length = proto_async::read_i32(stream).await? as usize;
-                *ptr = CMutSlice::new(alloc(length).await as *mut u8, length);
-                proto_async::read_chunk(stream, (*ptr).as_mut()).await?;
-                Ok(())
-            })
-        }
-        Tag::Tuple(it, arity) => {
-            *data = (*data).offset(alignment_offset(tag.alignment() as isize, *data as isize));
-            let mut it = it.clone();
-            for _ in 0..arity {
-                let tag = it.next().expect("truncated tag");
-                recv_value(stream, tag, data, alloc).await?;
-            }
-            Ok(())
-        }
-        Tag::List(it) => {
-            #[repr(C)]
-            struct List { elements: *mut (), length: u32 }
-            consume_value!(*mut List, |ptr| {
-                let length = proto_async::read_i32(stream).await? as usize;
-                let tag = it.clone().next().expect("truncated tag");
-                let data_size = tag.size() * length as usize +
-                    match tag {
-                        Tag::Int64 | Tag::Float64 => 4,
-                        _ => 0
-                    };
-                let data = alloc(data_size + 8).await as *mut u8;
-                *ptr = data as *mut List;
-                let ptr = data as *mut List;
-                let data = data.offset(8);
-
-                let alignment = tag.alignment();
-                let mut data = data.offset(alignment_offset(alignment as isize, data as isize)) as *mut ();
-                (*ptr).length  = length as u32;
-                (*ptr).elements = data;
-                match tag {
-                    Tag::Bool => {
-                        let ptr = data as *mut u8;
-                        let dest = core::slice::from_raw_parts_mut(ptr, length);
-                        proto_async::read_chunk(stream, dest).await?;
-                    },
-                    Tag::Int32 => {
-                        let ptr = data as *mut u32;
-                        // reading as raw bytes and do endianness conversion later
-                        let dest = core::slice::from_raw_parts_mut(ptr as *mut u8, length * 4);
-                        proto_async::read_chunk(stream, dest).await?;
-                        drop(dest);
-                        let dest = core::slice::from_raw_parts_mut(ptr, length);
-                        NativeEndian::from_slice_u32(dest);
-                    },
-                    Tag::Int64 | Tag::Float64 => {
-                        let ptr = data as *mut u64;
-                        let dest = core::slice::from_raw_parts_mut(ptr as *mut u8, length * 8);
-                        proto_async::read_chunk(stream, dest).await?;
-                        drop(dest);
-                        let dest = core::slice::from_raw_parts_mut(ptr, length);
-                        NativeEndian::from_slice_u64(dest);
-                    },
-                    _ => {
-                        for _ in 0..(*ptr).length as usize {
-                            recv_value(stream, tag, &mut data, alloc).await?
-                        }
-                    }
-                }
-                Ok(())
-            })
-        }
-        Tag::Array(it, num_dims) => {
-            consume_value!(*mut (), |buffer| {
-                let mut total_len: u32 = 1;
-                for _ in 0..num_dims {
-                    let len = proto_async::read_i32(stream).await? as u32;
-                    total_len *= len;
-                    consume_value!(u32, |ptr| *ptr = len )
-                }
-
-                let elt_tag = it.clone().next().expect("truncated tag");
-                let data_size = elt_tag.size() * total_len as usize +
-                    match elt_tag {
-                        Tag::Int64 | Tag::Float64 => 4,
-                        _ => 0
-                    };
-                let mut data = alloc(data_size).await;
-
-                let alignment = tag.alignment();
-                data = data.offset(alignment_offset(alignment as isize, data as isize));
-                *buffer = data;
-                let length = total_len as usize;
-                match elt_tag {
-                    Tag::Bool => {
-                        let ptr = data as *mut u8;
-                        let dest = core::slice::from_raw_parts_mut(ptr, length);
-                        proto_async::read_chunk(stream, dest).await?;
-                    },
-                    Tag::Int32 => {
-                        let ptr = data as *mut u32;
-                        let dest = core::slice::from_raw_parts_mut(ptr as *mut u8, length * 4);
-                        proto_async::read_chunk(stream, dest).await?;
-                        drop(dest);
-                        let dest = core::slice::from_raw_parts_mut(ptr, length);
-                        NativeEndian::from_slice_u32(dest);
-                    },
-                    Tag::Int64 | Tag::Float64 => {
-                        let ptr = data as *mut u64;
-                        let dest = core::slice::from_raw_parts_mut(ptr as *mut u8, length * 8);
-                        proto_async::read_chunk(stream, dest).await?;
-                        drop(dest);
-                        let dest = core::slice::from_raw_parts_mut(ptr, length);
-                        NativeEndian::from_slice_u64(dest);
-                    },
-                    _ => {
-                        for _ in 0..length {
-                            recv_value(stream, elt_tag, &mut data, alloc).await?
-                        }
-                    }
-                }
-                Ok(())
-            })
-        }
-        Tag::Range(it) => {
-            *data = (*data).offset(alignment_offset(tag.alignment() as isize, *data as isize));
-            let tag = it.clone().next().expect("truncated tag");
-            recv_value(stream, tag, data, alloc).await?;
-            recv_value(stream, tag, data, alloc).await?;
-            recv_value(stream, tag, data, alloc).await?;
-            Ok(())
-        }
-        Tag::Keyword(_) => unreachable!(),
-        Tag::Object => unreachable!()
-    }
-}
-
-pub async fn recv_return<F>(stream: &TcpStream, tag_bytes: &[u8], data: *mut (),
-                            alloc: &impl Fn(usize) -> F)
-                           -> Result<(), smoltcp::Error>
-                        where F: Future<Output=*mut ()>
-{
-    let mut it = TagIterator::new(tag_bytes);
-    trace!("recv ...->{}", it);
-
-    let tag = it.next().expect("truncated tag");
-    let mut data = data;
-    unsafe { recv_value(stream, tag, &mut data, alloc).await? };
-
-    Ok(())
-}
-
-unsafe fn send_value<W>(writer: &mut W, tag: Tag, data: &mut *const ())
-                       -> Result<(), Error>
-    where W: Write + ?Sized
-{
-    macro_rules! consume_value {
-        ($ty:ty, |$ptr:ident| $map:expr) => ({
-            let $ptr = align_ptr::<$ty>(*data);
-            *data = $ptr.offset(1) as *const ();
-            $map
-        })
-    }
-
-    writer.write_u8(tag.as_u8())?;
-    match tag {
-        Tag::None => Ok(()),
-        Tag::Bool =>
-            consume_value!(u8, |ptr|
-                writer.write_u8(*ptr)),
-        Tag::Int32 =>
-            consume_value!(u32, |ptr|
-                writer.write_u32(*ptr)),
-        Tag::Int64 | Tag::Float64 =>
-            consume_value!(u64, |ptr|
-                writer.write_u64(*ptr)),
-        Tag::String =>
-            consume_value!(CSlice<u8>, |ptr|
-                writer.write_string(str::from_utf8((*ptr).as_ref()).unwrap())),
-        Tag::Bytes | Tag::ByteArray =>
-            consume_value!(CSlice<u8>, |ptr|
-                writer.write_bytes((*ptr).as_ref())),
-        Tag::Tuple(it, arity) => {
-            let mut it = it.clone();
-            writer.write_u8(arity)?;
-            for _ in 0..arity {
-                let tag = it.next().expect("truncated tag");
-                send_value(writer, tag, data)?
-            }
-            Ok(())
-        }
-        Tag::List(it) => {
-            #[repr(C)]
-            struct List { elements: *const (), length: u32 }
-            consume_value!(&List, |ptr| {
-                let length = (**ptr).length as isize;
-                writer.write_u32((*ptr).length)?;
-                let tag = it.clone().next().expect("truncated tag");
-                let mut data = (**ptr).elements;
-                writer.write_u8(tag.as_u8())?;
-                match tag {
-                    Tag::Bool => {
-                        // we can pretend this is u8...
-                        let ptr1 = align_ptr::<u8>(data);
-                        let slice = core::slice::from_raw_parts(ptr1, length as usize);
-                        writer.write_all(slice)?;
-                    },
-                    Tag::Int32 => {
-                        let ptr1 = align_ptr::<i32>(data);
-                        let slice = core::slice::from_raw_parts(ptr1 as *const u8, length as usize * 4);
-                        writer.write_all(slice)?;
-                    },
-                    Tag::Int64 | Tag::Float64 => {
-                        let ptr1 = align_ptr::<i64>(data);
-                        let slice = core::slice::from_raw_parts(ptr1 as *const u8, length as usize * 8);
-                        writer.write_all(slice)?;
-                    },
-                    // non-primitive types, not sure if this would happen but we can handle it...
-                    _ => {
-                        for _ in 0..length {
-                            send_value(writer, tag, &mut data)?;
-                        }
-                    }
-                };
-                Ok(())
-            })
-        }
-        Tag::Array(it, num_dims) => {
-            writer.write_u8(num_dims)?;
-            consume_value!(*const(), |buffer| {
-                let elt_tag = it.clone().next().expect("truncated tag");
-
-                let mut total_len = 1;
-                for _ in 0..num_dims {
-                    consume_value!(u32, |len| {
-                        writer.write_u32(*len)?;
-                        total_len *= *len;
-                    })
-                }
-                let mut data = *buffer;
-                let length = total_len as isize;
-                writer.write_u8(elt_tag.as_u8())?;
-                match elt_tag {
-                    Tag::Bool => {
-                        let ptr1 = align_ptr::<u8>(data);
-                        let slice = core::slice::from_raw_parts(ptr1, length as usize);
-                        writer.write_all(slice)?;
-                    },
-                    Tag::Int32 => {
-                        let ptr1 = align_ptr::<i32>(data);
-                        let slice = core::slice::from_raw_parts(ptr1 as *const u8, length as usize * 4);
-                        writer.write_all(slice)?;
-                    },
-                    Tag::Int64 | Tag::Float64 => {
-                        let ptr1 = align_ptr::<i64>(data);
-                        let slice = core::slice::from_raw_parts(ptr1 as *const u8, length as usize * 8);
-                        writer.write_all(slice)?;
-                    },
-                    // non-primitive types, not sure if this would happen but we can handle it...
-                    _ => {
-                        for _ in 0..length {
-                            send_value(writer, elt_tag, &mut data)?;
-                        }
-                    }
-                };
-                Ok(())
-            })
-        }
-        Tag::Range(it) => {
-            let tag = it.clone().next().expect("truncated tag");
-            send_value(writer, tag, data)?;
-            send_value(writer, tag, data)?;
-            send_value(writer, tag, data)?;
-            Ok(())
-        }
-        Tag::Keyword(it) => {
-            #[repr(C)]
-            struct Keyword<'a> { name: CSlice<'a, u8> }
-            consume_value!(Keyword, |ptr| {
-                writer.write_string(str::from_utf8((*ptr).name.as_ref()).unwrap())?;
-                let tag = it.clone().next().expect("truncated tag");
-                let mut data = ptr.offset(1) as *const ();
-                send_value(writer, tag, &mut data)
-            })
-            // Tag::Keyword never appears in composite types, so we don't have
-            // to accurately advance data.
-        }
-        Tag::Object => {
-            #[repr(C)]
-            struct Object { id: u32 }
-            consume_value!(*const Object, |ptr|
-                writer.write_u32((**ptr).id))
-        }
-    }
-}
-
-pub fn send_args<W>(writer: &mut W, service: u32, tag_bytes: &[u8], data: *const *const ())
-                   -> Result<(), Error>
-    where W: Write + ?Sized
-{
-    let (arg_tags_bytes, return_tag_bytes) = split_tag(tag_bytes);
-
-    let mut args_it = TagIterator::new(arg_tags_bytes);
-    let return_it = TagIterator::new(return_tag_bytes);
-    trace!("send<{}>({})->{}", service, args_it, return_it);
-
-    writer.write_u32(service)?;
-    for index in 0.. {
-        if let Some(arg_tag) = args_it.next() {
-            let mut data = unsafe { *data.offset(index) };
-            unsafe { send_value(writer, arg_tag, &mut data)? };
-        } else {
-            break
-        }
-    }
-    writer.write_u8(0)?;
-    writer.write_bytes(return_tag_bytes)?;
-
-    Ok(())
-}
-
-mod tag {
-    use core::fmt;
-
-    pub fn split_tag(tag_bytes: &[u8]) -> (&[u8], &[u8]) {
-        let tag_separator =
-            tag_bytes.iter()
-                     .position(|&b| b == b':')
-                     .expect("tag without a return separator");
-        let (arg_tags_bytes, rest) = tag_bytes.split_at(tag_separator);
-        let return_tag_bytes = &rest[1..];
-        (arg_tags_bytes, return_tag_bytes)
-    }
-
-    #[derive(Debug, Clone, Copy)]
-    pub enum Tag<'a> {
-        None,
-        Bool,
-        Int32,
-        Int64,
-        Float64,
-        String,
-        Bytes,
-        ByteArray,
-        Tuple(TagIterator<'a>, u8),
-        List(TagIterator<'a>),
-        Array(TagIterator<'a>, u8),
-        Range(TagIterator<'a>),
-        Keyword(TagIterator<'a>),
-        Object
-    }
-
-    impl<'a> Tag<'a> {
-        pub fn as_u8(self) -> u8 {
-            match self {
-                Tag::None => b'n',
-                Tag::Bool => b'b',
-                Tag::Int32 => b'i',
-                Tag::Int64 => b'I',
-                Tag::Float64 => b'f',
-                Tag::String => b's',
-                Tag::Bytes => b'B',
-                Tag::ByteArray => b'A',
-                Tag::Tuple(_, _) => b't',
-                Tag::List(_) => b'l',
-                Tag::Array(_, _) => b'a',
-                Tag::Range(_) => b'r',
-                Tag::Keyword(_) => b'k',
-                Tag::Object => b'O',
-            }
-        }
-
-        pub fn alignment(self) -> usize {
-            use cslice::CSlice;
-            match self {
-                Tag::None => 1,
-                Tag::Bool => core::mem::align_of::<u8>(),
-                Tag::Int32 => core::mem::align_of::<i32>(),
-                Tag::Int64 => core::mem::align_of::<i64>(),
-                Tag::Float64 => core::mem::align_of::<f64>(),
-                // struct type: align to largest element
-                Tag::Tuple(it, arity) => {
-                    let it = it.clone();
-                    it.take(arity.into()).map(|t| t.alignment()).max().unwrap()
-                },
-                Tag::Range(it) => {
-                    let it = it.clone();
-                    it.take(3).map(|t| t.alignment()).max().unwrap()
-                }
-                // CSlice basically
-                Tag::Bytes | Tag::String | Tag::ByteArray =>
-                    core::mem::align_of::<CSlice<()>>(),
-                // array buffer is allocated, so no need for alignment first
-                Tag::List(_) | Tag::Array(_, _) => 1,
-                // will not be sent from the host
-                _ => unreachable!("unexpected tag from host")
-            }
-        }
-
-        pub fn size(self) -> usize {
-            use super::alignment_offset;
-            match self {
-                Tag::None => 0,
-                Tag::Bool => 1,
-                Tag::Int32 => 4,
-                Tag::Int64 => 8,
-                Tag::Float64 => 8,
-                Tag::String => 8,
-                Tag::Bytes => 8,
-                Tag::ByteArray => 8,
-                Tag::Tuple(it, arity) => {
-                    let mut size = 0;
-                    let mut it = it.clone();
-                    for _ in 0..arity {
-                        let tag = it.next().expect("truncated tag");
-                        size += tag.size();
-                        // includes padding
-                        size += alignment_offset(tag.alignment() as isize, size as isize) as usize;
-                    }
-                    size
-                }
-                Tag::List(_) => 4,
-                Tag::Array(_, num_dims) => 4 * (1 + num_dims as usize),
-                Tag::Range(it) => {
-                    let tag = it.clone().next().expect("truncated tag");
-                    tag.size() * 3
-                }
-                Tag::Keyword(_) => unreachable!(),
-                Tag::Object => unreachable!(),
-            }
-        }
-    }
-
-    #[derive(Debug, Clone, Copy)]
-    pub struct TagIterator<'a> {
-        data: &'a [u8]
-    }
-
-    impl<'a> TagIterator<'a> {
-        pub fn new(data: &'a [u8]) -> TagIterator<'a> {
-            TagIterator { data }
-        }
-
-
-        fn sub(&mut self, count: u8) -> TagIterator<'a> {
-            let data = self.data;
-            for _ in 0..count {
-                self.next().expect("truncated tag");
-            }
-            TagIterator { data: &data[..(data.len() - self.data.len())] }
-        }
-    }
-
-    impl<'a> core::iter::Iterator for TagIterator<'a> {
-        type Item = Tag<'a>;
-
-        fn next(&mut self) -> Option<Tag<'a>> {
-            if self.data.len() == 0 {
-                return None
-            }
-
-            let tag_byte = self.data[0];
-            self.data = &self.data[1..];
-            Some(match tag_byte {
-                b'n' => Tag::None,
-                b'b' => Tag::Bool,
-                b'i' => Tag::Int32,
-                b'I' => Tag::Int64,
-                b'f' => Tag::Float64,
-                b's' => Tag::String,
-                b'B' => Tag::Bytes,
-                b'A' => Tag::ByteArray,
-                b't' => {
-                    let count = self.data[0];
-                    self.data = &self.data[1..];
-                    Tag::Tuple(self.sub(count), count)
-                }
-                b'l' => Tag::List(self.sub(1)),
-                b'a' => {
-                    let count = self.data[0];
-                    self.data = &self.data[1..];
-                    Tag::Array(self.sub(1), count)
-                }
-                b'r' => Tag::Range(self.sub(1)),
-                b'k' => Tag::Keyword(self.sub(1)),
-                b'O' => Tag::Object,
-                _    => unreachable!()
-            })
-        }
-    }
-
-    impl<'a> fmt::Display for TagIterator<'a> {
-        fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
-            let mut it = self.clone();
-            let mut first = true;
-            while let Some(tag) = it.next() {
-                if first {
-                    first = false
-                } else {
-                    write!(f, ", ")?
-                }
-
-                match tag {
-                    Tag::None =>
-                        write!(f, "None")?,
-                    Tag::Bool =>
-                        write!(f, "Bool")?,
-                    Tag::Int32 =>
-                        write!(f, "Int32")?,
-                    Tag::Int64 =>
-                        write!(f, "Int64")?,
-                    Tag::Float64 =>
-                        write!(f, "Float64")?,
-                    Tag::String =>
-                        write!(f, "String")?,
-                    Tag::Bytes =>
-                        write!(f, "Bytes")?,
-                    Tag::ByteArray =>
-                        write!(f, "ByteArray")?,
-                    Tag::Tuple(it, _) => {
-                        write!(f, "Tuple(")?;
-                        it.fmt(f)?;
-                        write!(f, ")")?;
-                    }
-                    Tag::List(it) => {
-                        write!(f, "List(")?;
-                        it.fmt(f)?;
-                        write!(f, ")")?;
-                    }
-                    Tag::Array(it, num_dims) => {
-                        write!(f, "Array(")?;
-                        it.fmt(f)?;
-                        write!(f, ", {})", num_dims)?;
-                    }
-                    Tag::Range(it) => {
-                        write!(f, "Range(")?;
-                        it.fmt(f)?;
-                        write!(f, ")")?;
-                    }
-                    Tag::Keyword(it) => {
-                        write!(f, "Keyword(")?;
-                        it.fmt(f)?;
-                        write!(f, ")")?;
-                    }
-                    Tag::Object =>
-                        write!(f, "Object")?,
-                }
-            }
-
-            Ok(())
-        }
-    }
-}

src/runtime/src/rpc_async.rs

@@ -0,0 +1,197 @@
+use alloc::boxed::Box;
+use core::future::Future;
+
+use async_recursion::async_recursion;
+use byteorder::{ByteOrder, NativeEndian};
+use cslice::CMutSlice;
+use ksupport::rpc::{tag::{Tag, TagIterator},
+                    *};
+use libasync::smoltcp::TcpStream;
+use libboard_zynq::smoltcp;
+use log::trace;
+
+use crate::proto_async;
+
+/// Reads (deserializes) `length` array or list elements of type `tag` from `stream`,
+/// writing them into the buffer given by `storage`.
+///
+/// `alloc` is used for nested allocations (if elements themselves contain
+/// lists/arrays), see [recv_value].
+#[async_recursion(?Send)]
+async unsafe fn recv_elements<F>(
+    stream: &TcpStream,
+    elt_tag: Tag<'async_recursion>,
+    length: usize,
+    storage: *mut (),
+    alloc: &(impl Fn(usize) -> F + 'async_recursion),
+) -> Result<(), smoltcp::Error>
+where
+    F: Future<Output = *mut ()>,
+{
+    // List of simple types are special-cased in the protocol for performance.
+    match elt_tag {
+        Tag::Bool => {
+            let dest = core::slice::from_raw_parts_mut(storage as *mut u8, length);
+            proto_async::read_chunk(stream, dest).await?;
+        }
+        Tag::Int32 => {
+            let ptr = storage as *mut u32;
+            let dest = core::slice::from_raw_parts_mut(ptr as *mut u8, length * 4);
+            proto_async::read_chunk(stream, dest).await?;
+            drop(dest);
+            let dest = core::slice::from_raw_parts_mut(ptr, length);
+            NativeEndian::from_slice_u32(dest);
+        }
+        Tag::Int64 | Tag::Float64 => {
+            let ptr = storage as *mut u64;
+            let dest = core::slice::from_raw_parts_mut(ptr as *mut u8, length * 8);
+            proto_async::read_chunk(stream, dest).await?;
+            drop(dest);
+            let dest = core::slice::from_raw_parts_mut(ptr, length);
+            NativeEndian::from_slice_u64(dest);
+        }
+        _ => {
+            let mut data = storage;
+            for _ in 0..length {
+                recv_value(stream, elt_tag, &mut data, alloc).await?
+            }
+        }
+    }
+    Ok(())
+}
+
+/// Reads (deserializes) a value of type `tag` from `stream`, writing the results to
+/// the kernel-side buffer `data` (the passed pointer to which is incremented to point
+/// past the just-received data). For nested allocations (lists/arrays), `alloc` is
+/// invoked any number of times with the size of the required allocation as a parameter
+/// (which is assumed to be correctly aligned for all payload types).
+#[async_recursion(?Send)]
+async unsafe fn recv_value<F>(
+    stream: &TcpStream,
+    tag: Tag<'async_recursion>,
+    data: &mut *mut (),
+    alloc: &(impl Fn(usize) -> F + 'async_recursion),
+) -> Result<(), smoltcp::Error>
+where
+    F: Future<Output = *mut ()>,
+{
+    macro_rules! consume_value {
+        ($ty:ty, | $ptr:ident | $map:expr) => {{
+            let $ptr = align_ptr_mut::<$ty>(*data);
+            *data = $ptr.offset(1) as *mut ();
+            $map
+        }};
+    }
+
+    match tag {
+        Tag::None => Ok(()),
+        Tag::Bool => consume_value!(i8, |ptr| {
+            *ptr = proto_async::read_i8(stream).await?;
+            Ok(())
+        }),
+        Tag::Int32 => consume_value!(i32, |ptr| {
+            *ptr = proto_async::read_i32(stream).await?;
+            Ok(())
+        }),
+        Tag::Int64 | Tag::Float64 => consume_value!(i64, |ptr| {
+            *ptr = proto_async::read_i64(stream).await?;
+            Ok(())
+        }),
+        Tag::String | Tag::Bytes | Tag::ByteArray => {
+            consume_value!(CMutSlice<u8>, |ptr| {
+                let length = proto_async::read_i32(stream).await? as usize;
+                *ptr = CMutSlice::new(alloc(length).await as *mut u8, length);
+                proto_async::read_chunk(stream, (*ptr).as_mut()).await?;
+                Ok(())
+            })
+        }
+        Tag::Tuple(it, arity) => {
+            let alignment = tag.alignment();
+            *data = round_up_mut(*data, alignment);
+            let mut it = it.clone();
+            for _ in 0..arity {
+                let tag = it.next().expect("truncated tag");
+                recv_value(stream, tag, data, alloc).await?
+            }
+            // Take into account any tail padding (if element(s) with largest alignment
+            // are not at the end).
+            *data = round_up_mut(*data, alignment);
+            Ok(())
+        }
+        Tag::List(it) => {
+            #[repr(C)]
+            struct List {
+                elements: *mut (),
+                length: usize,
+            }
+            consume_value!(*mut List, |ptr_to_list| {
+                let tag = it.clone().next().expect("truncated tag");
+                let length = proto_async::read_i32(stream).await? as usize;
+
+                // To avoid multiple kernel CPU roundtrips, use a single allocation for
+                // both the pointer/length List (slice) and the backing storage for the
+                // elements. We can assume that alloc() is aligned suitably, so just
+                // need to take into account any extra padding required.
+                // (Note: At the time of writing, there will never actually be any types
+                // with alignment larger than 8 bytes, so storage_offset == 0 always.)
+                let list_size = 4 + 4;
+                let storage_offset = round_up(list_size, tag.alignment());
+                let storage_size = tag.size() * length;
+
+                let allocation = alloc(storage_offset + storage_size).await as *mut u8;
+                *ptr_to_list = allocation as *mut List;
+                let storage = allocation.offset(storage_offset as isize) as *mut ();
+
+                (**ptr_to_list).length = length;
+                (**ptr_to_list).elements = storage;
+                recv_elements(stream, tag, length, storage, alloc).await
+            })
+        }
+        Tag::Array(it, num_dims) => {
+            consume_value!(*mut (), |buffer| {
+                // Deserialize length along each dimension and compute total number of
+                // elements.
+                let mut total_len: usize = 1;
+                for _ in 0..num_dims {
+                    let len = proto_async::read_i32(stream).await? as usize;
+                    total_len *= len;
+                    consume_value!(usize, |ptr| *ptr = len)
+                }
+
+                // Allocate backing storage for elements; deserialize them.
+                let elt_tag = it.clone().next().expect("truncated tag");
+                *buffer = alloc(elt_tag.size() * total_len).await;
+                recv_elements(stream, elt_tag, total_len, *buffer, alloc).await
+            })
+        }
+        Tag::Range(it) => {
+            *data = round_up_mut(*data, tag.alignment());
+            let tag = it.clone().next().expect("truncated tag");
+            recv_value(stream, tag, data, alloc).await?;
+            recv_value(stream, tag, data, alloc).await?;
+            recv_value(stream, tag, data, alloc).await?;
+            Ok(())
+        }
+        Tag::Keyword(_) => unreachable!(),
+        Tag::Object => unreachable!(),
+    }
+}
+
+pub async fn recv_return<F>(
+    stream: &TcpStream,
+    tag_bytes: &[u8],
+    data: *mut (),
+    alloc: &impl Fn(usize) -> F,
+) -> Result<(), smoltcp::Error>
+where
+    F: Future<Output = *mut ()>,
+{
+    let mut it = TagIterator::new(tag_bytes);
+    trace!("recv ...->{}", it);
+
+    let tag = it.next().expect("truncated tag");
+    let mut data = data;
+    unsafe { recv_value(stream, tag, &mut data, alloc).await? };
+
+    Ok(())
+}

src/runtime/src/rtio_clocking.rs

@@ -1,14 +1,20 @@
-use log::{info, warn, error};
+#[cfg(not(feature = "target_ebaz4205"))]
-use libboard_zynq::timer::GlobalTimer;
 use embedded_hal::blocking::delay::DelayMs;
-use libconfig::Config;
+#[cfg(has_si5324)]
+use ksupport::i2c;
+#[cfg(not(feature = "target_ebaz4205"))]
 use libboard_artiq::pl;
 #[cfg(has_si5324)]
-use libboard_zynq::i2c::I2c;
-#[cfg(has_si5324)]
-use crate::i2c;
-#[cfg(has_si5324)]
 use libboard_artiq::si5324;
+#[cfg(has_si549)]
+use libboard_artiq::si549;
+#[cfg(has_si5324)]
+use libboard_zynq::i2c::I2c;
+use libboard_zynq::timer::GlobalTimer;
+use libconfig::Config;
+use log::{info, warn};
+#[cfg(feature = "target_ebaz4205")]
+use {libboard_zynq::slcr, libregister::RegisterRW};
 
 #[derive(Debug, PartialEq, Copy, Clone)]
 #[allow(non_camel_case_types)]
@@ -19,6 +25,7 @@ pub enum RtioClock {
     Int_150,
     Ext0_Bypass,
     Ext0_Synth0_10to125,
+    Ext0_Synth0_80to125,
     Ext0_Synth0_100to125,
     Ext0_Synth0_125to125,
 }
@@ -35,24 +42,24 @@ fn get_rtio_clock_cfg(cfg: &Config) -> RtioClock {
             "ext0_bypass_125" => RtioClock::Ext0_Bypass,
             "ext0_bypass_100" => RtioClock::Ext0_Bypass,
             "ext0_synth0_10to125" => RtioClock::Ext0_Synth0_10to125,
+            "ext0_synth0_80to125" => RtioClock::Ext0_Synth0_80to125,
             "ext0_synth0_100to125" => RtioClock::Ext0_Synth0_100to125,
             "ext0_synth0_125to125" => RtioClock::Ext0_Synth0_125to125,
-            _ => { 
+            _ => {
                 warn!("Unrecognised rtio_clock setting. Falling back to default.");
-                RtioClock::Default 
+                RtioClock::Default
             }
         };
-    }
+    } else {
-    else {
         warn!("error reading configuration. Falling back to default.");
     }
     if res == RtioClock::Default {
-        #[cfg(rtio_frequency="100.0")]
+        #[cfg(rtio_frequency = "100.0")]
         {
             warn!("Using default configuration - internal 100MHz RTIO clock.");
             return RtioClock::Int_100;
         }
-        #[cfg(rtio_frequency="125.0")]
+        #[cfg(rtio_frequency = "125.0")]
         {
             warn!("Using default configuration - internal 125MHz RTIO clock.");
             return RtioClock::Int_125;
@@ -66,189 +73,422 @@ fn get_rtio_clock_cfg(cfg: &Config) -> RtioClock {
     res
 }
 
-
+#[cfg(not(any(has_drtio, feature = "target_ebaz4205")))]
-fn init_rtio(timer: &mut GlobalTimer, _clk: RtioClock) {
+fn init_rtio(timer: &mut GlobalTimer) {
-    #[cfg(has_rtio_crg_clock_sel)]
+    info!("Switching SYS clocks...");
-    let clock_sel = match _clk {
-        RtioClock::Ext0_Bypass => { 
-            info!("Using bypassed external clock");
-            1
-        },
-        RtioClock::Int_125 => {
-            info!("Using internal RTIO clock");
-            0
-        },
-        _ => {
-            warn!("rtio_clock setting '{:?}' is not supported. Using default internal RTIO clock instead", _clk);
-            0
-        }
-    };
-
     unsafe {
-        pl::csr::rtio_crg::pll_reset_write(1);
+        pl::csr::sys_crg::clock_switch_write(1);
-        #[cfg(has_rtio_crg_clock_sel)]
-        pl::csr::rtio_crg::clock_sel_write(clock_sel);
-        pl::csr::rtio_crg::pll_reset_write(0);
-    }
-    timer.delay_ms(1);
-    let locked = unsafe { pl::csr::rtio_crg::pll_locked_read() != 0 };
-    if locked {
-        info!("RTIO PLL locked");
-    } else {
-        error!("RTIO PLL failed to lock");
     }
+    // if it's not locked, it will hang at the CSR.
 
+    timer.delay_ms(50); // wait for CPLL/QPLL/SYS PLL lock
+    let clk = unsafe { pl::csr::sys_crg::current_clock_read() };
+    if clk == 1 {
+        info!("SYS CLK switched successfully");
+    } else {
+        panic!("SYS CLK did not switch");
+    }
     unsafe {
         pl::csr::rtio_core::reset_phy_write(1);
     }
+    info!("SYS PLL locked");
 }
 
 #[cfg(has_drtio)]
-fn init_drtio(timer: &mut GlobalTimer)
+fn init_drtio(timer: &mut GlobalTimer) {
-{
     unsafe {
-        pl::csr::drtio_transceiver::stable_clkin_write(1);
+        pl::csr::gt_drtio::stable_clkin_write(1);
+    }
+
+    timer.delay_ms(50); // wait for CPLL/QPLL/SYS PLL lock
+    let clk = unsafe { pl::csr::sys_crg::current_clock_read() };
+    if clk == 1 {
+        info!("SYS CLK switched successfully");
+    } else {
+        panic!("SYS CLK did not switch");
     }
-    timer.delay_ms(2); // wait for CPLL/QPLL lock
     unsafe {
-        pl::csr::drtio_transceiver::txenable_write(0xffffffffu32 as _);
+        pl::csr::rtio_core::reset_phy_write(1);
+        pl::csr::gt_drtio::txenable_write(0xffffffffu32 as _);
+
+        #[cfg(has_drtio_eem)]
+        pl::csr::eem_transceiver::txenable_write(0xffffffffu32 as _);
     }
 }
 
+// Si5324 input to select for locking to an external clock.
+#[cfg(has_si5324)]
+const SI5324_EXT_INPUT: si5324::Input = si5324::Input::Ckin1;
+
 #[cfg(has_si5324)]
 fn setup_si5324(i2c: &mut I2c, timer: &mut GlobalTimer, clk: RtioClock) {
     let (si5324_settings, si5324_ref_input) = match clk {
-        RtioClock::Ext0_Synth0_10to125 => { // 125 MHz output from 10 MHz CLKINx reference, 504 Hz BW
+        RtioClock::Ext0_Synth0_10to125 => {
+            // 125 MHz output from 10 MHz CLKINx reference, 504 Hz BW
             info!("using 10MHz reference to make 125MHz RTIO clock with PLL");
             (
                 si5324::FrequencySettings {
-                    n1_hs  : 10,
+                    n1_hs: 10,
-                    nc1_ls : 4,
+                    nc1_ls: 4,
-                    n2_hs  : 10,
+                    n2_hs: 10,
-                    n2_ls  : 300,
+                    n2_ls: 300,
-                    n31    : 6,
+                    n31: 6,
-                    n32    : 6,
+                    n32: 6,
-                    bwsel  : 4,
+                    bwsel: 4,
-                    crystal_ref: false
+                    crystal_as_ckin2: false,
                 },
-                si5324::Input::Ckin1
+                SI5324_EXT_INPUT,
             )
-        },
+        }
-        RtioClock::Ext0_Synth0_100to125 => { // 125MHz output, from 100MHz CLKINx reference, 586 Hz loop bandwidth
+        RtioClock::Ext0_Synth0_80to125 => {
+            // 125 MHz output from 80 MHz CLKINx reference, 611 Hz BW
+            info!("using 80MHz reference to make 125MHz RTIO clock with PLL");
+            (
+                si5324::FrequencySettings {
+                    n1_hs: 4,
+                    nc1_ls: 10,
+                    n2_hs: 10,
+                    n2_ls: 250,
+                    n31: 40,
+                    n32: 40,
+                    bwsel: 4,
+                    crystal_as_ckin2: false,
+                },
+                SI5324_EXT_INPUT,
+            )
+        }
+        RtioClock::Ext0_Synth0_100to125 => {
+            // 125MHz output, from 100MHz CLKINx reference, 586 Hz loop bandwidth
             info!("using 100MHz reference to make 125MHz RTIO clock with PLL");
             (
                 si5324::FrequencySettings {
-                    n1_hs  : 10,
+                    n1_hs: 10,
-                    nc1_ls : 4,
+                    nc1_ls: 4,
-                    n2_hs  : 10,
+                    n2_hs: 10,
-                    n2_ls  : 260,
+                    n2_ls: 260,
-                    n31    : 52,
+                    n31: 52,
-                    n32    : 52,
+                    n32: 52,
-                    bwsel  : 4,
+                    bwsel: 4,
-                    crystal_ref: false
+                    crystal_as_ckin2: false,
                 },
-                si5324::Input::Ckin1
+                SI5324_EXT_INPUT,
             )
-        },
+        }
-        RtioClock::Ext0_Synth0_125to125 => { // 125MHz output, from 125MHz CLKINx reference, 606 Hz loop bandwidth
+        RtioClock::Ext0_Synth0_125to125 => {
+            // 125MHz output, from 125MHz CLKINx reference, 606 Hz loop bandwidth
             info!("using 125MHz reference to make 125MHz RTIO clock with PLL");
             (
                 si5324::FrequencySettings {
-                    n1_hs  : 5,
+                    n1_hs: 5,
-                    nc1_ls : 8,
+                    nc1_ls: 8,
-                    n2_hs  : 7,
+                    n2_hs: 7,
-                    n2_ls  : 360,
+                    n2_ls: 360,
-                    n31    : 63,
+                    n31: 63,
-                    n32    : 63,
+                    n32: 63,
-                    bwsel  : 4,
+                    bwsel: 4,
-                    crystal_ref: false
+                    crystal_as_ckin2: false,
                 },
-                si5324::Input::Ckin1
+                SI5324_EXT_INPUT,
             )
-        },
+        }
-        RtioClock::Int_150 => { // 150MHz output, from crystal
+        RtioClock::Int_150 => {
+            // 150MHz output, from crystal
             info!("using internal 150MHz RTIO clock");
             (
                 si5324::FrequencySettings {
-                    n1_hs  : 9,
+                    n1_hs: 9,
-                    nc1_ls : 4,
+                    nc1_ls: 4,
-                    n2_hs  : 10,
+                    n2_hs: 10,
-                    n2_ls  : 33732,
+                    n2_ls: 33732,
-                    n31    : 7139,
+                    n31: 7139,
-                    n32    : 7139,
+                    n32: 7139,
-                    bwsel  : 3,
+                    bwsel: 3,
-                    crystal_ref: true
+                    crystal_as_ckin2: true,
                 },
-                si5324::Input::Ckin2
+                si5324::Input::Ckin2,
             )
-        },
+        }
-        RtioClock::Int_100 => { // 100MHz output, from crystal.
+        RtioClock::Int_100 => {
+            // 100MHz output, from crystal
             info!("using internal 100MHz RTIO clock");
             (
                 si5324::FrequencySettings {
-                    n1_hs  : 9,
+                    n1_hs: 9,
-                    nc1_ls : 6,
+                    nc1_ls: 6,
-                    n2_hs  : 10,
+                    n2_hs: 10,
-                    n2_ls  : 33732,
+                    n2_ls: 33732,
-                    n31    : 7139,
+                    n31: 7139,
-                    n32    : 7139,
+                    n32: 7139,
-                    bwsel  : 3,
+                    bwsel: 3,
-                    crystal_ref: true
+                    crystal_as_ckin2: true,
                 },
-                si5324::Input::Ckin2
+                si5324::Input::Ckin2,
             )
-        },
+        }
-        RtioClock::Int_125 => { // 125MHz output, from crystal, 7 Hz
+        RtioClock::Int_125 => {
+            // 125MHz output, from crystal, 7 Hz
             info!("using internal 125MHz RTIO clock");
             (
                 si5324::FrequencySettings {
-                    n1_hs  : 10,
+                    n1_hs: 10,
-                    nc1_ls : 4,
+                    nc1_ls: 4,
-                    n2_hs  : 10,
+                    n2_hs: 10,
-                    n2_ls  : 19972,
+                    n2_ls: 19972,
-                    n31    : 4565,
+                    n31: 4565,
-                    n32    : 4565,
+                    n32: 4565,
-                    bwsel  : 4,
+                    bwsel: 4,
-                    crystal_ref: true
+                    crystal_as_ckin2: true,
                 },
-                si5324::Input::Ckin2
+                si5324::Input::Ckin2,
             )
-        },
+        }
-        _ => { // same setting  as Int_125, but fallback to default
+        _ => {
-            warn!("rtio_clock setting '{:?}' is unsupported. Falling back to default internal 125MHz RTIO clock.", clk);
+            // same setting  as Int_125, but fallback to default
+            warn!(
+                "rtio_clock setting '{:?}' is unsupported. Falling back to default internal 125MHz RTIO clock.",
+                clk
+            );
             (
                 si5324::FrequencySettings {
-                    n1_hs  : 10,
+                    n1_hs: 10,
-                    nc1_ls : 4,
+                    nc1_ls: 4,
-                    n2_hs  : 10,
+                    n2_hs: 10,
-                    n2_ls  : 19972,
+                    n2_ls: 19972,
-                    n31    : 4565,
+                    n31: 4565,
-                    n32    : 4565,
+                    n32: 4565,
-                    bwsel  : 4,
+                    bwsel: 4,
-                    crystal_ref: true
+                    crystal_as_ckin2: true,
                 },
-                si5324::Input::Ckin2
+                si5324::Input::Ckin2,
             )
         }
     };
     si5324::setup(i2c, &si5324_settings, si5324_ref_input, timer).expect("cannot initialize Si5324");
 }
 
-pub fn init(timer: &mut GlobalTimer, cfg: &Config) {
+#[cfg(all(has_si549, has_wrpll))]
+fn wrpll_setup(timer: &mut GlobalTimer, clk: RtioClock, si549_settings: &si549::FrequencySetting) {
+    // register values are directly copied from preconfigured mmcm
+    let (mmcm_setting, mmcm_bypass) = match clk {
+        RtioClock::Ext0_Synth0_10to125 => (
+            si549::wrpll_refclk::MmcmSetting {
+                // CLKFBOUT_MULT = 62.5, DIVCLK_DIVIDE = 1 , CLKOUT0_DIVIDE = 5
+                clkout0_reg1: 0x1083,
+                clkout0_reg2: 0x0080,
+                clkfbout_reg1: 0x179e,
+                clkfbout_reg2: 0x4c00,
+                div_reg: 0x1041,
+                lock_reg1: 0x00fa,
+                lock_reg2: 0x7c01,
+                lock_reg3: 0xffe9,
+                power_reg: 0x9900,
+                filt_reg1: 0x1008,
+                filt_reg2: 0x8800,
+            },
+            false,
+        ),
+        RtioClock::Ext0_Synth0_80to125 => (
+            si549::wrpll_refclk::MmcmSetting {
+                // CLKFBOUT_MULT = 15.625, DIVCLK_DIVIDE = 1 , CLKOUT0_DIVIDE = 10
+                clkout0_reg1: 0x1145,
+                clkout0_reg2: 0x0000,
+                clkfbout_reg1: 0x11c7,
+                clkfbout_reg2: 0x5880,
+                div_reg: 0x1041,
+                lock_reg1: 0x028a,
+                lock_reg2: 0x7c01,
+                lock_reg3: 0xffe9,
+                power_reg: 0x9900,
+                filt_reg1: 0x9908,
+                filt_reg2: 0x8100,
+            },
+            false,
+        ),
+        RtioClock::Ext0_Synth0_100to125 => (
+            si549::wrpll_refclk::MmcmSetting {
+                // CLKFBOUT_MULT = 12.5, DIVCLK_DIVIDE = 1 , CLKOUT0_DIVIDE = 10
+                clkout0_reg1: 0x1145,
+                clkout0_reg2: 0x0000,
+                clkfbout_reg1: 0x1145,
+                clkfbout_reg2: 0x4c00,
+                div_reg: 0x1041,
+                lock_reg1: 0x0339,
+                lock_reg2: 0x7c01,
+                lock_reg3: 0xffe9,
+                power_reg: 0x9900,
+                filt_reg1: 0x9108,
+                filt_reg2: 0x0100,
+            },
+            false,
+        ),
+        RtioClock::Ext0_Synth0_125to125 => (
+            si549::wrpll_refclk::MmcmSetting {
+                // CLKFBOUT_MULT = 10, DIVCLK_DIVIDE = 1 , CLKOUT0_DIVIDE = 10
+                clkout0_reg1: 0x1145,
+                clkout0_reg2: 0x0000,
+                clkfbout_reg1: 0x1145,
+                clkfbout_reg2: 0x0000,
+                div_reg: 0x1041,
+                lock_reg1: 0x03e8,
+                lock_reg2: 0x7001,
+                lock_reg3: 0xf3e9,
+                power_reg: 0x0100,
+                filt_reg1: 0x9908,
+                filt_reg2: 0x1100,
+            },
+            true,
+        ),
+        _ => unreachable!(),
+    };
 
+    si549::helper_setup(timer, &si549_settings).expect("cannot initialize helper Si549");
+    si549::wrpll_refclk::setup(timer, mmcm_setting, mmcm_bypass).expect("cannot initialize ref clk for wrpll");
+    si549::wrpll::select_recovered_clock(true, timer);
+}
+
+#[cfg(has_si549)]
+fn get_si549_setting(clk: RtioClock) -> si549::FrequencySetting {
+    match clk {
+        RtioClock::Ext0_Synth0_10to125 => {
+            info!("using 10MHz reference to make 125MHz RTIO clock with WRPLL");
+        }
+        RtioClock::Ext0_Synth0_80to125 => {
+            info!("using 80MHz reference to make 125MHz RTIO clock with WRPLL");
+        }
+        RtioClock::Ext0_Synth0_100to125 => {
+            info!("using 100MHz reference to make 125MHz RTIO clock with WRPLL");
+        }
+        RtioClock::Ext0_Synth0_125to125 => {
+            info!("using 125MHz reference to make 125MHz RTIO clock with WRPLL");
+        }
+        RtioClock::Int_100 => {
+            info!("using internal 100MHz RTIO clock");
+        }
+        RtioClock::Int_125 => {
+            info!("using internal 125MHz RTIO clock");
+        }
+        _ => {
+            warn!(
+                "rtio_clock setting '{:?}' is unsupported. Falling back to default internal 125MHz RTIO clock.",
+                clk
+            );
+        }
+    };
+
+    match clk {
+        RtioClock::Int_100 => {
+            si549::FrequencySetting {
+                main: si549::DividerConfig {
+                    hsdiv: 0x06C,
+                    lsdiv: 0,
+                    fbdiv: 0x046C5F49797,
+                },
+                helper: si549::DividerConfig {
+                    // 100MHz*32767/32768
+                    hsdiv: 0x06C,
+                    lsdiv: 0,
+                    fbdiv: 0x046C5670BBD,
+                },
+            }
+        }
+        _ => {
+            // Everything else use 125MHz
+            si549::FrequencySetting {
+                main: si549::DividerConfig {
+                    hsdiv: 0x058,
+                    lsdiv: 0,
+                    fbdiv: 0x04815791F25,
+                },
+                helper: si549::DividerConfig {
+                    // 125MHz*32767/32768
+                    hsdiv: 0x058,
+                    lsdiv: 0,
+                    fbdiv: 0x04814E8F442,
+                },
+            }
+        }
+    }
+}
+
+#[cfg(feature = "target_ebaz4205")]
+fn set_fclk0_freq(clk: RtioClock, cfg: &Config) {
+    let io_pll_freq: u32 = 1_000_000_000; // Hardcoded in zynq-rs
+    let mut target_freq = 0;
+    let mut divisor0 = 1u8;
+
+    match clk {
+        RtioClock::Int_100 => {
+            target_freq = 100_000_000;
+            divisor0 = 10;
+        }
+        RtioClock::Int_125 => {
+            target_freq = 125_000_000;
+            divisor0 = 8;
+        }
+        _ => {
+            warn!("Unsupported RTIO Clock: '{:?}'", clk);
+            return;
+        }
+    }
+
+    slcr::RegisterBlock::unlocked(|slcr| {
+        slcr.fpga0_clk_ctrl.modify(|_, w| w.divisor0(divisor0));
+    });
+
+    info!(
+        "Set FCLK0 to {:.2} MHz (target: {} MHz).",
+        io_pll_freq as f64 / divisor0 as f64,
+        target_freq / 1_000_000
+    );
+}
+
+pub fn init(timer: &mut GlobalTimer, cfg: &Config) {
     let clk = get_rtio_clock_cfg(cfg);
     #[cfg(has_si5324)]
     {
         let i2c = unsafe { (&mut i2c::I2C_BUS).as_mut().unwrap() };
-        let si5324_ext_input = si5324::Input::Ckin1;
         match clk {
-            RtioClock::Ext0_Bypass => si5324::bypass(i2c, si5324_ext_input, timer).expect("cannot bypass Si5324"),
+            RtioClock::Ext0_Bypass => {
+                info!("bypassing the PLL for RTIO clock");
+                si5324::bypass(i2c, SI5324_EXT_INPUT, timer).expect("cannot bypass Si5324")
+            }
             _ => setup_si5324(i2c, timer, clk),
         }
     }
+
+    #[cfg(has_si549)]
+    let si549_settings = get_si549_setting(clk);
+
+    #[cfg(has_si549)]
+    si549::main_setup(timer, &si549_settings).expect("cannot initialize main Si549");
+
     #[cfg(has_drtio)]
     init_drtio(timer);
 
-    init_rtio(timer, clk);
+    #[cfg(not(any(has_drtio, feature = "target_ebaz4205")))]
+    init_rtio(timer);
 
-}
+    #[cfg(feature = "target_ebaz4205")]
+    {
+        match clk {
+            RtioClock::Int_100 | RtioClock::Int_125 => {
+                set_fclk0_freq(clk, cfg);
+            }
+            _ => {} // Not set for external clocks
+        }
+    }
+
+    #[cfg(all(has_si549, has_wrpll))]
+    {
+        // SYS CLK switch will reset CSRs that are used by WRPLL
+        match clk {
+            RtioClock::Ext0_Synth0_10to125
+            | RtioClock::Ext0_Synth0_80to125
+            | RtioClock::Ext0_Synth0_100to125
+            | RtioClock::Ext0_Synth0_125to125 => {
+                wrpll_setup(timer, clk, &si549_settings);
+            }
+            _ => {}
+        }
+    }
+}

src/runtime/src/rtio_csr.rs

@@ -1,213 +0,0 @@
-use core::ptr::{read_volatile, write_volatile};
-use cslice::CSlice;
-
-use crate::artiq_raise;
-
-use crate::pl::csr;
-
-pub const RTIO_O_STATUS_WAIT:                      u8 = 1;
-pub const RTIO_O_STATUS_UNDERFLOW:                 u8 = 2;
-pub const RTIO_O_STATUS_DESTINATION_UNREACHABLE:   u8 = 4;
-pub const RTIO_I_STATUS_WAIT_EVENT:                u8 = 1;
-pub const RTIO_I_STATUS_OVERFLOW:                  u8 = 2;
-pub const RTIO_I_STATUS_WAIT_STATUS:               u8 = 4;
-pub const RTIO_I_STATUS_DESTINATION_UNREACHABLE:   u8 = 8;
-
-#[repr(C)]
-pub struct TimestampedData {
-    timestamp: i64,
-    data: i32,
-}
-
-pub extern fn init() {
-    unsafe {
-        csr::rtio_core::reset_write(1);
-    }
-}
-
-pub extern fn get_counter() -> i64 {
-    unsafe {
-        csr::rtio::counter_update_write(1);
-        csr::rtio::counter_read() as i64
-    }
-}
-
-pub extern fn now_mu() -> i64 {
-    unsafe {
-        csr::rtio::now_read() as i64
-    }
-}
-
-pub extern fn at_mu(t: i64) {
-    unsafe {
-        csr::rtio::now_write(t as u64);
-    }
-}
-
-pub extern fn delay_mu(dt: i64) {
-    unsafe {
-        csr::rtio::now_write(csr::rtio::now_read() + dt as u64);
-    }
-}
-
-// writing the LSB of o_data (offset=0) triggers the RTIO write
-#[inline(always)]
-pub unsafe fn rtio_o_data_write(offset: usize, data: u32) {
-    write_volatile(
-        csr::rtio::O_DATA_ADDR.offset((csr::rtio::O_DATA_SIZE - 1 - offset) as isize),
-        data);
-}
-
-#[inline(always)]
-pub unsafe fn rtio_i_data_read(offset: usize) -> u32 {
-    read_volatile(
-        csr::rtio::I_DATA_ADDR.offset((csr::rtio::I_DATA_SIZE - 1 - offset) as isize))
-}
-
-#[inline(never)]
-unsafe fn process_exceptional_status(channel: i32, status: u8) {
-    let timestamp = csr::rtio::now_read() as i64;
-    if status & RTIO_O_STATUS_WAIT != 0 {
-        while csr::rtio::o_status_read() & RTIO_O_STATUS_WAIT != 0 {}
-    }
-    if status & RTIO_O_STATUS_UNDERFLOW != 0 {
-        artiq_raise!("RTIOUnderflow",
-            "RTIO underflow at {0} mu, channel {1}, slack {2} mu",
-            timestamp, channel as i64, timestamp - get_counter());
-    }
-    if status & RTIO_O_STATUS_DESTINATION_UNREACHABLE != 0 {
-        artiq_raise!("RTIODestinationUnreachable",
-            "RTIO destination unreachable, output, at {0} mu, channel {1}",
-            timestamp, channel as i64, 0);
-    }
-}
-
-pub extern fn output(target: i32, data: i32) {
-    unsafe {
-        csr::rtio::target_write(target as u32);
-        // writing target clears o_data
-        rtio_o_data_write(0, data as _);
-        let status = csr::rtio::o_status_read();
-        if status != 0 {
-            process_exceptional_status(target >> 8, status);
-        }
-    }
-}
-
-pub extern fn output_wide(target: i32, data: CSlice<i32>) {
-    unsafe {
-        csr::rtio::target_write(target as u32);
-        // writing target clears o_data
-        for i in (0..data.len()).rev() {
-            rtio_o_data_write(i, data[i] as _)
-        }
-        let status = csr::rtio::o_status_read();
-        if status != 0 {
-            process_exceptional_status(target >> 8, status);
-        }
-    }
-}
-
-pub extern fn input_timestamp(timeout: i64, channel: i32) -> i64 {
-    unsafe {
-        csr::rtio::target_write((channel as u32) << 8);
-        csr::rtio::i_timeout_write(timeout as u64);
-
-        let mut status = RTIO_I_STATUS_WAIT_STATUS;
-        while status & RTIO_I_STATUS_WAIT_STATUS != 0 {
-            status = csr::rtio::i_status_read();
-        }
-
-        if status & RTIO_I_STATUS_OVERFLOW != 0 {
-            artiq_raise!("RTIOOverflow",
-                         "RTIO input overflow on channel {0}",
-                         channel as i64, 0, 0);
-        }
-        if status & RTIO_I_STATUS_WAIT_EVENT != 0 {
-            return -1
-        }
-        if status & RTIO_I_STATUS_DESTINATION_UNREACHABLE != 0 {
-            artiq_raise!("RTIODestinationUnreachable",
-                         "RTIO destination unreachable, input, on channel {0}",
-                         channel as i64, 0, 0);
-        }
-
-        csr::rtio::i_timestamp_read() as i64
-    }
-}
-
-pub extern fn input_data(channel: i32) -> i32 {
-    unsafe {
-        csr::rtio::target_write((channel as u32) << 8);
-        csr::rtio::i_timeout_write(0xffffffff_ffffffff);
-
-        let mut status = RTIO_I_STATUS_WAIT_STATUS;
-        while status & RTIO_I_STATUS_WAIT_STATUS != 0 {
-            status = csr::rtio::i_status_read();
-        }
-
-        if status & RTIO_I_STATUS_OVERFLOW != 0 {
-            artiq_raise!("RTIOOverflow",
-                         "RTIO input overflow on channel {0}",
-                         channel as i64, 0, 0);
-        }
-        if status & RTIO_I_STATUS_DESTINATION_UNREACHABLE != 0 {
-            artiq_raise!("RTIODestinationUnreachable",
-                         "RTIO destination unreachable, input, on channel {0}",
-                         channel as i64, 0, 0);
-        }
-
-        rtio_i_data_read(0) as i32
-    }
-}
-
-pub extern fn input_timestamped_data(timeout: i64, channel: i32) -> TimestampedData {
-    unsafe {
-        csr::rtio::target_write((channel as u32) << 8);
-        csr::rtio::i_timeout_write(timeout as u64);
-
-        let mut status = RTIO_I_STATUS_WAIT_STATUS;
-        while status & RTIO_I_STATUS_WAIT_STATUS != 0 {
-            status = csr::rtio::i_status_read();
-        }
-
-        if status & RTIO_I_STATUS_OVERFLOW != 0 {
-            artiq_raise!("RTIOOverflow",
-                         "RTIO input overflow on channel {0}",
-                         channel as i64, 0, 0);
-        }
-        if status & RTIO_I_STATUS_WAIT_EVENT != 0 {
-            return TimestampedData { timestamp: -1, data: 0 }
-        }
-        if status & RTIO_I_STATUS_DESTINATION_UNREACHABLE != 0 {
-            artiq_raise!("RTIODestinationUnreachable",
-                         "RTIO destination unreachable, input, on channel {0}",
-                         channel as i64, 0, 0);
-        }
-
-        TimestampedData {
-            timestamp: csr::rtio::i_timestamp_read() as i64,
-            data: rtio_i_data_read(0) as i32
-        }
-    }
-}
-
-pub fn write_log(data: &[i8]) {
-    unsafe {
-        csr::rtio::target_write(csr::CONFIG_RTIO_LOG_CHANNEL << 8);
-
-        let mut word: u32 = 0;
-        for i in 0..data.len() {
-            word <<= 8;
-            word |= data[i] as u32;
-            if i % 4 == 3 {
-                rtio_o_data_write(0, word);
-                word = 0;
-            }
-        }
-
-        if word != 0 {
-            rtio_o_data_write(0, word);
-        }
-    }
-}

src/runtime/src/rtio_dma.rs

@@ -0,0 +1,361 @@
+use alloc::{collections::BTreeMap, rc::Rc, string::String, vec::Vec};
+#[cfg(has_drtio)]
+use core::mem;
+
+use ksupport::kernel::DmaRecorder;
+#[cfg(has_drtio)]
+use libasync::task;
+use libboard_artiq::drtio_routing::RoutingTable;
+use libboard_zynq::timer::GlobalTimer;
+use libcortex_a9::{cache::dcci_slice, mutex::Mutex};
+
+const ALIGNMENT: usize = 16 * 8;
+
+static DMA_RECORD_STORE: Mutex<BTreeMap<String, (u32, Vec<u8>, i64)>> = Mutex::new(BTreeMap::new());
+
+#[cfg(has_drtio)]
+pub mod remote_dma {
+    use libboard_zynq::time::Milliseconds;
+    use log::error;
+
+    use super::*;
+    use crate::rtio_mgt::drtio;
+
+    #[derive(Debug, PartialEq, Clone)]
+    pub enum RemoteState {
+        NotLoaded,
+        Loaded,
+        PlaybackEnded { error: u8, channel: u32, timestamp: u64 },
+    }
+    #[derive(Debug, Clone)]
+    struct RemoteTrace {
+        trace: Vec<u8>,
+        pub state: RemoteState,
+    }
+
+    impl From<Vec<u8>> for RemoteTrace {
+        fn from(trace: Vec<u8>) -> Self {
+            RemoteTrace {
+                trace: trace,
+                state: RemoteState::NotLoaded,
+            }
+        }
+    }
+
+    impl RemoteTrace {
+        pub fn get_trace(&self) -> &Vec<u8> {
+            &self.trace
+        }
+    }
+
+    // represents all traces for a given ID
+    struct TraceSet {
+        id: u32,
+        done_count: Mutex<usize>,
+        traces: Mutex<BTreeMap<u8, RemoteTrace>>,
+    }
+
+    impl TraceSet {
+        pub fn new(id: u32, traces: BTreeMap<u8, Vec<u8>>) -> TraceSet {
+            let mut trace_map: BTreeMap<u8, RemoteTrace> = BTreeMap::new();
+            for (destination, trace) in traces {
+                trace_map.insert(destination, trace.into());
+            }
+            TraceSet {
+                id: id,
+                done_count: Mutex::new(0),
+                traces: Mutex::new(trace_map),
+            }
+        }
+
+        pub async fn await_done(&self, timeout: Option<u64>, timer: GlobalTimer) -> Result<RemoteState, &'static str> {
+            let timeout_ms = Milliseconds(timeout.unwrap_or(10_000));
+            let limit = timer.get_time() + timeout_ms;
+            while (timer.get_time() < limit)
+                & (*(self.done_count.async_lock().await) < self.traces.async_lock().await.len())
+            {
+                task::r#yield().await;
+            }
+            if timer.get_time() >= limit {
+                error!("Remote DMA await done timed out");
+                return Err("Timed out waiting for results.");
+            }
+            let mut playback_state: RemoteState = RemoteState::PlaybackEnded {
+                error: 0,
+                channel: 0,
+                timestamp: 0,
+            };
+            let mut lock = self.traces.async_lock().await;
+            let trace_iter = lock.iter_mut();
+            for (_dest, trace) in trace_iter {
+                match trace.state {
+                    RemoteState::PlaybackEnded {
+                        error: e,
+                        channel: _c,
+                        timestamp: _ts,
+                    } => {
+                        if e != 0 {
+                            playback_state = trace.state.clone();
+                        }
+                    }
+                    _ => (),
+                }
+                trace.state = RemoteState::Loaded;
+            }
+            Ok(playback_state)
+        }
+
+        pub async fn upload_traces(
+            &mut self,
+            aux_mutex: &Rc<Mutex<bool>>,
+            routing_table: &RoutingTable,
+            timer: GlobalTimer,
+        ) {
+            let mut lock = self.traces.async_lock().await;
+            let trace_iter = lock.iter_mut();
+            for (destination, trace) in trace_iter {
+                match drtio::ddma_upload_trace(
+                    aux_mutex,
+                    routing_table,
+                    timer,
+                    self.id,
+                    *destination,
+                    trace.get_trace(),
+                )
+                .await
+                {
+                    Ok(_) => trace.state = RemoteState::Loaded,
+                    Err(e) => error!("Error adding DMA trace on destination {}: {}", destination, e),
+                }
+            }
+            *(self.done_count.async_lock().await) = 0;
+        }
+
+        pub async fn erase(&mut self, aux_mutex: &Rc<Mutex<bool>>, routing_table: &RoutingTable, timer: GlobalTimer) {
+            let lock = self.traces.async_lock().await;
+            let trace_iter = lock.keys();
+            for destination in trace_iter {
+                match drtio::ddma_send_erase(aux_mutex, routing_table, timer, self.id, *destination).await {
+                    Ok(_) => (),
+                    Err(e) => error!("Error adding DMA trace on destination {}: {}", destination, e),
+                }
+            }
+        }
+
+        pub async fn playback_done(&mut self, source: u8, error: u8, channel: u32, timestamp: u64) {
+            let mut traces_locked = self.traces.async_lock().await;
+            let mut trace = traces_locked.get_mut(&source).unwrap();
+            trace.state = RemoteState::PlaybackEnded {
+                error: error,
+                channel: channel,
+                timestamp: timestamp,
+            };
+            *(self.done_count.async_lock().await) += 1;
+        }
+
+        pub async fn playback(
+            &self,
+            aux_mutex: &Rc<Mutex<bool>>,
+            routing_table: &RoutingTable,
+            timer: GlobalTimer,
+            timestamp: u64,
+        ) {
+            let mut dest_list: Vec<u8> = Vec::new();
+            {
+                let lock = self.traces.async_lock().await;
+                let trace_iter = lock.iter();
+                for (dest, trace) in trace_iter {
+                    if trace.state != RemoteState::Loaded {
+                        error!("Destination {} not ready for DMA, state: {:?}", dest, trace.state);
+                        continue;
+                    }
+                    dest_list.push(dest.clone());
+                }
+            }
+            // mutex lock must be dropped before sending a playback request to avoid a deadlock,
+            // if PlaybackStatus is sent from another satellite and the state must be updated.
+            for destination in dest_list {
+                match drtio::ddma_send_playback(aux_mutex, routing_table, timer, self.id, destination, timestamp).await
+                {
+                    Ok(_) => (),
+                    Err(e) => error!("Error during remote DMA playback: {}", e),
+                }
+            }
+        }
+
+        pub async fn destination_changed(
+            &mut self,
+            aux_mutex: &Rc<Mutex<bool>>,
+            routing_table: &RoutingTable,
+            timer: GlobalTimer,
+            destination: u8,
+            up: bool,
+        ) {
+            // update state of the destination, resend traces if it's up
+            if let Some(trace) = self.traces.async_lock().await.get_mut(&destination) {
+                if up {
+                    match drtio::ddma_upload_trace(
+                        aux_mutex,
+                        routing_table,
+                        timer,
+                        self.id,
+                        destination,
+                        trace.get_trace(),
+                    )
+                    .await
+                    {
+                        Ok(_) => trace.state = RemoteState::Loaded,
+                        Err(e) => error!("Error adding DMA trace on destination {}: {}", destination, e),
+                    }
+                } else {
+                    trace.state = RemoteState::NotLoaded;
+                }
+            }
+        }
+
+        pub async fn is_empty(&self) -> bool {
+            self.traces.async_lock().await.is_empty()
+        }
+    }
+
+    static mut TRACES: BTreeMap<u32, TraceSet> = BTreeMap::new();
+
+    pub fn add_traces(id: u32, traces: BTreeMap<u8, Vec<u8>>) {
+        unsafe { TRACES.insert(id, TraceSet::new(id, traces)) };
+    }
+
+    pub async fn await_done(id: u32, timeout: Option<u64>, timer: GlobalTimer) -> Result<RemoteState, &'static str> {
+        let trace_set = unsafe { TRACES.get_mut(&id).unwrap() };
+        trace_set.await_done(timeout, timer).await
+    }
+
+    pub async fn erase(aux_mutex: &Rc<Mutex<bool>>, routing_table: &RoutingTable, timer: GlobalTimer, id: u32) {
+        let trace_set = unsafe { TRACES.get_mut(&id).unwrap() };
+        trace_set.erase(aux_mutex, routing_table, timer).await;
+        unsafe {
+            TRACES.remove(&id);
+        }
+    }
+
+    pub async fn upload_traces(aux_mutex: &Rc<Mutex<bool>>, routing_table: &RoutingTable, timer: GlobalTimer, id: u32) {
+        let trace_set = unsafe { TRACES.get_mut(&id).unwrap() };
+        trace_set.upload_traces(aux_mutex, routing_table, timer).await;
+    }
+
+    pub async fn playback(
+        aux_mutex: &Rc<Mutex<bool>>,
+        routing_table: &RoutingTable,
+        timer: GlobalTimer,
+        id: u32,
+        timestamp: u64,
+    ) {
+        let trace_set = unsafe { TRACES.get_mut(&id).unwrap() };
+        trace_set.playback(aux_mutex, routing_table, timer, timestamp).await;
+    }
+
+    pub async fn playback_done(id: u32, destination: u8, error: u8, channel: u32, timestamp: u64) {
+        let trace_set = unsafe { TRACES.get_mut(&id).unwrap() };
+        trace_set.playback_done(destination, error, channel, timestamp).await;
+    }
+
+    pub async fn destination_changed(
+        aux_mutex: &Rc<Mutex<bool>>,
+        routing_table: &RoutingTable,
+        timer: GlobalTimer,
+        destination: u8,
+        up: bool,
+    ) {
+        let trace_iter = unsafe { TRACES.values_mut() };
+        for trace_set in trace_iter {
+            trace_set
+                .destination_changed(aux_mutex, routing_table, timer, destination, up)
+                .await;
+        }
+    }
+
+    pub async fn has_remote_traces(id: u32) -> bool {
+        let trace_set = unsafe { TRACES.get_mut(&id).unwrap() };
+        !(trace_set.is_empty().await)
+    }
+}
+
+pub async fn put_record(
+    _aux_mutex: &Rc<Mutex<bool>>,
+    _routing_table: &RoutingTable,
+    _timer: GlobalTimer,
+    mut recorder: DmaRecorder,
+) -> u32 {
+    #[cfg(has_drtio)]
+    let mut remote_traces: BTreeMap<u8, Vec<u8>> = BTreeMap::new();
+
+    #[cfg(has_drtio)]
+    if recorder.enable_ddma {
+        let mut local_trace: Vec<u8> = Vec::new();
+        // analyze each entry and put in proper buckets, as the kernel core
+        // sends whole chunks, to limit comms/kernel CPU communication,
+        // and as only comms core has access to varios DMA buffers.
+        let mut ptr = 0;
+        recorder.buffer.push(0);
+        while recorder.buffer[ptr] != 0 {
+            // ptr + 3 = tgt >> 24 (destination)
+            let len = recorder.buffer[ptr] as usize;
+            let destination = recorder.buffer[ptr + 3];
+            if destination == 0 {
+                local_trace.extend(&recorder.buffer[ptr..ptr + len]);
+            } else {
+                if let Some(remote_trace) = remote_traces.get_mut(&destination) {
+                    remote_trace.extend(&recorder.buffer[ptr..ptr + len]);
+                } else {
+                    remote_traces.insert(destination, recorder.buffer[ptr..ptr + len].to_vec());
+                }
+            }
+            // and jump to the next event
+            ptr += len;
+        }
+        mem::swap(&mut recorder.buffer, &mut local_trace);
+    }
+    // trailing zero to indicate end of buffer
+    recorder.buffer.push(0);
+    recorder.buffer.reserve(ALIGNMENT - 1);
+    let original_length = recorder.buffer.len();
+    let padding = ALIGNMENT - recorder.buffer.as_ptr() as usize % ALIGNMENT;
+    let padding = if padding == ALIGNMENT { 0 } else { padding };
+    for _ in 0..padding {
+        recorder.buffer.push(0);
+    }
+    recorder.buffer.copy_within(0..original_length, padding);
+    dcci_slice(&recorder.buffer);
+
+    let ptr = recorder.buffer[padding..].as_ptr() as u32;
+
+    let _old_record = DMA_RECORD_STORE
+        .lock()
+        .insert(recorder.name, (ptr, recorder.buffer, recorder.duration));
+
+    #[cfg(has_drtio)]
+    {
+        if let Some((old_id, _v, _d)) = _old_record {
+            remote_dma::erase(_aux_mutex, _routing_table, _timer, old_id).await;
+        }
+        remote_dma::add_traces(ptr, remote_traces);
+    }
+
+    ptr
+}
+
+pub async fn erase(name: String, _aux_mutex: &Rc<Mutex<bool>>, _routing_table: &RoutingTable, _timer: GlobalTimer) {
+    let _entry = DMA_RECORD_STORE.lock().remove(&name);
+    #[cfg(has_drtio)]
+    if let Some((id, _v, _d)) = _entry {
+        remote_dma::erase(_aux_mutex, _routing_table, _timer, id).await;
+    }
+}
+
+pub async fn retrieve(name: String) -> Option<(i32, i64, bool)> {
+    let (ptr, _v, duration) = DMA_RECORD_STORE.lock().get(&name)?.clone();
+    #[cfg(has_drtio)]
+    let uses_ddma = remote_dma::has_remote_traces(ptr).await;
+    #[cfg(not(has_drtio))]
+    let uses_ddma = false;
+    Some((ptr as i32, duration, uses_ddma))
+}

src/runtime/src/subkernel.rs

@@ -0,0 +1,335 @@
+use alloc::{collections::BTreeMap, rc::Rc, vec::Vec};
+
+use libasync::task;
+use libboard_artiq::{drtio_routing::RoutingTable,
+                     drtioaux_proto::{PayloadStatus, MASTER_PAYLOAD_MAX_SIZE}};
+use libboard_zynq::{time::Milliseconds, timer::GlobalTimer};
+use libcortex_a9::mutex::Mutex;
+use log::{error, warn};
+
+use crate::rtio_mgt::{drtio, drtio::Error as DrtioError};
+
+#[derive(Debug, PartialEq, Clone, Copy)]
+pub enum FinishStatus {
+    Ok,
+    CommLost,
+    Exception(u8), // exception source
+}
+
+#[derive(Debug, PartialEq, Clone, Copy)]
+pub enum SubkernelState {
+    NotLoaded,
+    Uploaded,
+    Running,
+    Finished { status: FinishStatus },
+}
+
+#[derive(Debug, PartialEq, Eq, Clone, Copy)]
+pub enum Error {
+    Timeout,
+    IncorrectState,
+    SubkernelNotFound,
+    SubkernelException,
+    CommLost,
+    DrtioError(DrtioError),
+}
+
+impl From<DrtioError> for Error {
+    fn from(value: DrtioError) -> Error {
+        Error::DrtioError(value)
+    }
+}
+
+pub struct SubkernelFinished {
+    pub id: u32,
+    pub status: FinishStatus,
+    pub exception: Option<Vec<u8>>,
+}
+
+struct Subkernel {
+    pub destination: u8,
+    pub data: Vec<u8>,
+    pub state: SubkernelState,
+}
+
+impl Subkernel {
+    pub fn new(destination: u8, data: Vec<u8>) -> Self {
+        Subkernel {
+            destination: destination,
+            data: data,
+            state: SubkernelState::NotLoaded,
+        }
+    }
+}
+
+static SUBKERNELS: Mutex<BTreeMap<u32, Subkernel>> = Mutex::new(BTreeMap::new());
+
+pub async fn add_subkernel(id: u32, destination: u8, kernel: Vec<u8>) {
+    SUBKERNELS
+        .async_lock()
+        .await
+        .insert(id, Subkernel::new(destination, kernel));
+}
+
+pub async fn upload(
+    aux_mutex: &Rc<Mutex<bool>>,
+    routing_table: &RoutingTable,
+    timer: GlobalTimer,
+    id: u32,
+) -> Result<(), Error> {
+    if let Some(subkernel) = SUBKERNELS.async_lock().await.get_mut(&id) {
+        drtio::subkernel_upload(
+            aux_mutex,
+            routing_table,
+            timer,
+            id,
+            subkernel.destination,
+            &subkernel.data,
+        )
+        .await?;
+        subkernel.state = SubkernelState::Uploaded;
+        Ok(())
+    } else {
+        Err(Error::SubkernelNotFound)
+    }
+}
+
+pub async fn load(
+    aux_mutex: &Rc<Mutex<bool>>,
+    routing_table: &RoutingTable,
+    timer: GlobalTimer,
+    id: u32,
+    run: bool,
+    timestamp: u64,
+) -> Result<(), Error> {
+    if let Some(subkernel) = SUBKERNELS.async_lock().await.get_mut(&id) {
+        if subkernel.state != SubkernelState::Uploaded {
+            return Err(Error::IncorrectState);
+        }
+        drtio::subkernel_load(
+            aux_mutex,
+            routing_table,
+            timer,
+            id,
+            subkernel.destination,
+            run,
+            timestamp,
+        )
+        .await?;
+        if run {
+            subkernel.state = SubkernelState::Running;
+        }
+        Ok(())
+    } else {
+        Err(Error::SubkernelNotFound)
+    }
+}
+
+pub async fn clear_subkernels() {
+    SUBKERNELS.async_lock().await.clear();
+    MESSAGE_QUEUE.async_lock().await.clear();
+    CURRENT_MESSAGES.async_lock().await.clear();
+}
+
+pub async fn subkernel_finished(id: u32, with_exception: bool, exception_src: u8) {
+    // called upon receiving DRTIO SubkernelRunDone
+    // may be None if session ends and is cleared
+    if let Some(subkernel) = SUBKERNELS.async_lock().await.get_mut(&id) {
+        if subkernel.state == SubkernelState::Running {
+            subkernel.state = SubkernelState::Finished {
+                status: match with_exception {
+                    true => FinishStatus::Exception(exception_src),
+                    false => FinishStatus::Ok,
+                },
+            }
+        }
+    }
+}
+
+pub async fn destination_changed(
+    aux_mutex: &Rc<Mutex<bool>>,
+    routing_table: &RoutingTable,
+    timer: GlobalTimer,
+    destination: u8,
+    up: bool,
+) {
+    let mut locked_subkernels = SUBKERNELS.async_lock().await;
+    for (id, subkernel) in locked_subkernels.iter_mut() {
+        if subkernel.destination == destination {
+            if up {
+                match drtio::subkernel_upload(aux_mutex, routing_table, timer, *id, destination, &subkernel.data).await
+                {
+                    Ok(_) => subkernel.state = SubkernelState::Uploaded,
+                    Err(e) => error!("Error adding subkernel on destination {}: {}", destination, e),
+                }
+            } else {
+                subkernel.state = match subkernel.state {
+                    SubkernelState::Running => SubkernelState::Finished {
+                        status: FinishStatus::CommLost,
+                    },
+                    _ => SubkernelState::NotLoaded,
+                }
+            }
+        }
+    }
+}
+
+pub async fn await_finish(
+    aux_mutex: &Rc<Mutex<bool>>,
+    routing_table: &RoutingTable,
+    timer: GlobalTimer,
+    id: u32,
+    timeout: i64,
+) -> Result<SubkernelFinished, Error> {
+    match SUBKERNELS.async_lock().await.get(&id).unwrap().state {
+        SubkernelState::Running | SubkernelState::Finished { .. } => (),
+        _ => return Err(Error::IncorrectState),
+    }
+    if timeout > 0 {
+        let max_time = timer.get_time() + Milliseconds(timeout as u64);
+        while timer.get_time() < max_time {
+            match SUBKERNELS.async_lock().await.get(&id).unwrap().state {
+                SubkernelState::Finished { .. } => break,
+                _ => (),
+            };
+            task::r#yield().await;
+        }
+        if timer.get_time() >= max_time {
+            error!("Remote subkernel finish await timed out");
+            return Err(Error::Timeout);
+        }
+    } else {
+        // no timeout, wait forever
+        loop {
+            match SUBKERNELS.async_lock().await.get(&id).unwrap().state {
+                SubkernelState::Finished { .. } => break,
+                _ => (),
+            };
+            task::r#yield().await;
+        }
+    }
+    if let Some(subkernel) = SUBKERNELS.async_lock().await.get_mut(&id) {
+        match subkernel.state {
+            SubkernelState::Finished { status } => {
+                subkernel.state = SubkernelState::Uploaded;
+                Ok(SubkernelFinished {
+                    id: id,
+                    status: status,
+                    exception: if let FinishStatus::Exception(dest) = status {
+                        Some(drtio::subkernel_retrieve_exception(aux_mutex, routing_table, timer, dest).await?)
+                    } else {
+                        None
+                    },
+                })
+            }
+            _ => Err(Error::IncorrectState),
+        }
+    } else {
+        Err(Error::SubkernelNotFound)
+    }
+}
+
+pub struct Message {
+    from_id: u32,
+    pub count: u8,
+    pub data: Vec<u8>,
+}
+
+// FIFO queue of messages
+static MESSAGE_QUEUE: Mutex<Vec<Message>> = Mutex::new(Vec::new());
+// currently under construction message(s) (can be from multiple sources)
+static CURRENT_MESSAGES: Mutex<BTreeMap<u32, Message>> = Mutex::new(BTreeMap::new());
+
+pub async fn message_handle_incoming(
+    id: u32,
+    status: PayloadStatus,
+    length: usize,
+    data: &[u8; MASTER_PAYLOAD_MAX_SIZE],
+) {
+    // called when receiving a message from satellite
+    {
+        let subkernel_lock = SUBKERNELS.async_lock().await;
+        let subkernel = subkernel_lock.get(&id);
+        if subkernel.is_some() && subkernel.unwrap().state != SubkernelState::Running {
+            // do not add messages for non-running or deleted subkernels
+            warn!("received a message for a non-running subkernel #{}", id);
+            return;
+        }
+    }
+    let mut current_messages = CURRENT_MESSAGES.async_lock().await;
+
+    if status.is_first() {
+        current_messages.remove(&id);
+    }
+
+    match current_messages.get_mut(&id) {
+        Some(message) => message.data.extend(&data[..length]),
+        None => {
+            current_messages.insert(
+                id,
+                Message {
+                    from_id: id,
+                    count: data[0],
+                    data: data[1..length].to_vec(),
+                },
+            );
+        }
+    };
+    if status.is_last() {
+        // when done, remove from working queue
+        MESSAGE_QUEUE
+            .async_lock()
+            .await
+            .push(current_messages.remove(&id).unwrap());
+    }
+}
+
+pub async fn message_await(id: u32, timeout: i64, timer: GlobalTimer) -> Result<Message, Error> {
+    let is_subkernel = SUBKERNELS.async_lock().await.get(&id).is_some();
+    if is_subkernel {
+        match SUBKERNELS.async_lock().await.get(&id).unwrap().state {
+            SubkernelState::Finished {
+                status: FinishStatus::CommLost,
+            } => return Err(Error::CommLost),
+            SubkernelState::Running | SubkernelState::Finished { .. } => (),
+            _ => return Err(Error::IncorrectState),
+        }
+    }
+    let max_time = timer.get_time() + Milliseconds(timeout as u64);
+    while timeout < 0 || (timeout > 0 && timer.get_time() < max_time) {
+        {
+            let mut message_queue = MESSAGE_QUEUE.async_lock().await;
+            for i in 0..message_queue.len() {
+                let msg = &message_queue[i];
+                if msg.from_id == id {
+                    let message = message_queue.remove(i);
+                    return Ok(message);
+                }
+            }
+        }
+        if is_subkernel {
+            match SUBKERNELS.async_lock().await.get(&id).unwrap().state {
+                SubkernelState::Finished {
+                    status: FinishStatus::CommLost,
+                } => return Err(Error::CommLost),
+                SubkernelState::Finished {
+                    status: FinishStatus::Exception(_),
+                } => return Err(Error::SubkernelException),
+                _ => (),
+            }
+        }
+        task::r#yield().await;
+    }
+    Err(Error::Timeout)
+}
+
+pub async fn message_send<'a>(
+    aux_mutex: &Rc<Mutex<bool>>,
+    routing_table: &RoutingTable,
+    timer: GlobalTimer,
+    id: u32,
+    destination: u8,
+    message: Vec<u8>,
+) -> Result<(), Error> {
+    Ok(drtio::subkernel_send_message(aux_mutex, routing_table, timer, id, destination, &message).await?)
+}

src/rustfmt.toml

@@ -0,0 +1,68 @@
+max_width = 120
+hard_tabs = false
+tab_spaces = 4
+newline_style = "Auto"
+use_small_heuristics = "Default"
+indent_style = "Block"
+wrap_comments = false
+format_code_in_doc_comments = false
+comment_width = 100
+normalize_comments = false
+normalize_doc_attributes = false
+license_template_path = ""
+format_strings = true
+format_macro_matchers = true
+format_macro_bodies = true
+empty_item_single_line = true
+struct_lit_single_line = true
+fn_single_line = false
+where_single_line = true
+imports_indent = "Visual"
+imports_layout = "Mixed"
+merge_imports = true
+group_imports = "StdExternalCrate"
+reorder_imports = true
+reorder_modules = true
+reorder_impl_items = false
+type_punctuation_density = "Wide"
+space_before_colon = false
+space_after_colon = true
+spaces_around_ranges = false
+binop_separator = "Front"
+remove_nested_parens = true
+combine_control_expr = true
+overflow_delimited_expr = false
+struct_field_align_threshold = 0
+enum_discrim_align_threshold = 0
+match_arm_blocks = true
+match_arm_leading_pipes = "Never"
+force_multiline_blocks = false
+fn_args_layout = "Tall"
+brace_style = "SameLineWhere"
+control_brace_style = "AlwaysSameLine"
+trailing_semicolon = true
+trailing_comma = "Vertical"
+match_block_trailing_comma = false
+blank_lines_upper_bound = 1
+blank_lines_lower_bound = 0
+edition = "2018"
+version = "Two"
+inline_attribute_width = 0
+merge_derives = true
+use_try_shorthand = false
+use_field_init_shorthand = false
+force_explicit_abi = true
+condense_wildcard_suffixes = false
+color = "Auto"
+required_version = "1.4.32"
+unstable_features = false
+disable_all_formatting = false
+skip_children = false
+hide_parse_errors = false
+error_on_line_overflow = false
+error_on_unformatted = false
+report_todo = "Never"
+report_fixme = "Never"
+ignore = []
+emit_mode = "Files"
+make_backup = false

src/satman/Cargo.toml

@@ -1,28 +0,0 @@
-[package]
-authors = ["M-Labs"]
-name = "satman"
-version = "0.0.0"
-build = "build.rs"
-
-[features]
-target_zc706 = ["libboard_zynq/target_zc706", "libsupport_zynq/target_zc706", "libconfig/target_zc706", "libboard_artiq/target_zc706"]
-target_kasli_soc = ["libboard_zynq/target_kasli_soc", "libsupport_zynq/target_kasli_soc", "libconfig/target_kasli_soc", "libboard_artiq/target_kasli_soc"]
-default = ["target_zc706", ]
-
-[build-dependencies]
-build_zynq = { path = "../libbuild_zynq" }
-
-[dependencies]
-log = { version = "0.4", default-features = false }
-embedded-hal = "0.2"
-
-libboard_zynq = { git = "https://git.m-labs.hk/M-Labs/zynq-rs.git", features = ["ipv6"]}
-libsupport_zynq = { default-features = false, features = ["alloc_core"], git = "https://git.m-labs.hk/M-Labs/zynq-rs.git" }
-libcortex_a9 = { git = "https://git.m-labs.hk/M-Labs/zynq-rs.git" }
-libasync = { git = "https://git.m-labs.hk/M-Labs/zynq-rs.git" }
-libregister = { git = "https://git.m-labs.hk/M-Labs/zynq-rs.git" }
-libconfig = { git = "https://git.m-labs.hk/M-Labs/zynq-rs.git", features = ["fat_lfn", "ipv6"] }
-
-libboard_artiq = { path = "../libboard_artiq" }
-unwind = { path = "../libunwind" }
-libc = { path = "../libc" }

src/satman/Cargo.toml.tpl

@@ -0,0 +1,35 @@
+[package]
+authors = ["M-Labs"]
+name = "satman"
+version = "0.0.0"
+build = "build.rs"
+
+[features]
+target_zc706 = ["libboard_zynq/target_zc706", "libsupport_zynq/target_zc706", "libconfig/target_zc706", "libboard_artiq/target_zc706"]
+target_kasli_soc = ["libboard_zynq/target_kasli_soc", "libsupport_zynq/target_kasli_soc", "libconfig/target_kasli_soc", "libboard_artiq/target_kasli_soc"]
+calibrate_wrpll_skew = ["libboard_artiq/calibrate_wrpll_skew"]
+default = ["target_zc706", ]
+
+[build-dependencies]
+build_zynq = { path = "../libbuild_zynq" }
+
+[dependencies]
+log = { version = "0.4", default-features = false }
+byteorder = { version = "1.3", default-features = false }
+core_io = { version = "0.1", features = ["collections"] }
+crc = { version = "1.7", default-features = false }
+cslice = "0.3"
+embedded-hal = "0.2"
+
+libboard_zynq = { path = "@@ZYNQ_RS@@/libboard_zynq", features = ["ipv6"]}
+libsupport_zynq = { path = "@@ZYNQ_RS@@/libsupport_zynq", default-features = false, features = ["alloc_core"] }
+libcortex_a9 = { path = "@@ZYNQ_RS@@/libcortex_a9" }
+libasync = { path = "@@ZYNQ_RS@@/libasync" }
+libregister = { path = "@@ZYNQ_RS@@/libregister" }
+libconfig = { path = "@@ZYNQ_RS@@/libconfig", features = ["fat_lfn", "ipv6"] }
+
+libboard_artiq = { path = "../libboard_artiq" }
+unwind = { path = "../libunwind" }
+libc = { path = "../libc" }
+io = { path = "../libio", features = ["alloc"] }
+ksupport = { path = "../libksupport" }

src/satman/src/analyzer.rs

@@ -0,0 +1,126 @@
+use core::cmp::min;
+
+use libboard_artiq::{drtioaux_proto::SAT_PAYLOAD_MAX_SIZE, pl::csr};
+use libcortex_a9::cache;
+
+const BUFFER_SIZE: usize = 512 * 1024;
+
+#[repr(align(64))]
+struct Buffer {
+    data: [u8; BUFFER_SIZE],
+}
+
+static mut BUFFER: Buffer = Buffer { data: [0; BUFFER_SIZE] };
+
+fn arm() {
+    unsafe {
+        let base_addr = &mut BUFFER.data[0] as *mut _ as usize;
+        let last_addr = &mut BUFFER.data[BUFFER_SIZE - 1] as *mut _ as usize;
+        csr::rtio_analyzer::dma_base_address_write(base_addr as u32);
+        csr::rtio_analyzer::message_encoder_overflow_reset_write(1);
+        csr::rtio_analyzer::dma_last_address_write(last_addr as u32);
+        csr::rtio_analyzer::dma_reset_write(1);
+        csr::rtio_analyzer::enable_write(1);
+    }
+}
+
+fn disarm() {
+    unsafe {
+        csr::rtio_analyzer::enable_write(0);
+        while csr::rtio_analyzer::busy_read() != 0 {}
+        cache::dcci_slice(&BUFFER.data);
+    }
+}
+
+pub struct Analyzer {
+    // necessary for keeping track of sent data
+    data_len: usize,
+    sent_bytes: usize,
+    data_pointer: usize,
+}
+
+pub struct Header {
+    pub total_byte_count: u64,
+    pub sent_bytes: u32,
+    pub error: bool,
+}
+
+pub struct AnalyzerSliceMeta {
+    pub len: u16,
+    pub last: bool,
+}
+
+impl Drop for Analyzer {
+    fn drop(&mut self) {
+        disarm();
+    }
+}
+
+impl Analyzer {
+    pub fn new() -> Analyzer {
+        // create and arm new Analyzer
+        arm();
+        Analyzer {
+            data_len: 0,
+            sent_bytes: 0,
+            data_pointer: 0,
+        }
+    }
+
+    pub fn get_header(&mut self) -> Header {
+        disarm();
+
+        let overflow = unsafe { csr::rtio_analyzer::message_encoder_overflow_read() != 0 };
+        let bus_err = unsafe { csr::rtio_analyzer::dma_bus_error_read() != 0 };
+        let total_byte_count = unsafe { csr::rtio_analyzer::dma_byte_count_read() as u64 };
+        let wraparound = total_byte_count >= BUFFER_SIZE as u64;
+        self.data_len = if wraparound {
+            BUFFER_SIZE
+        } else {
+            total_byte_count as usize
+        };
+        self.data_pointer = if wraparound {
+            (total_byte_count % BUFFER_SIZE as u64) as usize
+        } else {
+            0
+        };
+        self.sent_bytes = 0;
+
+        if overflow {
+            warn!("overflow occured");
+        }
+        if bus_err {
+            warn!("bus error occured");
+        }
+
+        Header {
+            total_byte_count: total_byte_count,
+            sent_bytes: self.data_len as u32,
+            error: overflow | bus_err,
+        }
+    }
+
+    pub fn get_data(&mut self, data_slice: &mut [u8; SAT_PAYLOAD_MAX_SIZE]) -> AnalyzerSliceMeta {
+        let data = unsafe { &BUFFER.data[..] };
+        let i = (self.data_pointer + self.sent_bytes) % BUFFER_SIZE;
+        let len = min(SAT_PAYLOAD_MAX_SIZE, self.data_len - self.sent_bytes);
+        let last = self.sent_bytes + len == self.data_len;
+
+        if i + len >= BUFFER_SIZE {
+            data_slice[..(BUFFER_SIZE - i)].clone_from_slice(&data[i..BUFFER_SIZE]);
+            data_slice[(BUFFER_SIZE - i)..len].clone_from_slice(&data[..(i + len) % BUFFER_SIZE]);
+        } else {
+            data_slice[..len].clone_from_slice(&data[i..i + len]);
+        }
+        self.sent_bytes += len;
+
+        if last {
+            arm();
+        }
+
+        AnalyzerSliceMeta {
+            len: len as u16,
+            last: last,
+        }
+    }
+}

src/satman/src/dma.rs

@@ -0,0 +1,563 @@
+use alloc::{collections::btree_map::BTreeMap, string::String, vec::Vec};
+use core::mem;
+
+use ksupport::kernel::DmaRecorder;
+use libboard_artiq::{drtio_routing::RoutingTable,
+                     drtioaux_proto::{Packet, PayloadStatus, MASTER_PAYLOAD_MAX_SIZE},
+                     pl::csr};
+use libcortex_a9::cache::dcci_slice;
+use routing::{Router, Sliceable};
+use subkernel::Manager as KernelManager;
+
+const ALIGNMENT: usize = 64;
+
+#[derive(Debug, PartialEq)]
+enum ManagerState {
+    Idle,
+    Playback,
+}
+
+pub struct RtioStatus {
+    pub source: u8,
+    pub id: u32,
+    pub error: u8,
+    pub channel: u32,
+    pub timestamp: u64,
+}
+
+#[derive(Debug)]
+pub enum Error {
+    IdNotFound,
+    PlaybackInProgress,
+    EntryNotComplete,
+    MasterDmaFound,
+    UploadFail,
+}
+
+#[derive(Debug)]
+struct Entry {
+    trace: Vec<u8>,
+    padding_len: usize,
+    complete: bool,
+    duration: i64, // relevant for local DMA
+}
+
+impl Entry {
+    pub fn from_vec(data: Vec<u8>, duration: i64) -> Entry {
+        let mut entry = Entry {
+            trace: data,
+            padding_len: 0,
+            complete: true,
+            duration: duration,
+        };
+        entry.realign();
+        entry
+    }
+
+    pub fn id(&self) -> u32 {
+        self.trace[self.padding_len..].as_ptr() as u32
+    }
+
+    pub fn realign(&mut self) {
+        self.trace.push(0);
+        let data_len = self.trace.len();
+
+        self.trace.reserve(ALIGNMENT - 1);
+        let padding = ALIGNMENT - self.trace.as_ptr() as usize % ALIGNMENT;
+        let padding = if padding == ALIGNMENT { 0 } else { padding };
+        for _ in 0..padding {
+            // Vec guarantees that this will not reallocate
+            self.trace.push(0)
+        }
+        for i in 1..data_len + 1 {
+            self.trace[data_len + padding - i] = self.trace[data_len - i]
+        }
+        self.complete = true;
+        self.padding_len = padding;
+
+        dcci_slice(&self.trace);
+    }
+}
+
+#[derive(Debug)]
+enum RemoteTraceState {
+    Unsent,
+    Sending(usize),
+    Ready,
+    Running(usize),
+}
+
+#[derive(Debug)]
+struct RemoteTraces {
+    remote_traces: BTreeMap<u8, Sliceable>,
+    state: RemoteTraceState,
+}
+
+impl RemoteTraces {
+    pub fn new(traces: BTreeMap<u8, Sliceable>) -> RemoteTraces {
+        RemoteTraces {
+            remote_traces: traces,
+            state: RemoteTraceState::Unsent,
+        }
+    }
+
+    // on subkernel request
+    pub fn upload_traces(
+        &mut self,
+        id: u32,
+        router: &mut Router,
+        rank: u8,
+        self_destination: u8,
+        routing_table: &RoutingTable,
+    ) -> usize {
+        let len = self.remote_traces.len();
+        if len > 0 {
+            self.state = RemoteTraceState::Sending(self.remote_traces.len());
+            for (dest, trace) in self.remote_traces.iter_mut() {
+                // queue up the first packet for all destinations, rest will be sent after first ACK
+                let mut data_slice: [u8; MASTER_PAYLOAD_MAX_SIZE] = [0; MASTER_PAYLOAD_MAX_SIZE];
+                let meta = trace.get_slice_master(&mut data_slice);
+                router.route(
+                    Packet::DmaAddTraceRequest {
+                        source: self_destination,
+                        destination: *dest,
+                        id: id,
+                        status: meta.status,
+                        length: meta.len,
+                        trace: data_slice,
+                    },
+                    routing_table,
+                    rank,
+                    self_destination,
+                );
+            }
+        }
+        len
+    }
+
+    // on incoming Packet::DmaAddTraceReply
+    pub fn ack_upload(
+        &mut self,
+        kernel_manager: &mut KernelManager,
+        source: u8,
+        id: u32,
+        succeeded: bool,
+        router: &mut Router,
+        rank: u8,
+        self_destination: u8,
+        routing_table: &RoutingTable,
+    ) {
+        if let RemoteTraceState::Sending(count) = self.state {
+            if let Some(trace) = self.remote_traces.get_mut(&source) {
+                if trace.at_end() {
+                    if count - 1 == 0 {
+                        self.state = RemoteTraceState::Ready;
+                        if let Some((id, timestamp)) = kernel_manager.ddma_remote_uploaded(succeeded) {
+                            self.playback(id, timestamp, router, rank, self_destination, routing_table);
+                        }
+                    } else {
+                        self.state = RemoteTraceState::Sending(count - 1);
+                    }
+                } else {
+                    // send next slice
+                    let mut data_slice: [u8; MASTER_PAYLOAD_MAX_SIZE] = [0; MASTER_PAYLOAD_MAX_SIZE];
+                    let meta = trace.get_slice_master(&mut data_slice);
+                    router.route(
+                        Packet::DmaAddTraceRequest {
+                            source: self_destination,
+                            destination: meta.destination,
+                            id: id,
+                            status: meta.status,
+                            length: meta.len,
+                            trace: data_slice,
+                        },
+                        routing_table,
+                        rank,
+                        self_destination,
+                    );
+                }
+            }
+        }
+    }
+
+    // on subkernel request
+    pub fn playback(
+        &mut self,
+        id: u32,
+        timestamp: u64,
+        router: &mut Router,
+        rank: u8,
+        self_destination: u8,
+        routing_table: &RoutingTable,
+    ) {
+        // route all the playback requests
+        // remote traces (local trace runs on core1 unlike mainline firmware)
+        self.state = RemoteTraceState::Running(self.remote_traces.len());
+        for (dest, _) in self.remote_traces.iter() {
+            router.route(
+                Packet::DmaPlaybackRequest {
+                    source: self_destination,
+                    destination: *dest,
+                    id: id,
+                    timestamp: timestamp,
+                },
+                routing_table,
+                rank,
+                self_destination,
+            );
+            // response will be ignored (succeeded = false handled by the main thread)
+        }
+    }
+
+    // on incoming Packet::DmaPlaybackDone
+    pub fn remote_finished(&mut self, kernel_manager: &mut KernelManager, error: u8, channel: u32, timestamp: u64) {
+        if let RemoteTraceState::Running(count) = self.state {
+            if error != 0 || count - 1 == 0 {
+                // notify the kernel about a DDMA error or finish
+                kernel_manager.ddma_finished(error, channel, timestamp);
+                self.state = RemoteTraceState::Ready;
+                // further messages will be ignored (if there was an error)
+            } else {
+                // no error and not the last one awaited
+                self.state = RemoteTraceState::Running(count - 1);
+            }
+        }
+    }
+
+    pub fn erase(
+        &mut self,
+        id: u32,
+        router: &mut Router,
+        rank: u8,
+        self_destination: u8,
+        routing_table: &RoutingTable,
+    ) {
+        for (dest, _) in self.remote_traces.iter() {
+            router.route(
+                Packet::DmaRemoveTraceRequest {
+                    source: self_destination,
+                    destination: *dest,
+                    id: id,
+                },
+                routing_table,
+                rank,
+                self_destination,
+            );
+            // response will be ignored as this object will stop existing too
+        }
+    }
+
+    pub fn has_remote_traces(&self) -> bool {
+        self.remote_traces.len() > 0
+    }
+}
+
+#[derive(Debug)]
+pub struct Manager {
+    entries: BTreeMap<(u8, u32), Entry>,
+    state: ManagerState,
+    current_id: u32,
+    current_source: u8,
+
+    remote_entries: BTreeMap<u32, RemoteTraces>,
+    name_map: BTreeMap<String, u32>,
+}
+
+impl Manager {
+    pub fn new() -> Manager {
+        // in case Manager is created during a DMA in progress
+        // wait for it to end
+        unsafe { while csr::rtio_dma::enable_read() != 0 {} }
+        Manager {
+            entries: BTreeMap::new(),
+            current_id: 0,
+            current_source: 0,
+            state: ManagerState::Idle,
+            remote_entries: BTreeMap::new(),
+            name_map: BTreeMap::new(),
+        }
+    }
+
+    pub fn add(
+        &mut self,
+        source: u8,
+        id: u32,
+        status: PayloadStatus,
+        trace: &[u8],
+        trace_len: usize,
+    ) -> Result<(), Error> {
+        let entry = match self.entries.get_mut(&(source, id)) {
+            Some(entry) => {
+                if entry.complete || status.is_first() {
+                    // replace entry
+                    self.entries.remove(&(source, id));
+                    self.entries.insert(
+                        (source, id),
+                        Entry {
+                            trace: Vec::new(),
+                            padding_len: 0,
+                            complete: false,
+                            duration: 0,
+                        },
+                    );
+                    self.entries.get_mut(&(source, id)).unwrap()
+                } else {
+                    entry
+                }
+            }
+            None => {
+                self.entries.insert(
+                    (source, id),
+                    Entry {
+                        trace: Vec::new(),
+                        padding_len: 0,
+                        complete: false,
+                        duration: 0,
+                    },
+                );
+                self.entries.get_mut(&(source, id)).unwrap()
+            }
+        };
+        entry.trace.extend(&trace[0..trace_len]);
+
+        if status.is_last() {
+            entry.realign();
+        }
+        Ok(())
+    }
+
+    // api for DRTIO
+    pub fn erase(&mut self, source: u8, id: u32) -> Result<(), Error> {
+        match self.entries.remove(&(source, id)) {
+            Some(_) => Ok(()),
+            None => Err(Error::IdNotFound),
+        }
+    }
+
+    // API for subkernel
+    pub fn erase_name(
+        &mut self,
+        name: &str,
+        router: &mut Router,
+        rank: u8,
+        self_destination: u8,
+        routing_table: &RoutingTable,
+    ) {
+        if let Some(id) = self.name_map.get(name) {
+            if let Some(traces) = self.remote_entries.get_mut(&id) {
+                traces.erase(*id, router, rank, self_destination, routing_table);
+                self.remote_entries.remove(&id);
+            }
+            self.entries.remove(&(self_destination, *id));
+            self.name_map.remove(name);
+        }
+    }
+
+    pub fn remote_finished(
+        &mut self,
+        kernel_manager: &mut KernelManager,
+        id: u32,
+        error: u8,
+        channel: u32,
+        timestamp: u64,
+    ) {
+        if let Some(entry) = self.remote_entries.get_mut(&id) {
+            entry.remote_finished(kernel_manager, error, channel, timestamp);
+        }
+    }
+
+    pub fn ack_upload(
+        &mut self,
+        kernel_manager: &mut KernelManager,
+        source: u8,
+        id: u32,
+        succeeded: bool,
+        router: &mut Router,
+        rank: u8,
+        self_destination: u8,
+        routing_table: &RoutingTable,
+    ) {
+        if let Some(entry) = self.remote_entries.get_mut(&id) {
+            entry.ack_upload(
+                kernel_manager,
+                source,
+                id,
+                succeeded,
+                router,
+                rank,
+                self_destination,
+                routing_table,
+            );
+        }
+    }
+
+    // API for subkernel
+    pub fn upload_traces(
+        &mut self,
+        id: u32,
+        router: &mut Router,
+        rank: u8,
+        self_destination: u8,
+        routing_table: &RoutingTable,
+    ) -> Result<usize, Error> {
+        let remote_traces = self.remote_entries.get_mut(&id);
+        let mut len = 0;
+        if let Some(traces) = remote_traces {
+            len = traces.upload_traces(id, router, rank, self_destination, routing_table);
+        }
+        Ok(len)
+    }
+
+    // API for subkernel
+    pub fn playback_remote(
+        &mut self,
+        id: u32,
+        timestamp: u64,
+        router: &mut Router,
+        rank: u8,
+        self_destination: u8,
+        routing_table: &RoutingTable,
+    ) -> Result<(), Error> {
+        if let Some(traces) = self.remote_entries.get_mut(&id) {
+            traces.playback(id, timestamp, router, rank, self_destination, routing_table);
+            Ok(())
+        } else {
+            Err(Error::IdNotFound)
+        }
+    }
+
+    // API for subkernel
+    pub fn cleanup(&mut self, router: &mut Router, rank: u8, self_destination: u8, routing_table: &RoutingTable) {
+        // after subkernel ends, remove all self-generated traces
+        for (_, id) in self.name_map.iter_mut() {
+            if let Some(traces) = self.remote_entries.get_mut(&id) {
+                traces.erase(*id, router, rank, self_destination, routing_table);
+                self.remote_entries.remove(&id);
+            }
+            self.entries.remove(&(self_destination, *id));
+        }
+        self.name_map.clear();
+    }
+
+    // API for subkernel
+    pub fn retrieve(&self, self_destination: u8, name: &String) -> Option<(i32, i64, bool)> {
+        let id = self.name_map.get(name)?;
+        let duration = self.entries.get(&(self_destination, *id))?.duration;
+        let uses_ddma = self.has_remote_traces(*id);
+        Some((*id as i32, duration, uses_ddma))
+    }
+
+    pub fn has_remote_traces(&self, id: u32) -> bool {
+        match self.remote_entries.get(&id) {
+            Some(traces) => traces.has_remote_traces(),
+            _ => false,
+        }
+    }
+
+    pub fn put_record(&mut self, mut recorder: DmaRecorder, self_destination: u8) -> Result<u32, Error> {
+        let mut remote_traces: BTreeMap<u8, Sliceable> = BTreeMap::new();
+
+        let mut local_trace: Vec<u8> = Vec::new();
+        // analyze each entry and put in proper buckets, as the kernel core
+        // sends whole chunks, to limit comms/kernel CPU communication,
+        // and as only comms core has access to varios DMA buffers.
+        let mut ptr = 0;
+        recorder.buffer.push(0);
+        while recorder.buffer[ptr] != 0 {
+            // ptr + 3 = tgt >> 24 (destination)
+            let len = recorder.buffer[ptr] as usize;
+            let destination = recorder.buffer[ptr + 3];
+            if destination == 0 {
+                return Err(Error::MasterDmaFound);
+            } else if destination == self_destination {
+                local_trace.extend(&recorder.buffer[ptr..ptr + len]);
+            } else {
+                if let Some(remote_trace) = remote_traces.get_mut(&destination) {
+                    remote_trace.extend(&recorder.buffer[ptr..ptr + len]);
+                } else {
+                    remote_traces.insert(
+                        destination,
+                        Sliceable::new(destination, recorder.buffer[ptr..ptr + len].to_vec()),
+                    );
+                }
+            }
+            // and jump to the next event
+            ptr += len;
+        }
+        let local_entry = Entry::from_vec(local_trace, recorder.duration);
+
+        let id = local_entry.id();
+        self.entries.insert((self_destination, id), local_entry);
+        self.remote_entries.insert(id, RemoteTraces::new(remote_traces));
+        let mut name = String::new();
+        mem::swap(&mut recorder.name, &mut name);
+        self.name_map.insert(name, id);
+
+        Ok(id)
+    }
+
+    pub fn playback(&mut self, source: u8, id: u32, timestamp: u64) -> Result<(), Error> {
+        if self.state != ManagerState::Idle {
+            return Err(Error::PlaybackInProgress);
+        }
+
+        let entry = match self.entries.get(&(source, id)) {
+            Some(entry) => entry,
+            None => {
+                return Err(Error::IdNotFound);
+            }
+        };
+        if !entry.complete {
+            return Err(Error::EntryNotComplete);
+        }
+        let ptr = entry.trace[entry.padding_len..].as_ptr();
+        assert!(ptr as u32 % 64 == 0);
+
+        self.state = ManagerState::Playback;
+        self.current_id = id;
+        self.current_source = source;
+
+        unsafe {
+            csr::rtio_dma::base_address_write(ptr as u32);
+            csr::rtio_dma::time_offset_write(timestamp as u64);
+
+            csr::cri_con::selected_write(1);
+            csr::rtio_dma::enable_write(1);
+            // playback has begun here, for status call check_state
+        }
+        Ok(())
+    }
+
+    pub fn check_state(&mut self) -> Option<RtioStatus> {
+        if self.state != ManagerState::Playback {
+            // nothing to report
+            return None;
+        }
+        let dma_enable = unsafe { csr::rtio_dma::enable_read() };
+        if dma_enable != 0 {
+            return None;
+        } else {
+            self.state = ManagerState::Idle;
+            unsafe {
+                csr::cri_con::selected_write(0);
+                let error = csr::rtio_dma::error_read();
+                let channel = csr::rtio_dma::error_channel_read();
+                let timestamp = csr::rtio_dma::error_timestamp_read();
+                if error != 0 {
+                    csr::rtio_dma::error_write(1);
+                }
+                return Some(RtioStatus {
+                    source: self.current_source,
+                    id: self.current_id,
+                    error: error,
+                    channel: channel,
+                    timestamp: timestamp,
+                });
+            }
+        }
+    }
+
+    pub fn running(&self) -> bool {
+        self.state == ManagerState::Playback
+    }
+}

src/satman/src/mgmt.rs

@@ -0,0 +1,149 @@
+use alloc::vec::Vec;
+
+use byteorder::{ByteOrder, NativeEndian};
+use crc::crc32;
+use io::{ProtoRead, ProtoWrite};
+use libboard_artiq::{drtioaux_proto::SAT_PAYLOAD_MAX_SIZE,
+                     logger::{BufferLogger, LogBufferRef}};
+use libconfig::Config;
+use log::{debug, error, info, warn, LevelFilter};
+
+use crate::routing::{SliceMeta, Sliceable};
+
+type Result<T> = core::result::Result<T, ()>;
+
+pub fn byte_to_level_filter(level_byte: u8) -> Result<LevelFilter> {
+    Ok(match level_byte {
+        0 => LevelFilter::Off,
+        1 => LevelFilter::Error,
+        2 => LevelFilter::Warn,
+        3 => LevelFilter::Info,
+        4 => LevelFilter::Debug,
+        5 => LevelFilter::Trace,
+        lv => {
+            error!("unknown log level: {}", lv);
+            return Err(());
+        }
+    })
+}
+
+fn get_logger_buffer() -> LogBufferRef<'static> {
+    let logger = unsafe { BufferLogger::get_logger().as_mut().unwrap() };
+    loop {
+        if let Some(buffer_ref) = logger.buffer() {
+            return buffer_ref;
+        }
+    }
+}
+
+pub fn clear_log() {
+    let mut buffer = get_logger_buffer();
+    buffer.clear();
+}
+
+pub struct Manager<'a> {
+    cfg: &'a mut Config,
+    last_log: Sliceable,
+    config_payload: Vec<u8>,
+    last_value: Sliceable,
+    image_payload: Vec<u8>,
+}
+
+impl<'a> Manager<'_> {
+    pub fn new(cfg: &mut Config) -> Manager {
+        Manager {
+            cfg: cfg,
+            last_log: Sliceable::new(0, Vec::new()),
+            config_payload: Vec::new(),
+            last_value: Sliceable::new(0, Vec::new()),
+            image_payload: Vec::new(),
+        }
+    }
+
+    pub fn log_get_slice(&mut self, data_slice: &mut [u8; SAT_PAYLOAD_MAX_SIZE], consume: bool) -> SliceMeta {
+        // Populate buffer if depleted
+        if self.last_log.at_end() {
+            let mut buffer = get_logger_buffer();
+            self.last_log.extend(buffer.extract().as_bytes());
+            if consume {
+                buffer.clear();
+            }
+        }
+
+        self.last_log.get_slice_satellite(data_slice)
+    }
+
+    pub fn fetch_config_value(&mut self, key: &str) -> Result<()> {
+        self.cfg
+            .read(&key)
+            .map(|value| {
+                debug!("got value");
+                self.last_value = Sliceable::new(0, value)
+            })
+            .map_err(|_| warn!("read error: no such key"))
+    }
+
+    pub fn get_config_value_slice(&mut self, data_slice: &mut [u8; SAT_PAYLOAD_MAX_SIZE]) -> SliceMeta {
+        self.last_value.get_slice_satellite(data_slice)
+    }
+
+    pub fn add_config_data(&mut self, data: &[u8], data_len: usize) {
+        self.config_payload.write_all(&data[..data_len]).unwrap();
+    }
+
+    pub fn clear_config_data(&mut self) {
+        self.config_payload.clear();
+    }
+
+    pub fn write_config(&mut self) -> Result<()> {
+        let mut payload = &self.config_payload[..];
+        let key = payload.read_string().map_err(|_err| error!("error on reading key"))?;
+        debug!("write key: {}", key);
+        let value = payload.read_bytes().unwrap();
+
+        self.cfg
+            .write(&key, value)
+            .map(|()| debug!("write success"))
+            .map_err(|err| error!("failed to write: {:?}", err))
+    }
+
+    pub fn remove_config(&mut self, key: &str) -> Result<()> {
+        debug!("erase key: {}", key);
+        self.cfg
+            .remove(&key)
+            .map(|()| debug!("erase success"))
+            .map_err(|err| warn!("failed to erase: {:?}", err))
+    }
+
+    pub fn allocate_image_buffer(&mut self, image_size: usize) {
+        self.image_payload = Vec::with_capacity(image_size);
+    }
+
+    pub fn add_image_data(&mut self, data: &[u8], data_len: usize) {
+        self.image_payload.extend(&data[..data_len]);
+    }
+
+    pub fn write_image(&self) {
+        let mut image = self.image_payload.clone();
+        let image_ref = &image[..];
+        let bin_len = image.len() - 4;
+
+        let (image_ref, expected_crc) = {
+            let (image_ref, crc_slice) = image_ref.split_at(bin_len);
+            (image_ref, NativeEndian::read_u32(crc_slice))
+        };
+
+        let actual_crc = crc32::checksum_ieee(image_ref);
+
+        if actual_crc == expected_crc {
+            info!("CRC passed. Writing boot image to SD card...");
+            image.truncate(bin_len);
+            self.cfg.write("boot", image).expect("failed to write boot image");
+        } else {
+            panic!(
+                "CRC failed, images have not been written to flash.\n(actual {:08x}, expected {:08x})",
+                actual_crc, expected_crc
+            );
+        }
+    }
+}

src/satman/src/repeater.rs

@@ -1,19 +1,17 @@
-use libboard_artiq::{drtioaux, drtio_routing};
-use libboard_zynq::timer::GlobalTimer;
-
-#[cfg(has_drtio_routing)]
-use libboard_artiq::{pl::csr};
-#[cfg(has_drtio_routing)]
-use libboard_zynq::time::Milliseconds;
 #[cfg(has_drtio_routing)]
 use embedded_hal::prelude::_embedded_hal_blocking_delay_DelayUs;
+#[cfg(has_drtio_routing)]
+use libboard_artiq::pl::csr;
+use libboard_artiq::{drtio_routing, drtioaux};
+#[cfg(has_drtio_routing)]
+use libboard_zynq::time::Milliseconds;
+use libboard_zynq::timer::GlobalTimer;
+use routing::Router;
 
 #[cfg(has_drtio_routing)]
 fn rep_link_rx_up(repno: u8) -> bool {
     let repno = repno as usize;
-    unsafe {
+    unsafe { (csr::DRTIOREP[repno].rx_up_read)() == 1 }
-        (csr::DRTIOREP[repno].rx_up_read)() == 1
-    }
 }
 
 #[cfg(has_drtio_routing)]
@@ -23,12 +21,14 @@ enum RepeaterState {
     SendPing { ping_count: u16 },
     WaitPingReply { ping_count: u16, timeout: Milliseconds },
     Up,
-    Failed
+    Failed,
 }
 
 #[cfg(has_drtio_routing)]
 impl Default for RepeaterState {
-    fn default() -> RepeaterState { RepeaterState::Down }
+    fn default() -> RepeaterState {
+        RepeaterState::Down
+    }
 }
 
 #[cfg(has_drtio_routing)]
@@ -36,7 +36,7 @@ impl Default for RepeaterState {
 pub struct Repeater {
     repno: u8,
     auxno: u8,
-    state: RepeaterState
+    state: RepeaterState,
 }
 
 #[cfg(has_drtio_routing)]
@@ -45,7 +45,7 @@ impl Repeater {
         Repeater {
             repno: repno,
             auxno: repno + 1,
-            state: RepeaterState::Down
+            state: RepeaterState::Down,
         }
     }
 
@@ -54,8 +54,14 @@ impl Repeater {
         self.state == RepeaterState::Up
     }
 
-    pub fn service(&mut self, routing_table: &drtio_routing::RoutingTable, rank: u8,
+    pub fn service(
-        timer: &mut GlobalTimer) {
+        &mut self,
+        routing_table: &drtio_routing::RoutingTable,
+        rank: u8,
+        destination: u8,
+        router: &mut Router,
+        timer: &mut GlobalTimer,
+    ) {
         self.process_local_errors();
 
         match self.state {
@@ -70,7 +76,7 @@ impl Repeater {
                     drtioaux::send(self.auxno, &drtioaux::Packet::EchoRequest).unwrap();
                     self.state = RepeaterState::WaitPingReply {
                         ping_count: ping_count + 1,
-                        timeout: timer.get_time() + Milliseconds(100)
+                        timeout: timer.get_time() + Milliseconds(100),
                     }
                 } else {
                     error!("[REP#{}] link RX went down during ping", self.repno);
@@ -81,6 +87,10 @@ impl Repeater {
                 if rep_link_rx_up(self.repno) {
                     if let Ok(Some(drtioaux::Packet::EchoReply)) = drtioaux::recv(self.auxno) {
                         info!("[REP#{}] remote replied after {} packets", self.repno, ping_count);
+                        let max_time = timer.get_time() + Milliseconds(200);
+                        while timer.get_time() < max_time {
+                            let _ = drtioaux::recv(self.auxno);
+                        }
                         self.state = RepeaterState::Up;
                         if let Err(e) = self.sync_tsc(timer) {
                             error!("[REP#{}] failed to sync TSC ({:?})", self.repno, e);
@@ -113,7 +123,7 @@ impl Repeater {
                 }
             }
             RepeaterState::Up => {
-                self.process_unsolicited_aux();
+                self.process_unsolicited_aux(routing_table, rank, destination, router);
                 if !rep_link_rx_up(self.repno) {
                     info!("[REP#{}] link is down", self.repno);
                     self.state = RepeaterState::Down;
@@ -128,11 +138,17 @@ impl Repeater {
         }
     }
 
-    fn process_unsolicited_aux(&self) {
+    fn process_unsolicited_aux(
+        &self,
+        routing_table: &drtio_routing::RoutingTable,
+        rank: u8,
+        destination: u8,
+        router: &mut Router,
+    ) {
         match drtioaux::recv(self.auxno) {
-            Ok(Some(packet)) => warn!("[REP#{}] unsolicited aux packet: {:?}", self.repno, packet),
+            Ok(Some(packet)) => router.route(packet, routing_table, rank, destination),
             Ok(None) => (),
-            Err(_) => warn!("[REP#{}] aux packet error", self.repno)
+            Err(_) => warn!("[REP#{}] aux packet error", self.repno),
         }
     }
 
@@ -155,14 +171,20 @@ impl Repeater {
                 cmd = (csr::DRTIOREP[repno].command_missed_cmd_read)();
                 chan_sel = (csr::DRTIOREP[repno].command_missed_chan_sel_read)();
             }
-            error!("[REP#{}] CRI command missed, cmd={}, chan_sel=0x{:06x}", repno, cmd, chan_sel)
+            error!(
+                "[REP#{}] CRI command missed, cmd={}, chan_sel=0x{:06x}",
+                repno, cmd, chan_sel
+            )
         }
         if errors & 8 != 0 {
             let destination;
             unsafe {
                 destination = (csr::DRTIOREP[repno].buffer_space_timeout_dest_read)();
             }
-            error!("[REP#{}] timeout attempting to get remote buffer space, destination=0x{:02x}", repno, destination);
+            error!(
+                "[REP#{}] timeout attempting to get remote buffer space, destination=0x{:02x}",
+                repno, destination
+            );
         }
         unsafe {
             (csr::DRTIOREP[repno].protocol_error_write)(errors);
@@ -181,19 +203,50 @@ impl Repeater {
             match drtioaux::recv(self.auxno) {
                 Ok(Some(packet)) => return Ok(packet),
                 Ok(None) => (),
-                Err(e) => return Err(e)
+                Err(e) => return Err(e),
             }
         }
     }
 
-    pub fn aux_forward(&self, request: &drtioaux::Packet, timer: &mut GlobalTimer) -> Result<(), drtioaux::Error> {
+    pub fn aux_forward(
+        &self,
+        request: &drtioaux::Packet,
+        router: &mut Router,
+        routing_table: &drtio_routing::RoutingTable,
+        rank: u8,
+        self_destination: u8,
+        timer: &mut GlobalTimer,
+    ) -> Result<(), drtioaux::Error> {
+        self.aux_send(request)?;
+        loop {
+            let reply = self.recv_aux_timeout(200, timer)?;
+            match reply {
+                // async/locally requested packets to be consumed or routed
+                // these may come while a packet would be forwarded
+                drtioaux::Packet::DmaPlaybackStatus { .. }
+                | drtioaux::Packet::SubkernelFinished { .. }
+                | drtioaux::Packet::SubkernelMessage { .. }
+                | drtioaux::Packet::SubkernelMessageAck { .. }
+                | drtioaux::Packet::SubkernelLoadRunReply { .. }
+                | drtioaux::Packet::SubkernelException { .. }
+                | drtioaux::Packet::DmaAddTraceReply { .. }
+                | drtioaux::Packet::DmaPlaybackReply { .. } => {
+                    router.route(reply, routing_table, rank, self_destination);
+                }
+                _ => {
+                    drtioaux::send(0, &reply).unwrap();
+                    break;
+                }
+            }
+        }
+        Ok(())
+    }
+
+    pub fn aux_send(&self, request: &drtioaux::Packet) -> Result<(), drtioaux::Error> {
         if self.state != RepeaterState::Up {
             return Err(drtioaux::Error::LinkDown);
         }
-        drtioaux::send(self.auxno, request).unwrap();
+        drtioaux::send(self.auxno, request)
-        let reply = self.recv_aux_timeout(200, timer)?;
-        drtioaux::send(0, &reply).unwrap();
-        Ok(())
     }
 
     pub fn sync_tsc(&self, timer: &mut GlobalTimer) -> Result<(), drtioaux::Error> {
@@ -217,15 +270,24 @@ impl Repeater {
         }
     }
 
-    pub fn set_path(&self, destination: u8, hops: &[u8; drtio_routing::MAX_HOPS], timer: &mut GlobalTimer) -> Result<(), drtioaux::Error> {
+    pub fn set_path(
+        &self,
+        destination: u8,
+        hops: &[u8; drtio_routing::MAX_HOPS],
+        timer: &mut GlobalTimer,
+    ) -> Result<(), drtioaux::Error> {
         if self.state != RepeaterState::Up {
             return Ok(());
         }
 
-        drtioaux::send(self.auxno, &drtioaux::Packet::RoutingSetPath {
+        drtioaux::send(
-            destination: destination,
+            self.auxno,
-            hops: *hops
+            &drtioaux::Packet::RoutingSetPath {
-        }).unwrap();
+                destination: destination,
+                hops: *hops,
+            },
+        )
+        .unwrap();
         let reply = self.recv_aux_timeout(200, timer)?;
         if reply != drtioaux::Packet::RoutingAck {
             return Err(drtioaux::Error::UnexpectedReply);
@@ -233,7 +295,11 @@ impl Repeater {
         Ok(())
     }
 
-    pub fn load_routing_table(&self, routing_table: &drtio_routing::RoutingTable, timer: &mut GlobalTimer) -> Result<(), drtioaux::Error> {
+    pub fn load_routing_table(
+        &self,
+        routing_table: &drtio_routing::RoutingTable,
+        timer: &mut GlobalTimer,
+    ) -> Result<(), drtioaux::Error> {
         for i in 0..drtio_routing::DEST_COUNT {
             self.set_path(i as u8, &routing_table.0[i], timer)?;
         }
@@ -244,9 +310,7 @@ impl Repeater {
         if self.state != RepeaterState::Up {
             return Ok(());
         }
-        drtioaux::send(self.auxno, &drtioaux::Packet::RoutingSetRank {
+        drtioaux::send(self.auxno, &drtioaux::Packet::RoutingSetRank { rank: rank }).unwrap();
-            rank: rank
-        }).unwrap();
         let reply = self.recv_aux_timeout(200, timer)?;
         if reply != drtioaux::Packet::RoutingAck {
             return Err(drtioaux::Error::UnexpectedReply);
@@ -256,9 +320,13 @@ impl Repeater {
 
     pub fn rtio_reset(&self, timer: &mut GlobalTimer) -> Result<(), drtioaux::Error> {
         let repno = self.repno as usize;
-        unsafe { (csr::DRTIOREP[repno].reset_write)(1); }
+        unsafe {
+            (csr::DRTIOREP[repno].reset_write)(1);
+        }
         timer.delay_us(100);
-        unsafe { (csr::DRTIOREP[repno].reset_write)(0); }
+        unsafe {
+            (csr::DRTIOREP[repno].reset_write)(0);
+        }
 
         if self.state != RepeaterState::Up {
             return Ok(());
@@ -275,16 +343,29 @@ impl Repeater {
 
 #[cfg(not(has_drtio_routing))]
 #[derive(Clone, Copy, Default)]
-pub struct Repeater {
+pub struct Repeater {}
-}
 
 #[cfg(not(has_drtio_routing))]
 impl Repeater {
-    pub fn new(_repno: u8) -> Repeater { Repeater::default() }
+    pub fn new(_repno: u8) -> Repeater {
+        Repeater::default()
+    }
 
-    pub fn service(&self, _routing_table: &drtio_routing::RoutingTable, _rank: u8, _timer: &mut GlobalTimer) { }
+    pub fn service(
+        &self,
+        _routing_table: &drtio_routing::RoutingTable,
+        _rank: u8,
+        _destination: u8,
+        _router: &mut Router,
+        _timer: &mut GlobalTimer,
+    ) {
+    }
 
-    pub fn sync_tsc(&self, _timer: &mut GlobalTimer) -> Result<(), drtioaux::Error> { Ok(()) }
+    pub fn sync_tsc(&self, _timer: &mut GlobalTimer) -> Result<(), drtioaux::Error> {
+        Ok(())
+    }
 
-    pub fn rtio_reset(&self, _timer: &mut GlobalTimer) -> Result<(), drtioaux::Error> { Ok(()) }
+    pub fn rtio_reset(&self, _timer: &mut GlobalTimer) -> Result<(), drtioaux::Error> {
+        Ok(())
+    }
 }

src/satman/src/routing.rs

@@ -0,0 +1,174 @@
+use alloc::{collections::vec_deque::VecDeque, vec::Vec};
+use core::cmp::min;
+
+#[cfg(has_drtio_routing)]
+use libboard_artiq::pl::csr;
+use libboard_artiq::{drtio_routing, drtioaux,
+                     drtioaux_proto::{PayloadStatus, MASTER_PAYLOAD_MAX_SIZE, SAT_PAYLOAD_MAX_SIZE}};
+
+pub struct SliceMeta {
+    pub destination: u8,
+    pub len: u16,
+    pub status: PayloadStatus,
+}
+
+/* represents data that has to be sent to Master */
+#[derive(Debug)]
+pub struct Sliceable {
+    it: usize,
+    data: Vec<u8>,
+    destination: u8,
+}
+
+macro_rules! get_slice_fn {
+    ($name:tt, $size:expr) => {
+        pub fn $name(&mut self, data_slice: &mut [u8; $size]) -> SliceMeta {
+            let first = self.it == 0;
+            let len = min($size, self.data.len() - self.it);
+            let last = self.it + len == self.data.len();
+            let status = PayloadStatus::from_status(first, last);
+
+            data_slice[..len].clone_from_slice(&self.data[self.it..self.it + len]);
+            self.it += len;
+
+            SliceMeta {
+                destination: self.destination,
+                len: len as u16,
+                status: status,
+            }
+        }
+    };
+}
+
+impl Sliceable {
+    pub fn new(destination: u8, data: Vec<u8>) -> Sliceable {
+        Sliceable {
+            it: 0,
+            data: data,
+            destination: destination,
+        }
+    }
+
+    pub fn at_end(&self) -> bool {
+        self.it == self.data.len()
+    }
+
+    pub fn extend(&mut self, data: &[u8]) {
+        self.data.extend(data);
+    }
+
+    get_slice_fn!(get_slice_master, MASTER_PAYLOAD_MAX_SIZE);
+    get_slice_fn!(get_slice_satellite, SAT_PAYLOAD_MAX_SIZE);
+}
+
+// Packets from downstream (further satellites) are received and routed appropriately.
+// they're passed as soon as possible downstream (within the subtree), or sent upstream,
+// which is notified about pending packets.
+// for rank 1 (connected to master) satellites, these packets are passed as an answer to DestinationStatusRequest;
+// for higher ranks, after getting a notification, it will transact with downstream to get the pending packets.
+
+// forward! macro is not deprecated, as routable packets are only these that can originate
+// from both master and satellite, e.g. DDMA and Subkernel.
+
+pub struct Router {
+    upstream_queue: VecDeque<drtioaux::Packet>,
+    local_queue: VecDeque<drtioaux::Packet>,
+    #[cfg(has_drtio_routing)]
+    downstream_queue: VecDeque<(usize, drtioaux::Packet)>,
+}
+
+impl Router {
+    pub fn new() -> Router {
+        Router {
+            upstream_queue: VecDeque::new(),
+            local_queue: VecDeque::new(),
+            #[cfg(has_drtio_routing)]
+            downstream_queue: VecDeque::new(),
+        }
+    }
+
+    // Called by local sources (DDMA, kernel) and by repeaters on receiving async data;
+    // messages are always buffered for both upstream and downstream
+    pub fn route(
+        &mut self,
+        packet: drtioaux::Packet,
+        _routing_table: &drtio_routing::RoutingTable,
+        _rank: u8,
+        self_destination: u8,
+    ) {
+        let destination = packet.routable_destination();
+        #[cfg(has_drtio_routing)]
+        {
+            if let Some(destination) = destination {
+                let hop = _routing_table.0[destination as usize][_rank as usize] as usize;
+                if destination == self_destination {
+                    self.local_queue.push_back(packet);
+                } else if hop > 0 && hop < csr::DRTIOREP.len() {
+                    let repno = (hop - 1) as usize;
+                    self.downstream_queue.push_back((repno, packet));
+                } else {
+                    self.upstream_queue.push_back(packet);
+                }
+            } else {
+                error!("Received an unroutable packet: {:?}", packet);
+            }
+        }
+        #[cfg(not(has_drtio_routing))]
+        {
+            if destination == Some(self_destination) {
+                self.local_queue.push_back(packet);
+            } else {
+                self.upstream_queue.push_back(packet);
+            }
+        }
+    }
+
+    // Sends a packet to a required destination, routing if necessary
+    pub fn send(
+        &mut self,
+        packet: drtioaux::Packet,
+        _routing_table: &drtio_routing::RoutingTable,
+        _rank: u8,
+        _destination: u8,
+    ) -> Result<(), drtioaux::Error> {
+        #[cfg(has_drtio_routing)]
+        {
+            let destination = packet.routable_destination();
+            if let Some(destination) = destination {
+                let hop = _routing_table.0[destination as usize][_rank as usize] as usize;
+                if destination == 0 {
+                    // response is needed immediately if master required it
+                    drtioaux::send(0, &packet)?;
+                } else if !(hop > 0 && hop < csr::DRTIOREP.len()) {
+                    // higher rank can wait
+                    self.upstream_queue.push_back(packet);
+                } else {
+                    let repno = (hop - 1) as usize;
+                    // transaction will occur at closest possible opportunity
+                    self.downstream_queue.push_back((repno, packet));
+                }
+                Ok(())
+            } else {
+                // packet not supported in routing, fallback - sent directly
+                drtioaux::send(0, &packet)
+            }
+        }
+        #[cfg(not(has_drtio_routing))]
+        {
+            drtioaux::send(0, &packet)
+        }
+    }
+
+    pub fn get_upstream_packet(&mut self) -> Option<drtioaux::Packet> {
+        self.upstream_queue.pop_front()
+    }
+
+    #[cfg(has_drtio_routing)]
+    pub fn get_downstream_packet(&mut self) -> Option<(usize, drtioaux::Packet)> {
+        self.downstream_queue.pop_front()
+    }
+
+    pub fn get_local_packet(&mut self) -> Option<drtioaux::Packet> {
+        self.local_queue.pop_front()
+    }
+}