flake: add missing attributes on rustc (for nixpkgs-unstable compat)

flake: update nixpkgs
switch to oxalica rust overlay
2024-11-16 17:31:34 +08:00 · 2024-11-16 17:15:03 +08:00 · 2024-11-16 17:14:37 +08:00 · 2024-11-15 13:09:17 -08:00 · 2024-10-04 23:38:28 -07:00 · 2024-09-30 14:15:10 +08:00
121 changed files with 7006 additions and 17797 deletions
--- a/.cargo/config
+++ b/.cargo/config
@ -1,5 +1,4 @@
 [target.armv7-none-eabihf]
-runner = "./runner.sh"
 rustflags = [
  "-C", "link-arg=-Tlink.x",
  "-C", "target-feature=a9,armv7-a,neon",
--- a/.gitignore
+++ b/.gitignore
@ -1 +1,2 @@
 /target
+result*
--- a/Cargo.lock
+++ b/Cargo.lock
@ -2,181 +2,257 @@
 # It is not intended for manual editing.
 [[package]]
 name = "bit_field"
-version = "0.10.0"
+version = "0.10.1"
 source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "dcb6dd1c2376d2e096796e234a70e17e94cc2d5d54ff8ce42b28cef1d0d359a4"

 [[package]]
 name = "bitflags"
-version = "1.2.1"
+version = "1.3.2"
 source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "bef38d45163c2f1dde094a7dfd33ccf595c92905c8f8f4fdc18d06fb1037718a"

 [[package]]
 name = "byteorder"
-version = "1.3.4"
+version = "1.4.3"
 source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "14c189c53d098945499cdfa7ecc63567cf3886b3332b312a5b4585d8d3a6a610"
+
+[[package]]
+name = "cc"
+version = "1.0.73"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "2fff2a6927b3bb87f9595d67196a70493f627687a71d87a0d692242c33f58c11"

 [[package]]
 name = "cfg-if"
-version = "0.1.10"
+version = "1.0.0"
 source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "baf1de4339761588bc0619e3cbc0120ee582ebb74b53b4efbf79117bd2da40fd"

 [[package]]
 name = "compiler_builtins"
-version = "0.1.27"
+version = "0.1.39"
 source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "3748f82c7d366a0b4950257d19db685d4958d2fa27c6d164a3f069fec42b748b"
+
+[[package]]
+name = "core_io"
+version = "0.1.20210325"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "97f8932064288cc79feb4d343a399d353a6f6f001e586ece47fe518a9e8507df"
+dependencies = [
+ "rustc_version",
+]

 [[package]]
 name = "embedded-hal"
-version = "0.2.3"
+version = "0.2.7"
 source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "35949884794ad573cf46071e41c9b60efb0cb311e3ca01f7af807af1debc66ff"
 dependencies = [
- "nb 0.1.2 (registry+https://github.com/rust-lang/crates.io-index)",
- "void 1.0.2 (registry+https://github.com/rust-lang/crates.io-index)",
+ "nb 0.1.3",
+ "void",
 ]

 [[package]]
 name = "experiments"
 version = "0.0.0"
 dependencies = [
- "embedded-hal 0.2.3 (registry+https://github.com/rust-lang/crates.io-index)",
- "libasync 0.0.0",
- "libboard_zynq 0.0.0",
- "libcortex_a9 0.0.0",
- "libregister 0.0.0",
- "libsupport_zynq 0.0.0",
- "log 0.4.8 (registry+https://github.com/rust-lang/crates.io-index)",
+ "embedded-hal",
+ "libasync",
+ "libboard_zynq",
+ "libcortex_a9",
+ "libregister",
+ "libsupport_zynq",
+ "log",
+]
+
+[[package]]
+name = "fatfs"
+version = "0.3.5"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "e18f80a87439240dac45d927fd8f8081b6f1e34c03e97271189fa8a8c2e96c8f"
+dependencies = [
+ "bitflags",
+ "byteorder",
+ "core_io",
+ "log",
 ]

 [[package]]
 name = "libasync"
 version = "0.0.0"
 dependencies = [
- "embedded-hal 0.2.3 (registry+https://github.com/rust-lang/crates.io-index)",
- "libcortex_a9 0.0.0",
- "nb 0.1.2 (registry+https://github.com/rust-lang/crates.io-index)",
- "pin-utils 0.1.0 (registry+https://github.com/rust-lang/crates.io-index)",
- "smoltcp 0.6.0 (registry+https://github.com/rust-lang/crates.io-index)",
+ "embedded-hal",
+ "libcortex_a9",
+ "nb 1.0.0",
+ "pin-utils",
+ "smoltcp",
 ]

 [[package]]
 name = "libboard_zynq"
 version = "0.0.0"
 dependencies = [
- "bit_field 0.10.0 (registry+https://github.com/rust-lang/crates.io-index)",
- "embedded-hal 0.2.3 (registry+https://github.com/rust-lang/crates.io-index)",
- "libcortex_a9 0.0.0",
- "libregister 0.0.0",
- "log 0.4.8 (registry+https://github.com/rust-lang/crates.io-index)",
- "nb 0.1.2 (registry+https://github.com/rust-lang/crates.io-index)",
- "smoltcp 0.6.0 (registry+https://github.com/rust-lang/crates.io-index)",
- "void 1.0.2 (registry+https://github.com/rust-lang/crates.io-index)",
- "volatile-register 0.2.0 (registry+https://github.com/rust-lang/crates.io-index)",
+ "bit_field",
+ "embedded-hal",
+ "libasync",
+ "libcortex_a9",
+ "libregister",
+ "log",
+ "nb 0.1.3",
+ "smoltcp",
+ "void",
+ "volatile-register",
+]
+
+[[package]]
+name = "libconfig"
+version = "0.1.0"
+dependencies = [
+ "core_io",
+ "fatfs",
+ "libboard_zynq",
+ "log",
 ]

 [[package]]
 name = "libcortex_a9"
 version = "0.0.0"
 dependencies = [
- "bit_field 0.10.0 (registry+https://github.com/rust-lang/crates.io-index)",
- "libregister 0.0.0",
+ "bit_field",
+ "libregister",
+ "volatile-register",
 ]

 [[package]]
 name = "libregister"
 version = "0.0.0"
 dependencies = [
- "bit_field 0.10.0 (registry+https://github.com/rust-lang/crates.io-index)",
- "vcell 0.1.2 (registry+https://github.com/rust-lang/crates.io-index)",
- "volatile-register 0.2.0 (registry+https://github.com/rust-lang/crates.io-index)",
+ "bit_field",
+ "vcell",
+ "volatile-register",
 ]

 [[package]]
 name = "libsupport_zynq"
 version = "0.0.0"
 dependencies = [
- "compiler_builtins 0.1.27 (registry+https://github.com/rust-lang/crates.io-index)",
- "libboard_zynq 0.0.0",
- "libcortex_a9 0.0.0",
- "libregister 0.0.0",
- "linked_list_allocator 0.8.4 (registry+https://github.com/rust-lang/crates.io-index)",
- "r0 1.0.0 (registry+https://github.com/rust-lang/crates.io-index)",
+ "cc",
+ "compiler_builtins",
+ "libboard_zynq",
+ "libcortex_a9",
+ "libregister",
+ "linked_list_allocator",
+ "r0",
 ]

 [[package]]
 name = "linked_list_allocator"
-version = "0.8.4"
+version = "0.8.11"
 source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "822add9edb1860698b79522510da17bef885171f75aa395cff099d770c609c24"

 [[package]]
 name = "log"
-version = "0.4.8"
+version = "0.4.14"
 source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "51b9bbe6c47d51fc3e1a9b945965946b4c44142ab8792c50835a980d362c2710"
 dependencies = [
- "cfg-if 0.1.10 (registry+https://github.com/rust-lang/crates.io-index)",
+ "cfg-if",
 ]

 [[package]]
 name = "managed"
-version = "0.7.1"
+version = "0.7.2"
 source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "c75de51135344a4f8ed3cfe2720dc27736f7711989703a0b43aadf3753c55577"

 [[package]]
 name = "nb"
-version = "0.1.2"
+version = "0.1.3"
 source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "801d31da0513b6ec5214e9bf433a77966320625a37860f910be265be6e18d06f"
+dependencies = [
+ "nb 1.0.0",
+]
+
+[[package]]
+name = "nb"
+version = "1.0.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "546c37ac5d9e56f55e73b677106873d9d9f5190605e41a856503623648488cae"

 [[package]]
 name = "pin-utils"
 version = "0.1.0"
 source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "8b870d8c151b6f2fb93e84a13146138f05d02ed11c7e7c54f8826aaaf7c9f184"

 [[package]]
 name = "r0"
 version = "1.0.0"
 source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "bd7a31eed1591dcbc95d92ad7161908e72f4677f8fabf2a32ca49b4237cbf211"
+
+[[package]]
+name = "rustc_version"
+version = "0.1.7"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "c5f5376ea5e30ce23c03eb77cbe4962b988deead10910c372b226388b594c084"
+dependencies = [
+ "semver",
+]
+
+[[package]]
+name = "semver"
+version = "0.1.20"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "d4f410fedcf71af0345d7607d246e7ad15faaadd49d240ee3b24e5dc21a820ac"

 [[package]]
 name = "smoltcp"
-version = "0.6.0"
+version = "0.7.5"
 source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "3e4a069bef843d170df47e7c0a8bf8d037f217d9f5b325865acc3e466ffe40d3"
 dependencies = [
- "bitflags 1.2.1 (registry+https://github.com/rust-lang/crates.io-index)",
- "byteorder 1.3.4 (registry+https://github.com/rust-lang/crates.io-index)",
- "managed 0.7.1 (registry+https://github.com/rust-lang/crates.io-index)",
+ "bitflags",
+ "byteorder",
+ "managed",
+]
+
+[[package]]
+name = "szl"
+version = "0.1.0"
+dependencies = [
+ "byteorder",
+ "core_io",
+ "libboard_zynq",
+ "libconfig",
+ "libcortex_a9",
+ "libregister",
+ "libsupport_zynq",
+ "log",
 ]

 [[package]]
 name = "vcell"
-version = "0.1.2"
+version = "0.1.3"
 source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "77439c1b53d2303b20d9459b1ade71a83c716e3f9c34f3228c00e6f185d6c002"

 [[package]]
 name = "void"
 version = "1.0.2"
 source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "6a02e4885ed3bc0f2de90ea6dd45ebcbb66dacffe03547fadbb0eeae2770887d"

 [[package]]
 name = "volatile-register"
-version = "0.2.0"
+version = "0.2.1"
 source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "9ee8f19f9d74293faf70901bc20ad067dc1ad390d2cbf1e3f75f721ffee908b6"
 dependencies = [
- "vcell 0.1.2 (registry+https://github.com/rust-lang/crates.io-index)",
+ "vcell",
 ]
-
-[metadata]
-"checksum bit_field 0.10.0 (registry+https://github.com/rust-lang/crates.io-index)" = "a165d606cf084741d4ac3a28fb6e9b1eb0bd31f6cd999098cfddb0b2ab381dc0"
-"checksum bitflags 1.2.1 (registry+https://github.com/rust-lang/crates.io-index)" = "cf1de2fe8c75bc145a2f577add951f8134889b4795d47466a54a5c846d691693"
-"checksum byteorder 1.3.4 (registry+https://github.com/rust-lang/crates.io-index)" = "08c48aae112d48ed9f069b33538ea9e3e90aa263cfa3d1c24309612b1f7472de"
-"checksum cfg-if 0.1.10 (registry+https://github.com/rust-lang/crates.io-index)" = "4785bdd1c96b2a846b2bd7cc02e86b6b3dbf14e7e53446c4f54c92a361040822"
-"checksum compiler_builtins 0.1.27 (registry+https://github.com/rust-lang/crates.io-index)" = "38f18416546abfbf8d801c555a0e99524453e7214f9cc9107ad49de3d5948ccc"
-"checksum embedded-hal 0.2.3 (registry+https://github.com/rust-lang/crates.io-index)" = "ee4908a155094da7723c2d60d617b820061e3b4efcc3d9e293d206a5a76c170b"
-"checksum linked_list_allocator 0.8.4 (registry+https://github.com/rust-lang/crates.io-index)" = "e70e46c13c0e8374c26cec5752e3347ca1087d9711de8f45aa513a7700efd73d"
-"checksum log 0.4.8 (registry+https://github.com/rust-lang/crates.io-index)" = "14b6052be84e6b71ab17edffc2eeabf5c2c3ae1fdb464aae35ac50c67a44e1f7"
-"checksum managed 0.7.1 (registry+https://github.com/rust-lang/crates.io-index)" = "fdcec5e97041c7f0f1c5b7d93f12e57293c831c646f4cc7a5db59460c7ea8de6"
-"checksum nb 0.1.2 (registry+https://github.com/rust-lang/crates.io-index)" = "b1411551beb3c11dedfb0a90a0fa256b47d28b9ec2cdff34c25a2fa59e45dbdc"
-"checksum pin-utils 0.1.0 (registry+https://github.com/rust-lang/crates.io-index)" = "8b870d8c151b6f2fb93e84a13146138f05d02ed11c7e7c54f8826aaaf7c9f184"
-"checksum r0 1.0.0 (registry+https://github.com/rust-lang/crates.io-index)" = "bd7a31eed1591dcbc95d92ad7161908e72f4677f8fabf2a32ca49b4237cbf211"
-"checksum smoltcp 0.6.0 (registry+https://github.com/rust-lang/crates.io-index)" = "0fe46639fd2ec79eadf8fe719f237a7a0bd4dac5d957f1ca5bbdbc1c3c39e53a"
-"checksum vcell 0.1.2 (registry+https://github.com/rust-lang/crates.io-index)" = "876e32dcadfe563a4289e994f7cb391197f362b6315dc45e8ba4aa6f564a4b3c"
-"checksum void 1.0.2 (registry+https://github.com/rust-lang/crates.io-index)" = "6a02e4885ed3bc0f2de90ea6dd45ebcbb66dacffe03547fadbb0eeae2770887d"
-"checksum volatile-register 0.2.0 (registry+https://github.com/rust-lang/crates.io-index)" = "0d67cb4616d99b940db1d6bd28844ff97108b498a6ca850e5b6191a532063286"
--- a/Cargo.toml
+++ b/Cargo.toml
@ -1,19 +1,20 @@
 [workspace]
 members = [
-  "libregister", "libcortex_a9",
-  "libboard_zynq", "libsupport_zynq",
+  "libregister",
+  "libcortex_a9",
+  "libboard_zynq",
+  "libsupport_zynq",
  "libasync",
+  "libconfig",
  "experiments",
+  "szl",
 ]

-[profile.dev]
-panic = "abort"
-lto = false
-
 [profile.release]
 panic = "abort"
 debug = true
-# Link-Time Optimization:
-# turn off if you get unusable debug symbols.
+codegen-units = 1
+opt-level = 's'
 lto = true
-opt-level = 'z'  # Optimize for size.
+debug-assertions = false
+overflow-checks = false
--- a/165
+++ b/165
@ -0,0 +1,165 @@
+                   GNU LESSER GENERAL PUBLIC LICENSE
+                       Version 3, 29 June 2007
+
+ Copyright (C) 2007 Free Software Foundation, Inc. <http://fsf.org/>
+ Everyone is permitted to copy and distribute verbatim copies
+ of this license document, but changing it is not allowed.
+
+
+  This version of the GNU Lesser General Public License incorporates
+the terms and conditions of version 3 of the GNU General Public
+License, supplemented by the additional permissions listed below.
+
+  0. Additional Definitions.
+
+  As used herein, "this License" refers to version 3 of the GNU Lesser
+General Public License, and the "GNU GPL" refers to version 3 of the GNU
+General Public License.
+
+  "The Library" refers to a covered work governed by this License,
+other than an Application or a Combined Work as defined below.
+
+  An "Application" is any work that makes use of an interface provided
+by the Library, but which is not otherwise based on the Library.
+Defining a subclass of a class defined by the Library is deemed a mode
+of using an interface provided by the Library.
+
+  A "Combined Work" is a work produced by combining or linking an
+Application with the Library.  The particular version of the Library
+with which the Combined Work was made is also called the "Linked
+Version".
+
+  The "Minimal Corresponding Source" for a Combined Work means the
+Corresponding Source for the Combined Work, excluding any source code
+for portions of the Combined Work that, considered in isolation, are
+based on the Application, and not on the Linked Version.
+
+  The "Corresponding Application Code" for a Combined Work means the
+object code and/or source code for the Application, including any data
+and utility programs needed for reproducing the Combined Work from the
+Application, but excluding the System Libraries of the Combined Work.
+
+  1. Exception to Section 3 of the GNU GPL.
+
+  You may convey a covered work under sections 3 and 4 of this License
+without being bound by section 3 of the GNU GPL.
+
+  2. Conveying Modified Versions.
+
+  If you modify a copy of the Library, and, in your modifications, a
+facility refers to a function or data to be supplied by an Application
+that uses the facility (other than as an argument passed when the
+facility is invoked), then you may convey a copy of the modified
+version:
+
+   a) under this License, provided that you make a good faith effort to
+   ensure that, in the event an Application does not supply the
+   function or data, the facility still operates, and performs
+   whatever part of its purpose remains meaningful, or
+
+   b) under the GNU GPL, with none of the additional permissions of
+   this License applicable to that copy.
+
+  3. Object Code Incorporating Material from Library Header Files.
+
+  The object code form of an Application may incorporate material from
+a header file that is part of the Library.  You may convey such object
+code under terms of your choice, provided that, if the incorporated
+material is not limited to numerical parameters, data structure
+layouts and accessors, or small macros, inline functions and templates
+(ten or fewer lines in length), you do both of the following:
+
+   a) Give prominent notice with each copy of the object code that the
+   Library is used in it and that the Library and its use are
+   covered by this License.
+
+   b) Accompany the object code with a copy of the GNU GPL and this license
+   document.
+
+  4. Combined Works.
+
+  You may convey a Combined Work under terms of your choice that,
+taken together, effectively do not restrict modification of the
+portions of the Library contained in the Combined Work and reverse
+engineering for debugging such modifications, if you also do each of
+the following:
+
+   a) Give prominent notice with each copy of the Combined Work that
+   the Library is used in it and that the Library and its use are
+   covered by this License.
+
+   b) Accompany the Combined Work with a copy of the GNU GPL and this license
+   document.
+
+   c) For a Combined Work that displays copyright notices during
+   execution, include the copyright notice for the Library among
+   these notices, as well as a reference directing the user to the
+   copies of the GNU GPL and this license document.
+
+   d) Do one of the following:
+
+       0) Convey the Minimal Corresponding Source under the terms of this
+       License, and the Corresponding Application Code in a form
+       suitable for, and under terms that permit, the user to
+       recombine or relink the Application with a modified version of
+       the Linked Version to produce a modified Combined Work, in the
+       manner specified by section 6 of the GNU GPL for conveying
+       Corresponding Source.
+
+       1) Use a suitable shared library mechanism for linking with the
+       Library.  A suitable mechanism is one that (a) uses at run time
+       a copy of the Library already present on the user's computer
+       system, and (b) will operate properly with a modified version
+       of the Library that is interface-compatible with the Linked
+       Version.
+
+   e) Provide Installation Information, but only if you would otherwise
+   be required to provide such information under section 6 of the
+   GNU GPL, and only to the extent that such information is
+   necessary to install and execute a modified version of the
+   Combined Work produced by recombining or relinking the
+   Application with a modified version of the Linked Version. (If
+   you use option 4d0, the Installation Information must accompany
+   the Minimal Corresponding Source and Corresponding Application
+   Code. If you use option 4d1, you must provide the Installation
+   Information in the manner specified by section 6 of the GNU GPL
+   for conveying Corresponding Source.)
+
+  5. Combined Libraries.
+
+  You may place library facilities that are a work based on the
+Library side by side in a single library together with other library
+facilities that are not Applications and are not covered by this
+License, and convey such a combined library under terms of your
+choice, if you do both of the following:
+
+   a) Accompany the combined library with a copy of the same work based
+   on the Library, uncombined with any other library facilities,
+   conveyed under the terms of this License.
+
+   b) Give prominent notice with the combined library that part of it
+   is a work based on the Library, and explaining where to find the
+   accompanying uncombined form of the same work.
+
+  6. Revised Versions of the GNU Lesser General Public License.
+
+  The Free Software Foundation may publish revised and/or new versions
+of the GNU Lesser General Public License from time to time. Such new
+versions will be similar in spirit to the present version, but may
+differ in detail to address new problems or concerns.
+
+  Each version is given a distinguishing version number. If the
+Library as you received it specifies that a certain numbered version
+of the GNU Lesser General Public License "or any later version"
+applies to it, you have the option of following the terms and
+conditions either of that published version or of any later version
+published by the Free Software Foundation. If the Library as you
+received it does not specify a version number of the GNU Lesser
+General Public License, you may choose any version of the GNU Lesser
+General Public License ever published by the Free Software Foundation.
+
+  If the Library as you received it specifies that a proxy can decide
+whether future versions of the GNU Lesser General Public License shall
+apply, that proxy's public statement of acceptance of any version is
+permanent authorization for you to choose that version for the
+Library.
--- a/README.md
+++ b/README.md
@ -1,47 +1,49 @@
-# Build
+# Bare-metal Rust on Zynq-7000
+
+Supported features:
+
+* Clocking setup
+* UART
+* SDRAM setup
+* Ethernet with smoltcp and async-await on TCP sockets
+* SD card
+* PL programming and startup
+* Pure Rust SZL first-stage bootloader, with SD boot and netboot
+* Control of second CPU core and message passing, with async-await support
+
+
+Supported boards:
+ * Kasli-SoC
+ * ZC706
+ * Red Pitaya
+ * Cora Z7-10 (seems to also run on Cora Z7-07S, including dual-core support)
+
+## Build
+
+Zynq-rs is packaged using the [Nix](https://nixos.org) Flakes system. Install Nix 2.4+ and enable flakes by adding ``experimental-features = nix-command flakes`` to ``nix.conf`` (e.g. ``~/.config/nix/nix.conf``). 
+
+You can build SZL or experiments crate for the platform of your choice by using ``nix build`` command, e.g.

 ```shell
-nix-shell --command "cargo xbuild --release -p experiments"
+nix build .#coraz7-experiments
 ```

-Currently the ELF output is placed at `target/armv7-none-eabihf/release/experiments`
+Alternatively, you can still use ``cargo xbuild`` within ``nix develop`` shell.

-# Debug
-
-## Using the Xilinx toolchain
-
-Tested with the ZC706 board.
-
-Run the Xilinx Microprocessor Debugger:
 ```shell
-/opt/Xilinx/14.7/ISE_DS/EDK/bin/lin64/xmd
+nix develop
+cargo xbuild --release -p experiments
 ```

-Connect to target (given it is connected and you have permissions):
-```tcl
-connect arm hw
-```
+Currently the ELF output is placed at `target/armv7-none-eabihf/release/experiments`, or `result/experiments.elf` for Nix Flakes build.

-Leave xmd running.
-
-Start the Xilinx version of the GNU debugger with your latest build:
-```shell
-/opt/Xilinx/14.7/ISE_DS/EDK/gnu/arm/lin/bin/arm-xilinx-linux-gnueabi-gdb zc706
-```
-
-Connect the debugger to xmd over TCP on localhost:
-```gdb
-target remote :1234
-```
-
-Proceed using gdb with `load`, `c`
-
-## Using OpenOCD
+## Debug

 ### Running on the ZC706

 ```shell
-nix-shell --command "cargo xbuild --release -p experiments"
+nix develop
+cargo xbuild --release -p experiments
 cd openocd
 openocd -f zc706.cfg
 ```
@ -49,7 +51,8 @@ openocd -f zc706.cfg
 ### Running on the Cora Z7-10

 ```shell
-nix-shell --command "cd experiments && cargo xbuild --release --no-default-features --features=target_cora_z7_10"
+nix develop
+cargo xbuild --release -p experiments --no-default-features --features=target_coraz7
 cd openocd
 openocd -f cora-z7-10.cfg
 ```
@ -60,43 +63,7 @@ openocd -f cora-z7-10.cfg
 openocd -f zc706.cfg -c "pld load 0 blinker_migen.bit; exit"
 ```

-### Development Process
-
-Clone this repo onto your development/build machine and the raspberry pi that controls the Xilinx 7000 board
-
-On the dev machine, the below script builds zc706 and secure copies it to the target pi (in your pi $HOME directory):
-```shell
-cd ~/zynq-rs
-./build.sh $your_user_or_ssh_id
-```
-
-On the pi, we need an information rich environment that includes a relatively reliable `gdb` experience (that includes `ctrl-p` and `ctrl-n` command history that persists across `cgdb` executions), run:
-```shell
-ssh pi4
-cd zynq-rs
-# For ZC706, run:
-./tmux.sh 0
-# For Cora Z7, run:
-./tmux.sh
-```
-
-Time to run your code with:
-```shell
-zynq-connect
-zynq-restart
-c
-```
-or, for a more succinct experience, (identical to above)
-```shell
-dc
-dr
-c
-```
-
-After every build on your dev machine, simply run:
-```shell
-dr
-c
-```
-Sometimes you might need to type `load` after `dr`.
+## License

+Copyright (C) 2019-2022 M-Labs Limited.
+Released under the GNU LGPL v3. See the LICENSE file for details.
--- a/build.sh
+++ b/build.sh
@ -1 +0,0 @@
-nix-shell --command "cargo xbuild --release -p experiments" && scp -C target/armv7-none-eabihf/release/experiments $1@rpi-4.m-labs.hk:/home/$1/zc706/zc706.elf
--- a/channel-rust-nightly.toml
+++ b/channel-rust-nightly.toml
--- a/default.nix
+++ b/default.nix
@ -1,63 +0,0 @@
-{ # Use master branch of the overlay by default
-  mozillaOverlay ? import (builtins.fetchTarball https://github.com/mozilla/nixpkgs-mozilla/archive/master.tar.gz),
-  rustManifest ? ./channel-rust-nightly.toml,
-}:
-
-let
-  pkgs = import <nixpkgs> { overlays = [ mozillaOverlay ]; };
-  rustcSrc = pkgs.fetchgit {
-    url = https://github.com/rust-lang/rust.git;
-    # master of 2020-04-25
-    rev = "14b15521c52549ebbb113173b4abecd124b5a823";
-    sha256 = "0a6bi8g636cajpdrpcfkpza95b7ss7041m9cs6hxcd7h8bf6xhwi";
-    fetchSubmodules = true;
-  };
-  targets = [];
-  rustChannelOfTargets = _channel: _date: targets:
-    (pkgs.lib.rustLib.fromManifestFile rustManifest {
-      inherit (pkgs) stdenv fetchurl patchelf;
-    }).rust.override { inherit targets; };
-  rust =
-    rustChannelOfTargets "nightly" null targets;
-  rustPlatform = pkgs.recurseIntoAttrs (pkgs.makeRustPlatform {
-    rustc = rust // { src = rustcSrc; };
-    cargo = rust;
-  });
-  gcc = pkgs.pkgsCross.armv7l-hf-multiplatform.buildPackages.gcc;
-  xbuildRustPackage = { cargoFeatures, crateSubdir, ... } @ attrs:
-    let
-      buildPkg = rustPlatform.buildRustPackage attrs;
-    in
-    buildPkg.overrideAttrs ({ name, nativeBuildInputs, ... }: {
-      nativeBuildInputs =
-        nativeBuildInputs ++ [ pkgs.cargo-xbuild ];
-      buildPhase = ''
-        pushd ${crateSubdir}
-        cargo xbuild --release --frozen \
-          --no-default-features \
-          --features=${cargoFeatures}
-        popd
-      '';
-      XARGO_RUST_SRC = "${rustcSrc}/src";
-      installPhase = ''
-        mkdir $out
-        ls -la target/armv7-none-eabihf/release/
-        cp target/armv7-none-eabihf/release/${name} $out/${name}.elf
-      '';
-    });
-  xbuildCrate = name: crate: features: xbuildRustPackage rec {
-    name = "${crate}";
-    src = ./.;
-    crateSubdir = crate;
-    cargoSha256 = "1c1qpg9by8bg93yhgllb5xs155g27qmh99pbrb681wazm8k7nwim";
-    cargoFeatures = features;
-    doCheck = false;
-    dontFixup = true;
-  };
-in {
-  inherit pkgs rustPlatform rustcSrc gcc;
-  zc706 = {
-    experiments-zc706 = xbuildCrate "experiments-zc706" "experiments" "target_zc706";
-    experiments-cora = xbuildCrate "experiments-cora" "experiments" "target_cora_z7_10";
-  };
-}
--- a/experiments/Cargo.toml
+++ b/experiments/Cargo.toml
@ -2,12 +2,15 @@
 name = "experiments"
 description = "Developing bare-metal Rust on Zynq"
 version = "0.0.0"
-authors = ["Astro <astro@spaceboyz.net>"]
+authors = ["M-Labs"]
 edition = "2018"

 [features]
 target_zc706 = ["libboard_zynq/target_zc706", "libsupport_zynq/target_zc706"]
-target_cora_z7_10 = ["libboard_zynq/target_cora_z7_10", "libsupport_zynq/target_cora_z7_10"]
+target_coraz7 = ["libboard_zynq/target_coraz7", "libsupport_zynq/target_coraz7"]
+target_ebaz4205 = ["libboard_zynq/target_ebaz4205", "libsupport_zynq/target_ebaz4205"]
+target_redpitaya = ["libboard_zynq/target_redpitaya", "libsupport_zynq/target_redpitaya"]
+target_kasli_soc = ["libboard_zynq/target_kasli_soc", "libsupport_zynq/target_kasli_soc"]
 default = ["target_zc706"]

 [dependencies]
@ -16,5 +19,5 @@ embedded-hal = "0.2"
 libregister = { path = "../libregister" }
 libcortex_a9 = { path = "../libcortex_a9" }
 libboard_zynq = { path = "../libboard_zynq" }
-libsupport_zynq = { path = "../libsupport_zynq", default-features = false, features = ["panic_handler"]}
+libsupport_zynq = { path = "../libsupport_zynq", default-features = false, features = ["panic_handler", "dummy_fiq_handler"]}
 libasync = { path = "../libasync" }
--- a/experiments/link.x
+++ b/experiments/link.x
@ -34,6 +34,20 @@ SECTIONS
        __bss_end = .;
    } > OCM3

+    .irq_stack1 (NOLOAD) : ALIGN(8)
+    {
+        __irq_stack1_end = .;
+        . += 0x100;
+        __irq_stack1_start = .;
+    } > OCM3
+
+    .irq_stack0 (NOLOAD) : ALIGN(8)
+    {
+        __irq_stack0_end = .;
+        . += 0x100;
+        __irq_stack0_start = .;
+    } > OCM3
+
    .stack1 (NOLOAD) : ALIGN(8) {
        __stack1_end = .;
        . += 0x200;
--- a/experiments/src/main.rs
+++ b/experiments/src/main.rs
@ -2,6 +2,7 @@
 #![no_main]
 #![feature(const_in_array_repeat_expressions)]
 #![feature(naked_functions)]
+#![feature(asm)]

 extern crate alloc;

@ -15,7 +16,7 @@ use libboard_zynq::{
    self as zynq,
    clocks::source::{ArmPll, ClockSource, IoPll},
    clocks::Clocks,
-    print, println, stdio,
+    println, stdio,
    mpcore,
    gic,
    smoltcp::{
@ -25,17 +26,20 @@ use libboard_zynq::{
    },
    time::Milliseconds,
 };
+#[cfg(feature = "target_zc706")]
+use libboard_zynq::print;
 use libcortex_a9::{
    mutex::Mutex,
+    l2c::enable_l2_cache,
    sync_channel::{Sender, Receiver},
    sync_channel,
    regs::{MPIDR, SP},
    spin_lock_yield, notify_spin_lock,
-    asm
+    asm, interrupt_handler
 };
 use libregister::{RegisterR, RegisterW};
 use libsupport_zynq::{
-    boot, ram,
+    boot, exception_vectors, ram,
 };
 use log::{info, warn};
 use core::sync::atomic::{AtomicBool, Ordering};
@ -51,28 +55,35 @@ extern "C" {

 static CORE1_RESTART: AtomicBool = AtomicBool::new(false);

-#[link_section = ".text.boot"]
-#[no_mangle]
-#[naked]
-pub unsafe extern "C" fn IRQ() {
-    if MPIDR.read().cpu_id() == 1{
-        let mpcore = mpcore::RegisterBlock::mpcore();
-        let mut gic = gic::InterruptController::gic(mpcore);
-        let id = gic.get_interrupt_id();
-        if id.0 == 0 {
-            gic.end_interrupt(id);
-            asm::exit_irq();
-            SP.write(&mut __stack1_start as *mut _ as u32);
-            asm::enable_irq();
-            CORE1_RESTART.store(false, Ordering::Relaxed);
-            notify_spin_lock();
-            main_core1();
-        }
+interrupt_handler!(IRQ, irq, __irq_stack0_start, __irq_stack1_start, {
+    let mpcore = mpcore::RegisterBlock::mpcore();
+    let mut gic = gic::InterruptController::gic(mpcore);
+    let id = gic.get_interrupt_id();
+    match MPIDR.read().cpu_id(){
+        0 => {
+            if id.0 == 0 {
+                println!("Interrupting core0...");
+                gic.end_interrupt(id);
+                return;
+            }
+        },
+        1 => {
+            if id.0 == 0 {
+                gic.end_interrupt(id);
+                asm::exit_irq();
+                SP.write(&mut __stack1_start as *mut _ as u32);
+                asm::enable_irq();
+                CORE1_RESTART.store(false, Ordering::Relaxed);
+                notify_spin_lock();
+                main_core1();
+            }
+        },
+        _ => {}
    }
    stdio::drop_uart();
    println!("IRQ");
    loop {}
-}
+});

 pub fn restart_core1() {
    let mut interrupt_controller = gic::InterruptController::gic(mpcore::RegisterBlock::mpcore());
@ -85,12 +96,12 @@ pub fn restart_core1() {

 #[no_mangle]
 pub fn main_core0() {
+    exception_vectors::set_vector_table(0x0);
    // zynq::clocks::CpuClocks::enable_io(1_250_000_000);
-    println!("\nzc706 main");
+    enable_l2_cache(0x8);
+    println!("\nZynq experiments");
    let mut interrupt_controller = gic::InterruptController::gic(mpcore::RegisterBlock::mpcore());
    interrupt_controller.enable_interrupts();
-    // ps7_init::apply();
-    libboard_zynq::stdio::drop_uart();

    libboard_zynq::logger::init().unwrap();
    log::set_max_level(log::LevelFilter::Trace);
@ -103,24 +114,21 @@ pub fn main_core0() {
            .boot_mode_pins()
    );

-    #[cfg(feature = "target_zc706")]
+    #[cfg(any(
+        feature = "target_zc706",
+        feature = "target_ebaz4205",
+        feature = "target_redpitaya",
+        feature = "target_kasli_soc",
+    ))]
    const CPU_FREQ: u32 = 800_000_000;
-    #[cfg(feature = "target_cora_z7_10")]
+    #[cfg(feature = "target_coraz7")]
    const CPU_FREQ: u32 = 650_000_000;

    info!("Setup clock sources...");
    ArmPll::setup(2 * CPU_FREQ);
    Clocks::set_cpu_freq(CPU_FREQ);
-    #[cfg(feature = "target_zc706")]
-    {
-        IoPll::setup(1_000_000_000);
-        libboard_zynq::stdio::drop_uart();
-    }
-    #[cfg(feature = "target_cora_z7_10")]
-    {
-        IoPll::setup(1_000_000_000);
-        libboard_zynq::stdio::drop_uart();
-    }
+    IoPll::setup(1_000_000_000);
+    libboard_zynq::stdio::drop_uart();
    info!("PLLs set up");
    let clocks = zynq::clocks::Clocks::get();
    info!(
@ -131,17 +139,6 @@ pub fn main_core0() {
        clocks.cpu_1x()
    );

-    let mut flash = zynq::flash::Flash::flash(200_000_000).linear_addressing_mode();
-    let flash_ram: &[u8] = unsafe { core::slice::from_raw_parts(flash.ptr(), flash.size()) };
-    for i in 0..=1 {
-        print!("Flash {}:", i);
-        for b in &flash_ram[(i * 16 * 1024 * 1024)..][..128] {
-            print!(" {:02X}", *b);
-        }
-        println!("");
-    }
-    let _flash = flash.stop();
-
    let timer = libboard_zynq::timer::GlobalTimer::start();

    let mut ddr = zynq::ddr::DdrRam::ddrram();
@ -149,44 +146,9 @@ pub fn main_core0() {
    ddr.memtest();
    ram::init_alloc_ddr(&mut ddr);

-    #[cfg(dev)]
-    for i in 0..=1 {
-        let mut flash_io = flash.manual_mode(i);
-        // println!("rdcr={:02X}", flash_io.rdcr());
-        print!("Flash {} ID:", i);
-        for b in flash_io.rdid() {
-            print!(" {:02X}", b);
-        }
-        println!("");
-        print!("Flash {} I/O:", i);
-        for o in 0..8 {
-            const CHUNK: u32 = 8;
-            for b in flash_io.read(CHUNK * o, CHUNK as usize) {
-                print!(" {:02X}", b);
-            }
-        }
-        println!("");
-
-        flash_io.dump("Read cr1", 0x35);
-        flash_io.dump("Read Autoboot", 0x14);
-        flash_io.dump("Read Bank", 0x16);
-        flash_io.dump("DLP Bank", 0x16);
-        flash_io.dump("Read ESig", 0xAB);
-        flash_io.dump("OTP Read", 0x4B);
-        flash_io.dump("DYB Read", 0xE0);
-        flash_io.dump("PPB Read", 0xE2);
-        flash_io.dump("ASP Read", 0x2B);
-        flash_io.dump("Password Read", 0xE7);
-
-        flash_io.write_enabled(|flash_io| {
-            flash_io.erase(0);
-        });
-        flash_io.write_enabled(|flash_io| {
-            flash_io.program(0, [0x23054223; 0x100 >> 2].iter().cloned());
-        });
-
-        flash = flash_io.stop();
-    }
+    info!("Send software interrupt to core0");
+    interrupt_controller.send_sgi(gic::InterruptId(0), gic::CPUCore::Core0.into());
+    info!("Core0 returned from interrupt");

    boot::Core1::start(false);

@ -203,33 +165,33 @@ pub fn main_core0() {
    unsafe {
        core1_req.drop_elements();
    }
-    
+
    // Test I2C
    #[cfg(feature = "target_zc706")]
    {
        let mut i2c = zynq::i2c::I2c::i2c0();
-        i2c.init();
+        i2c.init().unwrap();
        println!("I2C bit-banging enabled");
        let mut eeprom = zynq::i2c::eeprom::EEPROM::new(&mut i2c, 16);
        // Write to 0x00 and 0x08
        let eeprom_buffer: [u8; 22] = [
-            0x66, 0x77, 0x88, 0x99, 0xaa, 0xbb, 
-            0x77, 0x88, 0x99, 0xaa, 0xbb, 0xcc, 0xdd, 0xee, 
+            0x66, 0x77, 0x88, 0x99, 0xaa, 0xbb,
+            0x77, 0x88, 0x99, 0xaa, 0xbb, 0xcc, 0xdd, 0xee,
            0xef, 0xcd, 0xab, 0x89, 0x67, 0x45, 0x23, 0x01,
        ];
-        eeprom.write(0x00, &eeprom_buffer[0..6]);
-        eeprom.write(0x08, &eeprom_buffer[6..22]);
+        eeprom.write(0x00, &eeprom_buffer[0..6]).unwrap();
+        eeprom.write(0x08, &eeprom_buffer[6..22]).unwrap();
        println!("Data written to EEPROM");
        let mut eeprom_buffer = [0u8; 24];
        // Read from 0x00
-        eeprom.read(0x00, &mut eeprom_buffer);
+        eeprom.read(0x00, &mut eeprom_buffer).unwrap();
        print!("Data read from EEPROM @ 0x00: (hex) ");
        for i in 0..6 {
            print!("{:02x} ", eeprom_buffer[i]);
        }
        println!("");
        // Read from 0x08
-        eeprom.read(0x08, &mut eeprom_buffer);
+        eeprom.read(0x08, &mut eeprom_buffer).unwrap();
        print!("Data read from EEPROM @ 0x08: (hex) ");
        for i in 0..16 {
            print!("{:02x} ", eeprom_buffer[i]);
@ -237,6 +199,20 @@ pub fn main_core0() {
        println!("");
    }

+    #[cfg(feature = "target_kasli_soc")]
+    {
+        let mut err_cdwn = timer.countdown();
+        let mut err_state = true;
+        let mut led = zynq::error_led::ErrorLED::error_led();
+        task::spawn( async move { 
+            loop {
+                led.toggle(err_state);
+                err_state = !err_state;
+                delay(&mut err_cdwn, Milliseconds(1000)).await;
+            }
+        });
+    }
+
    let eth = zynq::eth::Eth::eth0(HWADDR.clone());
    println!("Eth on");

@ -270,12 +246,12 @@ pub fn main_core0() {
        while let Ok(stream) = TcpStream::accept(TCP_PORT, 0x10_0000, 0x10_0000).await {
            let stats_tx = stats_tx.clone();
            task::spawn(async move {
-                let tx_data = (0..=255).take(4096).collect::<alloc::vec::Vec<u8>>();
+                let tx_data = (0..=255).cycle().take(4096).collect::<alloc::vec::Vec<u8>>();
                loop {
                    // const CHUNK_SIZE: usize = 65536;
                    // match stream.send((0..=255).cycle().take(CHUNK_SIZE)).await {
                    match stream.send_slice(&tx_data[..]).await {
-                        Ok(len) => stats_tx.borrow_mut().1 += tx_data.len(), //CHUNK_SIZE,
+                        Ok(_len) => stats_tx.borrow_mut().1 += tx_data.len(), //CHUNK_SIZE,
                        Err(e) => {
                            warn!("tx: {:?}", e);
                            break
--- a/flake.lock
+++ b/flake.lock
@ -0,0 +1,49 @@
+{
+  "nodes": {
+    "nixpkgs": {
+      "locked": {
+        "lastModified": 1731652201,
+        "narHash": "sha256-XUO0JKP1hlww0d7mm3kpmIr4hhtR4zicg5Wwes9cPMg=",
+        "owner": "NixOS",
+        "repo": "nixpkgs",
+        "rev": "c21b77913ea840f8bcf9adf4c41cecc2abffd38d",
+        "type": "github"
+      },
+      "original": {
+        "owner": "NixOS",
+        "ref": "nixos-24.05",
+        "repo": "nixpkgs",
+        "type": "github"
+      }
+    },
+    "root": {
+      "inputs": {
+        "nixpkgs": "nixpkgs",
+        "rust-overlay": "rust-overlay"
+      }
+    },
+    "rust-overlay": {
+      "inputs": {
+        "nixpkgs": [
+          "nixpkgs"
+        ]
+      },
+      "locked": {
+        "lastModified": 1719454714,
+        "narHash": "sha256-MojqG0lyUINkEk0b3kM2drsU5vyaF8DFZe/FAlZVOGs=",
+        "owner": "oxalica",
+        "repo": "rust-overlay",
+        "rev": "d1c527659cf076ecc4b96a91c702d080b213801e",
+        "type": "github"
+      },
+      "original": {
+        "owner": "oxalica",
+        "ref": "snapshot/2024-08-01",
+        "repo": "rust-overlay",
+        "type": "github"
+      }
+    }
+  },
+  "root": "root",
+  "version": 7
+}
--- a/flake.nix
+++ b/flake.nix
@ -0,0 +1,179 @@
+{
+  description = "Bare-metal Rust on Zynq-7000";
+
+  inputs.nixpkgs.url = github:NixOS/nixpkgs/nixos-24.05;
+  inputs.rust-overlay = {
+    url = "github:oxalica/rust-overlay?ref=snapshot/2024-08-01";
+    inputs.nixpkgs.follows = "nixpkgs";
+  };
+
+  outputs = { self, nixpkgs, rust-overlay }:
+    let
+      pkgs = import nixpkgs { system = "x86_64-linux"; overlays = [ (import rust-overlay) crosspkgs-overlay ]; };
+      
+      rust = pkgs.rust-bin.nightly."2021-01-28".default.override {
+        extensions = [ "rust-src" ];
+        targets = [ ];
+      };
+      rustPlatform = pkgs.makeRustPlatform {
+        rustc = rust // {
+          # https://github.com/oxalica/rust-overlay/commit/c48c2d76b68dd9ede0815fec53479375c61af857
+          targetPlatforms = pkgs.lib.platforms.all;
+          tier1TargetPlatforms = pkgs.lib.platforms.all;
+          badTargetPlatforms = [ ];
+        };
+        cargo = rust;
+      };
+
+      # https://doc.rust-lang.org/rustc/linker-plugin-lto.html#toolchain-compatibility
+      llvmPackages_11 = pkgs.recurseIntoAttrs (pkgs.callPackage (import ./llvm/11) ({
+        inherit (pkgs.stdenvAdapters) overrideCC;
+        buildLlvmTools = null;
+        targetLlvmLibraries = null;
+        targetLlvm = null;
+      }));
+
+      crosspkgs-overlay = (self: super: {
+        pkgsCross = super.pkgsCross // {
+          zynq-baremetal = import super.path {
+            system = "x86_64-linux";
+            crossSystem = {
+              config = "arm-none-eabihf";
+              libc = "newlib";
+              gcc.cpu = "cortex-a9";
+              gcc.fpu = "vfpv3";
+            };
+          };
+        };
+      });
+
+      mkbootimage = pkgs.stdenv.mkDerivation {
+        pname = "mkbootimage";
+        version = "2.3dev";
+
+        src = pkgs.fetchFromGitHub {
+          owner = "antmicro";
+          repo = "zynq-mkbootimage";
+          rev = "872363ce32c249f8278cf107bc6d3bdeb38d849f";
+          sha256 = "sha256-5FPyAhUWZDwHbqmp9J2ZXTmjaXPz+dzrJMolaNwADHs=";
+        };
+
+        propagatedBuildInputs = [ pkgs.libelf pkgs.pcre ];
+        patchPhase =
+        ''
+          substituteInPlace Makefile --replace "git rev-parse --short HEAD" "echo nix"
+        '';
+        installPhase =
+        ''
+          mkdir -p $out/bin
+          cp mkbootimage $out/bin
+        '';
+        hardeningDisable = [ "fortify" ];
+      };
+
+      fsbl = { board ? "zc706" }: pkgs.stdenv.mkDerivation {
+        name = "${board}-fsbl";
+        src = pkgs.fetchFromGitHub {
+          owner = "Xilinx";
+          repo = "embeddedsw";
+          rev = "xilinx_v2022.2";
+          sha256 = "sha256-UDz9KK/Hw3qM1BAeKif30rE8Bi6C2uvuZlvyvtJCMfw=";
+        };
+        nativeBuildInputs = [
+          pkgs.pkgsCross.zynq-baremetal.buildPackages.binutils
+          pkgs.pkgsCross.zynq-baremetal.buildPackages.gcc
+        ];
+        patchPhase = ''
+          patchShebangs lib/sw_apps/zynq_fsbl/misc/copy_bsp.sh
+
+          for x in lib/sw_apps/zynq_fsbl/src/Makefile lib/sw_apps/zynq_fsbl/misc/copy_bsp.sh lib/bsp/standalone/src/arm/cortexa9/gcc/Makefile; do
+            substituteInPlace $x \
+              --replace "arm-none-eabi-" "arm-none-eabihf-"
+          done
+        '';
+        buildPhase = ''
+          cd lib/sw_apps/zynq_fsbl/src
+          make BOARD=${board} "CFLAGS=-DFSBL_DEBUG_INFO -g"
+        '';
+        installPhase = ''
+          mkdir $out
+          cp fsbl.elf $out
+        '';
+        doCheck = false;
+        dontFixup = true;
+      };
+
+      cargo-xbuild = pkgs.cargo-xbuild.overrideAttrs(oa: {
+        postPatch = "substituteInPlace src/sysroot.rs --replace 2021 2018";
+      });
+
+      build-crate = name: crate: features: rustPlatform.buildRustPackage rec {
+        name = "${crate}";
+
+        src = builtins.filterSource (path: type:
+          baseNameOf path != "target"
+        ) ./.;
+        cargoLock = { lockFile = ./Cargo.lock; };
+
+        nativeBuildInputs = [ cargo-xbuild llvmPackages_11.clang-unwrapped ];
+        buildPhase = ''
+          export XARGO_RUST_SRC="${rust}/lib/rustlib/src/rust/library"
+          export CARGO_HOME=$(mktemp -d cargo-home.XXX)
+          pushd ${crate}
+          cargo xbuild --release --frozen \
+            --no-default-features \
+            --features=${features}
+          popd
+        '';
+
+        installPhase = ''
+          mkdir -p $out $out/nix-support
+          cp target/armv7-none-eabihf/release/${name} $out/${name}.elf
+          echo file binary-dist $out/${name}.elf >> $out/nix-support/hydra-build-products
+        '';
+
+        doCheck = false;
+        dontFixup = true;
+        auditable = false;
+      };
+
+      targetCrates = target: {
+        "${target}-experiments" = build-crate "${target}-experiments" "experiments" "target_${target}";
+        "${target}-szl" = build-crate "${target}-szl" "szl" "target_${target}";
+      };
+      targets = ["zc706" "coraz7" "redpitaya" "kasli_soc" "ebaz4205"];
+      allTargetCrates = (builtins.foldl' (results: target:
+        results // targetCrates target
+      ) {} targets);
+      
+      szl = pkgs.runCommand "szl" {} (builtins.foldl' (commands: target:
+        let
+          szlResult = builtins.getAttr "${target}-szl" allTargetCrates;
+        in
+          commands + "ln -s ${szlResult}/szl.elf $out/szl-${target}.elf\n"
+      ) "mkdir $out\n" targets);
+    in rec {
+      packages.x86_64-linux = { 
+        inherit cargo-xbuild szl mkbootimage;
+        zc706-fsbl = fsbl { board = "zc706"; };
+      } // allTargetCrates ;
+
+      hydraJobs = packages.x86_64-linux;
+
+      inherit rust rustPlatform llvmPackages_11;
+
+      devShell.x86_64-linux = pkgs.mkShell {
+        name = "zynq-rs-dev-shell";
+        buildInputs = [
+          rust
+          cargo-xbuild
+          mkbootimage
+
+          pkgs.openocd pkgs.gdb
+          pkgs.openssh pkgs.rsync
+          llvmPackages_11.clang-unwrapped
+          (pkgs.python3.withPackages(ps: [ ps.pyftdi ]))
+        ];
+      };
+    };
+}
--- a/kasli_soc_por.py
+++ b/kasli_soc_por.py
@ -0,0 +1,17 @@
+from time import sleep
+from pyftdi.ftdi import Ftdi
+
+POR = 1 << 7
+
+def main():
+    dev = Ftdi()
+    dev.open_bitbang_from_url("ftdi://ftdi:4232h/0")
+    dev.set_bitmode(POR, Ftdi.BitMode.BITBANG)
+    dev.write_data(bytes([0]))
+    sleep(0.1)
+    dev.write_data(bytes([POR]))
+    sleep(0.1)
+    dev.close()
+
+if __name__ == "__main__":
+    main()
--- a/libasync/Cargo.toml
+++ b/libasync/Cargo.toml
@ -2,17 +2,17 @@
 name = "libasync"
 description = "low-level async support"
 version = "0.0.0"
-authors = ["Astro <astro@spaceboyz.net>"]
+authors = ["M-Labs"]
 edition = "2018"

 [dependencies]
 #futures = { version = "0.3", default-features = false }
 pin-utils = "0.1.0-alpha.4"
 embedded-hal = "0.2"
-nb = "0.1"
+nb = "1.0"
 libcortex_a9 = { path = "../libcortex_a9" }

 [dependencies.smoltcp]
-version = "0.6"
+version = "0.7"
 default-features = false
 features = ["alloc"]
--- a/libasync/src/executor.rs
+++ b/libasync/src/executor.rs
@ -6,7 +6,7 @@ use core::{
    sync::atomic::{AtomicBool, Ordering},
    task::{Context, Poll, RawWaker, RawWakerVTable, Waker},
 };
-use alloc::{boxed::Box, collections::VecDeque as Deque};
+use alloc::{boxed::Box, vec::Vec};
 //use futures::future::FutureExt;
 use pin_utils::pin_mut;

@ -31,7 +31,7 @@ static VTABLE: RawWakerVTable = {
 /// ready should not move as long as this waker references it. That is
 /// the reason for keeping Tasks in a pinned box.
 fn wrap_waker(ready: &AtomicBool) -> Waker {
-    unsafe { Waker::from_raw(RawWaker::new(ready as *const _ as *const _, &VTABLE)) }
+    unsafe { Waker::from_raw(RawWaker::new(ready as *const _ as *const (), &VTABLE)) }
 }

 /// A single-threaded executor
@ -44,7 +44,7 @@ pub struct Executor {
    /// Tasks reside on the heap, so that we just queue pointers. They
    /// must also be pinned in memory because our RawWaker is a pointer
    /// to their `ready` field.
-    tasks: RefCell<Deque<Pin<Box<Task>>>>,
+    tasks: RefCell<Vec<Pin<Box<Task>>>>,
 }

 impl Executor {
@ -52,7 +52,7 @@ impl Executor {
    pub fn new() -> Self {
        Self {
            in_block_on: RefCell::new(false),
-            tasks: RefCell::new(Deque::new()),
+            tasks: RefCell::new(Vec::new()),
        }
    }

@ -72,6 +72,7 @@ impl Executor {
        pin_mut!(f);
        let ready = AtomicBool::new(true);
        let waker = wrap_waker(&ready);
+        let mut backup = Vec::new();
        let val = loop {
            // advance the main task
            if ready.load(Ordering::Relaxed) {
@ -85,10 +86,9 @@ impl Executor {
                // println!("ran block_on");
            }

-            // println!("tasks: {}", self.tasks.borrow().len());
-            // advance other tasks
-            let next_task = self.tasks.borrow_mut().pop_front();
-            if let Some(mut task) = next_task {
+            // advance all tasks
+            core::mem::swap(&mut *self.tasks.borrow_mut(), &mut backup);
+            for mut task in backup.drain(..) {
                // NOTE we don't need a CAS operation here because `wake` invocations that come from
                // interrupt handlers (the only source of 'race conditions' (!= data races)) are
                // "oneshot": they'll issue a `wake` and then disable themselves to not run again
@ -106,7 +106,7 @@ impl Executor {
                    }
                }
                // Requeue
-                self.tasks.borrow_mut().push_back(task);
+                self.tasks.borrow_mut().push(task);
            }

            // // try to sleep; this will be a no-op if any of the previous tasks generated a SEV or an
@ -119,7 +119,7 @@ impl Executor {

    pub fn spawn(&self, f: impl Future + 'static) {
        let task = Box::pin(Task::new(f));
-        self.tasks.borrow_mut().push_back(task);
+        self.tasks.borrow_mut().push(task);
    }
 }

--- a/libasync/src/smoltcp/mod.rs
+++ b/libasync/src/smoltcp/mod.rs
@ -7,17 +7,23 @@ use smoltcp::{
    iface::EthernetInterface,
    phy::Device,
    socket::SocketSet,
-    time::Instant,
+    time::{Duration, Instant},
 };
 use crate::task;

 mod tcp_stream;
 pub use tcp_stream::TcpStream;

+pub trait LinkCheck {
+    type Link;
+    fn is_idle(&self) -> bool;
+    fn check_link_change(&mut self) -> Option<Self::Link>;
+}
+
 static mut SOCKETS: Option<Sockets> = None;

 pub struct Sockets {
-    sockets: RefCell<SocketSet<'static, 'static, 'static>>,
+    sockets: RefCell<SocketSet<'static>>,
    wakers: RefCell<Vec<Waker>>,
 }

@ -30,7 +36,7 @@ impl Sockets {
        let sockets = RefCell::new(SocketSet::new(sockets_storage));

        let wakers = RefCell::new(Vec::new());
-        
+
        let instance = Sockets {
            sockets,
            wakers,
@ -41,14 +47,24 @@ impl Sockets {

    /// Block and run executor indefinitely while polling the smoltcp
    /// iface
-    pub fn run<'b, 'c, 'e, D: for<'d> Device<'d>>(
-        iface: &mut EthernetInterface<'b, 'c, 'e, D>,
+    pub fn run<'b, D: for<'d> Device<'d> + LinkCheck>(
+        iface: &mut EthernetInterface<'b, D>,
        mut get_time: impl FnMut() -> Instant,
    ) -> ! {
        task::block_on(async {
+            let mut last_link_check = Instant::from_millis(0);
+            const LINK_CHECK_INTERVAL: u64 = 500;
+
            loop {
                let instant = get_time();
                Self::instance().poll(iface, instant);
+
+                let dev = iface.device_mut();
+                if dev.is_idle() && instant >= last_link_check + Duration::from_millis(LINK_CHECK_INTERVAL) {
+                    dev.check_link_change();
+                    last_link_check = instant;
+                }
+
                task::r#yield().await;
            }
        })
@ -57,10 +73,10 @@ impl Sockets {
    pub(crate) fn instance() -> &'static Self {
        unsafe { SOCKETS.as_ref().expect("Sockets") }
    }
-    
-    fn poll<'b, 'c, 'e, D: for<'d> Device<'d>>(
+
+    fn poll<'b, D: for<'d> Device<'d>>(
        &self,
-        iface: &mut EthernetInterface<'b, 'c, 'e, D>,
+        iface: &mut EthernetInterface<'b, D>,
        instant: Instant
    ) {
        let processed = {
@ -81,7 +97,14 @@ impl Sockets {
    /// TODO: this was called through eg. TcpStream, another poll()
    /// might want to send packets before sleeping for an interrupt.
    pub(crate) fn register_waker(waker: Waker) {
-        Self::instance().wakers.borrow_mut()
-            .push(waker);
+        let mut wakers = Self::instance().wakers.borrow_mut();
+        for (i, w) in wakers.iter().enumerate() {
+            if w.will_wake(&waker) {
+                let last = wakers.len() - 1;
+                wakers.swap(i, last);
+                return;
+            }
+        }
+        wakers.push(waker);
    }
 }
--- a/libasync/src/smoltcp/tcp_stream.rs
+++ b/libasync/src/smoltcp/tcp_stream.rs
@ -262,6 +262,14 @@ impl TcpStream {
    pub fn set_timeout(&mut self, duration: Option<Duration>) {
        self.with_socket(|mut socket| socket.set_timeout(duration));
    }
+
+    pub fn ack_delay(&self) -> Option<Duration> {
+        self.with_socket(|socket| socket.ack_delay())
+    }
+
+    pub fn set_ack_delay(&mut self, duration: Option<Duration>) {
+        self.with_socket(|mut socket| socket.set_ack_delay(duration));
+    }
 }

 impl Drop for TcpStream {
--- a/libboard_zynq/Cargo.toml
+++ b/libboard_zynq/Cargo.toml
@ -2,12 +2,16 @@
 name = "libboard_zynq"
 description = "Drivers for peripherals in the Zynq PS"
 version = "0.0.0"
-authors = ["Astro <astro@spaceboyz.net>"]
+authors = ["M-Labs"]
 edition = "2018"

 [features]
 target_zc706 = []
-target_cora_z7_10 = []
+target_coraz7 = []
+target_ebaz4205 = []
+target_redpitaya = []
+target_kasli_soc = []
+ipv6 = [ "smoltcp/proto-ipv6" ]

 [dependencies]
 volatile-register = "0.2"
@ -18,8 +22,9 @@ void = { version = "1", default-features = false }
 log = "0.4"
 libregister = { path = "../libregister" }
 libcortex_a9 = { path = "../libcortex_a9" }
+libasync = { path = "../libasync" }

 [dependencies.smoltcp]
-version = "0.6"
-features = ["ethernet", "proto-ipv4", "proto-ipv6", "socket-tcp"]
+version = "0.7"
+features = ["ethernet", "proto-ipv4", "socket-tcp"]
 default-features = false
--- a/libboard_zynq/src/clocks/mod.rs
+++ b/libboard_zynq/src/clocks/mod.rs
@ -1,3 +1,5 @@
+use core::unimplemented;
+
 use libregister::{RegisterR, RegisterRW};
 use super::slcr;
 pub use slcr::ArmPllSource;
@ -101,6 +103,8 @@ impl Clocks {
                self.ddr,
            slcr::PllSource::IoPll =>
                self.io,
+            slcr::PllSource::Emio =>
+                unimplemented!(),
        };
        pll / u32::from(uart_clk_ctrl.divisor())
    }
@ -115,6 +119,8 @@ impl Clocks {
                self.ddr,
            slcr::PllSource::IoPll =>
                self.io,
+            slcr::PllSource::Emio =>
+                unimplemented!(),
        };
        pll / u32::from(sdio_clk_ctrl.divisor())
    }
--- a/libboard_zynq/src/clocks/source.rs
+++ b/libboard_zynq/src/clocks/source.rs
@ -4,8 +4,14 @@ use super::slcr;

 #[cfg(feature = "target_zc706")]
 pub const PS_CLK: u32 = 33_333_333;
-#[cfg(feature = "target_cora_z7_10")]
+#[cfg(feature = "target_coraz7")]
 pub const PS_CLK: u32 = 50_000_000;
+#[cfg(feature = "target_ebaz4205")]
+pub const PS_CLK: u32 = 33_333_333;
+#[cfg(feature = "target_redpitaya")]
+pub const PS_CLK: u32 = 33_333_333;
+#[cfg(feature = "target_kasli_soc")]
+pub const PS_CLK: u32 = 33_333_333;

 /// (pll_fdiv_max, (pll_cp, pll_res, lock_cnt))
 const PLL_FDIV_LOCK_PARAM: &[(u16, (u8, u8, u16))] = &[
@ -55,7 +61,7 @@ pub trait ClockSource {
    /// 25.10.4 PLLs
    fn setup(target_freq: u32) {
        let fdiv = (target_freq / PS_CLK).min(66) as u16;
-        let (pll_res, pll_cp, lock_cnt) = PLL_FDIV_LOCK_PARAM.iter()
+        let (pll_cp, pll_res, lock_cnt) = PLL_FDIV_LOCK_PARAM.iter()
            .filter(|(fdiv_max, _)| fdiv <= *fdiv_max)
            .nth(0)
            .expect("PLL_FDIV_LOCK_PARAM")
--- a/libboard_zynq/src/ddr/mod.rs
+++ b/libboard_zynq/src/ddr/mod.rs
@ -1,7 +1,9 @@
 use libregister::{RegisterR, RegisterW, RegisterRW};
 use log::{debug, info, error};
 use crate::{print, println};
-use super::slcr::{self, DdriobVrefSel};
+use super::slcr;
+#[cfg(feature = "target_zc706")]
+use super::slcr::DdriobVrefSel;
 use super::clocks::{Clocks, source::{DdrPll, ClockSource}};

 mod regs;
@ -10,12 +12,23 @@ mod regs;
 /// Micron MT41J256M8HX-15E: 667 MHz DDR3
 const DDR_FREQ: u32 = 666_666_666;

-#[cfg(feature = "target_cora_z7_10")]
+#[cfg(feature = "target_coraz7")]
 /// Micron MT41K256M16HA-125: 800 MHz DDR3L, max supported 533 MHz
 const DDR_FREQ: u32 = 525_000_000;

-/// MT41K256M16HA-125
-const DCI_FREQ: u32 = 10_000_000;
+#[cfg(feature = "target_ebaz4205")]
+/// EtronTech Memory EM6GD16EWKG-12H: 800 MHz DDR3 at 533 MHz
+const DDR_FREQ: u32 = 533_333_333;
+
+#[cfg(feature = "target_redpitaya")]
+/// Alliance Memory AS4C256M16D3B: 800 MHz DDR3 at 533 MHz
+const DDR_FREQ: u32 = 533_333_333;
+
+#[cfg(feature = "target_kasli_soc")]
+/// MT41K256M16HA-125:E: 800 MHz DDR3L at 533 MHz
+const DDR_FREQ: u32 = 533_333_333;
+
+const DCI_MAX_FREQ: u32 = 10_000_000;

 pub struct DdrRam {
    regs: &'static mut regs::RegisterBlock,
@ -24,13 +37,11 @@ pub struct DdrRam {
 impl DdrRam {
    pub fn ddrram() -> Self {
        let clocks = Self::clock_setup();
-        Self::calibrate_iob_impedance(&clocks);
        Self::configure_iob();
-
-        let regs = unsafe { regs::RegisterBlock::ddrc() };
+        Self::calibrate_iob_impedance(&clocks);
+        let regs = regs::RegisterBlock::ddrc();
        let mut ddr = DdrRam { regs };
-        ddr.configure();
-        ddr.reset_ddrc();
+        ddr.reset_ddrc(|ddr| ddr.configure());
        ddr
    }

@ -57,7 +68,7 @@ impl DdrRam {
    }

    fn calculate_dci_divisors(clocks: &Clocks) -> (u8, u8) {
-        let target = (DCI_FREQ - 1 + clocks.ddr) / DCI_FREQ;
+        let target = (DCI_MAX_FREQ - 1 + clocks.ddr) / DCI_MAX_FREQ;

        let mut best = None;
        let mut best_error = 0;
@ -140,13 +151,23 @@ impl DdrRam {
                .output_en(slcr::DdriobOutputEn::Obuf);
            #[cfg(feature = "target_zc706")]
            let data1_config = data0_config.clone();
-            #[cfg(feature = "target_cora_z7_10")]
+            #[cfg(any(
+                feature = "target_coraz7",
+                feature = "target_ebaz4205",
+                feature = "target_redpitaya",
+                feature = "target_kasli_soc",
+            ))]
            let data0_config = slcr::DdriobConfig::zeroed()
                .inp_type(slcr::DdriobInputType::VrefDifferential)
                .term_en(true)
                .dci_type(slcr::DdriobDciType::Termination)
                .output_en(slcr::DdriobOutputEn::Obuf);
-            #[cfg(feature = "target_cora_z7_10")]
+            #[cfg(any(
+                feature = "target_coraz7",
+                feature = "target_ebaz4205",
+                feature = "target_redpitaya",
+                feature = "target_kasli_soc",
+            ))]
            let data1_config = slcr::DdriobConfig::zeroed()
                .pullup_en(true);
            slcr.ddriob_data0.write(data0_config);
@ -160,16 +181,25 @@ impl DdrRam {
                .output_en(slcr::DdriobOutputEn::Obuf);
            #[cfg(feature = "target_zc706")]
            let diff1_config = diff0_config.clone();
-            #[cfg(feature = "target_cora_z7_10")]
+            #[cfg(any(
+                feature = "target_coraz7",
+                feature = "target_ebaz4205",
+                feature = "target_redpitaya",
+                feature = "target_kasli_soc",
+            ))]
            let diff0_config = slcr::DdriobConfig::zeroed()
                .inp_type(slcr::DdriobInputType::Differential)
                .term_en(true)
                .dci_type(slcr::DdriobDciType::Termination)
                .output_en(slcr::DdriobOutputEn::Obuf);
-            #[cfg(feature = "target_cora_z7_10")]
+            #[cfg(any(
+                feature = "target_coraz7",
+                feature = "target_ebaz4205",
+                feature = "target_redpitaya",
+                feature = "target_kasli_soc",
+            ))]
            let diff1_config = slcr::DdriobConfig::zeroed()
                .pullup_en(true);
-
            slcr.ddriob_diff0.write(diff0_config);
            slcr.ddriob_diff1.write(diff1_config);

@ -186,12 +216,17 @@ impl DdrRam {
                slcr.ddriob_drive_slew_clock.write(0x00F9861C);
            }

-            // Enable external V[REF]
-            #[cfg(feature = "target_cora_z7_10")]
+            #[cfg(any(
+                feature = "target_coraz7",
+                feature = "target_ebaz4205",
+                feature = "target_redpitaya",
+                feature = "target_kasli_soc",
+            ))]
            slcr.ddriob_ddr_ctrl.modify(|_, w| w
                    .vref_int_en(false)
                    .vref_ext_en_lower(true)
                    .vref_ext_en_upper(false)
+                    .refio_en(true)
            );
            #[cfg(feature = "target_zc706")]
            slcr.ddriob_ddr_ctrl.modify(|_, w| w
@ -204,12 +239,50 @@ impl DdrRam {
    }

    fn configure(&mut self) {
+        #[cfg(any(feature = "target_coraz7", feature = "target_kasli_soc"))]
+        self.regs.dram_param0.write(
+            regs::DramParam0::zeroed()
+                .t_rc(0x1a)
+                .t_rfc_min(0x9e)
+                .post_selfref_gap_x32(0x10)
+        );
+        #[cfg(feature = "target_ebaz4205")]
+        self.regs.dram_param0.write(
+            regs::DramParam0::zeroed()
+                .t_rc(0x1a)
+                .t_rfc_min(0x56)
+                .post_selfref_gap_x32(0x10)
+        );
+        #[cfg(feature = "target_redpitaya")]
+        self.regs.dram_param0.write(
+            regs::DramParam0::zeroed()
+                .t_rc(0x1b)
+                .t_rfc_min(0xa0)
+                .post_selfref_gap_x32(0x10)
+        );
+        #[cfg(feature = "target_zc706")]
        self.regs.dram_param0.write(
            regs::DramParam0::zeroed()
                .t_rc(0x1b)
                .t_rfc_min(0x56)
                .post_selfref_gap_x32(0x10)
        );
+        #[cfg(feature = "target_ebaz4205")]
+        self.regs.dram_param1.modify(
+            |_, w| w
+                .t_faw(0x16)
+                .t_ras_min(0x13)
+        );
+        #[cfg(feature = "target_redpitaya")]
+        self.regs.dram_param1.modify(
+            |_, w| w
+                .wr2pre(0x12)
+                .powerdown_to_x32(6)
+                .t_faw(0x16)
+                .t_ras_max(0x24)
+                .t_ras_min(0x13)
+                .t_cke(4)
+        );

        self.regs.dram_param2.write(
            regs::DramParam2::zeroed()
@ -221,6 +294,25 @@ impl DdrRam {
                .rd2pre(0x4)
                .t_rcd(0x7)
        );
+        #[cfg(feature = "target_ebaz4205")]
+        self.regs.dram_param3.modify(
+            |_, w| w
+                .t_rp(7)
+        );
+        #[cfg(feature = "target_redpitaya")]
+        self.regs.dram_param3.modify(
+            |_, w| w
+                .t_ccd(4)
+                .t_rrd(6)
+                .refresh_margin(2)
+                .t_rp(7)
+                .refresh_to_x32(8)
+                .mobile(false)
+                .dfi_dram_clk_disable(false)
+                .read_latency(7)
+                .mode_ddr1_ddr2(true)
+                .dis_pad_pd(false)
+        );

        self.regs.dram_emr_mr.write(
            regs::DramEmrMr::zeroed()
@ -228,6 +320,25 @@ impl DdrRam {
                .emr(0x4)
        );

+        #[cfg(any(
+            feature = "target_coraz7",
+            feature = "target_ebaz4205",
+            feature = "target_redpitaya",
+            feature = "target_kasli_soc",
+        ))]
+        self.regs.phy_configs[2].modify(
+            |_, w| w.data_slice_in_use(false)
+        );
+        #[cfg(any(
+            feature = "target_coraz7",
+            feature = "target_ebaz4205",
+            feature = "target_redpitaya",
+            feature = "target_kasli_soc",
+        ))]
+        self.regs.phy_configs[3].modify(
+            |_, w| w.data_slice_in_use(false)
+        );
+
        self.regs.phy_cmd_timeout_rddata_cpt.modify(
            |_, w| w
                .rd_cmd_to_data(0x0)
@ -260,12 +371,36 @@ impl DdrRam {
                .ctrlup_max(0x40)
        );

-        self.regs.phy_init_ratio3.write(
+        #[cfg(feature = "target_zc706")]
+        self.regs.phy_init_ratios[3].write(
            regs::PhyInitRatio::zeroed()
                .wrlvl_init_ratio(0x21)
                .gatelvl_init_ratio(0xee)
        );

+        #[cfg(any(
+            feature = "target_coraz7",
+            feature = "target_ebaz4205",
+            feature = "target_kasli_soc"),
+        )]
+        self.regs.reg_64.modify(
+            |_, w| w
+                .phy_ctrl_slave_ratio(0x100)
+                .phy_invert_clkout(true)
+        );
+        #[cfg(feature = "target_redpitaya")]
+        self.regs.reg_64.modify(
+            |_, w| w
+                .phy_bl2(false)
+                .phy_invert_clkout(true)
+                .phy_sel_logic(false)
+                .phy_ctrl_slave_ratio(0x100)
+                .phy_ctrl_slave_force(false)
+                .phy_ctrl_slave_delay(0)
+                .phy_lpddr(false)
+                .phy_cmd_latency(false)
+        );
+
        self.regs.reg_65.write(
            regs::Reg65::zeroed()
                .wr_rl_delay(0x2)
@ -280,7 +415,23 @@ impl DdrRam {
    }

    /// Reset DDR controller
-    fn reset_ddrc(&mut self) {
+    fn reset_ddrc<F: FnMut(&mut Self)>(&mut self, mut f: F) {
+        #[cfg(feature = "target_zc706")]
+        let width = regs::DataBusWidth::Width32bit;
+        #[cfg(any(
+            feature = "target_coraz7",
+            feature = "target_ebaz4205",
+            feature = "target_redpitaya",
+            feature = "target_kasli_soc",
+        ))]
+        let width = regs::DataBusWidth::Width16bit;
+        self.regs.ddrc_ctrl.modify(|_, w| w
+            .soft_rstb(false)
+            .powerdown_en(false)
+            .data_bus_width(width)
+        );
+        f(self);
+
        #[cfg(feature = "target_zc706")]
        unsafe {
            // row/column address bits
@ -288,16 +439,19 @@ impl DdrRam {
            self.regs.dram_addr_map_col.write(0xFFF00000);
            self.regs.dram_addr_map_row.write(0x0F666666);
        }
+        #[cfg(any(
+            feature = "target_coraz7",
+            feature = "target_ebaz4205",
+            feature = "target_redpitaya",
+            feature = "target_kasli_soc",
+        ))]
+        unsafe {
+            // row/column address bits
+            self.regs.dram_addr_map_bank.write(0x00000666);
+            self.regs.dram_addr_map_col.write(0xFFFF0000);
+            self.regs.dram_addr_map_row.write(0x0F555555);
+        }

-        #[cfg(feature = "target_zc706")]
-        let width = regs::DataBusWidth::Width32bit;
-        #[cfg(feature = "target_cora_z7_10")]
-        let width = regs::DataBusWidth::Width16bit;
-        self.regs.ddrc_ctrl.modify(|_, w| w
-            .soft_rstb(false)
-            .powerdown_en(false)
-            .data_bus_width(width)
-        );
        self.regs.ddrc_ctrl.modify(|_, w| w
            .soft_rstb(true)
            .powerdown_en(false)
@ -318,10 +472,18 @@ impl DdrRam {
    /// actually there's 1 MB more but starting at 0x0000_0000
    /// overlaps with OCM.
    pub fn size(&self) -> usize {
+        // DDR range ends at 0x3FFF_FFFF in the default SCU address
+        // filtering address map
        #[cfg(feature = "target_zc706")]
        let megabytes = 1023;
-        #[cfg(feature = "target_cora_z7_10")]
-        let megabytes = 511;
+        #[cfg(any(
+            feature = "target_coraz7",
+            feature = "target_redpitaya",
+            feature = "target_kasli_soc",
+        ))]
+        let megabytes = 512;
+        #[cfg(feature = "target_ebaz4205")]
+        let megabytes = 256;

        megabytes * 1024 * 1024
    }
--- a/libboard_zynq/src/ddr/regs.rs
+++ b/libboard_zynq/src/ddr/regs.rs
@ -33,14 +33,14 @@ pub struct RegisterBlock {
    pub lpr: RW<u32>,
    pub wr: RW<u32>,
    pub dram_param0: DramParam0,
-    pub dram_param1: RW<u32>,
+    pub dram_param1: DramParam1,
    pub dram_param2: DramParam2,
-    pub dram_param3: RW<u32>,
+    pub dram_param3: DramParam3,
    pub dram_param4: RW<u32>,
    pub dram_init_param: RW<u32>,
    pub dram_emr: RW<u32>,
    pub dram_emr_mr: DramEmrMr,
-    pub dram_burst8_rdwr: RW<u32>,
+    pub dram_burst8_rdwr: Burst8Rdwr,
    pub dram_disable_dq: RW<u32>,
    pub dram_addr_map_bank: RW<u32>,
    pub dram_addr_map_col: RW<u32>,
@ -60,7 +60,7 @@ pub struct RegisterBlock {
    pub ctrl6: RW<u32>,
    _unused1: [RO<u32>; 8],
    pub che_refresh_timer01: RW<u32>,
-    pub che_t_zq: RW<u32>,
+    pub che_t_zq: CheTZq,
    pub che_t_zq_short_interval: RW<u32>,
    pub deep_pwrdwn: RW<u32>,
    pub reg_2c: Reg2C,
@ -84,15 +84,9 @@ pub struct RegisterBlock {
    pub che_ecc_corr_bit_mask_63_32_offset: RW<u32>,
    _unused3: [RO<u32>; 5],
    pub phy_rcvr_enable: RW<u32>,
-    pub phy_config0: RW<u32>,
-    pub phy_config1: RW<u32>,
-    pub phy_config2: RW<u32>,
-    pub phy_config3: RW<u32>,
+    pub phy_configs: [PhyConfig; 4],
    _unused4: RO<u32>,
-    pub phy_init_ratio0: PhyInitRatio,
-    pub phy_init_ratio1: PhyInitRatio,
-    pub phy_init_ratio2: PhyInitRatio,
-    pub phy_init_ratio3: PhyInitRatio,
+    pub phy_init_ratios: [PhyInitRatio; 4],
    _unused5: RO<u32>,
    pub phy_rd_dqs_cfg0: RW<u32>,
    pub phy_rd_dqs_cfg1: RW<u32>,
@ -114,7 +108,7 @@ pub struct RegisterBlock {
    pub wr_data_slv2: RW<u32>,
    pub wr_data_slv3: RW<u32>,
    _unused9: RO<u32>,
-    pub reg_64: RW<u32>,
+    pub reg_64: Reg64,
    pub reg_65: Reg65,
    _unused10: [RO<u32>; 3],
    pub reg69_6a0: RW<u32>,
@ -138,14 +132,8 @@ pub struct RegisterBlock {
    _unused14: [RO<u32>; 5],
    pub axi_id: RW<u32>,
    pub page_mask: RW<u32>,
-    pub axi_priority_wr_port0: RW<u32>,
-    pub axi_priority_wr_port1: RW<u32>,
-    pub axi_priority_wr_port2: RW<u32>,
-    pub axi_priority_wr_port3: RW<u32>,
-    pub axi_priority_rd_port0: RW<u32>,
-    pub axi_priority_rd_port1: RW<u32>,
-    pub axi_priority_rd_port2: RW<u32>,
-    pub axi_priority_rd_port3: RW<u32>,
+    pub axi_priority_wr_ports: [RW<u32>; 4],
+    pub axi_priority_rd_ports: [AxiPriorityRd; 4],
    _unused15: [RO<u32>; 27],
    pub excl_access_cfg0: RW<u32>,
    pub excl_access_cfg1: RW<u32>,
@ -173,6 +161,14 @@ register_bits!(dram_param0, t_rc, u8, 0, 5);
 register_bits!(dram_param0, t_rfc_min, u8, 6, 13);
 register_bits!(dram_param0, post_selfref_gap_x32, u8, 14, 20);

+register!(dram_param1, DramParam1, RW, u32);
+register_bits!(dram_param1, wr2pre, u8, 0, 4);
+register_bits!(dram_param1, powerdown_to_x32, u8, 5, 9);
+register_bits!(dram_param1, t_faw, u8, 10, 15);
+register_bits!(dram_param1, t_ras_max, u8, 16, 21);
+register_bits!(dram_param1, t_ras_min, u8, 22, 26);
+register_bits!(dram_param1, t_cke, u8, 28, 31);
+
 register!(dram_param2, DramParam2, RW, u32);
 register_bits!(dram_param2, write_latency, u8, 0, 4);
 register_bits!(dram_param2, rd2wr, u8, 5, 9);
@ -182,10 +178,29 @@ register_bits!(dram_param2, pad_pd, u8, 20, 22);
 register_bits!(dram_param2, rd2pre, u8, 23, 27);
 register_bits!(dram_param2, t_rcd, u8, 28, 31);

+register!(dram_param3, DramParam3, RW, u32);
+register_bits!(dram_param3, t_ccd, u8, 2, 4);
+register_bits!(dram_param3, t_rrd, u8, 5, 7);
+register_bits!(dram_param3, refresh_margin, u8, 8, 11);
+register_bits!(dram_param3, t_rp, u8, 12, 15);
+register_bits!(dram_param3, refresh_to_x32, u8, 16, 20);
+register_bit!(dram_param3, sdram, 21);
+register_bit!(dram_param3, mobile, 22);
+register_bit!(dram_param3, dfi_dram_clk_disable, 23);
+register_bits!(dram_param3, read_latency, u8, 24, 28);
+register_bit!(dram_param3, mode_ddr1_ddr2, 29);
+register_bit!(dram_param3, dis_pad_pd, 30);
+
 register!(dram_emr_mr, DramEmrMr, RW, u32);
 register_bits!(dram_emr_mr, mr, u16, 0, 15);
 register_bits!(dram_emr_mr, emr, u16, 16, 31);

+register!(burst8_rdwr, Burst8Rdwr, RW, u32);
+register_bits!(burst8_rdwr, burst_rdwr, u8, 0, 3);
+register_bits!(burst8_rdwr, pre_cke_x1024, u16, 4, 13);
+register_bits!(burst8_rdwr, post_cke_x1024, u16, 16, 25);
+register_bit!(burst8_rdwr, burstchop, 28);
+
 register!(phy_cmd_timeout_rddata_cpt, PhyCmdTimeoutRddataCpt, RW, u32);
 register_bits!(phy_cmd_timeout_rddata_cpt, rd_cmd_to_data, u8, 0, 3);
 register_bits!(phy_cmd_timeout_rddata_cpt, wr_cmd_to_data, u8, 4, 7);
@ -198,6 +213,13 @@ register_bit!(phy_cmd_timeout_rddata_cpt, clk_stall_level, 19);
 register_bits!(phy_cmd_timeout_rddata_cpt, gatelvl_num_of_dq0, u8, 24, 27);
 register_bits!(phy_cmd_timeout_rddata_cpt, wrlvl_num_of_dq0, u8, 28, 31);

+register!(che_t_zq, CheTZq, RW, u32);
+register_bit!(che_t_zq, dis_auto_zq, 0);
+register_bit!(che_t_zq, ddr3, 1);
+register_bits!(che_t_zq, t_mod, u8, 2, 11);
+register_bits!(che_t_zq, t_zq_long_nop, u16, 12, 21);
+register_bits!(che_t_zq, t_zq_short_nop, u16, 22, 31);
+
 register!(reg_2c, Reg2C, RW, u32);
 register_bits!(reg_2c, wrlvl_max_x1024, u16, 0, 11);
 register_bits!(reg_2c, rdlvl_max_x1024, u16, 12, 23);
@ -212,10 +234,27 @@ register_bits!(dfi_timing, rddata_en, u8, 0, 4);
 register_bits!(dfi_timing, ctrlup_min, u16, 5, 14);
 register_bits!(dfi_timing, ctrlup_max, u16, 15, 24);

+register!(phy_config, PhyConfig, RW, u32);
+register_bit!(phy_config, data_slice_in_use, 0);
+register_bit!(phy_config, rdlvl_inc_mode, 1);
+register_bit!(phy_config, gatelvl_inc_mode, 2);
+register_bit!(phy_config, wrlvl_inc_mode, 3);
+register_bits!(phy_config, dq_offset, u8, 24, 30);
+
 register!(phy_init_ratio, PhyInitRatio, RW, u32);
 register_bits!(phy_init_ratio, wrlvl_init_ratio, u16, 0, 9);
 register_bits!(phy_init_ratio, gatelvl_init_ratio, u16, 10, 19);

+register!(reg_64, Reg64, RW, u32);
+register_bit!(reg_64, phy_bl2, 1);
+register_bit!(reg_64, phy_invert_clkout, 7);
+register_bit!(reg_64, phy_sel_logic, 9);
+register_bits!(reg_64, phy_ctrl_slave_ratio, u16, 10, 19);
+register_bit!(reg_64, phy_ctrl_slave_force, 20);
+register_bits!(reg_64, phy_ctrl_slave_delay, u8, 21, 27);
+register_bit!(reg_64, phy_lpddr, 29);
+register_bit!(reg_64, phy_cmd_latency, 30);
+
 register!(reg_65, Reg65, RW, u32);
 register_bits!(reg_65, wr_rl_delay, u8, 0, 4);
 register_bits!(reg_65, rd_rl_delay, u8, 5, 9);
@ -231,3 +270,10 @@ register!(mode_sts_reg,
          ModeStsReg, RO, u32);
 register_bits_typed!(mode_sts_reg, operating_mode, u8, ControllerStatus, 0, 2);
 // (mode_sts_reg) ...
+
+register!(axi_priority_rd, AxiPriorityRd, RW, u32);
+register_bits!(axi_priority_rd, arb_pri_rd_portn, u16, 0, 9);
+register_bit!(axi_priority_rd, arb_disable_aging_rd_portn, 16);
+register_bit!(axi_priority_rd, arb_disable_urgent_rd_portn, 17);
+register_bit!(axi_priority_rd, arb_disable_page_match_rd_portn, 18);
+register_bit!(axi_priority_rd, arb_set_hpr_rd_portn, 19);
--- a/libboard_zynq/src/error_led.rs
+++ b/libboard_zynq/src/error_led.rs
@ -0,0 +1,114 @@
+use libregister::{RegisterRW, RegisterW};
+use libregister::{register, register_at, register_bit, register_bits};
+use super::slcr;
+
+pub struct ErrorLED {
+    regs: RegisterBlock,
+}
+
+impl ErrorLED {
+    #[cfg(feature = "target_kasli_soc")]
+    pub fn error_led() -> Self {
+        slcr::RegisterBlock::unlocked(|slcr| {
+            // Error LED at MIO pin 37
+            slcr.mio_pin_37.write(
+                slcr::MioPin37::zeroed()
+                    .l3_sel(0b000)
+                    .io_type(slcr::IoBufferType::Lvcmos25)
+                    .pullup(true)
+                    .disable_rcvr(true)
+            );
+        });
+
+        Self::error_led_common(0xFFFF - 0x0080)
+    }
+
+    fn error_led_common(gpio_output_mask: u16) -> Self {
+        // Setup register block
+        let self_ = Self {
+            regs: RegisterBlock::error_led(),
+        };
+
+        // Setup GPIO output mask
+        self_.regs.gpio_output_mask.modify(|_, w| {
+            w.mask(gpio_output_mask)
+        });
+
+        self_.regs.gpio_direction.modify(|_, w| {
+            w.lederr(true)
+        });
+
+        self_
+    }
+
+    fn led_oe(&mut self, oe: bool) {
+        self.regs.gpio_output_enable.modify(|_, w| {
+             w.lederr(oe)
+        })
+    }
+
+    fn led_o(&mut self, o: bool) {
+        self.regs.gpio_output_mask.modify(|_, w| {
+             w.lederr_o(o)
+        })
+    }
+
+    pub fn toggle(&mut self, state: bool) {
+        self.led_o(state);
+        self.led_oe(state);
+    }
+}
+
+
+pub struct RegisterBlock {
+    pub gpio_output_mask: &'static mut GPIOOutputMask,
+    pub gpio_direction: &'static mut GPIODirection,
+    pub gpio_output_enable: &'static mut GPIOOutputEnable,
+}
+
+impl RegisterBlock {
+    pub fn error_led() -> Self {
+        Self {
+            gpio_output_mask: GPIOOutputMask::new(),
+            gpio_direction: GPIODirection::new(),
+            gpio_output_enable: GPIOOutputEnable::new()
+        }
+    }
+}
+
+register!(gpio_output_mask,
+            /// MASK_DATA_1_LSW:
+            /// Maskable output data for MIO[47:32]
+            GPIOOutputMask, RW, u32);
+#[cfg(feature = "target_kasli_soc")]
+register_at!(GPIOOutputMask, 0xE000A008, new);
+#[cfg(feature = "target_kasli_soc")]
+register_bit!(gpio_output_mask,
+              /// Output for LED_ERR (MIO[37])
+              lederr_o, 5);
+#[cfg(feature = "target_kasli_soc")]
+register_bits!(gpio_output_mask,
+               mask, u16, 16, 31);
+
+register!(gpio_direction,
+          /// DIRM_1:
+          /// Direction mode for MIO[53:32]; 0/1 = in/out
+          GPIODirection, RW, u32);
+#[cfg(feature = "target_kasli_soc")]
+register_at!(GPIODirection, 0xE000A244, new);
+#[cfg(feature = "target_kasli_soc")]
+register_bit!(gpio_direction,
+              /// Direction for LED_ERR
+              lederr, 5);
+
+register!(gpio_output_enable,
+          /// OEN_1:
+          /// Output enable for MIO[53:32]
+          GPIOOutputEnable, RW, u32);
+#[cfg(feature = "target_kasli_soc")]
+register_at!(GPIOOutputEnable, 0xE000A248, new);
+#[cfg(feature = "target_kasli_soc")]
+register_bit!(gpio_output_enable,
+              /// Output enable for LED_ERR
+              lederr, 5);
+              
--- a/libboard_zynq/src/eth/mod.rs
+++ b/libboard_zynq/src/eth/mod.rs
@ -13,6 +13,9 @@ mod regs;
 pub mod rx;
 pub mod tx;

+use super::time::Milliseconds;
+use embedded_hal::timer::CountDown;
+
 /// Size of all the buffers
 pub const MTU: usize = 1536;
 /// Maximum MDC clock
@ -27,7 +30,7 @@ const TX_1000: u32 = 125_000_000;
 pub struct Buffer(pub [u8; MTU]);

 impl Buffer {
-    pub fn new() -> Self {
+    pub const fn new() -> Self {
        Buffer([0; MTU])
    }
 }
@ -62,17 +65,31 @@ impl Gem for Gem0 {
            slcr.gem0_clk_ctrl.write(
                // 0x0050_0801: 8, 5: 100 Mb/s
                // ...: 8, 1: 1000 Mb/s
+                #[cfg(not(feature = "target_ebaz4205"))]
                slcr::GemClkCtrl::zeroed()
                    .clkact(true)
                    .srcsel(slcr::PllSource::IoPll)
                    .divisor(divisor0 as u8)
+                    .divisor1(divisor1 as u8),
+                // ebaz4205 -- EMIO
+                #[cfg(feature = "target_ebaz4205")]
+                slcr::GemClkCtrl::zeroed()
+                    .clkact(true)
+                    .srcsel(slcr::PllSource::Emio)
+                    .divisor(divisor0 as u8)
                    .divisor1(divisor1 as u8)
            );
            // Enable gem0 recv clock
            slcr.gem0_rclk_ctrl.write(
                // 0x0000_0801
+                #[cfg(not(feature = "target_ebaz4205"))]
+                slcr::RclkCtrl::zeroed()
+                    .clkact(true),
+                // ebaz4205 -- EMIO
+                #[cfg(feature = "target_ebaz4205")]
                slcr::RclkCtrl::zeroed()
                    .clkact(true)
+                    .srcsel(true)
            );
        });
    }
@ -145,10 +162,13 @@ pub struct Eth<GEM: Gem, RX, TX> {
    tx: TX,
    inner: EthInner<GEM>,
    phy: Phy,
+    /// keep track of RX path occupation to avoid needless `check_link_change()`
+    idle: bool,
 }

 impl Eth<Gem0, (), ()> {
    pub fn eth0(macaddr: [u8; 6]) -> Self {
+        #[cfg(not(feature = "target_ebaz4205"))]
        slcr::RegisterBlock::unlocked(|slcr| {
            // Manual example: 0x0000_1280
            // MDIO
@ -224,48 +244,48 @@ impl Eth<Gem0, (), ()> {
            // RX_CLK
            slcr.mio_pin_22.write(
                slcr::MioPin22::zeroed()
-                    .tri_enable(true)
                    .l0_sel(true)
+                    .speed(true)
                    .io_type(slcr::IoBufferType::Hstl)
                    .pullup(true)
            );
            // RX_CTRL
            slcr.mio_pin_27.write(
                slcr::MioPin27::zeroed()
-                    .tri_enable(true)
                    .l0_sel(true)
+                    .speed(true)
                    .io_type(slcr::IoBufferType::Hstl)
                    .pullup(true)
            );
            // RXD3
            slcr.mio_pin_26.write(
                slcr::MioPin26::zeroed()
-                    .tri_enable(true)
                    .l0_sel(true)
+                    .speed(true)
                    .io_type(slcr::IoBufferType::Hstl)
                    .pullup(true)
            );
            // RXD2
            slcr.mio_pin_25.write(
                slcr::MioPin25::zeroed()
-                    .tri_enable(true)
                    .l0_sel(true)
+                    .speed(true)
                    .io_type(slcr::IoBufferType::Hstl)
                    .pullup(true)
            );
            // RXD1
            slcr.mio_pin_24.write(
                slcr::MioPin24::zeroed()
-                    .tri_enable(true)
                    .l0_sel(true)
+                    .speed(true)
                    .io_type(slcr::IoBufferType::Hstl)
                    .pullup(true)
            );
            // RXD0
            slcr.mio_pin_23.write(
                slcr::MioPin23::zeroed()
-                    .tri_enable(true)
                    .l0_sel(true)
+                    .speed(true)
                    .io_type(slcr::IoBufferType::Hstl)
                    .pullup(true)
            );
@ -298,22 +318,32 @@ impl<GEM: Gem> Eth<GEM, (), ()> {
    fn gem_common(macaddr: [u8; 6]) -> Self {
        GEM::setup_clock(TX_1000);

+        #[cfg(feature="target_kasli_soc")]
+        {
+            let mut eth_reset_pin = PhyRst::rst_pin();
+            eth_reset_pin.reset();
+        }
+
        let mut inner = EthInner {
            gem: PhantomData,
            link: None,
        };
        inner.init();
+
        inner.configure(macaddr);

        let phy = Phy::find(&mut inner).expect("phy");
        phy.reset(&mut inner);
        phy.restart_autoneg(&mut inner);
+        #[cfg(feature="target_kasli_soc")]
+        phy.set_leds(&mut inner);

        Eth {
            rx: (),
            tx: (),
            inner,
            phy,
+            idle: true,
        }
    }
 }
@ -325,6 +355,7 @@ impl<GEM: Gem, RX, TX> Eth<GEM, RX, TX> {
            tx: self.tx,
            inner: self.inner,
            phy: self.phy,
+            idle: self.idle,
        };
        let list_addr = new_self.rx.list_addr();
        assert!(list_addr & 0b11 == 0);
@ -344,6 +375,7 @@ impl<GEM: Gem, RX, TX> Eth<GEM, RX, TX> {
            tx: tx::DescList::new(tx_size),
            inner: self.inner,
            phy: self.phy,
+            idle: self.idle,
        };
        let list_addr = &new_self.tx.list_addr();
        assert!(list_addr & 0b11 == 0);
@ -395,17 +427,31 @@ impl<GEM: Gem, TX> Eth<GEM, rx::DescList, TX> {
                        regs::RxStatus::zeroed()
                            .frame_recd(true)
                    );
+                    self.idle = true;
                }
-                _ => {}
+                _ =>
+                    self.idle = false,
            }
            result
        } else {
-            self.inner.check_link_change(&self.phy);
+            self.idle = true;
            Ok(None)
        }
    }
 }

+impl<GEM: Gem, TX> libasync::smoltcp::LinkCheck for &mut Eth<GEM, rx::DescList, TX> {
+    type Link = Option<phy::Link>;
+
+    fn check_link_change(&mut self) -> Option<Self::Link> {
+        self.inner.check_link_change(&self.phy)
+    }
+
+    fn is_idle(&self) -> bool {
+        self.idle
+    }
+}
+
 impl<GEM: Gem, RX> Eth<GEM, RX, tx::DescList> {
    pub fn send<'s: 'p, 'p>(&'s mut self, length: usize) -> Option<tx::PktRef<'p>> {
        self.tx.send(GEM::regs(), length)
@ -439,10 +485,11 @@ impl<'a, GEM: Gem> smoltcp::phy::Device<'a> for &mut Eth<GEM, rx::DescList, tx::
                    regs: GEM::regs(),
                    desc_list: &mut self.tx,
                };
+                self.idle = false;
                Some((pktref, tx_token))
            }
            Ok(None) => {
-                self.inner.check_link_change(&self.phy);
+                self.idle = true;
                None
            }
            Err(e) => {
@ -460,6 +507,69 @@ impl<'a, GEM: Gem> smoltcp::phy::Device<'a> for &mut Eth<GEM, rx::DescList, tx::
    }
 }

+pub struct PhyRst {
+    regs: regs::GpioRegisterBlock,
+    count_down: super::timer::global::CountDown<Milliseconds>,
+}
+
+impl PhyRst {
+    pub fn rst_pin() -> Self {
+        slcr::RegisterBlock::unlocked(|slcr| {
+            // Hardware Reset for PHY
+            slcr.mio_pin_47.write(
+                slcr::MioPin47::zeroed()
+                    .l3_sel(0b000)
+                    .io_type(slcr::IoBufferType::Lvcmos18)
+                    .pullup(true)
+                    .disable_rcvr(true)
+            );
+        });
+        Self::eth_reset_common(0xFFFF - 0x8000)
+    }
+    
+    fn delay_ms(&mut self, ms: u64) {
+        self.count_down.start(Milliseconds(ms));
+        nb::block!(self.count_down.wait()).unwrap();
+    }
+
+    fn eth_reset_common(gpio_output_mask: u16) -> Self {
+        let self_ = Self {
+            regs: regs::GpioRegisterBlock::regs(),
+            count_down: unsafe { super::timer::GlobalTimer::get() }.countdown(),
+        };
+
+        // Setup GPIO output mask
+        self_.regs.gpio_output_mask.modify(|_, w| {
+            w.mask(gpio_output_mask)
+        });
+
+        self_.regs.gpio_direction.modify(|_, w| {
+            w.phy_rst(true)
+        });
+        
+        self_
+    }
+
+    fn oe(&mut self, oe: bool) {
+        self.regs.gpio_output_enable.modify(|_, w| {
+            w.phy_rst(oe)
+        })
+    }
+
+    fn toggle(&mut self, o: bool) {
+        self.regs.gpio_output_mask.modify(|_, w| {
+            w.phy_rst(o)
+        })
+    }
+
+    pub fn reset(&mut self) {
+        self.toggle(false); // drive phy_rst (active LOW) pin low
+        self.oe(true);         // enable pin's output
+        self.delay_ms(10);
+        self.toggle(true);
+    }
+}
+

 struct EthInner<GEM: Gem> {
    gem: PhantomData<GEM>,
@ -533,7 +643,10 @@ impl<GEM: Gem> EthInner<GEM> {

    fn configure(&mut self, macaddr: [u8; 6]) {
        let clocks = Clocks::get();
-        let mdc_clk_div = (clocks.cpu_1x() / MAX_MDC) + 1;
+        let mut mdc_clk_div = clocks.cpu_1x() / MAX_MDC;
+        if clocks.cpu_1x() % MAX_MDC > 0 {
+            mdc_clk_div += 1;
+        }

        GEM::regs().net_cfg.write(
            regs::NetCfg::zeroed()
@ -542,10 +655,10 @@ impl<GEM: Gem> EthInner<GEM> {
                .speed(true)
                .no_broadcast(false)
                .multi_hash_en(true)
-                // Promiscuous mode (TODO?)
-                .copy_all(true)
+                .rx_1536_byte_frames(true)
                // Remove 4-byte Frame CheckSum
                .fcs_remove(true)
+                .dis_cp_pause_frame(true)
                // RX checksum offload
                .rx_chksum_offld_en(true)
                // One of the slower speeds
@ -553,22 +666,23 @@ impl<GEM: Gem> EthInner<GEM> {
        );

        let macaddr_msbs =
-            (u16::from(macaddr[0]) << 8) |
-            u16::from(macaddr[1]);
+            (u16::from(macaddr[5]) << 8) |
+            u16::from(macaddr[4]);
        let macaddr_lsbs =
-            (u32::from(macaddr[2]) << 24) |
-            (u32::from(macaddr[3]) << 16) |
-            (u32::from(macaddr[4]) << 8) |
-            u32::from(macaddr[5]);
-        GEM::regs().spec_addr1_top.write(
-            regs::SpecAddrTop::zeroed()
-                .addr_msbs(macaddr_msbs)
-        );
+            (u32::from(macaddr[3]) << 24) |
+            (u32::from(macaddr[2]) << 16) |
+            (u32::from(macaddr[1]) << 8) |
+            u32::from(macaddr[0]);
+        // writing to bot would disable the specific address
        GEM::regs().spec_addr1_bot.write(
            regs::SpecAddrBot::zeroed()
                .addr_lsbs(macaddr_lsbs)
        );
-
+        // writing to top would enable it again
+        GEM::regs().spec_addr1_top.write(
+            regs::SpecAddrTop::zeroed()
+                .addr_msbs(macaddr_msbs)
+        );

        GEM::regs().dma_cfg.write(
            regs::DmaCfg::zeroed()
@ -598,13 +712,7 @@ impl<GEM: Gem> EthInner<GEM> {
    }


-    fn check_link_change(&mut self, phy: &Phy) {
-        // As the PHY access takes some time, exit early if there was
-        // already a link. TODO: check once per second.
-        if self.link.is_some() {
-            return
-        }
-
+    fn check_link_change(&mut self, phy: &Phy) -> Option<Option<phy::Link>> {
        let link = phy.get_link(self);

        // Check link state transition
@ -636,6 +744,9 @@ impl<GEM: Gem> EthInner<GEM> {
            }

            self.link = link;
+            Some(link)
+        } else {
+            None
        }
    }
 }
--- a/libboard_zynq/src/eth/phy/control.rs
+++ b/libboard_zynq/src/eth/phy/control.rs
@ -82,6 +82,10 @@ impl PhyRegister for Control {
    fn addr() -> u8 {
        0
    }
+    
+    fn page() -> u8 {
+        0
+    }
 }

 impl From<u16> for Control {
--- a/libboard_zynq/src/eth/phy/id.rs
+++ b/libboard_zynq/src/eth/phy/id.rs
@ -11,6 +11,9 @@ pub struct PhyIdentifier {
 }

 pub fn identify_phy<PA: PhyAccess>(pa: &mut PA, addr: u8) -> Option<PhyIdentifier> {
+    #[cfg(feature = "target_kasli_soc")]
+    pa.write_phy(addr, 0x16, 0); //reset page
+    
    let id1 = pa.read_phy(addr, 2);
    let id2 = pa.read_phy(addr, 3);
    if id1 != 0xFFFF || id2 != 0xFFFF {
--- a/libboard_zynq/src/eth/phy/leds.rs
+++ b/libboard_zynq/src/eth/phy/leds.rs
@ -0,0 +1,79 @@
+use bit_field::BitField;
+use super::{PhyRegister, Led0Control, Led1Control};
+
+#[derive(Clone, Copy, Debug)]
+/// LED Control Register
+pub struct Leds(pub u16);
+
+impl Leds {
+    pub fn led0(&self) -> Led0Control {
+        match self.0.get_bits(0..=3) {
+            0b0000 => Led0Control::OnLinkOffNoLink,
+            0b0001 => Led0Control::OnLinkBlinkActivityOffNoLink,
+            0b0010 => Led0Control::BlinkDependingOnLink,
+            0b0011 => Led0Control::OnActivityOffNoActivity,
+            0b0100 => Led0Control::BlinkActivityOffNoActivity,
+            0b0101 => Led0Control::OnTransmitOffNoTransmit,
+            0b0110 => Led0Control::OnCopperLinkOffElse,
+            0b0111 => Led0Control::On1000LinkOffElse,
+            0b1000 => Led0Control::ForceOff,
+            0b1001 => Led0Control::ForceOn,
+            0b1010 => Led0Control::ForceHiZ,
+            0b1011 => Led0Control::ForceBlink,
+            0b1100 => Led0Control::Mode1,
+            0b1101 => Led0Control::Mode2,
+            0b1110 => Led0Control::Mode3,
+            0b1111 => Led0Control::Mode4,
+            _ => unreachable!()
+        }
+    }
+    pub fn led1(&self) -> Led1Control {
+        match self.0.get_bits(4..=7) {
+            0b0000 => Led1Control::OnReceiveOffNoReceive,
+            0b0001 => Led1Control::OnLinkBlinkActivityOffNoLink,
+            0b0010 => Led1Control::OnLinkBlinkReceiveOffNoLink,
+            0b0011 => Led1Control::OnActivityOffNoActivity,
+            0b0100 => Led1Control::BlinkActivityOffNoActivity,
+            0b0101 => Led1Control::On100OrFiberOffElse,
+            0b0110 => Led1Control::On1001000LinkOffElse,
+            0b0111 => Led1Control::On100LinkOffElse,
+            0b1000 => Led1Control::ForceOff,
+            0b1001 => Led1Control::ForceOn,
+            0b1010 => Led1Control::ForceHiZ,
+            0b1011 => Led1Control::ForceBlink,
+            _ => unreachable!()
+        }
+    }
+
+    pub fn set_led0(mut self, setting: Led0Control) -> Self {
+        self.0.set_bits(0..=3, setting as u16);
+        self
+    }
+
+    pub fn set_led1(mut self, setting: Led1Control) -> Self {
+        self.0.set_bits(4..=7, setting as u16);
+        self
+    }
+}
+
+impl PhyRegister for Leds {
+    fn addr() -> u8 {
+        0x10
+    }
+        
+    fn page() -> u8 {
+        3
+    }
+}
+
+impl From<u16> for Leds {
+    fn from(value: u16) -> Self {
+        Leds(value)
+    }
+}
+
+impl Into<u16> for Leds {
+    fn into(self) -> u16 {
+        self.0
+    }
+}
--- a/libboard_zynq/src/eth/phy/mod.rs
+++ b/libboard_zynq/src/eth/phy/mod.rs
@ -6,8 +6,10 @@ mod control;
 pub use control::Control;
 mod pssr;
 pub use pssr::PSSR;
+mod leds;
+pub use leds::Leds;

-#[derive(Clone, Debug, PartialEq)]
+#[derive(Copy, Clone, Debug, PartialEq)]
 pub struct Link {
    pub speed: LinkSpeed,
    pub duplex: LinkDuplex,
@ -26,51 +28,105 @@ pub enum LinkDuplex {
    Full,
 }

+#[derive(Copy, Clone, Debug, PartialEq)]
+pub enum Led0Control {
+    OnLinkOffNoLink = 0b0000,
+    OnLinkBlinkActivityOffNoLink = 0b0001,
+    BlinkDependingOnLink = 0b0010,
+    OnActivityOffNoActivity = 0b0011,
+    BlinkActivityOffNoActivity = 0b0100,
+    OnTransmitOffNoTransmit = 0b0101,
+    OnCopperLinkOffElse = 0b0110,
+    On1000LinkOffElse = 0b0111,
+    ForceOff = 0b1000,
+    ForceOn = 0b1001,
+    ForceHiZ = 0b1010,
+    ForceBlink = 0b1011,
+    Mode1 = 0b1100,
+    Mode2 = 0b1101,
+    Mode3 = 0b1110,
+    Mode4 = 0b1111
+}
+
+#[derive(Copy, Clone, Debug, PartialEq)]
+pub enum Led1Control {
+    OnReceiveOffNoReceive = 0b0000,
+    OnLinkBlinkActivityOffNoLink = 0b0001,
+    OnLinkBlinkReceiveOffNoLink = 0b0010,
+    OnActivityOffNoActivity = 0b0011,
+    BlinkActivityOffNoActivity = 0b0100,
+    On100OrFiberOffElse = 0b0101,
+    On1001000LinkOffElse = 0b0110,
+    On100LinkOffElse = 0b0111,
+    ForceOff = 0b1000,
+    ForceOn = 0b1001,
+    ForceHiZ = 0b1010,
+    ForceBlink = 0b1011,
+}
+
 pub trait PhyAccess {
    fn read_phy(&mut self, addr: u8, reg: u8) -> u16;
    fn write_phy(&mut self, addr: u8, reg: u8, data: u16);
 }

+pub trait PhyRegister {
+    fn addr() -> u8;
+    fn page() -> u8;
+}
+
+
 #[derive(Clone)]
 pub struct Phy {
    pub addr: u8,
-    device: PhyDevice,
-}
-
-#[derive(Clone, Copy)]
-pub enum PhyDevice {
-    Marvell88E1116R,
-    Rtl8211E,
 }

 const OUI_MARVELL: u32 = 0x005043;
 const OUI_REALTEK: u32 = 0x000732;
+const OUI_LANTIQ : u32 = 0x355969;
+const OUI_ICPLUS : u32 = 0x0090c3;
+
+//only change pages on Kasli-SoC's Marvel 88E11xx
+#[cfg(feature="target_kasli_soc")]
+const PAGE_REGISTER: u8 = 0x16;

 impl Phy {
    /// Probe all addresses on MDIO for a known PHY
    pub fn find<PA: PhyAccess>(pa: &mut PA) -> Option<Phy> {
-        (1..32).filter_map(|addr| {
-            match identify_phy(pa, addr) {
+        (0..32).find(|addr| {
+            match identify_phy(pa, *addr) {
                Some(PhyIdentifier {
                    oui: OUI_MARVELL,
+                    // Marvell 88E1116R
                    model: 36,
                    ..
-                }) => Some(PhyDevice::Marvell88E1116R),
+                }) => true,
+                Some(PhyIdentifier {
+                    oui: OUI_MARVELL,
+                    // Marvell 88E1512
+                    model: 29,
+                    ..
+                }) => true,
                Some(PhyIdentifier {
                    oui: OUI_REALTEK,
+                    // RTL 8211E
                    model: 0b010001,
                    rev: 0b0101,
-                }) => Some(PhyDevice::Rtl8211E),
-                _ => None,
-            }.map(|device| Phy { addr, device })
-        }).next()
-    }
-
-    pub fn name(&self) -> &'static str {
-        match self.device {
-            PhyDevice::Marvell88E1116R => &"Marvell 88E1116R",
-            PhyDevice::Rtl8211E => &"RTL8211E",
-        }
+                }) => true,
+                Some(PhyIdentifier {
+                    oui: OUI_LANTIQ,
+                    // Intel XWAY PHY11G (PEF 7071/PEF 7072) v1.5 / v1.6
+                    model: 0,
+                    ..
+                }) => true,
+                Some(PhyIdentifier {
+                    oui: OUI_ICPLUS,
+                    // IP101G-DS-R01
+                    model: 5,
+                    rev: 4,
+                }) => true,
+                _ => false,
+            }
+        }).map(|addr| Phy { addr })
    }

    pub fn read_reg<PA, PR>(&self, pa: &mut PA) -> PR
@ -78,6 +134,9 @@ impl Phy {
        PA: PhyAccess,
        PR: PhyRegister + From<u16>,
    {
+        #[cfg(feature="target_kasli_soc")]
+        pa.write_phy(self.addr, PAGE_REGISTER, PR::page().into());
+
        pa.read_phy(self.addr, PR::addr()).into()
    }

@ -87,6 +146,9 @@ impl Phy {
        PR: PhyRegister + From<u16> + Into<u16>,
        F: FnMut(PR) -> PR,
    {
+        #[cfg(feature="target_kasli_soc")]
+        pa.write_phy(self.addr, PAGE_REGISTER, PR::page().into());
+        
        let reg = pa.read_phy(self.addr, PR::addr()).into();
        let reg = f(reg);
        pa.write_phy(self.addr, PR::addr(), reg.into())
@ -100,6 +162,14 @@ impl Phy {
        self.modify_reg(pa, f)
    }

+    pub fn modify_leds<PA, F>(&self, pa: &mut PA, f: F)
+    where
+        PA: PhyAccess,
+        F: FnMut(Leds) -> Leds,
+    {
+        self.modify_reg(pa, f)   
+    }
+
    pub fn get_control<PA: PhyAccess>(&self, pa: &mut PA) -> Control {
        self.read_reg(pa)
    }
@ -133,8 +203,12 @@ impl Phy {
                .set_restart_autoneg(true)
        );
    }
-}

-pub trait PhyRegister {
-    fn addr() -> u8;
+    #[cfg(feature="target_kasli_soc")]
+    pub fn set_leds<PA: PhyAccess>(&self, pa: &mut PA) {
+        self.modify_leds(pa, |leds|
+            leds.set_led0(Led0Control::OnCopperLinkOffElse)
+                .set_led1(Led1Control::BlinkActivityOffNoActivity)
+        );
+    }
 }
--- a/libboard_zynq/src/eth/phy/pssr.rs
+++ b/libboard_zynq/src/eth/phy/pssr.rs
@ -43,6 +43,10 @@ impl PhyRegister for PSSR {
    fn addr() -> u8 {
        0x11
    }
+        
+    fn page() -> u8 {
+        0
+    }
 }

 impl From<u16> for PSSR {
--- a/libboard_zynq/src/eth/phy/status.rs
+++ b/libboard_zynq/src/eth/phy/status.rs
@ -55,12 +55,22 @@ impl Status {
    pub fn get_link(&self) -> Option<Link> {
        if ! self.link_status() {
            None
-        } else if self.cap_10base_t_half() {
+        } else if self.cap_100base_tx_full() {
            Some(Link {
-                speed: LinkSpeed::S10,
+                speed: LinkSpeed::S100,
+                duplex: LinkDuplex::Full,
+            })
+        } else if self.cap_100base_tx_half() {
+            Some(Link {
+                speed: LinkSpeed::S100,
                duplex: LinkDuplex::Half,
            })
-        } else if self.cap_10base_t_full() {
+        } else if self.cap_100base_t4() {
+            Some(Link {
+                speed: LinkSpeed::S100,
+                duplex: LinkDuplex::Half,
+            })
+        } else if self.cap_10base_t2_full() {
            Some(Link {
                speed: LinkSpeed::S10,
                duplex: LinkDuplex::Full,
@ -70,26 +80,16 @@ impl Status {
                speed: LinkSpeed::S10,
                duplex: LinkDuplex::Half,
            })
-        } else if self.cap_10base_t2_full() {
+        } else if self.cap_10base_t_full() {
            Some(Link {
                speed: LinkSpeed::S10,
                duplex: LinkDuplex::Full,
            })
-        } else if self.cap_100base_t4() {
+        } else if self.cap_10base_t_half() {
            Some(Link {
-                speed: LinkSpeed::S100,
+                speed: LinkSpeed::S10,
                duplex: LinkDuplex::Half,
            })
-        } else if self.cap_100base_tx_half() {
-            Some(Link {
-                speed: LinkSpeed::S100,
-                duplex: LinkDuplex::Half,
-            })
-        } else if self.cap_100base_tx_full() {
-            Some(Link {
-                speed: LinkSpeed::S100,
-                duplex: LinkDuplex::Full,
-            })
        } else {
            None
        }
@ -100,6 +100,10 @@ impl PhyRegister for Status {
    fn addr() -> u8 {
        1
    }
+        
+    fn page() -> u8 {
+        0
+    }
 }

 impl From<u16> for Status {
--- a/libboard_zynq/src/eth/regs.rs
+++ b/libboard_zynq/src/eth/regs.rs
@ -110,6 +110,49 @@ pub struct RegisterBlock {
    pub design_cfg5: RO<u32>,
 }

+pub struct GpioRegisterBlock {
+    pub gpio_output_mask: &'static mut OutputMask,
+    pub gpio_direction: &'static mut Direction,
+    pub gpio_output_enable: &'static mut OutputEnable,
+}
+
+impl GpioRegisterBlock {
+    pub fn regs() -> Self {
+        Self {
+            gpio_output_mask: OutputMask::new(),
+            gpio_direction: Direction::new(),
+            gpio_output_enable: OutputEnable::new(),
+        }
+    }
+}
+
+register!(gpio_output_mask, 
+            /// MASK_DATA_1_SW:
+            /// Maskable output data for MIO[47:32]
+            OutputMask, RW, u32);
+register_at!(OutputMask, 0xE000A008, new);
+register_bit!(gpio_output_mask, 
+            /// Output for PHY_RST (MIO[47])
+            phy_rst, 15);
+register_bits!(gpio_output_mask,
+            mask, u16, 16, 31);
+register!(gpio_direction, 
+            /// DIRM_1:
+            /// Direction mode for MIO[53:32]; 0/1 = in/out
+            Direction, RW, u32);
+register_at!(Direction, 0xE000A244, new);
+register_bit!(gpio_direction,
+            /// Direction for PHY_RST
+            phy_rst, 15);
+register!(gpio_output_enable,
+            /// OEN_1:
+            /// Output enable for MIO[53:32]
+            OutputEnable, RW, u32);
+register_at!(OutputEnable, 0xE000A248, new);
+register_bit!(gpio_output_enable,
+            /// Output enable for PHY_RST
+            phy_rst, 15);
+    
 register_at!(RegisterBlock, 0xE000B000, gem0);
 register_at!(RegisterBlock, 0xE000C000, gem1);

--- a/libboard_zynq/src/eth/rx.rs
+++ b/libboard_zynq/src/eth/rx.rs
@ -108,6 +108,20 @@ impl DescList {
        if entry.word0.read().used() {
            let word1 = entry.word1.read();
            let len = word1.frame_length_lsbs().into();
+            let padding = {
+                let diff = len % 0x20;
+                if diff == 0 {
+                    0
+                } else {
+                    0x20 - diff
+                }
+            };
+            unsafe {
+                // invalidate the buffer
+                // we cannot do it in the drop function, as L2 cache data prefetch would prefetch
+                // the data, and there is no way for us to prevent that unless changing MMU table.
+                dci_slice(&mut self.buffers[self.next][0..len + padding]);
+            }
            let buffer = &mut self.buffers[self.next][0..len];

            self.next += 1;
@ -135,10 +149,6 @@ pub struct PktRef<'a> {

 impl<'a> Drop for PktRef<'a> {
    fn drop(&mut self) {
-        // Flush buffer from cache, to be filled by the peripheral
-        // before next read
-        dcci_slice(self.buffer);
-
        self.entry.word0.modify(|_, w| w.used(false));
        dmb();
    }
--- a/libboard_zynq/src/eth/tx.rs
+++ b/libboard_zynq/src/eth/tx.rs
@ -132,10 +132,8 @@ impl<'a> Drop for PktRef<'a> {
        dcc_slice(self.buffer);

        self.entry.word1.modify(|_, w| w.used(false));
-        if ! self.regs.tx_status.read().tx_go() {
-            // Start TX if not already running
-            self.regs.net_ctrl.modify(|_, w| w.start_tx(true));
-        }
+        // Start the TX engine
+        self.regs.net_ctrl.modify(|_, w| w.start_tx(true));
    }
 }

@ -166,10 +164,7 @@ impl<'a> smoltcp::phy::TxToken for Token<'a> {
            None =>
                Err(smoltcp::Error::Exhausted),
            Some(mut pktref) => {
-                let result = f(pktref.deref_mut());
-                // TODO: on result.is_err() don;t send
-                drop(pktref);
-                result
+                f(pktref.deref_mut())
            }
        }
    }
--- a/libboard_zynq/src/flash/bytes.rs
+++ b/libboard_zynq/src/flash/bytes.rs
@ -1,41 +0,0 @@
-pub trait BytesTransferExt: Sized {
-    // Turn u32 into u8
-    fn bytes_transfer(self) -> BytesTransfer<Self>
-    where
-        Self: Iterator<Item = u32>;
-}
-
-impl<I: Iterator<Item = u32>> BytesTransferExt for I {
-    // Turn u32 into u8
-    fn bytes_transfer(self) -> BytesTransfer<Self> {
-        BytesTransfer {
-            iter: self,
-            shift: 0,
-            word: 0,
-        }
-    }
-}
-
-pub struct BytesTransfer<I: Iterator<Item = u32> + Sized> {
-    iter: I,
-    shift: u8,
-    word: u32,
-}
-
-impl<I: Iterator<Item = u32> + Sized> Iterator for BytesTransfer<I> {
-    type Item = u8;
-
-    fn next(&mut self) -> Option<u8> {
-        if self.shift > 0 {
-            self.shift -= 8;
-            Some((self.word >> self.shift) as u8)
-        } else {
-            self.iter.next()
-                .and_then(|word| {
-                    self.shift = 32;
-                    self.word = word;
-                    self.next()
-                })
-        }
-    }
-}
--- a/libboard_zynq/src/flash/mod.rs
+++ b/libboard_zynq/src/flash/mod.rs
@ -1,503 +0,0 @@
-//! Quad-SPI Flash Controller
-
-use core::marker::PhantomData;
-use log::{error, info, warn};
-use libregister::{RegisterR, RegisterW, RegisterRW};
-use crate::{print, println};
-use super::slcr;
-use super::clocks::source::{IoPll, ClockSource};
-
-mod regs;
-mod bytes;
-pub use bytes::{BytesTransferExt, BytesTransfer};
-mod spi_flash_register;
-use spi_flash_register::*;
-mod transfer;
-use transfer::Transfer;
-
-const FLASH_BAUD_RATE: u32 = 50_000_000;
-/// 16 MB
-pub const SINGLE_CAPACITY: u32 = 0x1000000;
-pub const SECTOR_SIZE: u32 = 0x10000;
-pub const PAGE_SIZE: u32 = 0x100;
-
-/// Instruction: Read Identification
-const INST_RDID: u8 = 0x9F;
-/// Instruction: Read
-const INST_READ: u8 = 0x03;
-/// Instruction: Quad I/O Fast Read
-const INST_4IO_FAST_READ: u8 = 0xEB;
-/// Instruction: Write Disable
-const INST_WRDI: u8 = 0x04;
-/// Instruction: Write Enable
-const INST_WREN: u8 = 0x06;
-/// Instruction: Program page
-const INST_PP: u8 = 0x02;
-/// Instruction: Erase 4K Block
-const INST_BE_4K: u8 = 0x20;
-
-#[derive(Clone)]
-pub enum SpiWord {
-    W8(u8),
-    W16(u16),
-    W24(u32),
-    W32(u32),
-}
-
-impl From<u8> for SpiWord {
-    fn from(x: u8) -> Self {
-        SpiWord::W8(x)
-    }
-}
-
-impl From<u16> for SpiWord {
-    fn from(x: u16) -> Self {
-        SpiWord::W16(x)
-    }
-}
-
-impl From<u32> for SpiWord {
-    fn from(x: u32) -> Self {
-        SpiWord::W32(x)
-    }
-}
-
-/// Memory-mapped mode
-pub struct LinearAddressing;
-/// Manual I/O mode
-pub struct Manual;
-
-/// Flash Interface Driver
-///
-/// For 2x Spansion S25FL128SAGMFIR01
-pub struct Flash<MODE> {
-    regs: &'static mut regs::RegisterBlock,
-    _mode: PhantomData<MODE>,
-}
-
-impl<MODE> Flash<MODE> {
-    fn transition<TO>(self) -> Flash<TO> {
-        Flash {
-            regs: self.regs,
-            _mode: PhantomData,
-        }
-    }
-
-    fn disable_interrupts(&mut self) {
-        self.regs.intr_dis.write(
-            regs::IntrDis::zeroed()
-                .rx_overflow(true)
-                .tx_fifo_not_full(true)
-                .tx_fifo_full(true)
-                .rx_fifo_not_empty(true)
-                .rx_fifo_full(true)
-                .tx_fifo_underflow(true)
-        );
-    }
-
-    fn clear_rx_fifo(&self) {
-        while self.regs.intr_status.read().rx_fifo_not_empty() {
-            let _ = self.regs.rx_data.read();
-        }
-    }
-
-    fn clear_interrupt_status(&mut self) {
-        self.regs.intr_status.write(
-            regs::IntrStatus::zeroed()
-                .rx_overflow(true)
-                .tx_fifo_underflow(true)
-        );
-    }
-
-    fn wait_tx_fifo_flush(&mut self) {
-        self.regs.config.modify(|_, w| w.man_start_com(true));
-        while !self.regs.intr_status.read().tx_fifo_not_full() {}
-    }
-}
-
-impl Flash<()> {
-    pub fn flash(clock: u32) -> Self {
-        Self::enable_clocks(clock);
-        Self::setup_signals();
-        Self::reset();
-
-        let regs = regs::RegisterBlock::qspi();
-        let mut flash = Flash { regs, _mode: PhantomData };
-        flash.configure((FLASH_BAUD_RATE - 1 + clock) / FLASH_BAUD_RATE);
-        flash
-    }
-
-    /// typical: `200_000_000` Hz
-    fn enable_clocks(clock: u32) {
-        let io_pll = IoPll::freq();
-        let divisor = ((clock - 1 + io_pll) / clock)
-            .max(1).min(63) as u8;
-
-        slcr::RegisterBlock::unlocked(|slcr| {
-            slcr.lqspi_clk_ctrl.write(
-                slcr::LqspiClkCtrl::zeroed()
-                    .src_sel(slcr::PllSource::IoPll)
-                    .divisor(divisor)
-                    .clkact(true)
-            );
-        });
-    }
-
-    fn setup_signals() {
-        slcr::RegisterBlock::unlocked(|slcr| {
-            // 1. Configure MIO pin 1 for chip select 0 output.
-            slcr.mio_pin_01.write(
-                slcr::MioPin01::zeroed()
-                    .l0_sel(true)
-                    .io_type(slcr::IoBufferType::Lvcmos18)
-                    .pullup(true)
-            );
-
-            // Configure MIO pins 2 through 5 for I/O.
-            slcr.mio_pin_02.write(
-                slcr::MioPin02::zeroed()
-                    .l0_sel(true)
-                    .io_type(slcr::IoBufferType::Lvcmos18)
-            );
-            slcr.mio_pin_03.write(
-                slcr::MioPin03::zeroed()
-                    .l0_sel(true)
-                    .io_type(slcr::IoBufferType::Lvcmos18)
-            );
-            slcr.mio_pin_04.write(
-                slcr::MioPin04::zeroed()
-                    .l0_sel(true)
-                    .io_type(slcr::IoBufferType::Lvcmos18)
-            );
-            slcr.mio_pin_05.write(
-                slcr::MioPin05::zeroed()
-                    .l0_sel(true)
-                    .io_type(slcr::IoBufferType::Lvcmos18)
-            );
-
-            // 3. Configure MIO pin 6 for serial clock 0 output.
-            slcr.mio_pin_06.write(
-                slcr::MioPin06::zeroed()
-                    .l0_sel(true)
-                    .io_type(slcr::IoBufferType::Lvcmos18)
-            );
-
-            // Option: Add Second Device Chip Select
-            // 4. Configure MIO pin 0 for chip select 1 output.
-            slcr.mio_pin_00.write(
-                slcr::MioPin00::zeroed()
-                    .l0_sel(true)
-                    .io_type(slcr::IoBufferType::Lvcmos18)
-            );
-
-            // Option: Add Second Serial Clock
-            // 5. Configure MIO pin 9 for serial clock 1 output.
-            slcr.mio_pin_09.write(
-                slcr::MioPin09::zeroed()
-                    .l0_sel(true)
-                    .io_type(slcr::IoBufferType::Lvcmos18)
-                    .pullup(true)
-            );
-
-            // Option: Add 4-bit Data
-            // 6. Configure MIO pins 10 through 13 for I/O.
-            slcr.mio_pin_10.write(
-                slcr::MioPin10::zeroed()
-                    .l0_sel(true)
-                    .io_type(slcr::IoBufferType::Lvcmos18)
-                    .pullup(true)
-            );
-            slcr.mio_pin_11.write(
-                slcr::MioPin11::zeroed()
-                    .l0_sel(true)
-                    .io_type(slcr::IoBufferType::Lvcmos18)
-                    .pullup(true)
-            );
-            slcr.mio_pin_12.write(
-                slcr::MioPin12::zeroed()
-                    .l0_sel(true)
-                    .io_type(slcr::IoBufferType::Lvcmos18)
-                    .pullup(true)
-            );
-            slcr.mio_pin_13.write(
-                slcr::MioPin13::zeroed()
-                    .l0_sel(true)
-                    .io_type(slcr::IoBufferType::Lvcmos18)
-                    .pullup(true)
-            );
-
-            // Option: Add Feedback Output Clock
-            // 7. Configure MIO pin 8 for feedback clock.
-            slcr.mio_pin_08.write(
-                slcr::MioPin08::zeroed()
-                    .l0_sel(true)
-                    .io_type(slcr::IoBufferType::Lvcmos18)
-                    .pullup(true)
-            );
-        });
-    }
-
-    fn reset() {
-        slcr::RegisterBlock::unlocked(|slcr| {
-            slcr.lqspi_rst_ctrl.write(
-                slcr::LqspiRstCtrl::zeroed()
-                    .ref_rst(true)
-                    .cpu1x_rst(true)
-            );
-            slcr.lqspi_rst_ctrl.write(
-                slcr::LqspiRstCtrl::zeroed()
-            );
-        });
-    }
-
-    fn configure(&mut self, divider: u32) {
-        // Disable
-        self.regs.enable.write(
-            regs::Enable::zeroed()
-        );
-        self.disable_interrupts();
-        self.regs.lqspi_cfg.write(
-            regs::LqspiCfg::zeroed()
-        );
-        self.clear_rx_fifo();
-        self.clear_interrupt_status();
-
-        // for a baud_rate_div=1 LPBK_DLY_ADJ would be required
-        let mut baud_rate_div = 2u32;
-        while baud_rate_div < 7 && 2u32.pow(1 + baud_rate_div) < divider {
-            baud_rate_div += 1;
-        }
-
-        self.regs.config.write(regs::Config::zeroed()
-            .baud_rate_div(baud_rate_div as u8)
-            .mode_sel(true)
-            .leg_flsh(true)
-            .holdb_dr(true)
-            // 32 bits TX FIFO width
-            .fifo_width(0b11)
-        );
-
-        // Initialize RX/TX pipes thresholds
-        unsafe {
-            self.regs.rx_thres.write(1);
-            self.regs.tx_thres.write(1);
-        }
-    }
-
-    pub fn linear_addressing_mode(self) -> Flash<LinearAddressing> {
-        // Set manual start enable to auto mode.
-        // Assert the chip select.
-        self.regs.config.modify(|_, w| w
-            .man_start_en(false)
-            .pcs(false)
-            .manual_cs(false)
-        );
-
-        self.regs.lqspi_cfg.write(regs::LqspiCfg::zeroed()
-            // Quad I/O Fast Read
-            .inst_code(INST_4IO_FAST_READ)
-            .dummy_mask(0x2)
-            .mode_en(false)
-            .mode_bits(0xFF)
-            // 2 devices
-            .two_mem(true)
-            .u_page(false)
-            // Quad SPI mode
-            .lq_mode(true)
-        );
-
-        self.regs.enable.write(
-            regs::Enable::zeroed()
-                .spi_en(true)
-        );
-
-        self.transition()
-    }
-
-    pub fn manual_mode(self, chip_index: usize) -> Flash<Manual> {
-        self.regs.config.modify(|_, w| w
-            .man_start_en(true)
-            .manual_cs(true)
-            .endian(true)
-        );
-
-        self.regs.lqspi_cfg.write(regs::LqspiCfg::zeroed()
-            // Quad I/O Fast Read
-            .inst_code(INST_READ)
-            .dummy_mask(0x2)
-            .mode_en(false)
-            .mode_bits(0xFF)
-            // 2 devices
-            .two_mem(true)
-            .u_page(chip_index != 0)
-            // Quad SPI mode
-            .lq_mode(false)
-        );
-
-        self.transition()
-    }
-}
-
-impl Flash<LinearAddressing> {
-    /// Stop linear addressing mode
-    pub fn stop(self) -> Flash<()> {
-        self.regs.enable.modify(|_, w| w.spi_en(false));
-        // De-assert chip select.
-        self.regs.config.modify(|_, w| w.pcs(true));
-
-        self.transition()
-    }
-
-    pub fn ptr<T>(&mut self) -> *mut T {
-        0xFC00_0000 as *mut _
-    }
-
-    pub fn size(&self) -> usize {
-        2 * (SINGLE_CAPACITY as usize)
-    }
-}
-
-impl Flash<Manual> {
-    pub fn stop(self) -> Flash<()> {
-        self.transition()
-    }
-
-    pub fn read_reg<R: SpiFlashRegister>(&mut self) -> R {
-        let args = Some(R::inst_code());
-        let transfer = self.transfer(args.into_iter(), 2)
-            .bytes_transfer();
-        R::new(transfer.skip(1).next().unwrap())
-    }
-
-    pub fn read_reg_until<R, F, A>(&mut self, f: F) -> A
-    where
-        R: SpiFlashRegister,
-        F: Fn(R) -> Option<A>,
-    {
-        let mut result = None;
-        while result.is_none() {
-            let args = Some(R::inst_code());
-            for b in self.transfer(args.into_iter(), 32)
-                .bytes_transfer().skip(1) {
-                    result = f(R::new(b));
-                    
-                    if result.is_none() {
-                        break;
-                    }
-                }
-        }
-        result.unwrap()
-    }
-
-    /// Status Register-1 remains `0x00` immediately after invoking a command.
-    fn wait_while_sr1_zeroed(&mut self) -> SR1 {
-        self.read_reg_until::<SR1, _, SR1>(|sr1|
-            if sr1.is_zeroed() {
-                None
-            } else {
-                Some(sr1)
-            }
-        )
-    }
-
-    /// Read Identification
-    pub fn rdid(&mut self) -> core::iter::Skip<BytesTransfer<Transfer<core::option::IntoIter<u32>, u32>>> {
-        let args = Some((INST_RDID as u32) << 24);
-        self.transfer(args.into_iter(), 0x44)
-            .bytes_transfer().skip(1)
-    }
-
-    /// Read flash data
-    pub fn read(&mut self, offset: u32, len: usize
-    ) -> core::iter::Take<core::iter::Skip<BytesTransfer<Transfer<core::option::IntoIter<u32>, u32>>>>
-    {
-        let args = Some(((INST_READ as u32) << 24) | (offset as u32));
-        self.transfer(args.into_iter(), len + 6)
-            .bytes_transfer().skip(6).take(len)
-    }
-
-    pub fn erase(&mut self, offset: u32) {
-        let args = Some(((INST_BE_4K as u32) << 24) | (offset as u32));
-        self.transfer(args.into_iter(), 4);
-
-        let sr1 = self.wait_while_sr1_zeroed();
-
-        if sr1.e_err() {
-            error!("E_ERR");
-        } else if sr1.p_err() {
-            error!("P_ERR");
-        } else if sr1.wip() {
-            info!("Erase in progress");
-            while self.read_reg::<SR1>().wip() {
-                print!(".");
-            }
-            println!("");
-        } else {
-            warn!("erased? sr1={:02X}", sr1.inner);
-        }
-    }
-
-    pub fn program<I: Iterator<Item=u32>>(&mut self, offset: u32, data: I) {
-        {
-            let len = 4 + 4 * data.size_hint().0;
-            let args = Some(SpiWord::W32(((INST_PP as u32) << 24) | (offset as u32))).into_iter()
-                .chain(data.map(SpiWord::W32));
-            self.transfer(args, len);
-        }
-
-        // let sr1 = self.wait_while_sr1_zeroed();
-        let sr1 = self.read_reg::<SR1>();
-
-        if sr1.e_err() {
-            error!("E_ERR");
-        } else if sr1.p_err() {
-            error!("P_ERR");
-        } else if sr1.wip() {
-            info!("Program in progress");
-            while self.read_reg::<SR1>().wip() {
-                print!(".");
-            }
-            println!("");
-        } else {
-            warn!("programmed? sr1={:02X}", sr1.inner);
-        }
-    }
-
-    pub fn write_enabled<F: Fn(&mut Self) -> R, R>(&mut self, f: F) -> R {
-        // Write Enable
-        let args = Some(INST_WREN);
-        self.transfer(args.into_iter(), 1);
-        self.regs.gpio.modify(|_, w| w.wp_n(true));
-        let sr1 = self.wait_while_sr1_zeroed();
-        if !sr1.wel() {
-            panic!("Cannot write-enable flash");
-        }
-
-        let result = f(self);
-
-        // Write Disable
-        let args = Some(INST_WRDI);
-        self.transfer(args.into_iter(), 1);
-        self.regs.gpio.modify(|_, w| w.wp_n(false));
-
-        result
-    }
-
-    pub fn transfer<'s: 't, 't, Args, W>(&'s mut self, args: Args, len: usize) -> Transfer<'t, Args, W>
-    where
-        Args: Iterator<Item = W>,
-        W: Into<SpiWord>,
-    {
-        Transfer::new(self, args, len)
-    }
-
-    pub fn dump(&mut self, label: &'_ str, inst_code: u8) {
-        print!("{}:", label);
-
-        let args = Some(u32::from(inst_code) << 24);
-        for b in self.transfer(args.into_iter(), 32).bytes_transfer() {
-            print!(" {:02X}", b);
-        }
-        println!("");
-    }
-}
--- a/libboard_zynq/src/flash/regs.rs
+++ b/libboard_zynq/src/flash/regs.rs
@ -1,122 +0,0 @@
-use volatile_register::{RO, WO, RW};
-
-use libregister::{register, register_at, register_bit, register_bits};
-
-#[repr(C)]
-pub struct RegisterBlock {
-    pub config: Config,
-    pub intr_status: IntrStatus,
-    pub intr_en: IntrEn,
-    pub intr_dis: IntrDis,
-    pub intr_mask: RO<u32>,
-    pub enable: Enable,
-    pub delay: RW<u32>,
-    pub txd0: WO<u32>,
-    pub rx_data: RO<u32>,
-    pub slave_idle_count: RW<u32>,
-    pub tx_thres: RW<u32>,
-    pub rx_thres: RW<u32>,
-    pub gpio: QspiGpio,
-    pub _unused1: RO<u32>,
-    pub lpbk_dly_adj: RW<u32>,
-    pub _unused2: [RO<u32>; 17],
-    pub txd1: WO<u32>,
-    pub txd2: WO<u32>,
-    pub txd3: WO<u32>,
-    pub _unused3: [RO<u32>; 5],
-    pub lqspi_cfg: LqspiCfg,
-    pub lqspi_sts: RW<u32>,
-    pub _unused4: [RO<u32>; 21],
-    pub mod_id: RW<u32>,
-}
-
-const BASE_ADDRESS: u32 = 0xE000D000;
-
-register_at!(RegisterBlock, 0xE000D000, qspi);
-
-register!(config, Config, RW, u32);
-register_bit!(config,
-              /// Enables master mode
-              mode_sel, 0);
-register_bit!(config,
-              /// Clock polarity low/high
-              clk_pol, 1);
-register_bit!(config,
-              /// Clock phase
-              clk_ph, 2);
-register_bits!(config,
-               /// divider = 2 ** (1 + baud_rate_div)
-               baud_rate_div, u8, 3, 5);
-register_bits!(config,
-               /// Must be set to 0b11
-               fifo_width, u8, 6, 7);
-register_bit!(config,
-              /// Must be 0
-              ref_clk, 8);
-register_bit!(config,
-              /// Peripheral Chip Select Line
-              pcs, 10);
-register_bit!(config,
-              /// false: auto mode, true: manual CS mode
-              manual_cs, 14);
-register_bit!(config,
-              /// false: auto mode, true: enables manual start enable
-              man_start_en, 15);
-register_bit!(config,
-              /// false: auto mode, true: enables manual start command
-              man_start_com, 16);
-register_bit!(config, holdb_dr, 19);
-register_bit!(config,
-              /// false: little, true: endian
-              endian, 26);
-register_bit!(config,
-              /// false: legacy SPI mode, true: Flash memory interface mode
-              leg_flsh, 31);
-
-register!(intr_status, IntrStatus, RW, u32);
-register_bit!(intr_status, rx_overflow, 0);
-register_bit!(intr_status,
-              /// < tx_thres
-              tx_fifo_not_full, 2);
-register_bit!(intr_status, tx_fifo_full, 3);
-register_bit!(intr_status,
-              /// >= rx_thres
-              rx_fifo_not_empty, 4);
-register_bit!(intr_status, rx_fifo_full, 5);
-register_bit!(intr_status, tx_fifo_underflow, 6);
-
-register!(intr_en, IntrEn, WO, u32);
-register_bit!(intr_en, rx_overflow, 0);
-register_bit!(intr_en, tx_fifo_not_full, 2);
-register_bit!(intr_en, tx_fifo_full, 3);
-register_bit!(intr_en, rx_fifo_not_empty, 4);
-register_bit!(intr_en, rx_fifo_full, 5);
-register_bit!(intr_en, tx_fifo_underflow, 6);
-
-register!(intr_dis, IntrDis, WO, u32);
-register_bit!(intr_dis, rx_overflow, 0);
-register_bit!(intr_dis, tx_fifo_not_full, 2);
-register_bit!(intr_dis, tx_fifo_full, 3);
-register_bit!(intr_dis, rx_fifo_not_empty, 4);
-register_bit!(intr_dis, rx_fifo_full, 5);
-register_bit!(intr_dis, tx_fifo_underflow, 6);
-
-register!(enable, Enable, RW, u32);
-register_bit!(enable, spi_en, 0);
-
-// named to avoid confusion with normal gpio
-register!(qspi_gpio, QspiGpio, RW, u32);
-register_bit!(qspi_gpio,
-              /// Write protect pin (inverted)
-              wp_n, 0);
-
-register!(lqspi_cfg, LqspiCfg, RW, u32);
-register_bits!(lqspi_cfg, inst_code, u8, 0, 7);
-register_bits!(lqspi_cfg, dummy_mask, u8, 8, 10);
-register_bits!(lqspi_cfg, mode_bits, u8, 16, 23);
-register_bit!(lqspi_cfg, mode_on, 24);
-register_bit!(lqspi_cfg, mode_en, 25);
-register_bit!(lqspi_cfg, u_page, 28);
-register_bit!(lqspi_cfg, sep_bus, 29);
-register_bit!(lqspi_cfg, two_mem, 30);
-register_bit!(lqspi_cfg, lq_mode, 31);
--- a/libboard_zynq/src/flash/spi_flash_register.rs
+++ b/libboard_zynq/src/flash/spi_flash_register.rs
@ -1,62 +0,0 @@
-use bit_field::BitField;
-
-pub trait SpiFlashRegister {
-    fn inst_code() -> u8;
-    fn new(src: u8) -> Self;
-}
-
-macro_rules! u8_register {
-    ($name: ident, $doc: tt, $inst_code: expr) => {
-        #[derive(Clone)]
-        #[doc=$doc]
-        pub struct $name {
-            pub inner: u8,
-        }
-
-        impl SpiFlashRegister for $name {
-            fn inst_code() -> u8 {
-                $inst_code
-            }
-
-            fn new(src: u8) -> Self {
-                $name {
-                    inner: src,
-                }
-            }
-        }
-
-        impl $name {
-            #[allow(unused)]
-            pub fn is_zeroed(&self) -> bool {
-                self.inner == 0
-            }
-        }
-    };
-}
-
-u8_register!(CR, "Configuration Register", 0x35);
-u8_register!(SR1, "Status Register-1", 0x05);
-impl SR1 {
-    /// Write In Progress
-    pub fn wip(&self) -> bool {
-        self.inner.get_bit(0)
-    }
-
-    /// Write Enable Latch
-    pub fn wel(&self) -> bool {
-        self.inner.get_bit(1)
-    }
-
-    /// Erase Error Occurred
-    pub fn e_err(&self) -> bool {
-        self.inner.get_bit(5)
-    }
-
-    /// Programming Error Occurred
-    pub fn p_err(&self) -> bool {
-        self.inner.get_bit(6)
-    }
-}
-
-u8_register!(SR2, "Status Register-2", 0x07);
-u8_register!(BA, "Bank Address Register", 0xB9);
--- a/libboard_zynq/src/flash/transfer.rs
+++ b/libboard_zynq/src/flash/transfer.rs
@ -1,125 +0,0 @@
-use libregister::{RegisterR, RegisterW, RegisterRW};
-use super::regs;
-use super::{SpiWord, Flash, Manual};
-
-pub struct Transfer<'a, Args: Iterator<Item = W>, W: Into<SpiWord>> {
-    flash: &'a mut Flash<Manual>,
-    args: Args,
-    sent: usize,
-    received: usize,
-    len: usize,
-}
-
-impl<'a, Args: Iterator<Item = W>, W: Into<SpiWord>> Transfer<'a, Args, W> {
-    pub fn new(flash: &'a mut Flash<Manual>, args: Args, len: usize) -> Self {
-        flash.regs.config.modify(|_, w| w.pcs(false));
-        flash.regs.enable.write(
-            regs::Enable::zeroed()
-                .spi_en(true)
-        );
-
-        let mut xfer = Transfer {
-            flash,
-            args,
-            sent: 0,
-            received: 0,
-            len,
-        };
-        xfer.fill_tx_fifo();
-        xfer.flash.regs.config.modify(|_, w| w.man_start_com(true));
-        xfer
-    }
-
-    fn fill_tx_fifo(&mut self) {
-        while self.sent < self.len && !self.flash.regs.intr_status.read().tx_fifo_full() {
-            let arg = self.args.next()
-                .map(|n| n.into())
-                .unwrap_or(SpiWord::W32(0));
-            match arg {
-                SpiWord::W32(w) => {
-                    // println!("txd0 {:08X}", w);
-                    unsafe {
-                        self.flash.regs.txd0.write(w);
-                    }
-                    self.sent += 4;
-                }
-                // Only txd0 can be used without flushing
-                _ => {
-                    if !self.flash.regs.intr_status.read().tx_fifo_not_full() {
-                        // Flush if necessary
-                        self.flash.wait_tx_fifo_flush();
-                    }
-
-                    match arg {
-                        SpiWord::W8(w) => {
-                            // println!("txd1 {:02X}", w);
-                            unsafe {
-                                self.flash.regs.txd1.write(u32::from(w) << 24);
-                            }
-                            self.sent += 1;
-                        }
-                        SpiWord::W16(w) => {
-                            unsafe {
-                                self.flash.regs.txd2.write(u32::from(w) << 16);
-                            }
-                            self.sent += 2;
-                        }
-                        SpiWord::W24(w) => {
-                            unsafe {
-                                self.flash.regs.txd3.write(w << 8);
-                            }
-                            self.sent += 3;
-                        }
-                        SpiWord::W32(_) => unreachable!(),
-                    }
-
-                    self.flash.wait_tx_fifo_flush();
-                }
-            }
-        }
-    }
-
-    fn can_read(&mut self) -> bool {
-        self.flash.regs.intr_status.read().rx_fifo_not_empty()
-    }
-
-    fn read(&mut self) -> u32 {
-        let rx = self.flash.regs.rx_data.read();
-        self.received += 4;
-        rx
-    }
-}
-
-impl<'a, Args: Iterator<Item = W>, W: Into<SpiWord>> Drop for Transfer<'a, Args, W> {
-    fn drop(&mut self) {
-        // Discard remaining rx_data
-        while self.can_read() {
-            self.read();
-        }
-
-        // Stop
-        self.flash.regs.enable.write(
-            regs::Enable::zeroed()
-                .spi_en(false)
-        );
-        self.flash.regs.config.modify(|_, w| w
-            .pcs(true)
-            .man_start_com(false)
-        );
-    }
-}
-
-impl<'a, Args: Iterator<Item = W>, W: Into<SpiWord>> Iterator for Transfer<'a, Args, W> {
-    type Item = u32;
-
-    fn next<'s>(&'s mut self) -> Option<u32> {
-        if self.received >= self.len {
-            return None;
-        }
-
-        self.fill_tx_fifo();
-
-        while !self.can_read() {}
-        Some(self.read())
-    }
-}
--- a/libboard_zynq/src/gic.rs
+++ b/libboard_zynq/src/gic.rs
@ -115,7 +115,7 @@ impl InterruptController {
        let m = (id.0 >> 2) as usize;
        let n = (8 * (id.0 & 3)) as usize;
        unsafe {
-            self.mpcore.icdiptr[m].modify(|mut icdiptr| *icdiptr.set_bits(n..=n+1, target_cpu as u32 + 1));
+            self.mpcore.icdiptr[m].modify(|mut icdiptr| *icdiptr.set_bits(n..=n+1, target_cpu as u32));
        }

        // sensitivity
--- a/libboard_zynq/src/i2c/eeprom.rs
+++ b/libboard_zynq/src/i2c/eeprom.rs
@ -4,6 +4,7 @@ use embedded_hal::timer::CountDown;

 pub struct EEPROM<'a> {
    i2c: &'a mut I2c,
+    #[cfg(not(feature = "target_ebaz4205"))]
    port: u8,
    address: u8,
    page_size: u8,
@ -22,10 +23,32 @@ impl<'a> EEPROM<'a> {
        }
    }

+    #[cfg(feature = "target_kasli_soc")]
+    pub fn new(i2c: &'a mut I2c, page_size: u8) -> Self {
+        EEPROM {
+            i2c: i2c,
+            port: 3,
+            address: 0x57,
+            page_size: page_size,
+            count_down: unsafe { crate::timer::GlobalTimer::get() }.countdown()
+        }
+    }
+
    #[cfg(feature = "target_zc706")]
    fn select(&mut self) -> Result<(), &'static str> {
-        let mask: u16 = 1 << self.port;
-        self.i2c.pca9548_select(0b1110100, mask as u8)?;
+        self.i2c.pca954x_select(0b1110100, Some(self.port))?;
+        Ok(())
+    }
+
+    #[cfg(feature = "target_kasli_soc")]
+    fn select(&mut self) -> Result<(), &'static str> {
+        // tca9548 is compatible with pca9548
+        self.i2c.pca954x_select(0b1110001, Some(self.port))?;
+        Ok(())
+    }
+
+    #[cfg(feature = "target_ebaz4205")]
+    fn select(&mut self) -> Result<(), &'static str> {
        Ok(())
    }

--- a/libboard_zynq/src/i2c/mod.rs
+++ b/libboard_zynq/src/i2c/mod.rs
@ -2,20 +2,33 @@

 mod regs;
 pub mod eeprom;
+#[cfg(not(feature = "target_ebaz4205"))]
 use super::slcr;
 use super::time::Microseconds;
 use embedded_hal::timer::CountDown;
-use libregister::{RegisterR, RegisterRW, RegisterW};
+use libregister::{RegisterR, RegisterRW};
+#[cfg(not(feature = "target_ebaz4205"))]
+use libregister::RegisterW;
+#[cfg(feature = "target_kasli_soc")]
+use log::info;
+
+pub enum I2cMultiplexer {
+    PCA9548 = 0,
+    #[cfg(feature = "target_kasli_soc")]
+    PCA9547 = 1,
+}

 pub struct I2c {
    regs: regs::RegisterBlock,
-    count_down: super::timer::global::CountDown<Microseconds>
+    count_down: super::timer::global::CountDown<Microseconds>,
+    pca_type: I2cMultiplexer
 }

 impl I2c {
-    #[cfg(feature = "target_zc706")]
+    #[cfg(any(feature = "target_zc706", feature = "target_kasli_soc", feature = "target_ebaz4205"))]
    pub fn i2c0() -> Self {
        // Route I2C 0 SCL / SDA Signals to MIO Pins 50 / 51
+        #[cfg(not(feature = "target_ebaz4205"))]
        slcr::RegisterBlock::unlocked(|slcr| {
            // SCL
            slcr.mio_pin_50.write(
@ -33,18 +46,28 @@ impl I2c {
                    .pullup(true)
                    .disable_rcvr(true)
            );
-            // Reset
-            slcr.gpio_rst_ctrl.reset_gpio();
+            // On Kasli-SoC prototype, leakage through the unconfigured I2C_SW_RESET
+            // MIO pin develops enough voltage on the T21 gate to assert the reset.
+            // Configure the pin to avoid this problem.
+            #[cfg(feature = "target_kasli_soc")]
+            slcr.mio_pin_33.write(
+                slcr::MioPin33::zeroed()
+                    .l3_sel(0b000)
+                    .io_type(slcr::IoBufferType::Lvcmos33)
+                    .pullup(false)
+                    .disable_rcvr(true)
+            );
        });

-        Self::i2c_common(0xFFFF - 0x000C)
+        Self::i2c_common(0xFFFF - 0x000C, 0xFFFF - 0x0002)
    }

-    fn i2c_common(gpio_output_mask: u16) -> Self {
+    fn i2c_common(gpio_output_mask: u16, _gpio_output_mask_lower: u16) -> Self {
        // Setup register block
        let self_ = Self {
            regs: regs::RegisterBlock::i2c(),
-            count_down: unsafe { super::timer::GlobalTimer::get() }.countdown()
+            count_down: unsafe { super::timer::GlobalTimer::get() }.countdown(),
+            pca_type: I2cMultiplexer::PCA9548 //default for zc706
        };

        // Setup GPIO output mask
@ -56,6 +79,17 @@ impl I2c {
            w.scl(true).sda(true)
        });

+        //Kasli-SoC only: I2C_SW_RESET configuration
+        #[cfg(feature = "target_kasli_soc")]
+        {
+            self_.regs.gpio_output_mask_lower.modify(|_, w| {
+                w.mask(_gpio_output_mask_lower)
+            });
+            self_.regs.gpio_direction.modify(|_, w| {
+                w.i2cswr(true)
+            });
+        }
+
        self_
    }

@ -65,7 +99,7 @@ impl I2c {
        nb::block!(self.count_down.wait()).unwrap();
    }

-    fn half_period(&mut self) { self.delay_us(100) }
+    fn unit_delay(&mut self) { self.delay_us(100) }

    fn sda_i(&mut self) -> bool {
        self.regs.gpio_input.read().sda()
@ -99,6 +133,48 @@ impl I2c {
        })
    }

+    #[cfg(feature = "target_kasli_soc")]
+    fn i2cswr_oe(&mut self, oe: bool) {
+        self.regs.gpio_output_enable.modify(|_, w| {
+             w.i2cswr(oe)
+        })
+    }
+
+    #[cfg(feature = "target_kasli_soc")]
+    fn i2cswr_o(&mut self, o: bool) {
+        self.regs.gpio_output_mask_lower.modify(|_, w| {
+             w.i2cswr_o(o)
+        })
+    }
+
+    #[cfg(feature = "target_kasli_soc")]
+    fn pca_autodetect(&mut self) -> Result<I2cMultiplexer, &'static str> {
+        // start with resetting the PCA954X
+        // SDA must be clear (before start)
+        // reset time is 500ns, unit_delay (100us) to account for propagation
+        self.i2cswr_o(true);
+        self.unit_delay();
+        self.i2cswr_o(false);
+        self.unit_delay();
+    
+        let pca954x_read_addr = (0x71 << 1) | 0x01;
+
+        self.start()?;
+        // read the config register
+        if !self.write(pca954x_read_addr)? {
+            return Err("PCA954X failed to ack read address");
+        }
+        let config = self.read(false)?;
+
+        let pca = match config {
+            0x00 => { info!("PCA9548 detected"); I2cMultiplexer::PCA9548 },
+            0x08 => { info!("PCA9547 detected"); I2cMultiplexer::PCA9547 },
+            _ => { return Err("Unknown response for PCA954X autodetect")},
+        };
+        self.stop()?;
+        Ok(pca)
+    }
+
    pub fn init(&mut self) -> Result<(), &'static str> {
        self.scl_oe(false);
        self.sda_oe(false);
@ -106,15 +182,15 @@ impl I2c {
        self.sda_o(false);

        // Check the I2C bus is ready
-        self.half_period();
-        self.half_period();
+        self.unit_delay();
+        self.unit_delay();
        if !self.sda_i() {
            // Try toggling SCL a few times
            for _bit in 0..8 {
                self.scl_oe(true);
-                self.half_period();
+                self.unit_delay();
                self.scl_oe(false);
-                self.half_period();
+                self.unit_delay();
            }
        }

@ -122,23 +198,31 @@ impl I2c {
            return Err("SDA is stuck low and doesn't get unstuck");
        }
        if !self.scl_i() {
-            return Err("SCL is stuck low and doesn't get unstuck");
+            return Err("SCL is stuck low");
        }
        // postcondition: SCL and SDA high
+        
+        #[cfg(feature = "target_kasli_soc")]
+        {
+            self.i2cswr_oe(true);
+            self.pca_type = self.pca_autodetect()?;
+        }
+        
        Ok(())
    }

    pub fn start(&mut self) -> Result<(), &'static str> {
        // precondition: SCL and SDA high
        if !self.scl_i() {
-            return Err("SCL is stuck low and doesn't get unstuck");
+            return Err("SCL is stuck low");
        }
        if !self.sda_i() {
            return Err("SDA arbitration lost");
        }
        self.sda_oe(true);
-        self.half_period();
+        self.unit_delay();
        self.scl_oe(true);
+        self.unit_delay();
        // postcondition: SCL and SDA low
        Ok(())
    }
@ -146,9 +230,9 @@ impl I2c {
    pub fn restart(&mut self) -> Result<(), &'static str> {
        // precondition SCL and SDA low
        self.sda_oe(false);
-        self.half_period();
+        self.unit_delay();
        self.scl_oe(false);
-        self.half_period();
+        self.unit_delay();
        self.start()?;
        // postcondition: SCL and SDA low
        Ok(())
@ -156,11 +240,11 @@ impl I2c {

    pub fn stop(&mut self) -> Result<(), &'static str> {
        // precondition: SCL and SDA low
-        self.half_period();
+        self.unit_delay();
        self.scl_oe(false);
-        self.half_period();
+        self.unit_delay();
        self.sda_oe(false);
-        self.half_period();
+        self.unit_delay();
        if !self.sda_i() {
            return Err("SDA arbitration lost");
        }
@ -173,18 +257,20 @@ impl I2c {
        // MSB first
        for bit in (0..8).rev() {
            self.sda_oe(data & (1 << bit) == 0);
-            self.half_period();
+            self.unit_delay();
            self.scl_oe(false);
-            self.half_period();
+            self.unit_delay();
            self.scl_oe(true);
+            self.unit_delay();
        }
        self.sda_oe(false);
-        self.half_period();
+        self.unit_delay();
        self.scl_oe(false);
-        self.half_period();
+        self.unit_delay();
        // Read ack/nack
        let ack = !self.sda_i();
        self.scl_oe(true);
+        self.unit_delay();
        self.sda_oe(true);
        // postcondition: SCL and SDA low

@ -199,17 +285,17 @@ impl I2c {

        // MSB first
        for bit in (0..8).rev() {
-            self.half_period();
+            self.unit_delay();
            self.scl_oe(false);
-            self.half_period();
+            self.unit_delay();
            if self.sda_i() { data |= 1 << bit }
            self.scl_oe(true);
        }
-        // Send ack/nack
+        // Send ack/nack (true = nack, false = ack)
        self.sda_oe(ack);
-        self.half_period();
+        self.unit_delay();
        self.scl_oe(false);
-        self.half_period();
+        self.unit_delay();
        self.scl_oe(true);
        self.sda_oe(true);
        // postcondition: SCL and SDA low
@ -217,13 +303,32 @@ impl I2c {
        Ok(data)
    }

-    pub fn pca9548_select(&mut self, address: u8, channels: u8) -> Result<(), &'static str> {
+    pub fn pca954x_select(&mut self, address: u8, channel: Option<u8>) -> Result<(), &'static str> {
        self.start()?;
+        // PCA9547 supports only one channel at a time
+        // for compatibility, PCA9548 is treated as such too
+        // channel - Some(x) - # of the channel [0,7], or None for all disabled
+        let setting = match self.pca_type {
+            I2cMultiplexer::PCA9548 => { 
+                match channel {
+                    Some(ch) => 1 << ch,
+                    None => 0,
+                }
+            },
+            #[cfg(feature = "target_kasli_soc")]
+            I2cMultiplexer::PCA9547 => {
+                match channel {
+                    Some(ch) => ch | 0x08,
+                    None => 0,
+                }
+            }
+        };
+
        if !self.write(address << 1)? {
-            return Err("PCA9548 failed to ack write address")
+            return Err("PCA954X failed to ack write address")
        }
-        if !self.write(channels)? {
-            return Err("PCA9548 failed to ack control word")
+        if !self.write(setting)? {
+            return Err("PCA954X failed to ack control word")
        }
        self.stop()?;
        Ok(())
--- a/libboard_zynq/src/i2c/regs.rs
+++ b/libboard_zynq/src/i2c/regs.rs
@ -20,12 +20,16 @@ use libregister::{
 //
 // Current compatibility:
 // zc706: GPIO 50, 51 == SCL, SDA
+// kasli_soc: GPIO 50, 51 == SCL, SDA; GPIO 33 == I2C_SW_RESET
+// ebaz4205: GPIO (EMIO)

 pub struct RegisterBlock {
    pub gpio_output_mask: &'static mut GPIOOutputMask,
    pub gpio_input: &'static mut GPIOInput,
    pub gpio_direction: &'static mut GPIODirection,
    pub gpio_output_enable: &'static mut GPIOOutputEnable,
+    #[cfg(feature = "target_kasli_soc")]
+    pub gpio_output_mask_lower: &'static mut GPIOOutputMaskLower,
 }

 impl RegisterBlock {
@ -34,58 +38,98 @@ impl RegisterBlock {
            gpio_output_mask: GPIOOutputMask::new(),
            gpio_input: GPIOInput::new(),
            gpio_direction: GPIODirection::new(),
-            gpio_output_enable: GPIOOutputEnable::new()
+            gpio_output_enable: GPIOOutputEnable::new(),
+            #[cfg(feature = "target_kasli_soc")]
+            gpio_output_mask_lower: GPIOOutputMaskLower::new(),
        }
    }
 }

-// MASK_DATA_1_MSW:
-// Maskable output data for MIO[53:48]
-register!(gpio_output_mask, GPIOOutputMask, RW, u32);
-#[cfg(feature = "target_zc706")]
+register!(gpio_output_mask,
+          /// MASK_DATA_1_MSW:
+          /// Maskable output data for MIO[53:48]
+          GPIOOutputMask, RW, u32);
+#[cfg(any(feature = "target_zc706", feature = "target_kasli_soc", feature = "target_ebaz4205"))]
 register_at!(GPIOOutputMask, 0xE000A00C, new);
-// Output for SCL
-#[cfg(feature = "target_zc706")]
-register_bit!(gpio_output_mask, scl_o, 2);
-// Output for SDA
-#[cfg(feature = "target_zc706")]
-register_bit!(gpio_output_mask, sda_o, 3);
-// Mask for keeping bits except SCL and SDA unchanged
-#[cfg(feature = "target_zc706")]
-register_bits!(gpio_output_mask, mask, u16, 16, 31);
+#[cfg(any(feature = "target_zc706", feature = "target_kasli_soc", feature = "target_ebaz4205"))]
+register_bit!(gpio_output_mask,
+              /// Output for SCL
+              scl_o, 2);
+#[cfg(any(feature = "target_zc706", feature = "target_kasli_soc", feature = "target_ebaz4205"))]
+register_bit!(gpio_output_mask,
+              /// Output for SDA
+              sda_o, 3);
+#[cfg(any(feature = "target_zc706", feature = "target_kasli_soc", feature = "target_ebaz4205"))]
+register_bits!(gpio_output_mask,
+               /// Mask for keeping bits except SCL and SDA unchanged
+               mask, u16, 16, 31);

-// DATA_1_RO:
-// Input data for MIO[53:32]
-register!(gpio_input, GPIOInput, RO, u32);
-#[cfg(feature = "target_zc706")]
+
+register!(gpio_output_mask_lower,
+            /// MASK_DATA_1_LSW:
+            /// Maskable output data for MIO[47:32]
+            GPIOOutputMaskLower, RW, u32);
+#[cfg(feature = "target_kasli_soc")]
+register_at!(GPIOOutputMaskLower, 0xE000A008, new);
+#[cfg(feature = "target_kasli_soc")]
+register_bit!(gpio_output_mask_lower,
+              /// Output for I2C_SW_RESET (MIO[33])
+              i2cswr_o, 1);
+#[cfg(feature = "target_kasli_soc")]
+register_bits!(gpio_output_mask_lower,
+               mask, u16, 16, 31);
+
+register!(gpio_input,
+          /// DATA_1_RO:
+          /// Input data for MIO[53:32]
+          GPIOInput, RO, u32);
+#[cfg(any(feature = "target_zc706", feature = "target_kasli_soc", feature = "target_ebaz4205"))]
 register_at!(GPIOInput, 0xE000A064, new);
-// Input for SCL
-#[cfg(feature = "target_zc706")]
-register_bit!(gpio_input, scl, 18);
-// Input for SDA
-#[cfg(feature = "target_zc706")]
-register_bit!(gpio_input, sda, 19);
+#[cfg(any(feature = "target_zc706", feature = "target_kasli_soc", feature = "target_ebaz4205"))]
+register_bit!(gpio_input,
+              /// Input for SCL
+              scl, 18);
+#[cfg(any(feature = "target_zc706", feature = "target_kasli_soc", feature = "target_ebaz4205"))]
+register_bit!(gpio_input,
+              /// Input for SDA
+              sda, 19);

-// DIRM_1:
-// Direction mode for MIO[53:32]; 0/1 = in/out
-register!(gpio_direction, GPIODirection, RW, u32);
-#[cfg(feature = "target_zc706")]
+
+register!(gpio_direction,
+          /// DIRM_1:
+          /// Direction mode for MIO[53:32]; 0/1 = in/out
+          GPIODirection, RW, u32);
+#[cfg(any(feature = "target_zc706", feature = "target_kasli_soc", feature = "target_ebaz4205"))]
 register_at!(GPIODirection, 0xE000A244, new);
-// Direction for SCL
-#[cfg(feature = "target_zc706")]
-register_bit!(gpio_direction, scl, 18);
-// Direction for SDA
-#[cfg(feature = "target_zc706")]
-register_bit!(gpio_direction, sda, 19);
+#[cfg(any(feature = "target_zc706", feature = "target_kasli_soc", feature = "target_ebaz4205"))]
+register_bit!(gpio_direction,
+              /// Direction for SCL
+              scl, 18);
+#[cfg(any(feature = "target_zc706", feature = "target_kasli_soc", feature = "target_ebaz4205"))]
+register_bit!(gpio_direction,
+              /// Direction for SDA
+              sda, 19);
+#[cfg(feature = "target_kasli_soc")]
+register_bit!(gpio_direction,
+              /// Direction for I2C_SW_RESET
+              i2cswr, 1);

-// OEN_1:
-// Output enable for MIO[53:32]
-register!(gpio_output_enable, GPIOOutputEnable, RW, u32);
-#[cfg(feature = "target_zc706")]
+register!(gpio_output_enable,
+          /// OEN_1:
+          /// Output enable for MIO[53:32]
+          GPIOOutputEnable, RW, u32);
+#[cfg(any(feature = "target_zc706", feature = "target_kasli_soc", feature = "target_ebaz4205"))]
 register_at!(GPIOOutputEnable, 0xE000A248, new);
-// Output enable for SCL
-#[cfg(feature = "target_zc706")]
-register_bit!(gpio_output_enable, scl, 18);
-// Output enable for SDA
-#[cfg(feature = "target_zc706")]
-register_bit!(gpio_output_enable, sda, 19);
+#[cfg(any(feature = "target_zc706", feature = "target_kasli_soc", feature = "target_ebaz4205"))]
+register_bit!(gpio_output_enable,
+              /// Output enable for SCL
+              scl, 18);
+#[cfg(any(feature = "target_zc706", feature = "target_kasli_soc", feature = "target_ebaz4205"))]
+register_bit!(gpio_output_enable,
+              /// Output enable for SDA
+              sda, 19);
+#[cfg(feature = "target_kasli_soc")]
+register_bit!(gpio_output_enable,
+              /// Output enable for I2C_SW_RESET
+              i2cswr, 1);
+              
--- a/libboard_zynq/src/lib.rs
+++ b/libboard_zynq/src/lib.rs
@ -16,11 +16,12 @@ pub mod axi_gp;
 pub mod ddr;
 pub mod mpcore;
 pub mod gic;
-pub mod flash;
 pub mod time;
 pub mod timer;
 pub mod sdio;
-#[cfg(feature = "target_zc706")]
+#[cfg(any(feature = "target_zc706", feature = "target_kasli_soc", feature = "target_ebaz4205"))]
 pub mod i2c;
 pub mod logger;
 pub mod ps7_init;
+#[cfg(feature="target_kasli_soc")]
+pub mod error_led;
--- a/libboard_zynq/src/mpcore.rs
+++ b/libboard_zynq/src/mpcore.rs
@ -154,7 +154,7 @@ register_bit!(scu_control, enable, 0);

 impl ScuControl {
    pub fn start(&mut self) {
-        self.modify(|_, w| w.enable(true));
+        self.modify(|_, w| w.enable(true).scu_speculative_linefill_enable(true));
    }
 }

--- a/libboard_zynq/src/ps7_init/mod.rs
+++ b/libboard_zynq/src/ps7_init/mod.rs
@ -1,14 +1,14 @@
-#![cfg(feature = "target_zc706")]
-
 use crate::println;

+#[cfg(feature = "target_zc706")]
 mod zc706;
-// mod cora_z7_10;
+#[cfg(not(feature = "target_zc706"))]
+mod none;

 #[cfg(feature = "target_zc706")]
 use zc706 as target;
-// #[cfg(feature = "target_cora_z7_10")]
-// use cora_z7_10 as target;
+#[cfg(not(feature = "target_zc706"))]
+use none as target;

 pub fn report_differences() {
    for (i, op) in target::INIT_DATA.iter().enumerate() {
--- a/libboard_zynq/src/ps7_init/none.rs
+++ b/libboard_zynq/src/ps7_init/none.rs
@ -0,0 +1,4 @@
+use super::InitOp;
+
+pub const INIT_DATA: &'static [InitOp] = &[
+];
--- a/libboard_zynq/src/sdio/mod.rs
+++ b/libboard_zynq/src/sdio/mod.rs
@ -105,7 +105,7 @@ impl Sdio {
                );
            }
            // cora card detect pin
-            #[cfg(feature = "target_cora_z7_10")]
+            #[cfg(feature = "target_coraz7")]
            {
                unsafe {
                    slcr.sd0_wp_cd_sel.write(47 << 16);
@ -116,6 +116,32 @@ impl Sdio {
                        .speed(true),
                );
            }
+            // kasli_soc and redpitaya card detect pin
+            #[cfg(any(feature = "target_kasli_soc", feature = "target_redpitaya"))]
+            {
+                unsafe {
+                    slcr.sd0_wp_cd_sel.write(46 << 16);
+                }
+                slcr.mio_pin_46.write(
+                    slcr::MioPin46::zeroed()
+                        .io_type(slcr::IoBufferType::Lvcmos25)
+                        .speed(true),
+                );
+            }
+            // ebaz4205 card detect pin
+            #[cfg(feature = "target_ebaz4205")]
+            {
+                unsafe {
+                    slcr.sd0_wp_cd_sel.write(34 << 16);
+                }
+                slcr.mio_pin_34.write(
+                    slcr::MioPin34::zeroed()
+                        .io_type(slcr::IoBufferType::Lvcmos33)
+                        .pullup(true)
+                        .speed(true),
+                );
+            }
+
            slcr.sdio_rst_ctrl.reset_sdio0();
            slcr.aper_clk_ctrl.enable_sdio0();
            slcr.sdio_clk_ctrl.enable_sdio0();
--- a/libboard_zynq/src/slcr.rs
+++ b/libboard_zynq/src/slcr.rs
@ -9,9 +9,11 @@ use libregister::{

 #[repr(u8)]
 pub enum PllSource {
-    IoPll  = 0b00,
-    ArmPll = 0b10,
-    DdrPll = 0b11,
+    IoPll  = 0b000,
+    ArmPll = 0b010,
+    DdrPll = 0b011,
+    // Ethernet controller 0 EMIO clock
+    Emio   = 0b100,
 }

 #[repr(u8)]
@ -587,22 +589,36 @@ register_bit!(a9_cpu_rst_ctrl, a9_clkstop0, 4);
 register_bit!(a9_cpu_rst_ctrl, a9_rst1, 1);
 register_bit!(a9_cpu_rst_ctrl, a9_rst0, 0);

+pub fn reboot() {
+    RegisterBlock::unlocked(|slcr| {
+        unsafe {
+            let reboot = slcr.reboot_status.read();
+            slcr.reboot_status.write(reboot & 0xF0FFFFFF);
+            slcr.pss_rst_ctrl.modify(|_, w| w.soft_rst(true));
+        }
+    });
+}
+
+
 #[derive(Clone, Copy, Debug, PartialEq)]
 #[repr(u8)]
 pub enum BootModePins {
+    // CAUTION!
+    // The BOOT_MODE bits table 6-4 in UG585 are *out of order*.
    Jtag = 0b000,
-    Nor = 0b001,
-    Nand = 0b010,
-    QuadSpi = 0b100,
-    SdCard = 0b110,
+    Nor = 0b010,
+    Nand = 0b100,
+    QuadSpi = 0b001,
+    SdCard = 0b101,
 }

 register!(boot_mode, BootMode, RO, u32);
 register_bit!(boot_mode, pll_bypass, 4);
-register_bits_typed!(boot_mode, boot_mode_pins, u8, BootModePins, 0, 3);
+register_bit!(boot_mode, jtag_routing, 3);
+register_bits_typed!(boot_mode, boot_mode_pins, u8, BootModePins, 0, 2);

 register!(pss_rst_ctrl, PssRstCtrl, RW, u32);
-register_bit!(pss_rst_ctrl, soft_rst, 1);
+register_bit!(pss_rst_ctrl, soft_rst, 0);

 /// Used for MioPin*.io_type
 #[repr(u8)]
--- a/libboard_zynq/src/stdio.rs
+++ b/libboard_zynq/src/stdio.rs
@ -1,5 +1,5 @@
 use core::ops::{Deref, DerefMut};
-use libcortex_a9::mutex::{Mutex, MutexGuard};
+use libcortex_a9::{asm, mutex::{Mutex, MutexGuard}};
 use crate::uart::Uart;

 const UART_RATE: u32 = 115_200;
@ -10,7 +10,15 @@ pub fn get_uart<'a>() -> MutexGuard<'a, LazyUart> {
    unsafe { UART.lock() }
 }

+/// Deinitialize so that the Uart will be reinitialized on next
+/// output.
+///
+/// Delays so that an outstanding transmission can finish.
 pub fn drop_uart() {
+    for _ in 0..1_000_000 {
+        asm::nop();
+    }
+
    unsafe { UART = Mutex::new(LazyUart::Uninitialized); }
 }

@ -37,9 +45,13 @@ impl DerefMut for LazyUart {
    fn deref_mut(&mut self) -> &mut Uart {
        match self {
            LazyUart::Uninitialized => {
-                #[cfg(feature = "target_cora_z7_10")]
+                #[cfg(any(feature = "target_coraz7", feature = "target_redpitaya"))]
                let uart = Uart::uart0(UART_RATE);
-                #[cfg(feature = "target_zc706")]
+                #[cfg(any(
+                    feature = "target_zc706",
+                    feature = "target_ebaz4205",
+                    feature = "target_kasli_soc",
+                ))]
                let uart = Uart::uart1(UART_RATE);
                *self = LazyUart::Initialized(uart);
                self
--- a/libboard_zynq/src/uart/mod.rs
+++ b/libboard_zynq/src/uart/mod.rs
@ -13,7 +13,7 @@ pub struct Uart {
 }

 impl Uart {
-    #[cfg(feature = "target_cora_z7_10")]
+    #[cfg(any(feature = "target_coraz7", feature = "target_redpitaya"))]
    pub fn uart0(baudrate: u32) -> Self {
        slcr::RegisterBlock::unlocked(|slcr| {
            // Route UART 0 RxD/TxD Signals to MIO Pins
@ -46,7 +46,7 @@ impl Uart {
        self_
    }

-    #[cfg(feature = "target_zc706")]
+    #[cfg(any(feature = "target_zc706", feature = "target_kasli_soc"))]
    pub fn uart1(baudrate: u32) -> Self {
        slcr::RegisterBlock::unlocked(|slcr| {
            // Route UART 1 RxD/TxD Signals to MIO Pins
@ -79,6 +79,39 @@ impl Uart {
        self_
    }

+    #[cfg(feature = "target_ebaz4205")]
+    pub fn uart1(baudrate: u32) -> Self {
+        slcr::RegisterBlock::unlocked(|slcr| {
+            // Route UART 1 RxD/TxD Signals to MIO Pins
+            // TX pin
+            slcr.mio_pin_24.write(
+                slcr::MioPin24::zeroed()
+                    .l3_sel(0b111)
+                    .io_type(slcr::IoBufferType::Lvcmos33)
+                    .pullup(true)
+            );
+            // RX pin
+            slcr.mio_pin_25.write(
+                slcr::MioPin25::zeroed()
+                    .tri_enable(true)
+                    .l3_sel(0b111)
+                    .io_type(slcr::IoBufferType::Lvcmos33)
+                    .pullup(true)
+            );
+        });
+
+        slcr::RegisterBlock::unlocked(|slcr| {
+            slcr.uart_rst_ctrl.reset_uart1();
+            slcr.aper_clk_ctrl.enable_uart1();
+            slcr.uart_clk_ctrl.enable_uart1();
+        });
+        let mut self_ = Uart {
+            regs: regs::RegisterBlock::uart1(),
+        };
+        self_.configure(baudrate);
+        self_
+    }
+
    pub fn write_byte(&mut self, value: u8) {
        while self.tx_fifo_full() {}

--- a/libconfig/Cargo.toml
+++ b/libconfig/Cargo.toml
@ -0,0 +1,20 @@
+[package]
+name = "libconfig"
+version = "0.1.0"
+authors = ["M-Labs"]
+edition = "2018"
+
+[dependencies]
+libboard_zynq = { path = "../libboard_zynq" }
+core_io = { version = "0.1", features = ["collections"] }
+fatfs = { version = "0.3", features = ["core_io"], default-features = false }
+log = "0.4"
+
+[features]
+target_zc706 = []
+target_coraz7 = []
+target_ebaz4205 = []
+target_redpitaya = []
+target_kasli_soc = []
+ipv6 = []
+fat_lfn = [ "fatfs/alloc" ]
--- a/libconfig/src/bootgen.rs
+++ b/libconfig/src/bootgen.rs
@ -0,0 +1,181 @@
+use alloc::vec::Vec;
+use core_io::{Error, Read, Seek, SeekFrom};
+use libboard_zynq::devc;
+use log::debug;
+
+#[derive(Debug)]
+pub enum BootgenLoadingError {
+    InvalidBootImageHeader,
+    MissingPartition,
+    EncryptedBitstream,
+    IoError(Error),
+    DevcError(devc::DevcError),
+}
+
+impl From<Error> for BootgenLoadingError {
+    fn from(error: Error) -> Self {
+        BootgenLoadingError::IoError(error)
+    }
+}
+
+impl From<devc::DevcError> for BootgenLoadingError {
+    fn from(error: devc::DevcError) -> Self {
+        BootgenLoadingError::DevcError(error)
+    }
+}
+
+impl core::fmt::Display for BootgenLoadingError {
+    fn fmt(&self, f: &mut core::fmt::Formatter<'_>) -> core::fmt::Result {
+        use BootgenLoadingError::*;
+        match self {
+            InvalidBootImageHeader => write!(
+                f,
+                "Invalid boot image header. Check if the file is correct."
+            ),
+            MissingPartition => write!(f, "Partition not found. Check your compile configuration."),
+            EncryptedBitstream => write!(f, "Encrypted bitstream is not supported."),
+            IoError(e) => write!(f, "Error while reading: {}", e),
+            DevcError(e) => write!(f, "PCAP interface error: {}", e),
+        }
+    }
+}
+
+#[repr(C)]
+struct PartitionHeader {
+    pub encrypted_length: u32,
+    pub unencrypted_length: u32,
+    pub word_length: u32,
+    pub dest_load_addr: u32,
+    pub dest_exec_addr: u32,
+    pub data_offset: u32,
+    pub attribute_bits: u32,
+    pub section_count: u32,
+    pub checksum_offset: u32,
+    pub header_offset: u32,
+    pub cert_offset: u32,
+    pub reserved: [u32; 4],
+    pub checksum: u32,
+}
+
+/// Read a u32 word from the reader.
+fn read_u32<Reader: Read>(reader: &mut Reader) -> Result<u32, BootgenLoadingError> {
+    let mut buffer: [u8; 4] = [0; 4];
+    reader.read_exact(&mut buffer)?;
+    let mut result: u32 = 0;
+    for i in 0..4 {
+        result |= (buffer[i] as u32) << (i * 8);
+    }
+    Ok(result)
+}
+
+/// Load PL partition header.
+fn load_pl_header<File: Read + Seek>(
+    file: &mut File,
+) -> Result<Option<PartitionHeader>, BootgenLoadingError> {
+    let mut buffer: [u8; 0x40] = [0; 0x40];
+    file.read_exact(&mut buffer)?;
+    let header = unsafe { core::mem::transmute::<_, PartitionHeader>(buffer) };
+    if header.attribute_bits & (2 << 4) != 0 {
+        Ok(Some(header))
+    } else {
+        Ok(None)
+    }
+}
+
+fn load_ps_header<File: Read + Seek>(
+    file: &mut File,
+) -> Result<Option<PartitionHeader>, BootgenLoadingError> {
+    let mut buffer: [u8; 0x40] = [0; 0x40];
+    file.read_exact(&mut buffer)?;
+    let header = unsafe { core::mem::transmute::<_, PartitionHeader>(buffer) };
+    if header.attribute_bits & (1 << 4) != 0 {
+        Ok(Some(header))
+    } else {
+        Ok(None)
+    }
+}
+
+/// Locate the partition from the image, and return the size (in bytes) of the partition if successful.
+/// This function would seek the file to the location of the partition.
+fn locate<
+    File: Read + Seek,
+    F: Fn(&mut File) -> Result<Option<PartitionHeader>, BootgenLoadingError>,
+>(
+    file: &mut File,
+    f: F,
+) -> Result<usize, BootgenLoadingError> {
+    file.seek(SeekFrom::Start(0))?;
+    const BOOT_HEADER_SIGN: u32 = 0x584C4E58;
+    // read boot header signature
+    file.seek(SeekFrom::Start(0x24))?;
+    if read_u32(file)? != BOOT_HEADER_SIGN {
+        return Err(BootgenLoadingError::InvalidBootImageHeader);
+    }
+    // find fsbl offset
+    file.seek(SeekFrom::Start(0x30))?;
+    // the length is in bytes, we have to convert it to words to compare with the partition offset
+    // later
+    let fsbl = read_u32(file)? / 4;
+    // read partition header offset
+    file.seek(SeekFrom::Start(0x9C))?;
+    let ptr = read_u32(file)?;
+    debug!("Partition header pointer = {:0X}", ptr);
+    file.seek(SeekFrom::Start(ptr as u64))?;
+
+    // at most 3 partition headers
+    for _ in 0..3 {
+        if let Some(header) = f(file)? {
+            let encrypted_length = header.encrypted_length;
+            let unencrypted_length = header.unencrypted_length;
+            debug!("Unencrypted length = {:0X}", unencrypted_length);
+            if encrypted_length != unencrypted_length {
+                return Err(BootgenLoadingError::EncryptedBitstream);
+            }
+
+            let start_addr = header.data_offset;
+            // skip fsbl
+            if start_addr == fsbl {
+                continue;
+            }
+            debug!("Partition start address: {:0X}", start_addr);
+            file.seek(SeekFrom::Start(start_addr as u64 * 4))?;
+
+            return Ok(unencrypted_length as usize * 4);
+        }
+    }
+    Err(BootgenLoadingError::MissingPartition)
+}
+
+/// Load bitstream from bootgen file.
+/// This function parses the file, locate the bitstream and load it through the PCAP driver.
+/// It requires a large buffer, please enable the DDR RAM before using it.
+pub fn load_bitstream<File: Read + Seek>(file: &mut File) -> Result<(), BootgenLoadingError> {
+    let size = locate(file, load_pl_header)?;
+    unsafe {
+        // align to 64 bytes
+        let ptr = alloc::alloc::alloc(alloc::alloc::Layout::from_size_align(size, 64).unwrap());
+        let buffer = core::slice::from_raw_parts_mut(ptr, size);
+        file.read_exact(buffer).map_err(|e| {
+            core::ptr::drop_in_place(ptr);
+            e
+        })?;
+        let mut devcfg = devc::DevC::new();
+        devcfg.enable();
+        devcfg.program(&buffer).map_err(|e| {
+            core::ptr::drop_in_place(ptr);
+            e
+        })?;
+        core::ptr::drop_in_place(ptr);
+        Ok(())
+    }
+}
+
+pub fn get_runtime<File: Read + Seek>(file: &mut File) -> Result<Vec<u8>, BootgenLoadingError> {
+    let size = locate(file, load_ps_header)?;
+    let mut buffer = Vec::with_capacity(size);
+    unsafe {
+        buffer.set_len(size);
+    }
+    file.read_exact(&mut buffer)?;
+    Ok(buffer)
+}
--- a/libconfig/src/lib.rs
+++ b/libconfig/src/lib.rs
@ -0,0 +1,174 @@
+#![no_std]
+extern crate alloc;
+
+use core::fmt;
+use alloc::{string::FromUtf8Error, string::String, vec::Vec, rc::Rc};
+use core_io::{self as io, BufRead, BufReader, Read, Write, Seek, SeekFrom};
+use libboard_zynq::sdio;
+
+pub mod sd_reader;
+pub mod net_settings;
+pub mod bootgen;
+
+#[derive(Debug)]
+pub enum Error<'a> {
+    SdError(sdio::sd_card::CardInitializationError),
+    IoError(io::Error),
+    Utf8Error(FromUtf8Error),
+    KeyNotFoundError(&'a str),
+    NoConfig,
+}
+
+pub type Result<'a, T> = core::result::Result<T, Error<'a>>;
+
+impl<'a> fmt::Display for Error<'a> {
+    fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
+        match self {
+            Error::SdError(error) => write!(f, "SD error: {}", error),
+            Error::IoError(error) => write!(f, "I/O error: {}", error),
+            Error::Utf8Error(error) => write!(f, "UTF-8 error: {}", error),
+            Error::KeyNotFoundError(name) => write!(f, "Configuration key `{}` not found", name),
+            Error::NoConfig => write!(f, "Configuration not present"),
+        }
+    }
+}
+
+impl<'a> From<sdio::sd_card::CardInitializationError> for Error<'a> {
+    fn from(error: sdio::sd_card::CardInitializationError) -> Self {
+        Error::SdError(error)
+    }
+}
+
+impl<'a> From<io::Error> for Error<'a> {
+    fn from(error: io::Error) -> Self {
+        Error::IoError(error)
+    }
+}
+
+impl<'a> From<FromUtf8Error> for Error<'a> {
+    fn from(error: FromUtf8Error) -> Self {
+        Error::Utf8Error(error)
+    }
+}
+
+fn parse_config<'a>(
+    key: &'a str,
+    buffer: &mut Vec<u8>,
+    file: fatfs::File<sd_reader::SdReader>,
+) -> Result<'a, ()> {
+    let prefix = [key, "="].concat().to_ascii_lowercase();
+    for line in BufReader::new(file).lines() {
+        let line = line?.to_ascii_lowercase();
+        if line.starts_with(&prefix) {
+            buffer.extend(line[prefix.len()..].as_bytes());
+            return Ok(());
+        }
+    }
+    Err(Error::KeyNotFoundError(key))
+}
+
+pub struct Config {
+    fs: Option<Rc<fatfs::FileSystem<sd_reader::SdReader>>>,
+}
+
+const NEWLINE: &[u8] = b"\n";
+
+impl Config {
+    pub fn new() -> Result<'static, Self> {
+        let sdio = sdio::Sdio::sdio0(true);
+        if !sdio.is_card_inserted() {
+            Err(sdio::sd_card::CardInitializationError::NoCardInserted)?;
+        }
+        let sd = sdio::sd_card::SdCard::from_sdio(sdio)?;
+        let reader = sd_reader::SdReader::new(sd);
+
+        let fs = reader.mount_fatfs(sd_reader::PartitionEntry::Entry1)?;
+        Ok(Config { fs: Some(Rc::new(fs)) })
+    }
+
+    pub fn from_fs(fs: Option<Rc<fatfs::FileSystem<sd_reader::SdReader>>>) -> Self {
+        Config { fs }
+    }
+
+    pub fn new_dummy() -> Self {
+        Config { fs: None }
+    }
+
+    pub fn read<'b>(&self, key: &'b str) -> Result<'b, Vec<u8>> {
+        if let Some(fs) = &self.fs {
+            let root_dir = fs.root_dir();
+            let mut buffer: Vec<u8> = Vec::new();
+            match root_dir.open_file(&["/CONFIG/", key, ".BIN"].concat()) {
+                Ok(mut f) => f.read_to_end(&mut buffer).map(|_| ())?,
+                Err(_) => match root_dir.open_file("/CONFIG.TXT") {
+                    Ok(f) => parse_config(key, &mut buffer, f)?,
+                    Err(_) => return Err(Error::KeyNotFoundError(key)),
+                },
+            };
+            Ok(buffer)
+        } else {
+            Err(Error::NoConfig)
+        }
+    }
+
+    pub fn read_str<'b>(&self, key: &'b str) -> Result<'b, String> {
+        Ok(String::from_utf8(self.read(key)?)?)
+    }
+
+    pub fn remove<'b>(&self, key: &'b str) -> Result<'b, ()> {
+        if let Some(fs) = &self.fs {
+            let root_dir = fs.root_dir();
+            match root_dir.remove(&["/CONFIG/", key, ".BIN"].concat()) {
+                Ok(()) => Ok(()),
+                Err(_) => {
+                    let prefix = [key, "="].concat().to_ascii_lowercase();
+                    match root_dir.create_file("/CONFIG.TXT") {
+                        Ok(mut f) => {
+                            let mut buffer = String::new();
+                            f.read_to_string(&mut buffer)?;
+                            f.seek(SeekFrom::Start(0))?;
+                            f.truncate()?;
+                            for line in buffer.lines() {
+                                if line.len() > 0 && !line.to_ascii_lowercase().starts_with(&prefix) {
+                                    f.write(line.as_bytes())?;
+                                    f.write(NEWLINE)?;
+                                }
+                            }
+                            Ok(())
+                        },
+                        Err(_) => Err(Error::KeyNotFoundError(key))
+                    }
+                }
+            }
+        } else {
+            Err(Error::NoConfig)
+        }
+    }
+
+    pub fn write<'b>(&self, key: &'b str, value: Vec<u8>) -> Result<'b, ()> {
+        if self.fs.is_none() {
+            return Err(Error::NoConfig);
+        }
+        let fs = self.fs.as_ref().unwrap();
+        let root_dir = fs.root_dir();
+        let is_str = value.len() <= 100 && value.is_ascii() && !value.contains(&b'\n');
+        if key == "boot" {
+            let mut f = root_dir.create_file("/BOOT.BIN")?;
+            f.truncate()?;
+            f.write_all(&value)?;
+            drop(f);
+        } else {
+            let _ = self.remove(key);
+            if is_str {
+                let mut f = root_dir.create_file("/CONFIG.TXT")?;
+                f.seek(SeekFrom::End(0))?;
+                write!(f, "{}={}\n", key, String::from_utf8(value).unwrap())?;
+            } else {
+                let dir = root_dir.create_dir("/CONFIG")?;
+                let mut f = dir.create_file(&[key, ".BIN"].concat())?;
+                f.write_all(&value)?;
+            }
+        }
+        Ok(())
+    }
+}
--- a/libconfig/src/net_settings.rs
+++ b/libconfig/src/net_settings.rs
@ -0,0 +1,92 @@
+use core::fmt;
+
+use libboard_zynq::smoltcp::wire::{EthernetAddress, IpAddress};
+
+use super::Config;
+
+pub struct NetAddresses {
+    pub hardware_addr: EthernetAddress,
+    pub ipv4_addr: IpAddress,
+    #[cfg(feature = "ipv6")]
+    pub ipv6_ll_addr: IpAddress,
+    #[cfg(feature = "ipv6")]
+    pub ipv6_addr: Option<IpAddress>
+}
+
+impl fmt::Display for NetAddresses {
+    fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
+        write!(f, "MAC={} IPv4={} ",
+            self.hardware_addr, self.ipv4_addr)?;
+
+        #[cfg(feature = "ipv6")]
+        {
+            write!(f, "IPv6-LL={}", self.ipv6_ll_addr)?;
+            match self.ipv6_addr {
+                Some(addr) => write!(f, " {}", addr)?,
+                None => write!(f, " IPv6: no configured address")?
+            }
+        }
+        Ok(())
+    }
+}
+
+#[cfg(feature = "target_kasli_soc")]
+fn get_address_from_eeprom() -> EthernetAddress {
+    use libboard_zynq::i2c::{I2c, eeprom};
+
+    let mut i2c = I2c::i2c0();
+    i2c.init().unwrap();
+    let mut eeprom = eeprom::EEPROM::new(&mut i2c, 16);
+    let address = eeprom.read_eui48().unwrap_or([0x02, 0x00, 0x00, 0x00, 0x00, 0x56]);
+
+    EthernetAddress(address)
+}
+
+pub fn get_addresses(cfg: &Config) -> NetAddresses {
+    #[cfg(feature = "target_zc706")]
+    let mut hardware_addr = EthernetAddress([0x02, 0x00, 0x00, 0x00, 0x00, 0x52]);
+    #[cfg(feature = "target_zc706")]
+    let mut ipv4_addr = IpAddress::v4(192, 168, 1, 52);
+    #[cfg(feature = "target_coraz7")]
+    let mut hardware_addr = EthernetAddress([0x02, 0x00, 0x00, 0x00, 0x00, 0x54]);
+    #[cfg(feature = "target_coraz7")]
+    let mut ipv4_addr = IpAddress::v4(192, 168, 1, 54);
+    #[cfg(feature = "target_redpitaya")]
+    let mut hardware_addr = EthernetAddress([0x02, 0x00, 0x00, 0x00, 0x00, 0x55]);
+    #[cfg(feature = "target_redpitaya")]
+    let mut ipv4_addr = IpAddress::v4(192, 168, 1, 55);
+    #[cfg(feature = "target_kasli_soc")]
+    let mut hardware_addr = get_address_from_eeprom();
+    #[cfg(feature = "target_kasli_soc")]
+    let mut ipv4_addr = IpAddress::v4(192, 168, 1, 56);
+    #[cfg(feature = "target_ebaz4205")]
+    let mut hardware_addr = EthernetAddress([0x02, 0x00, 0x00, 0x00, 0x00, 0x57]);
+    #[cfg(feature = "target_ebaz4205")]
+    let mut ipv4_addr = IpAddress::v4(192, 168, 1, 57);
+
+    if let Ok(Ok(addr)) = cfg.read_str("mac").map(|s| s.parse()) {
+        hardware_addr = addr;
+    }
+    if let Ok(Ok(addr)) = cfg.read_str("ip").map(|s| s.parse()) {
+        ipv4_addr = addr;
+    }
+    #[cfg(feature = "ipv6")]
+    let ipv6_addr = cfg.read_str("ip6").ok().and_then(|s| s.parse().ok());
+
+    #[cfg(feature = "ipv6")]
+    let ipv6_ll_addr = IpAddress::v6(
+        0xfe80, 0x0000, 0x0000, 0x0000,
+        (((hardware_addr.0[0] ^ 0x02) as u16) << 8) | (hardware_addr.0[1] as u16),
+        ((hardware_addr.0[2] as u16) << 8) | 0x00ff,
+        0xfe00 | (hardware_addr.0[3] as u16),
+        ((hardware_addr.0[4] as u16) << 8) | (hardware_addr.0[5] as u16));
+
+    NetAddresses {
+        hardware_addr,
+        ipv4_addr,
+        #[cfg(feature = "ipv6")]
+        ipv6_ll_addr,
+        #[cfg(feature = "ipv6")]
+        ipv6_addr
+    }
+}
--- a/libconfig/src/sd_reader.rs
+++ b/libconfig/src/sd_reader.rs
@ -0,0 +1,304 @@
+use core_io::{BufRead, Error, ErrorKind, Read, Result as IoResult, Seek, SeekFrom, Write};
+use fatfs;
+use libboard_zynq::sdio::{sd_card::SdCard, CmdTransferError};
+use log::debug;
+use alloc::vec::Vec;
+
+const MBR_SIGNATURE: [u8; 2] = [0x55, 0xAA];
+const PARTID_FAT12: u8 = 0x01;
+const PARTID_FAT16_LESS32M: u8 = 0x04;
+const PARTID_FAT16: u8 = 0x06;
+const PARTID_FAT32: u8 = 0x0B;
+const PARTID_FAT32_LBA: u8 = 0x0C;
+const PARTID_FAT16_LBA: u8 = 0x0E;
+
+fn cmd_error_to_io_error(_: CmdTransferError) -> Error {
+    Error::new(ErrorKind::Other, "Command transfer error")
+}
+
+const BLOCK_SIZE: usize = 512;
+
+/// SdReader struct implementing `Read + BufRead + Write + Seek` traits for `core_io`.
+/// Used as an adaptor for fatfs crate, but could be used directly for raw data access.
+///
+/// Implementation: all read/writes would be split into unaligned and block-aligned parts,
+/// unaligned read/writes would do a buffered read/write using a block-sized internal buffer,
+/// while aligned transactions would be sent to the SD card directly for performance reason.
+pub struct SdReader {
+    /// Internal SdCard handle.
+    sd: SdCard,
+    /// Read buffer with the size of 1 block.
+    buffer: Vec<u8>,
+    /// Address for the next byte.
+    byte_addr: u32,
+    /// Internal index for the next byte.
+    /// Normally in range `[0, BLOCK_SIZE - 1]`.
+    ///
+    /// `index = BLOCK_SIZE` means that the `buffer` is invalid for the current `byte_addr`,
+    /// the next `fill_buf` call would fill the buffer.
+    index: usize,
+    /// Dirty flag indicating the content has to be flushed.
+    dirty: bool,
+    /// Base offset for translation from logical address to physical address.
+    offset: u32,
+}
+
+#[derive(Copy, Clone)]
+#[allow(unused)]
+// Partition entry enum, normally we would use entry1.
+pub enum PartitionEntry {
+    Entry1 = 0x1BE,
+    Entry2 = 0x1CE,
+    Entry3 = 0x1DE,
+    Entry4 = 0x1EE,
+}
+
+impl SdReader {
+    /// Create SdReader from SdCard
+    pub fn new(sd: SdCard) -> SdReader {
+        let mut vec: Vec<u8> = Vec::with_capacity(BLOCK_SIZE);
+        unsafe {
+            vec.set_len(vec.capacity());
+        }
+        SdReader {
+            sd,
+            buffer: vec,
+            byte_addr: 0,
+            index: BLOCK_SIZE,
+            dirty: false,
+            offset: 0,
+        }
+    }
+
+    /// Internal read function for unaligned read.
+    /// The read must not cross block boundary.
+    fn read_unaligned(&mut self, buf: &mut [u8]) -> IoResult<usize> {
+        if buf.len() == 0 {
+            return Ok(0);
+        }
+        let filled_buffer = self.fill_buf()?;
+        for (dest, src) in buf.iter_mut().zip(filled_buffer.iter()) {
+            *dest = *src;
+        }
+        self.consume(buf.len());
+        Ok(buf.len())
+    }
+
+    /// Internal write function for unaligned write.
+    /// The write must not cross block boundary.
+    fn write_unaligned(&mut self, buf: &[u8]) -> IoResult<usize> {
+        if buf.len() == 0 {
+            return Ok(0);
+        }
+        // update buffer if needed, as we will flush the entire block later.
+        self.fill_buf()?;
+        self.dirty = true;
+        let dest_buffer = &mut self.buffer[self.index..];
+        for (src, dest) in buf.iter().zip(dest_buffer.iter_mut()) {
+            *dest = *src;
+        }
+        self.consume(buf.len());
+        Ok(buf.len())
+    }
+
+    /// Split the slice into three segments, with the middle block-aligned.
+    /// Alignment depends on the current `self.byte_addr` instead of the slice pointer address
+    fn block_align<'b>(&self, buf: &'b [u8]) -> (&'b [u8], &'b [u8], &'b [u8]) {
+        let head_len = BLOCK_SIZE - (self.byte_addr as usize % BLOCK_SIZE);
+        if head_len > buf.len() {
+            (buf, &[], &[])
+        } else {
+            let remaining_length = buf.len() - head_len;
+            let mid_length = remaining_length - remaining_length % BLOCK_SIZE;
+            let (head, remaining) = buf.split_at(head_len);
+            let (mid, tail) = remaining.split_at(mid_length);
+            (head, mid, tail)
+        }
+    }
+
+    /// Split the mutable slice into three segments, with the middle block-aligned.
+    /// Alignment depends on the current `self.byte_addr` instead of the slice pointer address
+    fn block_align_mut<'b>(&self, buf: &'b mut [u8]) -> (&'b mut [u8], &'b mut [u8], &'b mut [u8]) {
+        let head_len = BLOCK_SIZE - (self.byte_addr as usize % BLOCK_SIZE);
+        if head_len > buf.len() {
+            (buf, &mut [], &mut [])
+        } else {
+            let remaining_length = buf.len() - head_len;
+            let mid_length = remaining_length - remaining_length % BLOCK_SIZE;
+            let (head, remaining) = buf.split_at_mut(head_len);
+            let (mid, tail) = remaining.split_at_mut(mid_length);
+            (head, mid, tail)
+        }
+    }
+
+    /// Invalidate the buffer, so later unaligned read/write would reload the buffer from SD card.
+    fn invalidate_buffer(&mut self) {
+        self.index = BLOCK_SIZE;
+    }
+
+    /// Set the base offset of the SD card, to transform from physical address to logical address.
+    fn set_base_offset(&mut self, offset: u32) -> IoResult<u64> {
+        self.offset = offset;
+        self.seek(SeekFrom::Start(0))
+    }
+
+    /// Mount fatfs from partition entry, and return the fatfs object if success.
+    /// This takes the ownership of self, so currently there is no way to recover from an error,
+    /// except creating a new SD card instance.
+    pub fn mount_fatfs(mut self, entry: PartitionEntry) -> IoResult<fatfs::FileSystem<Self>> {
+        let mut buffer: [u8; 4] = [0; 4];
+        self.seek(SeekFrom::Start(0x1FE))?;
+        self.read_exact(&mut buffer[..2])?;
+        // check MBR signature
+        if buffer[..2] != MBR_SIGNATURE {
+            return Err(Error::new(
+                ErrorKind::InvalidData,
+                "Incorrect signature for MBR sector.",
+            ));
+        }
+        // Read partition ID.
+        self.seek(SeekFrom::Start(entry as u64 + 0x4))?;
+        self.read_exact(&mut buffer[..1])?;
+        debug!("Partition ID: {:0X}", buffer[0]);
+        match buffer[0] {
+            PARTID_FAT12 | PARTID_FAT16_LESS32M | PARTID_FAT16 |
+            PARTID_FAT16_LBA | PARTID_FAT32 | PARTID_FAT32_LBA => {}
+            _ => {
+                return Err(Error::new(
+                    ErrorKind::InvalidData,
+                    "No FAT partition found for the specified entry.",
+                ));
+            }
+        }
+        // Read LBA
+        self.seek(SeekFrom::Current(0x3))?;
+        self.read_exact(&mut buffer)?;
+        let mut lba: u32 = 0;
+        // Little endian
+        for i in 0..4 {
+            lba |= (buffer[i] as u32) << (i * 8);
+        }
+        // Set to logical address
+        self.set_base_offset(lba * BLOCK_SIZE as u32)?;
+        // setup fatfs
+        fatfs::FileSystem::new(self, fatfs::FsOptions::new())
+    }
+}
+
+impl Read for SdReader {
+    fn read(&mut self, buf: &mut [u8]) -> IoResult<usize> {
+        let total_length = buf.len();
+        let (a, b, c) = self.block_align_mut(buf);
+        self.read_unaligned(a)?;
+        if b.len() > 0 {
+            // invalidate internal buffer
+            self.invalidate_buffer();
+            if let Err(_) = self.sd.read_block(
+                self.byte_addr / BLOCK_SIZE as u32,
+                (b.len() / BLOCK_SIZE) as u16,
+                b,
+            ) {
+                // we have to allow partial read, as per the trait required
+                return Ok(a.len());
+            }
+            self.byte_addr += b.len() as u32;
+        }
+        if let Err(_) = self.read_unaligned(c) {
+            // we have to allow partial read, as per the trait required
+            return Ok(a.len() + b.len());
+        }
+        Ok(total_length)
+    }
+}
+
+impl BufRead for SdReader {
+    fn fill_buf(&mut self) -> IoResult<&[u8]> {
+        if self.index == BLOCK_SIZE {
+            // flush the buffer if it is dirty before overwriting it with new data
+            if self.dirty {
+                self.flush()?;
+            }
+            // reload buffer
+            self.sd
+                .read_block(self.byte_addr / (BLOCK_SIZE as u32), 1, &mut self.buffer)
+                .map_err(cmd_error_to_io_error)?;
+            self.index = (self.byte_addr as usize) % BLOCK_SIZE;
+        }
+        Ok(&self.buffer[self.index..])
+    }
+
+    fn consume(&mut self, amt: usize) {
+        self.index += amt;
+        self.byte_addr += amt as u32;
+    }
+}
+
+impl Write for SdReader {
+    fn write(&mut self, buf: &[u8]) -> IoResult<usize> {
+        let (a, b, c) = self.block_align(buf);
+        self.write_unaligned(a)?;
+        if b.len() > 0 {
+            self.flush()?;
+            self.invalidate_buffer();
+            if let Err(_) = self.sd.write_block(
+                self.byte_addr / BLOCK_SIZE as u32,
+                (b.len() / BLOCK_SIZE) as u16,
+                b,
+            ) {
+                return Ok(a.len());
+            }
+            self.byte_addr += b.len() as u32;
+        }
+        if let Err(_) = self.write_unaligned(c) {
+            return Ok(a.len() + b.len());
+        }
+        Ok(buf.len())
+    }
+
+    fn flush(&mut self) -> IoResult<()> {
+        if self.dirty {
+            let block_addr = (self.byte_addr - self.index as u32) / (BLOCK_SIZE as u32);
+            self.sd
+                .write_block(block_addr, 1, &self.buffer)
+                .map_err(cmd_error_to_io_error)?;
+            self.dirty = false;
+        }
+        Ok(())
+    }
+}
+
+impl Seek for SdReader {
+    fn seek(&mut self, pos: SeekFrom) -> IoResult<u64> {
+        let raw_target = match pos {
+            SeekFrom::Start(x) => self.offset as i64 + x as i64,
+            SeekFrom::Current(x) => self.byte_addr as i64 + x,
+            SeekFrom::End(_) => panic!("SD card does not support seek from end"),
+        };
+        if raw_target < self.offset as i64 || raw_target > core::u32::MAX as i64 {
+            return Err(Error::new(ErrorKind::InvalidInput, "Invalid address"));
+        }
+        let target_byte_addr = raw_target as u32;
+        let address_same_block =
+            self.byte_addr / (BLOCK_SIZE as u32) == target_byte_addr / (BLOCK_SIZE as u32);
+        // if the buffer was invalidated, we consider seek as different block
+        let same_block = address_same_block && self.index != BLOCK_SIZE;
+        if !same_block {
+            self.flush()?;
+        }
+        self.byte_addr = target_byte_addr;
+        self.index = if same_block {
+            target_byte_addr as usize % BLOCK_SIZE
+        } else {
+            // invalidate the buffer as we moved to a different block
+            BLOCK_SIZE
+        };
+        Ok((self.byte_addr - self.offset) as u64)
+    }
+}
+
+impl Drop for SdReader {
+    fn drop(&mut self) {
+        // just try to flush it, ignore error if any
+        self.flush().unwrap_or(());
+    }
+}
--- a/libcortex_a9/Cargo.toml
+++ b/libcortex_a9/Cargo.toml
@ -1,15 +1,14 @@
 [package]
 name = "libcortex_a9"
 version = "0.0.0"
-authors = ["Astro <astro@spaceboyz.net>"]
+authors = ["M-Labs"]
 edition = "2018"

 [features]
-target_zc706 = []
-target_cora_z7_10 = []
 power_saving = []
-default = ["target_zc706"]
+default = []

 [dependencies]
 bit_field = "0.10"
+volatile-register = "0.2"
 libregister = { path = "../libregister" }
--- a/libcortex_a9/src/asm.rs
+++ b/libcortex_a9/src/asm.rs
@ -34,6 +34,12 @@ pub fn isb() {
    unsafe { llvm_asm!("isb" :::: "volatile") }
 }

+/// Enable FIQ
+#[inline]
+pub unsafe fn enable_fiq() {
+    llvm_asm!("cpsie f":::: "volatile");
+}
+
 /// Enable IRQ
 #[inline]
 pub unsafe fn enable_irq() {
--- a/libcortex_a9/src/cache.rs
+++ b/libcortex_a9/src/cache.rs
@ -1,4 +1,5 @@
 use super::asm::{dmb, dsb};
+use super::l2c::*;

 /// Invalidate TLBs
 #[inline(always)]
@ -52,10 +53,9 @@ pub fn dccisw(setway: u32) {
    }
 }

-
 /// A made-up "instruction": invalidate all of the L1 D-Cache
 #[inline(always)]
-pub fn dciall() {
+pub fn dciall_l1() {
    // the cache associativity could be read from a register, but will
    // always be 4 in L1 data cache of a cortex a9
    let ways = 4;
@ -80,9 +80,17 @@ pub fn dciall() {
    }
 }

+/// A made-up "instruction": invalidate all of the L1 L2 D-Cache
+#[inline(always)]
+pub fn dciall() {
+    dmb();
+    l2_cache_invalidate_all();
+    dciall_l1();
+}
+
 /// A made-up "instruction": flush and invalidate all of the L1 D-Cache
 #[inline(always)]
-pub fn dcciall() {
+pub fn dcciall_l1() {
    // the cache associativity could be read from a register, but will
    // always be 4 in L1 data cache of a cortex a9
    let ways = 4;
@ -107,6 +115,15 @@ pub fn dcciall() {
    }
 }

+#[inline(always)]
+pub  fn dcciall() {
+    dmb();
+    dcciall_l1();
+    dsb();
+    l2_cache_clean_invalidate_all();
+    dcciall_l1();
+    dsb();
+}

 const CACHE_LINE: usize = 0x20;
 const CACHE_LINE_MASK: usize = CACHE_LINE - 1;
@ -145,7 +162,16 @@ pub fn dccimvac(addr: usize) {

 /// Data cache clean and invalidate for an object.
 pub fn dcci<T>(object: &T) {
+    // ref: L2C310 TRM 3.3.10
    dmb();
+    for addr in object_cache_line_addrs(object) {
+        dccmvac(addr);
+    }
+    dsb();
+    for addr in object_cache_line_addrs(object) {
+        l2_cache_clean_invalidate(addr);
+    }
+    l2_cache_sync();
    for addr in object_cache_line_addrs(object) {
        dccimvac(addr);
    }
@ -154,6 +180,14 @@ pub fn dcci<T>(object: &T) {

 pub fn dcci_slice<T>(slice: &[T]) {
    dmb();
+    for addr in slice_cache_line_addrs(slice) {
+        dccmvac(addr);
+    }
+    dsb();
+    for addr in slice_cache_line_addrs(slice) {
+        l2_cache_clean_invalidate(addr);
+    }
+    l2_cache_sync();
    for addr in slice_cache_line_addrs(slice) {
        dccimvac(addr);
    }
@ -175,17 +209,28 @@ pub fn dcc<T>(object: &T) {
        dccmvac(addr);
    }
    dsb();
+    for addr in object_cache_line_addrs(object) {
+        l2_cache_clean(addr);
+    }
+    l2_cache_sync();
 }

 /// Data cache clean for an object. Panics if not properly
 /// aligned and properly sized to be contained in an exact number of
 /// cache lines.
 pub fn dcc_slice<T>(slice: &[T]) {
+    if slice.len() == 0 {
+        return;
+    }
    dmb();
    for addr in slice_cache_line_addrs(slice) {
        dccmvac(addr);
    }
    dsb();
+    for addr in slice_cache_line_addrs(slice) {
+        l2_cache_clean(addr);
+    }
+    l2_cache_sync();
 }

 /// Data cache invalidate by memory virtual address. This and
@ -205,6 +250,10 @@ pub unsafe fn dci<T>(object: &mut T) {
    assert_eq!(beyond_addr & CACHE_LINE_MASK, 0, "dci object beyond_addr must be aligned");

    dmb();
+    for addr in (first_addr..beyond_addr).step_by(CACHE_LINE) {
+        l2_cache_invalidate(addr);
+    }
+    l2_cache_sync();
    for addr in (first_addr..beyond_addr).step_by(CACHE_LINE) {
        dcimvac(addr);
    }
@ -219,6 +268,10 @@ pub unsafe fn dci_slice<T>(slice: &mut [T]) {
    assert_eq!(beyond_addr & CACHE_LINE_MASK, 0, "dci slice beyond_addr must be aligned");

    dmb();
+    for addr in (first_addr..beyond_addr).step_by(CACHE_LINE) {
+        l2_cache_invalidate(addr);
+    }
+    l2_cache_sync();
    for addr in (first_addr..beyond_addr).step_by(CACHE_LINE) {
        dcimvac(addr);
    }
--- a/libcortex_a9/src/l2c.rs
+++ b/libcortex_a9/src/l2c.rs
@ -0,0 +1,333 @@
+use libregister::{register, register_at, register_bit, register_bits, RegisterRW, RegisterR, RegisterW};
+use super::asm::dmb;
+use volatile_register::RW;
+
+/// enable L2 cache with specific prefetch offset
+/// prefetch offset requires manual tuning, it seems that 8 is good for ZC706 current settings
+pub fn enable_l2_cache(offset: u8) {
+    dmb();
+    let regs = RegisterBlock::new();
+    // disable L2 cache
+    regs.reg1_control.modify(|_, w| w.l2_enable(false));
+
+    regs.reg15_prefetch_ctrl.modify(|_, w|
+        w.instr_prefetch_en(true)
+            .data_prefetch_en(true)
+            .double_linefill_en(true)
+            .incr_double_linefill_en(true)
+            .pref_drop_en(true)
+            .prefetch_offset(offset)
+    );
+    regs.reg1_aux_control.modify(|_, w| {
+        w.early_bresp_en(true)
+            .instr_prefetch_en(true)
+            .data_prefetch_en(true)
+            .cache_replace_policy(true)
+            .way_size(3)
+    });
+    regs.reg1_tag_ram_control.modify(|_, w| w.ram_wr_access_lat(1).ram_rd_access_lat(1).ram_setup_lat(1));
+    regs.reg1_data_ram_control.modify(|_, w| w.ram_wr_access_lat(1).ram_rd_access_lat(2).ram_setup_lat(1));
+    // invalidate L2 ways
+    unsafe {
+        regs.reg7_inv_way.write(0xFFFF);
+    }
+    // poll for completion
+    while regs.reg7_cache_sync.read().c() {}
+    // write to a magic memory location with a magic sequence
+    // required in UG585 Section 3.4.10 Initialization Sequence
+    unsafe {
+        core::ptr::write_volatile(0xF8000008usize as *mut u32, 0xDF0D);
+        core::ptr::write_volatile(0xF8000A1Cusize as *mut u32, 0x020202);
+        core::ptr::write_volatile(0xF8000004usize as *mut u32, 0x767B);
+    }
+    regs.reg1_control.modify(|_, w| w.l2_enable(true));
+    dmb();
+}
+
+#[inline(always)]
+pub fn l2_cache_invalidate_all()  {
+    let regs = RegisterBlock::new();
+    unsafe {
+        regs.reg7_inv_way.write(0xFFFF);
+    }
+    // poll for completion
+    while regs.reg7_cache_sync.read().c() {}
+}
+
+#[inline(always)]
+pub fn l2_cache_clean_all()  {
+    let regs = RegisterBlock::new();
+    unsafe  {
+        regs.reg7_clean_way.write(0xFFFF);
+    }
+    // poll for completion
+    while regs.reg7_cache_sync.read().c() {}
+}
+
+#[inline(always)]
+pub fn l2_cache_clean_invalidate_all()  {
+    let regs = RegisterBlock::new();
+    unsafe {
+        regs.reg7_clean_inv_way.write(0xFFFF);
+    }
+    // poll for completion
+    while regs.reg7_cache_sync.read().c() {}
+}
+
+/// L2 cache sync, similar to dsb for L1 cache
+#[inline(always)]
+pub fn l2_cache_sync() {
+    let regs = RegisterBlock::new();
+    regs.reg7_cache_sync.write(Reg7CacheSync::zeroed().c(false));
+}
+
+#[inline(always)]
+pub fn l2_cache_clean(addr: usize) {
+    let regs = RegisterBlock::new();
+    unsafe {
+        regs.reg7_clean_pa.write(addr as u32);
+    }
+}
+
+#[inline(always)]
+pub fn l2_cache_invalidate(addr: usize) {
+    let regs = RegisterBlock::new();
+    unsafe {
+        regs.reg7_inv_pa.write(addr as u32);
+    }
+}
+
+#[inline(always)]
+pub fn l2_cache_clean_invalidate(addr: usize) {
+    let regs = RegisterBlock::new();
+    unsafe {
+        regs.reg7_clean_inv_pa.write(addr as u32);
+    }
+}
+
+#[repr(C)]
+struct RegisterBlock {
+    /// cache ID register, Returns the 32-bit device ID code it reads off the CACHEID input bus.
+    /// The value is specified by the system integrator. Reset value: 0x410000c8
+    pub reg0_cache_id: Reg0CacheId,
+    /// cache type register, Returns the 32-bit cache type. Reset value: 0x1c100100
+    pub reg0_cache_type: Reg0CacheType,
+    unused0: [u32; 62],
+    /// control register, reset value: 0x0
+    pub reg1_control: Reg1Control,
+    /// auxilary control register, reset value: 0x02020000
+    pub reg1_aux_control: Reg1AuxControl,
+    /// Configures Tag RAM latencies
+    pub reg1_tag_ram_control: Reg1TagRamControl,
+    /// configures data RAM latencies
+    pub reg1_data_ram_control: Reg1DataRamControl,
+    unused1: [u32; 60],
+    /// Permits the event counters to be enabled and reset.
+    pub reg2_ev_counter_ctrl: Reg2EvCounterCtrl,
+    /// Enables event counter 1 to be driven by a specific event. Counter 1 increments when the
+    /// event occurs.
+    pub reg2_ev_counter1_cfg: Reg2EvCounter1Cfg,
+    /// Enables event counter 0 to be driven by a specific event. Counter 0 increments when the
+    /// event occurs.
+    pub reg2_ev_counter0_cfg: Reg2EvCounter0Cfg,
+    /// Enable the programmer to read off the counter value. The counter counts an event as
+    /// specified by the Counter Configuration Registers. The counter can be preloaded if counting
+    /// is disabled and reset by the Event Counter Control Register.
+    pub reg2_ev_counter1: RW<u32>,
+    /// Enable the programmer to read off the counter value. The counter counts an event as
+    /// specified by the Counter Configuration Registers. The counter can be preloaded if counting
+    /// is disabled and reset by the Event Counter Control Register.
+    pub reg2_ev_counter0: RW<u32>,
+    /// This register enables or masks interrupts from being triggered on the external pins of the
+    /// cache controller. Figure 3-8 on page 3-17 shows the register bit assignments. The bit
+    /// assignments enables the masking of the interrupts on both their individual outputs and the
+    /// combined L2CCINTR line. Clearing a bit by writing a 0, disables the interrupt triggering on
+    /// that pin. All bits are cleared by a reset. You must write to the register bits with a 1 to
+    /// enable the generation of interrupts. 1 = Enabled. 0 = Masked. This is the default.
+    pub reg2_int_mask: Reg2IntMask,
+    /// This register is a read-only.It returns the masked interrupt status. This register can be
+    /// accessed by secure and non-secure operations. The register gives an AND function of the raw
+    /// interrupt status with the values of the interrupt mask register. All the bits are cleared
+    /// by a reset. A write to this register is ignored. Bits read can be HIGH or LOW: HIGH If the
+    /// bits read HIGH, they reflect the status of the input lines triggering an interrupt. LOW If
+    /// the bits read LOW, either no interrupt has been generated, or the interrupt is masked.
+    pub reg2_int_mask_status: Reg2IntMaskStatus,
+    /// The Raw Interrupt Status Register enables the interrupt status that excludes the masking
+    /// logic. Bits read can be HIGH or LOW: HIGH If the bits read HIGH, they reflect the status of
+    /// the input lines triggering an interrupt. LOW If the bits read LOW, no interrupt has been
+    /// generated.
+    pub reg2_int_raw_status: Reg2IntRawStatus,
+    /// Clears the Raw Interrupt Status Register bits. When a bit is written as 1, it clears the
+    /// corresponding bit in the Raw Interrupt Status Register. When a bit is written as 0, it has
+    /// no effect
+    pub reg2_int_clear: Reg2IntClear,
+    unused2: [u32; 323],
+    /// Drain the STB. Operation complete when all buffers, LRB, LFB, STB, and EB, are empty
+    pub reg7_cache_sync: Reg7CacheSync,
+    unused3: [u32; 15],
+    /// Invalidate Line by PA: Specific L2 cache line is marked as not valid
+    pub reg7_inv_pa: RW<u32>,
+    unused4: [u32; 2],
+    /// Invalidate by Way Invalidate all data in specified ways, including dirty data. An
+    /// Invalidate by way while selecting all cache ways is equivalent to invalidating all cache
+    /// entries. Completes as a background task with the way, or ways, locked, preventing
+    /// allocation.
+    pub reg7_inv_way: RW<u32>,
+    unused5: [u32; 12],
+    /// Clean Line by PA Write the specific L2 cache line to L3 main memory if the line is marked
+    /// as valid and dirty. The line is marked as not dirty. The valid bit is unchanged
+    pub reg7_clean_pa: RW<u32>,
+    unused6: [u32; 1],
+    /// Clean Line by Set/Way Write the specific L2 cache line within the specified way to L3 main
+    /// memory if the line is marked as valid and dirty. The line is marked as not dirty. The valid
+    /// bit is unchanged
+    pub reg7_clean_index: Reg7CleanIndex,
+    /// Clean by Way Writes each line of the specified L2 cache ways to L3 main memory if the line
+    /// is marked as valid and dirty. The lines are marked as not dirty. The valid bits are
+    /// unchanged. Completes as a background task with the way, or ways, locked, preventing
+    /// allocation.
+    pub reg7_clean_way: RW<u32>,
+    unused7: [u32; 12],
+    /// Clean and Invalidate Line by PA Write the specific L2 cache line to L3 main memory if the
+    /// line is marked as valid and dirty. The line is marked as not valid
+    pub reg7_clean_inv_pa: RW<u32>,
+    unused8: [u32; 1],
+    /// Clean and Invalidate Line by Set/Way Write the specific L2 cache line within the specified
+    /// way to L3 main memory if the line is marked as valid and dirty. The line is marked as not
+    /// valid
+    pub reg7_clean_inv_index: Reg7CleanInvIndex,
+    /// Clean and Invalidate by Way Writes each line of the specified L2 cache ways to L3 main
+    /// memory if the line is marked as valid and dirty. The lines are marked as not valid.
+    /// Completes as a background task with the way, or ways, locked, preventing allocation.
+    pub reg7_clean_inv_way: RW<u32>,
+    unused9: [u32; 0x1D8],
+    pub reg15_prefetch_ctrl: Reg15PrefetechCtrl,
+}
+
+register_at!(RegisterBlock, 0xF8F02000, new);
+
+register!(reg0_cache_id, Reg0CacheId, RW, u32);
+register_bits!(reg0_cache_id, implementer, u8, 24, 31);
+register_bits!(reg0_cache_id, cache_id, u8, 10, 15);
+register_bits!(reg0_cache_id, part_num, u8, 6, 9);
+register_bits!(reg0_cache_id, rtl_release, u8, 0, 5);
+
+register!(reg0_cache_type, Reg0CacheType, RW, u32);
+register_bit!(reg0_cache_type, data_banking, 31);
+register_bits!(reg0_cache_type, ctype, u8, 25, 28);
+register_bit!(reg0_cache_type, h, 24);
+register_bits!(reg0_cache_type, dsize_middsize_19, u8, 20, 22);
+register_bit!(reg0_cache_type, l2_assoc_d, 18);
+register_bits!(reg0_cache_type, l2cache_line_len_disize_11, u8, 12, 13);
+register_bits!(reg0_cache_type, isize_midisize_7, u8, 8, 10);
+register_bit!(reg0_cache_type, l2_assoc_i, 6);
+register_bits!(reg0_cache_type, l2cache_line_len_i, u8, 0, 1);
+
+register!(reg1_control, Reg1Control, RW, u32);
+register_bit!(reg1_control, l2_enable, 0);
+
+register!(reg1_aux_control, Reg1AuxControl, RW, u32);
+register_bit!(reg1_aux_control, early_bresp_en, 30);
+register_bit!(reg1_aux_control, instr_prefetch_en, 29);
+register_bit!(reg1_aux_control, data_prefetch_en, 28);
+register_bit!(reg1_aux_control, nonsec_inte_access_ctrl, 27);
+register_bit!(reg1_aux_control, nonsec_lockdown_en, 26);
+register_bit!(reg1_aux_control, cache_replace_policy, 25);
+register_bits!(reg1_aux_control, force_write_alloc, u8, 23, 24);
+register_bit!(reg1_aux_control, shared_attr_override_en, 22);
+register_bit!(reg1_aux_control, parity_en, 21);
+register_bit!(reg1_aux_control, event_mon_bus_en, 20);
+register_bits!(reg1_aux_control, way_size, u8, 17, 19);
+register_bit!(reg1_aux_control, associativity, 16);
+register_bit!(reg1_aux_control, shared_attr_inva_en, 13);
+register_bit!(reg1_aux_control, ex_cache_config, 12);
+register_bit!(reg1_aux_control, store_buff_dev_lim_en, 11);
+register_bit!(reg1_aux_control, high_pr_so_dev_rd_en, 10);
+register_bit!(reg1_aux_control, full_line_zero_enable, 0);
+
+register!(reg1_tag_ram_control, Reg1TagRamControl, RW, u32);
+register_bits!(reg1_tag_ram_control, ram_wr_access_lat, u8, 8, 10);
+register_bits!(reg1_tag_ram_control, ram_rd_access_lat, u8, 4, 6);
+register_bits!(reg1_tag_ram_control, ram_setup_lat, u8, 0, 2);
+
+register!(reg1_data_ram_control, Reg1DataRamControl, RW, u32);
+register_bits!(reg1_data_ram_control, ram_wr_access_lat, u8, 8, 10);
+register_bits!(reg1_data_ram_control, ram_rd_access_lat, u8, 4, 6);
+register_bits!(reg1_data_ram_control, ram_setup_lat, u8, 0, 2);
+
+register!(reg2_ev_counter_ctrl, Reg2EvCounterCtrl, RW, u32);
+register_bit!(reg2_ev_counter_ctrl, ev_ctr_en, 0);
+
+register!(reg2_ev_counter1_cfg, Reg2EvCounter1Cfg, RW, u32);
+register_bits!(reg2_ev_counter1_cfg, ctr_ev_src, u8, 2, 5);
+register_bits!(reg2_ev_counter1_cfg, ev_ctr_intr_gen, u8, 0, 1);
+
+register!(reg2_ev_counter0_cfg, Reg2EvCounter0Cfg, RW, u32);
+register_bits!(reg2_ev_counter0_cfg, ctr_ev_src, u8, 2, 5);
+register_bits!(reg2_ev_counter0_cfg, ev_ctr_intr_gen, u8, 0, 1);
+
+register!(reg2_int_mask, Reg2IntMask, RW, u32);
+register_bit!(reg2_int_mask, decerr, 8);
+register_bit!(reg2_int_mask, slverr, 7);
+register_bit!(reg2_int_mask, errrd, 6);
+register_bit!(reg2_int_mask, errrt, 5);
+register_bit!(reg2_int_mask, errwd, 4);
+register_bit!(reg2_int_mask, errwt, 3);
+register_bit!(reg2_int_mask, parrd, 2);
+register_bit!(reg2_int_mask, parrt, 1);
+register_bit!(reg2_int_mask, ecntr, 0);
+
+register!(reg2_int_mask_status, Reg2IntMaskStatus, RW, u32);
+register_bit!(reg2_int_mask_status, decerr, 8);
+register_bit!(reg2_int_mask_status, slverr, 7);
+register_bit!(reg2_int_mask_status, errrd, 6);
+register_bit!(reg2_int_mask_status, errrt, 5);
+register_bit!(reg2_int_mask_status, errwd, 4);
+register_bit!(reg2_int_mask_status, errwt, 3);
+register_bit!(reg2_int_mask_status, parrd, 2);
+register_bit!(reg2_int_mask_status, parrt, 1);
+register_bit!(reg2_int_mask_status, ecntr, 0);
+
+register!(reg2_int_raw_status, Reg2IntRawStatus, RW, u32);
+register_bit!(reg2_int_raw_status, decerr, 8);
+register_bit!(reg2_int_raw_status, slverr, 7);
+register_bit!(reg2_int_raw_status, errrd, 6);
+register_bit!(reg2_int_raw_status, errrt, 5);
+register_bit!(reg2_int_raw_status, errwd, 4);
+register_bit!(reg2_int_raw_status, errwt, 3);
+register_bit!(reg2_int_raw_status, parrd, 2);
+register_bit!(reg2_int_raw_status, parrt, 1);
+register_bit!(reg2_int_raw_status, ecntr, 0);
+
+register!(reg2_int_clear, Reg2IntClear, RW, u32, 0);
+register_bit!(reg2_int_clear, decerr, 8, WTC);
+register_bit!(reg2_int_clear, slverr, 7, WTC);
+register_bit!(reg2_int_clear, errrd, 6, WTC);
+register_bit!(reg2_int_clear, errrt, 5, WTC);
+register_bit!(reg2_int_clear, errwd, 4, WTC);
+register_bit!(reg2_int_clear, errwt, 3, WTC);
+register_bit!(reg2_int_clear, parrd, 2, WTC);
+register_bit!(reg2_int_clear, parrt, 1, WTC);
+register_bit!(reg2_int_clear, ecntr, 0, WTC);
+
+register!(reg7_cache_sync, Reg7CacheSync, RW, u32);
+register_bit!(reg7_cache_sync, c, 0);
+
+register!(reg7_clean_index, Reg7CleanIndex, RW, u32);
+register_bits!(reg7_clean_index, way, u8, 28, 30);
+register_bits!(reg7_clean_index, index, u8, 5, 11);
+register_bit!(reg7_clean_index, c, 0);
+
+register!(reg7_clean_inv_index, Reg7CleanInvIndex, RW, u32);
+register_bits!(reg7_clean_inv_index, way, u8, 28, 30);
+register_bits!(reg7_clean_inv_index, index, u8, 5, 11);
+register_bit!(reg7_clean_inv_index, c, 0);
+
+register!(reg15_prefetch_ctrl, Reg15PrefetechCtrl, RW, u32);
+register_bit!(reg15_prefetch_ctrl, double_linefill_en, 30);
+register_bit!(reg15_prefetch_ctrl, instr_prefetch_en, 29);
+register_bit!(reg15_prefetch_ctrl, data_prefetch_en, 28);
+register_bit!(reg15_prefetch_ctrl, pref_drop_en, 24);
+register_bit!(reg15_prefetch_ctrl, incr_double_linefill_en, 23);
+register_bits!(reg15_prefetch_ctrl, prefetch_offset, u8, 0, 4);
+
--- a/libcortex_a9/src/lib.rs
+++ b/libcortex_a9/src/lib.rs
@ -6,16 +6,17 @@
 extern crate alloc;

 pub mod asm;
-pub mod regs;
 pub mod cache;
+mod fpu;
+pub mod l2c;
 pub mod mmu;
 pub mod mutex;
-pub mod sync_channel;
+pub mod regs;
 pub mod semaphore;
+pub mod sync_channel;
 mod uncached;
-mod fpu;
-pub use uncached::UncachedSlice;
 pub use fpu::enable_fpu;
+pub use uncached::UncachedSlice;

 global_asm!(include_str!("exceptions.s"));

@ -34,3 +35,47 @@ pub fn notify_spin_lock() {
    }
 }

+#[macro_export]
+/// Interrupt handler, which setup the stack and preserve registers before jumping to actual interrupt handler.
+/// Registers r0-r12, PC, SP and CPSR are restored after the actual handler.
+/// 
+/// - `name` is the name of the interrupt, should be the same as the one defined in vector table.
+/// - `name2` is the name for the actual handler, should be different from name.
+/// - `stack0` is the stack for the interrupt handler when called from core0.
+/// - `stack1` is the stack for the interrupt handler when called from core1.
+/// - `body` is the body of the actual interrupt handler, should be a normal unsafe rust function
+/// body.
+///
+/// Note that the interrupt handler would use the same stack as normal programs by default.
+macro_rules! interrupt_handler {
+    ($name:ident, $name2:ident, $stack0:ident, $stack1:ident, $body:block) => {
+        #[link_section = ".text.boot"]
+        #[no_mangle]
+        #[naked]
+        pub unsafe extern "C" fn $name() -> ! {
+            asm!(
+                // setup SP, depending on CPU 0 or 1
+                // and preserve registers
+                "sub lr, lr, #4",
+                "stmfd sp!, {{r0-r12, lr}}",
+                "mrc p15, #0, r0, c0, c0, #5",
+                concat!("movw r1, :lower16:", stringify!($stack0)),
+                concat!("movt r1, :upper16:", stringify!($stack0)),
+                "tst r0, #3",
+                concat!("movwne r1, :lower16:", stringify!($stack1)),
+                concat!("movtne r1, :upper16:", stringify!($stack1)),
+                "mov r0, sp",
+                "mov sp, r1",
+                "push {{r0, r1}}",                                      // 2 registers are pushed to maintain 8 byte stack alignment 
+                concat!("bl ", stringify!($name2)),
+                "pop {{r0, r1}}",
+                "mov sp, r0",
+                "ldmfd sp!, {{r0-r12, pc}}^",                           // caret ^ : copy SPSR to the CPSR  
+                options(noreturn)
+            );
+        }
+
+        #[no_mangle]
+        pub unsafe extern "C" fn $name2() $body
+    };
+}
--- a/libcortex_a9/src/mmu.rs
+++ b/libcortex_a9/src/mmu.rs
@ -158,7 +158,7 @@ impl L1Table {
                global: true,
                shareable: true,
                access: AccessPermissions::FullAccess,
-                tex: 0b101,
+                tex: 0b0,
                domain: 0b1111,
                exec: true,
                cacheable: true,
@ -213,7 +213,7 @@ impl L1Table {
                access: AccessPermissions::FullAccess,
                tex: 0,
                domain: 0,
-                exec: true,
+                exec: false,
                cacheable: false,
                bufferable: true,
            });
@ -410,6 +410,7 @@ pub fn with_mmu<F: FnMut() -> !>(l1table: &L1Table, mut f: F) -> ! {
            .a(false)
            .c(true)
            .i(true)
+            .z(true)
            .unaligned(true)
    );

--- a/libcortex_a9/src/mutex.rs
+++ b/libcortex_a9/src/mutex.rs
@ -1,9 +1,12 @@
 use core::ops::{Deref, DerefMut};
 use core::sync::atomic::{AtomicU32, Ordering};
 use core::cell::UnsafeCell;
+use core::task::{Context, Poll};
+use core::pin::Pin;
+use core::future::Future;
 use super::{
    spin_lock_yield, notify_spin_lock,
-    asm::{dmb, enter_critical, exit_critical}
+    asm::{enter_critical, exit_critical}
 };

 const LOCKED: u32 = 1;
@ -20,6 +23,23 @@ pub struct Mutex<T> {
 unsafe impl<T: Send> Sync for Mutex<T> {}
 unsafe impl<T: Send> Send for Mutex<T> {}

+struct Fut<'a, T>(&'a Mutex<T>);
+
+impl<'a, T> Future for Fut<'a, T> {
+    type Output = MutexGuard<'a, T>;
+    fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
+        let irq = unsafe { enter_critical() };
+        if self.0.locked.compare_exchange_weak(UNLOCKED, LOCKED, Ordering::AcqRel, Ordering::Relaxed).is_err() {
+            unsafe { exit_critical(irq) };
+            cx.waker().wake_by_ref();
+            Poll::Pending
+        }
+        else {
+            Poll::Ready(MutexGuard { mutex: self.0, irq })
+        }
+    }
+}
+
 impl<T> Mutex<T> {
    /// Constructor, const-fn
    pub const fn new(inner: T) -> Self {
@ -32,30 +52,31 @@ impl<T> Mutex<T> {
    /// Lock the Mutex, blocks when already locked
    pub fn lock(&self) -> MutexGuard<T> {
        let mut irq = unsafe { enter_critical() };
-        while self.locked.compare_and_swap(UNLOCKED, LOCKED, Ordering::Acquire) != UNLOCKED {
+        while self.locked.compare_exchange_weak(UNLOCKED, LOCKED, Ordering::AcqRel, Ordering::Relaxed).is_err() {
            unsafe {
                exit_critical(irq);
                spin_lock_yield();
                irq = enter_critical();
            }
        }
-        dmb();
        MutexGuard { mutex: self, irq }
    }

+    pub async fn async_lock(&self) -> MutexGuard<'_, T> {
+        Fut(&self).await
+    }
+
    pub fn try_lock(&self) -> Option<MutexGuard<T>> {
        let irq = unsafe { enter_critical() };
-        if self.locked.compare_and_swap(UNLOCKED, LOCKED, Ordering::Acquire) != UNLOCKED {
+        if self.locked.compare_exchange_weak(UNLOCKED, LOCKED, Ordering::AcqRel, Ordering::Relaxed).is_err() {
            unsafe { exit_critical(irq) };
            None
        } else {
-            dmb();
            Some(MutexGuard { mutex: self, irq })
        }
    }

    fn unlock(&self) {
-        dmb();
        self.locked.store(UNLOCKED, Ordering::Release);

        notify_spin_lock();
--- a/libcortex_a9/src/regs.rs
+++ b/libcortex_a9/src/regs.rs
@ -156,6 +156,8 @@ register_bit!(actlr, excl, 7);
 register_bit!(actlr, smp, 6);
 register_bit!(actlr, write_full_line_of_zeros, 3);
 register_bit!(actlr, l1_prefetch_enable, 2);
+// L2 cache prefetch hint, in UG585 section 3.4.8
+register_bit!(actlr, l2_prefetch_enable, 1);
 // Cache/TLB maintenance broadcast
 register_bit!(actlr, fw, 0);

@ -171,7 +173,11 @@ impl RegisterRW for ACTLR {

 impl ACTLR {
    pub fn enable_smp(&mut self) {
-        self.modify(|_, w| w.smp(true).fw(true));
+        self.modify(|_, w| w.smp(true).fw(true).alloc_one_way(true));
+    }
+
+    pub fn enable_prefetch(&mut self) {
+        self.modify(|_, w| w.l1_prefetch_enable(true).l2_prefetch_enable(true))
    }
 }

--- a/libcortex_a9/src/semaphore.rs
+++ b/libcortex_a9/src/semaphore.rs
@ -12,7 +12,7 @@ pub struct Semaphore {
 }

 impl Semaphore {
-    pub fn new(value: i32, max: i32) -> Self {
+    pub const fn new(value: i32, max: i32) -> Self {
        Semaphore { value: AtomicI32::new(value), max}
    }

@ -20,7 +20,7 @@ impl Semaphore {
        loop {
            let value = self.value.load(Ordering::Relaxed);
            if value > 0 {
-                if self.value.compare_and_swap(value, value - 1, Ordering::SeqCst) == value {
+                if self.value.compare_exchange_weak(value, value - 1, Ordering::SeqCst, Ordering::Relaxed).is_ok() {
                    return Some(());
                }
            } else {
@ -58,7 +58,7 @@ impl Semaphore {
        loop {
            let value = self.value.load(Ordering::Relaxed);
            if value < self.max {
-                if self.value.compare_and_swap(value, value + 1, Ordering::SeqCst) == value {
+                if self.value.compare_exchange_weak(value, value + 1, Ordering::SeqCst, Ordering::Relaxed).is_ok() {
                    notify_spin_lock();
                    return;
                }
--- a/libcortex_a9/src/sync_channel.rs
+++ b/libcortex_a9/src/sync_channel.rs
@ -1,7 +1,6 @@
 use core::{
    pin::Pin,
    future::Future,
-    ptr::drop_in_place,
    sync::atomic::{AtomicPtr, AtomicUsize, Ordering},
    task::{Context, Poll},
 };
@ -38,7 +37,7 @@ impl<'a, T> Sender<'a, T> where T: Clone {
            notify_spin_lock();
            if !prev.is_null() {
                unsafe {
-                    drop_in_place(prev);
+                    Box::from_raw(prev);
                }
            }
            Ok(())
@ -92,7 +91,7 @@ impl<'a, T> Sender<'a, T> where T: Clone {
        for v in self.list.iter() {
            let original = v.swap(core::ptr::null_mut(), Ordering::Relaxed);
            if !original.is_null() {
-                drop_in_place(original);
+                Box::from_raw(original);
            }
        }
    }
--- a/libcortex_a9/src/uncached.rs
+++ b/libcortex_a9/src/uncached.rs
@ -2,7 +2,7 @@ use core::{
    ops::{Deref, DerefMut},
    mem::{align_of, size_of},
 };
-use alloc::alloc::{dealloc, Layout, LayoutErr};
+use alloc::alloc::{dealloc, Layout, LayoutError};
 use crate::mmu::{L1_PAGE_SIZE, L1Table};

 pub struct UncachedSlice<T: 'static> {
@ -12,7 +12,7 @@ pub struct UncachedSlice<T: 'static> {

 impl<T> UncachedSlice<T> {
    /// allocates in chunks of 1 MB
-    pub fn new<F: Fn() -> T>(len: usize, default: F) -> Result<Self, LayoutErr> {
+    pub fn new<F: Fn() -> T>(len: usize, default: F) -> Result<Self, LayoutError> {
        // round to full pages
        let size = ((len * size_of::<T>() - 1) | (L1_PAGE_SIZE - 1)) + 1;
        let align = align_of::<T>()
@ -23,10 +23,11 @@ impl<T> UncachedSlice<T> {
        assert_eq!(start & (L1_PAGE_SIZE - 1), 0);

        for page_start in (start..(start + size)).step_by(L1_PAGE_SIZE) {
+            // non-shareable device
            L1Table::get()
                .update(page_start as *const (), |l1_section| {
-                    l1_section.tex = 0b100;
-                    l1_section.cacheable = false;
+                    l1_section.tex = 0b10;
+                    l1_section.cacheable = true;
                    l1_section.bufferable = false;
                });
        }
--- a/libregister/Cargo.toml
+++ b/libregister/Cargo.toml
@ -1,7 +1,7 @@
 [package]
 name = "libregister"
 version = "0.0.0"
-authors = ["Astro <astro@spaceboyz.net>"]
+authors = ["M-Labs"]
 edition = "2018"

 [dependencies]
--- a/libregister/src/lib.rs
+++ b/libregister/src/lib.rs
@ -30,8 +30,9 @@ pub trait RegisterRW: RegisterR + RegisterW {
 #[doc(hidden)]
 #[macro_export]
 macro_rules! register_common {
-    ($mod_name: ident, $struct_name: ident, $access: ty, $inner: ty) => (
+    ($mod_name: ident, $(#[$outer:meta])* $struct_name: ident, $access: ty, $inner: ty) => (
        #[repr(C)]
+        $(#[$outer])*
        pub struct $struct_name {
            inner: $access,
        }
@ -52,7 +53,7 @@ macro_rules! register_common {
 #[macro_export]
 macro_rules! register_r {
    ($mod_name: ident, $struct_name: ident) => (
-        impl libregister::RegisterR for $struct_name {
+        impl $crate::RegisterR for $struct_name {
            type R = $mod_name::Read;

            #[inline]
@ -67,7 +68,7 @@ macro_rules! register_r {
 #[macro_export]
 macro_rules! register_w {
    ($mod_name: ident, $struct_name: ident) => (
-        impl libregister::RegisterW for $struct_name {
+        impl $crate::RegisterW for $struct_name {
            type W = $mod_name::Write;

            #[inline]
@ -88,7 +89,7 @@ macro_rules! register_w {
 #[macro_export]
 macro_rules! register_rw {
    ($mod_name: ident, $struct_name: ident) => (
-        impl libregister::RegisterRW for $struct_name {
+        impl $crate::RegisterRW for $struct_name {
            #[inline]
            fn modify<F: FnOnce(Self::R, Self::W) -> Self::W>(&mut self, f: F) {
                unsafe {
@ -101,7 +102,7 @@ macro_rules! register_rw {
        }
    );
    ($mod_name: ident, $struct_name: ident, $mask: expr) => (
-        impl libregister::RegisterRW for $struct_name {
+        impl $crate::RegisterRW for $struct_name {
            #[inline]
            fn modify<F: FnOnce(Self::R, Self::W) -> Self::W>(&mut self, f: F) {
                unsafe {
@ -119,7 +120,7 @@ macro_rules! register_rw {
 #[macro_export]
 macro_rules! register_vcell {
    ($mod_name: ident, $struct_name: ident) => (
-        impl libregister::RegisterR for $struct_name {
+        impl $crate::RegisterR for $struct_name {
            type R = $mod_name::Read;

            #[inline]
@ -128,7 +129,7 @@ macro_rules! register_vcell {
                $mod_name::Read { inner }
            }
        }
-        impl libregister::RegisterW for $struct_name {
+        impl $crate::RegisterW for $struct_name {
            type W = $mod_name::Write;

            #[inline]
@ -141,7 +142,7 @@ macro_rules! register_vcell {
                self.inner.set(w.inner);
            }
        }
-        impl libregister::RegisterRW for $struct_name {
+        impl $crate::RegisterRW for $struct_name {
            #[inline]
            fn modify<F: FnOnce(Self::R, Self::W) -> Self::W>(&mut self, f: F) {
                let r = self.read();
@ -157,37 +158,37 @@ macro_rules! register_vcell {
 #[macro_export]
 macro_rules! register {
    // Define read-only register
-    ($mod_name: ident, $struct_name: ident, RO, $inner: ty) => (
-        libregister::register_common!($mod_name, $struct_name, libregister::RO<$inner>, $inner);
-        libregister::register_r!($mod_name, $struct_name);
+    ($mod_name: ident, $(#[$outer:meta])* $struct_name: ident, RO, $inner: ty) => (
+        $crate::register_common!($mod_name, $(#[$outer])* $struct_name, $crate::RO<$inner>, $inner);
+        $crate::register_r!($mod_name, $struct_name);
    );

    // Define write-only register
-    ($mod_name: ident, $struct_name: ident, WO, $inner: ty) => (
-        libregister::register_common!($mod_name, $struct_name, volatile_register::WO<$inner>, $inner);
-        libregister::register_w!($mod_name, $struct_name);
+    ($mod_name: ident, $(#[$outer:meta])* $struct_name: ident, WO, $inner: ty) => (
+        $crate::register_common!($mod_name, $(#[$outer])* $struct_name, volatile_register::WO<$inner>, $inner);
+        $crate::register_w!($mod_name, $struct_name);
    );

    // Define read-write register
-    ($mod_name: ident, $struct_name: ident, RW, $inner: ty) => (
-        libregister::register_common!($mod_name, $struct_name, volatile_register::RW<$inner>, $inner);
-        libregister::register_r!($mod_name, $struct_name);
-        libregister::register_w!($mod_name, $struct_name);
-        libregister::register_rw!($mod_name, $struct_name);
+    ($mod_name: ident, $(#[$outer:meta])* $struct_name: ident, RW, $inner: ty) => (
+        $crate::register_common!($mod_name, $(#[$outer])* $struct_name, volatile_register::RW<$inner>, $inner);
+        $crate::register_r!($mod_name, $struct_name);
+        $crate::register_w!($mod_name, $struct_name);
+        $crate::register_rw!($mod_name, $struct_name);
    );

    // Define read-write register
-    ($mod_name: ident, $struct_name: ident, VolatileCell, $inner: ty) => (
-        libregister::register_common!($mod_name, $struct_name, VolatileCell<$inner>, $inner);
-        libregister::register_vcell!($mod_name, $struct_name);
+    ($mod_name: ident, $(#[$outer:meta])* $struct_name: ident, VolatileCell, $inner: ty) => (
+        $crate::register_common!($mod_name, $(#[$outer])* $struct_name, VolatileCell<$inner>, $inner);
+        $crate::register_vcell!($mod_name, $struct_name);
    );

    // Define read-write register with mask on write (for WTC mixed access.)
-    ($mod_name: ident, $struct_name: ident, RW, $inner: ty, $mask: expr) => (
-        libregister::register_common!($mod_name, $struct_name, volatile_register::RW<$inner>, $inner);
-        libregister::register_r!($mod_name, $struct_name);
-        libregister::register_w!($mod_name, $struct_name);
-        libregister::register_rw!($mod_name, $struct_name, $mask);
+    ($mod_name: ident, $(#[$outer:meta])* $struct_name: ident, RW, $inner: ty, $mask: expr) => (
+        $crate::register_common!($mod_name, $(#[$outer])* $struct_name, volatile_register::RW<$inner>, $inner);
+        $crate::register_r!($mod_name, $struct_name);
+        $crate::register_w!($mod_name, $struct_name);
+        $crate::register_rw!($mod_name, $struct_name, $mask);
    );
 }

--- a/libsupport_zynq/Cargo.toml
+++ b/libsupport_zynq/Cargo.toml
@ -2,22 +2,29 @@
 name = "libsupport_zynq"
 description = "Software support for running in the Zynq PS"
 version = "0.0.0"
-authors = ["Astro <astro@spaceboyz.net>"]
+authors = ["M-Labs"]
 edition = "2018"

 [features]
 target_zc706 = ["libboard_zynq/target_zc706"]
-target_cora_z7_10 = ["libboard_zynq/target_cora_z7_10"]
+target_coraz7 = ["libboard_zynq/target_coraz7"]
+target_ebaz4205 = ["libboard_zynq/target_ebaz4205"]
+target_redpitaya = ["libboard_zynq/target_redpitaya"]
+target_kasli_soc = ["libboard_zynq/target_kasli_soc"]
 panic_handler = []
 dummy_irq_handler = []
+dummy_fiq_handler = []
 alloc_core = []

-default = ["panic_handler", "dummy_irq_handler"]
+default = ["panic_handler", "dummy_irq_handler", "dummy_fiq_handler"]

 [dependencies]
 r0 = "1"
-compiler_builtins = "0.1"
-linked_list_allocator = { version = "0.8", default-features = false }
+compiler_builtins = "=0.1.39"
+linked_list_allocator = { version = "0.8", default-features = false, features = ["const_mut_refs"] }
 libregister = { path = "../libregister" }
 libcortex_a9 = { path = "../libcortex_a9" }
 libboard_zynq = { path = "../libboard_zynq" }
+
+[build-dependencies]
+cc = { version = "1.0" }
--- a/libsupport_zynq/build.rs
+++ b/libsupport_zynq/build.rs
@ -0,0 +1,24 @@
+fn main() {
+    println!("cargo:rerun-if-changed=build.rs");
+    compile_memcpy();
+}
+
+fn compile_memcpy() {
+    use std::path::Path;
+    extern crate cc;
+    let cfg = &mut cc::Build::new();
+    cfg.compiler("clang");
+    cfg.no_default_flags(true);
+    cfg.warnings(false);
+    cfg.flag("--target=armv7-none-eabihf");
+    let sources = vec![
+        "memcpy.S",
+    ];
+    let root = Path::new("src/asm");
+    for src in sources {
+        println!("cargo:rerun-if-changed={}", src);
+        cfg.file(root.join(src));
+    }
+    cfg.compile("memcpy");
+}
+
--- a/libsupport_zynq/src/abort.rs
+++ b/libsupport_zynq/src/abort.rs
@ -1,70 +0,0 @@
-use libregister::RegisterR;
-use libcortex_a9::regs::{DFSR, MPIDR};
-use libboard_zynq::{println, stdio};
-
-#[link_section = ".text.boot"]
-#[no_mangle]
-#[naked]
-pub unsafe extern "C" fn UndefinedInstruction() {
-    stdio::drop_uart();
-    println!("UndefinedInstruction");
-    loop {}
-}
-
-#[link_section = ".text.boot"]
-#[no_mangle]
-#[naked]
-pub unsafe extern "C" fn SoftwareInterrupt() {
-    stdio::drop_uart();
-    println!("SoftwareInterrupt");
-    loop {}
-}
-
-#[link_section = ".text.boot"]
-#[no_mangle]
-#[naked]
-pub unsafe extern "C" fn PrefetchAbort() {
-    stdio::drop_uart();
-    println!("PrefetchAbort");
-    loop {}
-}
-
-#[link_section = ".text.boot"]
-#[no_mangle]
-#[naked]
-pub unsafe extern "C" fn DataAbort() {
-    stdio::drop_uart();
-
-    println!("DataAbort on core {}", MPIDR.read().cpu_id());
-    println!("DFSR: {:03X}", DFSR.read());
-
-    loop {}
-}
-
-#[link_section = ".text.boot"]
-#[no_mangle]
-#[naked]
-pub unsafe extern "C" fn ReservedException() {
-    stdio::drop_uart();
-    println!("ReservedException");
-    loop {}
-}
-
-#[link_section = ".text.boot"]
-#[no_mangle]
-#[naked]
-#[cfg(feature = "dummy_irq_handler")]
-pub unsafe extern "C" fn IRQ() {
-    stdio::drop_uart();
-    println!("IRQ");
-    loop {}
-}
-
-#[link_section = ".text.boot"]
-#[no_mangle]
-#[naked]
-pub unsafe extern "C" fn FIQ() {
-    stdio::drop_uart();
-    println!("FIQ");
-    loop {}
-}
--- a/libsupport_zynq/src/asm/memcpy.S
+++ b/libsupport_zynq/src/asm/memcpy.S
@ -0,0 +1,626 @@
+/* Copyright (c) 2013, Linaro Limited
+   All rights reserved.
+
+   Redistribution and use in source and binary forms, with or without
+   modification, are permitted provided that the following conditions
+   are met:
+
+      * Redistributions of source code must retain the above copyright
+      notice, this list of conditions and the following disclaimer.
+
+      * Redistributions in binary form must reproduce the above copyright
+      notice, this list of conditions and the following disclaimer in the
+      documentation and/or other materials provided with the distribution.
+
+      * Neither the name of Linaro Limited nor the names of its
+      contributors may be used to endorse or promote products derived
+      from this software without specific prior written permission.
+
+   THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS
+   "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT
+   LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR
+   A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT
+   HOLDER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL,
+   SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT
+   LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE,
+   DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY
+   THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT
+   (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE
+   OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+
+   This memcpy routine is optimised for Cortex-A15 cores and takes advantage
+   of VFP or NEON when built with the appropriate flags.
+
+   Assumptions:
+
+    ARMv6 (ARMv7-a if using Neon)
+    ARM state
+    Unaligned accesses
+    LDRD/STRD support unaligned word accesses
+
+   If compiled with GCC, this file should be enclosed within following
+   pre-processing check:
+   if defined (__ARM_ARCH_7A__) && defined (__ARM_FEATURE_UNALIGNED)
+
+ */
+	.syntax unified
+	/* This implementation requires ARM state.  */
+	.arm
+
+#ifdef __ARM_NEON__
+
+	.fpu	neon
+	.arch	armv7-a
+# define FRAME_SIZE	4
+# define USE_VFP
+# define USE_NEON
+
+#elif !defined (__SOFTFP__)
+
+	.arch	armv6
+	.fpu	vfpv2
+# define FRAME_SIZE	32
+# define USE_VFP
+
+#else
+	.arch	armv6
+# define FRAME_SIZE    32
+
+#endif
+
+/* Old versions of GAS incorrectly implement the NEON align semantics.  */
+#ifdef BROKEN_ASM_NEON_ALIGN
+#define ALIGN(addr, align) addr,:align
+#else
+#define ALIGN(addr, align) addr:align
+#endif
+
+#define PC_OFFSET	8	/* PC pipeline compensation.  */
+#define INSN_SIZE	4
+
+/* Call parameters.  */
+#define dstin	r0
+#define src	r1
+#define count	r2
+
+/* Locals.  */
+#define tmp1	r3
+#define dst	ip
+#define tmp2	r10
+
+#ifndef USE_NEON
+/* For bulk copies using GP registers.  */
+#define	A_l	r2		/* Call-clobbered.  */
+#define	A_h	r3		/* Call-clobbered.  */
+#define	B_l	r4
+#define	B_h	r5
+#define	C_l	r6
+#define	C_h	r7
+#define	D_l	r8
+#define	D_h	r9
+#endif
+
+/* Number of lines ahead to pre-fetch data.  If you change this the code
+   below will need adjustment to compensate.  */
+
+#define prefetch_lines	5
+
+#ifdef USE_VFP
+	.macro	cpy_line_vfp vreg, base
+	vstr	\vreg, [dst, #\base]
+	vldr	\vreg, [src, #\base]
+	vstr	d0, [dst, #\base + 8]
+	vldr	d0, [src, #\base + 8]
+	vstr	d1, [dst, #\base + 16]
+	vldr	d1, [src, #\base + 16]
+	vstr	d2, [dst, #\base + 24]
+	vldr	d2, [src, #\base + 24]
+	vstr	\vreg, [dst, #\base + 32]
+	vldr	\vreg, [src, #\base + prefetch_lines * 64 - 32]
+	vstr	d0, [dst, #\base + 40]
+	vldr	d0, [src, #\base + 40]
+	vstr	d1, [dst, #\base + 48]
+	vldr	d1, [src, #\base + 48]
+	vstr	d2, [dst, #\base + 56]
+	vldr	d2, [src, #\base + 56]
+	.endm
+
+	.macro	cpy_tail_vfp vreg, base
+	vstr	\vreg, [dst, #\base]
+	vldr	\vreg, [src, #\base]
+	vstr	d0, [dst, #\base + 8]
+	vldr	d0, [src, #\base + 8]
+	vstr	d1, [dst, #\base + 16]
+	vldr	d1, [src, #\base + 16]
+	vstr	d2, [dst, #\base + 24]
+	vldr	d2, [src, #\base + 24]
+	vstr	\vreg, [dst, #\base + 32]
+	vstr	d0, [dst, #\base + 40]
+	vldr	d0, [src, #\base + 40]
+	vstr	d1, [dst, #\base + 48]
+	vldr	d1, [src, #\base + 48]
+	vstr	d2, [dst, #\base + 56]
+	vldr	d2, [src, #\base + 56]
+	.endm
+#endif
+
+	.macro def_fn f p2align=0
+	.text
+	.p2align \p2align
+	.global \f
+	.type \f, %function
+\f:
+	.endm
+
+	.global __aeabi_memcpy
+	.global __aeabi_memcpy4
+	.global __aeabi_memcpy8
+	.set __aeabi_memcpy, fast_memcpy
+	.set __aeabi_memcpy4, fast_memcpy
+	.set __aeabi_memcpy8, fast_memcpy
+def_fn fast_memcpy p2align=6
+
+	mov	dst, dstin	/* Preserve dstin, we need to return it.  */
+	cmp	count, #64
+	bge	.Lcpy_not_short
+	/* Deal with small copies quickly by dropping straight into the
+	   exit block.  */
+
+.Ltail63unaligned:
+#ifdef USE_NEON
+	and	tmp1, count, #0x38
+	rsb	tmp1, tmp1, #(56 - PC_OFFSET + INSN_SIZE)
+	add	pc, pc, tmp1
+	vld1.8	{d0}, [src]!	/* 14 words to go.  */
+	vst1.8	{d0}, [dst]!
+	vld1.8	{d0}, [src]!	/* 12 words to go.  */
+	vst1.8	{d0}, [dst]!
+	vld1.8	{d0}, [src]!	/* 10 words to go.  */
+	vst1.8	{d0}, [dst]!
+	vld1.8	{d0}, [src]!	/* 8 words to go.  */
+	vst1.8	{d0}, [dst]!
+	vld1.8	{d0}, [src]!	/* 6 words to go.  */
+	vst1.8	{d0}, [dst]!
+	vld1.8	{d0}, [src]!	/* 4 words to go.  */
+	vst1.8	{d0}, [dst]!
+	vld1.8	{d0}, [src]!	/* 2 words to go.  */
+	vst1.8	{d0}, [dst]!
+
+	tst	count, #4
+	ldrne	tmp1, [src], #4
+	strne	tmp1, [dst], #4
+#else
+	/* Copy up to 15 full words of data.  May not be aligned.  */
+	/* Cannot use VFP for unaligned data.  */
+	and	tmp1, count, #0x3c
+	add	dst, dst, tmp1
+	add	src, src, tmp1
+	rsb	tmp1, tmp1, #(60 - PC_OFFSET/2 + INSN_SIZE/2)
+	/* Jump directly into the sequence below at the correct offset.  */
+	add	pc, pc, tmp1, lsl #1
+
+	ldr	tmp1, [src, #-60]	/* 15 words to go.  */
+	str	tmp1, [dst, #-60]
+
+	ldr	tmp1, [src, #-56]	/* 14 words to go.  */
+	str	tmp1, [dst, #-56]
+	ldr	tmp1, [src, #-52]
+	str	tmp1, [dst, #-52]
+
+	ldr	tmp1, [src, #-48]	/* 12 words to go.  */
+	str	tmp1, [dst, #-48]
+	ldr	tmp1, [src, #-44]
+	str	tmp1, [dst, #-44]
+
+	ldr	tmp1, [src, #-40]	/* 10 words to go.  */
+	str	tmp1, [dst, #-40]
+	ldr	tmp1, [src, #-36]
+	str	tmp1, [dst, #-36]
+
+	ldr	tmp1, [src, #-32]	/* 8 words to go.  */
+	str	tmp1, [dst, #-32]
+	ldr	tmp1, [src, #-28]
+	str	tmp1, [dst, #-28]
+
+	ldr	tmp1, [src, #-24]	/* 6 words to go.  */
+	str	tmp1, [dst, #-24]
+	ldr	tmp1, [src, #-20]
+	str	tmp1, [dst, #-20]
+
+	ldr	tmp1, [src, #-16]	/* 4 words to go.  */
+	str	tmp1, [dst, #-16]
+	ldr	tmp1, [src, #-12]
+	str	tmp1, [dst, #-12]
+
+	ldr	tmp1, [src, #-8]	/* 2 words to go.  */
+	str	tmp1, [dst, #-8]
+	ldr	tmp1, [src, #-4]
+	str	tmp1, [dst, #-4]
+#endif
+
+	lsls	count, count, #31
+	ldrhcs	tmp1, [src], #2
+	ldrbne	src, [src]		/* Src is dead, use as a scratch.  */
+	strhcs	tmp1, [dst], #2
+	strbne	src, [dst]
+	bx	lr
+
+.Lcpy_not_short:
+	/* At least 64 bytes to copy, but don't know the alignment yet.  */
+	str	tmp2, [sp, #-FRAME_SIZE]!
+	and	tmp2, src, #7
+	and	tmp1, dst, #7
+	cmp	tmp1, tmp2
+	bne	.Lcpy_notaligned
+
+#ifdef USE_VFP
+	/* Magic dust alert!  Force VFP on Cortex-A9.  Experiments show
+	   that the FP pipeline is much better at streaming loads and
+	   stores.  This is outside the critical loop.  */
+	vmov.f32	s0, s0
+#endif
+
+	/* SRC and DST have the same mutual 32-bit alignment, but we may
+	   still need to pre-copy some bytes to get to natural alignment.
+	   We bring DST into full 64-bit alignment.  */
+	lsls	tmp2, dst, #29
+	beq	1f
+	rsbs	tmp2, tmp2, #0
+	sub	count, count, tmp2, lsr #29
+	ldrmi	tmp1, [src], #4
+	strmi	tmp1, [dst], #4
+	lsls	tmp2, tmp2, #2
+	ldrhcs	tmp1, [src], #2
+	ldrbne	tmp2, [src], #1
+	strhcs	tmp1, [dst], #2
+	strbne	tmp2, [dst], #1
+
+1:
+	subs	tmp2, count, #64	/* Use tmp2 for count.  */
+	blt	.Ltail63aligned
+
+	cmp	tmp2, #512
+	bge	.Lcpy_body_long
+
+.Lcpy_body_medium:			/* Count in tmp2.  */
+#ifdef USE_VFP
+1:
+	vldr	d0, [src, #0]
+	subs	tmp2, tmp2, #64
+	vldr	d1, [src, #8]
+	vstr	d0, [dst, #0]
+	vldr	d0, [src, #16]
+	vstr	d1, [dst, #8]
+	vldr	d1, [src, #24]
+	vstr	d0, [dst, #16]
+	vldr	d0, [src, #32]
+	vstr	d1, [dst, #24]
+	vldr	d1, [src, #40]
+	vstr	d0, [dst, #32]
+	vldr	d0, [src, #48]
+	vstr	d1, [dst, #40]
+	vldr	d1, [src, #56]
+	vstr	d0, [dst, #48]
+	add	src, src, #64
+	vstr	d1, [dst, #56]
+	add	dst, dst, #64
+	bge	1b
+	tst	tmp2, #0x3f
+	beq	.Ldone
+
+.Ltail63aligned:			/* Count in tmp2.  */
+	and	tmp1, tmp2, #0x38
+	add	dst, dst, tmp1
+	add	src, src, tmp1
+	rsb	tmp1, tmp1, #(56 - PC_OFFSET + INSN_SIZE)
+	add	pc, pc, tmp1
+
+	vldr	d0, [src, #-56]	/* 14 words to go.  */
+	vstr	d0, [dst, #-56]
+	vldr	d0, [src, #-48]	/* 12 words to go.  */
+	vstr	d0, [dst, #-48]
+	vldr	d0, [src, #-40]	/* 10 words to go.  */
+	vstr	d0, [dst, #-40]
+	vldr	d0, [src, #-32]	/* 8 words to go.  */
+	vstr	d0, [dst, #-32]
+	vldr	d0, [src, #-24]	/* 6 words to go.  */
+	vstr	d0, [dst, #-24]
+	vldr	d0, [src, #-16]	/* 4 words to go.  */
+	vstr	d0, [dst, #-16]
+	vldr	d0, [src, #-8]	/* 2 words to go.  */
+	vstr	d0, [dst, #-8]
+#else
+	sub	src, src, #8
+	sub	dst, dst, #8
+1:
+	ldrd	A_l, A_h, [src, #8]
+	strd	A_l, A_h, [dst, #8]
+	ldrd	A_l, A_h, [src, #16]
+	strd	A_l, A_h, [dst, #16]
+	ldrd	A_l, A_h, [src, #24]
+	strd	A_l, A_h, [dst, #24]
+	ldrd	A_l, A_h, [src, #32]
+	strd	A_l, A_h, [dst, #32]
+	ldrd	A_l, A_h, [src, #40]
+	strd	A_l, A_h, [dst, #40]
+	ldrd	A_l, A_h, [src, #48]
+	strd	A_l, A_h, [dst, #48]
+	ldrd	A_l, A_h, [src, #56]
+	strd	A_l, A_h, [dst, #56]
+	ldrd	A_l, A_h, [src, #64]!
+	strd	A_l, A_h, [dst, #64]!
+	subs	tmp2, tmp2, #64
+	bge	1b
+	tst	tmp2, #0x3f
+	bne	1f
+	ldr	tmp2,[sp], #FRAME_SIZE
+	bx	lr
+1:
+	add	src, src, #8
+	add	dst, dst, #8
+
+.Ltail63aligned:			/* Count in tmp2.  */
+	/* Copy up to 7 d-words of data.  Similar to Ltail63unaligned, but
+	   we know that the src and dest are 32-bit aligned so we can use
+	   LDRD/STRD to improve efficiency.  */
+	/* TMP2 is now negative, but we don't care about that.  The bottom
+	   six bits still tell us how many bytes are left to copy.  */
+
+	and	tmp1, tmp2, #0x38
+	add	dst, dst, tmp1
+	add	src, src, tmp1
+	rsb	tmp1, tmp1, #(56 - PC_OFFSET + INSN_SIZE)
+	add	pc, pc, tmp1
+	ldrd	A_l, A_h, [src, #-56]	/* 14 words to go.  */
+	strd	A_l, A_h, [dst, #-56]
+	ldrd	A_l, A_h, [src, #-48]	/* 12 words to go.  */
+	strd	A_l, A_h, [dst, #-48]
+	ldrd	A_l, A_h, [src, #-40]	/* 10 words to go.  */
+	strd	A_l, A_h, [dst, #-40]
+	ldrd	A_l, A_h, [src, #-32]	/* 8 words to go.  */
+	strd	A_l, A_h, [dst, #-32]
+	ldrd	A_l, A_h, [src, #-24]	/* 6 words to go.  */
+	strd	A_l, A_h, [dst, #-24]
+	ldrd	A_l, A_h, [src, #-16]	/* 4 words to go.  */
+	strd	A_l, A_h, [dst, #-16]
+	ldrd	A_l, A_h, [src, #-8]	/* 2 words to go.  */
+	strd	A_l, A_h, [dst, #-8]
+
+#endif
+	tst	tmp2, #4
+	ldrne	tmp1, [src], #4
+	strne	tmp1, [dst], #4
+	lsls	tmp2, tmp2, #31		/* Count (tmp2) now dead. */
+	ldrhcs	tmp1, [src], #2
+	ldrbne	tmp2, [src]
+	strhcs	tmp1, [dst], #2
+	strbne	tmp2, [dst]
+
+.Ldone:
+	ldr	tmp2, [sp], #FRAME_SIZE
+	bx	lr
+
+.Lcpy_body_long:			/* Count in tmp2.  */
+
+	/* Long copy.  We know that there's at least (prefetch_lines * 64)
+	   bytes to go.  */
+#ifdef USE_VFP
+	/* Don't use PLD.  Instead, read some data in advance of the current
+	   copy position into a register.  This should act like a PLD
+	   operation but we won't have to repeat the transfer.  */
+
+	vldr	d3, [src, #0]
+	vldr	d4, [src, #64]
+	vldr	d5, [src, #128]
+	vldr	d6, [src, #192]
+	vldr	d7, [src, #256]
+
+	vldr	d0, [src, #8]
+	vldr	d1, [src, #16]
+	vldr	d2, [src, #24]
+	add	src, src, #32
+
+	subs	tmp2, tmp2, #prefetch_lines * 64 * 2
+	blt	2f
+1:
+	cpy_line_vfp	d3, 0
+	cpy_line_vfp	d4, 64
+	cpy_line_vfp	d5, 128
+	add	dst, dst, #3 * 64
+	add	src, src, #3 * 64
+	cpy_line_vfp	d6, 0
+	cpy_line_vfp	d7, 64
+	add	dst, dst, #2 * 64
+	add	src, src, #2 * 64
+	subs	tmp2, tmp2, #prefetch_lines * 64
+	bge	1b
+
+2:
+	cpy_tail_vfp	d3, 0
+	cpy_tail_vfp	d4, 64
+	cpy_tail_vfp	d5, 128
+	add	src, src, #3 * 64
+	add	dst, dst, #3 * 64
+	cpy_tail_vfp	d6, 0
+	vstr	d7, [dst, #64]
+	vldr	d7, [src, #64]
+	vstr	d0, [dst, #64 + 8]
+	vldr	d0, [src, #64 + 8]
+	vstr	d1, [dst, #64 + 16]
+	vldr	d1, [src, #64 + 16]
+	vstr	d2, [dst, #64 + 24]
+	vldr	d2, [src, #64 + 24]
+	vstr	d7, [dst, #64 + 32]
+	add	src, src, #96
+	vstr	d0, [dst, #64 + 40]
+	vstr	d1, [dst, #64 + 48]
+	vstr	d2, [dst, #64 + 56]
+	add	dst, dst, #128
+	add	tmp2, tmp2, #prefetch_lines * 64
+	b	.Lcpy_body_medium
+#else
+	/* Long copy.  Use an SMS style loop to maximize the I/O
+	   bandwidth of the core.  We don't have enough spare registers
+	   to synthesise prefetching, so use PLD operations.  */
+	/* Pre-bias src and dst.  */
+	sub	src, src, #8
+	sub	dst, dst, #8
+	pld	[src, #8]
+	pld	[src, #72]
+	subs	tmp2, tmp2, #64
+	pld	[src, #136]
+	ldrd	A_l, A_h, [src, #8]
+	strd	B_l, B_h, [sp, #8]
+	ldrd	B_l, B_h, [src, #16]
+	strd	C_l, C_h, [sp, #16]
+	ldrd	C_l, C_h, [src, #24]
+	strd	D_l, D_h, [sp, #24]
+	pld	[src, #200]
+	ldrd	D_l, D_h, [src, #32]!
+	b	1f
+	.p2align	6
+2:
+	pld	[src, #232]
+	strd	A_l, A_h, [dst, #40]
+	ldrd	A_l, A_h, [src, #40]
+	strd	B_l, B_h, [dst, #48]
+	ldrd	B_l, B_h, [src, #48]
+	strd	C_l, C_h, [dst, #56]
+	ldrd	C_l, C_h, [src, #56]
+	strd	D_l, D_h, [dst, #64]!
+	ldrd	D_l, D_h, [src, #64]!
+	subs	tmp2, tmp2, #64
+1:
+	strd	A_l, A_h, [dst, #8]
+	ldrd	A_l, A_h, [src, #8]
+	strd	B_l, B_h, [dst, #16]
+	ldrd	B_l, B_h, [src, #16]
+	strd	C_l, C_h, [dst, #24]
+	ldrd	C_l, C_h, [src, #24]
+	strd	D_l, D_h, [dst, #32]
+	ldrd	D_l, D_h, [src, #32]
+	bcs	2b
+	/* Save the remaining bytes and restore the callee-saved regs.  */
+	strd	A_l, A_h, [dst, #40]
+	add	src, src, #40
+	strd	B_l, B_h, [dst, #48]
+	ldrd	B_l, B_h, [sp, #8]
+	strd	C_l, C_h, [dst, #56]
+	ldrd	C_l, C_h, [sp, #16]
+	strd	D_l, D_h, [dst, #64]
+	ldrd	D_l, D_h, [sp, #24]
+	add	dst, dst, #72
+	tst	tmp2, #0x3f
+	bne	.Ltail63aligned
+	ldr	tmp2, [sp], #FRAME_SIZE
+	bx	lr
+#endif
+
+.Lcpy_notaligned:
+	pld	[src]
+	pld	[src, #64]
+	/* There's at least 64 bytes to copy, but there is no mutual
+	   alignment.  */
+	/* Bring DST to 64-bit alignment.  */
+	lsls	tmp2, dst, #29
+	pld	[src, #(2 * 64)]
+	beq	1f
+	rsbs	tmp2, tmp2, #0
+	sub	count, count, tmp2, lsr #29
+	ldrmi	tmp1, [src], #4
+	strmi	tmp1, [dst], #4
+	lsls	tmp2, tmp2, #2
+	ldrbne	tmp1, [src], #1
+	ldrhcs	tmp2, [src], #2
+	strbne	tmp1, [dst], #1
+	strhcs	tmp2, [dst], #2
+1:
+	pld	[src, #(3 * 64)]
+	subs	count, count, #64
+	ldrmi	tmp2, [sp], #FRAME_SIZE
+	bmi	.Ltail63unaligned
+	pld	[src, #(4 * 64)]
+
+#ifdef USE_NEON
+	vld1.8	{d0-d3}, [src]!
+	vld1.8	{d4-d7}, [src]!
+	subs	count, count, #64
+	bmi	2f
+1:
+	pld	[src, #(4 * 64)]
+	vst1.8	{d0-d3}, [ALIGN (dst, 64)]!
+	vld1.8	{d0-d3}, [src]!
+	vst1.8	{d4-d7}, [ALIGN (dst, 64)]!
+	vld1.8	{d4-d7}, [src]!
+	subs	count, count, #64
+	bpl	1b
+2:
+	vst1.8	{d0-d3}, [ALIGN (dst, 64)]!
+	vst1.8	{d4-d7}, [ALIGN (dst, 64)]!
+	ands	count, count, #0x3f
+#else
+	/* Use an SMS style loop to maximize the I/O bandwidth.  */
+	sub	src, src, #4
+	sub	dst, dst, #8
+	subs	tmp2, count, #64	/* Use tmp2 for count.  */
+	ldr	A_l, [src, #4]
+	ldr	A_h, [src, #8]
+	strd	B_l, B_h, [sp, #8]
+	ldr	B_l, [src, #12]
+	ldr	B_h, [src, #16]
+	strd	C_l, C_h, [sp, #16]
+	ldr	C_l, [src, #20]
+	ldr	C_h, [src, #24]
+	strd	D_l, D_h, [sp, #24]
+	ldr	D_l, [src, #28]
+	ldr	D_h, [src, #32]!
+	b	1f
+	.p2align	6
+2:
+	pld	[src, #(5 * 64) - (32 - 4)]
+	strd	A_l, A_h, [dst, #40]
+	ldr	A_l, [src, #36]
+	ldr	A_h, [src, #40]
+	strd	B_l, B_h, [dst, #48]
+	ldr	B_l, [src, #44]
+	ldr	B_h, [src, #48]
+	strd	C_l, C_h, [dst, #56]
+	ldr	C_l, [src, #52]
+	ldr	C_h, [src, #56]
+	strd	D_l, D_h, [dst, #64]!
+	ldr	D_l, [src, #60]
+	ldr	D_h, [src, #64]!
+	subs	tmp2, tmp2, #64
+1:
+	strd	A_l, A_h, [dst, #8]
+	ldr	A_l, [src, #4]
+	ldr	A_h, [src, #8]
+	strd	B_l, B_h, [dst, #16]
+	ldr	B_l, [src, #12]
+	ldr	B_h, [src, #16]
+	strd	C_l, C_h, [dst, #24]
+	ldr	C_l, [src, #20]
+	ldr	C_h, [src, #24]
+	strd	D_l, D_h, [dst, #32]
+	ldr	D_l, [src, #28]
+	ldr	D_h, [src, #32]
+	bcs	2b
+
+	/* Save the remaining bytes and restore the callee-saved regs.  */
+	strd	A_l, A_h, [dst, #40]
+	add	src, src, #36
+	strd	B_l, B_h, [dst, #48]
+	ldrd	B_l, B_h, [sp, #8]
+	strd	C_l, C_h, [dst, #56]
+	ldrd	C_l, C_h, [sp, #16]
+	strd	D_l, D_h, [dst, #64]
+	ldrd	D_l, D_h, [sp, #24]
+	add	dst, dst, #72
+	ands	count, tmp2, #0x3f
+#endif
+	ldr	tmp2, [sp], #FRAME_SIZE
+	bne	.Ltail63unaligned
+	bx	lr
+
+	.size	memcpy, . - memcpy
+
--- a/libsupport_zynq/src/boot.rs
+++ b/libsupport_zynq/src/boot.rs
@ -2,9 +2,9 @@ use r0::zero_bss;
 use core::ptr::write_volatile;
 use libregister::{
    VolatileCell,
-    RegisterR, RegisterW, RegisterRW,
+    RegisterR, RegisterRW,
 };
-use libcortex_a9::{asm, regs::*, cache, mmu, spin_lock_yield, notify_spin_lock};
+use libcortex_a9::{asm, l2c, regs::*, cache, mmu, spin_lock_yield, notify_spin_lock, enable_fpu, interrupt_handler};
 use libboard_zynq::{slcr, mpcore};

 extern "C" {
@ -18,31 +18,27 @@ extern "C" {

 static mut CORE1_ENABLED: VolatileCell<bool> = VolatileCell::new(false);

-#[link_section = ".text.boot"]
-#[no_mangle]
-#[naked]
-pub unsafe extern "C" fn Reset() -> ! {
+interrupt_handler!(Reset, reset_irq, __stack0_start, __stack1_start, {
+    // no need to setup stack here, as we already did when entering the handler
    match MPIDR.read().cpu_id() {
        0 => {
-            SP.write(&mut __stack0_start as *mut _ as u32);
            boot_core0();
        }
        1 => {
            while !CORE1_ENABLED.get() {
                spin_lock_yield();
            }
-            SP.write(&mut __stack1_start as *mut _ as u32);
            boot_core1();
        }
        _ => unreachable!(),
    }
-}
+});

-#[naked]
 #[inline(never)]
-unsafe fn boot_core0() -> ! {
+unsafe extern "C" fn boot_core0() -> ! {
    l1_cache_init();

+    enable_fpu();
    let mpcore = mpcore::RegisterBlock::mpcore();
    mpcore.scu_invalidate.invalidate_all_cores();

@ -53,19 +49,20 @@ unsafe fn boot_core0() -> ! {
    mmu::with_mmu(mmu_table, || {
        mpcore.scu_control.start();
        ACTLR.enable_smp();
+        ACTLR.enable_prefetch();
        // TODO: Barriers reqd when core1 is not yet starting?
        asm::dmb();
        asm::dsb();

+        asm::enable_fiq();
        asm::enable_irq();
        main_core0();
        panic!("return from main");
    });
 }

-#[naked]
 #[inline(never)]
-unsafe fn boot_core1() -> ! {
+unsafe extern "C" fn boot_core1() -> ! {
    l1_cache_init();

    let mpcore = mpcore::RegisterBlock::mpcore();
@ -74,10 +71,12 @@ unsafe fn boot_core1() -> ! {
    let mmu_table = mmu::L1Table::get();
    mmu::with_mmu(mmu_table, || {
        ACTLR.enable_smp();
+        ACTLR.enable_prefetch();
        // TODO: Barriers reqd when core1 is not yet starting?
        asm::dmb();
        asm::dsb();

+        asm::enable_fiq();
        asm::enable_irq();
        main_core1();
        panic!("return from main_core1");
@ -101,7 +100,7 @@ fn l1_cache_init() {
    //       for all of the L1 data cache rather than a (previously
    //       unspecified) combination of one cache set and one cache
    //       way.
-    dciall();
+    dciall_l1();
 }

 pub struct Core1 {
@ -131,12 +130,13 @@ impl Core1 {
        unsafe {
            CORE1_ENABLED.set(true);
        }
-        // Ensure values have been written to cache
-        asm::dmb();
        // Flush cache-line
-        cache::dccmvac(unsafe { &CORE1_ENABLED } as *const _ as usize);
+        cache::dcc(unsafe { &CORE1_ENABLED });
        if sdram {
            cache::dccmvac(0);
+            asm::dsb();
+            l2c::l2_cache_clean(0);
+            l2c::l2_cache_sync();
        }

        // wake up core1
--- a/libsupport_zynq/src/exception_vectors.rs
+++ b/libsupport_zynq/src/exception_vectors.rs
@ -0,0 +1,54 @@
+use libregister::{RegisterR, RegisterW};
+use libcortex_a9::{regs::{DFSR, MPIDR, VBAR}, interrupt_handler};
+use libboard_zynq::{println, stdio}; 
+
+pub fn set_vector_table(base_addr: u32){
+    VBAR.write(base_addr);
+}
+
+interrupt_handler!(UndefinedInstruction, undefined_instruction, __irq_stack0_start, __irq_stack1_start, {
+    stdio::drop_uart();
+    println!("UndefinedInstruction");
+    loop {}
+});
+
+interrupt_handler!(SoftwareInterrupt, software_interrupt, __irq_stack0_start, __irq_stack1_start, {
+    stdio::drop_uart();
+    println!("SoftwareInterrupt");
+    loop {}
+});
+
+interrupt_handler!(PrefetchAbort, prefetch_abort, __irq_stack0_start, __irq_stack1_start, {
+    stdio::drop_uart();
+    println!("PrefetchAbort");
+    loop {}
+});
+
+interrupt_handler!(DataAbort, data_abort, __irq_stack0_start, __irq_stack1_start, {
+    stdio::drop_uart();
+
+    println!("DataAbort on core {}", MPIDR.read().cpu_id());
+    println!("DFSR: {:03X}", DFSR.read());
+
+    loop {}
+});
+
+interrupt_handler!(ReservedException, reserved_exception, __irq_stack0_start, __irq_stack1_start, {
+    stdio::drop_uart();
+    println!("ReservedException");
+    loop {}
+});
+
+#[cfg(feature = "dummy_irq_handler")]
+interrupt_handler!(IRQ, irq, __irq_stack0_start, __irq_stack1_start, {
+    stdio::drop_uart();
+    println!("IRQ");
+    loop {}
+});
+
+#[cfg(feature = "dummy_fiq_handler")]
+interrupt_handler!(FIQ, fiq, __irq_stack0_start, __irq_stack1_start, {
+    stdio::drop_uart();
+    println!("FIQ");
+    loop {}
+});
--- a/libsupport_zynq/src/lib.rs
+++ b/libsupport_zynq/src/lib.rs
@ -1,14 +1,16 @@
 #![no_std]

-#![feature(naked_functions)]
 #![feature(alloc_error_handler)]
 #![feature(panic_info_message)]
+#![feature(naked_functions)]
+#![feature(asm)]

 pub extern crate alloc;
 pub extern crate compiler_builtins;

 pub mod boot;
-mod abort;
+pub mod exception_vectors;
 #[cfg(feature = "panic_handler")]
 mod panic;
 pub mod ram;
+
--- a/libsupport_zynq/src/panic.rs
+++ b/libsupport_zynq/src/panic.rs
@ -1,4 +1,6 @@
 use libboard_zynq::{print, println};
+#[cfg(feature = "target_kasli_soc")]
+use libboard_zynq::error_led::ErrorLED;

 #[panic_handler]
 fn panic(info: &core::panic::PanicInfo) -> ! {
@ -13,6 +15,10 @@ fn panic(info: &core::panic::PanicInfo) -> ! {
    } else {
        println!("");
    }
-
+    #[cfg(feature = "target_kasli_soc")]
+    {
+        let mut err_led = ErrorLED::error_led();
+        err_led.toggle(true);
+    }
    loop {}
 }
--- a/libsupport_zynq/src/ram.rs
+++ b/libsupport_zynq/src/ram.rs
@ -34,7 +34,10 @@ unsafe impl GlobalAlloc for CortexA9Alloc {
    }

    unsafe fn dealloc(&self, ptr: *mut u8, layout: Layout) {
-        if cfg!(not(feature = "alloc_core")) || MPIDR.read().cpu_id() == 0 {
+        if cfg!(not(feature = "alloc_core"))
+            || ((&__heap0_start as *const usize as usize <= ptr as usize)
+                && ((ptr as usize) < &__heap0_end as *const usize as usize))
+        {
            &self.0
        } else {
            &self.1
--- a/llvm/11/clang/default.nix
+++ b/llvm/11/clang/default.nix
@ -0,0 +1,138 @@
+{ lib, stdenv, llvm_meta, fetch, fetchpatch, substituteAll, cmake, libxml2, libllvm, version, clang-tools-extra_src, python3
+, buildLlvmTools
+, fixDarwinDylibNames
+, enableManpages ? false
+, enablePolly ? false
+}:
+
+let
+  self = stdenv.mkDerivation ({
+    pname = "clang";
+    inherit version;
+
+    src = fetch "clang" "12sm91qx2m79cvj75a9aazf2x8xybjbd593dv6v7rxficpq8i0ha";
+    inherit clang-tools-extra_src;
+
+    unpackPhase = ''
+      unpackFile $src
+      mv clang-* clang
+      sourceRoot=$PWD/clang
+      unpackFile ${clang-tools-extra_src}
+      mv clang-tools-extra-* $sourceRoot/tools/extra
+    '';
+
+    nativeBuildInputs = [ cmake python3 ]
+      ++ lib.optional enableManpages python3.pkgs.sphinx
+      ++ lib.optional stdenv.hostPlatform.isDarwin fixDarwinDylibNames;
+
+    buildInputs = [ libxml2 libllvm ];
+
+    cmakeFlags = [
+      "-DCLANGD_BUILD_XPC=OFF"
+      "-DLLVM_ENABLE_RTTI=ON"
+    ] ++ lib.optionals enableManpages [
+      "-DCLANG_INCLUDE_DOCS=ON"
+      "-DLLVM_ENABLE_SPHINX=ON"
+      "-DSPHINX_OUTPUT_MAN=ON"
+      "-DSPHINX_OUTPUT_HTML=OFF"
+      "-DSPHINX_WARNINGS_AS_ERRORS=OFF"
+    ] ++ lib.optionals (stdenv.hostPlatform != stdenv.buildPlatform) [
+      "-DLLVM_TABLEGEN_EXE=${buildLlvmTools.llvm}/bin/llvm-tblgen"
+      "-DCLANG_TABLEGEN=${buildLlvmTools.libclang.dev}/bin/clang-tblgen"
+    ] ++ lib.optionals enablePolly [
+      "-DWITH_POLLY=ON"
+      "-DLINK_POLLY_INTO_TOOLS=ON"
+    ];
+
+
+    patches = [
+      ./purity.patch
+      # https://reviews.llvm.org/D51899
+      ./gnu-install-dirs.patch
+      (substituteAll {
+        src = ../../clang-11-12-LLVMgold-path.patch;
+        libllvmLibdir = "${libllvm.lib}/lib";
+      })
+    ];
+
+    postPatch = ''
+      sed -i -e 's/DriverArgs.hasArg(options::OPT_nostdlibinc)/true/' \
+             -e 's/Args.hasArg(options::OPT_nostdlibinc)/true/' \
+             lib/Driver/ToolChains/*.cpp
+    '' + lib.optionalString stdenv.hostPlatform.isMusl ''
+      sed -i -e 's/lgcc_s/lgcc_eh/' lib/Driver/ToolChains/*.cpp
+    '' + lib.optionalString stdenv.hostPlatform.isDarwin ''
+      substituteInPlace tools/extra/clangd/CMakeLists.txt \
+        --replace "NOT HAVE_CXX_ATOMICS64_WITHOUT_LIB" FALSE
+    '';
+
+    outputs = [ "out" "lib" "dev" "python" ];
+
+    postInstall = ''
+      ln -sv $out/bin/clang $out/bin/cpp
+
+      # Move libclang to 'lib' output
+      moveToOutput "lib/libclang.*" "$lib"
+      moveToOutput "lib/libclang-cpp.*" "$lib"
+      substituteInPlace $out/lib/cmake/clang/ClangTargets-release.cmake \
+          --replace "\''${_IMPORT_PREFIX}/lib/libclang." "$lib/lib/libclang." \
+          --replace "\''${_IMPORT_PREFIX}/lib/libclang-cpp." "$lib/lib/libclang-cpp."
+
+      mkdir -p $python/bin $python/share/{clang,scan-view}
+      mv $out/bin/{git-clang-format,scan-view} $python/bin
+      if [ -e $out/bin/set-xcode-analyzer ]; then
+        mv $out/bin/set-xcode-analyzer $python/bin
+      fi
+      mv $out/share/clang/*.py $python/share/clang
+      mv $out/share/scan-view/*.py $python/share/scan-view
+      rm $out/bin/c-index-test
+      patchShebangs $python/bin
+
+      mkdir -p $dev/bin
+      cp bin/clang-tblgen $dev/bin
+    '';
+
+    passthru = {
+      inherit libllvm;
+      isClang = true;
+      hardeningUnsupportedFlags = [ "fortify3" ];
+    };
+
+    meta = llvm_meta // {
+      homepage = "https://clang.llvm.org/";
+      description = "A C language family frontend for LLVM";
+      longDescription = ''
+        The Clang project provides a language front-end and tooling
+        infrastructure for languages in the C language family (C, C++, Objective
+        C/C++, OpenCL, CUDA, and RenderScript) for the LLVM project.
+        It aims to deliver amazingly fast compiles, extremely useful error and
+        warning messages and to provide a platform for building great source
+        level tools. The Clang Static Analyzer and clang-tidy are tools that
+        automatically find bugs in your code, and are great examples of the sort
+        of tools that can be built using the Clang frontend as a library to
+        parse C/C++ code.
+      '';
+      mainProgram = "clang";
+    };
+  } // lib.optionalAttrs enableManpages {
+    pname = "clang-manpages";
+
+    buildPhase = ''
+      make docs-clang-man
+    '';
+
+    installPhase = ''
+      mkdir -p $out/share/man/man1
+      # Manually install clang manpage
+      cp docs/man/*.1 $out/share/man/man1/
+    '';
+
+    outputs = [ "out" ];
+
+    doCheck = false;
+
+    meta = llvm_meta // {
+      description = "man page for Clang ${version}";
+    };
+  });
+in self
--- a/llvm/11/clang/gnu-install-dirs.patch
+++ b/llvm/11/clang/gnu-install-dirs.patch
@ -0,0 +1,235 @@
+diff --git a/CMakeLists.txt b/CMakeLists.txt
+index bb4b801f01c8..77a8b43b22c8 100644
+--- a/CMakeLists.txt
+++ b/CMakeLists.txt
+@@ -9,6 +9,8 @@ endif()
+ if( CMAKE_SOURCE_DIR STREQUAL CMAKE_CURRENT_SOURCE_DIR )
+   project(Clang)
+ 
+  include(GNUInstallDirs)
+
+   set(CMAKE_CXX_STANDARD 14 CACHE STRING "C++ standard to conform to")
+   set(CMAKE_CXX_STANDARD_REQUIRED YES)
+   set(CMAKE_CXX_EXTENSIONS NO)
+@@ -447,7 +449,7 @@ include_directories(BEFORE
+ 
+ if (NOT LLVM_INSTALL_TOOLCHAIN_ONLY)
+   install(DIRECTORY include/clang include/clang-c
+-    DESTINATION include
+    DESTINATION ${CMAKE_INSTALL_INCLUDEDIR}
+     COMPONENT clang-headers
+     FILES_MATCHING
+     PATTERN "*.def"
+@@ -457,7 +459,7 @@ if (NOT LLVM_INSTALL_TOOLCHAIN_ONLY)
+     )
+ 
+   install(DIRECTORY ${CMAKE_CURRENT_BINARY_DIR}/include/clang
+-    DESTINATION include
+    DESTINATION ${CMAKE_INSTALL_INCLUDEDIR}
+     COMPONENT clang-headers
+     FILES_MATCHING
+     PATTERN "CMakeFiles" EXCLUDE
+@@ -477,7 +479,7 @@ if (NOT LLVM_INSTALL_TOOLCHAIN_ONLY)
+ 
+   add_custom_target(bash-autocomplete DEPENDS utils/bash-autocomplete.sh)
+   install(PROGRAMS utils/bash-autocomplete.sh
+-          DESTINATION share/clang
+          DESTINATION ${CMAKE_INSTALL_DATADIR}/clang
+           COMPONENT bash-autocomplete)
+   if(NOT LLVM_ENABLE_IDE)
+     add_llvm_install_targets(install-bash-autocomplete
+diff --git a/cmake/modules/AddClang.cmake b/cmake/modules/AddClang.cmake
+index 704278a0e93b..d25c8d325c71 100644
+--- a/cmake/modules/AddClang.cmake
+++ b/cmake/modules/AddClang.cmake
+@@ -123,9 +123,9 @@ macro(add_clang_library name)
+         install(TARGETS ${lib}
+           COMPONENT ${lib}
+           ${export_to_clangtargets}
+-          LIBRARY DESTINATION lib${LLVM_LIBDIR_SUFFIX}
+-          ARCHIVE DESTINATION lib${LLVM_LIBDIR_SUFFIX}
+-          RUNTIME DESTINATION bin)
+          LIBRARY DESTINATION ${CMAKE_INSTALL_LIBDIR}${LLVM_LIBDIR_SUFFIX}
+          ARCHIVE DESTINATION ${CMAKE_INSTALL_LIBDIR}${LLVM_LIBDIR_SUFFIX}
+          RUNTIME DESTINATION ${CMAKE_INSTALL_BINDIR})
+ 
+         if (NOT LLVM_ENABLE_IDE)
+           add_llvm_install_targets(install-${lib}
+@@ -170,7 +170,7 @@ macro(add_clang_tool name)
+ 
+     install(TARGETS ${name}
+       ${export_to_clangtargets}
+-      RUNTIME DESTINATION bin
+      RUNTIME DESTINATION ${CMAKE_INSTALL_BINDIR}
+       COMPONENT ${name})
+ 
+     if(NOT LLVM_ENABLE_IDE)
+@@ -185,7 +185,7 @@ endmacro()
+ macro(add_clang_symlink name dest)
+   add_llvm_tool_symlink(${name} ${dest} ALWAYS_GENERATE)
+   # Always generate install targets
+-  llvm_install_symlink(${name} ${dest} ALWAYS_GENERATE)
+  llvm_install_symlink(${name} ${dest} ${CMAKE_INSTALL_FULL_BINDIR} ALWAYS_GENERATE)
+ endmacro()
+ 
+ function(clang_target_link_libraries target type)
+diff --git a/lib/Headers/CMakeLists.txt b/lib/Headers/CMakeLists.txt
+index 0692fe75a441..6f201e7207d0 100644
+--- a/lib/Headers/CMakeLists.txt
+++ b/lib/Headers/CMakeLists.txt
+@@ -208,7 +208,7 @@ set_target_properties(clang-resource-headers PROPERTIES
+   FOLDER "Misc"
+   RUNTIME_OUTPUT_DIRECTORY "${output_dir}")
+ 
+-set(header_install_dir lib${LLVM_LIBDIR_SUFFIX}/clang/${CLANG_VERSION}/include)
+set(header_install_dir ${CMAKE_INSTALL_LIBDIR}${LLVM_LIBDIR_SUFFIX}/clang/${CLANG_VERSION}/include)
+ 
+ install(
+   FILES ${files} ${generated_files}
+diff --git a/tools/c-index-test/CMakeLists.txt b/tools/c-index-test/CMakeLists.txt
+index ceef4b08637c..8efad5520ca4 100644
+--- a/tools/c-index-test/CMakeLists.txt
+++ b/tools/c-index-test/CMakeLists.txt
+@@ -54,7 +54,7 @@ if (NOT LLVM_INSTALL_TOOLCHAIN_ONLY)
+     set_property(TARGET c-index-test APPEND PROPERTY INSTALL_RPATH
+        "@executable_path/../../lib")
+   else()
+-    set(INSTALL_DESTINATION bin)
+    set(INSTALL_DESTINATION ${CMAKE_INSTALL_BINDIR})
+   endif()
+ 
+   install(TARGETS c-index-test
+diff --git a/tools/clang-format/CMakeLists.txt b/tools/clang-format/CMakeLists.txt
+index 35ecdb11253c..d77d75de0094 100644
+--- a/tools/clang-format/CMakeLists.txt
+++ b/tools/clang-format/CMakeLists.txt
+@@ -21,20 +21,20 @@ if( LLVM_LIB_FUZZING_ENGINE OR LLVM_USE_SANITIZE_COVERAGE )
+ endif()
+ 
+ install(PROGRAMS clang-format-bbedit.applescript
+-  DESTINATION share/clang
+  DESTINATION ${CMAKE_INSTALL_DATADIR}/clang
+   COMPONENT clang-format)
+ install(PROGRAMS clang-format-diff.py
+-  DESTINATION share/clang
+  DESTINATION ${CMAKE_INSTALL_DATADIR}/clang
+   COMPONENT clang-format)
+ install(PROGRAMS clang-format-sublime.py
+-  DESTINATION share/clang
+  DESTINATION ${CMAKE_INSTALL_DATADIR}/clang
+   COMPONENT clang-format)
+ install(PROGRAMS clang-format.el
+-  DESTINATION share/clang
+  DESTINATION ${CMAKE_INSTALL_DATADIR}/clang
+   COMPONENT clang-format)
+ install(PROGRAMS clang-format.py
+-  DESTINATION share/clang
+  DESTINATION ${CMAKE_INSTALL_DATADIR}/clang
+   COMPONENT clang-format)
+ install(PROGRAMS git-clang-format
+-  DESTINATION bin
+  DESTINATION ${CMAKE_INSTALL_BINDIR}
+   COMPONENT clang-format)
+diff --git a/tools/clang-rename/CMakeLists.txt b/tools/clang-rename/CMakeLists.txt
+index cda8e29ec5b1..0134d8ccd70b 100644
+--- a/tools/clang-rename/CMakeLists.txt
+++ b/tools/clang-rename/CMakeLists.txt
+@@ -19,8 +19,8 @@ clang_target_link_libraries(clang-rename
+   )
+ 
+ install(PROGRAMS clang-rename.py
+-  DESTINATION share/clang
+  DESTINATION ${CMAKE_INSTALL_DATADIR}/clang
+   COMPONENT clang-rename)
+ install(PROGRAMS clang-rename.el
+-  DESTINATION share/clang
+  DESTINATION ${CMAKE_INSTALL_DATADIR}/clang
+   COMPONENT clang-rename)
+diff --git a/tools/libclang/CMakeLists.txt b/tools/libclang/CMakeLists.txt
+index 5cd9ac5cddc1..a197676fedbd 100644
+--- a/tools/libclang/CMakeLists.txt
+++ b/tools/libclang/CMakeLists.txt
+@@ -165,7 +165,7 @@ endif()
+ if(INTERNAL_INSTALL_PREFIX)
+   set(LIBCLANG_HEADERS_INSTALL_DESTINATION "${INTERNAL_INSTALL_PREFIX}/include")
+ else()
+-  set(LIBCLANG_HEADERS_INSTALL_DESTINATION include)
+  set(LIBCLANG_HEADERS_INSTALL_DESTINATION ${CMAKE_INSTALL_INCLUDEDIR})
+ endif()
+ 
+ install(DIRECTORY ../../include/clang-c
+@@ -196,7 +196,7 @@ foreach(PythonVersion ${CLANG_PYTHON_BINDINGS_VERSIONS})
+           COMPONENT
+             libclang-python-bindings
+           DESTINATION
+-            "lib${LLVM_LIBDIR_SUFFIX}/python${PythonVersion}/site-packages")
+            "${CMAKE_INSTALL_LIBDIR}${LLVM_LIBDIR_SUFFIX}/python${PythonVersion}/site-packages")
+ endforeach()
+ if(NOT LLVM_ENABLE_IDE)
+   add_custom_target(libclang-python-bindings)
+diff --git a/tools/scan-build/CMakeLists.txt b/tools/scan-build/CMakeLists.txt
+index ec0702d76f18..d25d982f51da 100644
+--- a/tools/scan-build/CMakeLists.txt
+++ b/tools/scan-build/CMakeLists.txt
+@@ -47,7 +47,7 @@ if(CLANG_INSTALL_SCANBUILD)
+                        DEPENDS ${CMAKE_CURRENT_SOURCE_DIR}/bin/${BinFile})
+     list(APPEND Depends ${CMAKE_BINARY_DIR}/bin/${BinFile})
+     install(PROGRAMS bin/${BinFile}
+-            DESTINATION bin
+            DESTINATION ${CMAKE_INSTALL_BINDIR}
+             COMPONENT scan-build)
+   endforeach()
+ 
+@@ -61,7 +61,7 @@ if(CLANG_INSTALL_SCANBUILD)
+                        DEPENDS ${CMAKE_CURRENT_SOURCE_DIR}/libexec/${LibexecFile})
+     list(APPEND Depends ${CMAKE_BINARY_DIR}/libexec/${LibexecFile})
+     install(PROGRAMS libexec/${LibexecFile}
+-            DESTINATION libexec
+            DESTINATION ${CMAKE_INSTALL_LIBEXECDIR}
+             COMPONENT scan-build)
+   endforeach()
+ 
+@@ -89,7 +89,7 @@ if(CLANG_INSTALL_SCANBUILD)
+                        DEPENDS ${CMAKE_CURRENT_SOURCE_DIR}/share/scan-build/${ShareFile})
+     list(APPEND Depends ${CMAKE_BINARY_DIR}/share/scan-build/${ShareFile})
+     install(FILES share/scan-build/${ShareFile}
+-            DESTINATION share/scan-build
+            DESTINATION ${CMAKE_INSTALL_DATADIR}/scan-build
+             COMPONENT scan-build)
+   endforeach()
+ 
+diff --git a/tools/scan-view/CMakeLists.txt b/tools/scan-view/CMakeLists.txt
+index 22edb974bac7..9f140a9a4538 100644
+--- a/tools/scan-view/CMakeLists.txt
+++ b/tools/scan-view/CMakeLists.txt
+@@ -22,7 +22,7 @@ if(CLANG_INSTALL_SCANVIEW)
+                        DEPENDS ${CMAKE_CURRENT_SOURCE_DIR}/bin/${BinFile})
+     list(APPEND Depends ${CMAKE_BINARY_DIR}/bin/${BinFile})
+     install(PROGRAMS bin/${BinFile}
+-            DESTINATION bin
+            DESTINATION ${CMAKE_INSTALL_BINDIR}
+             COMPONENT scan-view)
+   endforeach()
+ 
+@@ -36,7 +36,7 @@ if(CLANG_INSTALL_SCANVIEW)
+                        DEPENDS ${CMAKE_CURRENT_SOURCE_DIR}/share/${ShareFile})
+     list(APPEND Depends ${CMAKE_BINARY_DIR}/share/scan-view/${ShareFile})
+     install(FILES share/${ShareFile}
+-            DESTINATION share/scan-view
+            DESTINATION ${CMAKE_INSTALL_DATADIR}/scan-view
+             COMPONENT scan-view)
+   endforeach()
+ 
+diff --git a/utils/hmaptool/CMakeLists.txt b/utils/hmaptool/CMakeLists.txt
+index 62f2de0cb15c..6aa66825b6ec 100644
+--- a/utils/hmaptool/CMakeLists.txt
+++ b/utils/hmaptool/CMakeLists.txt
+@@ -10,7 +10,7 @@ add_custom_command(OUTPUT ${CMAKE_BINARY_DIR}/${CMAKE_CFG_INTDIR}/bin/${CLANG_HM
+ 
+ list(APPEND Depends ${CMAKE_BINARY_DIR}/${CMAKE_CFG_INTDIR}/bin/${CLANG_HMAPTOOL})
+ install(PROGRAMS ${CLANG_HMAPTOOL}
+-        DESTINATION bin
+        DESTINATION ${CMAKE_INSTALL_BINDIR}
+         COMPONENT hmaptool)
+ 
+ add_custom_target(hmaptool ALL DEPENDS ${Depends})
--- a/llvm/11/clang/purity.patch
+++ b/llvm/11/clang/purity.patch
@ -0,0 +1,28 @@
+From 4add81bba40dcec62c4ea4481be8e35ac53e89d8 Mon Sep 17 00:00:00 2001
+From: Will Dietz <w@wdtz.org>
+Date: Thu, 18 May 2017 11:56:12 -0500
+Subject: [PATCH] "purity" patch for 5.0
+
+---
+ lib/Driver/ToolChains/Gnu.cpp | 7 -------
+ 1 file changed, 7 deletions(-)
+
+diff --git a/lib/Driver/ToolChains/Gnu.cpp b/lib/Driver/ToolChains/Gnu.cpp
+index fe3c0191bb..c6a482bece 100644
+--- a/lib/Driver/ToolChains/Gnu.cpp
+++ b/lib/Driver/ToolChains/Gnu.cpp
+@@ -487,12 +487,6 @@ void tools::gnutools::Linker::ConstructJob(Compilation &C, const JobAction &JA,
+   if (!IsStatic) {
+     if (Args.hasArg(options::OPT_rdynamic))
+       CmdArgs.push_back("-export-dynamic");
+-
+-    if (!Args.hasArg(options::OPT_shared) && !IsStaticPIE) {
+-      CmdArgs.push_back("-dynamic-linker");
+-      CmdArgs.push_back(Args.MakeArgString(Twine(D.DyldPrefix) +
+-                                           ToolChain.getDynamicLinker(Args)));
+-    }
+   }
+ 
+   CmdArgs.push_back("-o");
+-- 
+2.11.0
--- a/llvm/11/default.nix
+++ b/llvm/11/default.nix
@ -0,0 +1,296 @@
+{ lowPrio, newScope, pkgs, lib, stdenv, cmake
+, gccForLibs, preLibcCrossHeaders
+, libxml2, python3, isl, fetchurl, overrideCC, wrapCCWith, wrapBintoolsWith
+, buildLlvmTools # tools, but from the previous stage, for cross
+, targetLlvmLibraries # libraries, but from the next stage, for cross
+, targetLlvm
+# This is the default binutils, but with *this* version of LLD rather
+# than the default LLVM version's, if LLD is the choice. We use these for
+# the `useLLVM` bootstrapping below.
+, bootBintoolsNoLibc ?
+    if stdenv.targetPlatform.linker == "lld"
+    then null
+    else pkgs.bintoolsNoLibc
+, bootBintools ?
+    if stdenv.targetPlatform.linker == "lld"
+    then null
+    else pkgs.bintools
+}:
+
+let
+  release_version = "11.1.0";
+  candidate = ""; # empty or "rcN"
+  dash-candidate = lib.optionalString (candidate != "") "-${candidate}";
+  version = "${release_version}${dash-candidate}"; # differentiating these (variables) is important for RCs
+  targetConfig = stdenv.targetPlatform.config;
+
+  fetch = name: sha256: fetchurl {
+    url = "https://github.com/llvm/llvm-project/releases/download/llvmorg-${version}/${name}-${release_version}${candidate}.src.tar.xz";
+    inherit sha256;
+  };
+
+  clang-tools-extra_src = fetch "clang-tools-extra" "18n1w1hkv931xzq02b34wglbv6zd6sd0r5kb8piwvag7klj7qw3n";
+
+  llvm_meta = {
+    license     = lib.licenses.ncsa;
+
+    # See llvm/cmake/config-ix.cmake.
+    platforms   =
+      lib.platforms.aarch64 ++
+      lib.platforms.arm ++
+      lib.platforms.mips ++
+      lib.platforms.riscv ++
+      lib.platforms.wasi ++
+      lib.platforms.x86;
+  };
+
+  tools = lib.makeExtensible (tools: let
+    callPackage = newScope (tools // { inherit stdenv cmake libxml2 python3 isl release_version version fetch buildLlvmTools; });
+    mkExtraBuildCommands0 = cc: ''
+      rsrc="$out/resource-root"
+      mkdir "$rsrc"
+      ln -s "${cc.lib}/lib/clang/${release_version}/include" "$rsrc"
+      echo "-resource-dir=$rsrc" >> $out/nix-support/cc-cflags
+    '';
+    mkExtraBuildCommands = cc: mkExtraBuildCommands0 cc + ''
+      ln -s "${targetLlvmLibraries.compiler-rt.out}/lib" "$rsrc/lib"
+      ln -s "${targetLlvmLibraries.compiler-rt.out}/share" "$rsrc/share"
+    '';
+
+  bintoolsNoLibc' =
+    if bootBintoolsNoLibc == null
+    then tools.bintoolsNoLibc
+    else bootBintoolsNoLibc;
+  bintools' =
+    if bootBintools == null
+    then tools.bintools
+    else bootBintools;
+
+  in {
+
+    libllvm = callPackage ./llvm {
+      inherit llvm_meta;
+    };
+
+    # `llvm` historically had the binaries.  When choosing an output explicitly,
+    # we need to reintroduce `outputSpecified` to get the expected behavior e.g. of lib.get*
+    llvm = tools.libllvm;
+
+    libllvm-polly = callPackage ./llvm {
+      inherit llvm_meta;
+      enablePolly = true;
+    };
+
+    llvm-polly = tools.libllvm-polly.lib // { outputSpecified = false; };
+
+    libclang = callPackage ./clang {
+      inherit clang-tools-extra_src llvm_meta;
+    };
+
+    clang-unwrapped = tools.libclang;
+
+    clang-polly-unwrapped = callPackage ./clang {
+      inherit llvm_meta;
+      inherit clang-tools-extra_src;
+      libllvm = tools.libllvm-polly;
+      enablePolly = true;
+    };
+
+    llvm-manpages = lowPrio (tools.libllvm.override {
+      enableManpages = true;
+      python3 = pkgs.python3;  # don't use python-boot
+    });
+
+    clang-manpages = lowPrio (tools.libclang.override {
+      enableManpages = true;
+      python3 = pkgs.python3;  # don't use python-boot
+    });
+
+    # disabled until recommonmark supports sphinx 3
+    # lldb-manpages = lowPrio (tools.lldb.override {
+    #   enableManpages = true;
+    #   python3 = pkgs.python3;  # don't use python-boot
+    # });
+
+    # pick clang appropriate for package set we are targeting
+    clang =
+      /**/ if stdenv.targetPlatform.libc == null then tools.clangNoLibc
+      else if stdenv.targetPlatform.useLLVM or false then tools.clangUseLLVM
+      else if (pkgs.targetPackages.stdenv or stdenv).cc.isGNU then tools.libstdcxxClang
+      else tools.libcxxClang;
+
+    libstdcxxClang = wrapCCWith rec {
+      cc = tools.clang-unwrapped;
+      # libstdcxx is taken from gcc in an ad-hoc way in cc-wrapper.
+      libcxx = null;
+      extraPackages = [
+        targetLlvmLibraries.compiler-rt
+      ];
+      extraBuildCommands = mkExtraBuildCommands cc;
+    };
+
+    libcxxClang = wrapCCWith rec {
+      cc = tools.clang-unwrapped;
+      libcxx = targetLlvmLibraries.libcxx;
+      extraPackages = [
+        libcxx.cxxabi
+        targetLlvmLibraries.compiler-rt
+      ];
+      extraBuildCommands = mkExtraBuildCommands cc;
+    };
+
+    lld = callPackage ./lld {
+      inherit llvm_meta;
+    };
+
+    lldb = callPackage ../common/lldb.nix {
+      src = fetch "lldb" "1vlyg015dyng43xqb8cg2l6r9ix8klibxsajazbfnckdnh54hwxj";
+      patches = [
+        ./lldb/procfs.patch
+        ./lldb/gnu-install-dirs.patch
+      ];
+      inherit llvm_meta;
+    };
+
+    # Below, is the LLVM bootstrapping logic. It handles building a
+    # fully LLVM toolchain from scratch. No GCC toolchain should be
+    # pulled in. As a consequence, it is very quick to build different
+    # targets provided by LLVM and we can also build for what GCC
+    # doesn’t support like LLVM. Probably we should move to some other
+    # file.
+
+    bintools-unwrapped = callPackage ../common/bintools.nix { };
+
+    bintoolsNoLibc = wrapBintoolsWith {
+      bintools = tools.bintools-unwrapped;
+      libc = preLibcCrossHeaders;
+    };
+
+    bintools = wrapBintoolsWith {
+      bintools = tools.bintools-unwrapped;
+    };
+
+    clangUseLLVM = wrapCCWith rec {
+      cc = tools.clang-unwrapped;
+      libcxx = targetLlvmLibraries.libcxx;
+      bintools = bintools';
+      extraPackages = [
+        libcxx.cxxabi
+        targetLlvmLibraries.compiler-rt
+      ] ++ lib.optionals (!stdenv.targetPlatform.isWasm) [
+        targetLlvmLibraries.libunwind
+      ];
+      extraBuildCommands = ''
+        echo "-rtlib=compiler-rt -Wno-unused-command-line-argument" >> $out/nix-support/cc-cflags
+        echo "-B${targetLlvmLibraries.compiler-rt}/lib" >> $out/nix-support/cc-cflags
+      '' + lib.optionalString (!stdenv.targetPlatform.isWasm) ''
+        echo "--unwindlib=libunwind" >> $out/nix-support/cc-cflags
+      '' + lib.optionalString (!stdenv.targetPlatform.isWasm && stdenv.targetPlatform.useLLVM or false) ''
+        echo "-lunwind" >> $out/nix-support/cc-ldflags
+      '' + lib.optionalString stdenv.targetPlatform.isWasm ''
+        echo "-fno-exceptions" >> $out/nix-support/cc-cflags
+      '' + mkExtraBuildCommands cc;
+    };
+
+    clangNoLibcxx = wrapCCWith rec {
+      cc = tools.clang-unwrapped;
+      libcxx = null;
+      bintools = bintools';
+      extraPackages = [
+        targetLlvmLibraries.compiler-rt
+      ];
+      extraBuildCommands = ''
+        echo "-rtlib=compiler-rt" >> $out/nix-support/cc-cflags
+        echo "-B${targetLlvmLibraries.compiler-rt}/lib" >> $out/nix-support/cc-cflags
+        echo "-nostdlib++" >> $out/nix-support/cc-cflags
+      '' + mkExtraBuildCommands cc;
+    };
+
+    clangNoLibc = wrapCCWith rec {
+      cc = tools.clang-unwrapped;
+      libcxx = null;
+      bintools = bintoolsNoLibc';
+      extraPackages = [
+        targetLlvmLibraries.compiler-rt
+      ];
+      extraBuildCommands = ''
+        echo "-rtlib=compiler-rt" >> $out/nix-support/cc-cflags
+        echo "-B${targetLlvmLibraries.compiler-rt}/lib" >> $out/nix-support/cc-cflags
+      '' + mkExtraBuildCommands cc;
+    };
+
+    clangNoCompilerRt = wrapCCWith rec {
+      cc = tools.clang-unwrapped;
+      libcxx = null;
+      bintools = bintoolsNoLibc';
+      extraPackages = [ ];
+      extraBuildCommands = ''
+        echo "-nostartfiles" >> $out/nix-support/cc-cflags
+      '' + mkExtraBuildCommands0 cc;
+    };
+
+    clangNoCompilerRtWithLibc = wrapCCWith rec {
+      cc = tools.clang-unwrapped;
+      libcxx = null;
+      bintools = bintools';
+      extraPackages = [ ];
+      extraBuildCommands = mkExtraBuildCommands0 cc;
+    };
+
+  });
+
+  libraries = lib.makeExtensible (libraries: let
+    callPackage = newScope (libraries // buildLlvmTools // { inherit stdenv cmake libxml2 python3 isl release_version version fetch; });
+  in {
+
+    compiler-rt-libc = callPackage ./compiler-rt {
+      inherit llvm_meta;
+      stdenv = if (stdenv.hostPlatform.useLLVM or false) || (stdenv.hostPlatform.isDarwin && stdenv.hostPlatform.isAarch64) || (stdenv.hostPlatform.isRiscV && stdenv.hostPlatform.is32bit)
+               then overrideCC stdenv buildLlvmTools.clangNoCompilerRtWithLibc
+               else stdenv;
+    };
+
+    compiler-rt-no-libc = callPackage ./compiler-rt {
+      inherit llvm_meta;
+      stdenv = if (stdenv.hostPlatform.useLLVM or false) || (stdenv.hostPlatform.isDarwin && stdenv.hostPlatform.isAarch64)
+               then overrideCC stdenv buildLlvmTools.clangNoCompilerRt
+               else stdenv;
+    };
+
+    # N.B. condition is safe because without useLLVM both are the same.
+    compiler-rt = if stdenv.hostPlatform.isAndroid || (stdenv.hostPlatform.isDarwin && stdenv.hostPlatform.isAarch64) || (stdenv.hostPlatform.libc == "newlib")
+      then libraries.compiler-rt-libc
+      else libraries.compiler-rt-no-libc;
+
+    stdenv = overrideCC stdenv buildLlvmTools.clang;
+
+    libcxxStdenv = overrideCC stdenv buildLlvmTools.libcxxClang;
+
+    libcxx = callPackage ./libcxx {
+      inherit llvm_meta;
+      stdenv = if (stdenv.hostPlatform.useLLVM or false) || (stdenv.hostPlatform.isDarwin && stdenv.hostPlatform.isAarch64)
+               then overrideCC stdenv buildLlvmTools.clangNoLibcxx
+               else stdenv;
+    };
+
+    libcxxabi = callPackage ./libcxxabi {
+      inherit llvm_meta;
+      stdenv = if (stdenv.hostPlatform.useLLVM or false) || (stdenv.hostPlatform.isDarwin && stdenv.hostPlatform.isAarch64)
+               then overrideCC stdenv buildLlvmTools.clangNoLibcxx
+               else stdenv;
+    };
+
+    libunwind = callPackage ./libunwind {
+      inherit llvm_meta;
+      stdenv = if (stdenv.hostPlatform.useLLVM or false) || (stdenv.hostPlatform.isDarwin && stdenv.hostPlatform.isAarch64)
+               then overrideCC stdenv buildLlvmTools.clangNoLibcxx
+               else stdenv;
+    };
+
+    openmp = callPackage ./openmp {
+      inherit llvm_meta targetLlvm;
+    };
+  });
+  noExtend = extensible: builtins.removeAttrs extensible [ "extend" ];
+
+in { inherit tools libraries release_version; } // (noExtend libraries) // (noExtend tools)
--- a/llvm/11/llvm/default.nix
+++ b/llvm/11/llvm/default.nix
@ -0,0 +1,363 @@
+{ lib, stdenv, llvm_meta
+, pkgsBuildBuild
+, fetch
+, fetchpatch
+, cmake
+, python3
+, libffi
+, enableGoldPlugin ? false
+, libbfd
+, libpfm
+, libxml2
+, ncurses
+, version
+, release_version
+, zlib
+, buildLlvmTools
+, debugVersion ? false
+, doCheck ? stdenv.isLinux && (!stdenv.isx86_32) && (!stdenv.hostPlatform.isMusl) && (!stdenv.hostPlatform.isRiscV)
+  && (stdenv.hostPlatform == stdenv.buildPlatform)
+, enableManpages ? false
+, enableSharedLibraries ? !stdenv.hostPlatform.isStatic
+# broken for Ampere eMAG 8180 (c2.large.arm on Packet) #56245
+# broken for the armv7l builder
+, enablePFM ? stdenv.isLinux && !stdenv.hostPlatform.isAarch
+, enablePolly ? false # TODO should be on by default
+}:
+
+let
+  inherit (lib) optional optionals optionalString;
+
+  # Used when creating a version-suffixed symlink of libLLVM.dylib
+  shortVersion = with lib;
+    concatStringsSep "." (take 1 (splitString "." release_version));
+
+  # Ordinarily we would just the `doCheck` and `checkDeps` functionality
+  # `mkDerivation` gives us to manage our test dependencies (instead of breaking
+  # out `doCheck` as a package level attribute).
+  #
+  # Unfortunately `lit` does not forward `$PYTHONPATH` to children processes, in
+  # particular the children it uses to do feature detection.
+  #
+  # This means that python deps we add to `checkDeps` (which the python
+  # interpreter is made aware of via `$PYTHONPATH` – populated by the python
+  # setup hook) are not picked up by `lit` which causes it to skip tests.
+  #
+  # Adding `python3.withPackages (ps: [ ... ])` to `checkDeps` also doesn't work
+  # because this package is shadowed in `$PATH` by the regular `python3`
+  # package.
+  #
+  # So, we "manually" assemble one python derivation for the package to depend
+  # on, taking into account whether checks are enabled or not:
+  python = if doCheck then
+    let
+      checkDeps = ps: with ps; [ psutil ];
+    in python3.withPackages checkDeps
+  else python3;
+
+in stdenv.mkDerivation (rec {
+  pname = "llvm";
+  inherit version;
+
+  src = fetch pname "199yq3a214avcbi4kk2q0ajriifkvsr0l2dkx3a666m033ihi1ff";
+  polly_src = fetch "polly" "031r23ijhx7v93a5n33m2nc0x9xyqmx0d8xg80z7q971p6qd63sq";
+
+  unpackPhase = ''
+    unpackFile $src
+    mv llvm-${release_version}* llvm
+    sourceRoot=$PWD/llvm
+  '' + optionalString enablePolly ''
+    unpackFile $polly_src
+    mv polly-* $sourceRoot/tools/polly
+  '';
+
+  outputs = [ "out" "lib" "dev" "python" ];
+
+  nativeBuildInputs = [ cmake python ]
+    ++ optionals enableManpages [ python3.pkgs.sphinx python3.pkgs.recommonmark ];
+
+  buildInputs = [ libxml2 libffi ]
+    ++ optional enablePFM libpfm; # exegesis
+
+  propagatedBuildInputs = [ ncurses zlib ];
+
+  patches = [
+    # When cross-compiling we configure llvm-config-native with an approximation
+    # of the flags used for the normal LLVM build. To avoid the need for building
+    # a native libLLVM.so (which would fail) we force llvm-config to be linked
+    # statically against the necessary LLVM components always.
+    ../../llvm-config-link-static.patch
+
+    ./gnu-install-dirs.patch
+    # On older CPUs (e.g. Hydra/wendy) we'd be getting an error in this test.
+    (fetchpatch {
+      name = "uops-CMOV16rm-noreg.diff";
+      url = "https://github.com/llvm/llvm-project/commit/9e9f991ac033.diff";
+      sha256 = "sha256:12s8vr6ibri8b48h2z38f3afhwam10arfiqfy4yg37bmc054p5hi";
+      stripLen = 1;
+    })
+    # gcc-11 compat upstream patch
+    (fetchpatch {
+      url = "https://github.com/llvm/llvm-project/commit/b498303066a63a203d24f739b2d2e0e56dca70d1.patch";
+      sha256 = "sha256:0nh123kld0dgz2h941lng331dkj3wbm5lfxm375k1f569gv83hlk";
+      stripLen = 1;
+    })
+
+    # Fix invalid std::string(nullptr) for GCC 12
+    (fetchpatch {
+      name = "nvptx-gcc-12.patch";
+      url = "https://github.com/llvm/llvm-project/commit/99e64623ec9b31def9375753491cc6093c831809.patch";
+      sha256 = "0zjfjgavqzi2ypqwqnlvy6flyvdz8hi1anwv0ybwnm2zqixg7za3";
+      stripLen = 1;
+    })
+    (fetchpatch {
+      name = "dfaemitter-gcc-12.patch";
+      url = "https://github.com/llvm/llvm-project/commit/0841916e87a39e3c223c986e8da31e4a9a1432e3.patch";
+      sha256 = "1kckghvsngs51mqm82asy0s9vr19h8aqbw43a0w44mccqw6bzrwf";
+      stripLen = 1;
+    })
+
+    # Fix musl build.
+    (fetchpatch {
+      url = "https://github.com/llvm/llvm-project/commit/5cd554303ead0f8891eee3cd6d25cb07f5a7bf67.patch";
+      relative = "llvm";
+      hash = "sha256-XPbvNJ45SzjMGlNUgt/IgEvM2dHQpDOe6woUJY+nUYA=";
+    })
+
+    # Backport gcc-13 fixes with missing includes.
+    (fetchpatch {
+      name = "signals-gcc-13.patch";
+      url = "https://github.com/llvm/llvm-project/commit/ff1681ddb303223973653f7f5f3f3435b48a1983.patch";
+      hash = "sha256-CXwYxQezTq5vdmc8Yn88BUAEly6YZ5VEIA6X3y5NNOs=";
+      stripLen = 1;
+    })
+    (fetchpatch {
+      name = "base64-gcc-13.patch";
+      url = "https://github.com/llvm/llvm-project/commit/5e9be93566f39ee6cecd579401e453eccfbe81e5.patch";
+      hash = "sha256-PAwrVrvffPd7tphpwCkYiz+67szPRzRB2TXBvKfzQ7U=";
+      stripLen = 1;
+    })
+  ] ++ lib.optional enablePolly ./gnu-install-dirs-polly.patch;
+
+  postPatch = optionalString stdenv.isDarwin ''
+    substituteInPlace cmake/modules/AddLLVM.cmake \
+      --replace 'set(_install_name_dir INSTALL_NAME_DIR "@rpath")' "set(_install_name_dir)" \
+      --replace 'set(_install_rpath "@loader_path/../''${CMAKE_INSTALL_LIBDIR}''${LLVM_LIBDIR_SUFFIX}" ''${extra_libdir})' ""
+  '' + ''
+    # FileSystem permissions tests fail with various special bits
+    substituteInPlace unittests/Support/CMakeLists.txt \
+      --replace "Path.cpp" ""
+    rm unittests/Support/Path.cpp
+  '' + optionalString stdenv.hostPlatform.isMusl ''
+    patch -p1 -i ${../../TLI-musl.patch}
+    substituteInPlace unittests/Support/CMakeLists.txt \
+      --replace "add_subdirectory(DynamicLibrary)" ""
+    rm unittests/Support/DynamicLibrary/DynamicLibraryTest.cpp
+    # valgrind unhappy with musl or glibc, but fails w/musl only
+    rm test/CodeGen/AArch64/wineh4.mir
+  '' + optionalString stdenv.hostPlatform.isAarch32 ''
+    # skip failing X86 test cases on 32-bit ARM
+    rm test/DebugInfo/X86/convert-debugloc.ll
+    rm test/DebugInfo/X86/convert-inlined.ll
+    rm test/DebugInfo/X86/convert-linked.ll
+    rm test/tools/dsymutil/X86/op-convert.test
+    rm test/tools/gold/X86/split-dwarf.ll
+    rm test/tools/llvm-readobj/ELF/dependent-libraries.test
+  '' + optionalString (stdenv.hostPlatform.system == "armv6l-linux") ''
+    # Seems to require certain floating point hardware (NEON?)
+    rm test/ExecutionEngine/frem.ll
+  '' + ''
+    patchShebangs test/BugPoint/compile-custom.ll.py
+  '' + ''
+    # Tweak tests to ignore namespace part of type to support
+    # gcc-12: https://gcc.gnu.org/PR103598.
+    # The change below mangles strings like:
+    #    CHECK-NEXT: Starting llvm::Function pass manager run.
+    # to:
+    #    CHECK-NEXT: Starting {{.*}}Function pass manager run.
+    for f in \
+      test/Other/new-pass-manager.ll \
+      test/Other/new-pm-defaults.ll \
+      test/Other/new-pm-lto-defaults.ll \
+      test/Other/new-pm-thinlto-defaults.ll \
+      test/Other/pass-pipeline-parsing.ll \
+      test/Transforms/Inline/cgscc-incremental-invalidate.ll \
+      test/Transforms/Inline/clear-analyses.ll \
+      test/Transforms/LoopUnroll/unroll-loop-invalidation.ll \
+      test/Transforms/SCCP/ipsccp-preserve-analysis.ll \
+      test/Transforms/SCCP/preserve-analysis.ll \
+      test/Transforms/SROA/dead-inst.ll \
+      test/tools/gold/X86/new-pm.ll \
+      ; do
+      echo "PATCH: $f"
+      substituteInPlace $f \
+        --replace 'Starting llvm::' 'Starting {{.*}}' \
+        --replace 'Finished llvm::' 'Finished {{.*}}'
+    done
+  '';
+
+  preConfigure = ''
+    # Workaround for configure flags that need to have spaces
+    cmakeFlagsArray+=(
+      -DLLVM_LIT_ARGS='-svj''${NIX_BUILD_CORES} --no-progress-bar'
+    )
+  '';
+
+  # hacky fix: created binaries need to be run before installation
+  preBuild = ''
+    mkdir -p $out/
+    ln -sv $PWD/lib $out
+  '';
+
+  # E.g. mesa.drivers use the build-id as a cache key (see #93946):
+  LDFLAGS = optionalString (enableSharedLibraries && !stdenv.isDarwin) "-Wl,--build-id=sha1";
+
+  cmakeBuildType = if debugVersion then "Debug" else "Release";
+
+  cmakeFlags = with stdenv; let
+    # These flags influence llvm-config's BuildVariables.inc in addition to the
+    # general build. We need to make sure these are also passed via
+    # CROSS_TOOLCHAIN_FLAGS_NATIVE when cross-compiling or llvm-config-native
+    # will return different results from the cross llvm-config.
+    #
+    # Some flags don't need to be repassed because LLVM already does so (like
+    # CMAKE_BUILD_TYPE), others are irrelevant to the result.
+    flagsForLlvmConfig = [
+      "-DLLVM_INSTALL_CMAKE_DIR=${placeholder "dev"}/lib/cmake/llvm/"
+      "-DLLVM_ENABLE_RTTI=ON"
+    ] ++ optionals enableSharedLibraries [
+      "-DLLVM_LINK_LLVM_DYLIB=ON"
+    ];
+  in flagsForLlvmConfig ++ [
+    "-DLLVM_INSTALL_UTILS=ON"  # Needed by rustc
+    "-DLLVM_BUILD_TESTS=${if doCheck then "ON" else "OFF"}"
+    "-DLLVM_ENABLE_FFI=ON"
+    "-DLLVM_HOST_TRIPLE=${stdenv.hostPlatform.config}"
+    "-DLLVM_DEFAULT_TARGET_TRIPLE=${stdenv.hostPlatform.config}"
+    "-DLLVM_ENABLE_DUMP=ON"
+  ] ++ optionals stdenv.hostPlatform.isStatic [
+    # Disables building of shared libs, -fPIC is still injected by cc-wrapper
+    "-DLLVM_ENABLE_PIC=OFF"
+    "-DLLVM_BUILD_STATIC=ON"
+    # libxml2 needs to be disabled because the LLVM build system ignores its .la
+    # file and doesn't link zlib as well.
+    # https://github.com/ClangBuiltLinux/tc-build/issues/150#issuecomment-845418812
+    "-DLLVM_ENABLE_LIBXML2=OFF"
+    # This is a Shared Library not tied to LLVM_ENABLE_PIC
+    "-DLLVM_TOOL_REMARKS_SHLIB_BUILD=OFF"
+  ] ++ optionals enableManpages [
+    "-DLLVM_BUILD_DOCS=ON"
+    "-DLLVM_ENABLE_SPHINX=ON"
+    "-DSPHINX_OUTPUT_MAN=ON"
+    "-DSPHINX_OUTPUT_HTML=OFF"
+    "-DSPHINX_WARNINGS_AS_ERRORS=OFF"
+  ] ++ optionals (enableGoldPlugin) [
+    "-DLLVM_BINUTILS_INCDIR=${libbfd.dev}/include"
+  ] ++ optionals isDarwin [
+    "-DLLVM_ENABLE_LIBCXX=ON"
+    "-DCAN_TARGET_i386=false"
+  ] ++ optionals (stdenv.hostPlatform != stdenv.buildPlatform) [
+    "-DCMAKE_CROSSCOMPILING=True"
+    "-DLLVM_TABLEGEN=${buildLlvmTools.llvm}/bin/llvm-tblgen"
+    (
+      let
+        nativeCC = pkgsBuildBuild.targetPackages.stdenv.cc;
+        nativeBintools = nativeCC.bintools.bintools;
+        nativeToolchainFlags = [
+          "-DCMAKE_C_COMPILER=${nativeCC}/bin/${nativeCC.targetPrefix}cc"
+          "-DCMAKE_CXX_COMPILER=${nativeCC}/bin/${nativeCC.targetPrefix}c++"
+          "-DCMAKE_AR=${nativeBintools}/bin/${nativeBintools.targetPrefix}ar"
+          "-DCMAKE_STRIP=${nativeBintools}/bin/${nativeBintools.targetPrefix}strip"
+          "-DCMAKE_RANLIB=${nativeBintools}/bin/${nativeBintools.targetPrefix}ranlib"
+        ];
+        # We need to repass the custom GNUInstallDirs values, otherwise CMake
+        # will choose them for us, leading to wrong results in llvm-config-native
+        nativeInstallFlags = [
+          "-DCMAKE_INSTALL_PREFIX=${placeholder "out"}"
+          "-DCMAKE_INSTALL_BINDIR=${placeholder "out"}/bin"
+          "-DCMAKE_INSTALL_INCLUDEDIR=${placeholder "dev"}/include"
+          "-DCMAKE_INSTALL_LIBDIR=${placeholder "lib"}/lib"
+          "-DCMAKE_INSTALL_LIBEXECDIR=${placeholder "lib"}/libexec"
+        ];
+      in "-DCROSS_TOOLCHAIN_FLAGS_NATIVE:list="
+      + lib.concatStringsSep ";" (lib.concatLists [
+        flagsForLlvmConfig
+        nativeToolchainFlags
+        nativeInstallFlags
+      ])
+    )
+  ];
+
+  postBuild = ''
+    rm -fR $out
+  '';
+
+  preCheck = ''
+    export LD_LIBRARY_PATH=$LD_LIBRARY_PATH''${LD_LIBRARY_PATH:+:}$PWD/lib
+  '';
+
+  postInstall = ''
+    mkdir -p $python/share
+    mv $out/share/opt-viewer $python/share/opt-viewer
+    moveToOutput "bin/llvm-config*" "$dev"
+    substituteInPlace "$dev/lib/cmake/llvm/LLVMExports-${if debugVersion then "debug" else "release"}.cmake" \
+      --replace "\''${_IMPORT_PREFIX}/lib/lib" "$lib/lib/lib" \
+      --replace "$out/bin/llvm-config" "$dev/bin/llvm-config"
+    substituteInPlace "$dev/lib/cmake/llvm/LLVMConfig.cmake" \
+      --replace 'set(LLVM_BINARY_DIR "''${LLVM_INSTALL_PREFIX}")' 'set(LLVM_BINARY_DIR "''${LLVM_INSTALL_PREFIX}'"$lib"'")'
+  ''
+  + optionalString (stdenv.isDarwin && enableSharedLibraries) ''
+    ln -s $lib/lib/libLLVM.dylib $lib/lib/libLLVM-${shortVersion}.dylib
+    ln -s $lib/lib/libLLVM.dylib $lib/lib/libLLVM-${release_version}.dylib
+  ''
+  + optionalString (stdenv.buildPlatform != stdenv.hostPlatform) ''
+    cp NATIVE/bin/llvm-config $dev/bin/llvm-config-native
+  '';
+
+  inherit doCheck;
+
+  checkTarget = "check-all";
+
+  requiredSystemFeatures = [ "big-parallel" ];
+  meta = llvm_meta // {
+    homepage = "https://llvm.org/";
+    description = "A collection of modular and reusable compiler and toolchain technologies";
+    longDescription = ''
+      The LLVM Project is a collection of modular and reusable compiler and
+      toolchain technologies. Despite its name, LLVM has little to do with
+      traditional virtual machines. The name "LLVM" itself is not an acronym; it
+      is the full name of the project.
+      LLVM began as a research project at the University of Illinois, with the
+      goal of providing a modern, SSA-based compilation strategy capable of
+      supporting both static and dynamic compilation of arbitrary programming
+      languages. Since then, LLVM has grown to be an umbrella project consisting
+      of a number of subprojects, many of which are being used in production by
+      a wide variety of commercial and open source projects as well as being
+      widely used in academic research. Code in the LLVM project is licensed
+      under the "Apache 2.0 License with LLVM exceptions".
+    '';
+  };
+} // lib.optionalAttrs enableManpages {
+  pname = "llvm-manpages";
+
+  buildPhase = ''
+    make docs-llvm-man
+  '';
+
+  propagatedBuildInputs = [];
+
+  installPhase = ''
+    make -C docs install
+  '';
+
+  postPatch = null;
+  postInstall = null;
+
+  outputs = [ "out" ];
+
+  doCheck = false;
+
+  meta = llvm_meta // {
+    description = "man pages for LLVM ${version}";
+  };
+})
--- a/llvm/11/llvm/gnu-install-dirs-polly.patch
+++ b/llvm/11/llvm/gnu-install-dirs-polly.patch
@ -0,0 +1,106 @@
+diff --git a/tools/polly/CMakeLists.txt b/tools/polly/CMakeLists.txt
+index 9939097f743e..8cc538da912a 100644
+--- a/tools/polly/CMakeLists.txt
+++ b/tools/polly/CMakeLists.txt
+@@ -2,7 +2,11 @@
+ if (NOT DEFINED LLVM_MAIN_SRC_DIR)
+   project(Polly)
+   cmake_minimum_required(VERSION 3.4.3)
+endif()
+
+include(GNUInstallDirs)
+ 
+if (NOT DEFINED LLVM_MAIN_SRC_DIR)
+   # Where is LLVM installed?
+   find_package(LLVM CONFIG REQUIRED)
+   set(CMAKE_MODULE_PATH ${CMAKE_MODULE_PATH} ${LLVM_CMAKE_DIR})
+@@ -145,14 +149,14 @@ include_directories(
+ 
+ if (NOT LLVM_INSTALL_TOOLCHAIN_ONLY)
+   install(DIRECTORY include/
+-    DESTINATION include
+    DESTINATION ${CMAKE_INSTALL_INCLUDEDIR}
+     FILES_MATCHING
+     PATTERN "*.h"
+     PATTERN ".svn" EXCLUDE
+     )
+ 
+   install(DIRECTORY ${POLLY_BINARY_DIR}/include/
+-    DESTINATION include
+    DESTINATION ${CMAKE_INSTALL_INCLUDEDIR}
+     FILES_MATCHING
+     PATTERN "*.h"
+     PATTERN "CMakeFiles" EXCLUDE
+diff --git a/tools/polly/cmake/CMakeLists.txt b/tools/polly/cmake/CMakeLists.txt
+index 211f95512717..f9e04a4844b6 100644
+--- a/tools/polly/cmake/CMakeLists.txt
+++ b/tools/polly/cmake/CMakeLists.txt
+@@ -79,18 +79,18 @@ file(GENERATE
+ 
+ # Generate PollyConfig.cmake for the install tree.
+ unset(POLLY_EXPORTS)
+-set(POLLY_INSTALL_PREFIX "${CMAKE_INSTALL_PREFIX}")
+set(POLLY_INSTALL_PREFIX "")
+ set(POLLY_CONFIG_LLVM_CMAKE_DIR "${LLVM_BINARY_DIR}/${LLVM_INSTALL_PACKAGE_DIR}")
+-set(POLLY_CONFIG_CMAKE_DIR "${POLLY_INSTALL_PREFIX}/${POLLY_INSTALL_PACKAGE_DIR}")
+-set(POLLY_CONFIG_LIBRARY_DIRS "${POLLY_INSTALL_PREFIX}/lib${LLVM_LIBDIR_SUFFIX}")
+set(POLLY_CONFIG_CMAKE_DIR "${POLLY_INSTALL_PREFIX}${CMAKE_INSTALL_PREFIX}/${POLLY_INSTALL_PACKAGE_DIR}")
+set(POLLY_CONFIG_LIBRARY_DIRS "${POLLY_INSTALL_PREFIX}${CMAKE_INSTALL_FULL_LIBDIR}${LLVM_LIBDIR_SUFFIX}")
+ if (POLLY_BUNDLED_ISL)
+   set(POLLY_CONFIG_INCLUDE_DIRS
+-    "${POLLY_INSTALL_PREFIX}/include"
+-    "${POLLY_INSTALL_PREFIX}/include/polly"
+    "${POLLY_INSTALL_PREFIX}${CMAKE_INSTALL_FULL_LIBDIR}"
+    "${POLLY_INSTALL_PREFIX}${CMAKE_INSTALL_FULL_LIBDIR}/polly"
+     )
+ else()
+   set(POLLY_CONFIG_INCLUDE_DIRS
+-    "${POLLY_INSTALL_PREFIX}/include"
+    "${POLLY_INSTALL_PREFIX}${CMAKE_INSTALL_FULL_INCLUDEDIR}"
+     ${ISL_INCLUDE_DIRS}
+     )
+ endif()
+@@ -100,12 +100,12 @@ endif()
+ foreach(tgt IN LISTS POLLY_CONFIG_EXPORTED_TARGETS)
+   get_target_property(tgt_type ${tgt} TYPE)
+   if (tgt_type STREQUAL "EXECUTABLE")
+-    set(tgt_prefix "bin/")
+    set(tgt_prefix "${CMAKE_INSTALL_BINDIR}/")
+   else()
+-    set(tgt_prefix "lib/")
+    set(tgt_prefix "${CMAKE_INSTALL_LIBDIR}/")
+   endif()
+ 
+-  set(tgt_path "${CMAKE_INSTALL_PREFIX}/${tgt_prefix}$<TARGET_FILE_NAME:${tgt}>")
+  set(tgt_path "${tgt_prefix}$<TARGET_FILE_NAME:${tgt}>")
+   file(RELATIVE_PATH tgt_path ${POLLY_CONFIG_CMAKE_DIR} ${tgt_path})
+ 
+   if (NOT tgt_type STREQUAL "INTERFACE_LIBRARY")
+diff --git a/tools/polly/cmake/polly_macros.cmake b/tools/polly/cmake/polly_macros.cmake
+index 86de6f10686e..91f30891ccbe 100644
+--- a/tools/polly/cmake/polly_macros.cmake
+++ b/tools/polly/cmake/polly_macros.cmake
+@@ -44,8 +44,8 @@ macro(add_polly_library name)
+   if (NOT LLVM_INSTALL_TOOLCHAIN_ONLY OR ${name} STREQUAL "LLVMPolly")
+     install(TARGETS ${name}
+       EXPORT LLVMExports
+-      LIBRARY DESTINATION lib${LLVM_LIBDIR_SUFFIX}
+-      ARCHIVE DESTINATION lib${LLVM_LIBDIR_SUFFIX})
+	  LIBRARY DESTINATION ${CMAKE_INSTALL_LIBDIR}${LLVM_LIBDIR_SUFFIX}
+      ARCHIVE DESTINATION ${CMAKE_INSTALL_LIBDIR}${LLVM_LIBDIR_SUFFIX})
+   endif()
+   set_property(GLOBAL APPEND PROPERTY LLVM_EXPORTS ${name})
+ endmacro(add_polly_library)
+diff --git a/tools/polly/lib/External/CMakeLists.txt b/tools/polly/lib/External/CMakeLists.txt
+index 1039079cb49c..28b499ae1e9e 100644
+--- a/tools/polly/lib/External/CMakeLists.txt
+++ b/tools/polly/lib/External/CMakeLists.txt
+@@ -275,7 +275,7 @@ if (POLLY_BUNDLED_ISL)
+     install(DIRECTORY
+       ${ISL_SOURCE_DIR}/include/
+       ${ISL_BINARY_DIR}/include/
+-      DESTINATION include/polly
+      DESTINATION ${CMAKE_INSTALL_INCLUDEDIR}/polly
+       FILES_MATCHING
+       PATTERN "*.h"
+       PATTERN "CMakeFiles" EXCLUDE
--- a/llvm/11/llvm/gnu-install-dirs.patch
+++ b/llvm/11/llvm/gnu-install-dirs.patch
@ -0,0 +1,417 @@
+diff --git a/CMakeLists.txt b/CMakeLists.txt
+index 247ad36d3845..815e2c4ba955 100644
+--- a/CMakeLists.txt
+++ b/CMakeLists.txt
+@@ -269,15 +269,21 @@ if (CMAKE_BUILD_TYPE AND
+   message(FATAL_ERROR "Invalid value for CMAKE_BUILD_TYPE: ${CMAKE_BUILD_TYPE}")
+ endif()
+ 
+include(GNUInstallDirs)
+
+ set(LLVM_LIBDIR_SUFFIX "" CACHE STRING "Define suffix of library directory name (32/64)" )
+ 
+-set(LLVM_TOOLS_INSTALL_DIR "bin" CACHE STRING "Path for binary subdirectory (defaults to 'bin')")
+set(LLVM_TOOLS_INSTALL_DIR "${CMAKE_INSTALL_BINDIR}" CACHE STRING
+    "Path for binary subdirectory (defaults to 'bin')")
+ mark_as_advanced(LLVM_TOOLS_INSTALL_DIR)
+ 
+ set(LLVM_UTILS_INSTALL_DIR "${LLVM_TOOLS_INSTALL_DIR}" CACHE STRING
+     "Path to install LLVM utilities (enabled by LLVM_INSTALL_UTILS=ON) (defaults to LLVM_TOOLS_INSTALL_DIR)")
+ mark_as_advanced(LLVM_UTILS_INSTALL_DIR)
+ 
+set(LLVM_INSTALL_CMAKE_DIR "${CMAKE_INSTALL_LIBDIR}${LLVM_LIBDIR_SUFFIX}/cmake/llvm" CACHE STRING
+	"Path for CMake subdirectory (defaults to lib/cmake/llvm)" )
+
+ # They are used as destination of target generators.
+ set(LLVM_RUNTIME_OUTPUT_INTDIR ${CMAKE_CURRENT_BINARY_DIR}/${CMAKE_CFG_INTDIR}/bin)
+ set(LLVM_LIBRARY_OUTPUT_INTDIR ${CMAKE_CURRENT_BINARY_DIR}/${CMAKE_CFG_INTDIR}/lib${LLVM_LIBDIR_SUFFIX})
+@@ -559,9 +565,9 @@ option (LLVM_ENABLE_SPHINX "Use Sphinx to generate llvm documentation." OFF)
+ option (LLVM_ENABLE_OCAMLDOC "Build OCaml bindings documentation." ON)
+ option (LLVM_ENABLE_BINDINGS "Build bindings." ON)
+ 
+-set(LLVM_INSTALL_DOXYGEN_HTML_DIR "share/doc/llvm/doxygen-html"
+set(LLVM_INSTALL_DOXYGEN_HTML_DIR "${CMAKE_INSTALL_DOCDIR}/${project}/doxygen-html"
+     CACHE STRING "Doxygen-generated HTML documentation install directory")
+-set(LLVM_INSTALL_OCAMLDOC_HTML_DIR "share/doc/llvm/ocaml-html"
+set(LLVM_INSTALL_OCAMLDOC_HTML_DIR "${CMAKE_INSTALL_DOCDIR}/${project}/ocaml-html"
+     CACHE STRING "OCamldoc-generated HTML documentation install directory")
+ 
+ option (LLVM_BUILD_EXTERNAL_COMPILER_RT
+@@ -1107,7 +1113,7 @@ endif()
+ 
+ if (NOT LLVM_INSTALL_TOOLCHAIN_ONLY)
+   install(DIRECTORY include/llvm include/llvm-c
+-    DESTINATION include
+    DESTINATION ${CMAKE_INSTALL_INCLUDEDIR}
+     COMPONENT llvm-headers
+     FILES_MATCHING
+     PATTERN "*.def"
+@@ -1119,7 +1125,7 @@ if (NOT LLVM_INSTALL_TOOLCHAIN_ONLY)
+     )
+ 
+   install(DIRECTORY ${LLVM_INCLUDE_DIR}/llvm ${LLVM_INCLUDE_DIR}/llvm-c
+-    DESTINATION include
+    DESTINATION ${CMAKE_INSTALL_INCLUDEDIR}
+     COMPONENT llvm-headers
+     FILES_MATCHING
+     PATTERN "*.def"
+@@ -1134,13 +1140,13 @@ if (NOT LLVM_INSTALL_TOOLCHAIN_ONLY)
+ 
+   if (LLVM_INSTALL_MODULEMAPS)
+     install(DIRECTORY include/llvm include/llvm-c
+-            DESTINATION include
+            DESTINATION ${CMAKE_INSTALL_INCLUDEDIR}
+             COMPONENT llvm-headers
+             FILES_MATCHING
+             PATTERN "module.modulemap"
+             )
+     install(FILES include/llvm/module.install.modulemap
+-            DESTINATION include/llvm
+            DESTINATION ${CMAKE_INSTALL_INCLUDEDIR}/llvm
+             COMPONENT llvm-headers
+             RENAME "module.extern.modulemap"
+             )
+diff --git a/cmake/modules/AddLLVM.cmake b/cmake/modules/AddLLVM.cmake
+index b74adc11ade9..a5aa258cde30 100644
+--- a/cmake/modules/AddLLVM.cmake
+++ b/cmake/modules/AddLLVM.cmake
+@@ -766,9 +766,9 @@ macro(add_llvm_library name)
+ 
+       install(TARGETS ${name}
+               ${export_to_llvmexports}
+-              LIBRARY DESTINATION lib${LLVM_LIBDIR_SUFFIX} COMPONENT ${name}
+-              ARCHIVE DESTINATION lib${LLVM_LIBDIR_SUFFIX} COMPONENT ${name}
+-              RUNTIME DESTINATION bin COMPONENT ${name})
+              LIBRARY DESTINATION ${CMAKE_INSTALL_LIBDIR}${LLVM_LIBDIR_SUFFIX} COMPONENT ${name}
+              ARCHIVE DESTINATION ${CMAKE_INSTALL_LIBDIR}${LLVM_LIBDIR_SUFFIX} COMPONENT ${name}
+              RUNTIME DESTINATION ${CMAKE_INSTALL_BINDIR} COMPONENT ${name})
+ 
+       if (NOT LLVM_ENABLE_IDE)
+         add_llvm_install_targets(install-${name}
+@@ -981,7 +981,7 @@ function(process_llvm_pass_plugins)
+           "set(LLVM_STATIC_EXTENSIONS ${LLVM_STATIC_EXTENSIONS})")
+       install(FILES
+           ${llvm_cmake_builddir}/LLVMConfigExtensions.cmake
+-          DESTINATION ${LLVM_INSTALL_PACKAGE_DIR}
+          DESTINATION ${LLVM_INSTALL_CMAKE_DIR}
+           COMPONENT cmake-exports)
+ 
+       set(ExtensionDef "${LLVM_BINARY_DIR}/include/llvm/Support/Extension.def")
+@@ -1201,7 +1201,7 @@ macro(add_llvm_example name)
+   endif()
+   add_llvm_executable(${name} ${ARGN})
+   if( LLVM_BUILD_EXAMPLES )
+-    install(TARGETS ${name} RUNTIME DESTINATION examples)
+    install(TARGETS ${name} RUNTIME DESTINATION ${CMAKE_INSTALL_DOCDIR}/examples)
+   endif()
+   set_target_properties(${name} PROPERTIES FOLDER "Examples")
+ endmacro(add_llvm_example name)
+@@ -1819,7 +1819,7 @@ function(llvm_install_library_symlink name dest type)
+   set(full_name ${CMAKE_${type}_LIBRARY_PREFIX}${name}${CMAKE_${type}_LIBRARY_SUFFIX})
+   set(full_dest ${CMAKE_${type}_LIBRARY_PREFIX}${dest}${CMAKE_${type}_LIBRARY_SUFFIX})
+ 
+-  set(output_dir lib${LLVM_LIBDIR_SUFFIX})
+  set(output_dir ${CMAKE_INSTALL_FULL_LIBDIR}${LLVM_LIBDIR_SUFFIX})
+   if(WIN32 AND "${type}" STREQUAL "SHARED")
+     set(output_dir bin)
+   endif()
+@@ -1836,7 +1836,7 @@ function(llvm_install_library_symlink name dest type)
+   endif()
+ endfunction()
+ 
+-function(llvm_install_symlink name dest)
+function(llvm_install_symlink name dest output_dir)
+   cmake_parse_arguments(ARG "ALWAYS_GENERATE" "COMPONENT" "" ${ARGN})
+   foreach(path ${CMAKE_MODULE_PATH})
+     if(EXISTS ${path}/LLVMInstallSymlink.cmake)
+@@ -1859,7 +1859,7 @@ function(llvm_install_symlink name dest)
+   set(full_dest ${dest}${CMAKE_EXECUTABLE_SUFFIX})
+ 
+   install(SCRIPT ${INSTALL_SYMLINK}
+-          CODE "install_symlink(${full_name} ${full_dest} ${LLVM_TOOLS_INSTALL_DIR})"
+          CODE "install_symlink(${full_name} ${full_dest} ${output_dir})"
+           COMPONENT ${component})
+ 
+   if (NOT LLVM_ENABLE_IDE AND NOT ARG_ALWAYS_GENERATE)
+@@ -1942,7 +1942,8 @@ function(add_llvm_tool_symlink link_name target)
+     endif()
+ 
+     if ((TOOL_IS_TOOLCHAIN OR NOT LLVM_INSTALL_TOOLCHAIN_ONLY) AND LLVM_BUILD_TOOLS)
+-      llvm_install_symlink(${link_name} ${target})
+      GNUInstallDirs_get_absolute_install_dir(output_dir LLVM_TOOLS_INSTALL_DIR)
+      llvm_install_symlink(${link_name} ${target} ${output_dir})
+     endif()
+   endif()
+ endfunction()
+@@ -2064,9 +2065,9 @@ function(llvm_setup_rpath name)
+ 
+   if (APPLE)
+     set(_install_name_dir INSTALL_NAME_DIR "@rpath")
+-    set(_install_rpath "@loader_path/../lib${LLVM_LIBDIR_SUFFIX}" ${extra_libdir})
+    set(_install_rpath "@loader_path/../${CMAKE_INSTALL_LIBDIR}${LLVM_LIBDIR_SUFFIX}" ${extra_libdir})
+   elseif(UNIX)
+-    set(_install_rpath "\$ORIGIN/../lib${LLVM_LIBDIR_SUFFIX}" ${extra_libdir})
+    set(_install_rpath "\$ORIGIN/../${CMAKE_INSTALL_LIBDIR}${LLVM_LIBDIR_SUFFIX}" ${extra_libdir})
+     if(${CMAKE_SYSTEM_NAME} MATCHES "(FreeBSD|DragonFly)")
+       set_property(TARGET ${name} APPEND_STRING PROPERTY
+                    LINK_FLAGS " -Wl,-z,origin ")
+diff --git a/cmake/modules/AddOCaml.cmake b/cmake/modules/AddOCaml.cmake
+index 554046b20edf..4d1ad980641e 100644
+--- a/cmake/modules/AddOCaml.cmake
+++ b/cmake/modules/AddOCaml.cmake
+@@ -144,9 +144,9 @@ function(add_ocaml_library name)
+   endforeach()
+ 
+   if( APPLE )
+-    set(ocaml_rpath "@executable_path/../../../lib${LLVM_LIBDIR_SUFFIX}")
+    set(ocaml_rpath "@executable_path/../../../${CMAKE_INSTALL_LIBDIR}${LLVM_LIBDIR_SUFFIX}")
+   elseif( UNIX )
+-    set(ocaml_rpath "\\$ORIGIN/../../../lib${LLVM_LIBDIR_SUFFIX}")
+    set(ocaml_rpath "\\$ORIGIN/../../../${CMAKE_INSTALL_LIBDIR}${LLVM_LIBDIR_SUFFIX}")
+   endif()
+   list(APPEND ocaml_flags "-ldopt" "-Wl,-rpath,${ocaml_rpath}")
+ 
+diff --git a/cmake/modules/AddSphinxTarget.cmake b/cmake/modules/AddSphinxTarget.cmake
+index b5babb30abcf..190b1222a9f9 100644
+--- a/cmake/modules/AddSphinxTarget.cmake
+++ b/cmake/modules/AddSphinxTarget.cmake
+@@ -84,7 +84,7 @@ function (add_sphinx_target builder project)
+         endif()
+       elseif (builder STREQUAL html)
+         string(TOUPPER "${project}" project_upper)
+-        set(${project_upper}_INSTALL_SPHINX_HTML_DIR "share/doc/${project}/html"
+        set(${project_upper}_INSTALL_SPHINX_HTML_DIR "${CMAKE_INSTALL_DOCDIR}/${project}/html"
+             CACHE STRING "HTML documentation install directory for ${project}")
+ 
+         # '/.' indicates: copy the contents of the directory directly into
+diff --git a/cmake/modules/CMakeLists.txt b/cmake/modules/CMakeLists.txt
+index 4b8879f65fe4..f01920bcc60f 100644
+--- a/cmake/modules/CMakeLists.txt
+++ b/cmake/modules/CMakeLists.txt
+@@ -1,4 +1,4 @@
+-set(LLVM_INSTALL_PACKAGE_DIR lib${LLVM_LIBDIR_SUFFIX}/cmake/llvm)
+set(LLVM_INSTALL_PACKAGE_DIR ${LLVM_INSTALL_CMAKE_DIR} CACHE STRING "Path for CMake subdirectory (defaults to 'cmake/llvm')")
+ set(llvm_cmake_builddir "${LLVM_BINARY_DIR}/${LLVM_INSTALL_PACKAGE_DIR}")
+ 
+ # First for users who use an installed LLVM, create the LLVMExports.cmake file.
+@@ -108,13 +108,13 @@ foreach(p ${_count})
+   set(LLVM_CONFIG_CODE "${LLVM_CONFIG_CODE}
+ get_filename_component(LLVM_INSTALL_PREFIX \"\${LLVM_INSTALL_PREFIX}\" PATH)")
+ endforeach(p)
+-set(LLVM_CONFIG_INCLUDE_DIRS "\${LLVM_INSTALL_PREFIX}/include")
+set(LLVM_CONFIG_INCLUDE_DIRS "\${LLVM_INSTALL_PREFIX}/${CMAKE_INSTALL_INCLUDEDIR}")
+ set(LLVM_CONFIG_INCLUDE_DIR "${LLVM_CONFIG_INCLUDE_DIRS}")
+ set(LLVM_CONFIG_MAIN_INCLUDE_DIR "${LLVM_CONFIG_INCLUDE_DIRS}")
+-set(LLVM_CONFIG_LIBRARY_DIRS "\${LLVM_INSTALL_PREFIX}/lib\${LLVM_LIBDIR_SUFFIX}")
+set(LLVM_CONFIG_LIBRARY_DIRS "\${LLVM_INSTALL_PREFIX}/${CMAKE_INSTALL_LIBDIR}\${LLVM_LIBDIR_SUFFIX}")
+ set(LLVM_CONFIG_CMAKE_DIR "\${LLVM_INSTALL_PREFIX}/${LLVM_INSTALL_PACKAGE_DIR}")
+ set(LLVM_CONFIG_BINARY_DIR "\${LLVM_INSTALL_PREFIX}")
+-set(LLVM_CONFIG_TOOLS_BINARY_DIR "\${LLVM_INSTALL_PREFIX}/bin")
+set(LLVM_CONFIG_TOOLS_BINARY_DIR "\${LLVM_INSTALL_PREFIX}/${CMAKE_INSTALL_BINDIR}")
+ 
+ # Generate a default location for lit
+ if (LLVM_INSTALL_UTILS AND LLVM_BUILD_UTILS)
+diff --git a/cmake/modules/LLVMInstallSymlink.cmake b/cmake/modules/LLVMInstallSymlink.cmake
+index 09fed8085c23..aa79f192abf0 100644
+--- a/cmake/modules/LLVMInstallSymlink.cmake
+++ b/cmake/modules/LLVMInstallSymlink.cmake
+@@ -10,7 +10,7 @@ function(install_symlink name target outdir)
+     set(LINK_OR_COPY copy)
+   endif()
+ 
+-  set(bindir "${DESTDIR}${CMAKE_INSTALL_PREFIX}/${outdir}/")
+  set(bindir "${DESTDIR}${outdir}/")
+ 
+   message(STATUS "Creating ${name}")
+ 
+diff --git a/docs/CMake.rst b/docs/CMake.rst
+index 1f908d3e95b1..1315e0aa40e1 100644
+--- a/docs/CMake.rst
+++ b/docs/CMake.rst
+@@ -196,7 +196,7 @@ CMake manual, or execute ``cmake --help-variable VARIABLE_NAME``.
+ **LLVM_LIBDIR_SUFFIX**:STRING
+   Extra suffix to append to the directory where libraries are to be
+   installed. On a 64-bit architecture, one could use ``-DLLVM_LIBDIR_SUFFIX=64``
+-  to install libraries to ``/usr/lib64``.
+  to install libraries to ``/usr/lib64``. See also ``CMAKE_INSTALL_LIBDIR``.
+ 
+ **CMAKE_C_FLAGS**:STRING
+   Extra flags to use when compiling C source files.
+@@ -516,8 +516,8 @@ LLVM-specific variables
+ 
+ **LLVM_INSTALL_DOXYGEN_HTML_DIR**:STRING
+   The path to install Doxygen-generated HTML documentation to. This path can
+-  either be absolute or relative to the CMAKE_INSTALL_PREFIX. Defaults to
+-  `share/doc/llvm/doxygen-html`.
+  either be absolute or relative to the ``CMAKE_INSTALL_PREFIX``. Defaults to
+  `${CMAKE_INSTALL_DOCDIR}/${project}/doxygen-html`.
+ 
+ **LLVM_ENABLE_SPHINX**:BOOL
+   If specified, CMake will search for the ``sphinx-build`` executable and will make
+@@ -548,13 +548,33 @@ LLVM-specific variables
+ 
+ **LLVM_INSTALL_SPHINX_HTML_DIR**:STRING
+   The path to install Sphinx-generated HTML documentation to. This path can
+-  either be absolute or relative to the CMAKE_INSTALL_PREFIX. Defaults to
+-  `share/doc/llvm/html`.
+  either be absolute or relative to the ``CMAKE_INSTALL_PREFIX``. Defaults to
+  `${CMAKE_INSTALL_DOCDIR}/${project}/html`.
+ 
+ **LLVM_INSTALL_OCAMLDOC_HTML_DIR**:STRING
+   The path to install OCamldoc-generated HTML documentation to. This path can
+-  either be absolute or relative to the CMAKE_INSTALL_PREFIX. Defaults to
+-  `share/doc/llvm/ocaml-html`.
+  either be absolute or relative to the ``CMAKE_INSTALL_PREFIX``. Defaults to
+  `${CMAKE_INSTALL_DOCDIR}/${project}/ocaml-html`.
+
+**CMAKE_INSTALL_BINDIR**:STRING
+  The path to install binary tools, relative to the ``CMAKE_INSTALL_PREFIX``.
+  Defaults to `bin`.
+
+**CMAKE_INSTALL_LIBDIR**:STRING
+  The path to install libraries, relative to the ``CMAKE_INSTALL_PREFIX``.
+  Defaults to `lib`.
+
+**CMAKE_INSTALL_INCLUDEDIR**:STRING
+  The path to install header files, relative to the ``CMAKE_INSTALL_PREFIX``.
+  Defaults to `include`.
+
+**CMAKE_INSTALL_DOCDIR**:STRING
+  The path to install documentation, relative to the ``CMAKE_INSTALL_PREFIX``.
+  Defaults to `share/doc`.
+
+**CMAKE_INSTALL_MANDIR**:STRING
+  The path to install manpage files, relative to the ``CMAKE_INSTALL_PREFIX``.
+  Defaults to `share/man`.
+ 
+ **LLVM_CREATE_XCODE_TOOLCHAIN**:BOOL
+   macOS Only: If enabled CMake will generate a target named
+@@ -752,9 +772,11 @@ the ``cmake`` command or by setting it directly in ``ccmake`` or ``cmake-gui``).
+ 
+ This file is available in two different locations.
+ 
+-* ``<INSTALL_PREFIX>/lib/cmake/llvm/LLVMConfig.cmake`` where
+-  ``<INSTALL_PREFIX>`` is the install prefix of an installed version of LLVM.
+-  On Linux typically this is ``/usr/lib/cmake/llvm/LLVMConfig.cmake``.
+* ``<LLVM_INSTALL_PACKAGE_DIR>LLVMConfig.cmake`` where
+  ``<LLVM_INSTALL_PACKAGE_DIR>`` is the location where LLVM CMake modules are
+  installed as part of an installed version of LLVM. This is typically
+  ``cmake/llvm/`` within the lib directory. On Linux, this is typically
+  ``/usr/lib/cmake/llvm/LLVMConfig.cmake``.
+ 
+ * ``<LLVM_BUILD_ROOT>/lib/cmake/llvm/LLVMConfig.cmake`` where
+   ``<LLVM_BUILD_ROOT>`` is the root of the LLVM build tree. **Note: this is only
+diff --git a/examples/Bye/CMakeLists.txt b/examples/Bye/CMakeLists.txt
+index bb96edb4b4bf..678c22fb43c8 100644
+--- a/examples/Bye/CMakeLists.txt
+++ b/examples/Bye/CMakeLists.txt
+@@ -14,6 +14,6 @@ if (NOT WIN32)
+     BUILDTREE_ONLY
+    )
+ 
+-  install(TARGETS ${name} RUNTIME DESTINATION examples)
+  install(TARGETS ${name} RUNTIME DESTINATION ${CMAKE_INSTALL_DOCDIR}/examples)
+   set_target_properties(${name} PROPERTIES FOLDER "Examples")
+ endif()
+diff --git a/include/llvm/CMakeLists.txt b/include/llvm/CMakeLists.txt
+index b46319f24fc8..2feabd1954e4 100644
+--- a/include/llvm/CMakeLists.txt
+++ b/include/llvm/CMakeLists.txt
+@@ -5,5 +5,5 @@ add_subdirectory(Frontend)
+ # If we're doing an out-of-tree build, copy a module map for generated
+ # header files into the build area.
+ if (NOT "${CMAKE_SOURCE_DIR}" STREQUAL "${CMAKE_BINARY_DIR}")
+-  configure_file(module.modulemap.build module.modulemap COPYONLY)
+  configure_file(module.modulemap.build ${LLVM_INCLUDE_DIR}/module.modulemap COPYONLY)
+ endif (NOT "${CMAKE_SOURCE_DIR}" STREQUAL "${CMAKE_BINARY_DIR}")
+diff --git a/tools/llvm-config/BuildVariables.inc.in b/tools/llvm-config/BuildVariables.inc.in
+index 63cef75368b7..6295478b1f3d 100644
+--- a/tools/llvm-config/BuildVariables.inc.in
+++ b/tools/llvm-config/BuildVariables.inc.in
+@@ -23,6 +23,10 @@
+ #define LLVM_CXXFLAGS "@LLVM_CXXFLAGS@"
+ #define LLVM_BUILDMODE "@LLVM_BUILDMODE@"
+ #define LLVM_LIBDIR_SUFFIX "@LLVM_LIBDIR_SUFFIX@"
+#define LLVM_INSTALL_BINDIR "@CMAKE_INSTALL_BINDIR@"
+#define LLVM_INSTALL_LIBDIR "@CMAKE_INSTALL_LIBDIR@"
+#define LLVM_INSTALL_INCLUDEDIR "@CMAKE_INSTALL_INCLUDEDIR@"
+#define LLVM_INSTALL_CMAKEDIR "@LLVM_INSTALL_CMAKE_DIR@"
+ #define LLVM_TARGETS_BUILT "@LLVM_TARGETS_BUILT@"
+ #define LLVM_SYSTEM_LIBS "@LLVM_SYSTEM_LIBS@"
+ #define LLVM_BUILD_SYSTEM "@LLVM_BUILD_SYSTEM@"
+diff --git a/tools/llvm-config/llvm-config.cpp b/tools/llvm-config/llvm-config.cpp
+index 7e74b7c90816..f185e9283f83 100644
+--- a/tools/llvm-config/llvm-config.cpp
+++ b/tools/llvm-config/llvm-config.cpp
+@@ -358,12 +358,26 @@ int main(int argc, char **argv) {
+         ("-I" + ActiveIncludeDir + " " + "-I" + ActiveObjRoot + "/include");
+   } else {
+     ActivePrefix = CurrentExecPrefix;
+-    ActiveIncludeDir = ActivePrefix + "/include";
+-    SmallString<256> path(StringRef(LLVM_TOOLS_INSTALL_DIR));
+-    sys::fs::make_absolute(ActivePrefix, path);
+-    ActiveBinDir = std::string(path.str());
+-    ActiveLibDir = ActivePrefix + "/lib" + LLVM_LIBDIR_SUFFIX;
+-    ActiveCMakeDir = ActiveLibDir + "/cmake/llvm";
+    {
+      SmallString<256> path(StringRef(LLVM_INSTALL_INCLUDEDIR));
+      sys::fs::make_absolute(ActivePrefix, path);
+      ActiveIncludeDir = std::string(path.str());
+    }
+    {
+      SmallString<256> path(StringRef(LLVM_INSTALL_BINDIR));
+      sys::fs::make_absolute(ActivePrefix, path);
+      ActiveBinDir = std::string(path.str());
+    }
+    {
+      SmallString<256> path(StringRef(LLVM_INSTALL_LIBDIR LLVM_LIBDIR_SUFFIX));
+      sys::fs::make_absolute(ActivePrefix, path);
+      ActiveLibDir = std::string(path.str());
+    }
+    {
+      SmallString<256> path(StringRef(LLVM_INSTALL_CMAKEDIR));
+      sys::fs::make_absolute(ActivePrefix, path);
+      ActiveCMakeDir = std::string(path.str());
+    }
+     ActiveIncludeOption = "-I" + ActiveIncludeDir;
+   }
+ 
+diff --git a/tools/lto/CMakeLists.txt b/tools/lto/CMakeLists.txt
+index 2963f97cad88..69d66c9c9ca1 100644
+--- a/tools/lto/CMakeLists.txt
+++ b/tools/lto/CMakeLists.txt
+@@ -25,7 +25,7 @@ add_llvm_library(LTO SHARED INSTALL_WITH_TOOLCHAIN ${SOURCES} DEPENDS
+     intrinsics_gen)
+ 
+ install(FILES ${LLVM_MAIN_INCLUDE_DIR}/llvm-c/lto.h
+-  DESTINATION include/llvm-c
+  DESTINATION ${CMAKE_INSTALL_INCLUDEDIR}/llvm-c
+   COMPONENT LTO)
+ 
+ if (APPLE)
+diff --git a/tools/opt-viewer/CMakeLists.txt b/tools/opt-viewer/CMakeLists.txt
+index ead73ec13a8f..250362021f17 100644
+--- a/tools/opt-viewer/CMakeLists.txt
+++ b/tools/opt-viewer/CMakeLists.txt
+@@ -8,7 +8,7 @@ set (files
+ 
+ foreach (file ${files})
+   install(PROGRAMS ${file}
+-    DESTINATION share/opt-viewer
+    DESTINATION ${CMAKE_INSTALL_DATADIR}/opt-viewer
+     COMPONENT opt-viewer)
+ endforeach (file)
+ 
+diff --git a/tools/remarks-shlib/CMakeLists.txt b/tools/remarks-shlib/CMakeLists.txt
+index e948496c603a..1f4df8a98b10 100644
+--- a/tools/remarks-shlib/CMakeLists.txt
+++ b/tools/remarks-shlib/CMakeLists.txt
+@@ -11,7 +11,7 @@ set(LLVM_EXPORTED_SYMBOL_FILE ${CMAKE_CURRENT_SOURCE_DIR}/Remarks.exports)
+ add_llvm_library(Remarks SHARED INSTALL_WITH_TOOLCHAIN ${SOURCES})
+ 
+ install(FILES ${LLVM_MAIN_INCLUDE_DIR}/llvm-c/Remarks.h
+-  DESTINATION include/llvm-c
+  DESTINATION ${CMAKE_INSTALL_INCLUDEDIR}/llvm-c
+   COMPONENT Remarks)
+ 
+ if (APPLE)
--- a/llvm/TLI-musl.patch
+++ b/llvm/TLI-musl.patch
@ -0,0 +1,35 @@
+From 5c571082fdaf61f6df19d9b7137dc26d71334058 Mon Sep 17 00:00:00 2001
+From: Natanael Copa <ncopa@alpinelinux.org>
+Date: Thu, 18 Feb 2016 10:33:04 +0100
+Subject: [PATCH 2/3] Fix build with musl libc
+
+On musl libc the fopen64 and fopen are the same thing, but for
+compatibility they have a `#define fopen64 fopen`. Same applies for
+fseek64, fstat64, fstatvfs64, ftello64, lstat64, stat64 and tmpfile64.
+---
+ include/llvm/Analysis/TargetLibraryInfo.h | 9 +++++++++
+ 1 file changed, 9 insertions(+)
+
+diff --git a/include/llvm/Analysis/TargetLibraryInfo.h b/include/llvm/Analysis/TargetLibraryInfo.h
+index 7becdf0..7f14427 100644
+--- a/include/llvm/Analysis/TargetLibraryInfo.h
+++ b/include/llvm/Analysis/TargetLibraryInfo.h
+@@ -18,6 +18,15 @@
+ #include "llvm/IR/Module.h"
+ #include "llvm/Pass.h"
+ 
+#undef fopen64
+#undef fseeko64
+#undef fstat64
+#undef fstatvfs64
+#undef ftello64
+#undef lstat64
+#undef stat64
+#undef tmpfile64
+
+ namespace llvm {
+ /// VecDesc - Describes a possible vectorization of a function.
+ /// Function 'VectorFnName' is equivalent to 'ScalarFnName' vectorized
+-- 
+2.7.3
+
--- a/llvm/aarch64.patch
+++ b/llvm/aarch64.patch
@ -0,0 +1,51 @@
+--- lib/Support/Unix/Memory.inc
+++ lib/Support/Unix/Memory.inc
+@@ -126,8 +126,12 @@
+   Result.Address = Addr;
+   Result.Size = NumPages*PageSize;
+ 
+-  if (PFlags & MF_EXEC)
+-    Memory::InvalidateInstructionCache(Result.Address, Result.Size);
+  // Rely on protectMappedMemory to invalidate instruction cache.
+  if (PFlags & MF_EXEC) {
+    EC = Memory::protectMappedMemory (Result, PFlags);
+    if (EC != std::error_code())
+      return MemoryBlock();
+  }
+ 
+   return Result;
+ }
+@@ -156,15 +160,31 @@
+     return std::error_code(EINVAL, std::generic_category());
+ 
+   int Protect = getPosixProtectionFlags(Flags);
+-
+   uintptr_t Start = alignAddr((uint8_t *)M.Address - PageSize + 1, PageSize);
+   uintptr_t End = alignAddr((uint8_t *)M.Address + M.Size, PageSize);
+
+  bool InvalidateCache = (Flags & MF_EXEC);
+
+#if defined(__arm__) || defined(__aarch64__)
+  // Certain ARM implementations treat icache clear instruction as a memory read,
+  // and CPU segfaults on trying to clear cache on !PROT_READ page.  Therefore we need
+  // to temporarily add PROT_READ for the sake of flushing the instruction caches.
+  if (InvalidateCache && !(Protect & PROT_READ)) {
+    int Result = ::mprotect((void *)Start, End - Start, Protect | PROT_READ);
+    if (Result != 0)
+      return std::error_code(errno, std::generic_category());
+
+    Memory::InvalidateInstructionCache(M.Address, M.Size);
+    InvalidateCache = false;
+  }
+#endif
+
+   int Result = ::mprotect((void *)Start, End - Start, Protect);
+ 
+   if (Result != 0)
+     return std::error_code(errno, std::generic_category());
+ 
+-  if (Flags & MF_EXEC)
+  if (InvalidateCache)
+     Memory::InvalidateInstructionCache(M.Address, M.Size);
+ 
+   return std::error_code();
--- a/llvm/clang-11-12-LLVMgold-path.patch
+++ b/llvm/clang-11-12-LLVMgold-path.patch
@ -0,0 +1,13 @@
+diff --git a/lib/Driver/ToolChains/CommonArgs.cpp b/lib/Driver/ToolChains/CommonArgs.cpp
+index 6b6e276b8ce7..7896542a1202 100644
+--- a/lib/Driver/ToolChains/CommonArgs.cpp
+++ b/lib/Driver/ToolChains/CommonArgs.cpp
+@@ -409,7 +409,7 @@ void tools::addLTOOptions(const ToolChain &ToolChain, const ArgList &Args,
+ 
+     SmallString<1024> Plugin;
+     llvm::sys::path::native(
+-        Twine(D.Dir) + "/../lib" CLANG_LIBDIR_SUFFIX "/LLVMgold" + Suffix,
+        Twine("@libllvmLibdir@" "/LLVMgold") + Suffix,
+         Plugin);
+     CmdArgs.push_back(Args.MakeArgString(Plugin));
+   }
--- a/llvm/clang-6-10-LLVMgold-path.patch
+++ b/llvm/clang-6-10-LLVMgold-path.patch
@ -0,0 +1,15 @@
+diff --git a/lib/Driver/ToolChains/CommonArgs.cpp b/lib/Driver/ToolChains/CommonArgs.cpp
+index 37ec73468570..b73e75aa6e59 100644
+--- a/lib/Driver/ToolChains/CommonArgs.cpp
+++ b/lib/Driver/ToolChains/CommonArgs.cpp
+@@ -370,8 +370,8 @@ void tools::AddGoldPlugin(const ToolChain &ToolChain, const ArgList &Args,
+ #endif
+ 
+   SmallString<1024> Plugin;
+-  llvm::sys::path::native(Twine(ToolChain.getDriver().Dir) +
+-                              "/../lib" CLANG_LIBDIR_SUFFIX "/LLVMgold" +
+  llvm::sys::path::native(Twine("@libllvmLibdir@"
+                                "/LLVMgold") +
+                               Suffix,
+                           Plugin);
+   CmdArgs.push_back(Args.MakeArgString(Plugin));
--- a/llvm/common/bintools.nix
+++ b/llvm/common/bintools.nix
@ -0,0 +1,48 @@
+{ lib, runCommand, stdenv, llvm, lld, version, release_version }:
+
+let
+  targetPrefix = lib.optionalString (stdenv.hostPlatform != stdenv.targetPlatform) "${stdenv.targetPlatform.config}-";
+in
+runCommand "llvm-binutils-${version}"
+{
+  preferLocalBuild = true;
+  passthru = {
+    isLLVM = true;
+  };
+}
+  (''
+    mkdir -p $out/bin
+    for prog in ${lld}/bin/*; do
+      ln -s $prog $out/bin/${targetPrefix}$(basename $prog)
+    done
+    for prog in ${llvm}/bin/*; do
+      ln -sf $prog $out/bin/${targetPrefix}$(basename $prog)
+    done
+
+    llvmBin="${llvm}/bin"
+
+    ln -s $llvmBin/llvm-ar $out/bin/${targetPrefix}ar
+    ln -s $llvmBin/llvm-ar $out/bin/${targetPrefix}dlltool
+    ln -s $llvmBin/llvm-ar $out/bin/${targetPrefix}ranlib
+    ln -s $llvmBin/llvm-cxxfilt $out/bin/${targetPrefix}c++filt
+    ln -s $llvmBin/llvm-dwp $out/bin/${targetPrefix}dwp
+    ln -s $llvmBin/llvm-nm $out/bin/${targetPrefix}nm
+    ln -s $llvmBin/llvm-objcopy $out/bin/${targetPrefix}objcopy
+    ln -s $llvmBin/llvm-objcopy $out/bin/${targetPrefix}strip
+    ln -s $llvmBin/llvm-objdump $out/bin/${targetPrefix}objdump
+    ln -s $llvmBin/llvm-readobj $out/bin/${targetPrefix}readelf
+    ln -s $llvmBin/llvm-size $out/bin/${targetPrefix}size
+    ln -s $llvmBin/llvm-strings $out/bin/${targetPrefix}strings
+    ln -s $llvmBin/llvm-symbolizer $out/bin/${targetPrefix}addr2line
+
+    if [ -e "$llvmBin/llvm-debuginfod" ]; then
+      ln -s $llvmBin/llvm-debuginfod $out/bin/${targetPrefix}debuginfod
+      ln -s $llvmBin/llvm-debuginfod-find $out/bin/${targetPrefix}debuginfod-find
+    fi
+
+    ln -s ${lld}/bin/lld $out/bin/${targetPrefix}ld
+
+    # Only >=13 show GNU windres compatible in help
+  '' + lib.optionalString (lib.versionAtLeast release_version "13") ''
+    ln -s $llvmBin/llvm-rc $out/bin/${targetPrefix}windres
+  '')
--- a/llvm/common/clang/5-8-purity.patch
+++ b/llvm/common/clang/5-8-purity.patch
@ -0,0 +1,30 @@
+From 4add81bba40dcec62c4ea4481be8e35ac53e89d8 Mon Sep 17 00:00:00 2001
+From: Will Dietz <w@wdtz.org>
+Date: Thu, 18 May 2017 11:56:12 -0500
+Subject: [PATCH] "purity" patch for 5.0
+
+---
+ lib/Driver/ToolChains/Gnu.cpp | 7 -------
+ 1 file changed, 7 deletions(-)
+
+diff --git a/lib/Driver/ToolChains/Gnu.cpp b/lib/Driver/ToolChains/Gnu.cpp
+index fe3c0191bb..c6a482bece 100644
+--- a/lib/Driver/ToolChains/Gnu.cpp
+++ b/lib/Driver/ToolChains/Gnu.cpp
+@@ -494,13 +494,6 @@ void tools::gnutools::Linker::ConstructJob(Compilation &C, const JobAction &JA,
+   if (!Args.hasArg(options::OPT_static)) {
+     if (Args.hasArg(options::OPT_rdynamic))
+       CmdArgs.push_back("-export-dynamic");
+-
+-    if (!Args.hasArg(options::OPT_shared)) {
+-      const std::string Loader =
+-          D.DyldPrefix + ToolChain.getDynamicLinker(Args);
+-      CmdArgs.push_back("-dynamic-linker");
+-      CmdArgs.push_back(Args.MakeArgString(Loader));
+-    }
+   }
+ 
+   CmdArgs.push_back("-o");
+-- 
+2.11.0
+
--- a/llvm/common/clang/add-nostdlibinc-flag.patch
+++ b/llvm/common/clang/add-nostdlibinc-flag.patch
@ -0,0 +1,18 @@
+diff --git a/lib/Driver/Driver.cpp b/lib/Driver/Driver.cpp
+index 3f29afd35971..223d2769cdfc 100644
+--- a/lib/Driver/Driver.cpp
+++ b/lib/Driver/Driver.cpp
+@@ -491,6 +491,13 @@ DerivedArgList *Driver::TranslateInputArgs(const InputArgList &Args) const {
+   }
+ #endif
+ 
+  {
+    Arg *A = DAL->MakeFlagArg(/*BaseArg=*/nullptr,
+                              Opts.getOption(options::OPT_nostdlibinc));
+    A->claim();
+    DAL->append(A);
+  }
+
+   return DAL;
+ }
+ 
--- a/llvm/common/lldb.nix
+++ b/llvm/common/lldb.nix
@ -0,0 +1,196 @@
+{ lib
+, stdenv
+, llvm_meta
+, release_version
+, cmake
+, zlib
+, ncurses
+, swig
+, which
+, libedit
+, libxml2
+, libllvm
+, libclang
+, python3
+, version
+, darwin
+, lit
+, makeWrapper
+, lua5_3
+, ninja
+, runCommand
+, src ? null
+, monorepoSrc ? null
+, patches ? [ ]
+, enableManpages ? false
+}:
+
+let
+  src' =
+    if monorepoSrc != null then
+      runCommand "lldb-src-${version}" { } ''
+        mkdir -p "$out"
+        cp -r ${monorepoSrc}/cmake "$out"
+        cp -r ${monorepoSrc}/lldb "$out"
+      '' else src;
+in
+
+stdenv.mkDerivation (rec {
+  passthru.monorepoSrc = monorepoSrc;
+  pname = "lldb";
+  inherit version;
+
+  src = src';
+  inherit patches;
+
+  outputs = [ "out" "lib" "dev" ];
+
+  sourceRoot = lib.optional (lib.versionAtLeast release_version "13") "${src.name}/${pname}";
+
+  nativeBuildInputs = [
+    cmake
+    python3
+    which
+    swig
+    lit
+    makeWrapper
+    lua5_3
+  ] ++ lib.optionals enableManpages [
+    python3.pkgs.sphinx
+    python3.pkgs.recommonmark
+  ] ++ lib.optionals (lib.versionAtLeast release_version "14") [
+    ninja
+  ];
+
+  buildInputs = [
+    ncurses
+    zlib
+    libedit
+    libxml2
+    libllvm
+  ] ++ lib.optionals stdenv.isDarwin [
+    darwin.libobjc
+    darwin.apple_sdk.libs.xpc
+    darwin.apple_sdk.frameworks.Foundation
+    darwin.bootstrap_cmds
+    darwin.apple_sdk.frameworks.Carbon
+    darwin.apple_sdk.frameworks.Cocoa
+  ]
+  # The older libSystem used on x86_64 macOS is missing the
+  # `<bsm/audit_session.h>` header which `lldb` uses.
+  #
+  # We copy this header over from macOS 10.12 SDK.
+  #
+  # See here for context:
+  # https://github.com/NixOS/nixpkgs/pull/194634#issuecomment-1272129132
+  ++ lib.optional
+    (
+      stdenv.targetPlatform.isDarwin
+        && !stdenv.targetPlatform.isAarch64
+        && (lib.versionAtLeast release_version "15")
+    )
+    (
+      runCommand "bsm-audit-session-header" { } ''
+        install -Dm444 \
+          "${lib.getDev darwin.apple_sdk.sdk}/include/bsm/audit_session.h" \
+          "$out/include/bsm/audit_session.h"
+      ''
+    );
+
+  hardeningDisable = [ "format" ];
+
+  cmakeFlags = [
+    "-DLLDB_INCLUDE_TESTS=${if doCheck then "YES" else "NO"}"
+    "-DLLVM_ENABLE_RTTI=OFF"
+    "-DClang_DIR=${lib.getDev libclang}/lib/cmake"
+    "-DLLVM_EXTERNAL_LIT=${lit}/bin/lit"
+  ] ++ lib.optionals stdenv.isDarwin [
+    "-DLLDB_USE_SYSTEM_DEBUGSERVER=ON"
+  ] ++ lib.optionals (!stdenv.isDarwin) [
+    "-DLLDB_CODESIGN_IDENTITY=" # codesigning makes nondeterministic
+  ] ++ lib.optionals enableManpages ([
+    "-DLLVM_ENABLE_SPHINX=ON"
+    "-DSPHINX_OUTPUT_MAN=ON"
+    "-DSPHINX_OUTPUT_HTML=OFF"
+  ] ++ lib.optionals (lib.versionAtLeast release_version "15") [
+    # docs reference `automodapi` but it's not added to the extensions list when
+    # only building the manpages:
+    # https://github.com/llvm/llvm-project/blob/af6ec9200b09039573d85e349496c4f5b17c3d7f/lldb/docs/conf.py#L54
+    #
+    # so, we just ignore the resulting errors
+    "-DSPHINX_WARNINGS_AS_ERRORS=OFF"
+  ]) ++ lib.optionals doCheck [
+    "-DLLDB_TEST_C_COMPILER=${stdenv.cc}/bin/${stdenv.cc.targetPrefix}cc"
+    "-DLLDB_TEST_CXX_COMPILER=${stdenv.cc}/bin/${stdenv.cc.targetPrefix}c++"
+  ];
+
+  doCheck = false;
+  doInstallCheck = lib.versionOlder release_version "15";
+
+  # TODO: cleanup with mass-rebuild
+  installCheckPhase = ''
+    if [ ! -e $lib/${python3.sitePackages}/lldb/_lldb*.so ] ; then
+        echo "ERROR: python files not installed where expected!";
+        return 1;
+    fi
+  '' # Something lua is built on older versions but this file doesn't exist.
+  + lib.optionalString (lib.versionAtLeast release_version "14") ''
+    if [ ! -e "$lib/lib/lua/${lua5_3.luaversion}/lldb.so" ] ; then
+        echo "ERROR: lua files not installed where expected!";
+        return 1;
+    fi
+  '';
+
+  postInstall = ''
+    wrapProgram $out/bin/lldb --prefix PYTHONPATH : $lib/${python3.sitePackages}/
+
+    # Editor support
+    # vscode:
+    install -D ../tools/lldb-vscode/package.json $out/share/vscode/extensions/llvm-org.lldb-vscode-0.1.0/package.json
+    mkdir -p $out/share/vscode/extensions/llvm-org.lldb-vscode-0.1.0/bin
+    ln -s $out/bin/*-vscode $out/share/vscode/extensions/llvm-org.lldb-vscode-0.1.0/bin
+  '';
+
+  meta = llvm_meta // {
+    homepage = "https://lldb.llvm.org/";
+    description = "A next-generation high-performance debugger";
+    longDescription = ''
+      LLDB is a next generation, high-performance debugger. It is built as a set
+      of reusable components which highly leverage existing libraries in the
+      larger LLVM Project, such as the Clang expression parser and LLVM
+      disassembler.
+    '';
+    # llvm <10 never built on aarch64-darwin since first introduction in nixpkgs
+    broken =
+      (lib.versionOlder release_version "11" && stdenv.isDarwin && stdenv.isAarch64)
+        || (((lib.versions.major release_version) == "13") && stdenv.isDarwin);
+  };
+} // lib.optionalAttrs enableManpages {
+  pname = "lldb-manpages";
+
+  buildPhase = lib.optionalString (lib.versionOlder release_version "15") ''
+    make ${if (lib.versionOlder release_version "12") then "docs-man" else "docs-lldb-man"}
+  '';
+
+
+  ninjaFlags = lib.optionals (lib.versionAtLeast release_version "15") [ "docs-lldb-man" ];
+
+  propagatedBuildInputs = [ ];
+
+  # manually install lldb man page
+  installPhase = ''
+    mkdir -p $out/share/man/man1
+    install docs/man/lldb.1 -t $out/share/man/man1/
+  '';
+
+  postPatch = null;
+  postInstall = null;
+
+  outputs = [ "out" ];
+
+  doCheck = false;
+
+  meta = llvm_meta // {
+    description = "man pages for LLDB ${version}";
+  };
+})
--- a/llvm/exegesis-force-bdver2.patch
+++ b/llvm/exegesis-force-bdver2.patch
@ -0,0 +1,11 @@
+diff --git a/test/tools/llvm-exegesis/X86/uops-CMOV16rm-noreg.s b/test/tools/llvm-exegesis/X86/uops-CMOV16rm-noreg.s
+index 3fc1f31d54dc..a4c9bdd92131 100644
+--- a/test/tools/llvm-exegesis/X86/uops-CMOV16rm-noreg.s
+++ b/test/tools/llvm-exegesis/X86/uops-CMOV16rm-noreg.s
+@@ -1,5 +1,6 @@
+ # RUN: llvm-exegesis -mode=uops -opcode-name=CMOV16rm  -benchmarks-file=%t.CMOV16rm-uops.yaml
+ # RUN: FileCheck -check-prefixes=CHECK-YAML -input-file=%t.CMOV16rm-uops.yaml %s
+# RUN: sed -i 's,cpu_name:.*,cpu_name: bdver2,g' %t.CMOV16rm-uops.yaml
+ # RUN: llvm-exegesis -mcpu=bdver2 -mode=analysis -benchmarks-file=%t.CMOV16rm-uops.yaml -analysis-clusters-output-file=- -analysis-clustering-epsilon=0.1 -analysis-inconsistency-epsilon=0.1 -analysis-numpoints=1 -analysis-clustering=naive | FileCheck -check-prefixes=CHECK-CLUSTERS %s
+ 
+ # https://bugs.llvm.org/show_bug.cgi?id=41448
--- a/llvm/libcxx-0001-musl-hacks.patch
+++ b/llvm/libcxx-0001-musl-hacks.patch
@ -0,0 +1,39 @@
+From 1c936d7fda3275265e37f93697232a1ed652390f Mon Sep 17 00:00:00 2001
+From: Will Dietz <w@wdtz.org>
+Date: Sat, 9 Jul 2016 19:22:54 -0500
+Subject: [PATCH] musl fixes/hacks
+
+Conflicts:
+
+	include/__config
+	include/locale
+	src/locale.cpp
+---
+ include/locale |    4 ++--
+ 1 files changed, 2 insertions(+), 2 deletions(-)
+
+diff --git a/include/locale b/include/locale
+index 3d804e8..9b01f5b 100644
+--- a/include/locale
+++ b/include/locale
+@@ -695,7 +695,7 @@ __num_get_signed_integral(const char* __a, const char* __a_end,
+         typename remove_reference<decltype(errno)>::type __save_errno = errno;
+         errno = 0;
+         char *__p2;
+-        long long __ll = strtoll_l(__a, &__p2, __base, _LIBCPP_GET_C_LOCALE);
+        long long __ll = strtoll(__a, &__p2, __base);
+         typename remove_reference<decltype(errno)>::type __current_errno = errno;
+         if (__current_errno == 0)
+             errno = __save_errno;
+@@ -735,7 +735,7 @@ __num_get_unsigned_integral(const char* __a, const char* __a_end,
+         typename remove_reference<decltype(errno)>::type __save_errno = errno;
+         errno = 0;
+         char *__p2;
+-        unsigned long long __ll = strtoull_l(__a, &__p2, __base, _LIBCPP_GET_C_LOCALE);
+        unsigned long long __ll = strtoull(__a, &__p2, __base);
+         typename remove_reference<decltype(errno)>::type __current_errno = errno;
+         if (__current_errno == 0)
+             errno = __save_errno;
+-- 
+1.7.1
+
--- a/llvm/llvm-7-musl.patch
+++ b/llvm/llvm-7-musl.patch
@ -0,0 +1,92 @@
+From 8c747d3157df2830eed9205e7caf1203b345de17 Mon Sep 17 00:00:00 2001
+From: Khem Raj <raj.khem@gmail.com>
+Date: Sat, 4 Feb 2023 13:54:41 -0800
+Subject: [PATCH] cmake: Enable 64bit off_t on 32bit glibc systems
+
+Pass -D_FILE_OFFSET_BITS=64 to compiler flags on 32bit glibc based
+systems. This will make sure that 64bit versions of LFS functions are
+used e.g. seek will behave same as lseek64. Also revert [1] partially
+because this added a cmake test to detect lseek64 but then forgot to
+pass the needed macro to actual compile, this test was incomplete too
+since libc implementations like musl has 64bit off_t by default on 32bit
+systems and does not bundle[2] -D_LARGEFILE64_SOURCE under -D_GNU_SOURCE
+like glibc, which means the compile now fails on musl because the cmake
+check passes but we do not have _LARGEFILE64_SOURCE defined. Using the
+*64 function was transitional anyways so use -D_FILE_OFFSET_BITS=64
+instead
+
+[1] https://github.com/llvm/llvm-project/commit/8db7e5e4eed4c4e697dc3164f2c9351d8c3e942b
+[2] https://git.musl-libc.org/cgit/musl/commit/?id=25e6fee27f4a293728dd15b659170e7b9c7db9bc
+
+Reviewed By: MaskRay
+
+Differential Revision: https://reviews.llvm.org/D139752
+
+(cherry picked from commit 5cd554303ead0f8891eee3cd6d25cb07f5a7bf67)
+---
+ cmake/config-ix.cmake              | 13 ++++++++++---
+ include/llvm/Config/config.h.cmake |  3 ---
+ lib/Support/raw_ostream.cpp        |  2 --
+ 3 files changed, 10 insertions(+), 8 deletions(-)
+
+diff --git a/cmake/config-ix.cmake b/cmake/config-ix.cmake
+index 18977d9950ff..b558aa83fa62 100644
+--- a/cmake/config-ix.cmake
+++ b/cmake/config-ix.cmake
+@@ -197,9 +197,6 @@ check_symbol_exists(posix_fallocate fcntl.h HAVE_POSIX_FALLOCATE)
+ if( HAVE_SIGNAL_H AND NOT LLVM_USE_SANITIZER MATCHES ".*Address.*" AND NOT APPLE )
+   check_symbol_exists(sigaltstack signal.h HAVE_SIGALTSTACK)
+ endif()
+-set(CMAKE_REQUIRED_DEFINITIONS "-D_LARGEFILE64_SOURCE")
+-check_symbol_exists(lseek64 "sys/types.h;unistd.h" HAVE_LSEEK64)
+-set(CMAKE_REQUIRED_DEFINITIONS "")
+ check_symbol_exists(mallctl malloc_np.h HAVE_MALLCTL)
+ check_symbol_exists(mallinfo malloc.h HAVE_MALLINFO)
+ check_symbol_exists(malloc_zone_statistics malloc/malloc.h
+@@ -237,6 +234,16 @@ if( PURE_WINDOWS )
+   check_function_exists(__main HAVE___MAIN)
+   check_function_exists(__cmpdi2 HAVE___CMPDI2)
+ endif()
+
+check_symbol_exists(__GLIBC__ stdio.h LLVM_USING_GLIBC)
+if( LLVM_USING_GLIBC )
+# enable 64bit off_t on 32bit systems using glibc
+  if (CMAKE_SIZEOF_VOID_P EQUAL 4)
+    add_compile_definitions(_FILE_OFFSET_BITS=64)
+    list(APPEND CMAKE_REQUIRED_DEFINITIONS "-D_FILE_OFFSET_BITS=64")
+  endif()
+endif()
+
+ if( HAVE_DLFCN_H )
+   if( HAVE_LIBDL )
+     list(APPEND CMAKE_REQUIRED_LIBRARIES dl)
+diff --git a/include/llvm/Config/config.h.cmake b/include/llvm/Config/config.h.cmake
+index e934617d7ec7..3c39c373b3c1 100644
+--- a/include/llvm/Config/config.h.cmake
+++ b/include/llvm/Config/config.h.cmake
+@@ -112,9 +112,6 @@
+ /* Define to 1 if you have the <link.h> header file. */
+ #cmakedefine HAVE_LINK_H ${HAVE_LINK_H}
+ 
+-/* Define to 1 if you have the `lseek64' function. */
+-#cmakedefine HAVE_LSEEK64 ${HAVE_LSEEK64}
+-
+ /* Define to 1 if you have the <mach/mach.h> header file. */
+ #cmakedefine HAVE_MACH_MACH_H ${HAVE_MACH_MACH_H}
+ 
+diff --git a/lib/Support/raw_ostream.cpp b/lib/Support/raw_ostream.cpp
+index 038ad00bd608..921ab8409008 100644
+--- a/lib/Support/raw_ostream.cpp
+++ b/lib/Support/raw_ostream.cpp
+@@ -677,8 +677,6 @@ uint64_t raw_fd_ostream::seek(uint64_t off) {
+   flush();
+ #ifdef _WIN32
+   pos = ::_lseeki64(FD, off, SEEK_SET);
+-#elif defined(HAVE_LSEEK64)
+-  pos = ::lseek64(FD, off, SEEK_SET);
+ #else
+   pos = ::lseek(FD, off, SEEK_SET);
+ #endif
+-- 
+2.37.1
+
--- a/llvm/llvm-config-link-static.patch
+++ b/llvm/llvm-config-link-static.patch
@ -0,0 +1,12 @@
+diff --git llvm/tools/llvm-config/CMakeLists.txt llvm/tools/llvm-config/CMakeLists.txt
+index 16ba54c0cf2f..20b017195e84 100644
+--- llvm/tools/llvm-config/CMakeLists.txt
+++ llvm/tools/llvm-config/CMakeLists.txt
+@@ -6,6 +6,7 @@ set(BUILDVARIABLES_OBJPATH ${CMAKE_CURRENT_BINARY_DIR}/BuildVariables.inc)
+ # Add the llvm-config tool.
+ add_llvm_tool(llvm-config
+   llvm-config.cpp
+  DISABLE_LLVM_LINK_LLVM_DYLIB
+   )
+ 
+ # Compute the substitution values for various items.
--- a/llvm/multi.nix
+++ b/llvm/multi.nix
@ -0,0 +1,60 @@
+{ runCommand,
+clang,
+gcc64,
+gcc32,
+glibc_multi
+}:
+
+let
+  combine = basegcc: runCommand "combine-gcc-libc" {} ''
+    mkdir -p $out
+    cp -r ${basegcc.cc}/lib $out/lib
+
+    chmod u+rw -R $out/lib
+    cp -r ${basegcc.libc}/lib/* $(ls -d $out/lib/gcc/*/*)
+  '';
+  gcc_multi_sysroot = runCommand "gcc-multi-sysroot" {
+    passthru = {
+      inherit (gcc64) version;
+      lib = gcc_multi_sysroot;
+    };
+  } ''
+    mkdir -p $out/lib{,64}/gcc
+
+    ln -s ${combine gcc64}/lib/gcc/* $out/lib64/gcc/
+    ln -s ${combine gcc32}/lib/gcc/* $out/lib/gcc/
+    # XXX: This shouldn't be needed, clang just doesn't look for "i686-unknown"
+    ln -s $out/lib/gcc/i686-unknown-linux-gnu $out/lib/gcc/i686-pc-linux-gnu
+
+
+    # includes
+    mkdir -p $out/include
+    ln -s ${glibc_multi.dev}/include/* $out/include
+    ln -s ${gcc64.cc}/include/c++ $out/include/c++
+
+    # dynamic linkers
+    mkdir -p $out/lib/32
+    ln -s ${glibc_multi.out}/lib/ld-linux* $out/lib
+    ln -s ${glibc_multi.out}/lib/32/ld-linux* $out/lib/32/
+  '';
+
+  clangMulti = clang.override {
+    # Only used for providing expected structure re:dynamic linkers, AFAIK Most
+    # of the magic is done by setting the --gcc-toolchain option via
+    # `gccForLibs`.
+    libc = gcc_multi_sysroot;
+
+    bintools = clang.bintools.override {
+      libc = gcc_multi_sysroot;
+    };
+
+    gccForLibs = gcc_multi_sysroot // {
+      inherit (glibc_multi) libgcc;
+      langCC =
+        assert (gcc64.cc.langCC != gcc32.cc.langCC)
+               -> throw "(gcc64.cc.langCC=${gcc64.cc.langCC}) != (gcc32.cc.langCC=${gcc32.cc.langCC})";
+        gcc64.cc.langCC;
+    };
+  };
+
+in clangMulti
--- a/openocd/common.cfg
+++ b/openocd/common.cfg
@ -0,0 +1,20 @@
+set XC7_JSHUTDOWN 0x0d
+set XC7_JPROGRAM 0x0b
+set XC7_JSTART 0x0c
+set XC7_BYPASS 0x3f
+
+proc xc7_program {tap} {
+    global XC7_JSHUTDOWN XC7_JPROGRAM XC7_JSTART XC7_BYPASS
+    irscan $tap $XC7_JSHUTDOWN
+    irscan $tap $XC7_JPROGRAM
+    runtest 60000
+    #JSTART prevents this from working...
+    #irscan $tap $XC7_JSTART
+    runtest 2000
+    irscan $tap $XC7_BYPASS
+    runtest 2000
+}
+
+pld device virtex2 zynq.tap 1
+init
+xc7_program zynq.tap
--- a/Show More
+++ b/Show More
				`@ -1 +0,0 @@`
				`nix-shell --command "cargo xbuild --release -p experiments" && scp -C target/armv7-none-eabihf/release/experiments $1@rpi-4.m-labs.hk:/home/$1/zc706/zc706.elf`