Compare commits

..

69 Commits

Author SHA1 Message Date
stevefan1999 fdb658839b Merge branch 'master' into master 2021-12-06 16:23:29 +08:00
Steve Fan 24747f09cd fixup! session: send host any async errors detection if found 2021-12-06 15:23:34 +08:00
stevefan1999 a4fbb96296 little fixes for README (#157)
Co-authored-by: Steve Fan <sf@m-labs.hk>
Reviewed-on: M-Labs/artiq-zynq#157
Co-authored-by: stevefan1999 <sf@m-labs.hk>
Co-committed-by: stevefan1999 <sf@m-labs.hk>
2021-12-06 15:20:55 +08:00
Steve Fan 851ed095df session: send host any async errors detection if found 2021-12-06 15:00:59 +08:00
Steve Fan dbc3f581e5 rtio_mgt: capture occurrences of async errors to a global variable 2021-12-06 14:51:46 +08:00
mwojcik 64fecf09b7 restore kasli-soc satellite variant check 2021-12-03 19:20:54 +08:00
mwojcik 31fb2b388a Support for DRTIO 100MHz (#155)
Co-authored-by: mwojcik <mw@m-labs.hk>
Co-committed-by: mwojcik <mw@m-labs.hk>
2021-12-03 17:19:42 +08:00
mwojcik e045837b67 zc706: not actually ultrascale 2021-11-29 12:48:45 +08:00
mwojcik ada3f2e704 drtio: reading still needs work buffer after all 2021-11-29 12:46:08 +08:00
mwojcik 8be5048cd3 upgrade to new clock configuration system (#152)
As mentioned in https://github.com/m-labs/artiq/issues/1735 - this is the Zynq version.

Reviewed-on: M-Labs/artiq-zynq#152
Co-authored-by: mwojcik <mw@m-labs.hk>
Co-committed-by: mwojcik <mw@m-labs.hk>
2021-11-29 11:17:59 +08:00
mwojcik e8db2a4b49 drtio: crc from mainline, removed byte swap 2021-11-24 12:12:40 +08:00
mwojcik 4218354e65 zc706: updated device_db for tests 2021-10-16 19:01:54 +08:00
mwojcik 2376f9ab5e Merge pull request 'zc706: added dummy spi' (#149) from mwojcik/artiq-zynq:zc706_dummy_spi into master
Reviewed-on: M-Labs/artiq-zynq#149
2021-10-14 16:38:06 +08:00
mwojcik 0b27349ec4 dummy_spi -> pmod_spi 2021-10-14 16:37:13 +08:00
mwojcik 21eb1cab1a zc706: added dummy spi in place of sdio 2021-10-14 15:43:51 +08:00
mwojcik 3096daaaee zc706: removed nist_clock sdcard, put pmod instead 2021-10-14 15:01:38 +08:00
mwojcik 4fbfccf575 zc706: fix nist_qc2 extension, ams101 iostandard 2021-10-14 12:39:09 +08:00
mwojcik 5c40115945 make ZC706 RTIO channels consistent with KC705
Reviewed-on: M-Labs/artiq-zynq#147
Co-authored-by: mwojcik <mw@m-labs.hk>
Co-committed-by: mwojcik <mw@m-labs.hk>
2021-10-13 17:20:25 +08:00
Sebastien Bourdeauducq a5e3580d18 Revert "runtime: expose rint from libm"
This reverts commit 3582af564d.
2021-10-11 08:13:26 +08:00
Sebastien Bourdeauducq 3582af564d runtime: expose rint from libm 2021-10-10 20:40:29 +08:00
mwojcik 742ce9fdde fix sd and acpki satellite builds 2021-10-08 15:18:23 +02:00
mwojcik c4de1c261a default.nix: restored proper satellite variants 2021-10-08 15:13:56 +02:00
mwojcik 219c075931 added explicit runtime/satman targets for makefile
Reviewed-on: M-Labs/artiq-zynq#144
Co-authored-by: mwojcik <mw@m-labs.hk>
Co-committed-by: mwojcik <mw@m-labs.hk>
2021-10-08 21:06:23 +08:00
mwojcik d04a7decfe removed simple variants from zc706 2021-10-08 11:07:12 +02:00
mwojcik 0efa83e956 update build scripts for DRTIO
Reviewed-on: M-Labs/artiq-zynq#135
Co-authored-by: mwojcik <mw@m-labs.hk>
Co-committed-by: mwojcik <mw@m-labs.hk>
2021-10-08 16:25:13 +08:00
Sebastien Bourdeauducq 4fa824f42b kasli-soc: remove irrelevant comment 2021-10-08 16:13:17 +08:00
mwojcik ab0c205dd2 gateware: add DRTIO
Reviewed-on: M-Labs/artiq-zynq#140
Co-authored-by: mwojcik <mw@m-labs.hk>
Co-committed-by: mwojcik <mw@m-labs.hk>
2021-10-08 16:12:30 +08:00
mwojcik 8d2bb09149 add satman firmware (#136)
Reviewed-on: M-Labs/artiq-zynq#136
Co-authored-by: mwojcik <mw@m-labs.hk>
Co-committed-by: mwojcik <mw@m-labs.hk>
2021-10-08 16:04:50 +08:00
Sebastien Bourdeauducq 41295b0e01 update cargoSha256 2021-10-06 19:43:01 +08:00
mwojcik aaec0abdf6 fix build/warnings before drtio is fully merged 2021-10-06 16:17:19 +08:00
mwojcik e241957419 add libbuild_zynq
Reviewed-on: M-Labs/artiq-zynq#141
Co-authored-by: mwojcik <mw@m-labs.hk>
Co-committed-by: mwojcik <mw@m-labs.hk>
2021-10-06 16:16:49 +08:00
mwojcik 50262b3f0c runtime: link_thread -> link_task 2021-10-06 07:59:55 +02:00
mwojcik 827c6c1306 runtime: switch to libio/libboard_artiq, add DRTIO mastering support
Reviewed-on: M-Labs/artiq-zynq#137
Co-authored-by: mwojcik <mw@m-labs.hk>
Co-committed-by: mwojcik <mw@m-labs.hk>
2021-10-06 13:05:45 +08:00
mwojcik e6863263b4 add libboard_artiq (to be shared between runtime and satman)
Reviewed-on: M-Labs/artiq-zynq#139
Co-authored-by: mwojcik <mw@m-labs.hk>
Co-committed-by: mwojcik <mw@m-labs.hk>
2021-10-06 13:02:28 +08:00
mwojcik d7f45d473e add libio (to be shared between runtime and satman)
Reviewed-on: M-Labs/artiq-zynq#138
Co-authored-by: mwojcik <mw@m-labs.hk>
Co-committed-by: mwojcik <mw@m-labs.hk>
2021-10-06 13:01:52 +08:00
pca006132 35250b3f56 libdyld: fixed symbol relocation
Note that in libdyld/src/lib.rs #117-118, image pointer is already added
to the symbol offset, so we do not need to add the pointer again
2021-09-25 11:30:45 +08:00
Sebastien Bourdeauducq 2ed2ffe417 update dependencies 2021-08-09 15:16:54 +08:00
Sebastien Bourdeauducq 18e05c91e1 zc706: si5324 is not needed for standalone target 2021-08-04 09:14:19 +08:00
mwojcik e3d3cb2311 si5324: bring on par with mainline ARTIQ (#132)
si5324 driver in runtime should be now equal in function to the one in artiq.

kasli-soc has no way of doing a hard reset on the peripheral, but zc706 does.

Reviewed-on: M-Labs/artiq-zynq#132
Co-authored-by: mwojcik <mw@m-labs.hk>
Co-committed-by: mwojcik <mw@m-labs.hk>
2021-08-04 09:12:38 +08:00
Sebastien Bourdeauducq f543501012 si5324: remove debug print 2021-08-02 14:14:59 +08:00
Sebastien Bourdeauducq 111ac0c716 runtime: clock Si5324 from its crystal 2021-07-30 17:07:58 +08:00
Sebastien Bourdeauducq 8128dc0b56 Revert "kasli-soc: work around I2C breakage (#130)"
This reverts commit f1fd55dee5.
2021-07-30 16:55:06 +08:00
Sebastien Bourdeauducq cbcda286dc Revert "README: stable ARTIQ channel"
This reverts commit 4f1689f254.
2021-07-07 18:07:49 +08:00
Sebastien Bourdeauducq dcb6129b0e update dependencies 2021-07-05 13:56:40 +08:00
Sebastien Bourdeauducq f5933092c9 nixpkgs 21.05 2021-06-29 15:07:26 +08:00
Sebastien Bourdeauducq f25e261bdd update dependencies 2021-06-25 17:12:47 +08:00
Sebastien Bourdeauducq 44c2c0fe4d support Kasli-SoC in run scripts 2021-06-25 17:03:55 +08:00
Sebastien Bourdeauducq 4c2c23fcdd shell.nix: install pyftdi (for POR GPIO) 2021-06-25 16:03:26 +08:00
Sebastien Bourdeauducq 480a80cab7 shell.nix: use kasli-soc SZL 2021-06-25 16:03:07 +08:00
Sebastien Bourdeauducq 2ba4d8935d fix compilation with nixpkgs 21.05
The environment variable is optional to keep compatibility with other build environments.

Closes #131
2021-06-25 15:57:39 +08:00
Sebastien Bourdeauducq 8c8a5d53b9 update dependencies 2021-06-19 22:51:25 +08:00
Sebastien Bourdeauducq 852123b42a kasli-soc: add RTIO LEDs 2021-05-30 20:40:53 +08:00
Sebastien Bourdeauducq f1fd55dee5 kasli-soc: work around I2C breakage (#130) 2021-05-29 17:13:41 +08:00
Sebastien Bourdeauducq 21d98711c1 use new smoltcp error code 2021-05-29 17:13:22 +08:00
Sebastien Bourdeauducq 0ae2138034 kasli-soc: preliminary si5324 support 2021-05-29 16:15:27 +08:00
Sebastien Bourdeauducq ce9d38827b update cargoSha256 2021-05-29 14:57:54 +08:00
Sebastien Bourdeauducq 1b474d2dd4 update dependencies 2021-05-29 14:20:23 +08:00
Sebastien Bourdeauducq 4f1689f254 README: stable ARTIQ channel 2021-02-17 19:33:13 +08:00
Sebastien Bourdeauducq 506c741238 support absence of gateware RTIO clock selection mux 2021-02-15 21:41:30 +08:00
Sebastien Bourdeauducq 8815f76114 kasli_soc: fix has_grabber 2021-02-15 21:41:02 +08:00
Sebastien Bourdeauducq ef18fa4c6d kasli_soc: add RTIO log channel 2021-02-15 19:56:59 +08:00
Sebastien Bourdeauducq faf9714e10 add demo build for Kasli-SoC 2021-02-15 19:52:13 +08:00
Sebastien Bourdeauducq c90cb7adad add Kasli-SoC demo JSON 2021-02-15 19:51:46 +08:00
Sebastien Bourdeauducq 8d4e42be32 remove redpitaya and coraz7 support 2021-02-15 19:30:13 +08:00
Sebastien Bourdeauducq dcd3cbc488 update copyright year 2021-02-15 19:16:22 +08:00
Astro fcb38fae6c runtime: disable TCP delayed ack 2021-02-08 03:24:18 +01:00
Astro bfd8343876 update zynq-rs and dependencies (smoltcp 0.7.0) 2021-02-08 03:24:18 +01:00
Sebastien Bourdeauducq 4039431533 kasli_soc: fix eem iostandards 2021-02-07 22:34:29 +08:00
Sebastien Bourdeauducq 3f9bd06468 add Kasli-SoC generic gateware builder (WIP) 2021-02-07 14:44:32 +08:00
50 changed files with 4487 additions and 759 deletions

View File

@ -24,7 +24,7 @@ The following configuration keys are available:
- ``ip``: IPv4 address. - ``ip``: IPv4 address.
- ``ip6``: IPv6 address. - ``ip6``: IPv6 address.
- ``startup``: startup kernel in ELF format (as produced by ``artiq_compile``). - ``startup``: startup kernel in ELF format (as produced by ``artiq_compile``).
- ``rtioclk``: source of RTIO clock; valid values are ``external`` and ``internal``. - ``rtio_clock``: source of RTIO clock; valid values are ``ext0_bypass`` and ``int_125``.
- ``boot``: SD card "boot.bin" file, for replacing the boot firmware/gateware. Write only. - ``boot``: SD card "boot.bin" file, for replacing the boot firmware/gateware. Write only.
Configurations can be read/written/removed via ``artiq_coremgmt``. Config erase is Configurations can be read/written/removed via ``artiq_coremgmt``. Config erase is
@ -45,7 +45,7 @@ Note: if you are using Nix channels the first time, you need to be aware of this
Pure build with Nix and execution on a remote JTAG server: Pure build with Nix and execution on a remote JTAG server:
```shell ```shell
nix-build -A zc706-simple-jtag # or zc706-nist_qc2-jtag or zc706-nist_clock-jtag nix-build -A zc706-nist_clock-jtag # or zc706-nist_qc2-jtag or zc706-nist_clock_satellite-jtag etc.
./remote_run.sh ./remote_run.sh
``` ```
@ -54,19 +54,23 @@ Impure incremental build and execution on a remote JTAG server:
```shell ```shell
nix-shell nix-shell
cd src cd src
gateware/zc706.py -g ../build/gateware # build gateware gateware/zc706.py -g ../build/gateware -v <variant> # build gateware
make # build firmware make GWARGS="-V <variant>" <runtime/satman> # build firmware
cd .. cd ..
./remote_run.sh -i ./remote_run.sh -i
``` ```
Notes: Notes:
- This is developed with Nixpkgs 21.05, and the ``nixbld.m-labs.hk`` binary substituter can also be used here (see the ARTIQ manual for the public key and instructions). - This is developed with Nixpkgs 21.05[^1], and the ``nixbld.m-labs.hk`` binary substituter can also be used here (see the ARTIQ manual for the public key and instructions).
- The impure build process is also compatible with non-Nix systems. - The impure build process is also compatible with non-Nix systems.
- When calling make, you need to specify both the variant and firmware type.
- Firmware type must be either ``runtime`` for DRTIO-less or DRTIO master variants, or ``satman`` for DRTIO satellite.
- If the board is connected to the local machine, use the ``local_run.sh`` script. - If the board is connected to the local machine, use the ``local_run.sh`` script.
- To update ``zynq-rs``, update the cargo files as per usual for Rust projects, but also keep ``zynq-rs.nix`` in sync. - To update ``zynq-rs``, update the cargo files as per usual for Rust projects, but also keep ``zynq-rs.nix`` in sync.
[^1]: Thus, on newer version of NixOS, you should run `nix-shell -I nixpkgs=https://github.com/NixOS/nixpkgs/archive/21.05.tar.gz` instead
License License
------- -------

View File

@ -8,23 +8,31 @@ let
vivado = import <artiq-fast/vivado.nix> { inherit pkgs; }; vivado = import <artiq-fast/vivado.nix> { inherit pkgs; };
# FSBL configuration supplied by Vivado 2020.1 for these boards: # FSBL configuration supplied by Vivado 2020.1 for these boards:
fsblTargets = ["zc702" "zc706" "zed"]; fsblTargets = ["zc702" "zc706" "zed"];
build = { target, variant }: let sat_variants = [
# kasli-soc satellite variants
"satellite"
# zc706 satellite variants
"nist_clock_satellite" "nist_qc2_satellite" "acpki_nist_clock_satellite" "acpki_nist_qc2_satellite"
"nist_clock_satellite_100mhz" "nist_qc2_satellite_100mhz" "acpki_nist_clock_satellite_100mhz" "acpki_nist_qc2_satellite_100mhz"
];
build = { target, variant, json ? null }: let
szl = (import zynq-rs)."${target}-szl"; szl = (import zynq-rs)."${target}-szl";
fsbl = import "${zynq-rs}/nix/fsbl.nix" { fsbl = import "${zynq-rs}/nix/fsbl.nix" {
inherit pkgs; inherit pkgs;
board = target; board = target;
}; };
fwtype = if builtins.elem variant sat_variants then "satman" else "runtime";
firmware = rustPlatform.buildRustPackage rec { firmware = rustPlatform.buildRustPackage rec {
# note: due to fetchCargoTarball, cargoSha256 depends on package name # note: due to fetchCargoTarball, cargoSha256 depends on package name
name = "firmware"; name = "firmware";
src = ./src; src = ./src;
cargoSha256 = "1g1nb8jz1na1v60hq3zrpgrwnw9qz7xrnnr2lkiyhsp72bg52ssl"; cargoSha256 = "sha256-uiwESZNwPdVnDkA1n0v1DQHp3rTazDkgIYscVTpgNq0=";
nativeBuildInputs = [ nativeBuildInputs = [
pkgs.gnumake pkgs.gnumake
(pkgs.python3.withPackages(ps: (with artiqpkgs; [ migen migen-axi misoc artiq ]))) (pkgs.python3.withPackages(ps: (with artiqpkgs; [ ps.jsonschema migen migen-axi misoc artiq ])))
cargo-xbuild cargo-xbuild
pkgs.llvmPackages_9.llvm pkgs.llvmPackages_9.llvm
pkgs.llvmPackages_9.clang-unwrapped pkgs.llvmPackages_9.clang-unwrapped
@ -33,15 +41,15 @@ let
export XARGO_RUST_SRC="${rustPlatform.rust.rustc}/lib/rustlib/src/rust/library" export XARGO_RUST_SRC="${rustPlatform.rust.rustc}/lib/rustlib/src/rust/library"
export CLANG_EXTRA_INCLUDE_DIR="${pkgs.llvmPackages_9.clang-unwrapped.lib}/lib/clang/9.0.1/include" export CLANG_EXTRA_INCLUDE_DIR="${pkgs.llvmPackages_9.clang-unwrapped.lib}/lib/clang/9.0.1/include"
export CARGO_HOME=$(mktemp -d cargo-home.XXX) export CARGO_HOME=$(mktemp -d cargo-home.XXX)
make TARGET=${target} VARIANT=${variant} make TARGET=${target} GWARGS="${if json == null then "-V ${variant}" else json}" ${fwtype}
''; '';
installPhase = '' installPhase = ''
mkdir -p $out $out/nix-support mkdir -p $out $out/nix-support
cp ../build/runtime.bin $out/runtime.bin cp ../build/${fwtype}.bin $out/${fwtype}.bin
cp ../build/firmware/armv7-none-eabihf/release/runtime $out/runtime.elf cp ../build/firmware/armv7-none-eabihf/release/${fwtype} $out/${fwtype}.elf
echo file binary-dist $out/runtime.bin >> $out/nix-support/hydra-build-products echo file binary-dist $out/${fwtype}.bin >> $out/nix-support/hydra-build-products
echo file binary-dist $out/runtime.elf >> $out/nix-support/hydra-build-products echo file binary-dist $out/${fwtype}.elf >> $out/nix-support/hydra-build-products
''; '';
doCheck = false; doCheck = false;
@ -50,12 +58,12 @@ let
gateware = pkgs.runCommand "${target}-${variant}-gateware" gateware = pkgs.runCommand "${target}-${variant}-gateware"
{ {
nativeBuildInputs = [ nativeBuildInputs = [
(pkgs.python3.withPackages(ps: (with artiqpkgs; [ migen migen-axi misoc artiq ]))) (pkgs.python3.withPackages(ps: (with artiqpkgs; [ ps.jsonschema migen migen-axi misoc artiq ])))
vivado vivado
]; ];
} }
'' ''
python ${./src/gateware}/${target}.py -g build -V ${variant} python ${./src/gateware}/${target}.py -g build ${if json == null then "-V ${variant}" else json}
mkdir -p $out $out/nix-support mkdir -p $out $out/nix-support
cp build/top.bit $out cp build/top.bit $out
echo file binary-dist $out/top.bit >> $out/nix-support/hydra-build-products echo file binary-dist $out/top.bit >> $out/nix-support/hydra-build-products
@ -66,7 +74,7 @@ let
'' ''
mkdir $out mkdir $out
ln -s ${szl}/szl.elf $out ln -s ${szl}/szl.elf $out
ln -s ${firmware}/runtime.bin $out ln -s ${firmware}/${fwtype}.bin $out
ln -s ${gateware}/top.bit $out ln -s ${gateware}/top.bit $out
''; '';
sd = pkgs.runCommand "${target}-${variant}-sd" sd = pkgs.runCommand "${target}-${variant}-sd"
@ -79,14 +87,14 @@ let
bifdir=`mktemp -d` bifdir=`mktemp -d`
cd $bifdir cd $bifdir
ln -s ${szl}/szl.elf szl.elf ln -s ${szl}/szl.elf szl.elf
ln -s ${firmware}/runtime.elf runtime.elf ln -s ${firmware}/${fwtype}.elf ${fwtype}.elf
ln -s ${gateware}/top.bit top.bit ln -s ${gateware}/top.bit top.bit
cat > boot.bif << EOF cat > boot.bif << EOF
the_ROM_image: the_ROM_image:
{ {
[bootloader]szl.elf [bootloader]szl.elf
top.bit top.bit
runtime.elf ${fwtype}.elf
} }
EOF EOF
mkdir $out $out/nix-support mkdir $out $out/nix-support
@ -104,13 +112,13 @@ let
cd $bifdir cd $bifdir
ln -s ${fsbl}/fsbl.elf fsbl.elf ln -s ${fsbl}/fsbl.elf fsbl.elf
ln -s ${gateware}/top.bit top.bit ln -s ${gateware}/top.bit top.bit
ln -s ${firmware}/runtime.elf runtime.elf ln -s ${firmware}/${fwtype}.elf ${fwtype}.elf
cat > boot.bif << EOF cat > boot.bif << EOF
the_ROM_image: the_ROM_image:
{ {
[bootloader]fsbl.elf [bootloader]fsbl.elf
top.bit top.bit
runtime.elf ${fwtype}.elf
} }
EOF EOF
mkdir $out $out/nix-support mkdir $out $out/nix-support
@ -131,17 +139,24 @@ let
); );
in in
( (
(build { target = "zc706"; variant = "simple"; }) //
(build { target = "zc706"; variant = "nist_clock"; }) // (build { target = "zc706"; variant = "nist_clock"; }) //
(build { target = "zc706"; variant = "nist_clock_master"; }) //
(build { target = "zc706"; variant = "nist_clock_satellite"; }) //
(build { target = "zc706"; variant = "nist_clock_satellite_100mhz"; }) //
(build { target = "zc706"; variant = "nist_qc2"; }) // (build { target = "zc706"; variant = "nist_qc2"; }) //
(build { target = "zc706"; variant = "acpki_simple"; }) // (build { target = "zc706"; variant = "nist_qc2_master"; }) //
(build { target = "zc706"; variant = "nist_qc2_satellite"; }) //
(build { target = "zc706"; variant = "nist_qc2_satellite_100mhz"; }) //
(build { target = "zc706"; variant = "acpki_nist_clock"; }) // (build { target = "zc706"; variant = "acpki_nist_clock"; }) //
(build { target = "zc706"; variant = "acpki_nist_clock_master"; }) //
(build { target = "zc706"; variant = "acpki_nist_clock_satellite"; }) //
(build { target = "zc706"; variant = "acpki_nist_clock_satellite_100mhz"; }) //
(build { target = "zc706"; variant = "acpki_nist_qc2"; }) // (build { target = "zc706"; variant = "acpki_nist_qc2"; }) //
(build { target = "coraz7"; variant = "10"; }) // (build { target = "zc706"; variant = "acpki_nist_qc2_master"; }) //
(build { target = "coraz7"; variant = "07s"; }) // (build { target = "zc706"; variant = "acpki_nist_qc2_satellite"; }) //
(build { target = "coraz7"; variant = "acpki_10"; }) // (build { target = "zc706"; variant = "acpki_nist_qc2_satellite_100mhz"; }) //
(build { target = "coraz7"; variant = "acpki_07s"; }) // (build { target = "kasli_soc"; variant = "demo"; json = ./demo.json; }) //
(build { target = "redpitaya"; variant = "simple"; }) // (build { target = "kasli_soc"; variant = "master"; json = ./kasli-soc-master.json; }) //
(build { target = "redpitaya"; variant = "acpki_simple"; }) // (build { target = "kasli_soc"; variant = "satellite"; json = ./kasli-soc-satellite.json; }) //
{ inherit zynq-rs; } { inherit zynq-rs; }
) )

60
demo.json Normal file
View File

@ -0,0 +1,60 @@
{
"target": "kasli_soc",
"variant": "demo",
"hw_rev": "v1.0",
"base": "standalone",
"peripherals": [
{
"type": "grabber",
"ports": [0]
},
{
"type": "dio",
"ports": [1],
"bank_direction_low": "input",
"bank_direction_high": "output"
},
{
"type": "dio",
"ports": [2],
"bank_direction_low": "output",
"bank_direction_high": "output"
},
{
"type": "urukul",
"dds": "ad9910",
"ports": [3, 4],
"clk_sel": 2
},
{
"type": "zotino",
"ports": [5]
},
{
"type": "sampler",
"ports": [6, 7]
},
{
"type": "mirny",
"ports": [8],
"clk_sel": 1,
"refclk": 125e6
},
{
"type": "fastino",
"ports": [9]
},
{
"type": "dio",
"ports": [10],
"bank_direction_low": "input",
"bank_direction_high": "input"
},
{
"type": "dio",
"ports": [11],
"bank_direction_low": "output",
"bank_direction_high": "input"
}
]
}

View File

@ -29,30 +29,11 @@ device_db = {
"class": "PCA9548" "class": "PCA9548"
}, },
# led? are common to all variants
"led0": { "led0": {
"type": "local", "type": "local",
"module": "artiq.coredevice.ttl", "module": "artiq.coredevice.ttl",
"class": "TTLOut", "class": "TTLOut",
"arguments": {"channel": 0}, "arguments": {"channel": 41},
},
"led1": {
"type": "local",
"module": "artiq.coredevice.ttl",
"class": "TTLOut",
"arguments": {"channel": 1},
},
"led2": {
"type": "local",
"module": "artiq.coredevice.ttl",
"class": "TTLOut",
"arguments": {"channel": 2}
},
"led3": {
"type": "local",
"module": "artiq.coredevice.ttl",
"class": "TTLOut",
"arguments": {"channel": 3}
}, },
} }
@ -62,7 +43,7 @@ for i in range(40):
"type": "local", "type": "local",
"module": "artiq.coredevice.ttl", "module": "artiq.coredevice.ttl",
"class": "TTLInOut", "class": "TTLInOut",
"arguments": {"channel": 4+i} "arguments": {"channel": i}
} }
device_db["ad9914dds0"] = { device_db["ad9914dds0"] = {

60
kasli-soc-master.json Normal file
View File

@ -0,0 +1,60 @@
{
"target": "kasli_soc",
"variant": "master",
"hw_rev": "v1.0",
"base": "master",
"peripherals": [
{
"type": "grabber",
"ports": [0]
},
{
"type": "dio",
"ports": [1],
"bank_direction_low": "input",
"bank_direction_high": "output"
},
{
"type": "dio",
"ports": [2],
"bank_direction_low": "output",
"bank_direction_high": "output"
},
{
"type": "urukul",
"dds": "ad9910",
"ports": [3, 4],
"clk_sel": 2
},
{
"type": "zotino",
"ports": [5]
},
{
"type": "sampler",
"ports": [6, 7]
},
{
"type": "mirny",
"ports": [8],
"clk_sel": 1,
"refclk": 125e6
},
{
"type": "fastino",
"ports": [9]
},
{
"type": "dio",
"ports": [10],
"bank_direction_low": "input",
"bank_direction_high": "input"
},
{
"type": "dio",
"ports": [11],
"bank_direction_low": "output",
"bank_direction_high": "input"
}
]
}

60
kasli-soc-satellite.json Normal file
View File

@ -0,0 +1,60 @@
{
"target": "kasli_soc",
"variant": "satellite",
"hw_rev": "v1.0",
"base": "satellite",
"peripherals": [
{
"type": "grabber",
"ports": [0]
},
{
"type": "dio",
"ports": [1],
"bank_direction_low": "input",
"bank_direction_high": "output"
},
{
"type": "dio",
"ports": [2],
"bank_direction_low": "output",
"bank_direction_high": "output"
},
{
"type": "urukul",
"dds": "ad9910",
"ports": [3, 4],
"clk_sel": 2
},
{
"type": "zotino",
"ports": [5]
},
{
"type": "sampler",
"ports": [6, 7]
},
{
"type": "mirny",
"ports": [8],
"clk_sel": 1,
"refclk": 125e6
},
{
"type": "fastino",
"ports": [9]
},
{
"type": "dio",
"ports": [10],
"bank_direction_low": "input",
"bank_direction_high": "input"
},
{
"type": "dio",
"ports": [11],
"bank_direction_low": "output",
"bank_direction_high": "input"
}
]
}

View File

@ -13,9 +13,10 @@ fi
impure=0 impure=0
load_bitstream=1 load_bitstream=1
board_host="192.168.1.52" board_type="kasli_soc"
fw_type="runtime"
while getopts "ilb:" opt; do while getopts "ilb:t:f:" opt; do
case "$opt" in case "$opt" in
\?) exit 1 \?) exit 1
;; ;;
@ -25,24 +26,36 @@ while getopts "ilb:" opt; do
;; ;;
b) board_host=$OPTARG b) board_host=$OPTARG
;; ;;
t) board_type=$OPTARG
;;
f) fw_type=$OPTARG
;;
esac esac
done done
if [ -z "$board_host" ]; then
case $board_type in
kasli_soc) board_host="192.168.1.56";;
zc706) board_host="192.168.1.52";;
*) echo "Unknown board type"; exit 1;;
esac
fi
load_bitstream_cmd="" load_bitstream_cmd=""
build_dir=`pwd`/build build_dir=`pwd`/build
result_dir=`pwd`/result result_dir=`pwd`/result
cd $OPENOCD_ZYNQ cd $OPENOCD_ZYNQ
openocd -f zc706.cfg -c "load_image $SZL; resume 0; exit" openocd -f $board_type.cfg -c "load_image $SZL/szl-$board_type.elf; resume 0; exit"
sleep 5 sleep 5
if [ $impure -eq 1 ]; then if [ $impure -eq 1 ]; then
if [ $load_bitstream -eq 1 ]; then if [ $load_bitstream -eq 1 ]; then
load_bitstream_cmd="-g $build_dir/gateware/top.bit" load_bitstream_cmd="-g $build_dir/gateware/top.bit"
fi fi
artiq_netboot $load_bitstream_cmd -f $build_dir/runtime.bin -b $board_host artiq_netboot $load_bitstream_cmd -f $build_dir/$fwtype.bin -b $board_host
else else
if [ $load_bitstream -eq 1 ]; then if [ $load_bitstream -eq 1 ]; then
load_bitstream_cmd="-g $result_dir/top.bit" load_bitstream_cmd="-g $result_dir/top.bit"
fi fi
artiq_netboot $load_bitstream_cmd -f $result_dir/runtime.bin -b $board_host artiq_netboot $load_bitstream_cmd -f $result_dir/$fwtype.bin -b $board_host
fi fi

View File

@ -1,5 +1,7 @@
#!/usr/bin/env bash #!/usr/bin/env bash
# Only ZC706 supported for now.
set -e set -e
if [ -z "$OPENOCD_ZYNQ" ]; then if [ -z "$OPENOCD_ZYNQ" ]; then
@ -18,8 +20,9 @@ impure_dir="build"
sshopts="" sshopts=""
load_bitstream=1 load_bitstream=1
board_host="192.168.1.52" board_host="192.168.1.52"
fw_type="runtime"
while getopts "h:id:o:l" opt; do while getopts "h:id:o:lt:" opt; do
case "$opt" in case "$opt" in
\?) exit 1 \?) exit 1
;; ;;
@ -36,6 +39,8 @@ while getopts "h:id:o:l" opt; do
;; ;;
b) board_host=$OPTARG b) board_host=$OPTARG
;; ;;
t) fw_type=$OPTARG
;;
esac esac
done done
@ -46,17 +51,17 @@ echo "Creating $target_folder..."
ssh $sshopts $target_host "mkdir -p $target_folder" ssh $sshopts $target_host "mkdir -p $target_folder"
echo "Copying files..." echo "Copying files..."
rsync -e "ssh $sshopts" -Lc $OPENOCD_ZYNQ/* $target_host:$target_folder rsync -e "ssh $sshopts" -Lc $OPENOCD_ZYNQ/* $target_host:$target_folder
rsync -e "ssh $sshopts" -Lc $SZL $target_host:$target_folder rsync -e "ssh $sshopts" -Lc $SZL/szl-zc706.elf $target_host:$target_folder/szl.elf
if [ $impure -eq 1 ]; then if [ $impure -eq 1 ]; then
if [ $load_bitstream -eq 1 ]; then if [ $load_bitstream -eq 1 ]; then
load_bitstream_cmd="-g build/gateware/top.bit" load_bitstream_cmd="-g build/gateware/top.bit"
fi fi
firmware="build/runtime.bin" firmware="build/$fw_type.bin"
else else
if [ $load_bitstream -eq 1 ]; then if [ $load_bitstream -eq 1 ]; then
load_bitstream_cmd="-g $pure_dir/top.bit" load_bitstream_cmd="-g $pure_dir/top.bit"
fi fi
firmware="$pure_dir/runtime.bin" firmware="$pure_dir/$fw_type.bin"
fi fi
echo "Programming board..." echo "Programming board..."
ssh $sshopts $target_host "cd $target_folder; openocd -f zc706.cfg -c'load_image szl.elf; resume 0; exit'" ssh $sshopts $target_host "cd $target_folder; openocd -f zc706.cfg -c'load_image szl.elf; resume 0; exit'"

View File

@ -6,7 +6,6 @@ let
artiq-fast = <artiq-fast>; artiq-fast = <artiq-fast>;
artiqpkgs = import "${artiq-fast}/default.nix" { inherit pkgs; }; artiqpkgs = import "${artiq-fast}/default.nix" { inherit pkgs; };
vivado = import "${artiq-fast}/vivado.nix" { inherit pkgs; }; vivado = import "${artiq-fast}/vivado.nix" { inherit pkgs; };
zc706-szl = (import zynq-rs).zc706-szl;
in in
pkgs.stdenv.mkDerivation { pkgs.stdenv.mkDerivation {
name = "artiq-zynq-env"; name = "artiq-zynq-env";
@ -22,7 +21,7 @@ in
pkgs.openocd pkgs.openocd
pkgs.openssh pkgs.rsync pkgs.openssh pkgs.rsync
(pkgs.python3.withPackages(ps: (with artiqpkgs; [ migen migen-axi misoc artiq artiq-netboot ]))) (pkgs.python3.withPackages(ps: (with artiqpkgs; [ migen migen-axi misoc artiq artiq-netboot ps.jsonschema ps.pyftdi ])))
vivado vivado
artiqpkgs.binutils-arm artiqpkgs.binutils-arm
@ -32,5 +31,5 @@ in
XARGO_RUST_SRC = "${rustPlatform.rust.rustc}/lib/rustlib/src/rust/library"; XARGO_RUST_SRC = "${rustPlatform.rust.rustc}/lib/rustlib/src/rust/library";
CLANG_EXTRA_INCLUDE_DIR = "${pkgs.llvmPackages_9.clang-unwrapped.lib}/lib/clang/9.0.1/include"; CLANG_EXTRA_INCLUDE_DIR = "${pkgs.llvmPackages_9.clang-unwrapped.lib}/lib/clang/9.0.1/include";
OPENOCD_ZYNQ = "${zynq-rs}/openocd"; OPENOCD_ZYNQ = "${zynq-rs}/openocd";
SZL = "${zc706-szl}/szl.elf"; SZL = "${(import zynq-rs).szl}";
} }

16
src/Cargo.lock generated
View File

@ -94,9 +94,9 @@ dependencies = [
[[package]] [[package]]
name = "embedded-hal" name = "embedded-hal"
version = "0.2.5" version = "0.2.6"
source = "registry+https://github.com/rust-lang/crates.io-index" source = "registry+https://github.com/rust-lang/crates.io-index"
checksum = "db184d3fa27bc7a2344250394c0264144dfe0bc81a4401801dcb964b8dd172ad" checksum = "e36cfb62ff156596c892272f3015ef952fe1525e85261fa3a7f327bd6b384ab9"
dependencies = [ dependencies = [
"nb 0.1.3", "nb 0.1.3",
"void", "void",
@ -195,7 +195,7 @@ dependencies = [
[[package]] [[package]]
name = "libasync" name = "libasync"
version = "0.0.0" version = "0.0.0"
source = "git+https://git.m-labs.hk/M-Labs/zynq-rs.git#2c161720fa12f8b7abecaf60f77b062b08ac9bc1" source = "git+https://git.m-labs.hk/M-Labs/zynq-rs.git#57d8d8fbc7087863305721bcb8fdbdd13d65bd65"
dependencies = [ dependencies = [
"embedded-hal", "embedded-hal",
"libcortex_a9", "libcortex_a9",
@ -207,7 +207,7 @@ dependencies = [
[[package]] [[package]]
name = "libboard_zynq" name = "libboard_zynq"
version = "0.0.0" version = "0.0.0"
source = "git+https://git.m-labs.hk/M-Labs/zynq-rs.git#2c161720fa12f8b7abecaf60f77b062b08ac9bc1" source = "git+https://git.m-labs.hk/M-Labs/zynq-rs.git#57d8d8fbc7087863305721bcb8fdbdd13d65bd65"
dependencies = [ dependencies = [
"bit_field", "bit_field",
"embedded-hal", "embedded-hal",
@ -232,7 +232,7 @@ dependencies = [
[[package]] [[package]]
name = "libconfig" name = "libconfig"
version = "0.1.0" version = "0.1.0"
source = "git+https://git.m-labs.hk/M-Labs/zynq-rs.git#2c161720fa12f8b7abecaf60f77b062b08ac9bc1" source = "git+https://git.m-labs.hk/M-Labs/zynq-rs.git#57d8d8fbc7087863305721bcb8fdbdd13d65bd65"
dependencies = [ dependencies = [
"core_io", "core_io",
"fatfs", "fatfs",
@ -243,7 +243,7 @@ dependencies = [
[[package]] [[package]]
name = "libcortex_a9" name = "libcortex_a9"
version = "0.0.0" version = "0.0.0"
source = "git+https://git.m-labs.hk/M-Labs/zynq-rs.git#2c161720fa12f8b7abecaf60f77b062b08ac9bc1" source = "git+https://git.m-labs.hk/M-Labs/zynq-rs.git#57d8d8fbc7087863305721bcb8fdbdd13d65bd65"
dependencies = [ dependencies = [
"bit_field", "bit_field",
"libregister", "libregister",
@ -259,7 +259,7 @@ checksum = "c7d73b3f436185384286bd8098d17ec07c9a7d2388a6599f824d8502b529702a"
[[package]] [[package]]
name = "libregister" name = "libregister"
version = "0.0.0" version = "0.0.0"
source = "git+https://git.m-labs.hk/M-Labs/zynq-rs.git#2c161720fa12f8b7abecaf60f77b062b08ac9bc1" source = "git+https://git.m-labs.hk/M-Labs/zynq-rs.git#57d8d8fbc7087863305721bcb8fdbdd13d65bd65"
dependencies = [ dependencies = [
"bit_field", "bit_field",
"vcell", "vcell",
@ -269,7 +269,7 @@ dependencies = [
[[package]] [[package]]
name = "libsupport_zynq" name = "libsupport_zynq"
version = "0.0.0" version = "0.0.0"
source = "git+https://git.m-labs.hk/M-Labs/zynq-rs.git#2c161720fa12f8b7abecaf60f77b062b08ac9bc1" source = "git+https://git.m-labs.hk/M-Labs/zynq-rs.git#57d8d8fbc7087863305721bcb8fdbdd13d65bd65"
dependencies = [ dependencies = [
"cc", "cc",
"compiler_builtins", "compiler_builtins",

View File

@ -3,8 +3,10 @@ members = [
"libc", "libc",
"libdyld", "libdyld",
"libdwarf", "libdwarf",
"libio",
"libunwind", "libunwind",
"runtime", "runtime",
"satman"
] ]
[profile.release] [profile.release]

View File

@ -1,16 +1,19 @@
TARGET := zc706 TARGET := zc706
VARIANT := simple GWARGS := -V nist_clock
all: ../build/firmware/armv7-none-eabihf/release/runtime ../build/runtime.bin all: runtime
.PHONY: all runtime: ../build/runtime.bin
satman: ../build/satman.bin
../build/pl.rs ../build/rustc-cfg: gateware/* .PHONY: all runtime_target satman_target
../build/pl.rs ../build/rustc-cfg ../build/mem.rs: gateware/*
mkdir -p ../build mkdir -p ../build
python gateware/$(TARGET).py -r ../build/pl.rs -c ../build/rustc-cfg -V $(VARIANT) python gateware/$(TARGET).py -r ../build/pl.rs -c ../build/rustc-cfg -m ../build/mem.rs $(GWARGS)
../build/firmware/armv7-none-eabihf/release/runtime: ../build/pl.rs ../build/rustc-cfg $(shell find . -print) ../build/firmware/armv7-none-eabihf/release/runtime: ../build/pl.rs ../build/rustc-cfg ../build/mem.rs $(shell find . -type f -print)
cd runtime && \ cd runtime && \
XBUILD_SYSROOT_PATH=`pwd`/../../build/sysroot \ XBUILD_SYSROOT_PATH=`pwd`/../../build/sysroot \
cargo xbuild --release \ cargo xbuild --release \
@ -19,3 +22,13 @@ all: ../build/firmware/armv7-none-eabihf/release/runtime ../build/runtime.bin
../build/runtime.bin: ../build/firmware/armv7-none-eabihf/release/runtime ../build/runtime.bin: ../build/firmware/armv7-none-eabihf/release/runtime
llvm-objcopy -O binary ../build/firmware/armv7-none-eabihf/release/runtime ../build/runtime.bin llvm-objcopy -O binary ../build/firmware/armv7-none-eabihf/release/runtime ../build/runtime.bin
../build/firmware/armv7-none-eabihf/release/satman: ../build/pl.rs ../build/rustc-cfg ../build/mem.rs $(shell find . -type f -print)
cd satman && \
XBUILD_SYSROOT_PATH=`pwd`/../../build/sysroot \
cargo xbuild --release \
--target-dir ../../build/firmware \
--no-default-features --features=target_$(TARGET)
../build/satman.bin: ../build/firmware/armv7-none-eabihf/release/satman
llvm-objcopy -O binary ../build/firmware/armv7-none-eabihf/release/satman ../build/satman.bin

View File

@ -1,191 +0,0 @@
#!/usr/bin/env python
import argparse
from operator import itemgetter
from migen import *
from migen.build.generic_platform import *
from migen.genlib.resetsync import AsyncResetSynchronizer
from migen.genlib.cdc import MultiReg
from migen_axi.integration.soc_core import SoCCore
from migen_axi.platforms import coraz7
from misoc.interconnect.csr import *
from misoc.integration import cpu_interface
from artiq.gateware import rtio
from artiq.gateware.rtio.phy import ttl_simple, ttl_serdes_7series, dds, spi2
import dma
import analyzer
import acpki
class RTIOCRG(Module, AutoCSR):
def __init__(self, platform, rtio_internal_clk):
self.clock_sel = CSRStorage()
self.pll_reset = CSRStorage(reset=1)
self.pll_locked = CSRStatus()
self.clock_domains.cd_rtio = ClockDomain()
self.clock_domains.cd_rtiox4 = ClockDomain(reset_less=True)
rtio_external_clk = Signal()
# user_sma_clock = platform.request("user_sma_clock")
# platform.add_period_constraint(user_sma_clock.p, 8.0)
# self.specials += Instance("IBUFDS",
# i_I=user_sma_clock.p, i_IB=user_sma_clock.n,
# o_O=rtio_external_clk)
pll_locked = Signal()
rtio_clk = Signal()
rtiox4_clk = Signal()
self.specials += [
Instance("PLLE2_ADV",
p_STARTUP_WAIT="FALSE", o_LOCKED=pll_locked,
p_REF_JITTER1=0.01,
p_CLKIN1_PERIOD=8.0, p_CLKIN2_PERIOD=8.0,
i_CLKIN1=rtio_internal_clk, i_CLKIN2=rtio_external_clk,
# Warning: CLKINSEL=0 means CLKIN2 is selected
i_CLKINSEL=~self.clock_sel.storage,
# VCO @ 1GHz when using 125MHz input
p_CLKFBOUT_MULT=8, p_DIVCLK_DIVIDE=1,
i_CLKFBIN=self.cd_rtio.clk,
i_RST=self.pll_reset.storage,
o_CLKFBOUT=rtio_clk,
p_CLKOUT0_DIVIDE=2, p_CLKOUT0_PHASE=0.0,
o_CLKOUT0=rtiox4_clk),
Instance("BUFG", i_I=rtio_clk, o_O=self.cd_rtio.clk),
Instance("BUFG", i_I=rtiox4_clk, o_O=self.cd_rtiox4.clk),
AsyncResetSynchronizer(self.cd_rtio, ~pll_locked),
MultiReg(pll_locked, self.pll_locked.status)
]
class CoraZ7(SoCCore):
def __init__(self, device_variant="10", acpki=False):
self.acpki = acpki
self.rustc_cfg = dict()
platform = coraz7.Platform(device_variant=device_variant)
platform.toolchain.bitstream_commands.extend([
"set_property BITSTREAM.GENERAL.COMPRESS True [current_design]",
])
ident = self.__class__.__name__
if self.acpki:
ident = "acpki_" + ident
SoCCore.__init__(self, platform=platform, csr_data_width=32, ident=ident)
platform.add_platform_command("create_clock -name clk_fpga_0 -period 8 [get_pins \"PS7/FCLKCLK[0]\"]")
platform.add_platform_command("set_input_jitter clk_fpga_0 0.24")
self.submodules.rtio_crg = RTIOCRG(self.platform, self.ps7.cd_sys.clk)
self.csr_devices.append("rtio_crg")
self.platform.add_period_constraint(self.rtio_crg.cd_rtio.clk, 8.)
self.platform.add_false_path_constraints(
self.ps7.cd_sys.clk,
self.rtio_crg.cd_rtio.clk)
def add_rtio(self, rtio_channels):
self.submodules.rtio_tsc = rtio.TSC("async", glbl_fine_ts_width=3)
self.submodules.rtio_core = rtio.Core(self.rtio_tsc, rtio_channels)
self.csr_devices.append("rtio_core")
if self.acpki:
self.rustc_cfg["ki_impl"] = "acp"
self.submodules.rtio = acpki.KernelInitiator(self.rtio_tsc,
bus=self.ps7.s_axi_acp,
user=self.ps7.s_axi_acp_user,
evento=self.ps7.event.o)
self.csr_devices.append("rtio")
else:
self.rustc_cfg["ki_impl"] = "csr"
self.submodules.rtio = rtio.KernelInitiator(self.rtio_tsc, now64=True)
self.csr_devices.append("rtio")
self.submodules.rtio_dma = dma.DMA(self.ps7.s_axi_hp0)
self.csr_devices.append("rtio_dma")
self.submodules.cri_con = rtio.CRIInterconnectShared(
[self.rtio.cri, self.rtio_dma.cri],
[self.rtio_core.cri])
self.csr_devices.append("cri_con")
self.submodules.rtio_moninj = rtio.MonInj(rtio_channels)
self.csr_devices.append("rtio_moninj")
self.submodules.rtio_analyzer = analyzer.Analyzer(self.rtio_tsc, self.rtio_core.cri,
self.ps7.s_axi_hp1)
self.csr_devices.append("rtio_analyzer")
class Simple(CoraZ7):
def __init__(self, **kwargs):
CoraZ7.__init__(self, **kwargs)
platform = self.platform
rtio_channels = []
for i in range(2):
phy = ttl_simple.Output(platform.request("user_led", i))
self.submodules += phy
rtio_channels.append(rtio.Channel.from_phy(phy))
self.config["RTIO_LOG_CHANNEL"] = len(rtio_channels)
rtio_channels.append(rtio.LogChannel())
self.add_rtio(rtio_channels)
def write_csr_file(soc, filename):
with open(filename, "w") as f:
f.write(cpu_interface.get_csr_rust(
soc.get_csr_regions(), soc.get_csr_groups(), soc.get_constants()))
def write_rustc_cfg_file(soc, filename):
with open(filename, "w") as f:
for k, v in sorted(soc.rustc_cfg.items(), key=itemgetter(0)):
if v is None:
f.write("{}\n".format(k))
else:
f.write("{}=\"{}\"\n".format(k, v))
def main():
parser = argparse.ArgumentParser(
description="ARTIQ port to the Cora Z7 Zynq development kit")
parser.add_argument("-r", default=None,
help="build Rust interface into the specified file")
parser.add_argument("-c", default=None,
help="build Rust compiler configuration into the specified file")
parser.add_argument("-g", default=None,
help="build gateware into the specified directory")
parser.add_argument("-V", "--variant", default="10",
help="variant: "
"[acpki_]10/07s "
"(default: %(default)s)")
args = parser.parse_args()
variant = args.variant.lower()
acpki = variant.startswith("acpki_")
if acpki:
variant = variant[6:]
try:
soc = Simple(device_variant=variant, acpki=acpki)
except KeyError:
raise SystemExit("Invalid variant (-V/--variant)")
soc.finalize()
if args.r is not None:
write_csr_file(soc, args.r)
if args.c is not None:
write_rustc_cfg_file(soc, args.c)
if args.g is not None:
soc.build(build_dir=args.g)
if __name__ == "__main__":
main()

View File

@ -0,0 +1,85 @@
"""Auxiliary controller, common to satellite and master"""
from artiq.gateware.drtio.aux_controller import Transmitter, Receiver
from migen.fhdl.simplify import FullMemoryWE
from misoc.interconnect.csr import *
from migen_axi.interconnect.sram import SRAM
from migen_axi.interconnect import axi
max_packet = 1024
class _DRTIOAuxControllerBase(Module):
def __init__(self, link_layer):
self.bus = axi.Interface()
self.submodules.transmitter = Transmitter(link_layer, len(self.bus.w.data))
self.submodules.receiver = Receiver(link_layer, len(self.bus.w.data))
def get_csrs(self):
return self.transmitter.get_csrs() + self.receiver.get_csrs()
# TODO: FullMemoryWE should be applied by migen.build
@FullMemoryWE()
class DRTIOAuxControllerAxi(_DRTIOAuxControllerBase):
def __init__(self, link_layer):
_DRTIOAuxControllerBase.__init__(self, link_layer)
tx_sdram_if = SRAM(self.transmitter.mem, read_only=False)
rx_sdram_if = SRAM(self.receiver.mem, read_only=True)
aw_decoder = axi.AddressDecoder(self.bus.aw,
[(lambda a: a[log2_int(max_packet)] == 0, tx_sdram_if.bus.aw),
(lambda a: a[log2_int(max_packet)] == 1, rx_sdram_if.bus.aw)],
register=True)
ar_decoder = axi.AddressDecoder(self.bus.ar,
[(lambda a: a[log2_int(max_packet)] == 0, tx_sdram_if.bus.ar),
(lambda a: a[log2_int(max_packet)] == 1, rx_sdram_if.bus.ar)],
register=True)
# unlike wb, axi address decoder only connects ar/aw lanes,
# the rest must also be connected!
# not quite unlike an address decoder itself.
# connect bus.b with tx.b
self.comb += [tx_sdram_if.bus.b.ready.eq(self.bus.b.ready),
self.bus.b.id.eq(tx_sdram_if.bus.b.id),
self.bus.b.resp.eq(tx_sdram_if.bus.b.resp),
self.bus.b.valid.eq(tx_sdram_if.bus.b.valid)]
# connect bus.w with tx.w
# no worries about w.valid and slave sel here, only tx will be written to
self.comb += [tx_sdram_if.bus.w.id.eq(self.bus.w.id),
tx_sdram_if.bus.w.data.eq(self.bus.w.data),
tx_sdram_if.bus.w.strb.eq(self.bus.w.strb),
tx_sdram_if.bus.w.last.eq(self.bus.w.last),
tx_sdram_if.bus.w.valid.eq(self.bus.w.valid),
self.bus.w.ready.eq(tx_sdram_if.bus.w.ready)]
# connect bus.r with rx.r and tx.r w/o data
self.comb += [self.bus.r.id.eq(rx_sdram_if.bus.r.id | tx_sdram_if.bus.r.id),
#self.bus.r.data.eq(rx_sdram_if.bus.r.data | tx_sdram_if.bus.r.data),
self.bus.r.resp.eq(rx_sdram_if.bus.r.resp | tx_sdram_if.bus.r.resp),
self.bus.r.last.eq(rx_sdram_if.bus.r.last | tx_sdram_if.bus.r.last),
self.bus.r.valid.eq(rx_sdram_if.bus.r.valid | tx_sdram_if.bus.r.valid),
rx_sdram_if.bus.r.ready.eq(self.bus.r.ready),
tx_sdram_if.bus.r.ready.eq(self.bus.r.ready)]
# connect read data after being masked
masked = [Replicate(rx_sdram_if.bus.r.valid,
len(self.bus.r.data)
) & rx_sdram_if.bus.r.data,
Replicate(tx_sdram_if.bus.r.valid,
len(self.bus.r.data)
) & tx_sdram_if.bus.r.data]
self.comb += self.bus.r.data.eq(reduce(or_, masked))
self.submodules += tx_sdram_if, rx_sdram_if, aw_decoder, ar_decoder
@FullMemoryWE()
class DRTIOAuxControllerBare(_DRTIOAuxControllerBase):
# Barebones version of the AuxController. No SRAM, no decoders.
# add memories manually from tx and rx in target code.
def get_tx_port(self):
return self.transmitter.mem.get_port(write_capable=True)
def get_rx_port(self):
return self.receiver.mem.get_port(write_capable=False)
def get_mem_size(self):
return max_packet

526
src/gateware/kasli_soc.py Executable file
View File

@ -0,0 +1,526 @@
#!/usr/bin/env python
import argparse
from operator import itemgetter
from migen import *
from migen.build.generic_platform import *
from migen.genlib.resetsync import AsyncResetSynchronizer
from migen.genlib.cdc import MultiReg
from migen_axi.integration.soc_core import SoCCore
from migen_axi.platforms import kasli_soc
from misoc.interconnect.csr import *
from misoc.integration import cpu_interface
from artiq.coredevice import jsondesc
from artiq.gateware import rtio, eem_7series
from artiq.gateware.rtio.phy import ttl_simple
from artiq.gateware.rtio.xilinx_clocking import RTIOClockMultiplier
from artiq.gateware.drtio.transceiver import gtx_7series
from artiq.gateware.drtio.siphaser import SiPhaser7Series
from artiq.gateware.drtio.rx_synchronizer import XilinxRXSynchronizer
from artiq.gateware.drtio import *
import dma
import analyzer
import acpki
import drtio_aux_controller
class RTIOCRG(Module, AutoCSR):
def __init__(self, platform):
self.pll_reset = CSRStorage(reset=1)
self.pll_locked = CSRStatus()
self.clock_domains.cd_rtio = ClockDomain()
self.clock_domains.cd_rtiox4 = ClockDomain(reset_less=True)
clk_synth = platform.request("cdr_clk_clean_fabric")
clk_synth_se = Signal()
platform.add_period_constraint(clk_synth.p, 8.0)
self.specials += [
Instance("IBUFGDS",
p_DIFF_TERM="TRUE", p_IBUF_LOW_PWR="FALSE",
i_I=clk_synth.p, i_IB=clk_synth.n, o_O=clk_synth_se),
]
pll_locked = Signal()
rtio_clk = Signal()
rtiox4_clk = Signal()
fb_clk = Signal()
self.specials += [
Instance("PLLE2_ADV",
p_STARTUP_WAIT="FALSE", o_LOCKED=pll_locked,
p_BANDWIDTH="HIGH",
p_REF_JITTER1=0.001,
p_CLKIN1_PERIOD=8.0, p_CLKIN2_PERIOD=8.0,
i_CLKIN2=clk_synth_se,
# Warning: CLKINSEL=0 means CLKIN2 is selected
i_CLKINSEL=0,
# VCO @ 1.5GHz when using 125MHz input
p_CLKFBOUT_MULT=12, p_DIVCLK_DIVIDE=1,
i_CLKFBIN=fb_clk,
i_RST=self.pll_reset.storage,
o_CLKFBOUT=fb_clk,
p_CLKOUT0_DIVIDE=3, p_CLKOUT0_PHASE=0.0,
o_CLKOUT0=rtiox4_clk,
p_CLKOUT1_DIVIDE=12, p_CLKOUT1_PHASE=0.0,
o_CLKOUT1=rtio_clk),
Instance("BUFG", i_I=rtio_clk, o_O=self.cd_rtio.clk),
Instance("BUFG", i_I=rtiox4_clk, o_O=self.cd_rtiox4.clk),
AsyncResetSynchronizer(self.cd_rtio, ~pll_locked),
MultiReg(pll_locked, self.pll_locked.status)
]
eem_iostandard_dict = {
0: "LVDS_25",
1: "LVDS_25",
2: "LVDS",
3: "LVDS",
4: "LVDS",
5: "LVDS",
6: "LVDS",
7: "LVDS",
8: "LVDS_25",
9: "LVDS_25",
10: "LVDS",
11: "LVDS",
}
def eem_iostandard(eem):
return IOStandard(eem_iostandard_dict[eem])
class GenericStandalone(SoCCore):
def __init__(self, description, acpki=False):
self.acpki = acpki
self.rustc_cfg = dict()
platform = kasli_soc.Platform()
platform.toolchain.bitstream_commands.extend([
"set_property BITSTREAM.GENERAL.COMPRESS True [current_design]",
])
ident = self.__class__.__name__
if self.acpki:
ident = "acpki_" + ident
SoCCore.__init__(self, platform=platform, csr_data_width=32, ident=ident)
platform.add_platform_command("create_clock -name clk_fpga_0 -period 8 [get_pins \"PS7/FCLKCLK[0]\"]")
platform.add_platform_command("set_input_jitter clk_fpga_0 0.24")
self.rustc_cfg["has_si5324"] = None
self.rustc_cfg["si5324_soft_reset"] = None
self.crg = self.ps7 # HACK for eem_7series to find the clock
self.submodules.rtio_crg = RTIOCRG(self.platform)
self.csr_devices.append("rtio_crg")
self.platform.add_period_constraint(self.rtio_crg.cd_rtio.clk, 8.)
self.platform.add_false_path_constraints(
self.ps7.cd_sys.clk,
self.rtio_crg.cd_rtio.clk)
self.rtio_channels = []
has_grabber = any(peripheral["type"] == "grabber" for peripheral in description["peripherals"])
if has_grabber:
self.grabber_csr_group = []
eem_7series.add_peripherals(self, description["peripherals"], iostandard=eem_iostandard)
for i in (0, 1):
print("USER LED at RTIO channel 0x{:06x}".format(len(self.rtio_channels)))
user_led = self.platform.request("user_led", i)
phy = ttl_simple.Output(user_led)
self.submodules += phy
self.rtio_channels.append(rtio.Channel.from_phy(phy))
self.config["RTIO_LOG_CHANNEL"] = len(self.rtio_channels)
self.rtio_channels.append(rtio.LogChannel())
self.submodules.rtio_tsc = rtio.TSC("async", glbl_fine_ts_width=3)
self.submodules.rtio_core = rtio.Core(self.rtio_tsc, self.rtio_channels)
self.csr_devices.append("rtio_core")
if self.acpki:
self.rustc_cfg["ki_impl"] = "acp"
self.submodules.rtio = acpki.KernelInitiator(self.rtio_tsc,
bus=self.ps7.s_axi_acp,
user=self.ps7.s_axi_acp_user,
evento=self.ps7.event.o)
self.csr_devices.append("rtio")
else:
self.rustc_cfg["ki_impl"] = "csr"
self.submodules.rtio = rtio.KernelInitiator(self.rtio_tsc, now64=True)
self.csr_devices.append("rtio")
self.submodules.rtio_dma = dma.DMA(self.ps7.s_axi_hp0)
self.csr_devices.append("rtio_dma")
self.submodules.cri_con = rtio.CRIInterconnectShared(
[self.rtio.cri, self.rtio_dma.cri],
[self.rtio_core.cri])
self.csr_devices.append("cri_con")
self.submodules.rtio_moninj = rtio.MonInj(self.rtio_channels)
self.csr_devices.append("rtio_moninj")
self.submodules.rtio_analyzer = analyzer.Analyzer(self.rtio_tsc, self.rtio_core.cri,
self.ps7.s_axi_hp1)
self.csr_devices.append("rtio_analyzer")
if has_grabber:
self.rustc_cfg["has_grabber"] = None
self.add_csr_group("grabber", self.grabber_csr_group)
for grabber in self.grabber_csr_group:
self.platform.add_false_path_constraints(
self.rtio_crg.cd_rtio.clk, getattr(self, grabber).deserializer.cd_cl.clk)
class GenericMaster(SoCCore):
def __init__(self, description, acpki=False):
sys_clk_freq = 125e6
rtio_clk_freq = description["rtio_frequency"]
self.acpki = acpki
self.rustc_cfg = dict()
platform = kasli_soc.Platform()
platform.toolchain.bitstream_commands.extend([
"set_property BITSTREAM.GENERAL.COMPRESS True [current_design]",
])
ident = self.__class__.__name__
if self.acpki:
ident = "acpki_" + ident
SoCCore.__init__(self, platform=platform, csr_data_width=32, ident=ident)
platform.add_platform_command("create_clock -name clk_fpga_0 -period 8 [get_pins \"PS7/FCLKCLK[0]\"]")
platform.add_platform_command("set_input_jitter clk_fpga_0 0.24")
data_pads = [platform.request("sfp", i) for i in range(4)]
self.submodules.drtio_transceiver = gtx_7series.GTX(
clock_pads=platform.request("clk125_gtp"),
pads=data_pads,
sys_clk_freq=sys_clk_freq)
self.csr_devices.append("drtio_transceiver")
self.crg = self.ps7 # HACK for eem_7series to find the clock
self.submodules.rtio_crg = RTIOClockMultiplier(rtio_clk_freq)
self.csr_devices.append("rtio_crg")
self.rtio_channels = []
has_grabber = any(peripheral["type"] == "grabber" for peripheral in description["peripherals"])
if has_grabber:
self.grabber_csr_group = []
eem_7series.add_peripherals(self, description["peripherals"], iostandard=eem_iostandard)
for i in (0, 1):
print("USER LED at RTIO channel 0x{:06x}".format(len(self.rtio_channels)))
user_led = self.platform.request("user_led", i)
phy = ttl_simple.Output(user_led)
self.submodules += phy
self.rtio_channels.append(rtio.Channel.from_phy(phy))
self.config["RTIO_LOG_CHANNEL"] = len(self.rtio_channels)
self.rtio_channels.append(rtio.LogChannel())
self.submodules.rtio_tsc = rtio.TSC("async", glbl_fine_ts_width=3)
drtio_csr_group = []
drtioaux_csr_group = []
drtioaux_memory_group = []
self.drtio_cri = []
for i in range(len(self.drtio_transceiver.channels)):
core_name = "drtio" + str(i)
coreaux_name = "drtioaux" + str(i)
memory_name = "drtioaux" + str(i) + "_mem"
drtio_csr_group.append(core_name)
drtioaux_csr_group.append(coreaux_name)
drtioaux_memory_group.append(memory_name)
cdr = ClockDomainsRenamer({"rtio_rx": "rtio_rx" + str(i)})
core = cdr(DRTIOMaster(self.rtio_tsc, self.drtio_transceiver.channels[i]))
setattr(self.submodules, core_name, core)
self.drtio_cri.append(core.cri)
self.csr_devices.append(core_name)
coreaux = cdr(drtio_aux_controller.DRTIOAuxControllerBare(core.link_layer))
setattr(self.submodules, coreaux_name, coreaux)
self.csr_devices.append(coreaux_name)
size = coreaux.get_mem_size()
memory_address = self.axi2csr.register_port(coreaux.get_tx_port(), size)
self.axi2csr.register_port(coreaux.get_rx_port(), size)
self.add_memory_region(memory_name, self.mem_map["csr"] + memory_address, size * 2)
self.rustc_cfg["has_drtio"] = None
self.rustc_cfg["has_drtio_routing"] = None
self.add_csr_group("drtio", drtio_csr_group)
self.add_csr_group("drtioaux", drtioaux_csr_group)
self.add_memory_group("drtioaux_mem", drtioaux_memory_group)
self.submodules.rtio_core = rtio.Core(self.rtio_tsc, self.rtio_channels)
self.csr_devices.append("rtio_core")
if self.acpki:
self.rustc_cfg["ki_impl"] = "acp"
self.submodules.rtio = acpki.KernelInitiator(self.rtio_tsc,
bus=self.ps7.s_axi_acp,
user=self.ps7.s_axi_acp_user,
evento=self.ps7.event.o)
self.csr_devices.append("rtio")
else:
self.rustc_cfg["ki_impl"] = "csr"
self.submodules.rtio = rtio.KernelInitiator(self.rtio_tsc, now64=True)
self.csr_devices.append("rtio")
self.submodules.rtio_dma = dma.DMA(self.ps7.s_axi_hp0)
self.csr_devices.append("rtio_dma")
self.submodules.cri_con = rtio.CRIInterconnectShared(
[self.rtio.cri, self.rtio_dma.cri],
[self.rtio_core.cri] + self.drtio_cri,
enable_routing=True)
self.csr_devices.append("cri_con")
self.submodules.rtio_moninj = rtio.MonInj(self.rtio_channels)
self.csr_devices.append("rtio_moninj")
self.submodules.routing_table = rtio.RoutingTableAccess(self.cri_con)
self.csr_devices.append("routing_table")
self.submodules.rtio_analyzer = analyzer.Analyzer(self.rtio_tsc, self.rtio_core.cri,
self.ps7.s_axi_hp1)
self.csr_devices.append("rtio_analyzer")
if has_grabber:
self.rustc_cfg["has_grabber"] = None
self.add_csr_group("grabber", self.grabber_csr_group)
class GenericSatellite(SoCCore):
def __init__(self, description, acpki=False):
sys_clk_freq = 125e6
rtio_clk_freq = description["rtio_frequency"]
self.acpki = acpki
self.rustc_cfg = dict()
platform = kasli_soc.Platform()
platform.toolchain.bitstream_commands.extend([
"set_property BITSTREAM.GENERAL.COMPRESS True [current_design]",
])
ident = self.__class__.__name__
if self.acpki:
ident = "acpki_" + ident
SoCCore.__init__(self, platform=platform, csr_data_width=32, ident=ident)
platform.add_platform_command("create_clock -name clk_fpga_0 -period 8 [get_pins \"PS7/FCLKCLK[0]\"]")
platform.add_platform_command("set_input_jitter clk_fpga_0 0.24")
self.crg = self.ps7 # HACK for eem_7series to find the clock
self.submodules.rtio_crg = RTIOClockMultiplier(rtio_clk_freq)
self.csr_devices.append("rtio_crg")
data_pads = [platform.request("sfp", i) for i in range(4)]
self.submodules.drtio_transceiver = gtx_7series.GTX(
clock_pads=platform.request("clk125_gtp"),
pads=data_pads,
sys_clk_freq=sys_clk_freq)
self.csr_devices.append("drtio_transceiver")
self.rtio_channels = []
has_grabber = any(peripheral["type"] == "grabber" for peripheral in description["peripherals"])
if has_grabber:
self.grabber_csr_group = []
eem_7series.add_peripherals(self, description["peripherals"], iostandard=eem_iostandard)
for i in (0, 1):
print("USER LED at RTIO channel 0x{:06x}".format(len(self.rtio_channels)))
user_led = self.platform.request("user_led", i)
phy = ttl_simple.Output(user_led)
self.submodules += phy
self.rtio_channels.append(rtio.Channel.from_phy(phy))
self.config["RTIO_LOG_CHANNEL"] = len(self.rtio_channels)
self.rtio_channels.append(rtio.LogChannel())
self.submodules.rtio_tsc = rtio.TSC("sync", glbl_fine_ts_width=3)
drtioaux_csr_group = []
drtioaux_memory_group = []
drtiorep_csr_group = []
self.drtio_cri = []
for i in range(len(self.drtio_transceiver.channels)):
coreaux_name = "drtioaux" + str(i)
memory_name = "drtioaux" + str(i) + "_mem"
drtioaux_csr_group.append(coreaux_name)
drtioaux_memory_group.append(memory_name)
cdr = ClockDomainsRenamer({"rtio_rx": "rtio_rx" + str(i)})
if i == 0:
self.submodules.rx_synchronizer = cdr(XilinxRXSynchronizer())
core = cdr(DRTIOSatellite(
self.rtio_tsc, self.drtio_transceiver.channels[i],
self.rx_synchronizer))
self.submodules.drtiosat = core
self.csr_devices.append("drtiosat")
else:
corerep_name = "drtiorep" + str(i-1)
drtiorep_csr_group.append(corerep_name)
core = cdr(DRTIORepeater(
self.rtio_tsc, self.drtio_transceiver.channels[i]))
setattr(self.submodules, corerep_name, core)
self.drtio_cri.append(core.cri)
self.csr_devices.append(corerep_name)
coreaux = cdr(drtio_aux_controller.DRTIOAuxControllerBare(core.link_layer))
setattr(self.submodules, coreaux_name, coreaux)
self.csr_devices.append(coreaux_name)
mem_size = coreaux.get_mem_size()
tx_port = coreaux.get_tx_port()
rx_port = coreaux.get_rx_port()
memory_address = self.axi2csr.register_port(tx_port, mem_size)
# rcv in upper half of the memory, thus added second
self.axi2csr.register_port(rx_port, mem_size)
# and registered in PS interface
# manually, because software refers to rx/tx by halves of entire memory block, not names
self.add_memory_region(memory_name, self.mem_map["csr"] + memory_address, mem_size * 2)
self.rustc_cfg["has_drtio"] = None
self.rustc_cfg["has_drtio_routing"] = None
self.add_csr_group("drtioaux", drtioaux_csr_group)
self.add_memory_group("drtioaux_mem", drtioaux_memory_group)
self.add_csr_group("drtiorep", drtiorep_csr_group)
self.rustc_cfg["has_si5324"] = None
self.rustc_cfg["si5324_soft_reset"] = None
if self.acpki:
self.rustc_cfg["ki_impl"] = "acp"
self.submodules.rtio = acpki.KernelInitiator(self.rtio_tsc,
bus=self.ps7.s_axi_acp,
user=self.ps7.s_axi_acp_user,
evento=self.ps7.event.o)
self.csr_devices.append("rtio")
else:
self.rustc_cfg["ki_impl"] = "csr"
self.submodules.rtio = rtio.KernelInitiator(self.rtio_tsc, now64=True)
self.csr_devices.append("rtio")
self.submodules.rtio_dma = dma.DMA(self.ps7.s_axi_hp0)
self.csr_devices.append("rtio_dma")
self.submodules.local_io = SyncRTIO(self.rtio_tsc, self.rtio_channels)
self.comb += self.drtiosat.async_errors.eq(self.local_io.async_errors)
self.submodules.cri_con = rtio.CRIInterconnectShared(
[self.drtiosat.cri],
[self.local_io.cri] + self.drtio_cri,
mode="sync", enable_routing=True)
self.csr_devices.append("cri_con")
self.submodules.routing_table = rtio.RoutingTableAccess(self.cri_con)
self.csr_devices.append("routing_table")
self.submodules.rtio_moninj = rtio.MonInj(self.rtio_channels)
self.csr_devices.append("rtio_moninj")
rtio_clk_period = 1e9/rtio_clk_freq
self.rustc_cfg["rtio_frequency"] = str(rtio_clk_freq/1e6)
self.submodules.siphaser = SiPhaser7Series(
si5324_clkin=platform.request("cdr_clk"),
rx_synchronizer=self.rx_synchronizer,
ultrascale=False,
rtio_clk_freq=self.drtio_transceiver.rtio_clk_freq)
platform.add_false_path_constraints(
self.crg.cd_sys.clk, self.siphaser.mmcm_freerun_output)
self.csr_devices.append("siphaser")
self.rustc_cfg["has_si5324"] = None
self.rustc_cfg["has_siphaser"] = None
self.rustc_cfg["si5324_soft_reset"] = None
gtx0 = self.drtio_transceiver.gtxs[0]
platform.add_period_constraint(gtx0.txoutclk, rtio_clk_period)
platform.add_period_constraint(gtx0.rxoutclk, rtio_clk_period)
platform.add_false_path_constraints(
self.crg.cd_sys.clk,
gtx0.txoutclk, gtx0.rxoutclk)
for gtx in self.drtio_transceiver.gtxs[1:]:
platform.add_period_constraint(gtx.rxoutclk, rtio_clk_period)
platform.add_false_path_constraints(
self.crg.cd_sys.clk, gtx.rxoutclk)
if has_grabber:
self.rustc_cfg["has_grabber"] = None
self.add_csr_group("grabber", self.grabber_csr_group)
# no RTIO CRG here
def write_mem_file(soc, filename):
with open(filename, "w") as f:
f.write(cpu_interface.get_mem_rust(
soc.get_memory_regions(), soc.get_memory_groups(), None))
def write_csr_file(soc, filename):
with open(filename, "w") as f:
f.write(cpu_interface.get_csr_rust(
soc.get_csr_regions(), soc.get_csr_groups(), soc.get_constants()))
def write_rustc_cfg_file(soc, filename):
with open(filename, "w") as f:
for k, v in sorted(soc.rustc_cfg.items(), key=itemgetter(0)):
if v is None:
f.write("{}\n".format(k))
else:
f.write("{}=\"{}\"\n".format(k, v))
def main():
parser = argparse.ArgumentParser(
description="ARTIQ device binary builder for generic Kasli-SoC systems")
parser.add_argument("-r", default=None,
help="build Rust interface into the specified file")
parser.add_argument("-c", default=None,
help="build Rust compiler configuration into the specified file")
parser.add_argument("-m", default=None,
help="build Rust memory interface into the specified file")
parser.add_argument("-g", default=None,
help="build gateware into the specified directory")
parser.add_argument("--acpki", default=False, action="store_true",
help="enable ACPKI")
parser.add_argument("description", metavar="DESCRIPTION",
help="JSON system description file")
args = parser.parse_args()
description = jsondesc.load(args.description)
if description["target"] != "kasli_soc":
raise ValueError("Description is for a different target")
if description["base"] == "standalone":
cls = GenericStandalone
elif description["base"] == "master":
cls = GenericMaster
elif description["base"] == "satellite":
cls = GenericSatellite
else:
raise ValueError("Invalid base")
soc = cls(description, acpki=args.acpki)
soc.finalize()
if args.r is not None:
write_csr_file(soc, args.r)
if args.m is not None:
write_mem_file(soc, args.m)
if args.c is not None:
write_rustc_cfg_file(soc, args.c)
if args.g is not None:
soc.build(build_dir=args.g)
if __name__ == "__main__":
main()

View File

@ -1,191 +0,0 @@
#!/usr/bin/env python
import argparse
from operator import itemgetter
from migen import *
from migen.build.generic_platform import *
from migen.genlib.resetsync import AsyncResetSynchronizer
from migen.genlib.cdc import MultiReg
from migen_axi.integration.soc_core import SoCCore
from migen_axi.platforms import redpitaya
from misoc.interconnect.csr import *
from misoc.integration import cpu_interface
from artiq.gateware import rtio
from artiq.gateware.rtio.phy import ttl_simple, ttl_serdes_7series, dds, spi2
import dma
import analyzer
import acpki
class RTIOCRG(Module, AutoCSR):
def __init__(self, platform, rtio_internal_clk):
self.clock_sel = CSRStorage()
self.pll_reset = CSRStorage(reset=1)
self.pll_locked = CSRStatus()
self.clock_domains.cd_rtio = ClockDomain()
self.clock_domains.cd_rtiox4 = ClockDomain(reset_less=True)
rtio_external_clk = Signal()
# user_sma_clock = platform.request("user_sma_clock")
# platform.add_period_constraint(user_sma_clock.p, 8.0)
# self.specials += Instance("IBUFDS",
# i_I=user_sma_clock.p, i_IB=user_sma_clock.n,
# o_O=rtio_external_clk)
pll_locked = Signal()
rtio_clk = Signal()
rtiox4_clk = Signal()
self.specials += [
Instance("PLLE2_ADV",
p_STARTUP_WAIT="FALSE", o_LOCKED=pll_locked,
p_REF_JITTER1=0.01,
p_CLKIN1_PERIOD=8.0, p_CLKIN2_PERIOD=8.0,
i_CLKIN1=rtio_internal_clk, i_CLKIN2=rtio_external_clk,
# Warning: CLKINSEL=0 means CLKIN2 is selected
i_CLKINSEL=~self.clock_sel.storage,
# VCO @ 1GHz when using 125MHz input
p_CLKFBOUT_MULT=8, p_DIVCLK_DIVIDE=1,
i_CLKFBIN=self.cd_rtio.clk,
i_RST=self.pll_reset.storage,
o_CLKFBOUT=rtio_clk,
p_CLKOUT0_DIVIDE=2, p_CLKOUT0_PHASE=0.0,
o_CLKOUT0=rtiox4_clk),
Instance("BUFG", i_I=rtio_clk, o_O=self.cd_rtio.clk),
Instance("BUFG", i_I=rtiox4_clk, o_O=self.cd_rtiox4.clk),
AsyncResetSynchronizer(self.cd_rtio, ~pll_locked),
MultiReg(pll_locked, self.pll_locked.status)
]
class Redpitaya(SoCCore):
def __init__(self, acpki=False):
self.acpki = acpki
self.rustc_cfg = dict()
platform = redpitaya.Platform()
platform.toolchain.bitstream_commands.extend([
"set_property BITSTREAM.GENERAL.COMPRESS True [current_design]",
])
ident = self.__class__.__name__
if self.acpki:
ident = "acpki_" + ident
SoCCore.__init__(self, platform=platform, csr_data_width=32, ident=ident)
platform.add_platform_command("create_clock -name clk_fpga_0 -period 8 [get_pins \"PS7/FCLKCLK[0]\"]")
platform.add_platform_command("set_input_jitter clk_fpga_0 0.24")
self.submodules.rtio_crg = RTIOCRG(self.platform, self.ps7.cd_sys.clk)
self.csr_devices.append("rtio_crg")
self.platform.add_period_constraint(self.rtio_crg.cd_rtio.clk, 8.)
self.platform.add_false_path_constraints(
self.ps7.cd_sys.clk,
self.rtio_crg.cd_rtio.clk)
def add_rtio(self, rtio_channels):
self.submodules.rtio_tsc = rtio.TSC("async", glbl_fine_ts_width=3)
self.submodules.rtio_core = rtio.Core(self.rtio_tsc, rtio_channels)
self.csr_devices.append("rtio_core")
if self.acpki:
self.rustc_cfg["ki_impl"] = "acp"
self.submodules.rtio = acpki.KernelInitiator(self.rtio_tsc,
bus=self.ps7.s_axi_acp,
user=self.ps7.s_axi_acp_user,
evento=self.ps7.event.o)
self.csr_devices.append("rtio")
else:
self.rustc_cfg["ki_impl"] = "csr"
self.submodules.rtio = rtio.KernelInitiator(self.rtio_tsc, now64=True)
self.csr_devices.append("rtio")
self.submodules.rtio_dma = dma.DMA(self.ps7.s_axi_hp0)
self.csr_devices.append("rtio_dma")
self.submodules.cri_con = rtio.CRIInterconnectShared(
[self.rtio.cri, self.rtio_dma.cri],
[self.rtio_core.cri])
self.csr_devices.append("cri_con")
self.submodules.rtio_moninj = rtio.MonInj(rtio_channels)
self.csr_devices.append("rtio_moninj")
self.submodules.rtio_analyzer = analyzer.Analyzer(self.rtio_tsc, self.rtio_core.cri,
self.ps7.s_axi_hp1)
self.csr_devices.append("rtio_analyzer")
class Simple(Redpitaya):
def __init__(self, **kwargs):
Redpitaya.__init__(self, **kwargs)
platform = self.platform
rtio_channels = []
for i in range(2):
phy = ttl_simple.Output(platform.request("user_led", i))
self.submodules += phy
rtio_channels.append(rtio.Channel.from_phy(phy))
self.config["RTIO_LOG_CHANNEL"] = len(rtio_channels)
rtio_channels.append(rtio.LogChannel())
self.add_rtio(rtio_channels)
VARIANTS = {cls.__name__.lower(): cls for cls in [Simple]}
def write_csr_file(soc, filename):
with open(filename, "w") as f:
f.write(cpu_interface.get_csr_rust(
soc.get_csr_regions(), soc.get_csr_groups(), soc.get_constants()))
def write_rustc_cfg_file(soc, filename):
with open(filename, "w") as f:
for k, v in sorted(soc.rustc_cfg.items(), key=itemgetter(0)):
if v is None:
f.write("{}\n".format(k))
else:
f.write("{}=\"{}\"\n".format(k, v))
def main():
parser = argparse.ArgumentParser(
description="ARTIQ port to the Redpitaya Zynq development kit")
parser.add_argument("-r", default=None,
help="build Rust interface into the specified file")
parser.add_argument("-c", default=None,
help="build Rust compiler configuration into the specified file")
parser.add_argument("-g", default=None,
help="build gateware into the specified directory")
parser.add_argument("-V", "--variant", default="10",
help="variant: "
"[acpki_]simple "
"(default: %(default)s)")
args = parser.parse_args()
variant = args.variant.lower()
acpki = variant.startswith("acpki_")
if acpki:
variant = variant[6:]
soc = Simple(acpki=acpki)
soc.finalize()
if args.r is not None:
write_csr_file(soc, args.r)
if args.c is not None:
write_rustc_cfg_file(soc, args.c)
if args.g is not None:
soc.build(build_dir=args.g)
if __name__ == "__main__":
main()

View File

@ -11,13 +11,20 @@ from migen_axi.integration.soc_core import SoCCore
from migen_axi.platforms import zc706 from migen_axi.platforms import zc706
from misoc.interconnect.csr import * from misoc.interconnect.csr import *
from misoc.integration import cpu_interface from misoc.integration import cpu_interface
from misoc.cores import gpio
from artiq.gateware import rtio, nist_clock, nist_qc2 from artiq.gateware import rtio, nist_clock, nist_qc2
from artiq.gateware.rtio.phy import ttl_simple, ttl_serdes_7series, dds, spi2 from artiq.gateware.rtio.phy import ttl_simple, ttl_serdes_7series, dds, spi2
from artiq.gateware.rtio.xilinx_clocking import RTIOClockMultiplier, fix_serdes_timing_path
from artiq.gateware.drtio.transceiver import gtx_7series
from artiq.gateware.drtio.siphaser import SiPhaser7Series
from artiq.gateware.drtio.rx_synchronizer import XilinxRXSynchronizer
from artiq.gateware.drtio import *
import dma import dma
import analyzer import analyzer
import acpki import acpki
import drtio_aux_controller
class RTIOCRG(Module, AutoCSR): class RTIOCRG(Module, AutoCSR):
@ -64,25 +71,77 @@ class RTIOCRG(Module, AutoCSR):
] ]
# The NIST backplanes require setting VADJ to 3.3V by reprogramming the power supply.
# This also changes the I/O standard for some on-board LEDs.
leds_fmc33 = [
("user_led_33", 0, Pins("Y21"), IOStandard("LVCMOS33")),
("user_led_33", 1, Pins("G2"), IOStandard("LVCMOS15")),
("user_led_33", 2, Pins("W21"), IOStandard("LVCMOS33")),
("user_led_33", 3, Pins("A17"), IOStandard("LVCMOS15")),
]
# same deal as with LEDs - changed I/O standard.
si5324_fmc33 = [
("si5324_33", 0,
Subsignal("rst_n", Pins("W23"), IOStandard("LVCMOS33")),
Subsignal("int", Pins("AJ25"), IOStandard("LVCMOS33"))
),
]
pmod1_33 = [
("pmod1_33", 0, Pins("AJ21"), IOStandard("LVCMOS33")),
("pmod1_33", 1, Pins("AK21"), IOStandard("LVCMOS33")),
("pmod1_33", 2, Pins("AB21"), IOStandard("LVCMOS33")),
("pmod1_33", 3, Pins("AB16"), IOStandard("LVCMOS33")),
# rest removed for use with dummy spi
]
_ams101_dac = [
("ams101_dac", 0,
Subsignal("ldac", Pins("XADC:GPIO0")),
Subsignal("clk", Pins("XADC:GPIO1")),
Subsignal("mosi", Pins("XADC:GPIO2")),
Subsignal("cs_n", Pins("XADC:GPIO3")),
IOStandard("LVCMOS15")
)
]
_pmod_spi = [
("pmod_spi", 0,
# PMOD_1 4-7 pins, same bank as sfp_tx_disable or user_sma_clock
Subsignal("miso", Pins("Y20"), IOStandard("LVCMOS25")),
Subsignal("clk", Pins("AA20"), IOStandard("LVCMOS25")),
Subsignal("mosi", Pins("AC18"), IOStandard("LVCMOS25")),
Subsignal("cs_n", Pins("AC19"), IOStandard("LVCMOS25")),
IOStandard("LVCMOS25")
)
]
def prepare_zc706_platform(platform):
platform.toolchain.bitstream_commands.extend([
"set_property BITSTREAM.GENERAL.COMPRESS True [current_design]",
])
platform.add_platform_command("create_clock -name clk_fpga_0 -period 8 [get_pins \"PS7/FCLKCLK[0]\"]")
platform.add_platform_command("set_input_jitter clk_fpga_0 0.24")
class ZC706(SoCCore): class ZC706(SoCCore):
def __init__(self, acpki=False): def __init__(self, acpki=False):
self.acpki = acpki self.acpki = acpki
self.rustc_cfg = dict() self.rustc_cfg = dict()
platform = zc706.Platform() platform = zc706.Platform()
platform.toolchain.bitstream_commands.extend([ prepare_zc706_platform(platform)
"set_property BITSTREAM.GENERAL.COMPRESS True [current_design]",
])
ident = self.__class__.__name__ ident = self.__class__.__name__
if self.acpki: if self.acpki:
ident = "acpki_" + ident ident = "acpki_" + ident
SoCCore.__init__(self, platform=platform, csr_data_width=32, ident=ident) SoCCore.__init__(self, platform=platform, csr_data_width=32, ident=ident)
platform.add_platform_command("create_clock -name clk_fpga_0 -period 8 [get_pins \"PS7/FCLKCLK[0]\"]")
platform.add_platform_command("set_input_jitter clk_fpga_0 0.24")
self.submodules.rtio_crg = RTIOCRG(self.platform, self.ps7.cd_sys.clk) self.submodules.rtio_crg = RTIOCRG(self.platform, self.ps7.cd_sys.clk)
self.csr_devices.append("rtio_crg") self.csr_devices.append("rtio_crg")
self.rustc_cfg["has_rtio_crg_clock_sel"] = None
self.platform.add_period_constraint(self.rtio_crg.cd_rtio.clk, 8.) self.platform.add_period_constraint(self.rtio_crg.cd_rtio.clk, 8.)
self.platform.add_false_path_constraints( self.platform.add_false_path_constraints(
self.ps7.cd_sys.clk, self.ps7.cd_sys.clk,
@ -121,52 +180,301 @@ class ZC706(SoCCore):
self.csr_devices.append("rtio_analyzer") self.csr_devices.append("rtio_analyzer")
class Simple(ZC706): class _MasterBase(SoCCore):
def __init__(self, **kwargs): def __init__(self, acpki=False, drtio100mhz=False):
ZC706.__init__(self, **kwargs) self.acpki = acpki
self.rustc_cfg = dict()
platform = zc706.Platform()
prepare_zc706_platform(platform)
ident = self.__class__.__name__
if self.acpki:
ident = "acpki_" + ident
SoCCore.__init__(self, platform=platform, csr_data_width=32, ident=ident)
platform.add_extension(si5324_fmc33)
self.sys_clk_freq = 125e6
rtio_clk_freq = 100e6 if drtio100mhz else self.sys_clk_freq
platform = self.platform platform = self.platform
rtio_channels = [] self.comb += platform.request("sfp_tx_disable_n").eq(1)
for i in range(4): data_pads = [
phy = ttl_simple.Output(platform.request("user_led", i)) platform.request("sfp"),
self.submodules += phy platform.request("user_sma_mgt")
rtio_channels.append(rtio.Channel.from_phy(phy)) ]
self.config["RTIO_LOG_CHANNEL"] = len(rtio_channels) # 1000BASE_BX10 Ethernet compatible, 125MHz RTIO clock
rtio_channels.append(rtio.LogChannel()) self.submodules.drtio_transceiver = gtx_7series.GTX(
clock_pads=platform.request("si5324_clkout"),
pads=data_pads,
sys_clk_freq=self.sys_clk_freq,
rtio_clk_freq=rtio_clk_freq)
self.csr_devices.append("drtio_transceiver")
self.add_rtio(rtio_channels) self.submodules.rtio_tsc = rtio.TSC("async", glbl_fine_ts_width=3)
drtio_csr_group = []
drtioaux_csr_group = []
drtioaux_memory_group = []
self.drtio_cri = []
for i in range(len(self.drtio_transceiver.channels)):
core_name = "drtio" + str(i)
coreaux_name = "drtioaux" + str(i)
memory_name = "drtioaux" + str(i) + "_mem"
drtio_csr_group.append(core_name)
drtioaux_csr_group.append(coreaux_name)
drtioaux_memory_group.append(memory_name)
cdr = ClockDomainsRenamer({"rtio_rx": "rtio_rx" + str(i)})
core = cdr(DRTIOMaster(
self.rtio_tsc, self.drtio_transceiver.channels[i]))
setattr(self.submodules, core_name, core)
self.drtio_cri.append(core.cri)
self.csr_devices.append(core_name)
coreaux = cdr(drtio_aux_controller.DRTIOAuxControllerBare(core.link_layer))
setattr(self.submodules, coreaux_name, coreaux)
self.csr_devices.append(coreaux_name)
mem_size = coreaux.get_mem_size()
memory_address = self.axi2csr.register_port(coreaux.get_tx_port(), mem_size)
self.axi2csr.register_port(coreaux.get_rx_port(), mem_size)
self.add_memory_region(memory_name, self.mem_map["csr"] + memory_address, mem_size * 2)
self.rustc_cfg["has_drtio"] = None
self.rustc_cfg["has_drtio_routing"] = None
self.add_csr_group("drtio", drtio_csr_group)
self.add_csr_group("drtioaux", drtioaux_csr_group)
self.add_memory_group("drtioaux_mem", drtioaux_memory_group)
self.rustc_cfg["rtio_frequency"] = str(self.drtio_transceiver.rtio_clk_freq/1e6)
self.submodules.si5324_rst_n = gpio.GPIOOut(platform.request("si5324_33").rst_n)
self.csr_devices.append("si5324_rst_n")
self.rustc_cfg["has_si5324"] = None
self.rustc_cfg["si5324_as_synthesizer"] = None
rtio_clk_period = 1e9/self.drtio_transceiver.rtio_clk_freq
# Constrain TX & RX timing for the first transceiver channel
# (First channel acts as master for phase alignment for all channels' TX)
gtx0 = self.drtio_transceiver.gtxs[0]
platform.add_period_constraint(gtx0.txoutclk, rtio_clk_period)
platform.add_period_constraint(gtx0.rxoutclk, rtio_clk_period)
platform.add_false_path_constraints(
self.ps7.cd_sys.clk,
gtx0.txoutclk, gtx0.rxoutclk)
# Constrain RX timing for the each transceiver channel
# (Each channel performs single-lane phase alignment for RX)
for gtx in self.drtio_transceiver.gtxs[1:]:
platform.add_period_constraint(gtx.rxoutclk, rtio_clk_period)
platform.add_false_path_constraints(
self.ps7.cd_sys.clk, gtx0.txoutclk, gtx.rxoutclk)
self.submodules.rtio_crg = RTIOClockMultiplier(self.sys_clk_freq)
self.csr_devices.append("rtio_crg")
fix_serdes_timing_path(self.platform)
def add_rtio(self, rtio_channels):
self.submodules.rtio_tsc = rtio.TSC("async", glbl_fine_ts_width=3)
self.submodules.rtio_core = rtio.Core(self.rtio_tsc, rtio_channels)
self.csr_devices.append("rtio_core")
if self.acpki:
self.rustc_cfg["ki_impl"] = "acp"
self.submodules.rtio = acpki.KernelInitiator(self.rtio_tsc,
bus=self.ps7.s_axi_acp,
user=self.ps7.s_axi_acp_user,
evento=self.ps7.event.o)
self.csr_devices.append("rtio")
else:
self.rustc_cfg["ki_impl"] = "csr"
self.submodules.rtio = rtio.KernelInitiator(self.rtio_tsc, now64=True)
self.csr_devices.append("rtio")
self.submodules.rtio_dma = dma.DMA(self.ps7.s_axi_hp0)
self.csr_devices.append("rtio_dma")
self.submodules.local_io = SyncRTIO(self.rtio_tsc, rtio_channels)
self.submodules.cri_con = rtio.CRIInterconnectShared(
[self.rtio.cri, self.rtio_dma.cri],
[self.local_io.cri] + self.drtio_cri,
mode="sync", enable_routing=True)
self.csr_devices.append("cri_con")
self.submodules.rtio_moninj = rtio.MonInj(rtio_channels)
self.csr_devices.append("rtio_moninj")
self.submodules.rtio_analyzer = analyzer.Analyzer(self.rtio_tsc, self.rtio_core.cri,
self.ps7.s_axi_hp1)
self.csr_devices.append("rtio_analyzer")
self.submodules.routing_table = rtio.RoutingTableAccess(self.cri_con)
self.csr_devices.append("routing_table")
# The NIST backplanes require setting VADJ to 3.3V by reprogramming the power supply. class _SatelliteBase(SoCCore):
# This also changes the I/O standard for some on-board LEDs. def __init__(self, acpki=False, drtio100mhz=False):
leds_fmc33 = [ self.acpki = acpki
("user_led_33", 0, Pins("Y21"), IOStandard("LVCMOS33")), self.rustc_cfg = dict()
("user_led_33", 1, Pins("G2"), IOStandard("LVCMOS15")),
("user_led_33", 2, Pins("W21"), IOStandard("LVCMOS33")), platform = zc706.Platform()
("user_led_33", 3, Pins("A17"), IOStandard("LVCMOS15")), prepare_zc706_platform(platform)
] ident = self.__class__.__name__
if self.acpki:
ident = "acpki_" + ident
SoCCore.__init__(self, platform=platform, csr_data_width=32, ident=ident)
platform.add_extension(si5324_fmc33)
self.sys_clk_freq = 125e6
rtio_clk_freq = 100e6 if drtio100mhz else self.sys_clk_freq
platform = self.platform
# SFP
self.comb += platform.request("sfp_tx_disable_n").eq(0)
data_pads = [
platform.request("sfp"),
platform.request("user_sma_mgt")
]
self.submodules.rtio_tsc = rtio.TSC("sync", glbl_fine_ts_width=3)
# 1000BASE_BX10 Ethernet compatible, 125MHz RTIO clock
self.submodules.drtio_transceiver = gtx_7series.GTX(
clock_pads=platform.request("si5324_clkout"),
pads=data_pads,
sys_clk_freq=self.sys_clk_freq,
rtio_clk_freq=rtio_clk_freq)
self.csr_devices.append("drtio_transceiver")
drtioaux_csr_group = []
drtioaux_memory_group = []
drtiorep_csr_group = []
self.drtio_cri = []
for i in range(len(self.drtio_transceiver.channels)):
coreaux_name = "drtioaux" + str(i)
memory_name = "drtioaux" + str(i) + "_mem"
drtioaux_csr_group.append(coreaux_name)
drtioaux_memory_group.append(memory_name)
cdr = ClockDomainsRenamer({"rtio_rx": "rtio_rx" + str(i)})
# Satellite
if i == 0:
self.submodules.rx_synchronizer = cdr(XilinxRXSynchronizer())
core = cdr(DRTIOSatellite(
self.rtio_tsc, self.drtio_transceiver.channels[0], self.rx_synchronizer))
self.submodules.drtiosat = core
self.csr_devices.append("drtiosat")
# Repeaters
else:
corerep_name = "drtiorep" + str(i-1)
drtiorep_csr_group.append(corerep_name)
core = cdr(DRTIORepeater(
self.rtio_tsc, self.drtio_transceiver.channels[i]))
setattr(self.submodules, corerep_name, core)
self.drtio_cri.append(core.cri)
self.csr_devices.append(corerep_name)
coreaux = cdr(drtio_aux_controller.DRTIOAuxControllerBare(core.link_layer))
setattr(self.submodules, coreaux_name, coreaux)
self.csr_devices.append(coreaux_name)
mem_size = coreaux.get_mem_size()
tx_port = coreaux.get_tx_port()
rx_port = coreaux.get_rx_port()
memory_address = self.axi2csr.register_port(tx_port, mem_size)
# rcv in upper half of the memory, thus added second
self.axi2csr.register_port(rx_port, mem_size)
# and registered in PS interface
# manually, because software refers to rx/tx by halves of entire memory block, not names
self.add_memory_region(memory_name, self.mem_map["csr"] + memory_address, mem_size * 2)
self.rustc_cfg["has_drtio"] = None
self.rustc_cfg["has_drtio_routing"] = None
self.add_csr_group("drtioaux", drtioaux_csr_group)
self.add_csr_group("drtiorep", drtiorep_csr_group)
self.add_memory_group("drtioaux_mem", drtioaux_memory_group)
self.rustc_cfg["rtio_frequency"] = str(self.drtio_transceiver.rtio_clk_freq/1e6)
# Si5324 Phaser
self.submodules.siphaser = SiPhaser7Series(
si5324_clkin=platform.request("si5324_clkin"),
rx_synchronizer=self.rx_synchronizer,
ultrascale=False,
rtio_clk_freq=self.drtio_transceiver.rtio_clk_freq)
platform.add_false_path_constraints(
self.ps7.cd_sys.clk, self.siphaser.mmcm_freerun_output)
self.csr_devices.append("siphaser")
self.submodules.si5324_rst_n = gpio.GPIOOut(platform.request("si5324_33").rst_n)
self.csr_devices.append("si5324_rst_n")
self.rustc_cfg["has_si5324"] = None
self.rustc_cfg["has_siphaser"] = None
rtio_clk_period = 1e9/self.drtio_transceiver.rtio_clk_freq
# Constrain TX & RX timing for the first transceiver channel
# (First channel acts as master for phase alignment for all channels' TX)
gtx0 = self.drtio_transceiver.gtxs[0]
platform.add_period_constraint(gtx0.txoutclk, rtio_clk_period)
platform.add_period_constraint(gtx0.rxoutclk, rtio_clk_period)
platform.add_false_path_constraints(
self.ps7.cd_sys.clk,
gtx0.txoutclk, gtx0.rxoutclk)
# Constrain RX timing for the each transceiver channel
# (Each channel performs single-lane phase alignment for RX)
for gtx in self.drtio_transceiver.gtxs[1:]:
platform.add_period_constraint(gtx.rxoutclk, rtio_clk_period)
platform.add_false_path_constraints(
self.ps7.cd_sys.clk, gtx.rxoutclk)
self.submodules.rtio_crg = RTIOClockMultiplier(self.sys_clk_freq)
self.csr_devices.append("rtio_crg")
fix_serdes_timing_path(self.platform)
def add_rtio(self, rtio_channels):
self.submodules.rtio_moninj = rtio.MonInj(rtio_channels)
self.csr_devices.append("rtio_moninj")
if self.acpki:
self.rustc_cfg["ki_impl"] = "acp"
self.submodules.rtio = acpki.KernelInitiator(self.rtio_tsc,
bus=self.ps7.s_axi_acp,
user=self.ps7.s_axi_acp_user,
evento=self.ps7.event.o)
self.csr_devices.append("rtio")
else:
self.rustc_cfg["ki_impl"] = "csr"
self.submodules.rtio = rtio.KernelInitiator(self.rtio_tsc, now64=True)
self.csr_devices.append("rtio")
self.submodules.local_io = SyncRTIO(self.rtio_tsc, rtio_channels)
self.submodules.cri_con = rtio.CRIInterconnectShared(
[self.drtiosat.cri],
[self.local_io.cri] + self.drtio_cri,
mode="sync", enable_routing=True)
self.csr_devices.append("cri_con")
self.submodules.routing_table = rtio.RoutingTableAccess(self.cri_con)
self.csr_devices.append("routing_table")
class NIST_CLOCK(ZC706):
class _NIST_CLOCK_RTIO:
""" """
NIST clock hardware, with old backplane and 11 DDS channels NIST clock hardware, with old backplane and 11 DDS channels
""" """
def __init__(self, **kwargs): def __init__(self):
ZC706.__init__(self, **kwargs)
platform = self.platform platform = self.platform
platform.add_extension(nist_clock.fmc_adapter_io) platform.add_extension(nist_clock.fmc_adapter_io)
platform.add_extension(leds_fmc33) platform.add_extension(leds_fmc33)
platform.add_extension(pmod1_33)
platform.add_extension(_ams101_dac)
platform.add_extension(_pmod_spi)
rtio_channels = [] rtio_channels = []
for i in range(4):
phy = ttl_simple.Output(platform.request("user_led_33", i))
self.submodules += phy
rtio_channels.append(rtio.Channel.from_phy(phy))
for i in range(16): for i in range(16):
if i % 4 == 3: if i % 4 == 3:
phy = ttl_serdes_7series.InOut_8X(platform.request("ttl", i)) phy = ttl_serdes_7series.InOut_8X(platform.request("ttl", i))
@ -182,16 +490,40 @@ class NIST_CLOCK(ZC706):
self.submodules += phy self.submodules += phy
rtio_channels.append(rtio.Channel.from_phy(phy, ififo_depth=512)) rtio_channels.append(rtio.Channel.from_phy(phy, ififo_depth=512))
# no SMA GPIO, replaced with PMOD1_0
phy = ttl_serdes_7series.InOut_8X(platform.request("pmod1_33", 0))
self.submodules += phy
rtio_channels.append(rtio.Channel.from_phy(phy, ififo_depth=512))
phy = ttl_simple.Output(platform.request("user_led_33", 0))
self.submodules += phy
rtio_channels.append(rtio.Channel.from_phy(phy))
ams101_dac = self.platform.request("ams101_dac", 0)
phy = ttl_simple.Output(ams101_dac.ldac)
self.submodules += phy
rtio_channels.append(rtio.Channel.from_phy(phy))
phy = ttl_simple.ClockGen(platform.request("la32_p")) phy = ttl_simple.ClockGen(platform.request("la32_p"))
self.submodules += phy self.submodules += phy
rtio_channels.append(rtio.Channel.from_phy(phy)) rtio_channels.append(rtio.Channel.from_phy(phy))
phy = spi2.SPIMaster(ams101_dac)
self.submodules += phy
rtio_channels.append(rtio.Channel.from_phy(
phy, ififo_depth=4))
for i in range(3): for i in range(3):
phy = spi2.SPIMaster(self.platform.request("spi", i)) phy = spi2.SPIMaster(self.platform.request("spi", i))
self.submodules += phy self.submodules += phy
rtio_channels.append(rtio.Channel.from_phy( rtio_channels.append(rtio.Channel.from_phy(
phy, ififo_depth=128)) phy, ififo_depth=128))
# no SDIO on PL side, dummy SPI placeholder instead
phy = spi2.SPIMaster(platform.request("pmod_spi"))
self.submodules += phy
rtio_channels.append(rtio.Channel.from_phy(phy, ififo_depth=4))
phy = dds.AD9914(platform.request("dds"), 11, onehot=True) phy = dds.AD9914(platform.request("dds"), 11, onehot=True)
self.submodules += phy self.submodules += phy
rtio_channels.append(rtio.Channel.from_phy(phy, ififo_depth=4)) rtio_channels.append(rtio.Channel.from_phy(phy, ififo_depth=4))
@ -202,31 +534,40 @@ class NIST_CLOCK(ZC706):
self.add_rtio(rtio_channels) self.add_rtio(rtio_channels)
class NIST_QC2(ZC706): class _NIST_QC2_RTIO:
""" """
NIST QC2 hardware, as used in Quantum I and Quantum II, with new backplane NIST QC2 hardware, as used in Quantum I and Quantum II, with new backplane
and 24 DDS channels. Two backplanes are used. and 24 DDS channels. Two backplanes are used.
""" """
def __init__(self, **kwargs): def __init__(self):
ZC706.__init__(self, **kwargs)
platform = self.platform platform = self.platform
platform.add_extension(nist_qc2.fmc_adapter_io) platform.add_extension(nist_qc2.fmc_adapter_io)
platform.add_extension(leds_fmc33) platform.add_extension(leds_fmc33)
platform.add_extension(_ams101_dac)
platform.add_extension(pmod1_33)
rtio_channels = [] rtio_channels = []
for i in range(4):
phy = ttl_simple.Output(platform.request("user_led_33", i))
self.submodules += phy
rtio_channels.append(rtio.Channel.from_phy(phy))
# All TTL channels are In+Out capable # All TTL channels are In+Out capable
for i in range(40): for i in range(40):
phy = ttl_serdes_7series.InOut_8X(platform.request("ttl", i)) phy = ttl_serdes_7series.InOut_8X(platform.request("ttl", i))
self.submodules += phy self.submodules += phy
rtio_channels.append(rtio.Channel.from_phy(phy, ififo_depth=512)) rtio_channels.append(rtio.Channel.from_phy(phy, ififo_depth=512))
# no SMA GPIO, replaced with PMOD1_0
phy = ttl_serdes_7series.InOut_8X(platform.request("pmod1_33", 0))
self.submodules += phy
rtio_channels.append(rtio.Channel.from_phy(phy, ififo_depth=512))
phy = ttl_simple.Output(platform.request("user_led_33", 0))
self.submodules += phy
rtio_channels.append(rtio.Channel.from_phy(phy))
ams101_dac = self.platform.request("ams101_dac", 0)
phy = ttl_simple.Output(ams101_dac.ldac)
self.submodules += phy
rtio_channels.append(rtio.Channel.from_phy(phy))
# CLK0, CLK1 are for clock generators, on backplane SMP connectors # CLK0, CLK1 are for clock generators, on backplane SMP connectors
for i in range(2): for i in range(2):
phy = ttl_simple.ClockGen( phy = ttl_simple.ClockGen(
@ -234,6 +575,11 @@ class NIST_QC2(ZC706):
self.submodules += phy self.submodules += phy
rtio_channels.append(rtio.Channel.from_phy(phy)) rtio_channels.append(rtio.Channel.from_phy(phy))
phy = spi2.SPIMaster(ams101_dac)
self.submodules += phy
rtio_channels.append(rtio.Channel.from_phy(
phy, ififo_depth=4))
for i in range(4): for i in range(4):
phy = spi2.SPIMaster(self.platform.request("spi", i)) phy = spi2.SPIMaster(self.platform.request("spi", i))
self.submodules += phy self.submodules += phy
@ -252,7 +598,38 @@ class NIST_QC2(ZC706):
self.add_rtio(rtio_channels) self.add_rtio(rtio_channels)
VARIANTS = {cls.__name__.lower(): cls for cls in [Simple, NIST_CLOCK, NIST_QC2]} class NIST_CLOCK(ZC706, _NIST_CLOCK_RTIO):
def __init__(self, acpki, drtio100mhz):
ZC706.__init__(self, acpki)
_NIST_CLOCK_RTIO.__init__(self)
class NIST_CLOCK_Master(_MasterBase, _NIST_CLOCK_RTIO):
def __init__(self, acpki, drtio100mhz):
_MasterBase.__init__(self, acpki, drtio100mhz)
_NIST_CLOCK_RTIO.__init__(self)
class NIST_CLOCK_Satellite(_SatelliteBase, _NIST_CLOCK_RTIO):
def __init__(self, acpki, drtio100mhz):
_SatelliteBase.__init__(self, acpki, drtio100mhz)
_NIST_CLOCK_RTIO.__init__(self)
class NIST_QC2(ZC706, _NIST_QC2_RTIO):
def __init__(self, acpki, drtio100mhz):
ZC706.__init__(self, acpki)
_NIST_QC2_RTIO.__init__(self)
class NIST_QC2_Master(_MasterBase, _NIST_QC2_RTIO):
def __init__(self, acpki, drtio100mhz):
_MasterBase.__init__(self, acpki, drtio100mhz)
_NIST_QC2_RTIO.__init__(self)
class NIST_QC2_Satellite(_SatelliteBase, _NIST_QC2_RTIO):
def __init__(self, acpki, drtio100mhz):
_SatelliteBase.__init__(self, acpki, drtio100mhz)
_NIST_QC2_RTIO.__init__(self)
VARIANTS = {cls.__name__.lower(): cls for cls in [NIST_CLOCK, NIST_CLOCK_Master, NIST_CLOCK_Satellite,
NIST_QC2, NIST_QC2_Master, NIST_QC2_Satellite]}
def write_csr_file(soc, filename): def write_csr_file(soc, filename):
@ -260,6 +637,11 @@ def write_csr_file(soc, filename):
f.write(cpu_interface.get_csr_rust( f.write(cpu_interface.get_csr_rust(
soc.get_csr_regions(), soc.get_csr_groups(), soc.get_constants())) soc.get_csr_regions(), soc.get_csr_groups(), soc.get_constants()))
def write_mem_file(soc, filename):
with open(filename, "w") as f:
f.write(cpu_interface.get_mem_rust(
soc.get_memory_regions(), soc.get_memory_groups(), None))
def write_rustc_cfg_file(soc, filename): def write_rustc_cfg_file(soc, filename):
with open(filename, "w") as f: with open(filename, "w") as f:
@ -275,13 +657,15 @@ def main():
description="ARTIQ port to the ZC706 Zynq development kit") description="ARTIQ port to the ZC706 Zynq development kit")
parser.add_argument("-r", default=None, parser.add_argument("-r", default=None,
help="build Rust interface into the specified file") help="build Rust interface into the specified file")
parser.add_argument("-m", default=None,
help="build Rust memory interface into the specified file")
parser.add_argument("-c", default=None, parser.add_argument("-c", default=None,
help="build Rust compiler configuration into the specified file") help="build Rust compiler configuration into the specified file")
parser.add_argument("-g", default=None, parser.add_argument("-g", default=None,
help="build gateware into the specified directory") help="build gateware into the specified directory")
parser.add_argument("-V", "--variant", default="simple", parser.add_argument("-V", "--variant", default="nist_clock",
help="variant: " help="variant: "
"[acpki_]simple/nist_clock/nist_qc2 " "[acpki_]nist_clock/nist_qc2[_master/_satellite][_100mhz]"
"(default: %(default)s)") "(default: %(default)s)")
args = parser.parse_args() args = parser.parse_args()
@ -289,21 +673,25 @@ def main():
acpki = variant.startswith("acpki_") acpki = variant.startswith("acpki_")
if acpki: if acpki:
variant = variant[6:] variant = variant[6:]
drtio100mhz = variant.endswith("_100mhz")
if drtio100mhz:
variant = variant[:-7]
try: try:
cls = VARIANTS[variant] cls = VARIANTS[variant]
except KeyError: except KeyError:
raise SystemExit("Invalid variant (-V/--variant)") raise SystemExit("Invalid variant (-V/--variant)")
soc = cls(acpki=acpki) soc = cls(acpki=acpki, drtio100mhz=drtio100mhz)
soc.finalize() soc.finalize()
if args.r is not None: if args.r is not None:
write_csr_file(soc, args.r) write_csr_file(soc, args.r)
if args.m is not None:
write_mem_file(soc, args.m)
if args.c is not None: if args.c is not None:
write_rustc_cfg_file(soc, args.c) write_rustc_cfg_file(soc, args.c)
if args.g is not None: if args.g is not None:
soc.build(build_dir=args.g) soc.build(build_dir=args.g)
if __name__ == "__main__": if __name__ == "__main__":
main() main()

View File

@ -0,0 +1,31 @@
[package]
name = "libboard_artiq"
version = "0.0.0"
authors = ["M-Labs"]
edition = "2018"
[lib]
name = "libboard_artiq"
[features]
target_zc706 = []
target_kasli_soc = []
[build-dependencies]
build_zynq = { path = "../libbuild_zynq" }
[dependencies]
log = "0.4"
log_buffer = { version = "1.2" }
crc = { version = "1.7", default-features = false }
core_io = { version = "0.1", features = ["collections"] }
embedded-hal = "0.2"
nb = "1.0"
void = { version = "1", default-features = false }
io = { path = "../libio", features = ["byteorder"] }
libboard_zynq = { git = "https://git.m-labs.hk/M-Labs/zynq-rs.git"}
libregister = { git = "https://git.m-labs.hk/M-Labs/zynq-rs.git" }
libconfig = { git = "https://git.m-labs.hk/M-Labs/zynq-rs.git"}
libcortex_a9 = { git = "https://git.m-labs.hk/M-Labs/zynq-rs.git" }
libasync = { git = "https://git.m-labs.hk/M-Labs/zynq-rs.git" }

View File

@ -0,0 +1,5 @@
extern crate build_zynq;
fn main() {
build_zynq::cfg();
}

View File

@ -0,0 +1,109 @@
use libconfig::Config;
#[cfg(has_drtio_routing)]
use crate::pl::csr;
use core::fmt;
use log::{warn, info};
#[cfg(has_drtio_routing)]
pub const DEST_COUNT: usize = 256;
#[cfg(not(has_drtio_routing))]
pub const DEST_COUNT: usize = 0;
pub const MAX_HOPS: usize = 32;
pub const INVALID_HOP: u8 = 0xff;
pub struct RoutingTable(pub [[u8; MAX_HOPS]; DEST_COUNT]);
impl RoutingTable {
// default routing table is for star topology with no repeaters
pub fn default_master(default_n_links: usize) -> RoutingTable {
let mut ret = RoutingTable([[INVALID_HOP; MAX_HOPS]; DEST_COUNT]);
let n_entries = default_n_links + 1; // include local RTIO
for i in 0..n_entries {
ret.0[i][0] = i as u8;
}
for i in 1..n_entries {
ret.0[i][1] = 0x00;
}
ret
}
// use this by default on satellite, as they receive
// the routing table from the master
pub fn default_empty() -> RoutingTable {
RoutingTable([[INVALID_HOP; MAX_HOPS]; DEST_COUNT])
}
}
impl fmt::Display for RoutingTable {
fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
write!(f, "RoutingTable {{")?;
for i in 0..DEST_COUNT {
if self.0[i][0] != INVALID_HOP {
write!(f, " {}:", i)?;
for j in 0..MAX_HOPS {
if self.0[i][j] == INVALID_HOP {
break;
}
write!(f, " {}", self.0[i][j])?;
}
write!(f, ";")?;
}
}
write!(f, " }}")?;
Ok(())
}
}
pub fn config_routing_table(default_n_links: usize, cfg: &Config) -> RoutingTable {
let mut ret = RoutingTable::default_master(default_n_links);
if let Ok(data) = cfg.read("routing_table") {
if data.len() == DEST_COUNT*MAX_HOPS
{
for i in 0..DEST_COUNT {
for j in 0..MAX_HOPS {
ret.0[i][j] = data[i*MAX_HOPS+j];
}
}
}
else {
warn!("length of the routing table is incorrect, using default");
}
}
else {
warn!("could not read routing table from configuration, using default");
}
info!("routing table: {}", ret);
ret
}
#[cfg(has_drtio_routing)]
pub fn interconnect_enable(routing_table: &RoutingTable, rank: u8, destination: u8) {
let hop = routing_table.0[destination as usize][rank as usize];
unsafe {
csr::routing_table::destination_write(destination);
csr::routing_table::hop_write(hop);
}
}
#[cfg(has_drtio_routing)]
pub fn interconnect_disable(destination: u8) {
unsafe {
csr::routing_table::destination_write(destination);
csr::routing_table::hop_write(INVALID_HOP);
}
}
#[cfg(has_drtio_routing)]
pub fn interconnect_enable_all(routing_table: &RoutingTable, rank: u8) {
for i in 0..DEST_COUNT {
interconnect_enable(routing_table, rank, i as u8);
}
}
#[cfg(has_drtio_routing)]
pub fn interconnect_disable_all() {
for i in 0..DEST_COUNT {
interconnect_disable(i as u8);
}
}

View File

@ -0,0 +1,166 @@
use crc;
use core_io::{ErrorKind as IoErrorKind, Error as IoError};
use io::{proto::ProtoRead, proto::ProtoWrite, Cursor};
use libboard_zynq::{timer::GlobalTimer, time::Milliseconds};
use crate::mem::mem::DRTIOAUX_MEM;
use crate::pl::csr::DRTIOAUX;
use crate::drtioaux_proto::Error as ProtocolError;
pub use crate::drtioaux_proto::Packet;
#[derive(Debug)]
pub enum Error {
GatewareError,
CorruptedPacket,
LinkDown,
TimedOut,
UnexpectedReply,
RoutingError,
Protocol(ProtocolError)
}
impl From<ProtocolError> for Error {
fn from(value: ProtocolError) -> Error {
Error::Protocol(value)
}
}
impl From<IoError> for Error {
fn from(value: IoError) -> Error {
Error::Protocol(ProtocolError::Io(value))
}
}
pub fn reset(linkno: u8) {
let linkno = linkno as usize;
unsafe {
// clear buffer first to limit race window with buffer overflow
// error. We assume the CPU is fast enough so that no two packets
// will be received between the buffer and the error flag are cleared.
(DRTIOAUX[linkno].aux_rx_present_write)(1);
(DRTIOAUX[linkno].aux_rx_error_write)(1);
}
}
pub fn has_rx_error(linkno: u8) -> bool {
let linkno = linkno as usize;
unsafe {
let error = (DRTIOAUX[linkno].aux_rx_error_read)() != 0;
if error {
(DRTIOAUX[linkno].aux_rx_error_write)(1)
}
error
}
}
pub fn copy_work_buffer(src: *mut u16, dst: *mut u16, len: isize) {
// AXI writes must be 4-byte aligned (drtio proto doesn't care for that),
// and AXI burst reads/writes are not implemented yet in gateware
// thus the need for a work buffer for transmitting and copying it over
unsafe {
for i in (0..(len/2)).step_by(2) {
*dst.offset(i) = *src.offset(i);
*dst.offset(i+1) = *src.offset(i+1);
}
}
}
fn receive<F, T>(linkno: u8, f: F) -> Result<Option<T>, Error>
where F: FnOnce(&[u8]) -> Result<T, Error>
{
let linkidx = linkno as usize;
unsafe {
if (DRTIOAUX[linkidx].aux_rx_present_read)() == 1 {
let ptr = (DRTIOAUX_MEM[linkidx].base + DRTIOAUX_MEM[linkidx].size / 2) as *mut u16;
let len = (DRTIOAUX[linkidx].aux_rx_length_read)() as usize;
// work buffer to accomodate axi burst reads
let mut buf: [u8; 1024] = [0; 1024];
copy_work_buffer(ptr, buf.as_mut_ptr() as *mut u16, len as isize);
let result = f(&buf[0..len]);
(DRTIOAUX[linkidx].aux_rx_present_write)(1);
Ok(Some(result?))
} else {
Ok(None)
}
}
}
pub fn recv(linkno: u8) -> Result<Option<Packet>, Error> {
if has_rx_error(linkno) {
return Err(Error::GatewareError)
}
receive(linkno, |buffer| {
if buffer.len() < 8 {
return Err(IoError::new(IoErrorKind::UnexpectedEof, "Unexpected end").into())
}
let mut reader = Cursor::new(buffer);
let checksum_at = buffer.len() - 4;
let checksum = crc::crc32::checksum_ieee(&reader.get_ref()[0..checksum_at]);
reader.set_position(checksum_at);
if reader.read_u32()? != checksum {
return Err(Error::CorruptedPacket)
}
reader.set_position(0);
Ok(Packet::read_from(&mut reader)?)
})
}
pub fn recv_timeout(linkno: u8, timeout_ms: Option<u64>,
timer: GlobalTimer) -> Result<Packet, Error>
{
let timeout_ms = Milliseconds(timeout_ms.unwrap_or(10));
let limit = timer.get_time() + timeout_ms;
while timer.get_time() < limit {
match recv(linkno)? {
None => (),
Some(packet) => return Ok(packet),
}
}
Err(Error::TimedOut)
}
fn transmit<F>(linkno: u8, f: F) -> Result<(), Error>
where F: FnOnce(&mut [u8]) -> Result<usize, Error>
{
let linkno = linkno as usize;
unsafe {
while (DRTIOAUX[linkno].aux_tx_read)() != 0 {}
let ptr = DRTIOAUX_MEM[linkno].base as *mut u16;
let len = DRTIOAUX_MEM[linkno].size / 2;
// work buffer, works with unaligned mem access
let mut buf: [u8; 1024] = [0; 1024];
let len = f(&mut buf[0..len])?;
copy_work_buffer(buf.as_mut_ptr() as *mut u16, ptr, len as isize);
(DRTIOAUX[linkno].aux_tx_length_write)(len as u16);
(DRTIOAUX[linkno].aux_tx_write)(1);
Ok(())
}
}
pub fn send(linkno: u8, packet: &Packet) -> Result<(), Error> {
transmit(linkno, |buffer| {
let mut writer = Cursor::new(buffer);
packet.write_to(&mut writer)?;
let padding = 4 - (writer.position() % 4);
if padding != 4 {
for _ in 0..padding {
writer.write_u8(0)?;
}
}
let checksum = crc::crc32::checksum_ieee(&writer.get_ref()[0..writer.position()]);
writer.write_u32(checksum)?;
Ok(writer.position())
})
}

View File

@ -0,0 +1,139 @@
use crc;
use core_io::{ErrorKind as IoErrorKind, Error as IoError};
use void::Void;
use nb;
use libboard_zynq::{timer::GlobalTimer, time::Milliseconds};
use libasync::{task, block_async};
use io::{proto::ProtoRead, proto::ProtoWrite, Cursor};
use crate::mem::mem::DRTIOAUX_MEM;
use crate::pl::csr::DRTIOAUX;
use crate::drtioaux::{Error, has_rx_error, copy_work_buffer};
pub use crate::drtioaux_proto::Packet;
pub async fn reset(linkno: u8) {
let linkno = linkno as usize;
unsafe {
// clear buffer first to limit race window with buffer overflow
// error. We assume the CPU is fast enough so that no two packets
// will be received between the buffer and the error flag are cleared.
(DRTIOAUX[linkno].aux_rx_present_write)(1);
(DRTIOAUX[linkno].aux_rx_error_write)(1);
}
}
fn tx_ready(linkno: usize) -> nb::Result<(), Void> {
unsafe {
if (DRTIOAUX[linkno].aux_tx_read)() != 0 {
Err(nb::Error::WouldBlock)
}
else {
Ok(())
}
}
}
async fn receive<F, T>(linkno: u8, f: F) -> Result<Option<T>, Error>
where F: FnOnce(&[u8]) -> Result<T, Error>
{
let linkidx = linkno as usize;
unsafe {
if (DRTIOAUX[linkidx].aux_rx_present_read)() == 1 {
let ptr = (DRTIOAUX_MEM[linkidx].base + DRTIOAUX_MEM[linkidx].size / 2) as *mut u16;
let len = (DRTIOAUX[linkidx].aux_rx_length_read)() as usize;
// work buffer to accomodate axi burst reads
let mut buf: [u8; 1024] = [0; 1024];
copy_work_buffer(ptr, buf.as_mut_ptr() as *mut u16, len as isize);
let result = f(&buf[0..len]);
(DRTIOAUX[linkidx].aux_rx_present_write)(1);
Ok(Some(result?))
} else {
Ok(None)
}
}
}
pub async fn recv(linkno: u8) -> Result<Option<Packet>, Error> {
if has_rx_error(linkno) {
return Err(Error::GatewareError)
}
receive(linkno, |buffer| {
if buffer.len() < 8 {
return Err(IoError::new(IoErrorKind::UnexpectedEof, "Unexpected end").into())
}
let mut reader = Cursor::new(buffer);
let checksum_at = buffer.len() - 4;
let checksum = crc::crc32::checksum_ieee(&reader.get_ref()[0..checksum_at]);
reader.set_position(checksum_at);
if reader.read_u32()? != checksum {
return Err(Error::CorruptedPacket)
}
reader.set_position(0);
Ok(Packet::read_from(&mut reader)?)
}).await
}
pub async fn recv_timeout(linkno: u8, timeout_ms: Option<u64>,
timer: GlobalTimer) -> Result<Packet, Error>
{
let timeout_ms = Milliseconds(timeout_ms.unwrap_or(10));
let limit = timer.get_time() + timeout_ms;
let mut would_block = false;
while timer.get_time() < limit {
// to ensure one last time recv would run one last time
// in case async would return after timeout
if would_block {
task::r#yield().await;
}
match recv(linkno).await? {
None => { would_block = true; },
Some(packet) => return Ok(packet),
}
}
Err(Error::TimedOut)
}
async fn transmit<F>(linkno: u8, f: F) -> Result<(), Error>
where F: FnOnce(&mut [u8]) -> Result<usize, Error>
{
let linkno = linkno as usize;
unsafe {
let _ = block_async!(tx_ready(linkno)).await;
let ptr = DRTIOAUX_MEM[linkno].base as *mut u16;
let len = DRTIOAUX_MEM[linkno].size / 2;
// work buffer, works with unaligned mem access
let mut buf: [u8; 1024] = [0; 1024];
let len = f(&mut buf[0..len])?;
copy_work_buffer(buf.as_mut_ptr() as *mut u16, ptr, len as isize);
(DRTIOAUX[linkno].aux_tx_length_write)(len as u16);
(DRTIOAUX[linkno].aux_tx_write)(1);
Ok(())
}
}
pub async fn send(linkno: u8, packet: &Packet) -> Result<(), Error> {
transmit(linkno, |buffer| {
let mut writer = Cursor::new(buffer);
packet.write_to(&mut writer)?;
let padding = 4 - (writer.position() % 4);
if padding != 4 {
for _ in 0..padding {
writer.write_u8(0)?;
}
}
let checksum = crc::crc32::checksum_ieee(&writer.get_ref()[0..writer.position()]);
writer.write_u32(checksum)?;
Ok(writer.position())
}).await
}

View File

@ -0,0 +1,339 @@
use core_io::{Write, Read, Error as IoError};
use io::proto::{ProtoWrite, ProtoRead};
#[derive(Debug)]
pub enum Error {
UnknownPacket(u8),
Io(IoError)
}
impl From<IoError> for Error {
fn from(value: IoError) -> Error {
Error::Io(value)
}
}
#[derive(PartialEq, Debug)]
pub enum Packet {
EchoRequest,
EchoReply,
ResetRequest,
ResetAck,
TSCAck,
DestinationStatusRequest { destination: u8 },
DestinationDownReply,
DestinationOkReply,
DestinationSequenceErrorReply { channel: u16 },
DestinationCollisionReply { channel: u16 },
DestinationBusyReply { channel: u16 },
RoutingSetPath { destination: u8, hops: [u8; 32] },
RoutingSetRank { rank: u8 },
RoutingAck,
MonitorRequest { destination: u8, channel: u16, probe: u8 },
MonitorReply { value: u32 },
InjectionRequest { destination: u8, channel: u16, overrd: u8, value: u8 },
InjectionStatusRequest { destination: u8, channel: u16, overrd: u8 },
InjectionStatusReply { value: u8 },
I2cStartRequest { destination: u8, busno: u8 },
I2cRestartRequest { destination: u8, busno: u8 },
I2cStopRequest { destination: u8, busno: u8 },
I2cWriteRequest { destination: u8, busno: u8, data: u8 },
I2cWriteReply { succeeded: bool, ack: bool },
I2cReadRequest { destination: u8, busno: u8, ack: bool },
I2cReadReply { succeeded: bool, data: u8 },
I2cBasicReply { succeeded: bool },
SpiSetConfigRequest { destination: u8, busno: u8, flags: u8, length: u8, div: u8, cs: u8 },
SpiWriteRequest { destination: u8, busno: u8, data: u32 },
SpiReadRequest { destination: u8, busno: u8 },
SpiReadReply { succeeded: bool, data: u32 },
SpiBasicReply { succeeded: bool },
}
impl Packet {
pub fn read_from<R>(reader: &mut R) -> Result<Self, Error>
where R: Read + ?Sized
{
Ok(match reader.read_u8()? {
0x00 => Packet::EchoRequest,
0x01 => Packet::EchoReply,
0x02 => Packet::ResetRequest,
0x03 => Packet::ResetAck,
0x04 => Packet::TSCAck,
0x20 => Packet::DestinationStatusRequest {
destination: reader.read_u8()?
},
0x21 => Packet::DestinationDownReply,
0x22 => Packet::DestinationOkReply,
0x23 => Packet::DestinationSequenceErrorReply {
channel: reader.read_u16()?
},
0x24 => Packet::DestinationCollisionReply {
channel: reader.read_u16()?
},
0x25 => Packet::DestinationBusyReply {
channel: reader.read_u16()?
},
0x30 => {
let destination = reader.read_u8()?;
let mut hops = [0; 32];
reader.read_exact(&mut hops)?;
Packet::RoutingSetPath {
destination: destination,
hops: hops
}
},
0x31 => Packet::RoutingSetRank {
rank: reader.read_u8()?
},
0x32 => Packet::RoutingAck,
0x40 => Packet::MonitorRequest {
destination: reader.read_u8()?,
channel: reader.read_u16()?,
probe: reader.read_u8()?
},
0x41 => Packet::MonitorReply {
value: reader.read_u32()?
},
0x50 => Packet::InjectionRequest {
destination: reader.read_u8()?,
channel: reader.read_u16()?,
overrd: reader.read_u8()?,
value: reader.read_u8()?
},
0x51 => Packet::InjectionStatusRequest {
destination: reader.read_u8()?,
channel: reader.read_u16()?,
overrd: reader.read_u8()?
},
0x52 => Packet::InjectionStatusReply {
value: reader.read_u8()?
},
0x80 => Packet::I2cStartRequest {
destination: reader.read_u8()?,
busno: reader.read_u8()?
},
0x81 => Packet::I2cRestartRequest {
destination: reader.read_u8()?,
busno: reader.read_u8()?
},
0x82 => Packet::I2cStopRequest {
destination: reader.read_u8()?,
busno: reader.read_u8()?
},
0x83 => Packet::I2cWriteRequest {
destination: reader.read_u8()?,
busno: reader.read_u8()?,
data: reader.read_u8()?
},
0x84 => Packet::I2cWriteReply {
succeeded: reader.read_bool()?,
ack: reader.read_bool()?
},
0x85 => Packet::I2cReadRequest {
destination: reader.read_u8()?,
busno: reader.read_u8()?,
ack: reader.read_bool()?
},
0x86 => Packet::I2cReadReply {
succeeded: reader.read_bool()?,
data: reader.read_u8()?
},
0x87 => Packet::I2cBasicReply {
succeeded: reader.read_bool()?
},
0x90 => Packet::SpiSetConfigRequest {
destination: reader.read_u8()?,
busno: reader.read_u8()?,
flags: reader.read_u8()?,
length: reader.read_u8()?,
div: reader.read_u8()?,
cs: reader.read_u8()?
},
/* 0x91: was Packet::SpiSetXferRequest */
0x92 => Packet::SpiWriteRequest {
destination: reader.read_u8()?,
busno: reader.read_u8()?,
data: reader.read_u32()?
},
0x93 => Packet::SpiReadRequest {
destination: reader.read_u8()?,
busno: reader.read_u8()?
},
0x94 => Packet::SpiReadReply {
succeeded: reader.read_bool()?,
data: reader.read_u32()?
},
0x95 => Packet::SpiBasicReply {
succeeded: reader.read_bool()?
},
ty => return Err(Error::UnknownPacket(ty))
})
}
pub fn write_to<W>(&self, writer: &mut W) -> Result<(), IoError>
where W: Write + ?Sized
{
match *self {
Packet::EchoRequest =>
writer.write_u8(0x00)?,
Packet::EchoReply =>
writer.write_u8(0x01)?,
Packet::ResetRequest =>
writer.write_u8(0x02)?,
Packet::ResetAck =>
writer.write_u8(0x03)?,
Packet::TSCAck =>
writer.write_u8(0x04)?,
Packet::DestinationStatusRequest { destination } => {
writer.write_u8(0x20)?;
writer.write_u8(destination)?;
},
Packet::DestinationDownReply =>
writer.write_u8(0x21)?,
Packet::DestinationOkReply =>
writer.write_u8(0x22)?,
Packet::DestinationSequenceErrorReply { channel } => {
writer.write_u8(0x23)?;
writer.write_u16(channel)?;
},
Packet::DestinationCollisionReply { channel } => {
writer.write_u8(0x24)?;
writer.write_u16(channel)?;
},
Packet::DestinationBusyReply { channel } => {
writer.write_u8(0x25)?;
writer.write_u16(channel)?;
},
Packet::RoutingSetPath { destination, hops } => {
writer.write_u8(0x30)?;
writer.write_u8(destination)?;
writer.write_all(&hops)?;
},
Packet::RoutingSetRank { rank } => {
writer.write_u8(0x31)?;
writer.write_u8(rank)?;
},
Packet::RoutingAck =>
writer.write_u8(0x32)?,
Packet::MonitorRequest { destination, channel, probe } => {
writer.write_u8(0x40)?;
writer.write_u8(destination)?;
writer.write_u16(channel)?;
writer.write_u8(probe)?;
},
Packet::MonitorReply { value } => {
writer.write_u8(0x41)?;
writer.write_u32(value)?;
},
Packet::InjectionRequest { destination, channel, overrd, value } => {
writer.write_u8(0x50)?;
writer.write_u8(destination)?;
writer.write_u16(channel)?;
writer.write_u8(overrd)?;
writer.write_u8(value)?;
},
Packet::InjectionStatusRequest { destination, channel, overrd } => {
writer.write_u8(0x51)?;
writer.write_u8(destination)?;
writer.write_u16(channel)?;
writer.write_u8(overrd)?;
},
Packet::InjectionStatusReply { value } => {
writer.write_u8(0x52)?;
writer.write_u8(value)?;
},
Packet::I2cStartRequest { destination, busno } => {
writer.write_u8(0x80)?;
writer.write_u8(destination)?;
writer.write_u8(busno)?;
},
Packet::I2cRestartRequest { destination, busno } => {
writer.write_u8(0x81)?;
writer.write_u8(destination)?;
writer.write_u8(busno)?;
},
Packet::I2cStopRequest { destination, busno } => {
writer.write_u8(0x82)?;
writer.write_u8(destination)?;
writer.write_u8(busno)?;
},
Packet::I2cWriteRequest { destination, busno, data } => {
writer.write_u8(0x83)?;
writer.write_u8(destination)?;
writer.write_u8(busno)?;
writer.write_u8(data)?;
},
Packet::I2cWriteReply { succeeded, ack } => {
writer.write_u8(0x84)?;
writer.write_bool(succeeded)?;
writer.write_bool(ack)?;
},
Packet::I2cReadRequest { destination, busno, ack } => {
writer.write_u8(0x85)?;
writer.write_u8(destination)?;
writer.write_u8(busno)?;
writer.write_bool(ack)?;
},
Packet::I2cReadReply { succeeded, data } => {
writer.write_u8(0x86)?;
writer.write_bool(succeeded)?;
writer.write_u8(data)?;
},
Packet::I2cBasicReply { succeeded } => {
writer.write_u8(0x87)?;
writer.write_bool(succeeded)?;
},
Packet::SpiSetConfigRequest { destination, busno, flags, length, div, cs } => {
writer.write_u8(0x90)?;
writer.write_u8(destination)?;
writer.write_u8(busno)?;
writer.write_u8(flags)?;
writer.write_u8(length)?;
writer.write_u8(div)?;
writer.write_u8(cs)?;
},
Packet::SpiWriteRequest { destination, busno, data } => {
writer.write_u8(0x92)?;
writer.write_u8(destination)?;
writer.write_u8(busno)?;
writer.write_u32(data)?;
},
Packet::SpiReadRequest { destination, busno } => {
writer.write_u8(0x93)?;
writer.write_u8(destination)?;
writer.write_u8(busno)?;
},
Packet::SpiReadReply { succeeded, data } => {
writer.write_u8(0x94)?;
writer.write_bool(succeeded)?;
writer.write_u32(data)?;
},
Packet::SpiBasicReply { succeeded } => {
writer.write_u8(0x95)?;
writer.write_bool(succeeded)?;
},
}
Ok(())
}
}

View File

@ -0,0 +1,69 @@
#![no_std]
#![feature(never_type)]
extern crate log;
extern crate crc;
extern crate embedded_hal;
extern crate core_io;
extern crate io;
extern crate libboard_zynq;
extern crate libregister;
extern crate libconfig;
extern crate libcortex_a9;
extern crate libasync;
extern crate log_buffer;
#[path = "../../../build/pl.rs"]
pub mod pl;
pub mod drtioaux_proto;
pub mod drtio_routing;
pub mod logger;
#[cfg(has_si5324)]
pub mod si5324;
#[cfg(has_drtio)]
pub mod drtioaux;
#[cfg(has_drtio)]
pub mod drtioaux_async;
#[cfg(has_drtio)]
#[path = "../../../build/mem.rs"]
pub mod mem;
use core::{cmp, str};
use libboard_zynq::slcr;
use libregister::RegisterW;
pub fn identifier_read(buf: &mut [u8]) -> &str {
unsafe {
pl::csr::identifier::address_write(0);
let len = pl::csr::identifier::data_read();
let len = cmp::min(len, buf.len() as u8);
for i in 0..len {
pl::csr::identifier::address_write(1 + i);
buf[i as usize] = pl::csr::identifier::data_read();
}
str::from_utf8_unchecked(&buf[..len as usize])
}
}
pub fn init_gateware() {
// Set up PS->PL clocks
slcr::RegisterBlock::unlocked(|slcr| {
// As we are touching the mux, the clock may glitch, so reset the PL.
slcr.fpga_rst_ctrl.write(
slcr::FpgaRstCtrl::zeroed()
.fpga0_out_rst(true)
.fpga1_out_rst(true)
.fpga2_out_rst(true)
.fpga3_out_rst(true)
);
slcr.fpga0_clk_ctrl.write(
slcr::Fpga0ClkCtrl::zeroed()
.src_sel(slcr::PllSource::IoPll)
.divisor0(8)
.divisor1(1)
);
slcr.fpga_rst_ctrl.write(
slcr::FpgaRstCtrl::zeroed()
);
});
}

View File

@ -0,0 +1,353 @@
use core::result;
use log::info;
use libboard_zynq::{i2c::I2c, timer::GlobalTimer, time::Milliseconds};
use embedded_hal::blocking::delay::DelayUs;
#[cfg(not(si5324_soft_reset))]
use crate::pl::csr;
type Result<T> = result::Result<T, &'static str>;
const ADDRESS: u8 = 0x68;
#[cfg(not(si5324_soft_reset))]
fn hard_reset(timer: &mut GlobalTimer) {
unsafe { csr::si5324_rst_n::out_write(0); }
timer.delay_us(1_000);
unsafe { csr::si5324_rst_n::out_write(1); }
timer.delay_us(10_000);
}
// NOTE: the logical parameters DO NOT MAP to physical values written
// into registers. They have to be mapped; see the datasheet.
// DSPLLsim reports the logical parameters in the design summary, not
// the physical register values.
pub struct FrequencySettings {
pub n1_hs: u8,
pub nc1_ls: u32,
pub n2_hs: u8,
pub n2_ls: u32,
pub n31: u32,
pub n32: u32,
pub bwsel: u8,
pub crystal_ref: bool
}
pub enum Input {
Ckin1,
Ckin2,
}
fn map_frequency_settings(settings: &FrequencySettings) -> Result<FrequencySettings> {
if settings.nc1_ls != 0 && (settings.nc1_ls % 2) == 1 {
return Err("NC1_LS must be 0 or even")
}
if settings.nc1_ls > (1 << 20) {
return Err("NC1_LS is too high")
}
if (settings.n2_ls % 2) == 1 {
return Err("N2_LS must be even")
}
if settings.n2_ls > (1 << 20) {
return Err("N2_LS is too high")
}
if settings.n31 > (1 << 19) {
return Err("N31 is too high")
}
if settings.n32 > (1 << 19) {
return Err("N32 is too high")
}
let r = FrequencySettings {
n1_hs: match settings.n1_hs {
4 => 0b000,
5 => 0b001,
6 => 0b010,
7 => 0b011,
8 => 0b100,
9 => 0b101,
10 => 0b110,
11 => 0b111,
_ => return Err("N1_HS has an invalid value")
},
nc1_ls: settings.nc1_ls - 1,
n2_hs: match settings.n2_hs {
4 => 0b000,
5 => 0b001,
6 => 0b010,
7 => 0b011,
8 => 0b100,
9 => 0b101,
10 => 0b110,
11 => 0b111,
_ => return Err("N2_HS has an invalid value")
},
n2_ls: settings.n2_ls - 1,
n31: settings.n31 - 1,
n32: settings.n32 - 1,
bwsel: settings.bwsel,
crystal_ref: settings.crystal_ref
};
Ok(r)
}
fn write(i2c: &mut I2c, reg: u8, val: u8) -> Result<()> {
i2c.start().unwrap();
if !i2c.write(ADDRESS << 1).unwrap() {
return Err("Si5324 failed to ack write address")
}
if !i2c.write(reg).unwrap() {
return Err("Si5324 failed to ack register")
}
if !i2c.write(val).unwrap() {
return Err("Si5324 failed to ack value")
}
i2c.stop().unwrap();
Ok(())
}
#[allow(dead_code)]
fn write_no_ack_value(i2c: &mut I2c, reg: u8, val: u8) -> Result<()> {
i2c.start().unwrap();
if !i2c.write(ADDRESS << 1).unwrap() {
return Err("Si5324 failed to ack write address")
}
if !i2c.write(reg).unwrap() {
return Err("Si5324 failed to ack register")
}
i2c.write(val).unwrap();
i2c.stop().unwrap();
Ok(())
}
fn read(i2c: &mut I2c, reg: u8) -> Result<u8> {
i2c.start().unwrap();
if !i2c.write(ADDRESS << 1).unwrap() {
return Err("Si5324 failed to ack write address")
}
if !i2c.write(reg).unwrap() {
return Err("Si5324 failed to ack register")
}
i2c.restart().unwrap();
if !i2c.write((ADDRESS << 1) | 1).unwrap() {
return Err("Si5324 failed to ack read address")
}
let val = i2c.read(false).unwrap();
i2c.stop().unwrap();
Ok(val)
}
fn rmw<F>(i2c: &mut I2c, reg: u8, f: F) -> Result<()> where
F: Fn(u8) -> u8 {
let value = read(i2c, reg)?;
write(i2c, reg, f(value))?;
Ok(())
}
fn ident(i2c: &mut I2c) -> Result<u16> {
Ok(((read(i2c, 134)? as u16) << 8) | (read(i2c, 135)? as u16))
}
#[cfg(si5324_soft_reset)]
fn soft_reset(i2c: &mut I2c, timer: &mut GlobalTimer) -> Result<()> {
let val = read(i2c, 136)?;
write_no_ack_value(i2c, 136, val | 0x80)?;
timer.delay_us(10_000);
Ok(())
}
fn has_xtal(i2c: &mut I2c) -> Result<bool> {
Ok((read(i2c, 129)? & 0x01) == 0) // LOSX_INT=0
}
fn has_ckin(i2c: &mut I2c, input: Input) -> Result<bool> {
match input {
Input::Ckin1 => Ok((read(i2c, 129)? & 0x02) == 0), // LOS1_INT=0
Input::Ckin2 => Ok((read(i2c, 129)? & 0x04) == 0), // LOS2_INT=0
}
}
fn locked(i2c: &mut I2c) -> Result<bool> {
Ok((read(i2c, 130)? & 0x01) == 0) // LOL_INT=0
}
fn monitor_lock(i2c: &mut I2c, timer: &mut GlobalTimer) -> Result<()> {
info!("waiting for Si5324 lock...");
let timeout = timer.get_time() + Milliseconds(20_000);
while !locked(i2c)? {
// Yes, lock can be really slow.
if timer.get_time() > timeout {
return Err("Si5324 lock timeout");
}
}
info!(" ...locked");
Ok(())
}
fn init(i2c: &mut I2c, timer: &mut GlobalTimer) -> Result<()> {
#[cfg(not(si5324_soft_reset))]
hard_reset(timer);
#[cfg(feature = "target_kasli_soc")]
{
i2c.pca9548_select(0x70, 0)?;
i2c.pca9548_select(0x71, 1 << 3)?;
}
#[cfg(feature = "target_zc706")]
{
i2c.pca9548_select(0x74, 1 << 4)?;
}
if ident(i2c)? != 0x0182 {
return Err("Si5324 does not have expected product number");
}
#[cfg(si5324_soft_reset)]
soft_reset(i2c, timer)?;
Ok(())
}
pub fn bypass(i2c: &mut I2c, input: Input, timer: &mut GlobalTimer) -> Result<()> {
let cksel_reg = match input {
Input::Ckin1 => 0b00,
Input::Ckin2 => 0b01,
};
init(i2c, timer)?;
rmw(i2c, 21, |v| v & 0xfe)?; // CKSEL_PIN=0
rmw(i2c, 3, |v| (v & 0x3f) | (cksel_reg << 6))?; // CKSEL_REG
rmw(i2c, 4, |v| (v & 0x3f) | (0b00 << 6))?; // AUTOSEL_REG=b00
rmw(i2c, 6, |v| (v & 0xc0) | 0b111111)?; // SFOUT2_REG=b111 SFOUT1_REG=b111
rmw(i2c, 0, |v| (v & 0xfd) | 0x02)?; // BYPASS_REG=1
Ok(())
}
pub fn setup(i2c: &mut I2c, settings: &FrequencySettings, input: Input, timer: &mut GlobalTimer) -> Result<()> {
let s = map_frequency_settings(settings)?;
let cksel_reg = match input {
Input::Ckin1 => 0b00,
Input::Ckin2 => 0b01,
};
init(i2c, timer)?;
if settings.crystal_ref {
rmw(i2c, 0, |v| v | 0x40)?; // FREE_RUN=1
}
rmw(i2c, 2, |v| (v & 0x0f) | (s.bwsel << 4))?;
rmw(i2c, 21, |v| v & 0xfe)?; // CKSEL_PIN=0
rmw(i2c, 3, |v| (v & 0x2f) | (cksel_reg << 6) | 0x10)?; // CKSEL_REG, SQ_ICAL=1
rmw(i2c, 4, |v| (v & 0x3f) | (0b00 << 6))?; // AUTOSEL_REG=b00
rmw(i2c, 6, |v| (v & 0xc0) | 0b111111)?; // SFOUT2_REG=b111 SFOUT1_REG=b111
write(i2c, 25, (s.n1_hs << 5 ) as u8)?;
write(i2c, 31, (s.nc1_ls >> 16) as u8)?;
write(i2c, 32, (s.nc1_ls >> 8 ) as u8)?;
write(i2c, 33, (s.nc1_ls) as u8)?;
write(i2c, 34, (s.nc1_ls >> 16) as u8)?; // write to NC2_LS as well
write(i2c, 35, (s.nc1_ls >> 8 ) as u8)?;
write(i2c, 36, (s.nc1_ls) as u8)?;
write(i2c, 40, (s.n2_hs << 5 ) as u8 | (s.n2_ls >> 16) as u8)?;
write(i2c, 41, (s.n2_ls >> 8 ) as u8)?;
write(i2c, 42, (s.n2_ls) as u8)?;
write(i2c, 43, (s.n31 >> 16) as u8)?;
write(i2c, 44, (s.n31 >> 8) as u8)?;
write(i2c, 45, (s.n31) as u8)?;
write(i2c, 46, (s.n32 >> 16) as u8)?;
write(i2c, 47, (s.n32 >> 8) as u8)?;
write(i2c, 48, (s.n32) as u8)?;
rmw(i2c, 137, |v| v | 0x01)?; // FASTLOCK=1
rmw(i2c, 136, |v| v | 0x40)?; // ICAL=1
if !has_xtal(i2c)? {
return Err("Si5324 misses XA/XB signal");
}
if !has_ckin(i2c, input)? {
return Err("Si5324 misses clock input signal");
}
monitor_lock(i2c, timer)?;
Ok(())
}
pub fn select_input(i2c: &mut I2c, input: Input, timer: &mut GlobalTimer) -> Result<()> {
let cksel_reg = match input {
Input::Ckin1 => 0b00,
Input::Ckin2 => 0b01,
};
rmw(i2c, 3, |v| (v & 0x3f) | (cksel_reg << 6))?;
if !has_ckin(i2c, input)? {
return Err("Si5324 misses clock input signal");
}
monitor_lock(i2c, timer)?;
Ok(())
}
#[cfg(has_siphaser)]
pub mod siphaser {
use super::*;
use crate::pl::csr;
pub fn select_recovered_clock(i2c: &mut I2c, rc: bool, timer: &mut GlobalTimer) -> Result<()> {
let val = read(i2c, 3)?;
write(i2c, 3, (val & 0xdf) | (1 << 5))?; // DHOLD=1
unsafe {
csr::siphaser::switch_clocks_write(if rc { 1 } else { 0 });
}
let val = read(i2c, 3)?;
write(i2c, 3, (val & 0xdf) | (0 << 5))?; // DHOLD=0
monitor_lock(i2c, timer)?;
Ok(())
}
fn phase_shift(direction: u8, timer: &mut GlobalTimer) {
unsafe {
csr::siphaser::phase_shift_write(direction);
while csr::siphaser::phase_shift_done_read() == 0 {}
}
// wait for the Si5324 loop to stabilize
timer.delay_us(500);
}
fn has_error(timer: &mut GlobalTimer) -> bool {
unsafe {
csr::siphaser::error_write(1);
}
timer.delay_us(5_000);
unsafe {
csr::siphaser::error_read() != 0
}
}
fn find_edge(target: bool, timer: &mut GlobalTimer) -> Result<u32> {
let mut nshifts = 0;
let mut previous = has_error(timer);
loop {
phase_shift(1, timer);
nshifts += 1;
let current = has_error(timer);
if previous != target && current == target {
return Ok(nshifts);
}
if nshifts > 5000 {
return Err("failed to find timing error edge");
}
previous = current;
}
}
pub fn calibrate_skew(timer: &mut GlobalTimer) -> Result<()> {
let jitter_margin = 32;
let lead = find_edge(false, timer)?;
for _ in 0..jitter_margin {
phase_shift(1, timer);
}
let width = find_edge(true, timer)? + jitter_margin;
// width is 360 degrees (one full rotation of the phase between s/h limits) minus jitter
info!("calibration successful, lead: {}, width: {} ({}deg)", lead, width, width*360/(56*8));
// Apply reverse phase shift for half the width to get into the
// middle of the working region.
for _ in 0..width/2 {
phase_shift(0, timer);
}
Ok(())
}
}

View File

@ -0,0 +1,8 @@
[package]
authors = ["M-Labs"]
name = "build_zynq"
version = "0.0.0"
[lib]
name = "build_zynq"
path = "lib.rs"

30
src/libbuild_zynq/lib.rs Normal file
View File

@ -0,0 +1,30 @@
use std::env;
use std::fs::File;
use std::io::{BufRead, BufReader, Write};
use std::path::PathBuf;
pub fn add_linker_script() {
// Put the linker script somewhere the linker can find it
let out = &PathBuf::from(env::var_os("OUT_DIR").unwrap());
File::create(out.join("link.x"))
.unwrap()
.write_all(include_bytes!("link.x"))
.unwrap();
println!("cargo:rustc-link-search={}", out.display());
// Only re-run the build script when link.x is changed,
// instead of when any part of the source code changes.
println!("cargo:rerun-if-changed=link.x");
}
pub fn cfg() {
// Handle rustc-cfg file
let cfg_path = "../../build/rustc-cfg";
println!("cargo:rerun-if-changed={}", cfg_path);
let f = BufReader::new(File::open(cfg_path).unwrap());
for line in f.lines() {
println!("cargo:rustc-cfg={}", line.unwrap());
}
}

17
src/libio/Cargo.toml Normal file
View File

@ -0,0 +1,17 @@
[package]
authors = ["M-Labs"]
name = "io"
version = "0.0.0"
[lib]
name = "io"
path = "lib.rs"
[dependencies]
core_io = { version = "0.1", features = ["collections"] }
byteorder = { version = "1.0", default-features = false, optional = true }
libsupport_zynq = { default-features = false, features = ["alloc_core"], git = "https://git.m-labs.hk/M-Labs/zynq-rs.git" }
[features]
alloc = []

81
src/libio/cursor.rs Normal file
View File

@ -0,0 +1,81 @@
use core_io::{Read, Write, Error as IoError};
#[derive(Debug, Clone)]
pub struct Cursor<T> {
inner: T,
pos: usize
}
impl<T> Cursor<T> {
#[inline]
pub fn new(inner: T) -> Cursor<T> {
Cursor { inner, pos: 0 }
}
#[inline]
pub fn into_inner(self) -> T {
self.inner
}
#[inline]
pub fn get_ref(&self) -> &T {
&self.inner
}
#[inline]
pub fn get_mut(&mut self) -> &mut T {
&mut self.inner
}
#[inline]
pub fn position(&self) -> usize {
self.pos
}
#[inline]
pub fn set_position(&mut self, pos: usize) {
self.pos = pos
}
}
impl<T: AsRef<[u8]>> Read for Cursor<T> {
fn read(&mut self, buf: &mut [u8]) -> Result<usize, IoError> {
let data = &self.inner.as_ref()[self.pos..];
let len = buf.len().min(data.len());
buf[..len].copy_from_slice(&data[..len]);
self.pos += len;
Ok(len)
}
}
impl Write for Cursor<&mut [u8]> {
fn write(&mut self, buf: &[u8]) -> Result<usize, IoError> {
let data = &mut self.inner[self.pos..];
let len = buf.len().min(data.len());
data[..len].copy_from_slice(&buf[..len]);
self.pos += len;
Ok(len)
}
#[inline]
fn flush(&mut self) -> Result<(), IoError> {
Ok(())
}
}
#[cfg(feature = "alloc")]
impl Write for Cursor<::alloc::Vec<u8>> {
#[inline]
fn write(&mut self, buf: &[u8]) -> Result<usize, IoError> {
self.inner.extend_from_slice(buf);
Ok(buf.len())
}
#[inline]
fn flush(&mut self) -> Result<(), IoError> {
Ok(())
}
}

22
src/libio/lib.rs Normal file
View File

@ -0,0 +1,22 @@
#![no_std]
#![feature(never_type)]
#![cfg_attr(feature = "alloc", feature(alloc))]
extern crate alloc;
extern crate core_io;
#[cfg(feature = "alloc")]
#[macro_use]
use alloc;
#[cfg(feature = "byteorder")]
extern crate byteorder;
pub mod cursor;
#[cfg(feature = "byteorder")]
pub mod proto;
pub use cursor::Cursor;
#[cfg(feature = "byteorder")]
pub use proto::{ProtoRead, ProtoWrite};
#[cfg(all(feature = "byteorder", feature = "alloc"))]
pub use proto::ReadStringError;

View File

@ -6,12 +6,13 @@ authors = ["M-Labs"]
edition = "2018" edition = "2018"
[features] [features]
target_zc706 = ["libboard_zynq/target_zc706", "libsupport_zynq/target_zc706", "libconfig/target_zc706"] target_zc706 = ["libboard_zynq/target_zc706", "libsupport_zynq/target_zc706", "libconfig/target_zc706", "libboard_artiq/target_zc706"]
target_coraz7 = ["libboard_zynq/target_coraz7", "libsupport_zynq/target_coraz7", "libconfig/target_coraz7"] target_kasli_soc = ["libboard_zynq/target_kasli_soc", "libsupport_zynq/target_kasli_soc", "libconfig/target_kasli_soc", "libboard_artiq/target_kasli_soc"]
target_redpitaya = ["libboard_zynq/target_redpitaya", "libsupport_zynq/target_redpitaya", "libconfig/target_redpitaya"]
target_kasli_soc = ["libboard_zynq/target_kasli_soc", "libsupport_zynq/target_kasli_soc", "libconfig/target_kasli_soc"]
default = ["target_zc706"] default = ["target_zc706"]
[build-dependencies]
build_zynq = { path = "../libbuild_zynq" }
[dependencies] [dependencies]
num-traits = { version = "0.2", default-features = false } num-traits = { version = "0.2", default-features = false }
num-derive = "0.3" num-derive = "0.3"
@ -39,3 +40,5 @@ dyld = { path = "../libdyld" }
dwarf = { path = "../libdwarf" } dwarf = { path = "../libdwarf" }
unwind = { path = "../libunwind" } unwind = { path = "../libunwind" }
libc = { path = "../libc" } libc = { path = "../libc" }
io = { path = "../libio" }
libboard_artiq = { path = "../libboard_artiq" }

View File

@ -1,28 +1,6 @@
use std::env; extern crate build_zynq;
use std::fs::File;
use std::io::Write;
use std::io::{BufRead, BufReader};
use std::path::PathBuf;
fn main() { fn main() {
// Put the linker script somewhere the linker can find it build_zynq::add_linker_script();
let out = &PathBuf::from(env::var_os("OUT_DIR").unwrap()); build_zynq::cfg();
File::create(out.join("link.x"))
.unwrap()
.write_all(include_bytes!("link.x"))
.unwrap();
println!("cargo:rustc-link-search={}", out.display());
// Only re-run the build script when link.x is changed,
// instead of when any part of the source code changes.
println!("cargo:rerun-if-changed=link.x");
// Handle rustc-cfg file
let cfg_path = "../../build/rustc-cfg";
println!("cargo:rerun-if-changed={}", cfg_path);
let f = BufReader::new(File::open(cfg_path).unwrap());
for line in f.lines() {
println!("cargo:rustc-cfg={}", line.unwrap());
}
} }

View File

@ -21,6 +21,7 @@ use libcortex_a9::{semaphore::Semaphore, mutex::Mutex, sync_channel::{Sender, Re
use futures::{select_biased, future::FutureExt}; use futures::{select_biased, future::FutureExt};
use libasync::{smoltcp::{Sockets, TcpStream}, task}; use libasync::{smoltcp::{Sockets, TcpStream}, task};
use libconfig::{Config, net_settings}; use libconfig::{Config, net_settings};
use libboard_artiq::drtio_routing;
use crate::proto_async::*; use crate::proto_async::*;
use crate::kernel; use crate::kernel;
@ -28,7 +29,9 @@ use crate::rpc;
use crate::moninj; use crate::moninj;
use crate::mgmt; use crate::mgmt;
use crate::analyzer; use crate::analyzer;
use crate::rtio_mgt;
#[cfg(has_drtio)]
use crate::pl;
#[derive(Debug, Clone, Copy, PartialEq, Eq)] #[derive(Debug, Clone, Copy, PartialEq, Eq)]
pub enum Error { pub enum Error {
@ -94,13 +97,13 @@ async fn read_request(stream: &TcpStream, allow_close: bool) -> Result<Option<Re
Ok(true) => {} Ok(true) => {}
Ok(false) => Ok(false) =>
return Err(Error::UnexpectedPattern), return Err(Error::UnexpectedPattern),
Err(smoltcp::Error::Illegal) => { Err(smoltcp::Error::Finished) => {
if allow_close { if allow_close {
info!("peer closed connection"); info!("peer closed connection");
return Ok(None); return Ok(None);
} else { } else {
error!("peer unexpectedly closed connection"); error!("peer unexpectedly closed connection");
return Err(smoltcp::Error::Illegal)?; return Err(smoltcp::Error::Finished)?;
} }
}, },
Err(e) => Err(e) =>
@ -221,13 +224,14 @@ async fn handle_run_kernel(stream: Option<&TcpStream>, control: &Rc<RefCell<kern
} }
} }
}, },
kernel::Message::KernelFinished => { kernel::Message::KernelFinished(async_errors) => {
if let Some(stream) = stream { if let Some(stream) = stream {
write_header(stream, Reply::KernelFinished).await?; write_header(stream, Reply::KernelFinished).await?;
write_i8(stream, async_errors as i8).await?;
} }
break; break;
}, },
kernel::Message::KernelException(exception, backtrace) => { kernel::Message::KernelException(exception, backtrace, async_errors) => {
match stream { match stream {
Some(stream) => { Some(stream) => {
// only send the exception data to host if there is host, // only send the exception data to host if there is host,
@ -246,6 +250,7 @@ async fn handle_run_kernel(stream: Option<&TcpStream>, control: &Rc<RefCell<kern
for &addr in backtrace { for &addr in backtrace {
write_i32(stream, addr as i32).await?; write_i32(stream, addr as i32).await?;
} }
write_i8(stream, async_errors as i8).await?;
}, },
None => { None => {
error!("Uncaught kernel exception: {:?}", exception); error!("Uncaught kernel exception: {:?}", exception);
@ -313,7 +318,9 @@ async fn load_kernel(buffer: &Vec<u8>, control: &Rc<RefCell<kernel::Control>>, s
} }
} }
async fn handle_connection(stream: &TcpStream, control: Rc<RefCell<kernel::Control>>) -> Result<()> { async fn handle_connection(stream: &mut TcpStream, control: Rc<RefCell<kernel::Control>>) -> Result<()> {
stream.set_ack_delay(None);
if !expect(stream, b"ARTIQ coredev\n").await? { if !expect(stream, b"ARTIQ coredev\n").await? {
return Err(Error::UnexpectedPattern); return Err(Error::UnexpectedPattern);
} }
@ -385,8 +392,21 @@ pub fn main(timer: GlobalTimer, cfg: Config) {
Sockets::init(32); Sockets::init(32);
// before, mutex was on io, but now that io isn't used...?
let aux_mutex: Rc<Mutex<bool>> = Rc::new(Mutex::new(false));
#[cfg(has_drtio)]
let drtio_routing_table = Rc::new(RefCell::new(
drtio_routing::config_routing_table(pl::csr::DRTIO.len(), &cfg)));
#[cfg(not(has_drtio))]
let drtio_routing_table = Rc::new(RefCell::new(drtio_routing::RoutingTable::default_empty()));
let up_destinations = Rc::new(RefCell::new([false; drtio_routing::DEST_COUNT]));
#[cfg(has_drtio_routing)]
drtio_routing::interconnect_disable_all();
rtio_mgt::startup(&aux_mutex, &drtio_routing_table, &up_destinations, timer);
analyzer::start(); analyzer::start();
moninj::start(timer); moninj::start(timer, aux_mutex, drtio_routing_table);
let control: Rc<RefCell<kernel::Control>> = Rc::new(RefCell::new(kernel::Control::start())); let control: Rc<RefCell<kernel::Control>> = Rc::new(RefCell::new(kernel::Control::start()));
let idle_kernel = Rc::new(cfg.read("idle").ok()); let idle_kernel = Rc::new(cfg.read("idle").ok());
@ -407,7 +427,7 @@ pub fn main(timer: GlobalTimer, cfg: Config) {
let connection = Rc::new(Semaphore::new(1, 1)); let connection = Rc::new(Semaphore::new(1, 1));
let terminate = Rc::new(Semaphore::new(0, 1)); let terminate = Rc::new(Semaphore::new(0, 1));
loop { loop {
let stream = TcpStream::accept(1381, 0x10_000, 0x10_000).await.unwrap(); let mut stream = TcpStream::accept(1381, 0x10_000, 0x10_000).await.unwrap();
if connection.try_wait().is_none() { if connection.try_wait().is_none() {
// there is an existing connection // there is an existing connection
@ -425,7 +445,7 @@ pub fn main(timer: GlobalTimer, cfg: Config) {
task::spawn(async move { task::spawn(async move {
select_biased! { select_biased! {
_ = (async { _ = (async {
let _ = handle_connection(&stream, control.clone()) let _ = handle_connection(&mut stream, control.clone())
.await .await
.map_err(|e| warn!("connection terminated: {}", e)); .map_err(|e| warn!("connection terminated: {}", e));
if let Some(buffer) = &*idle_kernel { if let Some(buffer) = &*idle_kernel {

View File

@ -1,11 +1,9 @@
#[cfg(feature = "target_zc706")] use libboard_zynq;
mod i2c { use crate::artiq_raise;
use libboard_zynq;
use crate::artiq_raise;
static mut I2C_BUS: Option<libboard_zynq::i2c::I2c> = None; pub static mut I2C_BUS: Option<libboard_zynq::i2c::I2c> = None;
pub extern fn start(busno: i32) { pub extern fn start(busno: i32) {
if busno > 0 { if busno > 0 {
artiq_raise!("I2CError", "I2C bus could not be accessed"); artiq_raise!("I2CError", "I2C bus could not be accessed");
} }
@ -14,9 +12,9 @@ mod i2c {
artiq_raise!("I2CError", "I2C start failed"); artiq_raise!("I2CError", "I2C start failed");
} }
} }
} }
pub extern fn restart(busno: i32) { pub extern fn restart(busno: i32) {
if busno > 0 { if busno > 0 {
artiq_raise!("I2CError", "I2C bus could not be accessed"); artiq_raise!("I2CError", "I2C bus could not be accessed");
} }
@ -25,9 +23,9 @@ mod i2c {
artiq_raise!("I2CError", "I2C restart failed"); artiq_raise!("I2CError", "I2C restart failed");
} }
} }
} }
pub extern fn stop(busno: i32) { pub extern fn stop(busno: i32) {
if busno > 0 { if busno > 0 {
artiq_raise!("I2CError", "I2C bus could not be accessed"); artiq_raise!("I2CError", "I2C bus could not be accessed");
} }
@ -36,9 +34,9 @@ mod i2c {
artiq_raise!("I2CError", "I2C stop failed"); artiq_raise!("I2CError", "I2C stop failed");
} }
} }
} }
pub extern fn write(busno: i32, data: i32) -> bool { pub extern fn write(busno: i32, data: i32) -> bool {
if busno > 0 { if busno > 0 {
artiq_raise!("I2CError", "I2C bus could not be accessed"); artiq_raise!("I2CError", "I2C bus could not be accessed");
} }
@ -48,9 +46,9 @@ mod i2c {
Err(_) => artiq_raise!("I2CError", "I2C write failed"), Err(_) => artiq_raise!("I2CError", "I2C write failed"),
} }
} }
} }
pub extern fn read(busno: i32, ack: bool) -> i32 { pub extern fn read(busno: i32, ack: bool) -> i32 {
if busno > 0 { if busno > 0 {
artiq_raise!("I2CError", "I2C bus could not be accessed"); artiq_raise!("I2CError", "I2C bus could not be accessed");
} }
@ -60,41 +58,10 @@ mod i2c {
Err(_) => artiq_raise!("I2CError", "I2C read failed"), Err(_) => artiq_raise!("I2CError", "I2C read failed"),
} }
} }
} }
pub fn init() { pub fn init() {
let mut i2c = libboard_zynq::i2c::I2c::i2c0(); let mut i2c = libboard_zynq::i2c::I2c::i2c0();
i2c.init().expect("I2C bus initialization failed"); i2c.init().expect("I2C bus initialization failed");
unsafe { I2C_BUS = Some(i2c) }; unsafe { I2C_BUS = Some(i2c) };
}
} }
#[cfg(not(feature = "target_zc706"))]
mod i2c {
use crate::artiq_raise;
pub extern fn start(_busno: i32) {
artiq_raise!("I2CError", "No I2C bus");
}
pub extern fn restart(_busno: i32) {
artiq_raise!("I2CError", "No I2C bus");
}
pub extern fn stop(_busno: i32) {
artiq_raise!("I2CError", "No I2C bus");
}
pub extern fn write(_busno: i32, _data: i32) -> bool {
artiq_raise!("I2CError", "No I2C bus");
}
pub extern fn read(_busno: i32, _ack: bool) -> i32 {
artiq_raise!("I2CError", "No I2C bus");
}
pub fn init() {
}
}
pub use i2c::*;

View File

@ -14,7 +14,7 @@ use libcortex_a9::{
use libboard_zynq::{mpcore, gic}; use libboard_zynq::{mpcore, gic};
use libsupport_zynq::ram; use libsupport_zynq::ram;
use dyld::{self, Library}; use dyld::{self, Library};
use crate::{eh_artiq, rtio}; use crate::{eh_artiq, get_async_errors, rtio};
use super::{ use super::{
api::resolve, api::resolve,
rpc::rpc_send_async, rpc::rpc_send_async,
@ -192,7 +192,8 @@ pub extern "C" fn main_core1() {
} }
} }
info!("kernel finished"); info!("kernel finished");
core1_tx.send(Message::KernelFinished); let async_errors = unsafe { get_async_errors() };
core1_tx.send(Message::KernelFinished(async_errors));
} }
_ => error!("Core1 received unexpected message: {:?}", message), _ => error!("Core1 received unexpected message: {:?}", message),
} }
@ -216,7 +217,8 @@ pub fn terminate(exception: &'static eh_artiq::Exception<'static>, backtrace: &'
{ {
let core1_tx = unsafe { KERNEL_CHANNEL_1TO0.as_mut().unwrap() }; let core1_tx = unsafe { KERNEL_CHANNEL_1TO0.as_mut().unwrap() };
core1_tx.send(Message::KernelException(exception, &backtrace[..cursor])); let errors = unsafe { get_async_errors() };
core1_tx.send(Message::KernelException(exception, &backtrace[..cursor], errors));
} }
loop {} loop {}
} }

View File

@ -30,8 +30,8 @@ pub enum Message {
LoadCompleted, LoadCompleted,
LoadFailed, LoadFailed,
StartRequest, StartRequest,
KernelFinished, KernelFinished(u8),
KernelException(&'static eh_artiq::Exception<'static>, &'static [usize]), KernelException(&'static eh_artiq::Exception<'static>, &'static [usize], u8),
RpcSend { is_async: bool, data: Vec<u8> }, RpcSend { is_async: bool, data: Vec<u8> },
RpcRecvRequest(*mut ()), RpcRecvRequest(*mut ()),
RpcRecvReply(Result<usize, RPCException>), RpcRecvReply(Result<usize, RPCException>),

View File

@ -11,120 +11,43 @@
extern crate alloc; extern crate alloc;
use core::{cmp, str};
use log::{info, warn, error}; use log::{info, warn, error};
use libboard_zynq::{timer::GlobalTimer, mpcore, gic, slcr}; use libboard_zynq::{timer::GlobalTimer, mpcore, gic};
use libasync::{task, block_async}; use libasync::{task, block_async};
use libsupport_zynq::ram; use libsupport_zynq::ram;
use nb; use nb;
use void::Void; use void::Void;
use embedded_hal::blocking::delay::DelayMs;
use libconfig::Config; use libconfig::Config;
use libregister::RegisterW;
use libcortex_a9::l2c::enable_l2_cache; use libcortex_a9::l2c::enable_l2_cache;
use libboard_artiq::{logger, identifier_read, init_gateware, pl};
mod proto_core_io;
mod proto_async; mod proto_async;
mod comms; mod comms;
mod rpc; mod rpc;
#[path = "../../../build/pl.rs"]
mod pl;
#[cfg(ki_impl = "csr")] #[cfg(ki_impl = "csr")]
#[path = "rtio_csr.rs"] #[path = "rtio_csr.rs"]
mod rtio; mod rtio;
#[cfg(ki_impl = "acp")] #[cfg(ki_impl = "acp")]
#[path = "rtio_acp.rs"] #[path = "rtio_acp.rs"]
mod rtio; mod rtio;
mod rtio_mgt;
mod rtio_clocking;
mod kernel; mod kernel;
mod moninj; mod moninj;
mod eh_artiq; mod eh_artiq;
mod panic; mod panic;
mod logger;
mod mgmt; mod mgmt;
mod analyzer; mod analyzer;
mod irq; mod irq;
mod i2c; mod i2c;
fn init_gateware() { static mut SEEN_ASYNC_ERRORS: u8 = 0;
// Set up PS->PL clocks
slcr::RegisterBlock::unlocked(|slcr| {
// As we are touching the mux, the clock may glitch, so reset the PL.
slcr.fpga_rst_ctrl.write(
slcr::FpgaRstCtrl::zeroed()
.fpga0_out_rst(true)
.fpga1_out_rst(true)
.fpga2_out_rst(true)
.fpga3_out_rst(true)
);
slcr.fpga0_clk_ctrl.write(
slcr::Fpga0ClkCtrl::zeroed()
.src_sel(slcr::PllSource::IoPll)
.divisor0(8)
.divisor1(1)
);
slcr.fpga_rst_ctrl.write(
slcr::FpgaRstCtrl::zeroed()
);
});
}
fn identifier_read(buf: &mut [u8]) -> &str { pub unsafe fn get_async_errors() -> u8 {
unsafe { let errors = SEEN_ASYNC_ERRORS;
pl::csr::identifier::address_write(0); SEEN_ASYNC_ERRORS = 0;
let len = pl::csr::identifier::data_read(); errors
let len = cmp::min(len, buf.len() as u8);
for i in 0..len {
pl::csr::identifier::address_write(1 + i);
buf[i as usize] = pl::csr::identifier::data_read();
}
str::from_utf8_unchecked(&buf[..len as usize])
}
}
fn init_rtio(timer: &mut GlobalTimer, cfg: &Config) {
let clock_sel =
if let Ok(rtioclk) = cfg.read_str("rtioclk") {
match rtioclk.as_ref() {
"internal" => {
info!("using internal RTIO clock");
0
},
"external" => {
info!("using external RTIO clock");
1
},
other => {
warn!("RTIO clock specification '{}' not recognized", other);
info!("using internal RTIO clock");
0
},
}
} else {
info!("using internal RTIO clock (default)");
0
};
loop {
unsafe {
pl::csr::rtio_crg::pll_reset_write(1);
pl::csr::rtio_crg::clock_sel_write(clock_sel);
pl::csr::rtio_crg::pll_reset_write(0);
}
timer.delay_ms(1);
let locked = unsafe { pl::csr::rtio_crg::pll_locked_read() != 0 };
if locked {
info!("RTIO PLL locked");
break;
} else {
warn!("RTIO PLL failed to lock, retrying...");
timer.delay_ms(500);
}
}
unsafe {
pl::csr::rtio_core::reset_phy_write(1);
}
} }
fn wait_for_async_rtio_error() -> nb::Result<(), Void> { fn wait_for_async_rtio_error() -> nb::Result<(), Void> {
@ -154,11 +77,14 @@ async fn report_async_rtio_errors() {
error!("RTIO sequence error involving channel {}", error!("RTIO sequence error involving channel {}",
pl::csr::rtio_core::sequence_error_channel_read()); pl::csr::rtio_core::sequence_error_channel_read());
} }
SEEN_ASYNC_ERRORS = errors;
pl::csr::rtio_core::async_error_write(errors); pl::csr::rtio_core::async_error_write(errors);
} }
} }
} }
static mut LOG_BUFFER: [u8; 1<<17] = [0; 1<<17]; static mut LOG_BUFFER: [u8; 1<<17] = [0; 1<<17];
#[no_mangle] #[no_mangle]
@ -191,7 +117,8 @@ pub fn main_core0() {
} }
}; };
init_rtio(&mut timer, &cfg); rtio_clocking::init(&mut timer, &cfg);
task::spawn(report_async_rtio_errors()); task::spawn(report_async_rtio_errors());
comms::main(timer, cfg); comms::main(timer, cfg);

View File

@ -6,7 +6,7 @@ use core::cell::RefCell;
use alloc::{rc::Rc, vec::Vec, string::String}; use alloc::{rc::Rc, vec::Vec, string::String};
use log::{self, info, debug, warn, error, LevelFilter}; use log::{self, info, debug, warn, error, LevelFilter};
use crate::logger::{BufferLogger, LogBufferRef}; use libboard_artiq::logger::{BufferLogger, LogBufferRef};
use crate::proto_async::*; use crate::proto_async::*;
use num_derive::FromPrimitive; use num_derive::FromPrimitive;
use num_traits::FromPrimitive; use num_traits::FromPrimitive;
@ -121,7 +121,7 @@ async fn handle_connection(
loop { loop {
let msg = read_i8(stream).await; let msg = read_i8(stream).await;
if let Err(smoltcp::Error::Illegal) = msg { if let Err(smoltcp::Error::Finished) = msg {
return Ok(()); return Ok(());
} }
let msg: Request = FromPrimitive::from_i8(msg?).ok_or(Error::UnrecognizedPacket)?; let msg: Request = FromPrimitive::from_i8(msg?).ok_or(Error::UnrecognizedPacket)?;

View File

@ -1,17 +1,19 @@
use core::fmt; use core::{fmt, cell::RefCell};
use alloc::collections::BTreeMap; use alloc::{collections::BTreeMap, rc::Rc};
use log::{debug, info, warn}; use log::{debug, info, warn};
use void::Void; use void::Void;
use libboard_artiq::drtio_routing;
use libboard_zynq::{smoltcp, timer::GlobalTimer, time::Milliseconds}; use libboard_zynq::{smoltcp, timer::GlobalTimer, time::Milliseconds};
use libasync::{task, smoltcp::TcpStream, block_async, nb}; use libasync::{task, smoltcp::TcpStream, block_async, nb};
use libcortex_a9::mutex::Mutex;
use num_derive::{FromPrimitive, ToPrimitive}; use num_derive::{FromPrimitive, ToPrimitive};
use num_traits::{FromPrimitive, ToPrimitive}; use num_traits::{FromPrimitive, ToPrimitive};
use futures::{pin_mut, select_biased, FutureExt}; use futures::{pin_mut, select_biased, FutureExt};
use crate::proto_async::*; use crate::proto_async::*;
use crate::pl::csr;
#[derive(Debug, Clone, Copy, PartialEq, Eq)] #[derive(Debug, Clone, Copy, PartialEq, Eq)]
@ -19,7 +21,6 @@ pub enum Error {
NetworkError(smoltcp::Error), NetworkError(smoltcp::Error),
UnexpectedPattern, UnexpectedPattern,
UnrecognizedPacket, UnrecognizedPacket,
} }
pub type Result<T> = core::result::Result<T, Error>; pub type Result<T> = core::result::Result<T, Error>;
@ -54,32 +55,109 @@ enum DeviceMessage {
InjectionStatus = 1 InjectionStatus = 1
} }
fn read_probe(channel: i32, probe: i8) -> i32 { #[cfg(has_drtio)]
mod remote_moninj {
use super::*;
use libboard_artiq::drtioaux;
use crate::rtio_mgt::drtio;
use log::error;
pub fn read_probe(aux_mutex: &Rc<Mutex<bool>>, timer: GlobalTimer, linkno: u8, destination: u8, channel: i32, probe: i8) -> i32 {
let reply = task::block_on(drtio::aux_transact(aux_mutex, linkno, &drtioaux::Packet::MonitorRequest {
destination: destination,
channel: channel as _,
probe: probe as _},
timer));
match reply {
Ok(drtioaux::Packet::MonitorReply { value }) => return value as i32,
Ok(packet) => error!("received unexpected aux packet: {:?}", packet),
Err(e) => error!("aux packet error ({})", e)
}
0
}
pub fn inject(aux_mutex: &Rc<Mutex<bool>>, _timer: GlobalTimer, linkno: u8, destination: u8, channel: i32, overrd: i8, value: i8) {
let _lock = aux_mutex.lock();
drtioaux::send(linkno, &drtioaux::Packet::InjectionRequest {
destination: destination,
channel: channel as _,
overrd: overrd as _,
value: value as _
}).unwrap();
}
pub fn read_injection_status(aux_mutex: &Rc<Mutex<bool>>, timer: GlobalTimer, linkno: u8, destination: u8, channel: i32, overrd: i8) -> i8 {
let reply = task::block_on(drtio::aux_transact(aux_mutex,
linkno,
&drtioaux::Packet::InjectionStatusRequest {
destination: destination,
channel: channel as _,
overrd: overrd as _},
timer));
match reply {
Ok(drtioaux::Packet::InjectionStatusReply { value }) => return value as i8,
Ok(packet) => error!("received unexpected aux packet: {:?}", packet),
Err(e) => error!("aux packet error ({})", e)
}
0
}
}
mod local_moninj {
use libboard_artiq::pl::csr;
pub fn read_probe(channel: i32, probe: i8) -> i32 {
unsafe { unsafe {
csr::rtio_moninj::mon_chan_sel_write(channel as _); csr::rtio_moninj::mon_chan_sel_write(channel as _);
csr::rtio_moninj::mon_probe_sel_write(probe as _); csr::rtio_moninj::mon_probe_sel_write(probe as _);
csr::rtio_moninj::mon_value_update_write(1); csr::rtio_moninj::mon_value_update_write(1);
csr::rtio_moninj::mon_value_read() as i32 csr::rtio_moninj::mon_value_read() as i32
} }
} }
fn inject(channel: i32, overrd: i8, value: i8) { pub fn inject(channel: i32, overrd: i8, value: i8) {
unsafe { unsafe {
csr::rtio_moninj::inj_chan_sel_write(channel as _); csr::rtio_moninj::inj_chan_sel_write(channel as _);
csr::rtio_moninj::inj_override_sel_write(overrd as _); csr::rtio_moninj::inj_override_sel_write(overrd as _);
csr::rtio_moninj::inj_value_write(value as _); csr::rtio_moninj::inj_value_write(value as _);
} }
} }
fn read_injection_status(channel: i32, overrd: i8) -> i8 { pub fn read_injection_status(channel: i32, overrd: i8) -> i8 {
unsafe { unsafe {
csr::rtio_moninj::inj_chan_sel_write(channel as _); csr::rtio_moninj::inj_chan_sel_write(channel as _);
csr::rtio_moninj::inj_override_sel_write(overrd as _); csr::rtio_moninj::inj_override_sel_write(overrd as _);
csr::rtio_moninj::inj_value_read() as i8 csr::rtio_moninj::inj_value_read() as i8
} }
}
} }
async fn handle_connection(stream: &TcpStream, timer: GlobalTimer) -> Result<()> { #[cfg(has_drtio)]
macro_rules! dispatch {
($timer:ident, $aux_mutex:ident, $routing_table:ident, $channel:expr, $func:ident $(, $param:expr)*) => {{
let destination = ($channel >> 16) as u8;
let channel = $channel;
let routing_table = $routing_table.borrow_mut();
let hop = routing_table.0[destination as usize][0];
if hop == 0 {
local_moninj::$func(channel.into(), $($param, )*)
} else {
let linkno = hop - 1 as u8;
remote_moninj::$func($aux_mutex, $timer, linkno, destination, channel, $($param, )*)
}
}}
}
#[cfg(not(has_drtio))]
macro_rules! dispatch {
($timer:ident, $aux_mutex:ident, $routing_table:ident, $channel:expr, $func:ident $(, $param:expr)*) => {{
let channel = $channel as u16;
local_moninj::$func(channel.into(), $($param, )*)
}}
}
async fn handle_connection(stream: &TcpStream, timer: GlobalTimer,
_aux_mutex: &Rc<Mutex<bool>>, _routing_table: &Rc<RefCell<drtio_routing::RoutingTable>>) -> Result<()> {
if !expect(&stream, b"ARTIQ moninj\n").await? { if !expect(&stream, b"ARTIQ moninj\n").await? {
return Err(Error::UnexpectedPattern); return Err(Error::UnexpectedPattern);
} }
@ -135,13 +213,13 @@ async fn handle_connection(stream: &TcpStream, timer: GlobalTimer) -> Result<()>
let channel = read_i32(&stream).await?; let channel = read_i32(&stream).await?;
let overrd = read_i8(&stream).await?; let overrd = read_i8(&stream).await?;
let value = read_i8(&stream).await?; let value = read_i8(&stream).await?;
inject(channel, overrd, value); dispatch!(timer, _aux_mutex, _routing_table, channel, inject, overrd, value);
debug!("INJECT channel {}, overrd {}, value {}", channel, overrd, value); debug!("INJECT channel {}, overrd {}, value {}", channel, overrd, value);
}, },
HostMessage::GetInjectionStatus => { HostMessage::GetInjectionStatus => {
let channel = read_i32(&stream).await?; let channel = read_i32(&stream).await?;
let overrd = read_i8(&stream).await?; let overrd = read_i8(&stream).await?;
let value = read_injection_status(channel, overrd); let value = dispatch!(timer, _aux_mutex, _routing_table, channel, read_injection_status, overrd);
write_i8(&stream, DeviceMessage::InjectionStatus.to_i8().unwrap()).await?; write_i8(&stream, DeviceMessage::InjectionStatus.to_i8().unwrap()).await?;
write_i32(&stream, channel).await?; write_i32(&stream, channel).await?;
write_i8(&stream, overrd).await?; write_i8(&stream, overrd).await?;
@ -151,7 +229,7 @@ async fn handle_connection(stream: &TcpStream, timer: GlobalTimer) -> Result<()>
}, },
_ = timeout_f => { _ = timeout_f => {
for (&(channel, probe), previous) in probe_watch_list.iter_mut() { for (&(channel, probe), previous) in probe_watch_list.iter_mut() {
let current = read_probe(channel, probe); let current = dispatch!(timer, _aux_mutex, _routing_table, channel, read_probe, probe);
if previous.is_none() || previous.unwrap() != current { if previous.is_none() || previous.unwrap() != current {
write_i8(&stream, DeviceMessage::MonitorStatus.to_i8().unwrap()).await?; write_i8(&stream, DeviceMessage::MonitorStatus.to_i8().unwrap()).await?;
write_i32(&stream, channel).await?; write_i32(&stream, channel).await?;
@ -161,7 +239,7 @@ async fn handle_connection(stream: &TcpStream, timer: GlobalTimer) -> Result<()>
} }
} }
for (&(channel, overrd), previous) in inject_watch_list.iter_mut() { for (&(channel, overrd), previous) in inject_watch_list.iter_mut() {
let current = read_injection_status(channel, overrd); let current = dispatch!(timer, _aux_mutex, _routing_table, channel, read_injection_status, overrd);
if previous.is_none() || previous.unwrap() != current { if previous.is_none() || previous.unwrap() != current {
write_i8(&stream, DeviceMessage::InjectionStatus.to_i8().unwrap()).await?; write_i8(&stream, DeviceMessage::InjectionStatus.to_i8().unwrap()).await?;
write_i32(&stream, channel).await?; write_i32(&stream, channel).await?;
@ -176,15 +254,17 @@ async fn handle_connection(stream: &TcpStream, timer: GlobalTimer) -> Result<()>
} }
} }
pub fn start(timer: GlobalTimer) { pub fn start(timer: GlobalTimer, aux_mutex: Rc<Mutex<bool>>, routing_table: Rc<RefCell<drtio_routing::RoutingTable>>) {
task::spawn(async move { task::spawn(async move {
loop { loop {
let aux_mutex = aux_mutex.clone();
let routing_table = routing_table.clone();
let stream = TcpStream::accept(1383, 2048, 2048).await.unwrap(); let stream = TcpStream::accept(1383, 2048, 2048).await.unwrap();
task::spawn(async move { task::spawn(async move {
info!("received connection"); info!("received connection");
let result = handle_connection(&stream, timer).await; let result = handle_connection(&stream, timer, &aux_mutex, &routing_table).await;
match result { match result {
Err(Error::NetworkError(smoltcp::Error::Illegal)) => info!("peer closed connection"), Err(Error::NetworkError(smoltcp::Error::Finished)) => info!("peer closed connection"),
Err(error) => warn!("connection terminated: {}", error), Err(error) => warn!("connection terminated: {}", error),
_ => (), _ => (),
} }

View File

@ -10,7 +10,7 @@ use libasync::smoltcp::TcpStream;
use alloc::boxed::Box; use alloc::boxed::Box;
use async_recursion::async_recursion; use async_recursion::async_recursion;
use crate::proto_core_io::ProtoWrite; use io::proto::ProtoWrite;
use crate::proto_async; use crate::proto_async;
use self::tag::{Tag, TagIterator, split_tag}; use self::tag::{Tag, TagIterator, split_tag};

View File

@ -0,0 +1,238 @@
use log::{info, warn};
use libboard_zynq::timer::GlobalTimer;
use embedded_hal::blocking::delay::DelayMs;
use libconfig::Config;
use libboard_artiq::pl;
#[cfg(has_si5324)]
use libboard_zynq::i2c::I2c;
#[cfg(has_si5324)]
use crate::i2c;
#[cfg(has_si5324)]
use libboard_artiq::si5324;
#[derive(Debug, PartialEq, Copy, Clone)]
#[allow(non_camel_case_types)]
pub enum RtioClock {
Default,
Int_125,
Int_100,
Int_150,
Ext0_Bypass,
Ext0_Synth0_10to125,
Ext0_Synth0_100to125,
Ext0_Synth0_125to125,
}
#[allow(unreachable_code)]
fn get_rtio_clock_cfg(cfg: &Config) -> RtioClock {
let mut res = RtioClock::Default;
if let Ok(clk) = cfg.read_str("rtio_clock") {
res = match clk.as_ref() {
"int_125" => RtioClock::Int_125,
"int_100" => RtioClock::Int_100,
"int_150" => RtioClock::Int_150,
"ext0_bypass" => RtioClock::Ext0_Bypass,
"ext0_bypass_125" => RtioClock::Ext0_Bypass,
"ext0_bypass_100" => RtioClock::Ext0_Bypass,
"ext0_synth0_10to125" => RtioClock::Ext0_Synth0_10to125,
"ext0_synth0_100to125" => RtioClock::Ext0_Synth0_100to125,
"ext0_synth0_125to125" => RtioClock::Ext0_Synth0_125to125,
_ => {
warn!("Unrecognised rtio_clock setting. Falling back to default.");
RtioClock::Default
}
};
}
else {
warn!("error reading configuration. Falling back to default.");
}
if res == RtioClock::Default {
#[cfg(rtio_frequency="100.0")]
{
warn!("Using default configuration - internal 100MHz RTIO clock.");
return RtioClock::Int_100;
}
#[cfg(rtio_frequency="125.0")]
{
warn!("Using default configuration - internal 125MHz RTIO clock.");
return RtioClock::Int_125;
}
// anything else
{
warn!("Using default configuration - internal 125MHz RTIO clock.");
return RtioClock::Int_125;
}
}
res
}
fn init_rtio(timer: &mut GlobalTimer, _clk: RtioClock) {
#[cfg(has_rtio_crg_clock_sel)]
let clock_sel = match _clk {
RtioClock::Ext0_Bypass => {
info!("Using bypassed external clock");
1
},
RtioClock::Int_125 => {
info!("Using internal RTIO clock");
0
},
_ => {
warn!("rtio_clock setting '{:?}' is not supported. Using default internal RTIO clock instead", _clk);
0
}
};
loop {
unsafe {
pl::csr::rtio_crg::pll_reset_write(1);
#[cfg(has_rtio_crg_clock_sel)]
pl::csr::rtio_crg::clock_sel_write(clock_sel);
pl::csr::rtio_crg::pll_reset_write(0);
}
timer.delay_ms(1);
let locked = unsafe { pl::csr::rtio_crg::pll_locked_read() != 0 };
if locked {
info!("RTIO PLL locked");
break;
} else {
warn!("RTIO PLL failed to lock, retrying...");
timer.delay_ms(500);
}
}
unsafe {
pl::csr::rtio_core::reset_phy_write(1);
}
}
#[cfg(has_drtio)]
fn init_drtio(timer: &mut GlobalTimer)
{
unsafe {
pl::csr::drtio_transceiver::stable_clkin_write(1);
}
timer.delay_ms(2); // wait for CPLL/QPLL lock
unsafe {
pl::csr::drtio_transceiver::txenable_write(0xffffffffu32 as _);
}
}
#[cfg(has_si5324)]
fn setup_si5324(i2c: &mut I2c, timer: &mut GlobalTimer, clk: RtioClock) {
let si5324_settings = match clk {
RtioClock::Ext0_Synth0_10to125 => { // 125 MHz output from 10 MHz CLKINx reference, 504 Hz BW
info!("using 10MHz reference to make 125MHz RTIO clock with PLL");
si5324::FrequencySettings {
n1_hs : 10,
nc1_ls : 4,
n2_hs : 10,
n2_ls : 300,
n31 : 6,
n32 : 6,
bwsel : 4,
crystal_ref: false
}
},
RtioClock::Ext0_Synth0_100to125 => { // 125MHz output, from 100MHz CLKINx reference, 586 Hz loop bandwidth
info!("using 10MHz reference to make 125MHz RTIO clock with PLL");
si5324::FrequencySettings {
n1_hs : 10,
nc1_ls : 4,
n2_hs : 10,
n2_ls : 260,
n31 : 52,
n32 : 52,
bwsel : 4,
crystal_ref: false
}
},
RtioClock::Ext0_Synth0_125to125 => { // 125MHz output, from 125MHz CLKINx reference, 606 Hz loop bandwidth
info!("using 10MHz reference to make 125MHz RTIO clock with PLL");
si5324::FrequencySettings {
n1_hs : 5,
nc1_ls : 8,
n2_hs : 7,
n2_ls : 360,
n31 : 63,
n32 : 63,
bwsel : 4,
crystal_ref: false
}
},
RtioClock::Int_150 => { // 150MHz output, from crystal
info!("using internal 150MHz RTIO clock");
si5324::FrequencySettings {
n1_hs : 9,
nc1_ls : 4,
n2_hs : 10,
n2_ls : 33732,
n31 : 7139,
n32 : 7139,
bwsel : 3,
crystal_ref: true
}
},
RtioClock::Int_100 => { // 100MHz output, from crystal.
info!("using internal 100MHz RTIO clock");
si5324::FrequencySettings {
n1_hs : 9,
nc1_ls : 6,
n2_hs : 10,
n2_ls : 33732,
n31 : 7139,
n32 : 7139,
bwsel : 3,
crystal_ref: true
}
},
RtioClock::Int_125 => { // 125MHz output, from crystal, 7 Hz
info!("using internal 125MHz RTIO clock");
si5324::FrequencySettings {
n1_hs : 10,
nc1_ls : 4,
n2_hs : 10,
n2_ls : 19972,
n31 : 4565,
n32 : 4565,
bwsel : 4,
crystal_ref: true
}
}
_ => { // same setting as Int_125, but fallback to default
warn!("rtio_clock setting '{:?}' is unsupported. Falling back to default internal 125MHz RTIO clock.", clk);
si5324::FrequencySettings {
n1_hs : 10,
nc1_ls : 4,
n2_hs : 10,
n2_ls : 19972,
n31 : 4565,
n32 : 4565,
bwsel : 4,
crystal_ref: true
}
}
};
let si5324_ref_input = si5324::Input::Ckin2;
si5324::setup(i2c, &si5324_settings, si5324_ref_input, timer).expect("cannot initialize Si5324");
}
pub fn init(timer: &mut GlobalTimer, cfg: &Config) {
let clk = get_rtio_clock_cfg(cfg);
#[cfg(has_si5324)]
{
let i2c = unsafe { (&mut i2c::I2C_BUS).as_mut().unwrap() };
let si5324_ext_input = si5324::Input::Ckin2;
match clk {
RtioClock::Ext0_Bypass => si5324::bypass(i2c, si5324_ext_input, timer).expect("cannot bypass Si5324"),
_ => setup_si5324(i2c, timer, clk),
}
}
#[cfg(has_drtio)]
init_drtio(timer);
init_rtio(timer, clk);
}

352
src/runtime/src/rtio_mgt.rs Normal file
View File

@ -0,0 +1,352 @@
use core::cell::RefCell;
use alloc::rc::Rc;
use libboard_zynq::timer::GlobalTimer;
use libboard_artiq::{pl::csr, drtio_routing};
use libcortex_a9::mutex::Mutex;
#[cfg(has_drtio)]
pub mod drtio {
use super::*;
use libboard_artiq::drtioaux_async;
use libboard_artiq::drtioaux_async::Packet;
use libboard_artiq::drtioaux::Error;
use log::{warn, error, info};
use embedded_hal::blocking::delay::DelayMs;
use libasync::{task, delay};
use libboard_zynq::time::Milliseconds;
pub fn startup(aux_mutex: &Rc<Mutex<bool>>,
routing_table: &Rc<RefCell<drtio_routing::RoutingTable>>,
up_destinations: &Rc<RefCell<[bool; drtio_routing::DEST_COUNT]>>,
timer: GlobalTimer) {
let aux_mutex = aux_mutex.clone();
let routing_table = routing_table.clone();
let up_destinations = up_destinations.clone();
task::spawn(async move {
let routing_table = routing_table.borrow();
link_task(&aux_mutex, &routing_table, &up_destinations, timer).await;
});
}
async fn link_rx_up(linkno: u8) -> bool {
let linkno = linkno as usize;
unsafe {
(csr::DRTIO[linkno].rx_up_read)() == 1
}
}
async fn recv_aux_timeout(linkno: u8, timeout: u64, timer: GlobalTimer) -> Result<Packet, &'static str> {
if !link_rx_up(linkno).await {
return Err("link went down");
}
match drtioaux_async::recv_timeout(linkno, Some(timeout), timer).await {
Ok(packet) => return Ok(packet),
Err(Error::TimedOut) => return Err("timed out"),
Err(_) => return Err("aux packet error"),
}
}
pub async fn aux_transact(aux_mutex: &Mutex<bool>, linkno: u8, request: &Packet,
timer: GlobalTimer) -> Result<Packet, &'static str> {
let _lock = aux_mutex.lock();
drtioaux_async::send(linkno, request).await.unwrap();
recv_aux_timeout(linkno, 200, timer).await
}
async fn drain_buffer(linkno: u8, draining_time: Milliseconds, timer: GlobalTimer) {
let max_time = timer.get_time() + draining_time;
loop {
if timer.get_time() > max_time {
return;
} //could this be cut short?
let _ = drtioaux_async::recv(linkno).await;
}
}
async fn ping_remote(aux_mutex: &Rc<Mutex<bool>>, linkno: u8, timer: GlobalTimer) -> u32 {
let mut count = 0;
loop {
if !link_rx_up(linkno).await {
return 0
}
count += 1;
if count > 100 {
return 0;
}
let reply = aux_transact(aux_mutex, linkno, &Packet::EchoRequest, timer).await;
match reply {
Ok(Packet::EchoReply) => {
// make sure receive buffer is drained
let draining_time = Milliseconds(200);
drain_buffer(linkno, draining_time, timer).await;
return count;
}
_ => {}
}
}
}
async fn sync_tsc(aux_mutex: &Rc<Mutex<bool>>, linkno: u8, timer: GlobalTimer) -> Result<(), &'static str> {
let _lock = aux_mutex.lock();
unsafe {
(csr::DRTIO[linkno as usize].set_time_write)(1);
while (csr::DRTIO[linkno as usize].set_time_read)() == 1 {}
}
// TSCAck is the only aux packet that is sent spontaneously
// by the satellite, in response to a TSC set on the RT link.
let reply = recv_aux_timeout(linkno, 10000, timer).await?;
if reply == Packet::TSCAck {
return Ok(());
} else {
return Err("unexpected reply");
}
}
async fn load_routing_table(aux_mutex: &Rc<Mutex<bool>>, linkno: u8, routing_table: &drtio_routing::RoutingTable,
timer: GlobalTimer) -> Result<(), &'static str> {
for i in 0..drtio_routing::DEST_COUNT {
let reply = aux_transact(aux_mutex, linkno, &Packet::RoutingSetPath {
destination: i as u8,
hops: routing_table.0[i]
}, timer).await?;
if reply != Packet::RoutingAck {
return Err("unexpected reply");
}
}
Ok(())
}
async fn set_rank(aux_mutex: &Rc<Mutex<bool>>, linkno: u8, rank: u8, timer: GlobalTimer) -> Result<(), &'static str> {
let reply = aux_transact(aux_mutex, linkno, &Packet::RoutingSetRank {
rank: rank
}, timer).await?;
if reply != Packet::RoutingAck {
return Err("unexpected reply");
}
Ok(())
}
async fn init_buffer_space(destination: u8, linkno: u8) {
let linkno = linkno as usize;
unsafe {
(csr::DRTIO[linkno].destination_write)(destination);
(csr::DRTIO[linkno].force_destination_write)(1);
(csr::DRTIO[linkno].o_get_buffer_space_write)(1);
while (csr::DRTIO[linkno].o_wait_read)() == 1 {}
info!("[DEST#{}] buffer space is {}",
destination, (csr::DRTIO[linkno].o_dbg_buffer_space_read)());
(csr::DRTIO[linkno].force_destination_write)(0);
}
}
async fn process_unsolicited_aux(aux_mutex: &Rc<Mutex<bool>>, linkno: u8) {
let _lock = aux_mutex.lock();
match drtioaux_async::recv(linkno).await {
Ok(Some(packet)) => warn!("[LINK#{}] unsolicited aux packet: {:?}", linkno, packet),
Ok(None) => (),
Err(_) => warn!("[LINK#{}] aux packet error", linkno)
}
}
async fn process_local_errors(linkno: u8) {
let errors;
let linkidx = linkno as usize;
unsafe {
errors = (csr::DRTIO[linkidx].protocol_error_read)();
(csr::DRTIO[linkidx].protocol_error_write)(errors);
}
if errors != 0 {
error!("[LINK#{}] error(s) found (0x{:02x}):", linkno, errors);
if errors & 1 != 0 {
error!("[LINK#{}] received packet of an unknown type", linkno);
}
if errors & 2 != 0 {
error!("[LINK#{}] received truncated packet", linkno);
}
if errors & 4 != 0 {
error!("[LINK#{}] timeout attempting to get remote buffer space", linkno);
}
}
}
async fn destination_set_up(routing_table: &drtio_routing::RoutingTable,
up_destinations: &Rc<RefCell<[bool; drtio_routing::DEST_COUNT]>>,
destination: u8, up: bool) {
let mut up_destinations = up_destinations.borrow_mut();
up_destinations[destination as usize] = up;
if up {
drtio_routing::interconnect_enable(routing_table, 0, destination);
info!("[DEST#{}] destination is up", destination);
} else {
drtio_routing::interconnect_disable(destination);
info!("[DEST#{}] destination is down", destination);
}
}
async fn destination_up(up_destinations: &Rc<RefCell<[bool; drtio_routing::DEST_COUNT]>>, destination: u8) -> bool {
let up_destinations = up_destinations.borrow();
up_destinations[destination as usize]
}
async fn destination_survey(aux_mutex: &Rc<Mutex<bool>>, routing_table: &drtio_routing::RoutingTable,
up_links: &[bool],
up_destinations: &Rc<RefCell<[bool; drtio_routing::DEST_COUNT]>>,
timer: GlobalTimer) {
for destination in 0..drtio_routing::DEST_COUNT {
let hop = routing_table.0[destination][0];
let destination = destination as u8;
if hop == 0 {
/* local RTIO */
if !destination_up(up_destinations, destination).await {
destination_set_up(routing_table, up_destinations, destination, true).await;
}
} else if hop as usize <= csr::DRTIO.len() {
let linkno = hop - 1;
if destination_up(up_destinations, destination).await {
if up_links[linkno as usize] {
let reply = aux_transact(aux_mutex, linkno, &Packet::DestinationStatusRequest {
destination: destination
}, timer).await;
match reply {
Ok(Packet::DestinationDownReply) =>
destination_set_up(routing_table, up_destinations, destination, false).await,
Ok(Packet::DestinationOkReply) => (),
Ok(Packet::DestinationSequenceErrorReply { channel }) =>
error!("[DEST#{}] RTIO sequence error involving channel 0x{:04x}", destination, channel),
Ok(Packet::DestinationCollisionReply { channel }) =>
error!("[DEST#{}] RTIO collision involving channel 0x{:04x}", destination, channel),
Ok(Packet::DestinationBusyReply { channel }) =>
error!("[DEST#{}] RTIO busy error involving channel 0x{:04x}", destination, channel),
Ok(packet) => error!("[DEST#{}] received unexpected aux packet: {:?}", destination, packet),
Err(e) => error!("[DEST#{}] communication failed ({})", destination, e)
}
} else {
destination_set_up(routing_table, up_destinations, destination, false).await;
}
} else {
if up_links[linkno as usize] {
let reply = aux_transact(aux_mutex, linkno, &Packet::DestinationStatusRequest {
destination: destination
}, timer).await;
match reply {
Ok(Packet::DestinationDownReply) => (),
Ok(Packet::DestinationOkReply) => {
destination_set_up(routing_table, up_destinations, destination, true).await;
init_buffer_space(destination as u8, linkno).await;
},
Ok(packet) => error!("[DEST#{}] received unexpected aux packet: {:?}", destination, packet),
Err(e) => error!("[DEST#{}] communication failed ({})", destination, e)
}
}
}
}
}
}
pub async fn link_task(aux_mutex: &Rc<Mutex<bool>>,
routing_table: &drtio_routing::RoutingTable,
up_destinations: &Rc<RefCell<[bool; drtio_routing::DEST_COUNT]>>,
timer: GlobalTimer) {
let mut up_links = [false; csr::DRTIO.len()];
loop {
for linkno in 0..csr::DRTIO.len() {
let linkno = linkno as u8;
if up_links[linkno as usize] {
/* link was previously up */
if link_rx_up(linkno).await {
process_unsolicited_aux(aux_mutex, linkno).await;
process_local_errors(linkno).await;
} else {
info!("[LINK#{}] link is down", linkno);
up_links[linkno as usize] = false;
}
} else {
/* link was previously down */
if link_rx_up(linkno).await {
info!("[LINK#{}] link RX became up, pinging", linkno);
let ping_count = ping_remote(aux_mutex, linkno, timer).await;
if ping_count > 0 {
info!("[LINK#{}] remote replied after {} packets", linkno, ping_count);
up_links[linkno as usize] = true;
if let Err(e) = sync_tsc(aux_mutex, linkno, timer).await {
error!("[LINK#{}] failed to sync TSC ({})", linkno, e);
}
if let Err(e) = load_routing_table(aux_mutex, linkno, routing_table, timer).await {
error!("[LINK#{}] failed to load routing table ({})", linkno, e);
}
if let Err(e) = set_rank(aux_mutex, linkno, 1 as u8, timer).await {
error!("[LINK#{}] failed to set rank ({})", linkno, e);
}
info!("[LINK#{}] link initialization completed", linkno);
} else {
error!("[LINK#{}] ping failed", linkno);
}
}
}
}
destination_survey(aux_mutex, routing_table, &up_links, up_destinations, timer).await;
let mut countdown = timer.countdown();
delay(&mut countdown, Milliseconds(200)).await;
}
}
#[allow(dead_code)]
pub fn reset(aux_mutex: Rc<Mutex<bool>>, mut timer: GlobalTimer) {
for linkno in 0..csr::DRTIO.len() {
unsafe {
(csr::DRTIO[linkno].reset_write)(1);
}
}
timer.delay_ms(1);
for linkno in 0..csr::DRTIO.len() {
unsafe {
(csr::DRTIO[linkno].reset_write)(0);
}
}
for linkno in 0..csr::DRTIO.len() {
let linkno = linkno as u8;
if task::block_on(link_rx_up(linkno)) {
let reply = task::block_on(aux_transact(&aux_mutex, linkno,
&Packet::ResetRequest, timer));
match reply {
Ok(Packet::ResetAck) => (),
Ok(_) => error!("[LINK#{}] reset failed, received unexpected aux packet", linkno),
Err(e) => error!("[LINK#{}] reset failed, aux packet error ({})", linkno, e)
}
}
}
}
}
#[cfg(not(has_drtio))]
pub mod drtio {
use super::*;
pub fn startup(_aux_mutex: &Rc<Mutex<bool>>, _routing_table: &Rc<RefCell<drtio_routing::RoutingTable>>,
_up_destinations: &Rc<RefCell<[bool; drtio_routing::DEST_COUNT]>>, _timer: GlobalTimer) {}
#[allow(dead_code)]
pub fn reset(_aux_mutex: Rc<Mutex<bool>>, mut _timer: GlobalTimer) {}
}
pub fn startup(aux_mutex: &Rc<Mutex<bool>>,
routing_table: &Rc<RefCell<drtio_routing::RoutingTable>>,
up_destinations: &Rc<RefCell<[bool; drtio_routing::DEST_COUNT]>>,
timer: GlobalTimer) {
drtio::startup(aux_mutex, routing_table, up_destinations, timer);
unsafe {
csr::rtio_core::reset_phy_write(1);
}
}
#[allow(dead_code)]
pub fn reset(aux_mutex: Rc<Mutex<bool>>, timer: GlobalTimer) {
unsafe {
csr::rtio_core::reset_write(1);
}
drtio::reset(aux_mutex, timer)
}

28
src/satman/Cargo.toml Normal file
View File

@ -0,0 +1,28 @@
[package]
authors = ["M-Labs"]
name = "satman"
version = "0.0.0"
build = "build.rs"
[features]
target_zc706 = ["libboard_zynq/target_zc706", "libsupport_zynq/target_zc706", "libconfig/target_zc706", "libboard_artiq/target_zc706"]
target_kasli_soc = ["libboard_zynq/target_kasli_soc", "libsupport_zynq/target_kasli_soc", "libconfig/target_kasli_soc", "libboard_artiq/target_kasli_soc"]
default = ["target_zc706", ]
[build-dependencies]
build_zynq = { path = "../libbuild_zynq" }
[dependencies]
log = { version = "0.4", default-features = false }
embedded-hal = "0.2"
libboard_zynq = { git = "https://git.m-labs.hk/M-Labs/zynq-rs.git", features = ["ipv6"]}
libsupport_zynq = { default-features = false, features = ["alloc_core"], git = "https://git.m-labs.hk/M-Labs/zynq-rs.git" }
libcortex_a9 = { git = "https://git.m-labs.hk/M-Labs/zynq-rs.git" }
libasync = { git = "https://git.m-labs.hk/M-Labs/zynq-rs.git" }
libregister = { git = "https://git.m-labs.hk/M-Labs/zynq-rs.git" }
libconfig = { git = "https://git.m-labs.hk/M-Labs/zynq-rs.git", features = ["ipv6"] }
libboard_artiq = { path = "../libboard_artiq" }
unwind = { path = "../libunwind" }
libc = { path = "../libc" }

6
src/satman/build.rs Normal file
View File

@ -0,0 +1,6 @@
extern crate build_zynq;
fn main() {
build_zynq::add_linker_script();
build_zynq::cfg();
}

639
src/satman/src/main.rs Normal file
View File

@ -0,0 +1,639 @@
#![no_std]
#![no_main]
#![feature(never_type, panic_info_message, asm, naked_functions)]
#![feature(alloc_error_handler)]
#[macro_use]
extern crate log;
extern crate embedded_hal;
extern crate libboard_zynq;
extern crate libboard_artiq;
extern crate libsupport_zynq;
extern crate libcortex_a9;
extern crate libregister;
extern crate unwind;
extern crate alloc;
use libboard_zynq::{i2c::I2c, timer::GlobalTimer, time::Milliseconds, print, println, mpcore, gic, stdio};
use libsupport_zynq::ram;
#[cfg(has_si5324)]
use libboard_artiq::si5324;
use libboard_artiq::{pl::csr, drtio_routing, drtioaux, logger, identifier_read, init_gateware};
use libcortex_a9::{spin_lock_yield, interrupt_handler, regs::{MPIDR, SP}, notify_spin_lock, asm, l2c::enable_l2_cache};
use libregister::{RegisterW, RegisterR};
use embedded_hal::blocking::delay::DelayUs;
use core::sync::atomic::{AtomicBool, Ordering};
mod repeater;
fn drtiosat_reset(reset: bool) {
unsafe {
csr::drtiosat::reset_write(if reset { 1 } else { 0 });
}
}
fn drtiosat_reset_phy(reset: bool) {
unsafe {
csr::drtiosat::reset_phy_write(if reset { 1 } else { 0 });
}
}
fn drtiosat_link_rx_up() -> bool {
unsafe {
csr::drtiosat::rx_up_read() == 1
}
}
fn drtiosat_tsc_loaded() -> bool {
unsafe {
let tsc_loaded = csr::drtiosat::tsc_loaded_read() == 1;
if tsc_loaded {
csr::drtiosat::tsc_loaded_write(1);
}
tsc_loaded
}
}
#[cfg(has_drtio_routing)]
macro_rules! forward {
($routing_table:expr, $destination:expr, $rank:expr, $repeaters:expr, $packet:expr, $timer:expr) => {{
let hop = $routing_table.0[$destination as usize][$rank as usize];
if hop != 0 {
let repno = (hop - 1) as usize;
if repno < $repeaters.len() {
return $repeaters[repno].aux_forward($packet, $timer);
} else {
return Err(drtioaux::Error::RoutingError);
}
}
}}
}
#[cfg(not(has_drtio_routing))]
macro_rules! forward {
($routing_table:expr, $destination:expr, $rank:expr, $repeaters:expr, $packet:expr, $timer:expr) => {}
}
fn process_aux_packet(_repeaters: &mut [repeater::Repeater],
_routing_table: &mut drtio_routing::RoutingTable, _rank: &mut u8,
packet: drtioaux::Packet, timer: &mut GlobalTimer, i2c: &mut I2c) -> Result<(), drtioaux::Error> {
// In the code below, *_chan_sel_write takes an u8 if there are fewer than 256 channels,
// and u16 otherwise; hence the `as _` conversion.
match packet {
drtioaux::Packet::EchoRequest =>
drtioaux::send(0, &drtioaux::Packet::EchoReply),
drtioaux::Packet::ResetRequest => {
info!("resetting RTIO");
drtiosat_reset(true);
timer.delay_us(100);
drtiosat_reset(false);
for rep in _repeaters.iter() {
if let Err(e) = rep.rtio_reset(timer) {
error!("failed to issue RTIO reset ({:?})", e);
}
}
drtioaux::send(0, &drtioaux::Packet::ResetAck)
},
drtioaux::Packet::DestinationStatusRequest { destination: _destination } => {
#[cfg(has_drtio_routing)]
let hop = _routing_table.0[_destination as usize][*_rank as usize];
#[cfg(not(has_drtio_routing))]
let hop = 0;
if hop == 0 {
let errors;
unsafe {
errors = csr::drtiosat::rtio_error_read();
}
if errors & 1 != 0 {
let channel;
unsafe {
channel = csr::drtiosat::sequence_error_channel_read();
csr::drtiosat::rtio_error_write(1);
}
drtioaux::send(0,
&drtioaux::Packet::DestinationSequenceErrorReply { channel })?;
} else if errors & 2 != 0 {
let channel;
unsafe {
channel = csr::drtiosat::collision_channel_read();
csr::drtiosat::rtio_error_write(2);
}
drtioaux::send(0,
&drtioaux::Packet::DestinationCollisionReply { channel })?;
} else if errors & 4 != 0 {
let channel;
unsafe {
channel = csr::drtiosat::busy_channel_read();
csr::drtiosat::rtio_error_write(4);
}
drtioaux::send(0,
&drtioaux::Packet::DestinationBusyReply { channel })?;
}
else {
drtioaux::send(0, &drtioaux::Packet::DestinationOkReply)?;
}
}
#[cfg(has_drtio_routing)]
{
if hop != 0 {
let hop = hop as usize;
if hop <= csr::DRTIOREP.len() {
let repno = hop - 1;
match _repeaters[repno].aux_forward(&drtioaux::Packet::DestinationStatusRequest {
destination: _destination
}, timer) {
Ok(()) => (),
Err(drtioaux::Error::LinkDown) => drtioaux::send(0, &drtioaux::Packet::DestinationDownReply)?,
Err(e) => {
drtioaux::send(0, &drtioaux::Packet::DestinationDownReply)?;
error!("aux error when handling destination status request: {:?}", e);
},
}
} else {
drtioaux::send(0, &drtioaux::Packet::DestinationDownReply)?;
}
}
}
Ok(())
}
#[cfg(has_drtio_routing)]
drtioaux::Packet::RoutingSetPath { destination, hops } => {
_routing_table.0[destination as usize] = hops;
for rep in _repeaters.iter() {
if let Err(e) = rep.set_path(destination, &hops, timer) {
error!("failed to set path ({:?})", e);
}
}
drtioaux::send(0, &drtioaux::Packet::RoutingAck)
}
#[cfg(has_drtio_routing)]
drtioaux::Packet::RoutingSetRank { rank } => {
*_rank = rank;
drtio_routing::interconnect_enable_all(_routing_table, rank);
let rep_rank = rank + 1;
for rep in _repeaters.iter() {
if let Err(e) = rep.set_rank(rep_rank, timer) {
error!("failed to set rank ({:?})", e);
}
}
info!("rank: {}", rank);
info!("routing table: {}", _routing_table);
drtioaux::send(0, &drtioaux::Packet::RoutingAck)
}
#[cfg(not(has_drtio_routing))]
drtioaux::Packet::RoutingSetPath { destination: _, hops: _ } => {
drtioaux::send(0, &drtioaux::Packet::RoutingAck)
}
#[cfg(not(has_drtio_routing))]
drtioaux::Packet::RoutingSetRank { rank: _ } => {
drtioaux::send(0, &drtioaux::Packet::RoutingAck)
}
drtioaux::Packet::MonitorRequest { destination: _destination, channel: _channel, probe: _probe } => {
forward!(_routing_table, _destination, *_rank, _repeaters, &packet, timer);
let value;
#[cfg(has_rtio_moninj)]
unsafe {
csr::rtio_moninj::mon_chan_sel_write(channel as _);
csr::rtio_moninj::mon_probe_sel_write(probe);
csr::rtio_moninj::mon_value_update_write(1);
value = csr::rtio_moninj::mon_value_read();
}
#[cfg(not(has_rtio_moninj))]
{
value = 0;
}
let reply = drtioaux::Packet::MonitorReply { value: value as u32 };
drtioaux::send(0, &reply)
},
drtioaux::Packet::InjectionRequest { destination: _destination, channel: _channel,
overrd: _overrd, value: _value } => {
forward!(_routing_table, _destination, *_rank, _repeaters, &packet, timer);
#[cfg(has_rtio_moninj)]
unsafe {
csr::rtio_moninj::inj_chan_sel_write(channel as _);
csr::rtio_moninj::inj_override_sel_write(overrd);
csr::rtio_moninj::inj_value_write(value);
}
Ok(())
},
drtioaux::Packet::InjectionStatusRequest { destination: _destination,
channel: _channel, overrd: _overrd } => {
forward!(_routing_table, _destination, *_rank, _repeaters, &packet, timer);
let value;
#[cfg(has_rtio_moninj)]
unsafe {
csr::rtio_moninj::inj_chan_sel_write(channel as _);
csr::rtio_moninj::inj_override_sel_write(overrd);
value = csr::rtio_moninj::inj_value_read();
}
#[cfg(not(has_rtio_moninj))]
{
value = 0;
}
drtioaux::send(0, &drtioaux::Packet::InjectionStatusReply { value: value })
},
drtioaux::Packet::I2cStartRequest { destination: _destination, busno: _busno } => {
forward!(_routing_table, _destination, *_rank, _repeaters, &packet, timer);
let succeeded = i2c.start().is_ok();
drtioaux::send(0, &drtioaux::Packet::I2cBasicReply { succeeded: succeeded })
}
drtioaux::Packet::I2cRestartRequest { destination: _destination, busno: _busno } => {
forward!(_routing_table, _destination, *_rank, _repeaters, &packet, timer);
let succeeded = i2c.restart().is_ok();
drtioaux::send(0, &drtioaux::Packet::I2cBasicReply { succeeded: succeeded })
}
drtioaux::Packet::I2cStopRequest { destination: _destination, busno: _busno } => {
forward!(_routing_table, _destination, *_rank, _repeaters, &packet, timer);
let succeeded = i2c.stop().is_ok();
drtioaux::send(0, &drtioaux::Packet::I2cBasicReply { succeeded: succeeded })
}
drtioaux::Packet::I2cWriteRequest { destination: _destination, busno: _busno, data } => {
forward!(_routing_table, _destination, *_rank, _repeaters, &packet, timer);
match i2c.write(data) {
Ok(ack) => drtioaux::send(0,
&drtioaux::Packet::I2cWriteReply { succeeded: true, ack: ack }),
Err(_) => drtioaux::send(0,
&drtioaux::Packet::I2cWriteReply { succeeded: false, ack: false })
}
}
drtioaux::Packet::I2cReadRequest { destination: _destination, busno: _busno, ack } => {
forward!(_routing_table, _destination, *_rank, _repeaters, &packet, timer);
match i2c.read(ack) {
Ok(data) => drtioaux::send(0,
&drtioaux::Packet::I2cReadReply { succeeded: true, data: data }),
Err(_) => drtioaux::send(0,
&drtioaux::Packet::I2cReadReply { succeeded: false, data: 0xff })
}
}
drtioaux::Packet::SpiSetConfigRequest { destination: _destination, busno: _busno,
flags: _flags, length: _length, div: _div, cs: _cs } => {
forward!(_routing_table, _destination, *_rank, _repeaters, &packet, timer);
// todo: reimplement when/if SPI is available
//let succeeded = spi::set_config(busno, flags, length, div, cs).is_ok();
drtioaux::send(0,
&drtioaux::Packet::SpiBasicReply { succeeded: false })
},
drtioaux::Packet::SpiWriteRequest { destination: _destination, busno: _busno, data: _data } => {
forward!(_routing_table, _destination, *_rank, _repeaters, &packet, timer);
// todo: reimplement when/if SPI is available
//let succeeded = spi::write(busno, data).is_ok();
drtioaux::send(0,
&drtioaux::Packet::SpiBasicReply { succeeded: false })
}
drtioaux::Packet::SpiReadRequest { destination: _destination, busno: _busno } => {
forward!(_routing_table, _destination, *_rank, _repeaters, &packet, timer);
// todo: reimplement when/if SPI is available
// match spi::read(busno) {
// Ok(data) => drtioaux::send(0,
// &drtioaux::Packet::SpiReadReply { succeeded: true, data: data }),
// Err(_) => drtioaux::send(0,
// &drtioaux::Packet::SpiReadReply { succeeded: false, data: 0 })
// }
drtioaux::send(0,
&drtioaux::Packet::SpiReadReply { succeeded: false, data: 0 })
}
_ => {
warn!("received unexpected aux packet");
Ok(())
}
}
}
fn process_aux_packets(repeaters: &mut [repeater::Repeater],
routing_table: &mut drtio_routing::RoutingTable, rank: &mut u8,
timer: &mut GlobalTimer, i2c: &mut I2c) {
let result =
drtioaux::recv(0).and_then(|packet| {
if let Some(packet) = packet {
process_aux_packet(repeaters, routing_table, rank, packet, timer, i2c)
} else {
Ok(())
}
});
match result {
Ok(()) => (),
Err(e) => warn!("aux packet error ({:?})", e)
}
}
fn drtiosat_process_errors() {
let errors;
unsafe {
errors = csr::drtiosat::protocol_error_read();
}
if errors & 1 != 0 {
error!("received packet of an unknown type");
}
if errors & 2 != 0 {
error!("received truncated packet");
}
if errors & 4 != 0 {
let destination;
unsafe {
destination = csr::drtiosat::buffer_space_timeout_dest_read();
}
error!("timeout attempting to get buffer space from CRI, destination=0x{:02x}", destination)
}
if errors & 8 != 0 {
let channel;
let timestamp_event;
let timestamp_counter;
unsafe {
channel = csr::drtiosat::underflow_channel_read();
timestamp_event = csr::drtiosat::underflow_timestamp_event_read() as i64;
timestamp_counter = csr::drtiosat::underflow_timestamp_counter_read() as i64;
}
error!("write underflow, channel={}, timestamp={}, counter={}, slack={}",
channel, timestamp_event, timestamp_counter, timestamp_event-timestamp_counter);
}
if errors & 16 != 0 {
error!("write overflow");
}
unsafe {
csr::drtiosat::protocol_error_write(errors);
}
}
#[cfg(has_rtio_crg)]
fn init_rtio_crg(timer: GlobalTimer) {
unsafe {
csr::rtio_crg::pll_reset_write(0);
}
timer.delay_us(150);
let locked = unsafe { csr::rtio_crg::pll_locked_read() != 0 };
if !locked {
error!("RTIO clock failed");
}
}
#[cfg(not(has_rtio_crg))]
fn init_rtio_crg(_timer: GlobalTimer) { }
fn hardware_tick(ts: &mut u64, timer: &mut GlobalTimer) {
let now = timer.get_time();
let mut ts_ms = Milliseconds(*ts);
if now > ts_ms {
ts_ms = now + Milliseconds(200);
*ts = ts_ms.0;
}
}
#[cfg(all(has_si5324, rtio_frequency = "125.0"))]
const SI5324_SETTINGS: si5324::FrequencySettings
= si5324::FrequencySettings {
n1_hs : 5,
nc1_ls : 8,
n2_hs : 7,
n2_ls : 360,
n31 : 63,
n32 : 63,
bwsel : 4,
crystal_ref: true
};
#[cfg(all(has_si5324, rtio_frequency = "100.0"))]
const SI5324_SETTINGS: si5324::FrequencySettings
= si5324::FrequencySettings {
n1_hs : 5,
nc1_ls : 10,
n2_hs : 10,
n2_ls : 250,
n31 : 50,
n32 : 50,
bwsel : 4,
crystal_ref: true
};
static mut LOG_BUFFER: [u8; 1<<17] = [0; 1<<17];
#[no_mangle]
pub extern fn main_core0() -> i32 {
enable_l2_cache(0x8);
let mut timer = GlobalTimer::start();
let buffer_logger = unsafe {
logger::BufferLogger::new(&mut LOG_BUFFER[..])
};
buffer_logger.set_uart_log_level(log::LevelFilter::Info);
buffer_logger.register();
log::set_max_level(log::LevelFilter::Info);
init_gateware();
info!("ARTIQ satellite manager starting...");
info!("gateware ident {}", identifier_read(&mut [0; 64]));
ram::init_alloc_core0();
let mut i2c = I2c::i2c0();
i2c.init().expect("I2C initialization failed");
#[cfg(has_si5324)]
si5324::setup(&mut i2c, &SI5324_SETTINGS, si5324::Input::Ckin1, &mut timer).expect("cannot initialize Si5324");
unsafe {
csr::drtio_transceiver::stable_clkin_write(1);
}
timer.delay_us(1500); // wait for CPLL/QPLL lock
unsafe {
csr::drtio_transceiver::txenable_write(0xffffffffu32 as _);
}
init_rtio_crg(timer);
#[cfg(has_drtio_routing)]
let mut repeaters = [repeater::Repeater::default(); csr::DRTIOREP.len()];
#[cfg(not(has_drtio_routing))]
let mut repeaters = [repeater::Repeater::default(); 0];
for i in 0..repeaters.len() {
repeaters[i] = repeater::Repeater::new(i as u8);
}
let mut routing_table = drtio_routing::RoutingTable::default_empty();
let mut rank = 1;
let mut hardware_tick_ts = 0;
loop {
while !drtiosat_link_rx_up() {
drtiosat_process_errors();
#[allow(unused_mut)]
for mut rep in repeaters.iter_mut() {
rep.service(&routing_table, rank, &mut timer);
}
hardware_tick(&mut hardware_tick_ts, &mut timer);
}
info!("uplink is up, switching to recovered clock");
#[cfg(has_siphaser)]
{
si5324::siphaser::select_recovered_clock(&mut i2c, true, &mut timer).expect("failed to switch clocks");
si5324::siphaser::calibrate_skew(&mut timer).expect("failed to calibrate skew");
}
drtioaux::reset(0);
drtiosat_reset(false);
drtiosat_reset_phy(false);
while drtiosat_link_rx_up() {
drtiosat_process_errors();
process_aux_packets(&mut repeaters, &mut routing_table, &mut rank, &mut timer, &mut i2c);
#[allow(unused_mut)]
for mut rep in repeaters.iter_mut() {
rep.service(&routing_table, rank, &mut timer);
}
hardware_tick(&mut hardware_tick_ts, &mut timer);
if drtiosat_tsc_loaded() {
info!("TSC loaded from uplink");
for rep in repeaters.iter() {
if let Err(e) = rep.sync_tsc(&mut timer) {
error!("failed to sync TSC ({:?})", e);
}
}
if let Err(e) = drtioaux::send(0, &drtioaux::Packet::TSCAck) {
error!("aux packet error: {:?}", e);
}
}
}
drtiosat_reset_phy(true);
drtiosat_reset(true);
drtiosat_tsc_loaded();
info!("uplink is down, switching to local oscillator clock");
#[cfg(has_siphaser)]
si5324::siphaser::select_recovered_clock(&mut i2c, false, &mut timer).expect("failed to switch clocks");
}
}
extern "C" {
static mut __stack1_start: u32;
}
interrupt_handler!(IRQ, irq, __irq_stack0_start, __irq_stack1_start, {
if MPIDR.read().cpu_id() == 1{
let mpcore = mpcore::RegisterBlock::mpcore();
let mut gic = gic::InterruptController::gic(mpcore);
let id = gic.get_interrupt_id();
if id.0 == 0 {
gic.end_interrupt(id);
asm::exit_irq();
SP.write(&mut __stack1_start as *mut _ as u32);
asm::enable_irq();
CORE1_RESTART.store(false, Ordering::Relaxed);
notify_spin_lock();
main_core1();
}
stdio::drop_uart();
}
loop {}
});
static mut PANICKED: [bool; 2] = [false; 2];
static CORE1_RESTART: AtomicBool = AtomicBool::new(false);
pub fn restart_core1() {
let mut interrupt_controller = gic::InterruptController::gic(mpcore::RegisterBlock::mpcore());
CORE1_RESTART.store(true, Ordering::Relaxed);
interrupt_controller.send_sgi(gic::InterruptId(0), gic::CPUCore::Core1.into());
while CORE1_RESTART.load(Ordering::Relaxed) {
spin_lock_yield();
}
}
#[no_mangle]
pub fn main_core1() {
let mut interrupt_controller = gic::InterruptController::gic(mpcore::RegisterBlock::mpcore());
interrupt_controller.enable_interrupts();
loop {}
}
#[no_mangle]
pub extern fn exception(_vect: u32, _regs: *const u32, pc: u32, ea: u32) {
fn hexdump(addr: u32) {
let addr = (addr - addr % 4) as *const u32;
let mut ptr = addr;
println!("@ {:08p}", ptr);
for _ in 0..4 {
print!("+{:04x}: ", ptr as usize - addr as usize);
print!("{:08x} ", unsafe { *ptr }); ptr = ptr.wrapping_offset(1);
print!("{:08x} ", unsafe { *ptr }); ptr = ptr.wrapping_offset(1);
print!("{:08x} ", unsafe { *ptr }); ptr = ptr.wrapping_offset(1);
print!("{:08x}\n", unsafe { *ptr }); ptr = ptr.wrapping_offset(1);
}
}
hexdump(pc);
hexdump(ea);
panic!("exception at PC 0x{:x}, EA 0x{:x}", pc, ea)
}
#[no_mangle] // https://github.com/rust-lang/rust/issues/{38281,51647}
#[panic_handler]
pub fn panic_fmt(info: &core::panic::PanicInfo) -> ! {
let id = MPIDR.read().cpu_id() as usize;
print!("Core {} ", id);
unsafe {
if PANICKED[id] {
println!("nested panic!");
loop {}
}
PANICKED[id] = true;
}
print!("panic at ");
if let Some(location) = info.location() {
print!("{}:{}:{}", location.file(), location.line(), location.column());
} else {
print!("unknown location");
}
if let Some(message) = info.message() {
println!(": {}", message);
} else {
println!("");
}
loop {}
}
// linker symbols
extern "C" {
static __text_start: u32;
static __text_end: u32;
static __exidx_start: u32;
static __exidx_end: u32;
}
#[no_mangle]
extern fn dl_unwind_find_exidx(_pc: *const u32, len_ptr: *mut u32) -> *const u32 {
let length;
let start: *const u32;
unsafe {
length = (&__exidx_end as *const u32).offset_from(&__exidx_start) as u32;
start = &__exidx_start;
*len_ptr = length;
}
start
}

290
src/satman/src/repeater.rs Normal file
View File

@ -0,0 +1,290 @@
use libboard_artiq::{drtioaux, drtio_routing};
use libboard_zynq::timer::GlobalTimer;
#[cfg(has_drtio_routing)]
use libboard_artiq::{pl::csr};
#[cfg(has_drtio_routing)]
use libboard_zynq::time::Milliseconds;
#[cfg(has_drtio_routing)]
use embedded_hal::prelude::_embedded_hal_blocking_delay_DelayUs;
#[cfg(has_drtio_routing)]
fn rep_link_rx_up(repno: u8) -> bool {
let repno = repno as usize;
unsafe {
(csr::DRTIOREP[repno].rx_up_read)() == 1
}
}
#[cfg(has_drtio_routing)]
#[derive(Clone, Copy, PartialEq)]
enum RepeaterState {
Down,
SendPing { ping_count: u16 },
WaitPingReply { ping_count: u16, timeout: Milliseconds },
Up,
Failed
}
#[cfg(has_drtio_routing)]
impl Default for RepeaterState {
fn default() -> RepeaterState { RepeaterState::Down }
}
#[cfg(has_drtio_routing)]
#[derive(Clone, Copy, Default)]
pub struct Repeater {
repno: u8,
auxno: u8,
state: RepeaterState
}
#[cfg(has_drtio_routing)]
impl Repeater {
pub fn new(repno: u8) -> Repeater {
Repeater {
repno: repno,
auxno: repno + 1,
state: RepeaterState::Down
}
}
#[allow(dead_code)]
pub fn is_up(&self) -> bool {
self.state == RepeaterState::Up
}
pub fn service(&mut self, routing_table: &drtio_routing::RoutingTable, rank: u8,
timer: &mut GlobalTimer) {
self.process_local_errors();
match self.state {
RepeaterState::Down => {
if rep_link_rx_up(self.repno) {
info!("[REP#{}] link RX became up, pinging", self.repno);
self.state = RepeaterState::SendPing { ping_count: 0 };
}
}
RepeaterState::SendPing { ping_count } => {
if rep_link_rx_up(self.repno) {
drtioaux::send(self.auxno, &drtioaux::Packet::EchoRequest).unwrap();
self.state = RepeaterState::WaitPingReply {
ping_count: ping_count + 1,
timeout: timer.get_time() + Milliseconds(100)
}
} else {
error!("[REP#{}] link RX went down during ping", self.repno);
self.state = RepeaterState::Down;
}
}
RepeaterState::WaitPingReply { ping_count, timeout } => {
if rep_link_rx_up(self.repno) {
if let Ok(Some(drtioaux::Packet::EchoReply)) = drtioaux::recv(self.auxno) {
info!("[REP#{}] remote replied after {} packets", self.repno, ping_count);
self.state = RepeaterState::Up;
if let Err(e) = self.sync_tsc(timer) {
error!("[REP#{}] failed to sync TSC ({:?})", self.repno, e);
self.state = RepeaterState::Failed;
return;
}
if let Err(e) = self.load_routing_table(routing_table, timer) {
error!("[REP#{}] failed to load routing table ({:?})", self.repno, e);
self.state = RepeaterState::Failed;
return;
}
if let Err(e) = self.set_rank(rank + 1, timer) {
error!("[REP#{}] failed to set rank ({:?})", self.repno, e);
self.state = RepeaterState::Failed;
return;
}
} else {
if timer.get_time() > timeout {
if ping_count > 200 {
error!("[REP#{}] ping failed", self.repno);
self.state = RepeaterState::Failed;
} else {
self.state = RepeaterState::SendPing { ping_count: ping_count };
}
}
}
} else {
error!("[REP#{}] link RX went down during ping", self.repno);
self.state = RepeaterState::Down;
}
}
RepeaterState::Up => {
self.process_unsolicited_aux();
if !rep_link_rx_up(self.repno) {
info!("[REP#{}] link is down", self.repno);
self.state = RepeaterState::Down;
}
}
RepeaterState::Failed => {
if !rep_link_rx_up(self.repno) {
info!("[REP#{}] link is down", self.repno);
self.state = RepeaterState::Down;
}
}
}
}
fn process_unsolicited_aux(&self) {
match drtioaux::recv(self.auxno) {
Ok(Some(packet)) => warn!("[REP#{}] unsolicited aux packet: {:?}", self.repno, packet),
Ok(None) => (),
Err(_) => warn!("[REP#{}] aux packet error", self.repno)
}
}
fn process_local_errors(&self) {
let repno = self.repno as usize;
let errors;
unsafe {
errors = (csr::DRTIOREP[repno].protocol_error_read)();
}
if errors & 1 != 0 {
error!("[REP#{}] received packet of an unknown type", repno);
}
if errors & 2 != 0 {
error!("[REP#{}] received truncated packet", repno);
}
if errors & 4 != 0 {
let cmd;
let chan_sel;
unsafe {
cmd = (csr::DRTIOREP[repno].command_missed_cmd_read)();
chan_sel = (csr::DRTIOREP[repno].command_missed_chan_sel_read)();
}
error!("[REP#{}] CRI command missed, cmd={}, chan_sel=0x{:06x}", repno, cmd, chan_sel)
}
if errors & 8 != 0 {
let destination;
unsafe {
destination = (csr::DRTIOREP[repno].buffer_space_timeout_dest_read)();
}
error!("[REP#{}] timeout attempting to get remote buffer space, destination=0x{:02x}", repno, destination);
}
unsafe {
(csr::DRTIOREP[repno].protocol_error_write)(errors);
}
}
fn recv_aux_timeout(&self, timeout: u32, timer: &mut GlobalTimer) -> Result<drtioaux::Packet, drtioaux::Error> {
let max_time = timer.get_time() + Milliseconds(timeout.into());
loop {
if !rep_link_rx_up(self.repno) {
return Err(drtioaux::Error::LinkDown);
}
if timer.get_time() > max_time {
return Err(drtioaux::Error::TimedOut);
}
match drtioaux::recv(self.auxno) {
Ok(Some(packet)) => return Ok(packet),
Ok(None) => (),
Err(e) => return Err(e)
}
}
}
pub fn aux_forward(&self, request: &drtioaux::Packet, timer: &mut GlobalTimer) -> Result<(), drtioaux::Error> {
if self.state != RepeaterState::Up {
return Err(drtioaux::Error::LinkDown);
}
drtioaux::send(self.auxno, request).unwrap();
let reply = self.recv_aux_timeout(200, timer)?;
drtioaux::send(0, &reply).unwrap();
Ok(())
}
pub fn sync_tsc(&self, timer: &mut GlobalTimer) -> Result<(), drtioaux::Error> {
if self.state != RepeaterState::Up {
return Ok(());
}
let repno = self.repno as usize;
unsafe {
(csr::DRTIOREP[repno].set_time_write)(1);
while (csr::DRTIOREP[repno].set_time_read)() == 1 {}
}
// TSCAck is the only aux packet that is sent spontaneously
// by the satellite, in response to a TSC set on the RT link.
let reply = self.recv_aux_timeout(10000, timer)?;
if reply == drtioaux::Packet::TSCAck {
return Ok(());
} else {
return Err(drtioaux::Error::UnexpectedReply);
}
}
pub fn set_path(&self, destination: u8, hops: &[u8; drtio_routing::MAX_HOPS], timer: &mut GlobalTimer) -> Result<(), drtioaux::Error> {
if self.state != RepeaterState::Up {
return Ok(());
}
drtioaux::send(self.auxno, &drtioaux::Packet::RoutingSetPath {
destination: destination,
hops: *hops
}).unwrap();
let reply = self.recv_aux_timeout(200, timer)?;
if reply != drtioaux::Packet::RoutingAck {
return Err(drtioaux::Error::UnexpectedReply);
}
Ok(())
}
pub fn load_routing_table(&self, routing_table: &drtio_routing::RoutingTable, timer: &mut GlobalTimer) -> Result<(), drtioaux::Error> {
for i in 0..drtio_routing::DEST_COUNT {
self.set_path(i as u8, &routing_table.0[i], timer)?;
}
Ok(())
}
pub fn set_rank(&self, rank: u8, timer: &mut GlobalTimer) -> Result<(), drtioaux::Error> {
if self.state != RepeaterState::Up {
return Ok(());
}
drtioaux::send(self.auxno, &drtioaux::Packet::RoutingSetRank {
rank: rank
}).unwrap();
let reply = self.recv_aux_timeout(200, timer)?;
if reply != drtioaux::Packet::RoutingAck {
return Err(drtioaux::Error::UnexpectedReply);
}
Ok(())
}
pub fn rtio_reset(&self, timer: &mut GlobalTimer) -> Result<(), drtioaux::Error> {
let repno = self.repno as usize;
unsafe { (csr::DRTIOREP[repno].reset_write)(1); }
timer.delay_us(100);
unsafe { (csr::DRTIOREP[repno].reset_write)(0); }
if self.state != RepeaterState::Up {
return Ok(());
}
drtioaux::send(self.auxno, &drtioaux::Packet::ResetRequest).unwrap();
let reply = self.recv_aux_timeout(200, timer)?;
if reply != drtioaux::Packet::ResetAck {
return Err(drtioaux::Error::UnexpectedReply);
}
Ok(())
}
}
#[cfg(not(has_drtio_routing))]
#[derive(Clone, Copy, Default)]
pub struct Repeater {
}
#[cfg(not(has_drtio_routing))]
impl Repeater {
pub fn new(_repno: u8) -> Repeater { Repeater::default() }
pub fn service(&self, _routing_table: &drtio_routing::RoutingTable, _rank: u8, _timer: &mut GlobalTimer) { }
pub fn sync_tsc(&self, _timer: &mut GlobalTimer) -> Result<(), drtioaux::Error> { Ok(()) }
pub fn rtio_reset(&self, _timer: &mut GlobalTimer) -> Result<(), drtioaux::Error> { Ok(()) }
}

View File

@ -3,6 +3,6 @@ let
in in
pkgs.fetchgit { pkgs.fetchgit {
url = "https://git.m-labs.hk/M-Labs/zynq-rs.git"; url = "https://git.m-labs.hk/M-Labs/zynq-rs.git";
rev = "2c161720fa12f8b7abecaf60f77b062b08ac9bc1"; rev = "57d8d8fbc7087863305721bcb8fdbdd13d65bd65";
sha256 = "0zpazkicqzps86r7lgqf09y9ary94mjvxw6gc41z9kjjyxar5fhr"; sha256 = "0gnbaxgingrxrxi2sjd592r1630ld4ckrz4r8ajx8zp7q3bb43jj";
} }