i2c: fix comments

i2c: fix SCL/SDA race conditions & handle slave holding SCL after ack
update cargosha256
2021-07-13 15:41:55 +08:00 · 2021-06-23 17:09:07 +08:00 · 2021-06-19 22:47:21 +08:00 · 2021-06-19 22:40:09 +08:00 · 2021-06-19 22:25:07 +08:00 · 2021-06-19 22:04:14 +08:00
97 changed files with 13245 additions and 4616 deletions
--- a/.cargo/config
+++ b/.cargo/config
@ -1,5 +1,4 @@
 [target.armv7-none-eabihf]
-runner = "./runner.sh"
 rustflags = [
  "-C", "link-arg=-Tlink.x",
  "-C", "target-feature=a9,armv7-a,neon",
--- a/Cargo.lock
+++ b/Cargo.lock
@ -2,181 +2,257 @@
 # It is not intended for manual editing.
 [[package]]
 name = "bit_field"
-version = "0.10.0"
+version = "0.10.1"
 source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "dcb6dd1c2376d2e096796e234a70e17e94cc2d5d54ff8ce42b28cef1d0d359a4"

 [[package]]
 name = "bitflags"
 version = "1.2.1"
 source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "cf1de2fe8c75bc145a2f577add951f8134889b4795d47466a54a5c846d691693"

 [[package]]
 name = "byteorder"
-version = "1.3.4"
+version = "1.4.3"
 source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "14c189c53d098945499cdfa7ecc63567cf3886b3332b312a5b4585d8d3a6a610"
+
+[[package]]
+name = "cc"
+version = "1.0.68"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "4a72c244c1ff497a746a7e1fb3d14bd08420ecda70c8f25c7112f2781652d787"

 [[package]]
 name = "cfg-if"
-version = "0.1.10"
+version = "1.0.0"
 source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "baf1de4339761588bc0619e3cbc0120ee582ebb74b53b4efbf79117bd2da40fd"

 [[package]]
 name = "compiler_builtins"
-version = "0.1.27"
+version = "0.1.39"
 source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "3748f82c7d366a0b4950257d19db685d4958d2fa27c6d164a3f069fec42b748b"
+
+[[package]]
+name = "core_io"
+version = "0.1.20210325"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "97f8932064288cc79feb4d343a399d353a6f6f001e586ece47fe518a9e8507df"
+dependencies = [
+ "rustc_version",
+]

 [[package]]
 name = "embedded-hal"
-version = "0.2.3"
+version = "0.2.5"
 source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "db184d3fa27bc7a2344250394c0264144dfe0bc81a4401801dcb964b8dd172ad"
 dependencies = [
- "nb 0.1.2 (registry+https://github.com/rust-lang/crates.io-index)",
- "void 1.0.2 (registry+https://github.com/rust-lang/crates.io-index)",
+ "nb 0.1.3",
+ "void",
 ]

 [[package]]
 name = "experiments"
 version = "0.0.0"
 dependencies = [
- "embedded-hal 0.2.3 (registry+https://github.com/rust-lang/crates.io-index)",
- "libasync 0.0.0",
- "libboard_zynq 0.0.0",
- "libcortex_a9 0.0.0",
- "libregister 0.0.0",
- "libsupport_zynq 0.0.0",
- "log 0.4.8 (registry+https://github.com/rust-lang/crates.io-index)",
+ "embedded-hal",
+ "libasync",
+ "libboard_zynq",
+ "libcortex_a9",
+ "libregister",
+ "libsupport_zynq",
+ "log",
+]
+
+[[package]]
+name = "fatfs"
+version = "0.3.5"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "e18f80a87439240dac45d927fd8f8081b6f1e34c03e97271189fa8a8c2e96c8f"
+dependencies = [
+ "bitflags",
+ "byteorder",
+ "core_io",
+ "log",
 ]

 [[package]]
 name = "libasync"
 version = "0.0.0"
 dependencies = [
- "embedded-hal 0.2.3 (registry+https://github.com/rust-lang/crates.io-index)",
- "libcortex_a9 0.0.0",
- "nb 0.1.2 (registry+https://github.com/rust-lang/crates.io-index)",
- "pin-utils 0.1.0 (registry+https://github.com/rust-lang/crates.io-index)",
- "smoltcp 0.6.0 (registry+https://github.com/rust-lang/crates.io-index)",
+ "embedded-hal",
+ "libcortex_a9",
+ "nb 1.0.0",
+ "pin-utils",
+ "smoltcp",
 ]

 [[package]]
 name = "libboard_zynq"
 version = "0.0.0"
 dependencies = [
- "bit_field 0.10.0 (registry+https://github.com/rust-lang/crates.io-index)",
- "embedded-hal 0.2.3 (registry+https://github.com/rust-lang/crates.io-index)",
- "libcortex_a9 0.0.0",
- "libregister 0.0.0",
- "log 0.4.8 (registry+https://github.com/rust-lang/crates.io-index)",
- "nb 0.1.2 (registry+https://github.com/rust-lang/crates.io-index)",
- "smoltcp 0.6.0 (registry+https://github.com/rust-lang/crates.io-index)",
- "void 1.0.2 (registry+https://github.com/rust-lang/crates.io-index)",
- "volatile-register 0.2.0 (registry+https://github.com/rust-lang/crates.io-index)",
+ "bit_field",
+ "embedded-hal",
+ "libasync",
+ "libcortex_a9",
+ "libregister",
+ "log",
+ "nb 0.1.3",
+ "smoltcp",
+ "void",
+ "volatile-register",
+]
+
+[[package]]
+name = "libconfig"
+version = "0.1.0"
+dependencies = [
+ "core_io",
+ "fatfs",
+ "libboard_zynq",
+ "log",
 ]

 [[package]]
 name = "libcortex_a9"
 version = "0.0.0"
 dependencies = [
- "bit_field 0.10.0 (registry+https://github.com/rust-lang/crates.io-index)",
- "libregister 0.0.0",
+ "bit_field",
+ "libregister",
+ "volatile-register",
 ]

 [[package]]
 name = "libregister"
 version = "0.0.0"
 dependencies = [
- "bit_field 0.10.0 (registry+https://github.com/rust-lang/crates.io-index)",
- "vcell 0.1.2 (registry+https://github.com/rust-lang/crates.io-index)",
- "volatile-register 0.2.0 (registry+https://github.com/rust-lang/crates.io-index)",
+ "bit_field",
+ "vcell",
+ "volatile-register",
 ]

 [[package]]
 name = "libsupport_zynq"
 version = "0.0.0"
 dependencies = [
- "compiler_builtins 0.1.27 (registry+https://github.com/rust-lang/crates.io-index)",
- "libboard_zynq 0.0.0",
- "libcortex_a9 0.0.0",
- "libregister 0.0.0",
- "linked_list_allocator 0.8.4 (registry+https://github.com/rust-lang/crates.io-index)",
- "r0 1.0.0 (registry+https://github.com/rust-lang/crates.io-index)",
+ "cc",
+ "compiler_builtins",
+ "libboard_zynq",
+ "libcortex_a9",
+ "libregister",
+ "linked_list_allocator",
+ "r0",
 ]

 [[package]]
 name = "linked_list_allocator"
-version = "0.8.4"
+version = "0.8.11"
 source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "822add9edb1860698b79522510da17bef885171f75aa395cff099d770c609c24"

 [[package]]
 name = "log"
-version = "0.4.8"
+version = "0.4.14"
 source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "51b9bbe6c47d51fc3e1a9b945965946b4c44142ab8792c50835a980d362c2710"
 dependencies = [
- "cfg-if 0.1.10 (registry+https://github.com/rust-lang/crates.io-index)",
+ "cfg-if",
 ]

 [[package]]
 name = "managed"
-version = "0.7.1"
+version = "0.7.2"
 source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "c75de51135344a4f8ed3cfe2720dc27736f7711989703a0b43aadf3753c55577"

 [[package]]
 name = "nb"
-version = "0.1.2"
+version = "0.1.3"
 source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "801d31da0513b6ec5214e9bf433a77966320625a37860f910be265be6e18d06f"
+dependencies = [
+ "nb 1.0.0",
+]
+
+[[package]]
+name = "nb"
+version = "1.0.0"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "546c37ac5d9e56f55e73b677106873d9d9f5190605e41a856503623648488cae"

 [[package]]
 name = "pin-utils"
 version = "0.1.0"
 source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "8b870d8c151b6f2fb93e84a13146138f05d02ed11c7e7c54f8826aaaf7c9f184"

 [[package]]
 name = "r0"
 version = "1.0.0"
 source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "bd7a31eed1591dcbc95d92ad7161908e72f4677f8fabf2a32ca49b4237cbf211"
+
+[[package]]
+name = "rustc_version"
+version = "0.1.7"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "c5f5376ea5e30ce23c03eb77cbe4962b988deead10910c372b226388b594c084"
+dependencies = [
+ "semver",
+]
+
+[[package]]
+name = "semver"
+version = "0.1.20"
+source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "d4f410fedcf71af0345d7607d246e7ad15faaadd49d240ee3b24e5dc21a820ac"

 [[package]]
 name = "smoltcp"
-version = "0.6.0"
+version = "0.7.4"
 source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "a4ec49aa038736b0bc852ccd9a0eadc8f7832fe8f9c8eec4e8a740b36d665614"
 dependencies = [
- "bitflags 1.2.1 (registry+https://github.com/rust-lang/crates.io-index)",
- "byteorder 1.3.4 (registry+https://github.com/rust-lang/crates.io-index)",
- "managed 0.7.1 (registry+https://github.com/rust-lang/crates.io-index)",
+ "bitflags",
+ "byteorder",
+ "managed",
+]
+
+[[package]]
+name = "szl"
+version = "0.1.0"
+dependencies = [
+ "byteorder",
+ "core_io",
+ "libboard_zynq",
+ "libconfig",
+ "libcortex_a9",
+ "libregister",
+ "libsupport_zynq",
+ "log",
 ]

 [[package]]
 name = "vcell"
-version = "0.1.2"
+version = "0.1.3"
 source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "77439c1b53d2303b20d9459b1ade71a83c716e3f9c34f3228c00e6f185d6c002"

 [[package]]
 name = "void"
 version = "1.0.2"
 source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "6a02e4885ed3bc0f2de90ea6dd45ebcbb66dacffe03547fadbb0eeae2770887d"

 [[package]]
 name = "volatile-register"
 version = "0.2.0"
 source = "registry+https://github.com/rust-lang/crates.io-index"
+checksum = "0d67cb4616d99b940db1d6bd28844ff97108b498a6ca850e5b6191a532063286"
 dependencies = [
- "vcell 0.1.2 (registry+https://github.com/rust-lang/crates.io-index)",
+ "vcell",
 ]
-
-[metadata]
-"checksum bit_field 0.10.0 (registry+https://github.com/rust-lang/crates.io-index)" = "a165d606cf084741d4ac3a28fb6e9b1eb0bd31f6cd999098cfddb0b2ab381dc0"
-"checksum bitflags 1.2.1 (registry+https://github.com/rust-lang/crates.io-index)" = "cf1de2fe8c75bc145a2f577add951f8134889b4795d47466a54a5c846d691693"
-"checksum byteorder 1.3.4 (registry+https://github.com/rust-lang/crates.io-index)" = "08c48aae112d48ed9f069b33538ea9e3e90aa263cfa3d1c24309612b1f7472de"
-"checksum cfg-if 0.1.10 (registry+https://github.com/rust-lang/crates.io-index)" = "4785bdd1c96b2a846b2bd7cc02e86b6b3dbf14e7e53446c4f54c92a361040822"
-"checksum compiler_builtins 0.1.27 (registry+https://github.com/rust-lang/crates.io-index)" = "38f18416546abfbf8d801c555a0e99524453e7214f9cc9107ad49de3d5948ccc"
-"checksum embedded-hal 0.2.3 (registry+https://github.com/rust-lang/crates.io-index)" = "ee4908a155094da7723c2d60d617b820061e3b4efcc3d9e293d206a5a76c170b"
-"checksum linked_list_allocator 0.8.4 (registry+https://github.com/rust-lang/crates.io-index)" = "e70e46c13c0e8374c26cec5752e3347ca1087d9711de8f45aa513a7700efd73d"
-"checksum log 0.4.8 (registry+https://github.com/rust-lang/crates.io-index)" = "14b6052be84e6b71ab17edffc2eeabf5c2c3ae1fdb464aae35ac50c67a44e1f7"
-"checksum managed 0.7.1 (registry+https://github.com/rust-lang/crates.io-index)" = "fdcec5e97041c7f0f1c5b7d93f12e57293c831c646f4cc7a5db59460c7ea8de6"
-"checksum nb 0.1.2 (registry+https://github.com/rust-lang/crates.io-index)" = "b1411551beb3c11dedfb0a90a0fa256b47d28b9ec2cdff34c25a2fa59e45dbdc"
-"checksum pin-utils 0.1.0 (registry+https://github.com/rust-lang/crates.io-index)" = "8b870d8c151b6f2fb93e84a13146138f05d02ed11c7e7c54f8826aaaf7c9f184"
-"checksum r0 1.0.0 (registry+https://github.com/rust-lang/crates.io-index)" = "bd7a31eed1591dcbc95d92ad7161908e72f4677f8fabf2a32ca49b4237cbf211"
-"checksum smoltcp 0.6.0 (registry+https://github.com/rust-lang/crates.io-index)" = "0fe46639fd2ec79eadf8fe719f237a7a0bd4dac5d957f1ca5bbdbc1c3c39e53a"
-"checksum vcell 0.1.2 (registry+https://github.com/rust-lang/crates.io-index)" = "876e32dcadfe563a4289e994f7cb391197f362b6315dc45e8ba4aa6f564a4b3c"
-"checksum void 1.0.2 (registry+https://github.com/rust-lang/crates.io-index)" = "6a02e4885ed3bc0f2de90ea6dd45ebcbb66dacffe03547fadbb0eeae2770887d"
-"checksum volatile-register 0.2.0 (registry+https://github.com/rust-lang/crates.io-index)" = "0d67cb4616d99b940db1d6bd28844ff97108b498a6ca850e5b6191a532063286"
--- a/Cargo.toml
+++ b/Cargo.toml
@ -1,19 +1,20 @@
 [workspace]
 members = [
-  "libregister", "libcortex_a9",
-  "libboard_zynq", "libsupport_zynq",
+  "libregister",
+  "libcortex_a9",
+  "libboard_zynq",
+  "libsupport_zynq",
  "libasync",
+  "libconfig",
  "experiments",
+  "szl",
 ]

-[profile.dev]
-panic = "abort"
-lto = false
-
 [profile.release]
 panic = "abort"
 debug = true
-# Link-Time Optimization:
-# turn off if you get unusable debug symbols.
+codegen-units = 1
+opt-level = 'z'
 lto = true
-opt-level = 'z'  # Optimize for size.
+debug-assertions = false
+overflow-checks = false
--- a/165
+++ b/165
@ -0,0 +1,165 @@
+                   GNU LESSER GENERAL PUBLIC LICENSE
+                       Version 3, 29 June 2007
+
+ Copyright (C) 2007 Free Software Foundation, Inc. <http://fsf.org/>
+ Everyone is permitted to copy and distribute verbatim copies
+ of this license document, but changing it is not allowed.
+
+
+  This version of the GNU Lesser General Public License incorporates
+the terms and conditions of version 3 of the GNU General Public
+License, supplemented by the additional permissions listed below.
+
+  0. Additional Definitions.
+
+  As used herein, "this License" refers to version 3 of the GNU Lesser
+General Public License, and the "GNU GPL" refers to version 3 of the GNU
+General Public License.
+
+  "The Library" refers to a covered work governed by this License,
+other than an Application or a Combined Work as defined below.
+
+  An "Application" is any work that makes use of an interface provided
+by the Library, but which is not otherwise based on the Library.
+Defining a subclass of a class defined by the Library is deemed a mode
+of using an interface provided by the Library.
+
+  A "Combined Work" is a work produced by combining or linking an
+Application with the Library.  The particular version of the Library
+with which the Combined Work was made is also called the "Linked
+Version".
+
+  The "Minimal Corresponding Source" for a Combined Work means the
+Corresponding Source for the Combined Work, excluding any source code
+for portions of the Combined Work that, considered in isolation, are
+based on the Application, and not on the Linked Version.
+
+  The "Corresponding Application Code" for a Combined Work means the
+object code and/or source code for the Application, including any data
+and utility programs needed for reproducing the Combined Work from the
+Application, but excluding the System Libraries of the Combined Work.
+
+  1. Exception to Section 3 of the GNU GPL.
+
+  You may convey a covered work under sections 3 and 4 of this License
+without being bound by section 3 of the GNU GPL.
+
+  2. Conveying Modified Versions.
+
+  If you modify a copy of the Library, and, in your modifications, a
+facility refers to a function or data to be supplied by an Application
+that uses the facility (other than as an argument passed when the
+facility is invoked), then you may convey a copy of the modified
+version:
+
+   a) under this License, provided that you make a good faith effort to
+   ensure that, in the event an Application does not supply the
+   function or data, the facility still operates, and performs
+   whatever part of its purpose remains meaningful, or
+
+   b) under the GNU GPL, with none of the additional permissions of
+   this License applicable to that copy.
+
+  3. Object Code Incorporating Material from Library Header Files.
+
+  The object code form of an Application may incorporate material from
+a header file that is part of the Library.  You may convey such object
+code under terms of your choice, provided that, if the incorporated
+material is not limited to numerical parameters, data structure
+layouts and accessors, or small macros, inline functions and templates
+(ten or fewer lines in length), you do both of the following:
+
+   a) Give prominent notice with each copy of the object code that the
+   Library is used in it and that the Library and its use are
+   covered by this License.
+
+   b) Accompany the object code with a copy of the GNU GPL and this license
+   document.
+
+  4. Combined Works.
+
+  You may convey a Combined Work under terms of your choice that,
+taken together, effectively do not restrict modification of the
+portions of the Library contained in the Combined Work and reverse
+engineering for debugging such modifications, if you also do each of
+the following:
+
+   a) Give prominent notice with each copy of the Combined Work that
+   the Library is used in it and that the Library and its use are
+   covered by this License.
+
+   b) Accompany the Combined Work with a copy of the GNU GPL and this license
+   document.
+
+   c) For a Combined Work that displays copyright notices during
+   execution, include the copyright notice for the Library among
+   these notices, as well as a reference directing the user to the
+   copies of the GNU GPL and this license document.
+
+   d) Do one of the following:
+
+       0) Convey the Minimal Corresponding Source under the terms of this
+       License, and the Corresponding Application Code in a form
+       suitable for, and under terms that permit, the user to
+       recombine or relink the Application with a modified version of
+       the Linked Version to produce a modified Combined Work, in the
+       manner specified by section 6 of the GNU GPL for conveying
+       Corresponding Source.
+
+       1) Use a suitable shared library mechanism for linking with the
+       Library.  A suitable mechanism is one that (a) uses at run time
+       a copy of the Library already present on the user's computer
+       system, and (b) will operate properly with a modified version
+       of the Library that is interface-compatible with the Linked
+       Version.
+
+   e) Provide Installation Information, but only if you would otherwise
+   be required to provide such information under section 6 of the
+   GNU GPL, and only to the extent that such information is
+   necessary to install and execute a modified version of the
+   Combined Work produced by recombining or relinking the
+   Application with a modified version of the Linked Version. (If
+   you use option 4d0, the Installation Information must accompany
+   the Minimal Corresponding Source and Corresponding Application
+   Code. If you use option 4d1, you must provide the Installation
+   Information in the manner specified by section 6 of the GNU GPL
+   for conveying Corresponding Source.)
+
+  5. Combined Libraries.
+
+  You may place library facilities that are a work based on the
+Library side by side in a single library together with other library
+facilities that are not Applications and are not covered by this
+License, and convey such a combined library under terms of your
+choice, if you do both of the following:
+
+   a) Accompany the combined library with a copy of the same work based
+   on the Library, uncombined with any other library facilities,
+   conveyed under the terms of this License.
+
+   b) Give prominent notice with the combined library that part of it
+   is a work based on the Library, and explaining where to find the
+   accompanying uncombined form of the same work.
+
+  6. Revised Versions of the GNU Lesser General Public License.
+
+  The Free Software Foundation may publish revised and/or new versions
+of the GNU Lesser General Public License from time to time. Such new
+versions will be similar in spirit to the present version, but may
+differ in detail to address new problems or concerns.
+
+  Each version is given a distinguishing version number. If the
+Library as you received it specifies that a certain numbered version
+of the GNU Lesser General Public License "or any later version"
+applies to it, you have the option of following the terms and
+conditions either of that published version or of any later version
+published by the Free Software Foundation. If the Library as you
+received it does not specify a version number of the GNU Lesser
+General Public License, you may choose any version of the GNU Lesser
+General Public License ever published by the Free Software Foundation.
+
+  If the Library as you received it specifies that a proxy can decide
+whether future versions of the GNU Lesser General Public License shall
+apply, that proxy's public statement of acceptance of any version is
+permanent authorization for you to choose that version for the
+Library.
--- a/README.md
+++ b/README.md
@ -1,4 +1,24 @@
-# Build
+# Bare-metal Rust on Zynq-7000
+
+Supported features:
+
+* Clocking setup
+* UART
+* SDRAM setup
+* Ethernet with smoltcp and async-await on TCP sockets
+* SD card
+* PL programming and startup
+* Pure Rust SZL first-stage bootloader, with SD boot and netboot
+* Control of second CPU core and message passing, with async-await support
+
+
+Supported boards:
+ * Kasli-SoC
+ * ZC706
+ * Red Pitaya
+ * Cora Z7-10 (seems to also run on Cora Z7-07S, including dual-core support)
+
+## Build

 ```shell
 nix-shell --command "cargo xbuild --release -p experiments"
@ -6,37 +26,7 @@ nix-shell --command "cargo xbuild --release -p experiments"

 Currently the ELF output is placed at `target/armv7-none-eabihf/release/experiments`

-# Debug
-
-## Using the Xilinx toolchain
-
-Tested with the ZC706 board.
-
-Run the Xilinx Microprocessor Debugger:
-```shell
-/opt/Xilinx/14.7/ISE_DS/EDK/bin/lin64/xmd
-```
-
-Connect to target (given it is connected and you have permissions):
-```tcl
-connect arm hw
-```
-
-Leave xmd running.
-
-Start the Xilinx version of the GNU debugger with your latest build:
-```shell
-/opt/Xilinx/14.7/ISE_DS/EDK/gnu/arm/lin/bin/arm-xilinx-linux-gnueabi-gdb zc706
-```
-
-Connect the debugger to xmd over TCP on localhost:
-```gdb
-target remote :1234
-```
-
-Proceed using gdb with `load`, `c`
-
-## Using OpenOCD
+## Debug

 ### Running on the ZC706

@ -49,7 +39,7 @@ openocd -f zc706.cfg
 ### Running on the Cora Z7-10

 ```shell
-nix-shell --command "cd experiments && cargo xbuild --release --no-default-features --features=target_cora_z7_10"
+nix-shell --command "cd experiments && cargo xbuild --release --no-default-features --features=target_coraz7"
 cd openocd
 openocd -f cora-z7-10.cfg
 ```
@ -60,43 +50,7 @@ openocd -f cora-z7-10.cfg
 openocd -f zc706.cfg -c "pld load 0 blinker_migen.bit; exit"
 ```

-### Development Process
-
-Clone this repo onto your development/build machine and the raspberry pi that controls the Xilinx 7000 board
-
-On the dev machine, the below script builds zc706 and secure copies it to the target pi (in your pi $HOME directory):
-```shell
-cd ~/zynq-rs
-./build.sh $your_user_or_ssh_id
-```
-
-On the pi, we need an information rich environment that includes a relatively reliable `gdb` experience (that includes `ctrl-p` and `ctrl-n` command history that persists across `cgdb` executions), run:
-```shell
-ssh pi4
-cd zynq-rs
-# For ZC706, run:
-./tmux.sh 0
-# For Cora Z7, run:
-./tmux.sh
-```
-
-Time to run your code with:
-```shell
-zynq-connect
-zynq-restart
-c
-```
-or, for a more succinct experience, (identical to above)
-```shell
-dc
-dr
-c
-```
-
-After every build on your dev machine, simply run:
-```shell
-dr
-c
-```
-Sometimes you might need to type `load` after `dr`.
+## License

+Copyright (C) 2019-2021 M-Labs Limited.
+Released under the GNU LGPL v3. See the LICENSE file for details.
--- a/build.sh
+++ b/build.sh
@ -1 +0,0 @@
-nix-shell --command "cargo xbuild --release -p experiments" && scp -C target/armv7-none-eabihf/release/experiments $1@rpi-4.m-labs.hk:/home/$1/zc706/zc706.elf
--- a/default.nix
+++ b/default.nix
@ -1,63 +1,48 @@
-{ # Use master branch of the overlay by default
-  mozillaOverlay ? import (builtins.fetchTarball https://github.com/mozilla/nixpkgs-mozilla/archive/master.tar.gz),
-  rustManifest ? ./channel-rust-nightly.toml,
-}:
-
 let
-  pkgs = import <nixpkgs> { overlays = [ mozillaOverlay ]; };
-  rustcSrc = pkgs.fetchgit {
-    url = https://github.com/rust-lang/rust.git;
-    # master of 2020-04-25
-    rev = "14b15521c52549ebbb113173b4abecd124b5a823";
-    sha256 = "0a6bi8g636cajpdrpcfkpza95b7ss7041m9cs6hxcd7h8bf6xhwi";
-    fetchSubmodules = true;
-  };
-  targets = [];
-  rustChannelOfTargets = _channel: _date: targets:
-    (pkgs.lib.rustLib.fromManifestFile rustManifest {
-      inherit (pkgs) stdenv fetchurl patchelf;
-    }).rust.override { inherit targets; };
-  rust =
-    rustChannelOfTargets "nightly" null targets;
-  rustPlatform = pkgs.recurseIntoAttrs (pkgs.makeRustPlatform {
-    rustc = rust // { src = rustcSrc; };
-    cargo = rust;
-  });
-  gcc = pkgs.pkgsCross.armv7l-hf-multiplatform.buildPackages.gcc;
-  xbuildRustPackage = { cargoFeatures, crateSubdir, ... } @ attrs:
-    let
-      buildPkg = rustPlatform.buildRustPackage attrs;
-    in
-    buildPkg.overrideAttrs ({ name, nativeBuildInputs, ... }: {
-      nativeBuildInputs =
-        nativeBuildInputs ++ [ pkgs.cargo-xbuild ];
+  pkgs = import <nixpkgs> { overlays = [ (import ./nix/mozilla-overlay.nix) ]; };
+  rustPlatform = (import ./nix/rust-platform.nix { inherit pkgs; });
+  cargo-xbuild = pkgs.callPackage ./nix/cargo-xbuild.nix {};
+  cargoSha256Experiments = "154sdcfs1wazzn1pvm1nqbpary6kq5f3cx5sccz0ss4w8rkj9hr2";
+  cargoSha256SZL = "18rbf6vvvz65nc8m0l9y9km97pydhidw4f6yx6yb9vv58yzklsvy";
+  build-crate = name: crate: features: cargoSha256:
+    rustPlatform.buildRustPackage rec {
+      name = "${crate}";
+
+      src = builtins.filterSource (path: type:
+        baseNameOf path != "target"
+      ) ./.;
+      inherit cargoSha256;
+
+      nativeBuildInputs = [ cargo-xbuild pkgs.llvmPackages_9.clang-unwrapped ];
      buildPhase = ''
-        pushd ${crateSubdir}
+        export XARGO_RUST_SRC="${rustPlatform.rust.rustc}/lib/rustlib/src/rust/library"
+        export CARGO_HOME=$(mktemp -d cargo-home.XXX)
+        pushd ${crate}
        cargo xbuild --release --frozen \
          --no-default-features \
-          --features=${cargoFeatures}
+          --features=${features}
        popd
      '';
-      XARGO_RUST_SRC = "${rustcSrc}/src";
+
      installPhase = ''
-        mkdir $out
-        ls -la target/armv7-none-eabihf/release/
+        mkdir -p $out $out/nix-support
        cp target/armv7-none-eabihf/release/${name} $out/${name}.elf
+        echo file binary-dist $out/${name}.elf >> $out/nix-support/hydra-build-products
      '';
-    });
-  xbuildCrate = name: crate: features: xbuildRustPackage rec {
-    name = "${crate}";
-    src = ./.;
-    crateSubdir = crate;
-    cargoSha256 = "1c1qpg9by8bg93yhgllb5xs155g27qmh99pbrb681wazm8k7nwim";
-    cargoFeatures = features;
-    doCheck = false;
-    dontFixup = true;
+
+      doCheck = false;
+      dontFixup = true;
+    };
+
+  targetCrates = target: {
+    "${target}-experiments" = build-crate "${target}-experiments" "experiments" "target_${target}" cargoSha256Experiments;
+    "${target}-szl" = build-crate "${target}-szl" "szl" "target_${target}" cargoSha256SZL;
  };
-in {
-  inherit pkgs rustPlatform rustcSrc gcc;
-  zc706 = {
-    experiments-zc706 = xbuildCrate "experiments-zc706" "experiments" "target_zc706";
-    experiments-cora = xbuildCrate "experiments-cora" "experiments" "target_cora_z7_10";
-  };
-}
+  targets = ["zc706" "coraz7" "redpitaya" "kasli_soc"];
+in
+  {
+    inherit cargo-xbuild;
+    zc706-fsbl = import ./nix/fsbl.nix { inherit pkgs; };
+  } // (builtins.foldl' (results: target:
+    results // targetCrates target
+  ) {} targets)
--- a/experiments/Cargo.toml
+++ b/experiments/Cargo.toml
@ -2,12 +2,14 @@
 name = "experiments"
 description = "Developing bare-metal Rust on Zynq"
 version = "0.0.0"
-authors = ["Astro <astro@spaceboyz.net>"]
+authors = ["M-Labs"]
 edition = "2018"

 [features]
 target_zc706 = ["libboard_zynq/target_zc706", "libsupport_zynq/target_zc706"]
-target_cora_z7_10 = ["libboard_zynq/target_cora_z7_10", "libsupport_zynq/target_cora_z7_10"]
+target_coraz7 = ["libboard_zynq/target_coraz7", "libsupport_zynq/target_coraz7"]
+target_redpitaya = ["libboard_zynq/target_redpitaya", "libsupport_zynq/target_redpitaya"]
+target_kasli_soc = ["libboard_zynq/target_kasli_soc", "libsupport_zynq/target_kasli_soc"]
 default = ["target_zc706"]

 [dependencies]
--- a/experiments/link.x
+++ b/experiments/link.x
@ -34,6 +34,20 @@ SECTIONS
        __bss_end = .;
    } > OCM3

+    .irq_stack1 (NOLOAD) : ALIGN(8)
+    {
+        __irq_stack1_end = .;
+        . += 0x100;
+        __irq_stack1_start = .;
+    } > OCM3
+
+    .irq_stack0 (NOLOAD) : ALIGN(8)
+    {
+        __irq_stack0_end = .;
+        . += 0x100;
+        __irq_stack0_start = .;
+    } > OCM3
+
    .stack1 (NOLOAD) : ALIGN(8) {
        __stack1_end = .;
        . += 0x200;
--- a/experiments/src/main.rs
+++ b/experiments/src/main.rs
@ -2,6 +2,7 @@
 #![no_main]
 #![feature(const_in_array_repeat_expressions)]
 #![feature(naked_functions)]
+#![feature(asm)]

 extern crate alloc;

@ -15,7 +16,7 @@ use libboard_zynq::{
    self as zynq,
    clocks::source::{ArmPll, ClockSource, IoPll},
    clocks::Clocks,
-    print, println, stdio,
+    println, stdio,
    mpcore,
    gic,
    smoltcp::{
@ -25,13 +26,16 @@ use libboard_zynq::{
    },
    time::Milliseconds,
 };
+#[cfg(feature = "target_zc706")]
+use libboard_zynq::print;
 use libcortex_a9::{
    mutex::Mutex,
+    l2c::enable_l2_cache,
    sync_channel::{Sender, Receiver},
    sync_channel,
    regs::{MPIDR, SP},
    spin_lock_yield, notify_spin_lock,
-    asm
+    asm, interrupt_handler
 };
 use libregister::{RegisterR, RegisterW};
 use libsupport_zynq::{
@ -51,13 +55,10 @@ extern "C" {

 static CORE1_RESTART: AtomicBool = AtomicBool::new(false);

-#[link_section = ".text.boot"]
-#[no_mangle]
-#[naked]
-pub unsafe extern "C" fn IRQ() {
+interrupt_handler!(IRQ, irq, __irq_stack0_start, __irq_stack1_start, {
    if MPIDR.read().cpu_id() == 1{
-        let mpcore = mpcore::RegisterBlock::new();
-        let mut gic = gic::InterruptController::new(mpcore);
+        let mpcore = mpcore::RegisterBlock::mpcore();
+        let mut gic = gic::InterruptController::gic(mpcore);
        let id = gic.get_interrupt_id();
        if id.0 == 0 {
            gic.end_interrupt(id);
@ -72,10 +73,10 @@ pub unsafe extern "C" fn IRQ() {
    stdio::drop_uart();
    println!("IRQ");
    loop {}
-}
+});

 pub fn restart_core1() {
-    let mut interrupt_controller = gic::InterruptController::new(mpcore::RegisterBlock::new());
+    let mut interrupt_controller = gic::InterruptController::gic(mpcore::RegisterBlock::mpcore());
    CORE1_RESTART.store(true, Ordering::Relaxed);
    interrupt_controller.send_sgi(gic::InterruptId(0), gic::CPUCore::Core1.into());
    while CORE1_RESTART.load(Ordering::Relaxed) {
@ -86,41 +87,36 @@ pub fn restart_core1() {
 #[no_mangle]
 pub fn main_core0() {
    // zynq::clocks::CpuClocks::enable_io(1_250_000_000);
-    println!("\nzc706 main");
-    let mut interrupt_controller = gic::InterruptController::new(mpcore::RegisterBlock::new());
+    enable_l2_cache(0x8);
+    println!("\nZynq experiments");
+    let mut interrupt_controller = gic::InterruptController::gic(mpcore::RegisterBlock::mpcore());
    interrupt_controller.enable_interrupts();
-    // ps7_init::apply();
-    libboard_zynq::stdio::drop_uart();

    libboard_zynq::logger::init().unwrap();
    log::set_max_level(log::LevelFilter::Trace);

    info!(
        "Boot mode: {:?}",
-        zynq::slcr::RegisterBlock::new()
+        zynq::slcr::RegisterBlock::slcr()
            .boot_mode
            .read()
            .boot_mode_pins()
    );

-    #[cfg(feature = "target_zc706")]
+    #[cfg(any(
+        feature = "target_zc706",
+        feature = "target_redpitaya",
+        feature = "target_kasli_soc",
+    ))]
    const CPU_FREQ: u32 = 800_000_000;
-    #[cfg(feature = "target_cora_z7_10")]
+    #[cfg(feature = "target_coraz7")]
    const CPU_FREQ: u32 = 650_000_000;

    info!("Setup clock sources...");
    ArmPll::setup(2 * CPU_FREQ);
    Clocks::set_cpu_freq(CPU_FREQ);
-    #[cfg(feature = "target_zc706")]
-    {
-        IoPll::setup(1_000_000_000);
-        libboard_zynq::stdio::drop_uart();
-    }
-    #[cfg(feature = "target_cora_z7_10")]
-    {
-        IoPll::setup(1_000_000_000);
-        libboard_zynq::stdio::drop_uart();
-    }
+    IoPll::setup(1_000_000_000);
+    libboard_zynq::stdio::drop_uart();
    info!("PLLs set up");
    let clocks = zynq::clocks::Clocks::get();
    info!(
@ -131,63 +127,13 @@ pub fn main_core0() {
        clocks.cpu_1x()
    );

-    let mut flash = zynq::flash::Flash::new(200_000_000).linear_addressing_mode();
-    let flash_ram: &[u8] = unsafe { core::slice::from_raw_parts(flash.ptr(), flash.size()) };
-    for i in 0..=1 {
-        print!("Flash {}:", i);
-        for b in &flash_ram[(i * 16 * 1024 * 1024)..][..128] {
-            print!(" {:02X}", *b);
-        }
-        println!("");
-    }
-    let _flash = flash.stop();
-
    let timer = libboard_zynq::timer::GlobalTimer::start();

-    let mut ddr = zynq::ddr::DdrRam::new();
+    let mut ddr = zynq::ddr::DdrRam::ddrram();
    #[cfg(not(feature = "target_zc706"))]
    ddr.memtest();
    ram::init_alloc_ddr(&mut ddr);

-    #[cfg(dev)]
-    for i in 0..=1 {
-        let mut flash_io = flash.manual_mode(i);
-        // println!("rdcr={:02X}", flash_io.rdcr());
-        print!("Flash {} ID:", i);
-        for b in flash_io.rdid() {
-            print!(" {:02X}", b);
-        }
-        println!("");
-        print!("Flash {} I/O:", i);
-        for o in 0..8 {
-            const CHUNK: u32 = 8;
-            for b in flash_io.read(CHUNK * o, CHUNK as usize) {
-                print!(" {:02X}", b);
-            }
-        }
-        println!("");
-
-        flash_io.dump("Read cr1", 0x35);
-        flash_io.dump("Read Autoboot", 0x14);
-        flash_io.dump("Read Bank", 0x16);
-        flash_io.dump("DLP Bank", 0x16);
-        flash_io.dump("Read ESig", 0xAB);
-        flash_io.dump("OTP Read", 0x4B);
-        flash_io.dump("DYB Read", 0xE0);
-        flash_io.dump("PPB Read", 0xE2);
-        flash_io.dump("ASP Read", 0x2B);
-        flash_io.dump("Password Read", 0xE7);
-
-        flash_io.write_enabled(|flash_io| {
-            flash_io.erase(0);
-        });
-        flash_io.write_enabled(|flash_io| {
-            flash_io.program(0, [0x23054223; 0x100 >> 2].iter().cloned());
-        });
-
-        flash = flash_io.stop();
-    }
-
    boot::Core1::start(false);

    let core1_req = unsafe { &mut CORE1_REQ.0 };
@ -207,8 +153,8 @@ pub fn main_core0() {
    // Test I2C
    #[cfg(feature = "target_zc706")]
    {
-        let mut i2c = zynq::i2c::I2C::i2c();
-        i2c.init();
+        let mut i2c = zynq::i2c::I2c::i2c0();
+        i2c.init().unwrap();
        println!("I2C bit-banging enabled");
        let mut eeprom = zynq::i2c::eeprom::EEPROM::new(&mut i2c, 16);
        // Write to 0x00 and 0x08
@ -217,19 +163,19 @@ pub fn main_core0() {
            0x77, 0x88, 0x99, 0xaa, 0xbb, 0xcc, 0xdd, 0xee,
            0xef, 0xcd, 0xab, 0x89, 0x67, 0x45, 0x23, 0x01,
        ];
-        eeprom.write(0x00, &eeprom_buffer[0..6]);
-        eeprom.write(0x08, &eeprom_buffer[6..22]);
+        eeprom.write(0x00, &eeprom_buffer[0..6]).unwrap();
+        eeprom.write(0x08, &eeprom_buffer[6..22]).unwrap();
        println!("Data written to EEPROM");
        let mut eeprom_buffer = [0u8; 24];
        // Read from 0x00
-        eeprom.read(0x00, &mut eeprom_buffer);
+        eeprom.read(0x00, &mut eeprom_buffer).unwrap();
        print!("Data read from EEPROM @ 0x00: (hex) ");
        for i in 0..6 {
            print!("{:02x} ", eeprom_buffer[i]);
        }
        println!("");
        // Read from 0x08
-        eeprom.read(0x08, &mut eeprom_buffer);
+        eeprom.read(0x08, &mut eeprom_buffer).unwrap();
        print!("Data read from EEPROM @ 0x08: (hex) ");
        for i in 0..16 {
            print!("{:02x} ", eeprom_buffer[i]);
@ -237,7 +183,7 @@ pub fn main_core0() {
        println!("");
    }

-    let eth = zynq::eth::Eth::default(HWADDR.clone());
+    let eth = zynq::eth::Eth::eth0(HWADDR.clone());
    println!("Eth on");

    const RX_LEN: usize = 4096;
@ -270,12 +216,12 @@ pub fn main_core0() {
        while let Ok(stream) = TcpStream::accept(TCP_PORT, 0x10_0000, 0x10_0000).await {
            let stats_tx = stats_tx.clone();
            task::spawn(async move {
-                let tx_data = (0..=255).take(4096).collect::<alloc::vec::Vec<u8>>();
+                let tx_data = (0..=255).cycle().take(4096).collect::<alloc::vec::Vec<u8>>();
                loop {
                    // const CHUNK_SIZE: usize = 65536;
                    // match stream.send((0..=255).cycle().take(CHUNK_SIZE)).await {
                    match stream.send_slice(&tx_data[..]).await {
-                        Ok(len) => stats_tx.borrow_mut().1 += tx_data.len(), //CHUNK_SIZE,
+                        Ok(_len) => stats_tx.borrow_mut().1 += tx_data.len(), //CHUNK_SIZE,
                        Err(e) => {
                            warn!("tx: {:?}", e);
                            break
@ -331,7 +277,7 @@ static DONE: Mutex<bool> = Mutex::new(false);
 #[no_mangle]
 pub fn main_core1() {
    println!("Hello from core1!");
-    let mut interrupt_controller = gic::InterruptController::new(mpcore::RegisterBlock::new());
+    let mut interrupt_controller = gic::InterruptController::gic(mpcore::RegisterBlock::mpcore());
    interrupt_controller.enable_interrupts();
    let req = unsafe { &mut CORE1_REQ.1 };
    let res = unsafe { &mut CORE1_RES.0 };
--- a/kasli_soc_por.py
+++ b/kasli_soc_por.py
@ -0,0 +1,17 @@
+from time import sleep
+from pyftdi.ftdi import Ftdi
+
+POR = 1 << 7
+
+def main():
+    dev = Ftdi()
+    dev.open_bitbang_from_url("ftdi://ftdi:4232h/0")
+    dev.set_bitmode(POR, Ftdi.BitMode.BITBANG)
+    dev.write_data(bytes([0]))
+    sleep(0.1)
+    dev.write_data(bytes([POR]))
+    sleep(0.1)
+    dev.close()
+
+if __name__ == "__main__":
+    main()
--- a/libasync/Cargo.toml
+++ b/libasync/Cargo.toml
@ -2,17 +2,17 @@
 name = "libasync"
 description = "low-level async support"
 version = "0.0.0"
-authors = ["Astro <astro@spaceboyz.net>"]
+authors = ["M-Labs"]
 edition = "2018"

 [dependencies]
 #futures = { version = "0.3", default-features = false }
 pin-utils = "0.1.0-alpha.4"
 embedded-hal = "0.2"
-nb = "0.1"
+nb = "1.0"
 libcortex_a9 = { path = "../libcortex_a9" }

 [dependencies.smoltcp]
-version = "0.6"
+version = "0.7"
 default-features = false
 features = ["alloc"]
--- a/libasync/src/executor.rs
+++ b/libasync/src/executor.rs
@ -6,7 +6,7 @@ use core::{
    sync::atomic::{AtomicBool, Ordering},
    task::{Context, Poll, RawWaker, RawWakerVTable, Waker},
 };
-use alloc::{boxed::Box, collections::VecDeque as Deque};
+use alloc::{boxed::Box, vec::Vec};
 //use futures::future::FutureExt;
 use pin_utils::pin_mut;

@ -31,7 +31,7 @@ static VTABLE: RawWakerVTable = {
 /// ready should not move as long as this waker references it. That is
 /// the reason for keeping Tasks in a pinned box.
 fn wrap_waker(ready: &AtomicBool) -> Waker {
-    unsafe { Waker::from_raw(RawWaker::new(ready as *const _ as *const _, &VTABLE)) }
+    unsafe { Waker::from_raw(RawWaker::new(ready as *const _ as *const (), &VTABLE)) }
 }

 /// A single-threaded executor
@ -44,7 +44,7 @@ pub struct Executor {
    /// Tasks reside on the heap, so that we just queue pointers. They
    /// must also be pinned in memory because our RawWaker is a pointer
    /// to their `ready` field.
-    tasks: RefCell<Deque<Pin<Box<Task>>>>,
+    tasks: RefCell<Vec<Pin<Box<Task>>>>,
 }

 impl Executor {
@ -52,7 +52,7 @@ impl Executor {
    pub fn new() -> Self {
        Self {
            in_block_on: RefCell::new(false),
-            tasks: RefCell::new(Deque::new()),
+            tasks: RefCell::new(Vec::new()),
        }
    }

@ -72,6 +72,7 @@ impl Executor {
        pin_mut!(f);
        let ready = AtomicBool::new(true);
        let waker = wrap_waker(&ready);
+        let mut backup = Vec::new();
        let val = loop {
            // advance the main task
            if ready.load(Ordering::Relaxed) {
@ -85,10 +86,9 @@ impl Executor {
                // println!("ran block_on");
            }

-            // println!("tasks: {}", self.tasks.borrow().len());
-            // advance other tasks
-            let next_task = self.tasks.borrow_mut().pop_front();
-            if let Some(mut task) = next_task {
+            // advance all tasks
+            core::mem::swap(&mut *self.tasks.borrow_mut(), &mut backup);
+            for mut task in backup.drain(..) {
                // NOTE we don't need a CAS operation here because `wake` invocations that come from
                // interrupt handlers (the only source of 'race conditions' (!= data races)) are
                // "oneshot": they'll issue a `wake` and then disable themselves to not run again
@ -106,7 +106,7 @@ impl Executor {
                    }
                }
                // Requeue
-                self.tasks.borrow_mut().push_back(task);
+                self.tasks.borrow_mut().push(task);
            }

            // // try to sleep; this will be a no-op if any of the previous tasks generated a SEV or an
@ -119,7 +119,7 @@ impl Executor {

    pub fn spawn(&self, f: impl Future + 'static) {
        let task = Box::pin(Task::new(f));
-        self.tasks.borrow_mut().push_back(task);
+        self.tasks.borrow_mut().push(task);
    }
 }

--- a/libasync/src/smoltcp/mod.rs
+++ b/libasync/src/smoltcp/mod.rs
@ -7,17 +7,23 @@ use smoltcp::{
    iface::EthernetInterface,
    phy::Device,
    socket::SocketSet,
-    time::Instant,
+    time::{Duration, Instant},
 };
 use crate::task;

 mod tcp_stream;
 pub use tcp_stream::TcpStream;

+pub trait LinkCheck {
+    type Link;
+    fn is_idle(&self) -> bool;
+    fn check_link_change(&mut self) -> Option<Self::Link>;
+}
+
 static mut SOCKETS: Option<Sockets> = None;

 pub struct Sockets {
-    sockets: RefCell<SocketSet<'static, 'static, 'static>>,
+    sockets: RefCell<SocketSet<'static>>,
    wakers: RefCell<Vec<Waker>>,
 }

@ -41,14 +47,24 @@ impl Sockets {

    /// Block and run executor indefinitely while polling the smoltcp
    /// iface
-    pub fn run<'b, 'c, 'e, D: for<'d> Device<'d>>(
-        iface: &mut EthernetInterface<'b, 'c, 'e, D>,
+    pub fn run<'b, D: for<'d> Device<'d> + LinkCheck>(
+        iface: &mut EthernetInterface<'b, D>,
        mut get_time: impl FnMut() -> Instant,
    ) -> ! {
        task::block_on(async {
+            let mut last_link_check = Instant::from_millis(0);
+            const LINK_CHECK_INTERVAL: u64 = 500;
+
            loop {
                let instant = get_time();
                Self::instance().poll(iface, instant);
+
+                let dev = iface.device_mut();
+                if dev.is_idle() && instant >= last_link_check + Duration::from_millis(LINK_CHECK_INTERVAL) {
+                    dev.check_link_change();
+                    last_link_check = instant;
+                }
+
                task::r#yield().await;
            }
        })
@ -58,9 +74,9 @@ impl Sockets {
        unsafe { SOCKETS.as_ref().expect("Sockets") }
    }

-    fn poll<'b, 'c, 'e, D: for<'d> Device<'d>>(
+    fn poll<'b, D: for<'d> Device<'d>>(
        &self,
-        iface: &mut EthernetInterface<'b, 'c, 'e, D>,
+        iface: &mut EthernetInterface<'b, D>,
        instant: Instant
    ) {
        let processed = {
@ -81,7 +97,14 @@ impl Sockets {
    /// TODO: this was called through eg. TcpStream, another poll()
    /// might want to send packets before sleeping for an interrupt.
    pub(crate) fn register_waker(waker: Waker) {
-        Self::instance().wakers.borrow_mut()
-            .push(waker);
+        let mut wakers = Self::instance().wakers.borrow_mut();
+        for (i, w) in wakers.iter().enumerate() {
+            if w.will_wake(&waker) {
+                let last = wakers.len() - 1;
+                wakers.swap(i, last);
+                return;
+            }
+        }
+        wakers.push(waker);
    }
 }
--- a/libasync/src/smoltcp/tcp_stream.rs
+++ b/libasync/src/smoltcp/tcp_stream.rs
@ -262,6 +262,14 @@ impl TcpStream {
    pub fn set_timeout(&mut self, duration: Option<Duration>) {
        self.with_socket(|mut socket| socket.set_timeout(duration));
    }
+
+    pub fn ack_delay(&self) -> Option<Duration> {
+        self.with_socket(|socket| socket.ack_delay())
+    }
+
+    pub fn set_ack_delay(&mut self, duration: Option<Duration>) {
+        self.with_socket(|mut socket| socket.set_ack_delay(duration));
+    }
 }

 impl Drop for TcpStream {
--- a/libboard_zynq/Cargo.toml
+++ b/libboard_zynq/Cargo.toml
@ -2,12 +2,15 @@
 name = "libboard_zynq"
 description = "Drivers for peripherals in the Zynq PS"
 version = "0.0.0"
-authors = ["Astro <astro@spaceboyz.net>"]
+authors = ["M-Labs"]
 edition = "2018"

 [features]
 target_zc706 = []
-target_cora_z7_10 = []
+target_coraz7 = []
+target_redpitaya = []
+target_kasli_soc = []
+ipv6 = [ "smoltcp/proto-ipv6" ]

 [dependencies]
 volatile-register = "0.2"
@ -18,8 +21,9 @@ void = { version = "1", default-features = false }
 log = "0.4"
 libregister = { path = "../libregister" }
 libcortex_a9 = { path = "../libcortex_a9" }
+libasync = { path = "../libasync" }

 [dependencies.smoltcp]
-version = "0.6"
-features = ["ethernet", "proto-ipv4", "proto-ipv6", "socket-tcp"]
+version = "0.7"
+features = ["ethernet", "proto-ipv4", "socket-tcp"]
 default-features = false
--- a/libboard_zynq/src/clocks/mod.rs
+++ b/libboard_zynq/src/clocks/mod.rs
@ -14,7 +14,7 @@ enum CpuClockMode {

 impl CpuClockMode {
    pub fn get() -> Self {
-        let regs = slcr::RegisterBlock::new();
+        let regs = slcr::RegisterBlock::slcr();
        if regs.clk_621_true.read().clk_621_true() {
            CpuClockMode::C621
        } else {
@ -59,7 +59,7 @@ impl Clocks {
    }

    pub fn cpu_6x4x(&self) -> u32 {
-        let slcr = slcr::RegisterBlock::new();
+        let slcr = slcr::RegisterBlock::slcr();
        let arm_clk_ctrl = slcr.arm_clk_ctrl.read();
        let pll = match arm_clk_ctrl.srcsel() {
            ArmPllSource::ArmPll => self.arm,
@ -92,7 +92,7 @@ impl Clocks {
    }

    pub fn uart_ref_clk(&self) -> u32 {
-        let regs = slcr::RegisterBlock::new();
+        let regs = slcr::RegisterBlock::slcr();
        let uart_clk_ctrl = regs.uart_clk_ctrl.read();
        let pll = match uart_clk_ctrl.srcsel() {
            slcr::PllSource::ArmPll =>
@ -106,7 +106,7 @@ impl Clocks {
    }

    pub fn sdio_ref_clk(&self) -> u32 {
-        let regs = slcr::RegisterBlock::new();
+        let regs = slcr::RegisterBlock::slcr();
        let sdio_clk_ctrl = regs.sdio_clk_ctrl.read();
        let pll = match sdio_clk_ctrl.srcsel() {
            slcr::PllSource::ArmPll =>
--- a/libboard_zynq/src/clocks/source.rs
+++ b/libboard_zynq/src/clocks/source.rs
@ -4,8 +4,12 @@ use super::slcr;

 #[cfg(feature = "target_zc706")]
 pub const PS_CLK: u32 = 33_333_333;
-#[cfg(feature = "target_cora_z7_10")]
+#[cfg(feature = "target_coraz7")]
 pub const PS_CLK: u32 = 50_000_000;
+#[cfg(feature = "target_redpitaya")]
+pub const PS_CLK: u32 = 33_333_333;
+#[cfg(feature = "target_kasli_soc")]
+pub const PS_CLK: u32 = 33_333_333;

 /// (pll_fdiv_max, (pll_cp, pll_res, lock_cnt))
 const PLL_FDIV_LOCK_PARAM: &[(u16, (u8, u8, u16))] = &[
@ -44,7 +48,7 @@ pub trait ClockSource {

    /// get configured frequency
    fn freq() -> u32 {
-        let mut slcr = slcr::RegisterBlock::new();
+        let mut slcr = slcr::RegisterBlock::slcr();
        let (pll_ctrl, _, _) = Self::pll_regs(&mut slcr);
        u32::from(pll_ctrl.read().pll_fdiv()) * PS_CLK
    }
@ -55,7 +59,7 @@ pub trait ClockSource {
    /// 25.10.4 PLLs
    fn setup(target_freq: u32) {
        let fdiv = (target_freq / PS_CLK).min(66) as u16;
-        let (pll_res, pll_cp, lock_cnt) = PLL_FDIV_LOCK_PARAM.iter()
+        let (pll_cp, pll_res, lock_cnt) = PLL_FDIV_LOCK_PARAM.iter()
            .filter(|(fdiv_max, _)| fdiv <= *fdiv_max)
            .nth(0)
            .expect("PLL_FDIV_LOCK_PARAM")
--- a/libboard_zynq/src/ddr/mod.rs
+++ b/libboard_zynq/src/ddr/mod.rs
@ -1,7 +1,9 @@
 use libregister::{RegisterR, RegisterW, RegisterRW};
 use log::{debug, info, error};
 use crate::{print, println};
-use super::slcr::{self, DdriobVrefSel};
+use super::slcr;
+#[cfg(feature = "target_zc706")]
+use super::slcr::DdriobVrefSel;
 use super::clocks::{Clocks, source::{DdrPll, ClockSource}};

 mod regs;
@ -10,27 +12,32 @@ mod regs;
 /// Micron MT41J256M8HX-15E: 667 MHz DDR3
 const DDR_FREQ: u32 = 666_666_666;

-#[cfg(feature = "target_cora_z7_10")]
+#[cfg(feature = "target_coraz7")]
 /// Micron MT41K256M16HA-125: 800 MHz DDR3L, max supported 533 MHz
 const DDR_FREQ: u32 = 525_000_000;

-/// MT41K256M16HA-125
-const DCI_FREQ: u32 = 10_000_000;
+#[cfg(feature = "target_redpitaya")]
+/// Alliance Memory AS4C256M16D3B: 800 MHz DDR3 at 533 MHz
+const DDR_FREQ: u32 = 533_333_333;
+
+#[cfg(feature = "target_kasli_soc")]
+/// MT41K256M16HA-125:E: 800 MHz DDR3L at 533 MHz
+const DDR_FREQ: u32 = 533_333_333;
+
+const DCI_MAX_FREQ: u32 = 10_000_000;

 pub struct DdrRam {
    regs: &'static mut regs::RegisterBlock,
 }

 impl DdrRam {
-    pub fn new() -> Self {
+    pub fn ddrram() -> Self {
        let clocks = Self::clock_setup();
-        Self::calibrate_iob_impedance(&clocks);
        Self::configure_iob();
-
-        let regs = unsafe { regs::RegisterBlock::new() };
+        Self::calibrate_iob_impedance(&clocks);
+        let regs = regs::RegisterBlock::ddrc();
        let mut ddr = DdrRam { regs };
-        ddr.configure();
-        ddr.reset_ddrc();
+        ddr.reset_ddrc(|ddr| ddr.configure());
        ddr
    }

@ -57,7 +64,7 @@ impl DdrRam {
    }

    fn calculate_dci_divisors(clocks: &Clocks) -> (u8, u8) {
-        let target = (DCI_FREQ - 1 + clocks.ddr) / DCI_FREQ;
+        let target = (DCI_MAX_FREQ - 1 + clocks.ddr) / DCI_MAX_FREQ;

        let mut best = None;
        let mut best_error = 0;
@ -140,13 +147,22 @@ impl DdrRam {
                .output_en(slcr::DdriobOutputEn::Obuf);
            #[cfg(feature = "target_zc706")]
            let data1_config = data0_config.clone();
-            #[cfg(feature = "target_cora_z7_10")]
+            #[cfg(any(feature = "target_coraz7", feature = "target_kasli_soc"))]
            let data0_config = slcr::DdriobConfig::zeroed()
                .inp_type(slcr::DdriobInputType::VrefDifferential)
                .term_en(true)
                .dci_type(slcr::DdriobDciType::Termination)
                .output_en(slcr::DdriobOutputEn::Obuf);
-            #[cfg(feature = "target_cora_z7_10")]
+            #[cfg(any(feature = "target_coraz7", feature = "target_kasli_soc"))]
+            let data1_config = slcr::DdriobConfig::zeroed()
+                .pullup_en(true);
+            #[cfg(feature = "target_redpitaya")]
+            let data0_config = slcr::DdriobConfig::zeroed()
+                .inp_type(slcr::DdriobInputType::VrefDifferential)
+                .term_en(true)
+                .dci_type(slcr::DdriobDciType::Termination)
+                .output_en(slcr::DdriobOutputEn::Obuf);
+            #[cfg(feature = "target_redpitaya")]
            let data1_config = slcr::DdriobConfig::zeroed()
                .pullup_en(true);
            slcr.ddriob_data0.write(data0_config);
@ -160,16 +176,24 @@ impl DdrRam {
                .output_en(slcr::DdriobOutputEn::Obuf);
            #[cfg(feature = "target_zc706")]
            let diff1_config = diff0_config.clone();
-            #[cfg(feature = "target_cora_z7_10")]
+            #[cfg(any(feature = "target_coraz7", feature = "target_kasli_soc"))]
            let diff0_config = slcr::DdriobConfig::zeroed()
                .inp_type(slcr::DdriobInputType::Differential)
                .term_en(true)
                .dci_type(slcr::DdriobDciType::Termination)
                .output_en(slcr::DdriobOutputEn::Obuf);
-            #[cfg(feature = "target_cora_z7_10")]
+            #[cfg(any(feature = "target_coraz7", feature = "target_kasli_soc"))]
+            let diff1_config = slcr::DdriobConfig::zeroed()
+                .pullup_en(true);
+            #[cfg(feature = "target_redpitaya")]
+            let diff0_config = slcr::DdriobConfig::zeroed()
+                .inp_type(slcr::DdriobInputType::Differential)
+                .term_en(true)
+                .dci_type(slcr::DdriobDciType::Termination)
+                .output_en(slcr::DdriobOutputEn::Obuf);
+            #[cfg(feature = "target_redpitaya")]
            let diff1_config = slcr::DdriobConfig::zeroed()
                .pullup_en(true);
-
            slcr.ddriob_diff0.write(diff0_config);
            slcr.ddriob_diff1.write(diff1_config);

@ -186,12 +210,12 @@ impl DdrRam {
                slcr.ddriob_drive_slew_clock.write(0x00F9861C);
            }

-            // Enable external V[REF]
-            #[cfg(feature = "target_cora_z7_10")]
+            #[cfg(any(feature = "target_coraz7", feature = "target_kasli_soc"))]
            slcr.ddriob_ddr_ctrl.modify(|_, w| w
                    .vref_int_en(false)
                    .vref_ext_en_lower(true)
                    .vref_ext_en_upper(false)
+                    .refio_en(true)
            );
            #[cfg(feature = "target_zc706")]
            slcr.ddriob_ddr_ctrl.modify(|_, w| w
@ -200,16 +224,48 @@ impl DdrRam {
                    .vref_ext_en_lower(false)
                    .vref_ext_en_upper(false)
            );
+            #[cfg(feature = "target_redpitaya")]
+            slcr.ddriob_ddr_ctrl.modify(|_, w| w
+                    .vref_int_en(false)
+                    .vref_ext_en_lower(true)
+                    .vref_ext_en_upper(false)
+                    .refio_en(true)
+            );
        });
    }

    fn configure(&mut self) {
+        #[cfg(any(feature = "target_coraz7", feature = "target_kasli_soc"))]
+        self.regs.dram_param0.write(
+            regs::DramParam0::zeroed()
+                .t_rc(0x1a)
+                .t_rfc_min(0x9e)
+                .post_selfref_gap_x32(0x10)
+        );
+        #[cfg(feature = "target_redpitaya")]
+        self.regs.dram_param0.write(
+            regs::DramParam0::zeroed()
+                .t_rc(0x1b)
+                .t_rfc_min(0xa0)
+                .post_selfref_gap_x32(0x10)
+        );
+        #[cfg(feature = "target_zc706")]
        self.regs.dram_param0.write(
            regs::DramParam0::zeroed()
                .t_rc(0x1b)
                .t_rfc_min(0x56)
                .post_selfref_gap_x32(0x10)
        );
+        #[cfg(feature = "target_redpitaya")]
+        self.regs.dram_param1.modify(
+            |_, w| w
+                .wr2pre(0x12)
+                .powerdown_to_x32(6)
+                .t_faw(0x16)
+                .t_ras_max(0x24)
+                .t_ras_min(0x13)
+                .t_cke(4)
+        );

        self.regs.dram_param2.write(
            regs::DramParam2::zeroed()
@ -221,6 +277,20 @@ impl DdrRam {
                .rd2pre(0x4)
                .t_rcd(0x7)
        );
+        #[cfg(feature = "target_redpitaya")]
+        self.regs.dram_param3.modify(
+            |_, w| w
+                .t_ccd(4)
+                .t_rrd(6)
+                .refresh_margin(2)
+                .t_rp(7)
+                .refresh_to_x32(8)
+                .mobile(false)
+                .dfi_dram_clk_disable(false)
+                .read_latency(7)
+                .mode_ddr1_ddr2(true)
+                .dis_pad_pd(false)
+        );

        self.regs.dram_emr_mr.write(
            regs::DramEmrMr::zeroed()
@ -228,6 +298,23 @@ impl DdrRam {
                .emr(0x4)
        );

+        #[cfg(any(feature = "target_coraz7", feature = "target_kasli_soc"))]
+        self.regs.phy_configs[2].modify(
+            |_, w| w.data_slice_in_use(false)
+        );
+        #[cfg(any(feature = "target_coraz7", feature = "target_kasli_soc"))]
+        self.regs.phy_configs[3].modify(
+            |_, w| w.data_slice_in_use(false)
+        );
+        #[cfg(feature = "target_redpitaya")]
+        self.regs.phy_configs[2].modify(
+            |_, w| w.data_slice_in_use(false)
+        );
+        #[cfg(feature = "target_redpitaya")]
+        self.regs.phy_configs[3].modify(
+            |_, w| w.data_slice_in_use(false)
+        );
+
        self.regs.phy_cmd_timeout_rddata_cpt.modify(
            |_, w| w
                .rd_cmd_to_data(0x0)
@ -260,12 +347,32 @@ impl DdrRam {
                .ctrlup_max(0x40)
        );

-        self.regs.phy_init_ratio3.write(
+        #[cfg(feature = "target_zc706")]
+        self.regs.phy_init_ratios[3].write(
            regs::PhyInitRatio::zeroed()
                .wrlvl_init_ratio(0x21)
                .gatelvl_init_ratio(0xee)
        );

+        #[cfg(any(feature = "target_coraz7", feature = "target_kasli_soc"))]
+        self.regs.reg_64.modify(
+            |_, w| w
+                .phy_ctrl_slave_ratio(0x100)
+                .phy_invert_clkout(true)
+        );
+        #[cfg(feature = "target_redpitaya")]
+        self.regs.reg_64.modify(
+            |_, w| w
+                .phy_bl2(false)
+                .phy_invert_clkout(true)
+                .phy_sel_logic(false)
+                .phy_ctrl_slave_ratio(0x100)
+                .phy_ctrl_slave_force(false)
+                .phy_ctrl_slave_delay(0)
+                .phy_lpddr(false)
+                .phy_cmd_latency(false)
+        );
+
        self.regs.reg_65.write(
            regs::Reg65::zeroed()
                .wr_rl_delay(0x2)
@ -280,7 +387,20 @@ impl DdrRam {
    }

    /// Reset DDR controller
-    fn reset_ddrc(&mut self) {
+    fn reset_ddrc<F: FnMut(&mut Self)>(&mut self, mut f: F) {
+        #[cfg(feature = "target_zc706")]
+        let width = regs::DataBusWidth::Width32bit;
+        #[cfg(any(feature = "target_coraz7", feature = "target_kasli_soc"))]
+        let width = regs::DataBusWidth::Width16bit;
+        #[cfg(feature = "target_redpitaya")]
+        let width = regs::DataBusWidth::Width16bit;
+        self.regs.ddrc_ctrl.modify(|_, w| w
+            .soft_rstb(false)
+            .powerdown_en(false)
+            .data_bus_width(width)
+        );
+        f(self);
+
        #[cfg(feature = "target_zc706")]
        unsafe {
            // row/column address bits
@ -288,16 +408,18 @@ impl DdrRam {
            self.regs.dram_addr_map_col.write(0xFFF00000);
            self.regs.dram_addr_map_row.write(0x0F666666);
        }
+        #[cfg(any(
+            feature = "target_coraz7",
+            feature = "target_redpitaya",
+            feature = "target_kasli_soc",
+        ))]
+        unsafe {
+            // row/column address bits
+            self.regs.dram_addr_map_bank.write(0x00000666);
+            self.regs.dram_addr_map_col.write(0xFFFF0000);
+            self.regs.dram_addr_map_row.write(0x0F555555);
+        }

-        #[cfg(feature = "target_zc706")]
-        let width = regs::DataBusWidth::Width32bit;
-        #[cfg(feature = "target_cora_z7_10")]
-        let width = regs::DataBusWidth::Width16bit;
-        self.regs.ddrc_ctrl.modify(|_, w| w
-            .soft_rstb(false)
-            .powerdown_en(false)
-            .data_bus_width(width)
-        );
        self.regs.ddrc_ctrl.modify(|_, w| w
            .soft_rstb(true)
            .powerdown_en(false)
@ -318,10 +440,16 @@ impl DdrRam {
    /// actually there's 1 MB more but starting at 0x0000_0000
    /// overlaps with OCM.
    pub fn size(&self) -> usize {
+        // DDR range ends at 0x3FFF_FFFF in the default SCU address
+        // filtering address map
        #[cfg(feature = "target_zc706")]
        let megabytes = 1023;
-        #[cfg(feature = "target_cora_z7_10")]
-        let megabytes = 511;
+        #[cfg(any(
+            feature = "target_coraz7",
+            feature = "target_redpitaya",
+            feature = "target_kasli_soc",
+        ))]
+        let megabytes = 512;

        megabytes * 1024 * 1024
    }
--- a/libboard_zynq/src/ddr/regs.rs
+++ b/libboard_zynq/src/ddr/regs.rs
@ -1,6 +1,6 @@
 use volatile_register::{RO, RW};

-use libregister::{register, register_bit, register_bits, register_bits_typed};
+use libregister::{register, register_at, register_bit, register_bits, register_bits_typed};

 #[allow(unused)]
 #[derive(Clone, Copy)]
@ -33,14 +33,14 @@ pub struct RegisterBlock {
    pub lpr: RW<u32>,
    pub wr: RW<u32>,
    pub dram_param0: DramParam0,
-    pub dram_param1: RW<u32>,
+    pub dram_param1: DramParam1,
    pub dram_param2: DramParam2,
-    pub dram_param3: RW<u32>,
+    pub dram_param3: DramParam3,
    pub dram_param4: RW<u32>,
    pub dram_init_param: RW<u32>,
    pub dram_emr: RW<u32>,
    pub dram_emr_mr: DramEmrMr,
-    pub dram_burst8_rdwr: RW<u32>,
+    pub dram_burst8_rdwr: Burst8Rdwr,
    pub dram_disable_dq: RW<u32>,
    pub dram_addr_map_bank: RW<u32>,
    pub dram_addr_map_col: RW<u32>,
@ -60,7 +60,7 @@ pub struct RegisterBlock {
    pub ctrl6: RW<u32>,
    _unused1: [RO<u32>; 8],
    pub che_refresh_timer01: RW<u32>,
-    pub che_t_zq: RW<u32>,
+    pub che_t_zq: CheTZq,
    pub che_t_zq_short_interval: RW<u32>,
    pub deep_pwrdwn: RW<u32>,
    pub reg_2c: Reg2C,
@ -84,15 +84,9 @@ pub struct RegisterBlock {
    pub che_ecc_corr_bit_mask_63_32_offset: RW<u32>,
    _unused3: [RO<u32>; 5],
    pub phy_rcvr_enable: RW<u32>,
-    pub phy_config0: RW<u32>,
-    pub phy_config1: RW<u32>,
-    pub phy_config2: RW<u32>,
-    pub phy_config3: RW<u32>,
+    pub phy_configs: [PhyConfig; 4],
    _unused4: RO<u32>,
-    pub phy_init_ratio0: PhyInitRatio,
-    pub phy_init_ratio1: PhyInitRatio,
-    pub phy_init_ratio2: PhyInitRatio,
-    pub phy_init_ratio3: PhyInitRatio,
+    pub phy_init_ratios: [PhyInitRatio; 4],
    _unused5: RO<u32>,
    pub phy_rd_dqs_cfg0: RW<u32>,
    pub phy_rd_dqs_cfg1: RW<u32>,
@ -114,7 +108,7 @@ pub struct RegisterBlock {
    pub wr_data_slv2: RW<u32>,
    pub wr_data_slv3: RW<u32>,
    _unused9: RO<u32>,
-    pub reg_64: RW<u32>,
+    pub reg_64: Reg64,
    pub reg_65: Reg65,
    _unused10: [RO<u32>; 3],
    pub reg69_6a0: RW<u32>,
@ -138,14 +132,8 @@ pub struct RegisterBlock {
    _unused14: [RO<u32>; 5],
    pub axi_id: RW<u32>,
    pub page_mask: RW<u32>,
-    pub axi_priority_wr_port0: RW<u32>,
-    pub axi_priority_wr_port1: RW<u32>,
-    pub axi_priority_wr_port2: RW<u32>,
-    pub axi_priority_wr_port3: RW<u32>,
-    pub axi_priority_rd_port0: RW<u32>,
-    pub axi_priority_rd_port1: RW<u32>,
-    pub axi_priority_rd_port2: RW<u32>,
-    pub axi_priority_rd_port3: RW<u32>,
+    pub axi_priority_wr_ports: [RW<u32>; 4],
+    pub axi_priority_rd_ports: [AxiPriorityRd; 4],
    _unused15: [RO<u32>; 27],
    pub excl_access_cfg0: RW<u32>,
    pub excl_access_cfg1: RW<u32>,
@ -158,11 +146,7 @@ pub struct RegisterBlock {
    pub lpddr_ctrl3: RW<u32>,
 }

-impl RegisterBlock {
-    pub unsafe fn new() -> &'static mut Self {
-        &mut *(0xF8006000 as *mut _)
-    }
-}
+register_at!(RegisterBlock, 0xF8006000, ddrc);

 register!(ddrc_ctrl, DdrcCtrl, RW, u32);
 register_bit!(ddrc_ctrl,
@ -177,6 +161,14 @@ register_bits!(dram_param0, t_rc, u8, 0, 5);
 register_bits!(dram_param0, t_rfc_min, u8, 6, 13);
 register_bits!(dram_param0, post_selfref_gap_x32, u8, 14, 20);

+register!(dram_param1, DramParam1, RW, u32);
+register_bits!(dram_param1, wr2pre, u8, 0, 4);
+register_bits!(dram_param1, powerdown_to_x32, u8, 5, 9);
+register_bits!(dram_param1, t_faw, u8, 10, 15);
+register_bits!(dram_param1, t_ras_max, u8, 16, 21);
+register_bits!(dram_param1, t_ras_min, u8, 22, 26);
+register_bits!(dram_param1, t_cke, u8, 28, 31);
+
 register!(dram_param2, DramParam2, RW, u32);
 register_bits!(dram_param2, write_latency, u8, 0, 4);
 register_bits!(dram_param2, rd2wr, u8, 5, 9);
@ -186,10 +178,29 @@ register_bits!(dram_param2, pad_pd, u8, 20, 22);
 register_bits!(dram_param2, rd2pre, u8, 23, 27);
 register_bits!(dram_param2, t_rcd, u8, 28, 31);

+register!(dram_param3, DramParam3, RW, u32);
+register_bits!(dram_param3, t_ccd, u8, 2, 4);
+register_bits!(dram_param3, t_rrd, u8, 5, 7);
+register_bits!(dram_param3, refresh_margin, u8, 8, 11);
+register_bits!(dram_param3, t_rp, u8, 12, 15);
+register_bits!(dram_param3, refresh_to_x32, u8, 16, 20);
+register_bit!(dram_param3, sdram, 21);
+register_bit!(dram_param3, mobile, 22);
+register_bit!(dram_param3, dfi_dram_clk_disable, 23);
+register_bits!(dram_param3, read_latency, u8, 24, 28);
+register_bit!(dram_param3, mode_ddr1_ddr2, 29);
+register_bit!(dram_param3, dis_pad_pd, 30);
+
 register!(dram_emr_mr, DramEmrMr, RW, u32);
 register_bits!(dram_emr_mr, mr, u16, 0, 15);
 register_bits!(dram_emr_mr, emr, u16, 16, 31);

+register!(burst8_rdwr, Burst8Rdwr, RW, u32);
+register_bits!(burst8_rdwr, burst_rdwr, u8, 0, 3);
+register_bits!(burst8_rdwr, pre_cke_x1024, u16, 4, 13);
+register_bits!(burst8_rdwr, post_cke_x1024, u16, 16, 25);
+register_bit!(burst8_rdwr, burstchop, 28);
+
 register!(phy_cmd_timeout_rddata_cpt, PhyCmdTimeoutRddataCpt, RW, u32);
 register_bits!(phy_cmd_timeout_rddata_cpt, rd_cmd_to_data, u8, 0, 3);
 register_bits!(phy_cmd_timeout_rddata_cpt, wr_cmd_to_data, u8, 4, 7);
@ -202,6 +213,13 @@ register_bit!(phy_cmd_timeout_rddata_cpt, clk_stall_level, 19);
 register_bits!(phy_cmd_timeout_rddata_cpt, gatelvl_num_of_dq0, u8, 24, 27);
 register_bits!(phy_cmd_timeout_rddata_cpt, wrlvl_num_of_dq0, u8, 28, 31);

+register!(che_t_zq, CheTZq, RW, u32);
+register_bit!(che_t_zq, dis_auto_zq, 0);
+register_bit!(che_t_zq, ddr3, 1);
+register_bits!(che_t_zq, t_mod, u8, 2, 11);
+register_bits!(che_t_zq, t_zq_long_nop, u16, 12, 21);
+register_bits!(che_t_zq, t_zq_short_nop, u16, 22, 31);
+
 register!(reg_2c, Reg2C, RW, u32);
 register_bits!(reg_2c, wrlvl_max_x1024, u16, 0, 11);
 register_bits!(reg_2c, rdlvl_max_x1024, u16, 12, 23);
@ -216,10 +234,27 @@ register_bits!(dfi_timing, rddata_en, u8, 0, 4);
 register_bits!(dfi_timing, ctrlup_min, u16, 5, 14);
 register_bits!(dfi_timing, ctrlup_max, u16, 15, 24);

+register!(phy_config, PhyConfig, RW, u32);
+register_bit!(phy_config, data_slice_in_use, 0);
+register_bit!(phy_config, rdlvl_inc_mode, 1);
+register_bit!(phy_config, gatelvl_inc_mode, 2);
+register_bit!(phy_config, wrlvl_inc_mode, 3);
+register_bits!(phy_config, dq_offset, u8, 24, 30);
+
 register!(phy_init_ratio, PhyInitRatio, RW, u32);
 register_bits!(phy_init_ratio, wrlvl_init_ratio, u16, 0, 9);
 register_bits!(phy_init_ratio, gatelvl_init_ratio, u16, 10, 19);

+register!(reg_64, Reg64, RW, u32);
+register_bit!(reg_64, phy_bl2, 1);
+register_bit!(reg_64, phy_invert_clkout, 7);
+register_bit!(reg_64, phy_sel_logic, 9);
+register_bits!(reg_64, phy_ctrl_slave_ratio, u16, 10, 19);
+register_bit!(reg_64, phy_ctrl_slave_force, 20);
+register_bits!(reg_64, phy_ctrl_slave_delay, u8, 21, 27);
+register_bit!(reg_64, phy_lpddr, 29);
+register_bit!(reg_64, phy_cmd_latency, 30);
+
 register!(reg_65, Reg65, RW, u32);
 register_bits!(reg_65, wr_rl_delay, u8, 0, 4);
 register_bits!(reg_65, rd_rl_delay, u8, 5, 9);
@ -235,3 +270,10 @@ register!(mode_sts_reg,
          ModeStsReg, RO, u32);
 register_bits_typed!(mode_sts_reg, operating_mode, u8, ControllerStatus, 0, 2);
 // (mode_sts_reg) ...
+
+register!(axi_priority_rd, AxiPriorityRd, RW, u32);
+register_bits!(axi_priority_rd, arb_pri_rd_portn, u16, 0, 9);
+register_bit!(axi_priority_rd, arb_disable_aging_rd_portn, 16);
+register_bit!(axi_priority_rd, arb_disable_urgent_rd_portn, 17);
+register_bit!(axi_priority_rd, arb_disable_page_match_rd_portn, 18);
+register_bit!(axi_priority_rd, arb_set_hpr_rd_portn, 19);
--- a/libboard_zynq/src/eth/mod.rs
+++ b/libboard_zynq/src/eth/mod.rs
@ -27,7 +27,7 @@ const TX_1000: u32 = 125_000_000;
 pub struct Buffer(pub [u8; MTU]);

 impl Buffer {
-    pub fn new() -> Self {
+    pub const fn new() -> Self {
        Buffer([0; MTU])
    }
 }
@ -145,10 +145,12 @@ pub struct Eth<GEM: Gem, RX, TX> {
    tx: TX,
    inner: EthInner<GEM>,
    phy: Phy,
+    /// keep track of RX path occupation to avoid needless `check_link_change()`
+    idle: bool,
 }

 impl Eth<Gem0, (), ()> {
-    pub fn default(macaddr: [u8; 6]) -> Self {
+    pub fn eth0(macaddr: [u8; 6]) -> Self {
        slcr::RegisterBlock::unlocked(|slcr| {
            // Manual example: 0x0000_1280
            // MDIO
@ -224,48 +226,48 @@ impl Eth<Gem0, (), ()> {
            // RX_CLK
            slcr.mio_pin_22.write(
                slcr::MioPin22::zeroed()
-                    .tri_enable(true)
                    .l0_sel(true)
+                    .speed(true)
                    .io_type(slcr::IoBufferType::Hstl)
                    .pullup(true)
            );
            // RX_CTRL
            slcr.mio_pin_27.write(
                slcr::MioPin27::zeroed()
-                    .tri_enable(true)
                    .l0_sel(true)
+                    .speed(true)
                    .io_type(slcr::IoBufferType::Hstl)
                    .pullup(true)
            );
            // RXD3
            slcr.mio_pin_26.write(
                slcr::MioPin26::zeroed()
-                    .tri_enable(true)
                    .l0_sel(true)
+                    .speed(true)
                    .io_type(slcr::IoBufferType::Hstl)
                    .pullup(true)
            );
            // RXD2
            slcr.mio_pin_25.write(
                slcr::MioPin25::zeroed()
-                    .tri_enable(true)
                    .l0_sel(true)
+                    .speed(true)
                    .io_type(slcr::IoBufferType::Hstl)
                    .pullup(true)
            );
            // RXD1
            slcr.mio_pin_24.write(
                slcr::MioPin24::zeroed()
-                    .tri_enable(true)
                    .l0_sel(true)
+                    .speed(true)
                    .io_type(slcr::IoBufferType::Hstl)
                    .pullup(true)
            );
            // RXD0
            slcr.mio_pin_23.write(
                slcr::MioPin23::zeroed()
-                    .tri_enable(true)
                    .l0_sel(true)
+                    .speed(true)
                    .io_type(slcr::IoBufferType::Hstl)
                    .pullup(true)
            );
@ -280,19 +282,22 @@ impl Eth<Gem0, (), ()> {
    }

    pub fn gem0(macaddr: [u8; 6]) -> Self {
-        Self::new(macaddr)
+        Self::gem_common(macaddr)
    }
 }


 impl Eth<Gem1, (), ()> {
+    // TODO: Add a `eth1()`
+
    pub fn gem1(macaddr: [u8; 6]) -> Self {
-        Self::new(macaddr)
+        Self::gem_common(macaddr)
    }
 }

+
 impl<GEM: Gem> Eth<GEM, (), ()> {
-    fn new(macaddr: [u8; 6]) -> Self {
+    fn gem_common(macaddr: [u8; 6]) -> Self {
        GEM::setup_clock(TX_1000);

        let mut inner = EthInner {
@ -311,6 +316,7 @@ impl<GEM: Gem> Eth<GEM, (), ()> {
            tx: (),
            inner,
            phy,
+            idle: true,
        }
    }
 }
@ -322,6 +328,7 @@ impl<GEM: Gem, RX, TX> Eth<GEM, RX, TX> {
            tx: self.tx,
            inner: self.inner,
            phy: self.phy,
+            idle: self.idle,
        };
        let list_addr = new_self.rx.list_addr();
        assert!(list_addr & 0b11 == 0);
@ -341,6 +348,7 @@ impl<GEM: Gem, RX, TX> Eth<GEM, RX, TX> {
            tx: tx::DescList::new(tx_size),
            inner: self.inner,
            phy: self.phy,
+            idle: self.idle,
        };
        let list_addr = &new_self.tx.list_addr();
        assert!(list_addr & 0b11 == 0);
@ -392,17 +400,31 @@ impl<GEM: Gem, TX> Eth<GEM, rx::DescList, TX> {
                        regs::RxStatus::zeroed()
                            .frame_recd(true)
                    );
+                    self.idle = true;
                }
-                _ => {}
+                _ =>
+                    self.idle = false,
            }
            result
        } else {
-            self.inner.check_link_change(&self.phy);
+            self.idle = true;
            Ok(None)
        }
    }
 }

+impl<GEM: Gem, TX> libasync::smoltcp::LinkCheck for &mut Eth<GEM, rx::DescList, TX> {
+    type Link = Option<phy::Link>;
+
+    fn check_link_change(&mut self) -> Option<Self::Link> {
+        self.inner.check_link_change(&self.phy)
+    }
+
+    fn is_idle(&self) -> bool {
+        self.idle
+    }
+}
+
 impl<GEM: Gem, RX> Eth<GEM, RX, tx::DescList> {
    pub fn send<'s: 'p, 'p>(&'s mut self, length: usize) -> Option<tx::PktRef<'p>> {
        self.tx.send(GEM::regs(), length)
@ -436,10 +458,11 @@ impl<'a, GEM: Gem> smoltcp::phy::Device<'a> for &mut Eth<GEM, rx::DescList, tx::
                    regs: GEM::regs(),
                    desc_list: &mut self.tx,
                };
+                self.idle = false;
                Some((pktref, tx_token))
            }
            Ok(None) => {
-                self.inner.check_link_change(&self.phy);
+                self.idle = true;
                None
            }
            Err(e) => {
@ -530,7 +553,10 @@ impl<GEM: Gem> EthInner<GEM> {

    fn configure(&mut self, macaddr: [u8; 6]) {
        let clocks = Clocks::get();
-        let mdc_clk_div = (clocks.cpu_1x() / MAX_MDC) + 1;
+        let mut mdc_clk_div = clocks.cpu_1x() / MAX_MDC;
+        if clocks.cpu_1x() % MAX_MDC > 0 {
+            mdc_clk_div += 1;
+        }

        GEM::regs().net_cfg.write(
            regs::NetCfg::zeroed()
@ -539,10 +565,10 @@ impl<GEM: Gem> EthInner<GEM> {
                .speed(true)
                .no_broadcast(false)
                .multi_hash_en(true)
-                // Promiscuous mode (TODO?)
-                .copy_all(true)
+                .rx_1536_byte_frames(true)
                // Remove 4-byte Frame CheckSum
                .fcs_remove(true)
+                .dis_cp_pause_frame(true)
                // RX checksum offload
                .rx_chksum_offld_en(true)
                // One of the slower speeds
@ -550,22 +576,23 @@ impl<GEM: Gem> EthInner<GEM> {
        );

        let macaddr_msbs =
-            (u16::from(macaddr[0]) << 8) |
-            u16::from(macaddr[1]);
+            (u16::from(macaddr[5]) << 8) |
+            u16::from(macaddr[4]);
        let macaddr_lsbs =
-            (u32::from(macaddr[2]) << 24) |
-            (u32::from(macaddr[3]) << 16) |
-            (u32::from(macaddr[4]) << 8) |
-            u32::from(macaddr[5]);
-        GEM::regs().spec_addr1_top.write(
-            regs::SpecAddrTop::zeroed()
-                .addr_msbs(macaddr_msbs)
-        );
+            (u32::from(macaddr[3]) << 24) |
+            (u32::from(macaddr[2]) << 16) |
+            (u32::from(macaddr[1]) << 8) |
+            u32::from(macaddr[0]);
+        // writing to bot would disable the specific address
        GEM::regs().spec_addr1_bot.write(
            regs::SpecAddrBot::zeroed()
                .addr_lsbs(macaddr_lsbs)
        );
-
+        // writing to top would enable it again
+        GEM::regs().spec_addr1_top.write(
+            regs::SpecAddrTop::zeroed()
+                .addr_msbs(macaddr_msbs)
+        );

        GEM::regs().dma_cfg.write(
            regs::DmaCfg::zeroed()
@ -595,13 +622,7 @@ impl<GEM: Gem> EthInner<GEM> {
    }


-    fn check_link_change(&mut self, phy: &Phy) {
-        // As the PHY access takes some time, exit early if there was
-        // already a link. TODO: check once per second.
-        if self.link.is_some() {
-            return
-        }
-
+    fn check_link_change(&mut self, phy: &Phy) -> Option<Option<phy::Link>> {
        let link = phy.get_link(self);

        // Check link state transition
@ -633,6 +654,9 @@ impl<GEM: Gem> EthInner<GEM> {
            }

            self.link = link;
+            Some(link)
+        } else {
+            None
        }
    }
 }
--- a/libboard_zynq/src/eth/phy/mod.rs
+++ b/libboard_zynq/src/eth/phy/mod.rs
@ -1,5 +1,4 @@
 pub mod id;
-use id::{identify_phy, PhyIdentifier};
 mod status;
 pub use status::Status;
 mod control;
@ -7,7 +6,7 @@ pub use control::Control;
 mod pssr;
 pub use pssr::PSSR;

-#[derive(Clone, Debug, PartialEq)]
+#[derive(Copy, Clone, Debug, PartialEq)]
 pub struct Link {
    pub speed: LinkSpeed,
    pub duplex: LinkDuplex,
@ -31,110 +30,154 @@ pub trait PhyAccess {
    fn write_phy(&mut self, addr: u8, reg: u8, data: u16);
 }

-#[derive(Clone)]
-pub struct Phy {
-    pub addr: u8,
-    device: PhyDevice,
-}
-
-#[derive(Clone, Copy)]
-pub enum PhyDevice {
-    Marvell88E1116R,
-    Rtl8211E,
-}
-
-const OUI_MARVELL: u32 = 0x005043;
-const OUI_REALTEK: u32 = 0x000732;
-
-impl Phy {
-    /// Probe all addresses on MDIO for a known PHY
-    pub fn find<PA: PhyAccess>(pa: &mut PA) -> Option<Phy> {
-        (1..32).filter_map(|addr| {
-            match identify_phy(pa, addr) {
-                Some(PhyIdentifier {
-                    oui: OUI_MARVELL,
-                    model: 36,
-                    ..
-                }) => Some(PhyDevice::Marvell88E1116R),
-                Some(PhyIdentifier {
-                    oui: OUI_REALTEK,
-                    model: 0b010001,
-                    rev: 0b0101,
-                }) => Some(PhyDevice::Rtl8211E),
-                _ => None,
-            }.map(|device| Phy { addr, device })
-        }).next()
-    }
-
-    pub fn name(&self) -> &'static str {
-        match self.device {
-            PhyDevice::Marvell88E1116R => &"Marvell 88E1116R",
-            PhyDevice::Rtl8211E => &"RTL8211E",
-        }
-    }
-
-    pub fn read_reg<PA, PR>(&self, pa: &mut PA) -> PR
-    where
-        PA: PhyAccess,
-        PR: PhyRegister + From<u16>,
-    {
-        pa.read_phy(self.addr, PR::addr()).into()
-    }
-
-    pub fn modify_reg<PA, PR, F>(&self, pa: &mut PA, mut f: F)
-    where
-        PA: PhyAccess,
-        PR: PhyRegister + From<u16> + Into<u16>,
-        F: FnMut(PR) -> PR,
-    {
-        let reg = pa.read_phy(self.addr, PR::addr()).into();
-        let reg = f(reg);
-        pa.write_phy(self.addr, PR::addr(), reg.into())
-    }
-
-    pub fn modify_control<PA, F>(&self, pa: &mut PA, f: F)
-    where
-        PA: PhyAccess,
-        F: FnMut(Control) -> Control,
-    {
-        self.modify_reg(pa, f)
-    }
-
-    pub fn get_control<PA: PhyAccess>(&self, pa: &mut PA) -> Control {
-        self.read_reg(pa)
-    }
-
-    pub fn get_status<PA: PhyAccess>(&self, pa: &mut PA) -> Status {
-        self.read_reg(pa)
-    }
-
-    pub fn get_link<PA: PhyAccess>(&self, pa: &mut PA) -> Option<Link> {
-        let status = self.get_status(pa);
-        if !status.link_status() {
-            None
-        } else if status.cap_1000base_t_extended_status() {
-            let phy_status: PSSR = self.read_reg(pa);
-            phy_status.get_link()
-        } else {
-            status.get_link()
-        }
-    }
-
-    pub fn reset<PA: PhyAccess>(&self, pa: &mut PA) {
-        self.modify_control(pa, |control|
-            control.set_reset(true)
-        );
-        while self.get_control(pa).reset() {}
-    }
-
-    pub fn restart_autoneg<PA: PhyAccess>(&self, pa: &mut PA) {
-        self.modify_control(pa, |control|
-            control.set_autoneg_enable(true)
-                .set_restart_autoneg(true)
-        );
-    }
-}
-
 pub trait PhyRegister {
    fn addr() -> u8;
 }
+
+#[cfg(not(feature = "target_kasli_soc"))]
+mod phy_impl {
+    use super::*;
+    use id::{identify_phy, PhyIdentifier};
+
+    #[derive(Clone)]
+    pub struct Phy {
+        pub addr: u8,
+    }
+
+    const OUI_MARVELL: u32 = 0x005043;
+    const OUI_REALTEK: u32 = 0x000732;
+    const OUI_LANTIQ : u32 = 0x355969;
+
+    impl Phy {
+        /// Probe all addresses on MDIO for a known PHY
+        pub fn find<PA: PhyAccess>(pa: &mut PA) -> Option<Phy> {
+            (1..32).find(|addr| {
+                match identify_phy(pa, *addr) {
+                    Some(PhyIdentifier {
+                        oui: OUI_MARVELL,
+                        // Marvell 88E1116R
+                        model: 36,
+                        ..
+                    }) => true,
+                    Some(PhyIdentifier {
+                        oui: OUI_MARVELL,
+                        // Marvell 88E1512
+                        model: 29,
+                        ..
+                    }) => true,
+                    Some(PhyIdentifier {
+                        oui: OUI_REALTEK,
+                        // RTL 8211E
+                        model: 0b010001,
+                        rev: 0b0101,
+                    }) => true,
+                    Some(PhyIdentifier {
+                        oui: OUI_LANTIQ,
+                        // Intel XWAY PHY11G (PEF 7071/PEF 7072) v1.5 / v1.6
+                        model: 0,
+                        ..
+                    }) => true,
+                    _ => false,
+                }
+            }).map(|addr| Phy { addr })
+        }
+
+        pub fn read_reg<PA, PR>(&self, pa: &mut PA) -> PR
+        where
+            PA: PhyAccess,
+            PR: PhyRegister + From<u16>,
+        {
+            pa.read_phy(self.addr, PR::addr()).into()
+        }
+
+        pub fn modify_reg<PA, PR, F>(&self, pa: &mut PA, mut f: F)
+        where
+            PA: PhyAccess,
+            PR: PhyRegister + From<u16> + Into<u16>,
+            F: FnMut(PR) -> PR,
+        {
+            let reg = pa.read_phy(self.addr, PR::addr()).into();
+            let reg = f(reg);
+            pa.write_phy(self.addr, PR::addr(), reg.into())
+        }
+
+        pub fn modify_control<PA, F>(&self, pa: &mut PA, f: F)
+        where
+            PA: PhyAccess,
+            F: FnMut(Control) -> Control,
+        {
+            self.modify_reg(pa, f)
+        }
+
+        pub fn get_control<PA: PhyAccess>(&self, pa: &mut PA) -> Control {
+            self.read_reg(pa)
+        }
+
+        pub fn get_status<PA: PhyAccess>(&self, pa: &mut PA) -> Status {
+            self.read_reg(pa)
+        }
+
+        pub fn get_link<PA: PhyAccess>(&self, pa: &mut PA) -> Option<Link> {
+            let status = self.get_status(pa);
+            if !status.link_status() {
+                None
+            } else if status.cap_1000base_t_extended_status() {
+                let phy_status: PSSR = self.read_reg(pa);
+                phy_status.get_link()
+            } else {
+                status.get_link()
+            }
+        }
+
+        pub fn reset<PA: PhyAccess>(&self, pa: &mut PA) {
+            self.modify_control(pa, |control|
+                control.set_reset(true)
+            );
+            while self.get_control(pa).reset() {}
+        }
+
+        pub fn restart_autoneg<PA: PhyAccess>(&self, pa: &mut PA) {
+            self.modify_control(pa, |control|
+                control.set_autoneg_enable(true)
+                    .set_restart_autoneg(true)
+            );
+        }
+    }
+}
+
+#[cfg(feature = "target_kasli_soc")]
+mod phy_impl {
+    use super::*;
+
+    #[derive(Clone)]
+    pub struct Phy {
+    }
+
+    impl Phy {
+        pub fn find<PA: PhyAccess>(_pa: &mut PA) -> Option<Phy> {
+            Some(Phy {})
+        }
+
+        pub fn get_link<PA: PhyAccess>(&self, _pa: &mut PA) -> Option<Link> {
+            Some(Link {
+                speed: LinkSpeed::S1000,
+                duplex: LinkDuplex::Full,
+            })
+        }
+
+        pub fn modify_control<PA, F>(&self, _pa: &mut PA, _f: F)
+        where
+            PA: PhyAccess,
+            F: FnMut(Control) -> Control,
+        {
+        }
+
+        pub fn reset<PA: PhyAccess>(&self, _pa: &mut PA) {
+        }
+
+        pub fn restart_autoneg<PA: PhyAccess>(&self, _pa: &mut PA) {
+        }
+    }
+}
+
+pub use phy_impl::*;
--- a/libboard_zynq/src/eth/regs.rs
+++ b/libboard_zynq/src/eth/regs.rs
@ -1,6 +1,6 @@
 use volatile_register::{RO, WO, RW};

-use libregister::{register, register_bit, register_bits, register_bits_typed};
+use libregister::{register, register_at, register_bit, register_bits, register_bits_typed};

 #[repr(C)]
 pub struct RegisterBlock {
@ -110,18 +110,8 @@ pub struct RegisterBlock {
    pub design_cfg5: RO<u32>,
 }

-impl RegisterBlock {
-    const GEM0: *mut Self = 0xE000B000 as *mut _;
-    const GEM1: *mut Self = 0xE000C000 as *mut _;
-
-    pub fn gem0() -> &'static mut Self {
-        unsafe { &mut *Self::GEM0 }
-    }
-
-    pub fn gem1() -> &'static mut Self {
-        unsafe { &mut *Self::GEM1 }
-    }
-}
+register_at!(RegisterBlock, 0xE000B000, gem0);
+register_at!(RegisterBlock, 0xE000C000, gem1);

 register!(net_ctrl, NetCtrl, RW, u32);
 register_bit!(net_ctrl, loopback_local, 1);
--- a/libboard_zynq/src/eth/rx.rs
+++ b/libboard_zynq/src/eth/rx.rs
@ -108,6 +108,20 @@ impl DescList {
        if entry.word0.read().used() {
            let word1 = entry.word1.read();
            let len = word1.frame_length_lsbs().into();
+            let padding = {
+                let diff = len % 0x20;
+                if diff == 0 {
+                    0
+                } else {
+                    0x20 - diff
+                }
+            };
+            unsafe {
+                // invalidate the buffer
+                // we cannot do it in the drop function, as L2 cache data prefetch would prefetch
+                // the data, and there is no way for us to prevent that unless changing MMU table.
+                dci_slice(&mut self.buffers[self.next][0..len + padding]);
+            }
            let buffer = &mut self.buffers[self.next][0..len];

            self.next += 1;
@ -135,10 +149,6 @@ pub struct PktRef<'a> {

 impl<'a> Drop for PktRef<'a> {
    fn drop(&mut self) {
-        // Flush buffer from cache, to be filled by the peripheral
-        // before next read
-        dcci_slice(self.buffer);
-
        self.entry.word0.modify(|_, w| w.used(false));
        dmb();
    }
--- a/libboard_zynq/src/eth/tx.rs
+++ b/libboard_zynq/src/eth/tx.rs
@ -132,10 +132,8 @@ impl<'a> Drop for PktRef<'a> {
        dcc_slice(self.buffer);

        self.entry.word1.modify(|_, w| w.used(false));
-        if ! self.regs.tx_status.read().tx_go() {
-            // Start TX if not already running
-            self.regs.net_ctrl.modify(|_, w| w.start_tx(true));
-        }
+        // Start the TX engine
+        self.regs.net_ctrl.modify(|_, w| w.start_tx(true));
    }
 }

@ -166,10 +164,7 @@ impl<'a> smoltcp::phy::TxToken for Token<'a> {
            None =>
                Err(smoltcp::Error::Exhausted),
            Some(mut pktref) => {
-                let result = f(pktref.deref_mut());
-                // TODO: on result.is_err() don;t send
-                drop(pktref);
-                result
+                f(pktref.deref_mut())
            }
        }
    }
--- a/libboard_zynq/src/flash/bytes.rs
+++ b/libboard_zynq/src/flash/bytes.rs
@ -1,41 +0,0 @@
-pub trait BytesTransferExt: Sized {
-    // Turn u32 into u8
-    fn bytes_transfer(self) -> BytesTransfer<Self>
-    where
-        Self: Iterator<Item = u32>;
-}
-
-impl<I: Iterator<Item = u32>> BytesTransferExt for I {
-    // Turn u32 into u8
-    fn bytes_transfer(self) -> BytesTransfer<Self> {
-        BytesTransfer {
-            iter: self,
-            shift: 0,
-            word: 0,
-        }
-    }
-}
-
-pub struct BytesTransfer<I: Iterator<Item = u32> + Sized> {
-    iter: I,
-    shift: u8,
-    word: u32,
-}
-
-impl<I: Iterator<Item = u32> + Sized> Iterator for BytesTransfer<I> {
-    type Item = u8;
-
-    fn next(&mut self) -> Option<u8> {
-        if self.shift > 0 {
-            self.shift -= 8;
-            Some((self.word >> self.shift) as u8)
-        } else {
-            self.iter.next()
-                .and_then(|word| {
-                    self.shift = 32;
-                    self.word = word;
-                    self.next()
-                })
-        }
-    }
-}
--- a/libboard_zynq/src/flash/mod.rs
+++ b/libboard_zynq/src/flash/mod.rs
@ -1,503 +0,0 @@
-//! Quad-SPI Flash Controller
-
-use core::marker::PhantomData;
-use log::{error, info, warn};
-use libregister::{RegisterR, RegisterW, RegisterRW};
-use crate::{print, println};
-use super::slcr;
-use super::clocks::source::{IoPll, ClockSource};
-
-mod regs;
-mod bytes;
-pub use bytes::{BytesTransferExt, BytesTransfer};
-mod spi_flash_register;
-use spi_flash_register::*;
-mod transfer;
-use transfer::Transfer;
-
-const FLASH_BAUD_RATE: u32 = 50_000_000;
-/// 16 MB
-pub const SINGLE_CAPACITY: u32 = 0x1000000;
-pub const SECTOR_SIZE: u32 = 0x10000;
-pub const PAGE_SIZE: u32 = 0x100;
-
-/// Instruction: Read Identification
-const INST_RDID: u8 = 0x9F;
-/// Instruction: Read
-const INST_READ: u8 = 0x03;
-/// Instruction: Quad I/O Fast Read
-const INST_4IO_FAST_READ: u8 = 0xEB;
-/// Instruction: Write Disable
-const INST_WRDI: u8 = 0x04;
-/// Instruction: Write Enable
-const INST_WREN: u8 = 0x06;
-/// Instruction: Program page
-const INST_PP: u8 = 0x02;
-/// Instruction: Erase 4K Block
-const INST_BE_4K: u8 = 0x20;
-
-#[derive(Clone)]
-pub enum SpiWord {
-    W8(u8),
-    W16(u16),
-    W24(u32),
-    W32(u32),
-}
-
-impl From<u8> for SpiWord {
-    fn from(x: u8) -> Self {
-        SpiWord::W8(x)
-    }
-}
-
-impl From<u16> for SpiWord {
-    fn from(x: u16) -> Self {
-        SpiWord::W16(x)
-    }
-}
-
-impl From<u32> for SpiWord {
-    fn from(x: u32) -> Self {
-        SpiWord::W32(x)
-    }
-}
-
-/// Memory-mapped mode
-pub struct LinearAddressing;
-/// Manual I/O mode
-pub struct Manual;
-
-/// Flash Interface Driver
-///
-/// For 2x Spansion S25FL128SAGMFIR01
-pub struct Flash<MODE> {
-    regs: &'static mut regs::RegisterBlock,
-    _mode: PhantomData<MODE>,
-}
-
-impl<MODE> Flash<MODE> {
-    fn transition<TO>(self) -> Flash<TO> {
-        Flash {
-            regs: self.regs,
-            _mode: PhantomData,
-        }
-    }
-
-    fn disable_interrupts(&mut self) {
-        self.regs.intr_dis.write(
-            regs::IntrDis::zeroed()
-                .rx_overflow(true)
-                .tx_fifo_not_full(true)
-                .tx_fifo_full(true)
-                .rx_fifo_not_empty(true)
-                .rx_fifo_full(true)
-                .tx_fifo_underflow(true)
-        );
-    }
-
-    fn clear_rx_fifo(&self) {
-        while self.regs.intr_status.read().rx_fifo_not_empty() {
-            let _ = self.regs.rx_data.read();
-        }
-    }
-
-    fn clear_interrupt_status(&mut self) {
-        self.regs.intr_status.write(
-            regs::IntrStatus::zeroed()
-                .rx_overflow(true)
-                .tx_fifo_underflow(true)
-        );
-    }
-
-    fn wait_tx_fifo_flush(&mut self) {
-        self.regs.config.modify(|_, w| w.man_start_com(true));
-        while !self.regs.intr_status.read().tx_fifo_not_full() {}
-    }
-}
-
-impl Flash<()> {
-    pub fn new(clock: u32) -> Self {
-        Self::enable_clocks(clock);
-        Self::setup_signals();
-        Self::reset();
-
-        let regs = regs::RegisterBlock::qspi();
-        let mut flash = Flash { regs, _mode: PhantomData };
-        flash.configure((FLASH_BAUD_RATE - 1 + clock) / FLASH_BAUD_RATE);
-        flash
-    }
-
-    /// typical: `200_000_000` Hz
-    fn enable_clocks(clock: u32) {
-        let io_pll = IoPll::freq();
-        let divisor = ((clock - 1 + io_pll) / clock)
-            .max(1).min(63) as u8;
-
-        slcr::RegisterBlock::unlocked(|slcr| {
-            slcr.lqspi_clk_ctrl.write(
-                slcr::LqspiClkCtrl::zeroed()
-                    .src_sel(slcr::PllSource::IoPll)
-                    .divisor(divisor)
-                    .clkact(true)
-            );
-        });
-    }
-
-    fn setup_signals() {
-        slcr::RegisterBlock::unlocked(|slcr| {
-            // 1. Configure MIO pin 1 for chip select 0 output.
-            slcr.mio_pin_01.write(
-                slcr::MioPin01::zeroed()
-                    .l0_sel(true)
-                    .io_type(slcr::IoBufferType::Lvcmos18)
-                    .pullup(true)
-            );
-
-            // Configure MIO pins 2 through 5 for I/O.
-            slcr.mio_pin_02.write(
-                slcr::MioPin02::zeroed()
-                    .l0_sel(true)
-                    .io_type(slcr::IoBufferType::Lvcmos18)
-            );
-            slcr.mio_pin_03.write(
-                slcr::MioPin03::zeroed()
-                    .l0_sel(true)
-                    .io_type(slcr::IoBufferType::Lvcmos18)
-            );
-            slcr.mio_pin_04.write(
-                slcr::MioPin04::zeroed()
-                    .l0_sel(true)
-                    .io_type(slcr::IoBufferType::Lvcmos18)
-            );
-            slcr.mio_pin_05.write(
-                slcr::MioPin05::zeroed()
-                    .l0_sel(true)
-                    .io_type(slcr::IoBufferType::Lvcmos18)
-            );
-
-            // 3. Configure MIO pin 6 for serial clock 0 output.
-            slcr.mio_pin_06.write(
-                slcr::MioPin06::zeroed()
-                    .l0_sel(true)
-                    .io_type(slcr::IoBufferType::Lvcmos18)
-            );
-
-            // Option: Add Second Device Chip Select
-            // 4. Configure MIO pin 0 for chip select 1 output.
-            slcr.mio_pin_00.write(
-                slcr::MioPin00::zeroed()
-                    .l0_sel(true)
-                    .io_type(slcr::IoBufferType::Lvcmos18)
-            );
-
-            // Option: Add Second Serial Clock
-            // 5. Configure MIO pin 9 for serial clock 1 output.
-            slcr.mio_pin_09.write(
-                slcr::MioPin09::zeroed()
-                    .l0_sel(true)
-                    .io_type(slcr::IoBufferType::Lvcmos18)
-                    .pullup(true)
-            );
-
-            // Option: Add 4-bit Data
-            // 6. Configure MIO pins 10 through 13 for I/O.
-            slcr.mio_pin_10.write(
-                slcr::MioPin10::zeroed()
-                    .l0_sel(true)
-                    .io_type(slcr::IoBufferType::Lvcmos18)
-                    .pullup(true)
-            );
-            slcr.mio_pin_11.write(
-                slcr::MioPin11::zeroed()
-                    .l0_sel(true)
-                    .io_type(slcr::IoBufferType::Lvcmos18)
-                    .pullup(true)
-            );
-            slcr.mio_pin_12.write(
-                slcr::MioPin12::zeroed()
-                    .l0_sel(true)
-                    .io_type(slcr::IoBufferType::Lvcmos18)
-                    .pullup(true)
-            );
-            slcr.mio_pin_13.write(
-                slcr::MioPin13::zeroed()
-                    .l0_sel(true)
-                    .io_type(slcr::IoBufferType::Lvcmos18)
-                    .pullup(true)
-            );
-
-            // Option: Add Feedback Output Clock
-            // 7. Configure MIO pin 8 for feedback clock.
-            slcr.mio_pin_08.write(
-                slcr::MioPin08::zeroed()
-                    .l0_sel(true)
-                    .io_type(slcr::IoBufferType::Lvcmos18)
-                    .pullup(true)
-            );
-        });
-    }
-
-    fn reset() {
-        slcr::RegisterBlock::unlocked(|slcr| {
-            slcr.lqspi_rst_ctrl.write(
-                slcr::LqspiRstCtrl::zeroed()
-                    .ref_rst(true)
-                    .cpu1x_rst(true)
-            );
-            slcr.lqspi_rst_ctrl.write(
-                slcr::LqspiRstCtrl::zeroed()
-            );
-        });
-    }
-
-    fn configure(&mut self, divider: u32) {
-        // Disable
-        self.regs.enable.write(
-            regs::Enable::zeroed()
-        );
-        self.disable_interrupts();
-        self.regs.lqspi_cfg.write(
-            regs::LqspiCfg::zeroed()
-        );
-        self.clear_rx_fifo();
-        self.clear_interrupt_status();
-
-        // for a baud_rate_div=1 LPBK_DLY_ADJ would be required
-        let mut baud_rate_div = 2u32;
-        while baud_rate_div < 7 && 2u32.pow(1 + baud_rate_div) < divider {
-            baud_rate_div += 1;
-        }
-
-        self.regs.config.write(regs::Config::zeroed()
-            .baud_rate_div(baud_rate_div as u8)
-            .mode_sel(true)
-            .leg_flsh(true)
-            .holdb_dr(true)
-            // 32 bits TX FIFO width
-            .fifo_width(0b11)
-        );
-
-        // Initialize RX/TX pipes thresholds
-        unsafe {
-            self.regs.rx_thres.write(1);
-            self.regs.tx_thres.write(1);
-        }
-    }
-
-    pub fn linear_addressing_mode(self) -> Flash<LinearAddressing> {
-        // Set manual start enable to auto mode.
-        // Assert the chip select.
-        self.regs.config.modify(|_, w| w
-            .man_start_en(false)
-            .pcs(false)
-            .manual_cs(false)
-        );
-
-        self.regs.lqspi_cfg.write(regs::LqspiCfg::zeroed()
-            // Quad I/O Fast Read
-            .inst_code(INST_4IO_FAST_READ)
-            .dummy_mask(0x2)
-            .mode_en(false)
-            .mode_bits(0xFF)
-            // 2 devices
-            .two_mem(true)
-            .u_page(false)
-            // Quad SPI mode
-            .lq_mode(true)
-        );
-
-        self.regs.enable.write(
-            regs::Enable::zeroed()
-                .spi_en(true)
-        );
-
-        self.transition()
-    }
-
-    pub fn manual_mode(self, chip_index: usize) -> Flash<Manual> {
-        self.regs.config.modify(|_, w| w
-            .man_start_en(true)
-            .manual_cs(true)
-            .endian(true)
-        );
-
-        self.regs.lqspi_cfg.write(regs::LqspiCfg::zeroed()
-            // Quad I/O Fast Read
-            .inst_code(INST_READ)
-            .dummy_mask(0x2)
-            .mode_en(false)
-            .mode_bits(0xFF)
-            // 2 devices
-            .two_mem(true)
-            .u_page(chip_index != 0)
-            // Quad SPI mode
-            .lq_mode(false)
-        );
-
-        self.transition()
-    }
-}
-
-impl Flash<LinearAddressing> {
-    /// Stop linear addressing mode
-    pub fn stop(self) -> Flash<()> {
-        self.regs.enable.modify(|_, w| w.spi_en(false));
-        // De-assert chip select.
-        self.regs.config.modify(|_, w| w.pcs(true));
-
-        self.transition()
-    }
-
-    pub fn ptr<T>(&mut self) -> *mut T {
-        0xFC00_0000 as *mut _
-    }
-
-    pub fn size(&self) -> usize {
-        2 * (SINGLE_CAPACITY as usize)
-    }
-}
-
-impl Flash<Manual> {
-    pub fn stop(self) -> Flash<()> {
-        self.transition()
-    }
-
-    pub fn read_reg<R: SpiFlashRegister>(&mut self) -> R {
-        let args = Some(R::inst_code());
-        let transfer = self.transfer(args.into_iter(), 2)
-            .bytes_transfer();
-        R::new(transfer.skip(1).next().unwrap())
-    }
-
-    pub fn read_reg_until<R, F, A>(&mut self, f: F) -> A
-    where
-        R: SpiFlashRegister,
-        F: Fn(R) -> Option<A>,
-    {
-        let mut result = None;
-        while result.is_none() {
-            let args = Some(R::inst_code());
-            for b in self.transfer(args.into_iter(), 32)
-                .bytes_transfer().skip(1) {
-                    result = f(R::new(b));
-                    
-                    if result.is_none() {
-                        break;
-                    }
-                }
-        }
-        result.unwrap()
-    }
-
-    /// Status Register-1 remains `0x00` immediately after invoking a command.
-    fn wait_while_sr1_zeroed(&mut self) -> SR1 {
-        self.read_reg_until::<SR1, _, SR1>(|sr1|
-            if sr1.is_zeroed() {
-                None
-            } else {
-                Some(sr1)
-            }
-        )
-    }
-
-    /// Read Identification
-    pub fn rdid(&mut self) -> core::iter::Skip<BytesTransfer<Transfer<core::option::IntoIter<u32>, u32>>> {
-        let args = Some((INST_RDID as u32) << 24);
-        self.transfer(args.into_iter(), 0x44)
-            .bytes_transfer().skip(1)
-    }
-
-    /// Read flash data
-    pub fn read(&mut self, offset: u32, len: usize
-    ) -> core::iter::Take<core::iter::Skip<BytesTransfer<Transfer<core::option::IntoIter<u32>, u32>>>>
-    {
-        let args = Some(((INST_READ as u32) << 24) | (offset as u32));
-        self.transfer(args.into_iter(), len + 6)
-            .bytes_transfer().skip(6).take(len)
-    }
-
-    pub fn erase(&mut self, offset: u32) {
-        let args = Some(((INST_BE_4K as u32) << 24) | (offset as u32));
-        self.transfer(args.into_iter(), 4);
-
-        let sr1 = self.wait_while_sr1_zeroed();
-
-        if sr1.e_err() {
-            error!("E_ERR");
-        } else if sr1.p_err() {
-            error!("P_ERR");
-        } else if sr1.wip() {
-            info!("Erase in progress");
-            while self.read_reg::<SR1>().wip() {
-                print!(".");
-            }
-            println!("");
-        } else {
-            warn!("erased? sr1={:02X}", sr1.inner);
-        }
-    }
-
-    pub fn program<I: Iterator<Item=u32>>(&mut self, offset: u32, data: I) {
-        {
-            let len = 4 + 4 * data.size_hint().0;
-            let args = Some(SpiWord::W32(((INST_PP as u32) << 24) | (offset as u32))).into_iter()
-                .chain(data.map(SpiWord::W32));
-            self.transfer(args, len);
-        }
-
-        // let sr1 = self.wait_while_sr1_zeroed();
-        let sr1 = self.read_reg::<SR1>();
-
-        if sr1.e_err() {
-            error!("E_ERR");
-        } else if sr1.p_err() {
-            error!("P_ERR");
-        } else if sr1.wip() {
-            info!("Program in progress");
-            while self.read_reg::<SR1>().wip() {
-                print!(".");
-            }
-            println!("");
-        } else {
-            warn!("programmed? sr1={:02X}", sr1.inner);
-        }
-    }
-
-    pub fn write_enabled<F: Fn(&mut Self) -> R, R>(&mut self, f: F) -> R {
-        // Write Enable
-        let args = Some(INST_WREN);
-        self.transfer(args.into_iter(), 1);
-        self.regs.gpio.modify(|_, w| w.wp_n(true));
-        let sr1 = self.wait_while_sr1_zeroed();
-        if !sr1.wel() {
-            panic!("Cannot write-enable flash");
-        }
-
-        let result = f(self);
-
-        // Write Disable
-        let args = Some(INST_WRDI);
-        self.transfer(args.into_iter(), 1);
-        self.regs.gpio.modify(|_, w| w.wp_n(false));
-
-        result
-    }
-
-    pub fn transfer<'s: 't, 't, Args, W>(&'s mut self, args: Args, len: usize) -> Transfer<'t, Args, W>
-    where
-        Args: Iterator<Item = W>,
-        W: Into<SpiWord>,
-    {
-        Transfer::new(self, args, len)
-    }
-
-    pub fn dump(&mut self, label: &'_ str, inst_code: u8) {
-        print!("{}:", label);
-
-        let args = Some(u32::from(inst_code) << 24);
-        for b in self.transfer(args.into_iter(), 32).bytes_transfer() {
-            print!(" {:02X}", b);
-        }
-        println!("");
-    }
-}
--- a/libboard_zynq/src/flash/regs.rs
+++ b/libboard_zynq/src/flash/regs.rs
@ -1,126 +0,0 @@
-use volatile_register::{RO, WO, RW};
-
-use libregister::{register, register_bit, register_bits};
-
-#[repr(C)]
-pub struct RegisterBlock {
-    pub config: Config,
-    pub intr_status: IntrStatus,
-    pub intr_en: IntrEn,
-    pub intr_dis: IntrDis,
-    pub intr_mask: RO<u32>,
-    pub enable: Enable,
-    pub delay: RW<u32>,
-    pub txd0: WO<u32>,
-    pub rx_data: RO<u32>,
-    pub slave_idle_count: RW<u32>,
-    pub tx_thres: RW<u32>,
-    pub rx_thres: RW<u32>,
-    pub gpio: QspiGpio,
-    pub _unused1: RO<u32>,
-    pub lpbk_dly_adj: RW<u32>,
-    pub _unused2: [RO<u32>; 17],
-    pub txd1: WO<u32>,
-    pub txd2: WO<u32>,
-    pub txd3: WO<u32>,
-    pub _unused3: [RO<u32>; 5],
-    pub lqspi_cfg: LqspiCfg,
-    pub lqspi_sts: RW<u32>,
-    pub _unused4: [RO<u32>; 21],
-    pub mod_id: RW<u32>,
-}
-
-impl RegisterBlock {
-    const BASE_ADDRESS: *mut Self = 0xE000D000 as *mut _;
-
-    pub fn qspi() -> &'static mut Self {
-        unsafe { &mut *Self::BASE_ADDRESS }
-    }
-}
-
-register!(config, Config, RW, u32);
-register_bit!(config,
-              /// Enables master mode
-              mode_sel, 0);
-register_bit!(config,
-              /// Clock polarity low/high
-              clk_pol, 1);
-register_bit!(config,
-              /// Clock phase
-              clk_ph, 2);
-register_bits!(config,
-               /// divider = 2 ** (1 + baud_rate_div)
-               baud_rate_div, u8, 3, 5);
-register_bits!(config,
-               /// Must be set to 0b11
-               fifo_width, u8, 6, 7);
-register_bit!(config,
-              /// Must be 0
-              ref_clk, 8);
-register_bit!(config,
-              /// Peripheral Chip Select Line
-              pcs, 10);
-register_bit!(config,
-              /// false: auto mode, true: manual CS mode
-              manual_cs, 14);
-register_bit!(config,
-              /// false: auto mode, true: enables manual start enable
-              man_start_en, 15);
-register_bit!(config,
-              /// false: auto mode, true: enables manual start command
-              man_start_com, 16);
-register_bit!(config, holdb_dr, 19);
-register_bit!(config,
-              /// false: little, true: endian
-              endian, 26);
-register_bit!(config,
-              /// false: legacy SPI mode, true: Flash memory interface mode
-              leg_flsh, 31);
-
-register!(intr_status, IntrStatus, RW, u32);
-register_bit!(intr_status, rx_overflow, 0);
-register_bit!(intr_status,
-              /// < tx_thres
-              tx_fifo_not_full, 2);
-register_bit!(intr_status, tx_fifo_full, 3);
-register_bit!(intr_status,
-              /// >= rx_thres
-              rx_fifo_not_empty, 4);
-register_bit!(intr_status, rx_fifo_full, 5);
-register_bit!(intr_status, tx_fifo_underflow, 6);
-
-register!(intr_en, IntrEn, WO, u32);
-register_bit!(intr_en, rx_overflow, 0);
-register_bit!(intr_en, tx_fifo_not_full, 2);
-register_bit!(intr_en, tx_fifo_full, 3);
-register_bit!(intr_en, rx_fifo_not_empty, 4);
-register_bit!(intr_en, rx_fifo_full, 5);
-register_bit!(intr_en, tx_fifo_underflow, 6);
-
-register!(intr_dis, IntrDis, WO, u32);
-register_bit!(intr_dis, rx_overflow, 0);
-register_bit!(intr_dis, tx_fifo_not_full, 2);
-register_bit!(intr_dis, tx_fifo_full, 3);
-register_bit!(intr_dis, rx_fifo_not_empty, 4);
-register_bit!(intr_dis, rx_fifo_full, 5);
-register_bit!(intr_dis, tx_fifo_underflow, 6);
-
-register!(enable, Enable, RW, u32);
-register_bit!(enable, spi_en, 0);
-
-// named to avoid confusion with normal gpio
-register!(qspi_gpio, QspiGpio, RW, u32);
-register_bit!(qspi_gpio,
-              /// Write protect pin (inverted)
-              wp_n, 0);
-
-register!(lqspi_cfg, LqspiCfg, RW, u32);
-register_bits!(lqspi_cfg, inst_code, u8, 0, 7);
-register_bits!(lqspi_cfg, dummy_mask, u8, 8, 10);
-register_bits!(lqspi_cfg, mode_bits, u8, 16, 23);
-register_bit!(lqspi_cfg, mode_on, 24);
-register_bit!(lqspi_cfg, mode_en, 25);
-register_bit!(lqspi_cfg, u_page, 28);
-register_bit!(lqspi_cfg, sep_bus, 29);
-register_bit!(lqspi_cfg, two_mem, 30);
-register_bit!(lqspi_cfg, lq_mode, 31);
--- a/libboard_zynq/src/flash/spi_flash_register.rs
+++ b/libboard_zynq/src/flash/spi_flash_register.rs
@ -1,62 +0,0 @@
-use bit_field::BitField;
-
-pub trait SpiFlashRegister {
-    fn inst_code() -> u8;
-    fn new(src: u8) -> Self;
-}
-
-macro_rules! u8_register {
-    ($name: ident, $doc: tt, $inst_code: expr) => {
-        #[derive(Clone)]
-        #[doc=$doc]
-        pub struct $name {
-            pub inner: u8,
-        }
-
-        impl SpiFlashRegister for $name {
-            fn inst_code() -> u8 {
-                $inst_code
-            }
-
-            fn new(src: u8) -> Self {
-                $name {
-                    inner: src,
-                }
-            }
-        }
-
-        impl $name {
-            #[allow(unused)]
-            pub fn is_zeroed(&self) -> bool {
-                self.inner == 0
-            }
-        }
-    };
-}
-
-u8_register!(CR, "Configuration Register", 0x35);
-u8_register!(SR1, "Status Register-1", 0x05);
-impl SR1 {
-    /// Write In Progress
-    pub fn wip(&self) -> bool {
-        self.inner.get_bit(0)
-    }
-
-    /// Write Enable Latch
-    pub fn wel(&self) -> bool {
-        self.inner.get_bit(1)
-    }
-
-    /// Erase Error Occurred
-    pub fn e_err(&self) -> bool {
-        self.inner.get_bit(5)
-    }
-
-    /// Programming Error Occurred
-    pub fn p_err(&self) -> bool {
-        self.inner.get_bit(6)
-    }
-}
-
-u8_register!(SR2, "Status Register-2", 0x07);
-u8_register!(BA, "Bank Address Register", 0xB9);
--- a/libboard_zynq/src/flash/transfer.rs
+++ b/libboard_zynq/src/flash/transfer.rs
@ -1,125 +0,0 @@
-use libregister::{RegisterR, RegisterW, RegisterRW};
-use super::regs;
-use super::{SpiWord, Flash, Manual};
-
-pub struct Transfer<'a, Args: Iterator<Item = W>, W: Into<SpiWord>> {
-    flash: &'a mut Flash<Manual>,
-    args: Args,
-    sent: usize,
-    received: usize,
-    len: usize,
-}
-
-impl<'a, Args: Iterator<Item = W>, W: Into<SpiWord>> Transfer<'a, Args, W> {
-    pub fn new(flash: &'a mut Flash<Manual>, args: Args, len: usize) -> Self {
-        flash.regs.config.modify(|_, w| w.pcs(false));
-        flash.regs.enable.write(
-            regs::Enable::zeroed()
-                .spi_en(true)
-        );
-
-        let mut xfer = Transfer {
-            flash,
-            args,
-            sent: 0,
-            received: 0,
-            len,
-        };
-        xfer.fill_tx_fifo();
-        xfer.flash.regs.config.modify(|_, w| w.man_start_com(true));
-        xfer
-    }
-
-    fn fill_tx_fifo(&mut self) {
-        while self.sent < self.len && !self.flash.regs.intr_status.read().tx_fifo_full() {
-            let arg = self.args.next()
-                .map(|n| n.into())
-                .unwrap_or(SpiWord::W32(0));
-            match arg {
-                SpiWord::W32(w) => {
-                    // println!("txd0 {:08X}", w);
-                    unsafe {
-                        self.flash.regs.txd0.write(w);
-                    }
-                    self.sent += 4;
-                }
-                // Only txd0 can be used without flushing
-                _ => {
-                    if !self.flash.regs.intr_status.read().tx_fifo_not_full() {
-                        // Flush if necessary
-                        self.flash.wait_tx_fifo_flush();
-                    }
-
-                    match arg {
-                        SpiWord::W8(w) => {
-                            // println!("txd1 {:02X}", w);
-                            unsafe {
-                                self.flash.regs.txd1.write(u32::from(w) << 24);
-                            }
-                            self.sent += 1;
-                        }
-                        SpiWord::W16(w) => {
-                            unsafe {
-                                self.flash.regs.txd2.write(u32::from(w) << 16);
-                            }
-                            self.sent += 2;
-                        }
-                        SpiWord::W24(w) => {
-                            unsafe {
-                                self.flash.regs.txd3.write(w << 8);
-                            }
-                            self.sent += 3;
-                        }
-                        SpiWord::W32(_) => unreachable!(),
-                    }
-
-                    self.flash.wait_tx_fifo_flush();
-                }
-            }
-        }
-    }
-
-    fn can_read(&mut self) -> bool {
-        self.flash.regs.intr_status.read().rx_fifo_not_empty()
-    }
-
-    fn read(&mut self) -> u32 {
-        let rx = self.flash.regs.rx_data.read();
-        self.received += 4;
-        rx
-    }
-}
-
-impl<'a, Args: Iterator<Item = W>, W: Into<SpiWord>> Drop for Transfer<'a, Args, W> {
-    fn drop(&mut self) {
-        // Discard remaining rx_data
-        while self.can_read() {
-            self.read();
-        }
-
-        // Stop
-        self.flash.regs.enable.write(
-            regs::Enable::zeroed()
-                .spi_en(false)
-        );
-        self.flash.regs.config.modify(|_, w| w
-            .pcs(true)
-            .man_start_com(false)
-        );
-    }
-}
-
-impl<'a, Args: Iterator<Item = W>, W: Into<SpiWord>> Iterator for Transfer<'a, Args, W> {
-    type Item = u32;
-
-    fn next<'s>(&'s mut self) -> Option<u32> {
-        if self.received >= self.len {
-            return None;
-        }
-
-        self.fill_tx_fifo();
-
-        while !self.can_read() {}
-        Some(self.read())
-    }
-}
--- a/libboard_zynq/src/gic.rs
+++ b/libboard_zynq/src/gic.rs
@ -62,7 +62,7 @@ pub struct InterruptController {
 }

 impl InterruptController {
-    pub fn new(mpcore: &'static mut mpcore::RegisterBlock) -> Self {
+    pub fn gic(mpcore: &'static mut mpcore::RegisterBlock) -> Self {
        InterruptController { mpcore }
    }

--- a/libboard_zynq/src/i2c/eeprom.rs
+++ b/libboard_zynq/src/i2c/eeprom.rs
@ -1,9 +1,9 @@
-use super::I2C;
+use super::I2c;
 use crate::time::Milliseconds;
 use embedded_hal::timer::CountDown;

 pub struct EEPROM<'a> {
-    i2c: &'a mut I2C,
+    i2c: &'a mut I2c,
    port: u8,
    address: u8,
    page_size: u8,
@ -12,7 +12,7 @@ pub struct EEPROM<'a> {

 impl<'a> EEPROM<'a> {
    #[cfg(feature = "target_zc706")]
-    pub fn new(i2c: &'a mut I2C, page_size: u8) -> Self {
+    pub fn new(i2c: &'a mut I2c, page_size: u8) -> Self {
        EEPROM {
            i2c: i2c,
            port: 2,
@ -22,6 +22,17 @@ impl<'a> EEPROM<'a> {
        }
    }

+    #[cfg(feature = "target_kasli_soc")]
+    pub fn new(i2c: &'a mut I2c, page_size: u8) -> Self {
+        EEPROM {
+            i2c: i2c,
+            port: 3,
+            address: 0x57,
+            page_size: page_size,
+            count_down: unsafe { crate::timer::GlobalTimer::get() }.countdown()
+        }
+    }
+
    #[cfg(feature = "target_zc706")]
    fn select(&mut self) -> Result<(), &'static str> {
        let mask: u16 = 1 << self.port;
@ -29,6 +40,14 @@ impl<'a> EEPROM<'a> {
        Ok(())
    }

+    #[cfg(feature = "target_kasli_soc")]
+    fn select(&mut self) -> Result<(), &'static str> {
+        let mask: u16 = 1 << self.port;
+        // tca9548 is compatible with pca9548
+        self.i2c.pca9548_select(0b1110001, mask as u8)?;
+        Ok(())
+    }
+
    /// Random read
    pub fn read<'r>(&mut self, addr: u8, buf: &'r mut [u8]) -> Result<(), &'static str> {
        self.select()?;
--- a/libboard_zynq/src/i2c/mod.rs
+++ b/libboard_zynq/src/i2c/mod.rs
@ -2,22 +2,19 @@

 mod regs;
 pub mod eeprom;
-use super::clocks::Clocks;
 use super::slcr;
 use super::time::Microseconds;
 use embedded_hal::timer::CountDown;
 use libregister::{RegisterR, RegisterRW, RegisterW};

-const INVALID_BUS: &'static str = "Invalid I2C bus";
-
-pub struct I2C {
-    regs: regs::RegisterWrapper,
+pub struct I2c {
+    regs: regs::RegisterBlock,
    count_down: super::timer::global::CountDown<Microseconds>
 }

-impl I2C {
-    #[cfg(feature = "target_zc706")]
-    pub fn i2c() -> Self {
+impl I2c {
+    #[cfg(any(feature = "target_zc706", feature = "target_kasli_soc"))]
+    pub fn i2c0() -> Self {
        // Route I2C 0 SCL / SDA Signals to MIO Pins 50 / 51
        slcr::RegisterBlock::unlocked(|slcr| {
            // SCL
@ -36,18 +33,28 @@ impl I2C {
                    .pullup(true)
                    .disable_rcvr(true)
            );
+            // On Kasli-SoC prototype, leakage through the unconfigured I2C_SW_RESET
+            // MIO pin develops enough voltage on the T21 gate to assert the reset.
+            // Configure the pin to avoid this problem.
+            #[cfg(feature = "target_kasli_soc")]
+            slcr.mio_pin_33.write(
+                slcr::MioPin33::zeroed()
+                    .l3_sel(0b000)
+                    .io_type(slcr::IoBufferType::Lvcmos33)
+                    .pullup(false)
+                    .disable_rcvr(true)
+            );
            // Reset
            slcr.gpio_rst_ctrl.reset_gpio();
        });

-        Self::ctor_common(0xFFFF - 0x000C)
+        Self::i2c_common(0xFFFF - 0x000C)
    }

-    fn ctor_common(gpio_output_mask: u16) -> Self {
+    fn i2c_common(gpio_output_mask: u16) -> Self {
        // Setup register block
-        let clocks = Clocks::get();
        let self_ = Self {
-            regs: regs::RegisterWrapper::new(),
+            regs: regs::RegisterBlock::i2c(),
            count_down: unsafe { super::timer::GlobalTimer::get() }.countdown()
        };

@ -143,16 +150,18 @@ impl I2C {
        self.sda_oe(true);
        self.half_period();
        self.scl_oe(true);
+        while self.scl_i() {}   // ensure SCL is low before start() returns
        // postcondition: SCL and SDA low
        Ok(())
    }

    pub fn restart(&mut self) -> Result<(), &'static str> {
-        // precondition SCL and SDA low
+        // precondition: any
        self.sda_oe(false);
        self.half_period();
        self.scl_oe(false);
        self.half_period();
+        // enter the precondition for start(): SCL and SDA high
        self.start()?;
        // postcondition: SCL and SDA low
        Ok(())
@ -181,6 +190,7 @@ impl I2C {
            self.scl_oe(false);
            self.half_period();
            self.scl_oe(true);
+            while self.scl_i() {}   // ensure SCL is low before toggling SDA
        }
        self.sda_oe(false);
        self.half_period();
@ -189,6 +199,7 @@ impl I2C {
        // Read ack/nack
        let ack = !self.sda_i();
        self.scl_oe(true);
+        while self.scl_i() {}   // ensure SCL is low before toggling SDA
        self.sda_oe(true);
        // postcondition: SCL and SDA low

@ -208,6 +219,7 @@ impl I2C {
            self.half_period();
            if self.sda_i() { data |= 1 << bit }
            self.scl_oe(true);
+            while self.scl_i() {}   // ensure SCL is low so that slave can toggle SDA
        }
        // Send ack/nack
        self.sda_oe(ack);
@ -215,6 +227,7 @@ impl I2C {
        self.scl_oe(false);
        self.half_period();
        self.scl_oe(true);
+        while self.scl_i() {}   // ensure SCL is low before toggling SDA
        self.sda_oe(true);
        // postcondition: SCL and SDA low

--- a/libboard_zynq/src/i2c/regs.rs
+++ b/libboard_zynq/src/i2c/regs.rs
@ -1,5 +1,3 @@
-use volatile_register::{RO, WO, RW};
-
 use libregister::{
    register, register_at,
    register_bit, register_bits
@ -22,16 +20,17 @@ use libregister::{
 //
 // Current compatibility:
 // zc706: GPIO 50, 51 == SCL, SDA
+// kasli_soc: GPIO 50, 51 == SCL, SDA

-pub struct RegisterWrapper {
+pub struct RegisterBlock {
    pub gpio_output_mask: &'static mut GPIOOutputMask,
    pub gpio_input: &'static mut GPIOInput,
    pub gpio_direction: &'static mut GPIODirection,
    pub gpio_output_enable: &'static mut GPIOOutputEnable,
 }

-impl RegisterWrapper {
-    pub fn new() -> Self {
+impl RegisterBlock {
+    pub fn i2c() -> Self {
        Self {
            gpio_output_mask: GPIOOutputMask::new(),
            gpio_input: GPIOInput::new(),
@ -41,53 +40,66 @@ impl RegisterWrapper {
    }
 }

-// MASK_DATA_1_MSW:
-// Maskable output data for MIO[53:48]
-register!(gpio_output_mask, GPIOOutputMask, RW, u32);
-#[cfg(feature = "target_zc706")]
+register!(gpio_output_mask,
+          /// MASK_DATA_1_MSW:
+          /// Maskable output data for MIO[53:48]
+          GPIOOutputMask, RW, u32);
+#[cfg(any(feature = "target_zc706", feature = "target_kasli_soc"))]
 register_at!(GPIOOutputMask, 0xE000A00C, new);
-// Output for SCL
-#[cfg(feature = "target_zc706")]
-register_bit!(gpio_output_mask, scl_o, 2);
-// Output for SDA
-#[cfg(feature = "target_zc706")]
-register_bit!(gpio_output_mask, sda_o, 3);
-// Mask for keeping bits except SCL and SDA unchanged
-#[cfg(feature = "target_zc706")]
-register_bits!(gpio_output_mask, mask, u16, 16, 31);
+#[cfg(any(feature = "target_zc706", feature = "target_kasli_soc"))]
+register_bit!(gpio_output_mask,
+              /// Output for SCL
+              scl_o, 2);
+#[cfg(any(feature = "target_zc706", feature = "target_kasli_soc"))]
+register_bit!(gpio_output_mask,
+              /// Output for SDA
+              sda_o, 3);
+#[cfg(any(feature = "target_zc706", feature = "target_kasli_soc"))]
+register_bits!(gpio_output_mask,
+               /// Mask for keeping bits except SCL and SDA unchanged
+               mask, u16, 16, 31);

-// DATA_1_RO:
-// Input data for MIO[53:32]
-register!(gpio_input, GPIOInput, RO, u32);
-#[cfg(feature = "target_zc706")]
+register!(gpio_input,
+          /// DATA_1_RO:
+          /// Input data for MIO[53:32]
+          GPIOInput, RO, u32);
+#[cfg(any(feature = "target_zc706", feature = "target_kasli_soc"))]
 register_at!(GPIOInput, 0xE000A064, new);
-// Input for SCL
-#[cfg(feature = "target_zc706")]
-register_bit!(gpio_input, scl, 18);
-// Input for SDA
-#[cfg(feature = "target_zc706")]
-register_bit!(gpio_input, sda, 19);
+#[cfg(any(feature = "target_zc706", feature = "target_kasli_soc"))]
+register_bit!(gpio_input,
+              /// Input for SCL
+              scl, 18);
+#[cfg(any(feature = "target_zc706", feature = "target_kasli_soc"))]
+register_bit!(gpio_input,
+              /// Input for SDA
+              sda, 19);

-// DIRM_1:
-// Direction mode for MIO[53:32]; 0/1 = in/out
-register!(gpio_direction, GPIODirection, RW, u32);
-#[cfg(feature = "target_zc706")]
+register!(gpio_direction,
+          /// DIRM_1:
+          /// Direction mode for MIO[53:32]; 0/1 = in/out
+          GPIODirection, RW, u32);
+#[cfg(any(feature = "target_zc706", feature = "target_kasli_soc"))]
 register_at!(GPIODirection, 0xE000A244, new);
-// Direction for SCL
-#[cfg(feature = "target_zc706")]
-register_bit!(gpio_direction, scl, 18);
-// Direction for SDA
-#[cfg(feature = "target_zc706")]
-register_bit!(gpio_direction, sda, 19);
+#[cfg(any(feature = "target_zc706", feature = "target_kasli_soc"))]
+register_bit!(gpio_direction,
+              /// Direction for SCL
+              scl, 18);
+#[cfg(any(feature = "target_zc706", feature = "target_kasli_soc"))]
+register_bit!(gpio_direction,
+              /// Direction for SDA
+              sda, 19);

-// OEN_1:
-// Output enable for MIO[53:32]
-register!(gpio_output_enable, GPIOOutputEnable, RW, u32);
-#[cfg(feature = "target_zc706")]
+register!(gpio_output_enable,
+          /// OEN_1:
+          /// Output enable for MIO[53:32]
+          GPIOOutputEnable, RW, u32);
+#[cfg(any(feature = "target_zc706", feature = "target_kasli_soc"))]
 register_at!(GPIOOutputEnable, 0xE000A248, new);
-// Output enable for SCL
-#[cfg(feature = "target_zc706")]
-register_bit!(gpio_output_enable, scl, 18);
-// Output enable for SDA
-#[cfg(feature = "target_zc706")]
-register_bit!(gpio_output_enable, sda, 19);
+#[cfg(any(feature = "target_zc706", feature = "target_kasli_soc"))]
+register_bit!(gpio_output_enable,
+              /// Output enable for SCL
+              scl, 18);
+#[cfg(any(feature = "target_zc706", feature = "target_kasli_soc"))]
+register_bit!(gpio_output_enable,
+              /// Output enable for SDA
+              sda, 19);
--- a/libboard_zynq/src/lib.rs
+++ b/libboard_zynq/src/lib.rs
@ -16,11 +16,10 @@ pub mod axi_gp;
 pub mod ddr;
 pub mod mpcore;
 pub mod gic;
-pub mod flash;
 pub mod time;
 pub mod timer;
 pub mod sdio;
-#[cfg(feature = "target_zc706")]
+#[cfg(any(feature = "target_zc706", feature = "target_kasli_soc"))]
 pub mod i2c;
 pub mod logger;
 pub mod ps7_init;
--- a/libboard_zynq/src/mpcore.rs
+++ b/libboard_zynq/src/mpcore.rs
@ -138,7 +138,7 @@ pub struct RegisterBlock {
    pub icdsgir: ICDSGIR,
 }

-register_at!(RegisterBlock, 0xF8F00000, new);
+register_at!(RegisterBlock, 0xF8F00000, mpcore);

 register!(value_register, ValueRegister, RW, u32);
 register_bits!(value_register, value, u32, 0, 31);
@ -154,7 +154,7 @@ register_bit!(scu_control, enable, 0);

 impl ScuControl {
    pub fn start(&mut self) {
-        self.modify(|_, w| w.enable(true));
+        self.modify(|_, w| w.enable(true).scu_speculative_linefill_enable(true));
    }
 }

--- a/libboard_zynq/src/ps7_init/mod.rs
+++ b/libboard_zynq/src/ps7_init/mod.rs
@ -1,14 +1,14 @@
-#![cfg(feature = "target_zc706")]
-
 use crate::println;

+#[cfg(feature = "target_zc706")]
 mod zc706;
-// mod cora_z7_10;
+#[cfg(not(feature = "target_zc706"))]
+mod none;

 #[cfg(feature = "target_zc706")]
 use zc706 as target;
-// #[cfg(feature = "target_cora_z7_10")]
-// use cora_z7_10 as target;
+#[cfg(not(feature = "target_zc706"))]
+use none as target;

 pub fn report_differences() {
    for (i, op) in target::INIT_DATA.iter().enumerate() {
--- a/libboard_zynq/src/ps7_init/none.rs
+++ b/libboard_zynq/src/ps7_init/none.rs
@ -0,0 +1,4 @@
+use super::InitOp;
+
+pub const INIT_DATA: &'static [InitOp] = &[
+];
--- a/libboard_zynq/src/sdio/adma.rs
+++ b/libboard_zynq/src/sdio/adma.rs
@ -1,6 +1,6 @@
 /// ADMA library
 use core::mem::MaybeUninit;
-use super::SDIO;
+use super::Sdio;
 use libcortex_a9::cache;
 use libregister::{
    register, register_bit,
@ -32,7 +32,7 @@ impl Adma2DescTable {
    }

    /// Initialize the table and setup `adma_system_address`
-    pub fn setup(&mut self, sdio: &mut SDIO, blk_cnt: u32, buffer: &[u8]) {
+    pub fn setup(&mut self, sdio: &mut Sdio, blk_cnt: u32, buffer: &[u8]) {
        let descr_table = &mut self.0;
        let blk_size = sdio
            .regs
--- a/libboard_zynq/src/sdio/mod.rs
+++ b/libboard_zynq/src/sdio/mod.rs
@ -12,7 +12,7 @@ use log::{trace, debug};
 use nb;

 /// Basic SDIO Struct with common low-level functions.
-pub struct SDIO {
+pub struct Sdio {
    regs: &'static mut regs::RegisterBlock,
    count_down: super::timer::global::CountDown<Milliseconds>,
    input_clk_hz: u32,
@ -48,7 +48,7 @@ pub enum CardType {
    CardMmc,
 }

-impl SDIO {
+impl Sdio {
    /// Initialize SDIO0
    /// card_detect means if we would use the card detect pin,
    /// false to disable card detection (assume there is card inserted)
@ -105,7 +105,7 @@ impl SDIO {
                );
            }
            // cora card detect pin
-            #[cfg(feature = "target_cora_z7_10")]
+            #[cfg(feature = "target_coraz7")]
            {
                unsafe {
                    slcr.sd0_wp_cd_sel.write(47 << 16);
@ -116,12 +116,24 @@ impl SDIO {
                        .speed(true),
                );
            }
+            // redpitaya card detect pin
+            #[cfg(any(feature = "target_redpitaya", feature = "target_kasli_soc"))]
+            {
+                unsafe {
+                    slcr.sd0_wp_cd_sel.write(46 << 16);
+                }
+                slcr.mio_pin_46.write(
+                    slcr::MioPin46::zeroed()
+                        .io_type(slcr::IoBufferType::Lvcmos25)
+                        .speed(true),
+                );
+            }
            slcr.sdio_rst_ctrl.reset_sdio0();
            slcr.aper_clk_ctrl.enable_sdio0();
            slcr.sdio_clk_ctrl.enable_sdio0();
        });
        let clocks = Clocks::get();
-        let mut self_ = SDIO {
+        let mut self_ = Sdio {
            regs: regs::RegisterBlock::sdio0(),
            count_down: unsafe { super::timer::GlobalTimer::get() }.countdown(),
            input_clk_hz: clocks.sdio_ref_clk(),
--- a/libboard_zynq/src/sdio/sd_card.rs
+++ b/libboard_zynq/src/sdio/sd_card.rs
@ -1,4 +1,4 @@
-use super::{adma::Adma2DescTable, cmd, CardType, CmdTransferError, SDIO};
+use super::{adma::Adma2DescTable, cmd, CardType, CmdTransferError, Sdio};
 use libcortex_a9::cache;
 use libregister::{RegisterR, RegisterRW, RegisterW};
 use log::{trace, debug};
@ -37,7 +37,7 @@ enum CardVersion {
 }

 pub struct SdCard {
-    sdio: SDIO,
+    sdio: Sdio,
    adma2_desc_table: Adma2DescTable,
    card_version: CardVersion,
    hcs: bool,
@ -171,8 +171,8 @@ impl SdCard {
        Ok(())
    }

-    /// Convert SDIO into SdCard struct, error if no card inserted or it is not an SD card.
-    pub fn from_sdio(mut sdio: SDIO) -> Result<Self, CardInitializationError> {
+    /// Convert Sdio into SdCard struct, error if no card inserted or it is not an SD card.
+    pub fn from_sdio(mut sdio: Sdio) -> Result<Self, CardInitializationError> {
        match sdio.identify_card()? {
            CardType::CardSd => (),
            _ => return Err(CardInitializationError::NoCardInserted),
@ -192,8 +192,8 @@ impl SdCard {
        Ok(_self)
    }

-    /// Convert SdCard struct back to SDIO struct.
-    pub fn to_sdio(self) -> SDIO {
+    /// Convert SdCard struct back to Sdio struct.
+    pub fn to_sdio(self) -> Sdio {
        self.sdio
    }

--- a/libboard_zynq/src/slcr.rs
+++ b/libboard_zynq/src/slcr.rs
@ -253,12 +253,12 @@ pub struct RegisterBlock {
    pub ddriob_dci_ctrl: DdriobDciCtrl,
    pub ddriob_dci_status: DdriobDciStatus,
 }
-register_at!(RegisterBlock, 0xF8000000, new);
+register_at!(RegisterBlock, 0xF8000000, slcr);

 impl RegisterBlock {
    /// Required to modify any sclr register
    pub fn unlocked<F: FnMut(&mut Self) -> R, R>(mut f: F) -> R {
-        let mut self_ = Self::new();
+        let mut self_ = Self::slcr();
        self_.slcr_unlock.unlock();
        let r = f(&mut self_);
        self_.slcr_lock.lock();
@ -590,16 +590,19 @@ register_bit!(a9_cpu_rst_ctrl, a9_rst0, 0);
 #[derive(Clone, Copy, Debug, PartialEq)]
 #[repr(u8)]
 pub enum BootModePins {
+    // CAUTION!
+    // The BOOT_MODE bits table 6-4 in UG585 are *out of order*.
    Jtag = 0b000,
-    Nor = 0b001,
-    Nand = 0b010,
-    QuadSpi = 0b100,
-    SdCard = 0b110,
+    Nor = 0b010,
+    Nand = 0b100,
+    QuadSpi = 0b001,
+    SdCard = 0b101,
 }

 register!(boot_mode, BootMode, RO, u32);
 register_bit!(boot_mode, pll_bypass, 4);
-register_bits_typed!(boot_mode, boot_mode_pins, u8, BootModePins, 0, 3);
+register_bit!(boot_mode, jtag_routing, 3);
+register_bits_typed!(boot_mode, boot_mode_pins, u8, BootModePins, 0, 2);

 register!(pss_rst_ctrl, PssRstCtrl, RW, u32);
 register_bit!(pss_rst_ctrl, soft_rst, 1);
--- a/libboard_zynq/src/stdio.rs
+++ b/libboard_zynq/src/stdio.rs
@ -1,5 +1,5 @@
 use core::ops::{Deref, DerefMut};
-use libcortex_a9::mutex::{Mutex, MutexGuard};
+use libcortex_a9::{asm, mutex::{Mutex, MutexGuard}};
 use crate::uart::Uart;

 const UART_RATE: u32 = 115_200;
@ -10,7 +10,15 @@ pub fn get_uart<'a>() -> MutexGuard<'a, LazyUart> {
    unsafe { UART.lock() }
 }

+/// Deinitialize so that the Uart will be reinitialized on next
+/// output.
+///
+/// Delays so that an outstanding transmission can finish.
 pub fn drop_uart() {
+    for _ in 0..1_000_000 {
+        asm::nop();
+    }
+
    unsafe { UART = Mutex::new(LazyUart::Uninitialized); }
 }

@ -37,7 +45,10 @@ impl DerefMut for LazyUart {
    fn deref_mut(&mut self) -> &mut Uart {
        match self {
            LazyUart::Uninitialized => {
-                let uart = Uart::serial(UART_RATE);
+                #[cfg(any(feature = "target_coraz7", feature = "target_redpitaya"))]
+                let uart = Uart::uart0(UART_RATE);
+                #[cfg(any(feature = "target_zc706", feature = "target_kasli_soc"))]
+                let uart = Uart::uart1(UART_RATE);
                *self = LazyUart::Initialized(uart);
                self
            }
--- a/libboard_zynq/src/timer/global.rs
+++ b/libboard_zynq/src/timer/global.rs
@ -16,13 +16,13 @@ pub struct GlobalTimer {
 impl GlobalTimer {
    /// Get the potentially uninitialized timer
    pub unsafe fn get() -> GlobalTimer {
-        let regs = mpcore::RegisterBlock::new();
+        let regs = mpcore::RegisterBlock::mpcore();
        GlobalTimer { regs }
    }

    /// Get the timer with a reset
    pub fn start() -> GlobalTimer {
-        let mut regs = mpcore::RegisterBlock::new();
+        let mut regs = mpcore::RegisterBlock::mpcore();
        Self::reset(&mut regs);
        GlobalTimer { regs }
    }
--- a/libboard_zynq/src/uart/mod.rs
+++ b/libboard_zynq/src/uart/mod.rs
@ -13,31 +13,8 @@ pub struct Uart {
 }

 impl Uart {
-    #[cfg(feature = "target_zc706")]
-    pub fn serial(baudrate: u32) -> Self {
-        slcr::RegisterBlock::unlocked(|slcr| {
-            // Route UART 1 RxD/TxD Signals to MIO Pins
-            // TX pin
-            slcr.mio_pin_48.write(
-                slcr::MioPin48::zeroed()
-                    .l3_sel(0b111)
-                    .io_type(slcr::IoBufferType::Lvcmos18)
-                    .pullup(true)
-            );
-            // RX pin
-            slcr.mio_pin_49.write(
-                slcr::MioPin49::zeroed()
-                    .tri_enable(true)
-                    .l3_sel(0b111)
-                    .io_type(slcr::IoBufferType::Lvcmos18)
-                    .pullup(true)
-            );
-        });
-        Self::uart1(baudrate)
-    }
-
-    #[cfg(feature = "target_cora_z7_10")]
-    pub fn serial(baudrate: u32) -> Self {
+    #[cfg(any(feature = "target_coraz7", feature = "target_redpitaya"))]
+    pub fn uart0(baudrate: u32) -> Self {
        slcr::RegisterBlock::unlocked(|slcr| {
            // Route UART 0 RxD/TxD Signals to MIO Pins
            // TX pin
@ -56,10 +33,7 @@ impl Uart {
                    .pullup(true)
            );
        });
-        Self::uart0(baudrate)
-    }

-    pub fn uart0(baudrate: u32) -> Self {
        slcr::RegisterBlock::unlocked(|slcr| {
            slcr.uart_rst_ctrl.reset_uart0();
            slcr.aper_clk_ctrl.enable_uart0();
@ -72,7 +46,27 @@ impl Uart {
        self_
    }

+    #[cfg(any(feature = "target_zc706", feature = "target_kasli_soc"))]
    pub fn uart1(baudrate: u32) -> Self {
+        slcr::RegisterBlock::unlocked(|slcr| {
+            // Route UART 1 RxD/TxD Signals to MIO Pins
+            // TX pin
+            slcr.mio_pin_48.write(
+                slcr::MioPin48::zeroed()
+                    .l3_sel(0b111)
+                    .io_type(slcr::IoBufferType::Lvcmos18)
+                    .pullup(true)
+            );
+            // RX pin
+            slcr.mio_pin_49.write(
+                slcr::MioPin49::zeroed()
+                    .tri_enable(true)
+                    .l3_sel(0b111)
+                    .io_type(slcr::IoBufferType::Lvcmos18)
+                    .pullup(true)
+            );
+        });
+
        slcr::RegisterBlock::unlocked(|slcr| {
            slcr.uart_rst_ctrl.reset_uart1();
            slcr.aper_clk_ctrl.enable_uart1();
--- a/libconfig/Cargo.toml
+++ b/libconfig/Cargo.toml
@ -0,0 +1,18 @@
+[package]
+name = "libconfig"
+version = "0.1.0"
+authors = ["M-Labs"]
+edition = "2018"
+
+[dependencies]
+libboard_zynq = { path = "../libboard_zynq" }
+core_io = { version = "0.1", features = ["collections"] }
+fatfs = { version = "0.3", features = ["core_io"], default-features = false }
+log = "0.4"
+
+[features]
+target_zc706 = []
+target_coraz7 = []
+target_redpitaya = []
+target_kasli_soc = []
+ipv6 = []
--- a/libconfig/src/bootgen.rs
+++ b/libconfig/src/bootgen.rs
@ -0,0 +1,181 @@
+use alloc::vec::Vec;
+use core_io::{Error, Read, Seek, SeekFrom};
+use libboard_zynq::devc;
+use log::debug;
+
+#[derive(Debug)]
+pub enum BootgenLoadingError {
+    InvalidBootImageHeader,
+    MissingPartition,
+    EncryptedBitstream,
+    IoError(Error),
+    DevcError(devc::DevcError),
+}
+
+impl From<Error> for BootgenLoadingError {
+    fn from(error: Error) -> Self {
+        BootgenLoadingError::IoError(error)
+    }
+}
+
+impl From<devc::DevcError> for BootgenLoadingError {
+    fn from(error: devc::DevcError) -> Self {
+        BootgenLoadingError::DevcError(error)
+    }
+}
+
+impl core::fmt::Display for BootgenLoadingError {
+    fn fmt(&self, f: &mut core::fmt::Formatter<'_>) -> core::fmt::Result {
+        use BootgenLoadingError::*;
+        match self {
+            InvalidBootImageHeader => write!(
+                f,
+                "Invalid boot image header. Check if the file is correct."
+            ),
+            MissingPartition => write!(f, "Partition not found. Check your compile configuration."),
+            EncryptedBitstream => write!(f, "Encrypted bitstream is not supported."),
+            IoError(e) => write!(f, "Error while reading: {}", e),
+            DevcError(e) => write!(f, "PCAP interface error: {}", e),
+        }
+    }
+}
+
+#[repr(C)]
+struct PartitionHeader {
+    pub encrypted_length: u32,
+    pub unencrypted_length: u32,
+    pub word_length: u32,
+    pub dest_load_addr: u32,
+    pub dest_exec_addr: u32,
+    pub data_offset: u32,
+    pub attribute_bits: u32,
+    pub section_count: u32,
+    pub checksum_offset: u32,
+    pub header_offset: u32,
+    pub cert_offset: u32,
+    pub reserved: [u32; 4],
+    pub checksum: u32,
+}
+
+/// Read a u32 word from the reader.
+fn read_u32<Reader: Read>(reader: &mut Reader) -> Result<u32, BootgenLoadingError> {
+    let mut buffer: [u8; 4] = [0; 4];
+    reader.read_exact(&mut buffer)?;
+    let mut result: u32 = 0;
+    for i in 0..4 {
+        result |= (buffer[i] as u32) << (i * 8);
+    }
+    Ok(result)
+}
+
+/// Load PL partition header.
+fn load_pl_header<File: Read + Seek>(
+    file: &mut File,
+) -> Result<Option<PartitionHeader>, BootgenLoadingError> {
+    let mut buffer: [u8; 0x40] = [0; 0x40];
+    file.read_exact(&mut buffer)?;
+    let header = unsafe { core::mem::transmute::<_, PartitionHeader>(buffer) };
+    if header.attribute_bits & (2 << 4) != 0 {
+        Ok(Some(header))
+    } else {
+        Ok(None)
+    }
+}
+
+fn load_ps_header<File: Read + Seek>(
+    file: &mut File,
+) -> Result<Option<PartitionHeader>, BootgenLoadingError> {
+    let mut buffer: [u8; 0x40] = [0; 0x40];
+    file.read_exact(&mut buffer)?;
+    let header = unsafe { core::mem::transmute::<_, PartitionHeader>(buffer) };
+    if header.attribute_bits & (1 << 4) != 0 {
+        Ok(Some(header))
+    } else {
+        Ok(None)
+    }
+}
+
+/// Locate the partition from the image, and return the size (in bytes) of the partition if successful.
+/// This function would seek the file to the location of the partition.
+fn locate<
+    File: Read + Seek,
+    F: Fn(&mut File) -> Result<Option<PartitionHeader>, BootgenLoadingError>,
+>(
+    file: &mut File,
+    f: F,
+) -> Result<usize, BootgenLoadingError> {
+    file.seek(SeekFrom::Start(0))?;
+    const BOOT_HEADER_SIGN: u32 = 0x584C4E58;
+    // read boot header signature
+    file.seek(SeekFrom::Start(0x24))?;
+    if read_u32(file)? != BOOT_HEADER_SIGN {
+        return Err(BootgenLoadingError::InvalidBootImageHeader);
+    }
+    // find fsbl offset
+    file.seek(SeekFrom::Start(0x30))?;
+    // the length is in bytes, we have to convert it to words to compare with the partition offset
+    // later
+    let fsbl = read_u32(file)? / 4;
+    // read partition header offset
+    file.seek(SeekFrom::Start(0x9C))?;
+    let ptr = read_u32(file)?;
+    debug!("Partition header pointer = {:0X}", ptr);
+    file.seek(SeekFrom::Start(ptr as u64))?;
+
+    // at most 3 partition headers
+    for _ in 0..3 {
+        if let Some(header) = f(file)? {
+            let encrypted_length = header.encrypted_length;
+            let unencrypted_length = header.unencrypted_length;
+            debug!("Unencrypted length = {:0X}", unencrypted_length);
+            if encrypted_length != unencrypted_length {
+                return Err(BootgenLoadingError::EncryptedBitstream);
+            }
+
+            let start_addr = header.data_offset;
+            // skip fsbl
+            if start_addr == fsbl {
+                continue;
+            }
+            debug!("Partition start address: {:0X}", start_addr);
+            file.seek(SeekFrom::Start(start_addr as u64 * 4))?;
+
+            return Ok(unencrypted_length as usize * 4);
+        }
+    }
+    Err(BootgenLoadingError::MissingPartition)
+}
+
+/// Load bitstream from bootgen file.
+/// This function parses the file, locate the bitstream and load it through the PCAP driver.
+/// It requires a large buffer, please enable the DDR RAM before using it.
+pub fn load_bitstream<File: Read + Seek>(file: &mut File) -> Result<(), BootgenLoadingError> {
+    let size = locate(file, load_pl_header)?;
+    unsafe {
+        // align to 64 bytes
+        let ptr = alloc::alloc::alloc(alloc::alloc::Layout::from_size_align(size, 64).unwrap());
+        let buffer = core::slice::from_raw_parts_mut(ptr, size);
+        file.read_exact(buffer).map_err(|e| {
+            core::ptr::drop_in_place(ptr);
+            e
+        })?;
+        let mut devcfg = devc::DevC::new();
+        devcfg.enable();
+        devcfg.program(&buffer).map_err(|e| {
+            core::ptr::drop_in_place(ptr);
+            e
+        })?;
+        core::ptr::drop_in_place(ptr);
+        Ok(())
+    }
+}
+
+pub fn get_runtime<File: Read + Seek>(file: &mut File) -> Result<Vec<u8>, BootgenLoadingError> {
+    let size = locate(file, load_ps_header)?;
+    let mut buffer = Vec::with_capacity(size);
+    unsafe {
+        buffer.set_len(size);
+    }
+    file.read_exact(&mut buffer)?;
+    Ok(buffer)
+}
--- a/libconfig/src/lib.rs
+++ b/libconfig/src/lib.rs
@ -0,0 +1,173 @@
+#![no_std]
+extern crate alloc;
+
+use core::fmt;
+use alloc::{string::FromUtf8Error, string::String, vec::Vec, rc::Rc};
+use core_io::{self as io, BufRead, BufReader, Read, Write, Seek, SeekFrom};
+use libboard_zynq::sdio;
+
+pub mod sd_reader;
+pub mod net_settings;
+pub mod bootgen;
+
+#[derive(Debug)]
+pub enum Error<'a> {
+    SdError(sdio::sd_card::CardInitializationError),
+    IoError(io::Error),
+    Utf8Error(FromUtf8Error),
+    KeyNotFoundError(&'a str),
+    NoConfig,
+}
+
+pub type Result<'a, T> = core::result::Result<T, Error<'a>>;
+
+impl<'a> fmt::Display for Error<'a> {
+    fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
+        match self {
+            Error::SdError(error) => write!(f, "SD error: {}", error),
+            Error::IoError(error) => write!(f, "I/O error: {}", error),
+            Error::Utf8Error(error) => write!(f, "UTF-8 error: {}", error),
+            Error::KeyNotFoundError(name) => write!(f, "Configuration key `{}` not found", name),
+            Error::NoConfig => write!(f, "Configuration not present"),
+        }
+    }
+}
+
+impl<'a> From<sdio::sd_card::CardInitializationError> for Error<'a> {
+    fn from(error: sdio::sd_card::CardInitializationError) -> Self {
+        Error::SdError(error)
+    }
+}
+
+impl<'a> From<io::Error> for Error<'a> {
+    fn from(error: io::Error) -> Self {
+        Error::IoError(error)
+    }
+}
+
+impl<'a> From<FromUtf8Error> for Error<'a> {
+    fn from(error: FromUtf8Error) -> Self {
+        Error::Utf8Error(error)
+    }
+}
+
+fn parse_config<'a>(
+    key: &'a str,
+    buffer: &mut Vec<u8>,
+    file: fatfs::File<sd_reader::SdReader>,
+) -> Result<'a, ()> {
+    let prefix = [key, "="].concat().to_ascii_lowercase();
+    for line in BufReader::new(file).lines() {
+        let line = line?.to_ascii_lowercase();
+        if line.starts_with(&prefix) {
+            buffer.extend(line[prefix.len()..].as_bytes());
+            return Ok(());
+        }
+    }
+    Err(Error::KeyNotFoundError(key))
+}
+
+pub struct Config {
+    fs: Option<Rc<fatfs::FileSystem<sd_reader::SdReader>>>,
+}
+
+const NEWLINE: &[u8] = b"\n";
+
+impl Config {
+    pub fn new() -> Result<'static, Self> {
+        let sdio = sdio::Sdio::sdio0(true);
+        if !sdio.is_card_inserted() {
+            Err(sdio::sd_card::CardInitializationError::NoCardInserted)?;
+        }
+        let sd = sdio::sd_card::SdCard::from_sdio(sdio)?;
+        let reader = sd_reader::SdReader::new(sd);
+
+        let fs = reader.mount_fatfs(sd_reader::PartitionEntry::Entry1)?;
+        Ok(Config { fs: Some(Rc::new(fs)) })
+    }
+
+    pub fn from_fs(fs: Option<Rc<fatfs::FileSystem<sd_reader::SdReader>>>) -> Self {
+        Config { fs }
+    }
+
+    pub fn new_dummy() -> Self {
+        Config { fs: None }
+    }
+
+    pub fn read<'b>(&self, key: &'b str) -> Result<'b, Vec<u8>> {
+        if let Some(fs) = &self.fs {
+            let root_dir = fs.root_dir();
+            let mut buffer: Vec<u8> = Vec::new();
+            match root_dir.open_file(&["/CONFIG/", key, ".BIN"].concat()) {
+                Ok(mut f) => f.read_to_end(&mut buffer).map(|_| ())?,
+                Err(_) => match root_dir.open_file("/CONFIG.TXT") {
+                    Ok(f) => parse_config(key, &mut buffer, f)?,
+                    Err(_) => return Err(Error::KeyNotFoundError(key)),
+                },
+            };
+            Ok(buffer)
+        } else {
+            Err(Error::NoConfig)
+        }
+    }
+
+    pub fn read_str<'b>(&self, key: &'b str) -> Result<'b, String> {
+        Ok(String::from_utf8(self.read(key)?)?)
+    }
+
+    pub fn remove<'b>(&self, key: &'b str) -> Result<'b, ()> {
+        if let Some(fs) = &self.fs {
+            let root_dir = fs.root_dir();
+            match root_dir.remove(&["/CONFIG/", key, ".BIN"].concat()) {
+                Ok(()) => Ok(()),
+                Err(_) => {
+                    let prefix = [key, "="].concat().to_ascii_lowercase();
+                    match root_dir.create_file("/CONFIG.TXT") {
+                        Ok(mut f) => {
+                            let mut buffer = String::new();
+                            f.read_to_string(&mut buffer)?;
+                            f.seek(SeekFrom::Start(0))?;
+                            f.truncate()?;
+                            for line in buffer.lines() {
+                                if line.len() > 0 && !line.to_ascii_lowercase().starts_with(&prefix) {
+                                    f.write(line.as_bytes())?;
+                                    f.write(NEWLINE)?;
+                                }
+                            }
+                            Ok(())
+                        },
+                        Err(_) => Err(Error::KeyNotFoundError(key))
+                    }
+                }
+            }
+        } else {
+            Err(Error::NoConfig)
+        }
+    }
+
+    pub fn write<'b>(&self, key: &'b str, value: Vec<u8>) -> Result<'b, ()> {
+        if self.fs.is_none() {
+            return Err(Error::NoConfig);
+        }
+        let fs = self.fs.as_ref().unwrap();
+        let root_dir = fs.root_dir();
+        let is_str = value.len() <= 100 && value.is_ascii() && !value.contains(&b'\n');
+        if key == "boot" {
+            let mut f = root_dir.create_file("/BOOT.BIN")?;
+            f.truncate()?;
+            f.write_all(&value)?;
+            drop(f);
+        } else {
+            let _ = self.remove(key);
+            if is_str {
+                let mut f = root_dir.create_file("/CONFIG.TXT")?;
+                f.seek(SeekFrom::End(0))?;
+                write!(f, "{}={}\n", key, String::from_utf8(value).unwrap())?;
+            } else {
+                let mut f = root_dir.create_file(&["/CONFIG/", key, ".BIN"].concat())?;
+                f.write_all(&value)?;
+            }
+        }
+        Ok(())
+    }
+}
--- a/libconfig/src/net_settings.rs
+++ b/libconfig/src/net_settings.rs
@ -0,0 +1,76 @@
+use core::fmt;
+
+use libboard_zynq::smoltcp::wire::{EthernetAddress, IpAddress};
+
+use super::Config;
+
+pub struct NetAddresses {
+    pub hardware_addr: EthernetAddress,
+    pub ipv4_addr: IpAddress,
+    #[cfg(feature = "ipv6")]
+    pub ipv6_ll_addr: IpAddress,
+    #[cfg(feature = "ipv6")]
+    pub ipv6_addr: Option<IpAddress>
+}
+
+impl fmt::Display for NetAddresses {
+    fn fmt(&self, f: &mut fmt::Formatter) -> fmt::Result {
+        write!(f, "MAC={} IPv4={} ",
+            self.hardware_addr, self.ipv4_addr)?;
+
+        #[cfg(feature = "ipv6")]
+        {
+            write!(f, "IPv6-LL={}", self.ipv6_ll_addr)?;
+            match self.ipv6_addr {
+                Some(addr) => write!(f, " {}", addr)?,
+                None => write!(f, " IPv6: no configured address")?
+            }
+        }
+        Ok(())
+    }
+}
+
+pub fn get_adresses(cfg: &Config) -> NetAddresses {
+    #[cfg(feature = "target_zc706")]
+    let mut hardware_addr = EthernetAddress([0x02, 0x00, 0x00, 0x00, 0x00, 0x52]);
+    #[cfg(feature = "target_zc706")]
+    let mut ipv4_addr = IpAddress::v4(192, 168, 1, 52);
+    #[cfg(feature = "target_coraz7")]
+    let mut hardware_addr = EthernetAddress([0x02, 0x00, 0x00, 0x00, 0x00, 0x54]);
+    #[cfg(feature = "target_coraz7")]
+    let mut ipv4_addr = IpAddress::v4(192, 168, 1, 54);
+    #[cfg(feature = "target_redpitaya")]
+    let mut hardware_addr = EthernetAddress([0x02, 0x00, 0x00, 0x00, 0x00, 0x55]);
+    #[cfg(feature = "target_redpitaya")]
+    let mut ipv4_addr = IpAddress::v4(192, 168, 1, 55);
+    #[cfg(feature = "target_kasli_soc")]
+    let mut hardware_addr = EthernetAddress([0x02, 0x00, 0x00, 0x00, 0x00, 0x56]);
+    #[cfg(feature = "target_kasli_soc")]
+    let mut ipv4_addr = IpAddress::v4(192, 168, 1, 56);
+
+    if let Ok(Ok(addr)) = cfg.read_str("mac").map(|s| s.parse()) {
+        hardware_addr = addr;
+    }
+    if let Ok(Ok(addr)) = cfg.read_str("ip").map(|s| s.parse()) {
+        ipv4_addr = addr;
+    }
+    #[cfg(feature = "ipv6")]
+    let ipv6_addr = cfg.read_str("ip6").ok().and_then(|s| s.parse().ok());
+
+    #[cfg(feature = "ipv6")]
+    let ipv6_ll_addr = IpAddress::v6(
+        0xfe80, 0x0000, 0x0000, 0x0000,
+        (((hardware_addr.0[0] ^ 0x02) as u16) << 8) | (hardware_addr.0[1] as u16),
+        ((hardware_addr.0[2] as u16) << 8) | 0x00ff,
+        0xfe00 | (hardware_addr.0[3] as u16),
+        ((hardware_addr.0[4] as u16) << 8) | (hardware_addr.0[5] as u16));
+
+    NetAddresses {
+        hardware_addr,
+        ipv4_addr,
+        #[cfg(feature = "ipv6")]
+        ipv6_ll_addr,
+        #[cfg(feature = "ipv6")]
+        ipv6_addr
+    }
+}
--- a/libconfig/src/sd_reader.rs
+++ b/libconfig/src/sd_reader.rs
@ -0,0 +1,304 @@
+use core_io::{BufRead, Error, ErrorKind, Read, Result as IoResult, Seek, SeekFrom, Write};
+use fatfs;
+use libboard_zynq::sdio::{sd_card::SdCard, CmdTransferError};
+use log::debug;
+use alloc::vec::Vec;
+
+const MBR_SIGNATURE: [u8; 2] = [0x55, 0xAA];
+const PARTID_FAT12: u8 = 0x01;
+const PARTID_FAT16_LESS32M: u8 = 0x04;
+const PARTID_FAT16: u8 = 0x06;
+const PARTID_FAT32: u8 = 0x0B;
+const PARTID_FAT32_LBA: u8 = 0x0C;
+const PARTID_FAT16_LBA: u8 = 0x0E;
+
+fn cmd_error_to_io_error(_: CmdTransferError) -> Error {
+    Error::new(ErrorKind::Other, "Command transfer error")
+}
+
+const BLOCK_SIZE: usize = 512;
+
+/// SdReader struct implementing `Read + BufRead + Write + Seek` traits for `core_io`.
+/// Used as an adaptor for fatfs crate, but could be used directly for raw data access.
+///
+/// Implementation: all read/writes would be split into unaligned and block-aligned parts,
+/// unaligned read/writes would do a buffered read/write using a block-sized internal buffer,
+/// while aligned transactions would be sent to the SD card directly for performance reason.
+pub struct SdReader {
+    /// Internal SdCard handle.
+    sd: SdCard,
+    /// Read buffer with the size of 1 block.
+    buffer: Vec<u8>,
+    /// Address for the next byte.
+    byte_addr: u32,
+    /// Internal index for the next byte.
+    /// Normally in range `[0, BLOCK_SIZE - 1]`.
+    ///
+    /// `index = BLOCK_SIZE` means that the `buffer` is invalid for the current `byte_addr`,
+    /// the next `fill_buf` call would fill the buffer.
+    index: usize,
+    /// Dirty flag indicating the content has to be flushed.
+    dirty: bool,
+    /// Base offset for translation from logical address to physical address.
+    offset: u32,
+}
+
+#[derive(Copy, Clone)]
+#[allow(unused)]
+// Partition entry enum, normally we would use entry1.
+pub enum PartitionEntry {
+    Entry1 = 0x1BE,
+    Entry2 = 0x1CE,
+    Entry3 = 0x1DE,
+    Entry4 = 0x1EE,
+}
+
+impl SdReader {
+    /// Create SdReader from SdCard
+    pub fn new(sd: SdCard) -> SdReader {
+        let mut vec: Vec<u8> = Vec::with_capacity(BLOCK_SIZE);
+        unsafe {
+            vec.set_len(vec.capacity());
+        }
+        SdReader {
+            sd,
+            buffer: vec,
+            byte_addr: 0,
+            index: BLOCK_SIZE,
+            dirty: false,
+            offset: 0,
+        }
+    }
+
+    /// Internal read function for unaligned read.
+    /// The read must not cross block boundary.
+    fn read_unaligned(&mut self, buf: &mut [u8]) -> IoResult<usize> {
+        if buf.len() == 0 {
+            return Ok(0);
+        }
+        let filled_buffer = self.fill_buf()?;
+        for (dest, src) in buf.iter_mut().zip(filled_buffer.iter()) {
+            *dest = *src;
+        }
+        self.consume(buf.len());
+        Ok(buf.len())
+    }
+
+    /// Internal write function for unaligned write.
+    /// The write must not cross block boundary.
+    fn write_unaligned(&mut self, buf: &[u8]) -> IoResult<usize> {
+        if buf.len() == 0 {
+            return Ok(0);
+        }
+        // update buffer if needed, as we will flush the entire block later.
+        self.fill_buf()?;
+        self.dirty = true;
+        let dest_buffer = &mut self.buffer[self.index..];
+        for (src, dest) in buf.iter().zip(dest_buffer.iter_mut()) {
+            *dest = *src;
+        }
+        self.consume(buf.len());
+        Ok(buf.len())
+    }
+
+    /// Split the slice into three segments, with the middle block-aligned.
+    /// Alignment depends on the current `self.byte_addr` instead of the slice pointer address
+    fn block_align<'b>(&self, buf: &'b [u8]) -> (&'b [u8], &'b [u8], &'b [u8]) {
+        let head_len = BLOCK_SIZE - (self.byte_addr as usize % BLOCK_SIZE);
+        if head_len > buf.len() {
+            (buf, &[], &[])
+        } else {
+            let remaining_length = buf.len() - head_len;
+            let mid_length = remaining_length - remaining_length % BLOCK_SIZE;
+            let (head, remaining) = buf.split_at(head_len);
+            let (mid, tail) = remaining.split_at(mid_length);
+            (head, mid, tail)
+        }
+    }
+
+    /// Split the mutable slice into three segments, with the middle block-aligned.
+    /// Alignment depends on the current `self.byte_addr` instead of the slice pointer address
+    fn block_align_mut<'b>(&self, buf: &'b mut [u8]) -> (&'b mut [u8], &'b mut [u8], &'b mut [u8]) {
+        let head_len = BLOCK_SIZE - (self.byte_addr as usize % BLOCK_SIZE);
+        if head_len > buf.len() {
+            (buf, &mut [], &mut [])
+        } else {
+            let remaining_length = buf.len() - head_len;
+            let mid_length = remaining_length - remaining_length % BLOCK_SIZE;
+            let (head, remaining) = buf.split_at_mut(head_len);
+            let (mid, tail) = remaining.split_at_mut(mid_length);
+            (head, mid, tail)
+        }
+    }
+
+    /// Invalidate the buffer, so later unaligned read/write would reload the buffer from SD card.
+    fn invalidate_buffer(&mut self) {
+        self.index = BLOCK_SIZE;
+    }
+
+    /// Set the base offset of the SD card, to transform from physical address to logical address.
+    fn set_base_offset(&mut self, offset: u32) -> IoResult<u64> {
+        self.offset = offset;
+        self.seek(SeekFrom::Start(0))
+    }
+
+    /// Mount fatfs from partition entry, and return the fatfs object if success.
+    /// This takes the ownership of self, so currently there is no way to recover from an error,
+    /// except creating a new SD card instance.
+    pub fn mount_fatfs(mut self, entry: PartitionEntry) -> IoResult<fatfs::FileSystem<Self>> {
+        let mut buffer: [u8; 4] = [0; 4];
+        self.seek(SeekFrom::Start(0x1FE))?;
+        self.read_exact(&mut buffer[..2])?;
+        // check MBR signature
+        if buffer[..2] != MBR_SIGNATURE {
+            return Err(Error::new(
+                ErrorKind::InvalidData,
+                "Incorrect signature for MBR sector.",
+            ));
+        }
+        // Read partition ID.
+        self.seek(SeekFrom::Start(entry as u64 + 0x4))?;
+        self.read_exact(&mut buffer[..1])?;
+        debug!("Partition ID: {:0X}", buffer[0]);
+        match buffer[0] {
+            PARTID_FAT12 | PARTID_FAT16_LESS32M | PARTID_FAT16 |
+            PARTID_FAT16_LBA | PARTID_FAT32 | PARTID_FAT32_LBA => {}
+            _ => {
+                return Err(Error::new(
+                    ErrorKind::InvalidData,
+                    "No FAT partition found for the specified entry.",
+                ));
+            }
+        }
+        // Read LBA
+        self.seek(SeekFrom::Current(0x3))?;
+        self.read_exact(&mut buffer)?;
+        let mut lba: u32 = 0;
+        // Little endian
+        for i in 0..4 {
+            lba |= (buffer[i] as u32) << (i * 8);
+        }
+        // Set to logical address
+        self.set_base_offset(lba * BLOCK_SIZE as u32)?;
+        // setup fatfs
+        fatfs::FileSystem::new(self, fatfs::FsOptions::new())
+    }
+}
+
+impl Read for SdReader {
+    fn read(&mut self, buf: &mut [u8]) -> IoResult<usize> {
+        let total_length = buf.len();
+        let (a, b, c) = self.block_align_mut(buf);
+        self.read_unaligned(a)?;
+        if b.len() > 0 {
+            // invalidate internal buffer
+            self.invalidate_buffer();
+            if let Err(_) = self.sd.read_block(
+                self.byte_addr / BLOCK_SIZE as u32,
+                (b.len() / BLOCK_SIZE) as u16,
+                b,
+            ) {
+                // we have to allow partial read, as per the trait required
+                return Ok(a.len());
+            }
+            self.byte_addr += b.len() as u32;
+        }
+        if let Err(_) = self.read_unaligned(c) {
+            // we have to allow partial read, as per the trait required
+            return Ok(a.len() + b.len());
+        }
+        Ok(total_length)
+    }
+}
+
+impl BufRead for SdReader {
+    fn fill_buf(&mut self) -> IoResult<&[u8]> {
+        if self.index == BLOCK_SIZE {
+            // flush the buffer if it is dirty before overwriting it with new data
+            if self.dirty {
+                self.flush()?;
+            }
+            // reload buffer
+            self.sd
+                .read_block(self.byte_addr / (BLOCK_SIZE as u32), 1, &mut self.buffer)
+                .map_err(cmd_error_to_io_error)?;
+            self.index = (self.byte_addr as usize) % BLOCK_SIZE;
+        }
+        Ok(&self.buffer[self.index..])
+    }
+
+    fn consume(&mut self, amt: usize) {
+        self.index += amt;
+        self.byte_addr += amt as u32;
+    }
+}
+
+impl Write for SdReader {
+    fn write(&mut self, buf: &[u8]) -> IoResult<usize> {
+        let (a, b, c) = self.block_align(buf);
+        self.write_unaligned(a)?;
+        if b.len() > 0 {
+            self.flush()?;
+            self.invalidate_buffer();
+            if let Err(_) = self.sd.write_block(
+                self.byte_addr / BLOCK_SIZE as u32,
+                (b.len() / BLOCK_SIZE) as u16,
+                b,
+            ) {
+                return Ok(a.len());
+            }
+            self.byte_addr += b.len() as u32;
+        }
+        if let Err(_) = self.write_unaligned(c) {
+            return Ok(a.len() + b.len());
+        }
+        Ok(buf.len())
+    }
+
+    fn flush(&mut self) -> IoResult<()> {
+        if self.dirty {
+            let block_addr = (self.byte_addr - self.index as u32) / (BLOCK_SIZE as u32);
+            self.sd
+                .write_block(block_addr, 1, &self.buffer)
+                .map_err(cmd_error_to_io_error)?;
+            self.dirty = false;
+        }
+        Ok(())
+    }
+}
+
+impl Seek for SdReader {
+    fn seek(&mut self, pos: SeekFrom) -> IoResult<u64> {
+        let raw_target = match pos {
+            SeekFrom::Start(x) => self.offset as i64 + x as i64,
+            SeekFrom::Current(x) => self.byte_addr as i64 + x,
+            SeekFrom::End(_) => panic!("SD card does not support seek from end"),
+        };
+        if raw_target < self.offset as i64 || raw_target > core::u32::MAX as i64 {
+            return Err(Error::new(ErrorKind::InvalidInput, "Invalid address"));
+        }
+        let target_byte_addr = raw_target as u32;
+        let address_same_block =
+            self.byte_addr / (BLOCK_SIZE as u32) == target_byte_addr / (BLOCK_SIZE as u32);
+        // if the buffer was invalidated, we consider seek as different block
+        let same_block = address_same_block && self.index != BLOCK_SIZE;
+        if !same_block {
+            self.flush()?;
+        }
+        self.byte_addr = target_byte_addr;
+        self.index = if same_block {
+            target_byte_addr as usize % BLOCK_SIZE
+        } else {
+            // invalidate the buffer as we moved to a different block
+            BLOCK_SIZE
+        };
+        Ok((self.byte_addr - self.offset) as u64)
+    }
+}
+
+impl Drop for SdReader {
+    fn drop(&mut self) {
+        // just try to flush it, ignore error if any
+        self.flush().unwrap_or(());
+    }
+}
--- a/libcortex_a9/Cargo.toml
+++ b/libcortex_a9/Cargo.toml
@ -1,15 +1,14 @@
 [package]
 name = "libcortex_a9"
 version = "0.0.0"
-authors = ["Astro <astro@spaceboyz.net>"]
+authors = ["M-Labs"]
 edition = "2018"

 [features]
-target_zc706 = []
-target_cora_z7_10 = []
 power_saving = []
-default = ["target_zc706"]
+default = []

 [dependencies]
 bit_field = "0.10"
+volatile-register = "0.2"
 libregister = { path = "../libregister" }
--- a/libcortex_a9/src/cache.rs
+++ b/libcortex_a9/src/cache.rs
@ -1,4 +1,5 @@
 use super::asm::{dmb, dsb};
+use super::l2c::*;

 /// Invalidate TLBs
 #[inline(always)]
@ -52,10 +53,9 @@ pub fn dccisw(setway: u32) {
    }
 }

-
 /// A made-up "instruction": invalidate all of the L1 D-Cache
 #[inline(always)]
-pub fn dciall() {
+pub fn dciall_l1() {
    // the cache associativity could be read from a register, but will
    // always be 4 in L1 data cache of a cortex a9
    let ways = 4;
@ -80,9 +80,17 @@ pub fn dciall() {
    }
 }

+/// A made-up "instruction": invalidate all of the L1 L2 D-Cache
+#[inline(always)]
+pub fn dciall() {
+    dmb();
+    l2_cache_invalidate_all();
+    dciall_l1();
+}
+
 /// A made-up "instruction": flush and invalidate all of the L1 D-Cache
 #[inline(always)]
-pub fn dcciall() {
+pub fn dcciall_l1() {
    // the cache associativity could be read from a register, but will
    // always be 4 in L1 data cache of a cortex a9
    let ways = 4;
@ -107,6 +115,15 @@ pub fn dcciall() {
    }
 }

+#[inline(always)]
+pub  fn dcciall() {
+    dmb();
+    dcciall_l1();
+    dsb();
+    l2_cache_clean_invalidate_all();
+    dcciall_l1();
+    dsb();
+}

 const CACHE_LINE: usize = 0x20;
 const CACHE_LINE_MASK: usize = CACHE_LINE - 1;
@ -145,7 +162,16 @@ pub fn dccimvac(addr: usize) {

 /// Data cache clean and invalidate for an object.
 pub fn dcci<T>(object: &T) {
+    // ref: L2C310 TRM 3.3.10
    dmb();
+    for addr in object_cache_line_addrs(object) {
+        dccmvac(addr);
+    }
+    dsb();
+    for addr in object_cache_line_addrs(object) {
+        l2_cache_clean_invalidate(addr);
+    }
+    l2_cache_sync();
    for addr in object_cache_line_addrs(object) {
        dccimvac(addr);
    }
@ -154,6 +180,14 @@ pub fn dcci<T>(object: &T) {

 pub fn dcci_slice<T>(slice: &[T]) {
    dmb();
+    for addr in slice_cache_line_addrs(slice) {
+        dccmvac(addr);
+    }
+    dsb();
+    for addr in slice_cache_line_addrs(slice) {
+        l2_cache_clean_invalidate(addr);
+    }
+    l2_cache_sync();
    for addr in slice_cache_line_addrs(slice) {
        dccimvac(addr);
    }
@ -175,17 +209,28 @@ pub fn dcc<T>(object: &T) {
        dccmvac(addr);
    }
    dsb();
+    for addr in object_cache_line_addrs(object) {
+        l2_cache_clean(addr);
+    }
+    l2_cache_sync();
 }

 /// Data cache clean for an object. Panics if not properly
 /// aligned and properly sized to be contained in an exact number of
 /// cache lines.
 pub fn dcc_slice<T>(slice: &[T]) {
+    if slice.len() == 0 {
+        return;
+    }
    dmb();
    for addr in slice_cache_line_addrs(slice) {
        dccmvac(addr);
    }
    dsb();
+    for addr in slice_cache_line_addrs(slice) {
+        l2_cache_clean(addr);
+    }
+    l2_cache_sync();
 }

 /// Data cache invalidate by memory virtual address. This and
@ -205,6 +250,10 @@ pub unsafe fn dci<T>(object: &mut T) {
    assert_eq!(beyond_addr & CACHE_LINE_MASK, 0, "dci object beyond_addr must be aligned");

    dmb();
+    for addr in (first_addr..beyond_addr).step_by(CACHE_LINE) {
+        l2_cache_invalidate(addr);
+    }
+    l2_cache_sync();
    for addr in (first_addr..beyond_addr).step_by(CACHE_LINE) {
        dcimvac(addr);
    }
@ -219,6 +268,10 @@ pub unsafe fn dci_slice<T>(slice: &mut [T]) {
    assert_eq!(beyond_addr & CACHE_LINE_MASK, 0, "dci slice beyond_addr must be aligned");

    dmb();
+    for addr in (first_addr..beyond_addr).step_by(CACHE_LINE) {
+        l2_cache_invalidate(addr);
+    }
+    l2_cache_sync();
    for addr in (first_addr..beyond_addr).step_by(CACHE_LINE) {
        dcimvac(addr);
    }
--- a/libcortex_a9/src/l2c.rs
+++ b/libcortex_a9/src/l2c.rs
@ -0,0 +1,333 @@
+use libregister::{register, register_at, register_bit, register_bits, RegisterRW, RegisterR, RegisterW};
+use super::asm::dmb;
+use volatile_register::RW;
+
+/// enable L2 cache with specific prefetch offset
+/// prefetch offset requires manual tuning, it seems that 8 is good for ZC706 current settings
+pub fn enable_l2_cache(offset: u8) {
+    dmb();
+    let regs = RegisterBlock::new();
+    // disable L2 cache
+    regs.reg1_control.modify(|_, w| w.l2_enable(false));
+
+    regs.reg15_prefetch_ctrl.modify(|_, w|
+        w.instr_prefetch_en(true)
+            .data_prefetch_en(true)
+            .double_linefill_en(true)
+            .incr_double_linefill_en(true)
+            .pref_drop_en(true)
+            .prefetch_offset(offset)
+    );
+    regs.reg1_aux_control.modify(|_, w| {
+        w.early_bresp_en(true)
+            .instr_prefetch_en(true)
+            .data_prefetch_en(true)
+            .cache_replace_policy(true)
+            .way_size(3)
+    });
+    regs.reg1_tag_ram_control.modify(|_, w| w.ram_wr_access_lat(1).ram_rd_access_lat(1).ram_setup_lat(1));
+    regs.reg1_data_ram_control.modify(|_, w| w.ram_wr_access_lat(1).ram_rd_access_lat(2).ram_setup_lat(1));
+    // invalidate L2 ways
+    unsafe {
+        regs.reg7_inv_way.write(0xFFFF);
+    }
+    // poll for completion
+    while regs.reg7_cache_sync.read().c() {}
+    // write to a magic memory location with a magic sequence
+    // required in UG585 Section 3.4.10 Initialization Sequence
+    unsafe {
+        core::ptr::write_volatile(0xF8000008usize as *mut u32, 0xDF0D);
+        core::ptr::write_volatile(0xF8000A1Cusize as *mut u32, 0x020202);
+        core::ptr::write_volatile(0xF8000004usize as *mut u32, 0x767B);
+    }
+    regs.reg1_control.modify(|_, w| w.l2_enable(true));
+    dmb();
+}
+
+#[inline(always)]
+pub fn l2_cache_invalidate_all()  {
+    let regs = RegisterBlock::new();
+    unsafe {
+        regs.reg7_inv_way.write(0xFFFF);
+    }
+    // poll for completion
+    while regs.reg7_cache_sync.read().c() {}
+}
+
+#[inline(always)]
+pub fn l2_cache_clean_all()  {
+    let regs = RegisterBlock::new();
+    unsafe  {
+        regs.reg7_clean_way.write(0xFFFF);
+    }
+    // poll for completion
+    while regs.reg7_cache_sync.read().c() {}
+}
+
+#[inline(always)]
+pub fn l2_cache_clean_invalidate_all()  {
+    let regs = RegisterBlock::new();
+    unsafe {
+        regs.reg7_clean_inv_way.write(0xFFFF);
+    }
+    // poll for completion
+    while regs.reg7_cache_sync.read().c() {}
+}
+
+/// L2 cache sync, similar to dsb for L1 cache
+#[inline(always)]
+pub fn l2_cache_sync() {
+    let regs = RegisterBlock::new();
+    regs.reg7_cache_sync.write(Reg7CacheSync::zeroed().c(false));
+}
+
+#[inline(always)]
+pub fn l2_cache_clean(addr: usize) {
+    let regs = RegisterBlock::new();
+    unsafe {
+        regs.reg7_clean_pa.write(addr as u32);
+    }
+}
+
+#[inline(always)]
+pub fn l2_cache_invalidate(addr: usize) {
+    let regs = RegisterBlock::new();
+    unsafe {
+        regs.reg7_inv_pa.write(addr as u32);
+    }
+}
+
+#[inline(always)]
+pub fn l2_cache_clean_invalidate(addr: usize) {
+    let regs = RegisterBlock::new();
+    unsafe {
+        regs.reg7_clean_inv_pa.write(addr as u32);
+    }
+}
+
+#[repr(C)]
+struct RegisterBlock {
+    /// cache ID register, Returns the 32-bit device ID code it reads off the CACHEID input bus.
+    /// The value is specified by the system integrator. Reset value: 0x410000c8
+    pub reg0_cache_id: Reg0CacheId,
+    /// cache type register, Returns the 32-bit cache type. Reset value: 0x1c100100
+    pub reg0_cache_type: Reg0CacheType,
+    unused0: [u32; 62],
+    /// control register, reset value: 0x0
+    pub reg1_control: Reg1Control,
+    /// auxilary control register, reset value: 0x02020000
+    pub reg1_aux_control: Reg1AuxControl,
+    /// Configures Tag RAM latencies
+    pub reg1_tag_ram_control: Reg1TagRamControl,
+    /// configures data RAM latencies
+    pub reg1_data_ram_control: Reg1DataRamControl,
+    unused1: [u32; 60],
+    /// Permits the event counters to be enabled and reset.
+    pub reg2_ev_counter_ctrl: Reg2EvCounterCtrl,
+    /// Enables event counter 1 to be driven by a specific event. Counter 1 increments when the
+    /// event occurs.
+    pub reg2_ev_counter1_cfg: Reg2EvCounter1Cfg,
+    /// Enables event counter 0 to be driven by a specific event. Counter 0 increments when the
+    /// event occurs.
+    pub reg2_ev_counter0_cfg: Reg2EvCounter0Cfg,
+    /// Enable the programmer to read off the counter value. The counter counts an event as
+    /// specified by the Counter Configuration Registers. The counter can be preloaded if counting
+    /// is disabled and reset by the Event Counter Control Register.
+    pub reg2_ev_counter1: RW<u32>,
+    /// Enable the programmer to read off the counter value. The counter counts an event as
+    /// specified by the Counter Configuration Registers. The counter can be preloaded if counting
+    /// is disabled and reset by the Event Counter Control Register.
+    pub reg2_ev_counter0: RW<u32>,
+    /// This register enables or masks interrupts from being triggered on the external pins of the
+    /// cache controller. Figure 3-8 on page 3-17 shows the register bit assignments. The bit
+    /// assignments enables the masking of the interrupts on both their individual outputs and the
+    /// combined L2CCINTR line. Clearing a bit by writing a 0, disables the interrupt triggering on
+    /// that pin. All bits are cleared by a reset. You must write to the register bits with a 1 to
+    /// enable the generation of interrupts. 1 = Enabled. 0 = Masked. This is the default.
+    pub reg2_int_mask: Reg2IntMask,
+    /// This register is a read-only.It returns the masked interrupt status. This register can be
+    /// accessed by secure and non-secure operations. The register gives an AND function of the raw
+    /// interrupt status with the values of the interrupt mask register. All the bits are cleared
+    /// by a reset. A write to this register is ignored. Bits read can be HIGH or LOW: HIGH If the
+    /// bits read HIGH, they reflect the status of the input lines triggering an interrupt. LOW If
+    /// the bits read LOW, either no interrupt has been generated, or the interrupt is masked.
+    pub reg2_int_mask_status: Reg2IntMaskStatus,
+    /// The Raw Interrupt Status Register enables the interrupt status that excludes the masking
+    /// logic. Bits read can be HIGH or LOW: HIGH If the bits read HIGH, they reflect the status of
+    /// the input lines triggering an interrupt. LOW If the bits read LOW, no interrupt has been
+    /// generated.
+    pub reg2_int_raw_status: Reg2IntRawStatus,
+    /// Clears the Raw Interrupt Status Register bits. When a bit is written as 1, it clears the
+    /// corresponding bit in the Raw Interrupt Status Register. When a bit is written as 0, it has
+    /// no effect
+    pub reg2_int_clear: Reg2IntClear,
+    unused2: [u32; 323],
+    /// Drain the STB. Operation complete when all buffers, LRB, LFB, STB, and EB, are empty
+    pub reg7_cache_sync: Reg7CacheSync,
+    unused3: [u32; 15],
+    /// Invalidate Line by PA: Specific L2 cache line is marked as not valid
+    pub reg7_inv_pa: RW<u32>,
+    unused4: [u32; 2],
+    /// Invalidate by Way Invalidate all data in specified ways, including dirty data. An
+    /// Invalidate by way while selecting all cache ways is equivalent to invalidating all cache
+    /// entries. Completes as a background task with the way, or ways, locked, preventing
+    /// allocation.
+    pub reg7_inv_way: RW<u32>,
+    unused5: [u32; 12],
+    /// Clean Line by PA Write the specific L2 cache line to L3 main memory if the line is marked
+    /// as valid and dirty. The line is marked as not dirty. The valid bit is unchanged
+    pub reg7_clean_pa: RW<u32>,
+    unused6: [u32; 1],
+    /// Clean Line by Set/Way Write the specific L2 cache line within the specified way to L3 main
+    /// memory if the line is marked as valid and dirty. The line is marked as not dirty. The valid
+    /// bit is unchanged
+    pub reg7_clean_index: Reg7CleanIndex,
+    /// Clean by Way Writes each line of the specified L2 cache ways to L3 main memory if the line
+    /// is marked as valid and dirty. The lines are marked as not dirty. The valid bits are
+    /// unchanged. Completes as a background task with the way, or ways, locked, preventing
+    /// allocation.
+    pub reg7_clean_way: RW<u32>,
+    unused7: [u32; 12],
+    /// Clean and Invalidate Line by PA Write the specific L2 cache line to L3 main memory if the
+    /// line is marked as valid and dirty. The line is marked as not valid
+    pub reg7_clean_inv_pa: RW<u32>,
+    unused8: [u32; 1],
+    /// Clean and Invalidate Line by Set/Way Write the specific L2 cache line within the specified
+    /// way to L3 main memory if the line is marked as valid and dirty. The line is marked as not
+    /// valid
+    pub reg7_clean_inv_index: Reg7CleanInvIndex,
+    /// Clean and Invalidate by Way Writes each line of the specified L2 cache ways to L3 main
+    /// memory if the line is marked as valid and dirty. The lines are marked as not valid.
+    /// Completes as a background task with the way, or ways, locked, preventing allocation.
+    pub reg7_clean_inv_way: RW<u32>,
+    unused9: [u32; 0x1D8],
+    pub reg15_prefetch_ctrl: Reg15PrefetechCtrl,
+}
+
+register_at!(RegisterBlock, 0xF8F02000, new);
+
+register!(reg0_cache_id, Reg0CacheId, RW, u32);
+register_bits!(reg0_cache_id, implementer, u8, 24, 31);
+register_bits!(reg0_cache_id, cache_id, u8, 10, 15);
+register_bits!(reg0_cache_id, part_num, u8, 6, 9);
+register_bits!(reg0_cache_id, rtl_release, u8, 0, 5);
+
+register!(reg0_cache_type, Reg0CacheType, RW, u32);
+register_bit!(reg0_cache_type, data_banking, 31);
+register_bits!(reg0_cache_type, ctype, u8, 25, 28);
+register_bit!(reg0_cache_type, h, 24);
+register_bits!(reg0_cache_type, dsize_middsize_19, u8, 20, 22);
+register_bit!(reg0_cache_type, l2_assoc_d, 18);
+register_bits!(reg0_cache_type, l2cache_line_len_disize_11, u8, 12, 13);
+register_bits!(reg0_cache_type, isize_midisize_7, u8, 8, 10);
+register_bit!(reg0_cache_type, l2_assoc_i, 6);
+register_bits!(reg0_cache_type, l2cache_line_len_i, u8, 0, 1);
+
+register!(reg1_control, Reg1Control, RW, u32);
+register_bit!(reg1_control, l2_enable, 0);
+
+register!(reg1_aux_control, Reg1AuxControl, RW, u32);
+register_bit!(reg1_aux_control, early_bresp_en, 30);
+register_bit!(reg1_aux_control, instr_prefetch_en, 29);
+register_bit!(reg1_aux_control, data_prefetch_en, 28);
+register_bit!(reg1_aux_control, nonsec_inte_access_ctrl, 27);
+register_bit!(reg1_aux_control, nonsec_lockdown_en, 26);
+register_bit!(reg1_aux_control, cache_replace_policy, 25);
+register_bits!(reg1_aux_control, force_write_alloc, u8, 23, 24);
+register_bit!(reg1_aux_control, shared_attr_override_en, 22);
+register_bit!(reg1_aux_control, parity_en, 21);
+register_bit!(reg1_aux_control, event_mon_bus_en, 20);
+register_bits!(reg1_aux_control, way_size, u8, 17, 19);
+register_bit!(reg1_aux_control, associativity, 16);
+register_bit!(reg1_aux_control, shared_attr_inva_en, 13);
+register_bit!(reg1_aux_control, ex_cache_config, 12);
+register_bit!(reg1_aux_control, store_buff_dev_lim_en, 11);
+register_bit!(reg1_aux_control, high_pr_so_dev_rd_en, 10);
+register_bit!(reg1_aux_control, full_line_zero_enable, 0);
+
+register!(reg1_tag_ram_control, Reg1TagRamControl, RW, u32);
+register_bits!(reg1_tag_ram_control, ram_wr_access_lat, u8, 8, 10);
+register_bits!(reg1_tag_ram_control, ram_rd_access_lat, u8, 4, 6);
+register_bits!(reg1_tag_ram_control, ram_setup_lat, u8, 0, 2);
+
+register!(reg1_data_ram_control, Reg1DataRamControl, RW, u32);
+register_bits!(reg1_data_ram_control, ram_wr_access_lat, u8, 8, 10);
+register_bits!(reg1_data_ram_control, ram_rd_access_lat, u8, 4, 6);
+register_bits!(reg1_data_ram_control, ram_setup_lat, u8, 0, 2);
+
+register!(reg2_ev_counter_ctrl, Reg2EvCounterCtrl, RW, u32);
+register_bit!(reg2_ev_counter_ctrl, ev_ctr_en, 0);
+
+register!(reg2_ev_counter1_cfg, Reg2EvCounter1Cfg, RW, u32);
+register_bits!(reg2_ev_counter1_cfg, ctr_ev_src, u8, 2, 5);
+register_bits!(reg2_ev_counter1_cfg, ev_ctr_intr_gen, u8, 0, 1);
+
+register!(reg2_ev_counter0_cfg, Reg2EvCounter0Cfg, RW, u32);
+register_bits!(reg2_ev_counter0_cfg, ctr_ev_src, u8, 2, 5);
+register_bits!(reg2_ev_counter0_cfg, ev_ctr_intr_gen, u8, 0, 1);
+
+register!(reg2_int_mask, Reg2IntMask, RW, u32);
+register_bit!(reg2_int_mask, decerr, 8);
+register_bit!(reg2_int_mask, slverr, 7);
+register_bit!(reg2_int_mask, errrd, 6);
+register_bit!(reg2_int_mask, errrt, 5);
+register_bit!(reg2_int_mask, errwd, 4);
+register_bit!(reg2_int_mask, errwt, 3);
+register_bit!(reg2_int_mask, parrd, 2);
+register_bit!(reg2_int_mask, parrt, 1);
+register_bit!(reg2_int_mask, ecntr, 0);
+
+register!(reg2_int_mask_status, Reg2IntMaskStatus, RW, u32);
+register_bit!(reg2_int_mask_status, decerr, 8);
+register_bit!(reg2_int_mask_status, slverr, 7);
+register_bit!(reg2_int_mask_status, errrd, 6);
+register_bit!(reg2_int_mask_status, errrt, 5);
+register_bit!(reg2_int_mask_status, errwd, 4);
+register_bit!(reg2_int_mask_status, errwt, 3);
+register_bit!(reg2_int_mask_status, parrd, 2);
+register_bit!(reg2_int_mask_status, parrt, 1);
+register_bit!(reg2_int_mask_status, ecntr, 0);
+
+register!(reg2_int_raw_status, Reg2IntRawStatus, RW, u32);
+register_bit!(reg2_int_raw_status, decerr, 8);
+register_bit!(reg2_int_raw_status, slverr, 7);
+register_bit!(reg2_int_raw_status, errrd, 6);
+register_bit!(reg2_int_raw_status, errrt, 5);
+register_bit!(reg2_int_raw_status, errwd, 4);
+register_bit!(reg2_int_raw_status, errwt, 3);
+register_bit!(reg2_int_raw_status, parrd, 2);
+register_bit!(reg2_int_raw_status, parrt, 1);
+register_bit!(reg2_int_raw_status, ecntr, 0);
+
+register!(reg2_int_clear, Reg2IntClear, RW, u32, 0);
+register_bit!(reg2_int_clear, decerr, 8, WTC);
+register_bit!(reg2_int_clear, slverr, 7, WTC);
+register_bit!(reg2_int_clear, errrd, 6, WTC);
+register_bit!(reg2_int_clear, errrt, 5, WTC);
+register_bit!(reg2_int_clear, errwd, 4, WTC);
+register_bit!(reg2_int_clear, errwt, 3, WTC);
+register_bit!(reg2_int_clear, parrd, 2, WTC);
+register_bit!(reg2_int_clear, parrt, 1, WTC);
+register_bit!(reg2_int_clear, ecntr, 0, WTC);
+
+register!(reg7_cache_sync, Reg7CacheSync, RW, u32);
+register_bit!(reg7_cache_sync, c, 0);
+
+register!(reg7_clean_index, Reg7CleanIndex, RW, u32);
+register_bits!(reg7_clean_index, way, u8, 28, 30);
+register_bits!(reg7_clean_index, index, u8, 5, 11);
+register_bit!(reg7_clean_index, c, 0);
+
+register!(reg7_clean_inv_index, Reg7CleanInvIndex, RW, u32);
+register_bits!(reg7_clean_inv_index, way, u8, 28, 30);
+register_bits!(reg7_clean_inv_index, index, u8, 5, 11);
+register_bit!(reg7_clean_inv_index, c, 0);
+
+register!(reg15_prefetch_ctrl, Reg15PrefetechCtrl, RW, u32);
+register_bit!(reg15_prefetch_ctrl, double_linefill_en, 30);
+register_bit!(reg15_prefetch_ctrl, instr_prefetch_en, 29);
+register_bit!(reg15_prefetch_ctrl, data_prefetch_en, 28);
+register_bit!(reg15_prefetch_ctrl, pref_drop_en, 24);
+register_bit!(reg15_prefetch_ctrl, incr_double_linefill_en, 23);
+register_bits!(reg15_prefetch_ctrl, prefetch_offset, u8, 0, 4);
+
--- a/libcortex_a9/src/lib.rs
+++ b/libcortex_a9/src/lib.rs
@ -6,16 +6,17 @@
 extern crate alloc;

 pub mod asm;
-pub mod regs;
 pub mod cache;
+mod fpu;
+pub mod l2c;
 pub mod mmu;
 pub mod mutex;
-pub mod sync_channel;
+pub mod regs;
 pub mod semaphore;
+pub mod sync_channel;
 mod uncached;
-mod fpu;
-pub use uncached::UncachedSlice;
 pub use fpu::enable_fpu;
+pub use uncached::UncachedSlice;

 global_asm!(include_str!("exceptions.s"));

@ -34,3 +35,38 @@ pub fn notify_spin_lock() {
    }
 }

+#[macro_export]
+/// Interrupt handler, which setup the stack and jump to actual interrupt handler.
+/// - `name` is the name of the interrupt, should be the same as the one defined in vector table.
+/// - `name2` is the name for the actual handler, should be different from name.
+/// - `stack0` is the stack for the interrupt handler when called from core0.
+/// - `stack1` is the stack for the interrupt handler when called from core1.
+/// - `body` is the body of the actual interrupt handler, should be a normal unsafe rust function
+/// body.
+///
+/// Note that the interrupt handler would use the same stack as normal programs by default, so
+/// interrupt handlers should not return to normal program or it may corrupt the stack.
+macro_rules! interrupt_handler {
+    ($name:ident, $name2:ident, $stack0:ident, $stack1:ident, $body:block) => {
+        #[link_section = ".text.boot"]
+        #[no_mangle]
+        #[naked]
+        pub unsafe extern "C" fn $name() -> ! {
+            asm!(
+                // setup SP, depending on CPU 0 or 1
+                "mrc p15, #0, r0, c0, c0, #5",
+                concat!("movw r1, :lower16:", stringify!($stack0)),
+                concat!("movt r1, :upper16:", stringify!($stack0)),
+                "tst r0, #3",
+                concat!("movwne r1, :lower16:", stringify!($stack1)),
+                concat!("movtne r1, :upper16:", stringify!($stack1)),
+                "mov sp, r1",
+                concat!("bl ", stringify!($name2)),
+                options(noreturn)
+            );
+        }
+
+        #[no_mangle]
+        pub unsafe extern "C" fn $name2() -> ! $body
+    };
+}
--- a/libcortex_a9/src/mmu.rs
+++ b/libcortex_a9/src/mmu.rs
@ -158,7 +158,7 @@ impl L1Table {
                global: true,
                shareable: true,
                access: AccessPermissions::FullAccess,
-                tex: 0b101,
+                tex: 0b0,
                domain: 0b1111,
                exec: true,
                cacheable: true,
@ -213,7 +213,7 @@ impl L1Table {
                access: AccessPermissions::FullAccess,
                tex: 0,
                domain: 0,
-                exec: true,
+                exec: false,
                cacheable: false,
                bufferable: true,
            });
@ -410,6 +410,7 @@ pub fn with_mmu<F: FnMut() -> !>(l1table: &L1Table, mut f: F) -> ! {
            .a(false)
            .c(true)
            .i(true)
+            .z(true)
            .unaligned(true)
    );

--- a/libcortex_a9/src/mutex.rs
+++ b/libcortex_a9/src/mutex.rs
@ -3,7 +3,7 @@ use core::sync::atomic::{AtomicU32, Ordering};
 use core::cell::UnsafeCell;
 use super::{
    spin_lock_yield, notify_spin_lock,
-    asm::{dmb, enter_critical, exit_critical}
+    asm::{enter_critical, exit_critical}
 };

 const LOCKED: u32 = 1;
@ -32,30 +32,27 @@ impl<T> Mutex<T> {
    /// Lock the Mutex, blocks when already locked
    pub fn lock(&self) -> MutexGuard<T> {
        let mut irq = unsafe { enter_critical() };
-        while self.locked.compare_and_swap(UNLOCKED, LOCKED, Ordering::Acquire) != UNLOCKED {
+        while self.locked.compare_exchange_weak(UNLOCKED, LOCKED, Ordering::AcqRel, Ordering::Relaxed).is_err() {
            unsafe {
                exit_critical(irq);
                spin_lock_yield();
                irq = enter_critical();
            }
        }
-        dmb();
        MutexGuard { mutex: self, irq }
    }

    pub fn try_lock(&self) -> Option<MutexGuard<T>> {
        let irq = unsafe { enter_critical() };
-        if self.locked.compare_and_swap(UNLOCKED, LOCKED, Ordering::Acquire) != UNLOCKED {
+        if self.locked.compare_exchange_weak(UNLOCKED, LOCKED, Ordering::AcqRel, Ordering::Relaxed).is_err() {
            unsafe { exit_critical(irq) };
            None
        } else {
-            dmb();
            Some(MutexGuard { mutex: self, irq })
        }
    }

    fn unlock(&self) {
-        dmb();
        self.locked.store(UNLOCKED, Ordering::Release);

        notify_spin_lock();
--- a/libcortex_a9/src/regs.rs
+++ b/libcortex_a9/src/regs.rs
@ -156,6 +156,8 @@ register_bit!(actlr, excl, 7);
 register_bit!(actlr, smp, 6);
 register_bit!(actlr, write_full_line_of_zeros, 3);
 register_bit!(actlr, l1_prefetch_enable, 2);
+// L2 cache prefetch hint, in UG585 section 3.4.8
+register_bit!(actlr, l2_prefetch_enable, 1);
 // Cache/TLB maintenance broadcast
 register_bit!(actlr, fw, 0);

@ -171,7 +173,11 @@ impl RegisterRW for ACTLR {

 impl ACTLR {
    pub fn enable_smp(&mut self) {
-        self.modify(|_, w| w.smp(true).fw(true));
+        self.modify(|_, w| w.smp(true).fw(true).alloc_one_way(true));
+    }
+
+    pub fn enable_prefetch(&mut self) {
+        self.modify(|_, w| w.l1_prefetch_enable(true).l2_prefetch_enable(true))
    }
 }

--- a/libcortex_a9/src/semaphore.rs
+++ b/libcortex_a9/src/semaphore.rs
@ -12,7 +12,7 @@ pub struct Semaphore {
 }

 impl Semaphore {
-    pub fn new(value: i32, max: i32) -> Self {
+    pub const fn new(value: i32, max: i32) -> Self {
        Semaphore { value: AtomicI32::new(value), max}
    }

@ -20,7 +20,7 @@ impl Semaphore {
        loop {
            let value = self.value.load(Ordering::Relaxed);
            if value > 0 {
-                if self.value.compare_and_swap(value, value - 1, Ordering::SeqCst) == value {
+                if self.value.compare_exchange_weak(value, value - 1, Ordering::SeqCst, Ordering::Relaxed).is_ok() {
                    return Some(());
                }
            } else {
@ -58,7 +58,7 @@ impl Semaphore {
        loop {
            let value = self.value.load(Ordering::Relaxed);
            if value < self.max {
-                if self.value.compare_and_swap(value, value + 1, Ordering::SeqCst) == value {
+                if self.value.compare_exchange_weak(value, value + 1, Ordering::SeqCst, Ordering::Relaxed).is_ok() {
                    notify_spin_lock();
                    return;
                }
--- a/libcortex_a9/src/sync_channel.rs
+++ b/libcortex_a9/src/sync_channel.rs
@ -1,7 +1,6 @@
 use core::{
    pin::Pin,
    future::Future,
-    ptr::drop_in_place,
    sync::atomic::{AtomicPtr, AtomicUsize, Ordering},
    task::{Context, Poll},
 };
@ -38,7 +37,7 @@ impl<'a, T> Sender<'a, T> where T: Clone {
            notify_spin_lock();
            if !prev.is_null() {
                unsafe {
-                    drop_in_place(prev);
+                    Box::from_raw(prev);
                }
            }
            Ok(())
@ -92,7 +91,7 @@ impl<'a, T> Sender<'a, T> where T: Clone {
        for v in self.list.iter() {
            let original = v.swap(core::ptr::null_mut(), Ordering::Relaxed);
            if !original.is_null() {
-                drop_in_place(original);
+                Box::from_raw(original);
            }
        }
    }
--- a/libcortex_a9/src/uncached.rs
+++ b/libcortex_a9/src/uncached.rs
@ -2,7 +2,7 @@ use core::{
    ops::{Deref, DerefMut},
    mem::{align_of, size_of},
 };
-use alloc::alloc::{dealloc, Layout, LayoutErr};
+use alloc::alloc::{dealloc, Layout, LayoutError};
 use crate::mmu::{L1_PAGE_SIZE, L1Table};

 pub struct UncachedSlice<T: 'static> {
@ -12,7 +12,7 @@ pub struct UncachedSlice<T: 'static> {

 impl<T> UncachedSlice<T> {
    /// allocates in chunks of 1 MB
-    pub fn new<F: Fn() -> T>(len: usize, default: F) -> Result<Self, LayoutErr> {
+    pub fn new<F: Fn() -> T>(len: usize, default: F) -> Result<Self, LayoutError> {
        // round to full pages
        let size = ((len * size_of::<T>() - 1) | (L1_PAGE_SIZE - 1)) + 1;
        let align = align_of::<T>()
@ -23,10 +23,11 @@ impl<T> UncachedSlice<T> {
        assert_eq!(start & (L1_PAGE_SIZE - 1), 0);

        for page_start in (start..(start + size)).step_by(L1_PAGE_SIZE) {
+            // non-shareable device
            L1Table::get()
                .update(page_start as *const (), |l1_section| {
-                    l1_section.tex = 0b100;
-                    l1_section.cacheable = false;
+                    l1_section.tex = 0b10;
+                    l1_section.cacheable = true;
                    l1_section.bufferable = false;
                });
        }
--- a/libregister/Cargo.toml
+++ b/libregister/Cargo.toml
@ -1,7 +1,7 @@
 [package]
 name = "libregister"
 version = "0.0.0"
-authors = ["Astro <astro@spaceboyz.net>"]
+authors = ["M-Labs"]
 edition = "2018"

 [dependencies]
--- a/libregister/src/lib.rs
+++ b/libregister/src/lib.rs
@ -30,8 +30,9 @@ pub trait RegisterRW: RegisterR + RegisterW {
 #[doc(hidden)]
 #[macro_export]
 macro_rules! register_common {
-    ($mod_name: ident, $struct_name: ident, $access: ty, $inner: ty) => (
+    ($mod_name: ident, $(#[$outer:meta])* $struct_name: ident, $access: ty, $inner: ty) => (
        #[repr(C)]
+        $(#[$outer])*
        pub struct $struct_name {
            inner: $access,
        }
@ -52,7 +53,7 @@ macro_rules! register_common {
 #[macro_export]
 macro_rules! register_r {
    ($mod_name: ident, $struct_name: ident) => (
-        impl libregister::RegisterR for $struct_name {
+        impl $crate::RegisterR for $struct_name {
            type R = $mod_name::Read;

            #[inline]
@ -67,7 +68,7 @@ macro_rules! register_r {
 #[macro_export]
 macro_rules! register_w {
    ($mod_name: ident, $struct_name: ident) => (
-        impl libregister::RegisterW for $struct_name {
+        impl $crate::RegisterW for $struct_name {
            type W = $mod_name::Write;

            #[inline]
@ -88,7 +89,7 @@ macro_rules! register_w {
 #[macro_export]
 macro_rules! register_rw {
    ($mod_name: ident, $struct_name: ident) => (
-        impl libregister::RegisterRW for $struct_name {
+        impl $crate::RegisterRW for $struct_name {
            #[inline]
            fn modify<F: FnOnce(Self::R, Self::W) -> Self::W>(&mut self, f: F) {
                unsafe {
@ -101,7 +102,7 @@ macro_rules! register_rw {
        }
    );
    ($mod_name: ident, $struct_name: ident, $mask: expr) => (
-        impl libregister::RegisterRW for $struct_name {
+        impl $crate::RegisterRW for $struct_name {
            #[inline]
            fn modify<F: FnOnce(Self::R, Self::W) -> Self::W>(&mut self, f: F) {
                unsafe {
@ -119,7 +120,7 @@ macro_rules! register_rw {
 #[macro_export]
 macro_rules! register_vcell {
    ($mod_name: ident, $struct_name: ident) => (
-        impl libregister::RegisterR for $struct_name {
+        impl $crate::RegisterR for $struct_name {
            type R = $mod_name::Read;

            #[inline]
@ -128,7 +129,7 @@ macro_rules! register_vcell {
                $mod_name::Read { inner }
            }
        }
-        impl libregister::RegisterW for $struct_name {
+        impl $crate::RegisterW for $struct_name {
            type W = $mod_name::Write;

            #[inline]
@ -141,7 +142,7 @@ macro_rules! register_vcell {
                self.inner.set(w.inner);
            }
        }
-        impl libregister::RegisterRW for $struct_name {
+        impl $crate::RegisterRW for $struct_name {
            #[inline]
            fn modify<F: FnOnce(Self::R, Self::W) -> Self::W>(&mut self, f: F) {
                let r = self.read();
@ -157,37 +158,37 @@ macro_rules! register_vcell {
 #[macro_export]
 macro_rules! register {
    // Define read-only register
-    ($mod_name: ident, $struct_name: ident, RO, $inner: ty) => (
-        libregister::register_common!($mod_name, $struct_name, libregister::RO<$inner>, $inner);
-        libregister::register_r!($mod_name, $struct_name);
+    ($mod_name: ident, $(#[$outer:meta])* $struct_name: ident, RO, $inner: ty) => (
+        $crate::register_common!($mod_name, $(#[$outer])* $struct_name, $crate::RO<$inner>, $inner);
+        $crate::register_r!($mod_name, $struct_name);
    );

    // Define write-only register
-    ($mod_name: ident, $struct_name: ident, WO, $inner: ty) => (
-        libregister::register_common!($mod_name, $struct_name, volatile_register::WO<$inner>, $inner);
-        libregister::register_w!($mod_name, $struct_name);
+    ($mod_name: ident, $(#[$outer:meta])* $struct_name: ident, WO, $inner: ty) => (
+        $crate::register_common!($mod_name, $(#[$outer])* $struct_name, volatile_register::WO<$inner>, $inner);
+        $crate::register_w!($mod_name, $struct_name);
    );

    // Define read-write register
-    ($mod_name: ident, $struct_name: ident, RW, $inner: ty) => (
-        libregister::register_common!($mod_name, $struct_name, volatile_register::RW<$inner>, $inner);
-        libregister::register_r!($mod_name, $struct_name);
-        libregister::register_w!($mod_name, $struct_name);
-        libregister::register_rw!($mod_name, $struct_name);
+    ($mod_name: ident, $(#[$outer:meta])* $struct_name: ident, RW, $inner: ty) => (
+        $crate::register_common!($mod_name, $(#[$outer])* $struct_name, volatile_register::RW<$inner>, $inner);
+        $crate::register_r!($mod_name, $struct_name);
+        $crate::register_w!($mod_name, $struct_name);
+        $crate::register_rw!($mod_name, $struct_name);
    );

    // Define read-write register
-    ($mod_name: ident, $struct_name: ident, VolatileCell, $inner: ty) => (
-        libregister::register_common!($mod_name, $struct_name, VolatileCell<$inner>, $inner);
-        libregister::register_vcell!($mod_name, $struct_name);
+    ($mod_name: ident, $(#[$outer:meta])* $struct_name: ident, VolatileCell, $inner: ty) => (
+        $crate::register_common!($mod_name, $(#[$outer])* $struct_name, VolatileCell<$inner>, $inner);
+        $crate::register_vcell!($mod_name, $struct_name);
    );

    // Define read-write register with mask on write (for WTC mixed access.)
-    ($mod_name: ident, $struct_name: ident, RW, $inner: ty, $mask: expr) => (
-        libregister::register_common!($mod_name, $struct_name, volatile_register::RW<$inner>, $inner);
-        libregister::register_r!($mod_name, $struct_name);
-        libregister::register_w!($mod_name, $struct_name);
-        libregister::register_rw!($mod_name, $struct_name, $mask);
+    ($mod_name: ident, $(#[$outer:meta])* $struct_name: ident, RW, $inner: ty, $mask: expr) => (
+        $crate::register_common!($mod_name, $(#[$outer])* $struct_name, volatile_register::RW<$inner>, $inner);
+        $crate::register_r!($mod_name, $struct_name);
+        $crate::register_w!($mod_name, $struct_name);
+        $crate::register_rw!($mod_name, $struct_name, $mask);
    );
 }

--- a/libsupport_zynq/Cargo.toml
+++ b/libsupport_zynq/Cargo.toml
@ -2,12 +2,14 @@
 name = "libsupport_zynq"
 description = "Software support for running in the Zynq PS"
 version = "0.0.0"
-authors = ["Astro <astro@spaceboyz.net>"]
+authors = ["M-Labs"]
 edition = "2018"

 [features]
 target_zc706 = ["libboard_zynq/target_zc706"]
-target_cora_z7_10 = ["libboard_zynq/target_cora_z7_10"]
+target_coraz7 = ["libboard_zynq/target_coraz7"]
+target_redpitaya = ["libboard_zynq/target_redpitaya"]
+target_kasli_soc = ["libboard_zynq/target_kasli_soc"]
 panic_handler = []
 dummy_irq_handler = []
 alloc_core = []
@ -16,8 +18,11 @@ default = ["panic_handler", "dummy_irq_handler"]

 [dependencies]
 r0 = "1"
-compiler_builtins = "0.1"
-linked_list_allocator = { version = "0.8", default-features = false }
+compiler_builtins = "=0.1.39"
+linked_list_allocator = { version = "0.8", default-features = false, features = ["const_mut_refs"] }
 libregister = { path = "../libregister" }
 libcortex_a9 = { path = "../libcortex_a9" }
 libboard_zynq = { path = "../libboard_zynq" }
+
+[build-dependencies]
+cc = { version = "1.0" }
--- a/libsupport_zynq/build.rs
+++ b/libsupport_zynq/build.rs
@ -0,0 +1,24 @@
+fn main() {
+    println!("cargo:rerun-if-changed=build.rs");
+    compile_memcpy();
+}
+
+fn compile_memcpy() {
+    use std::path::Path;
+    extern crate cc;
+    let cfg = &mut cc::Build::new();
+    cfg.compiler("clang");
+    cfg.no_default_flags(true);
+    cfg.warnings(false);
+    cfg.flag("--target=armv7-none-eabihf");
+    let sources = vec![
+        "memcpy.S",
+    ];
+    let root = Path::new("src/asm");
+    for src in sources {
+        println!("cargo:rerun-if-changed={}", src);
+        cfg.file(root.join(src));
+    }
+    cfg.compile("memcpy");
+}
+
--- a/libsupport_zynq/src/abort.rs
+++ b/libsupport_zynq/src/abort.rs
@ -1,70 +1,49 @@
 use libregister::RegisterR;
-use libcortex_a9::regs::{DFSR, MPIDR};
+use libcortex_a9::{regs::{DFSR, MPIDR}, interrupt_handler};
 use libboard_zynq::{println, stdio};

-#[link_section = ".text.boot"]
-#[no_mangle]
-#[naked]
-pub unsafe extern "C" fn UndefinedInstruction() {
+interrupt_handler!(UndefinedInstruction, undefined_instruction, __irq_stack0_start, __irq_stack1_start, {
    stdio::drop_uart();
    println!("UndefinedInstruction");
    loop {}
-}
+});

-#[link_section = ".text.boot"]
-#[no_mangle]
-#[naked]
-pub unsafe extern "C" fn SoftwareInterrupt() {
+interrupt_handler!(SoftwareInterrupt, software_interrupt, __irq_stack0_start, __irq_stack1_start, {
    stdio::drop_uart();
    println!("SoftwareInterrupt");
    loop {}
-}
+});

-#[link_section = ".text.boot"]
-#[no_mangle]
-#[naked]
-pub unsafe extern "C" fn PrefetchAbort() {
+interrupt_handler!(PrefetchAbort, prefetch_abort, __irq_stack0_start, __irq_stack1_start, {
    stdio::drop_uart();
    println!("PrefetchAbort");
    loop {}
-}
+});

-#[link_section = ".text.boot"]
-#[no_mangle]
-#[naked]
-pub unsafe extern "C" fn DataAbort() {
+interrupt_handler!(DataAbort, data_abort, __irq_stack0_start, __irq_stack1_start, {
    stdio::drop_uart();

    println!("DataAbort on core {}", MPIDR.read().cpu_id());
    println!("DFSR: {:03X}", DFSR.read());

    loop {}
-}
+});

-#[link_section = ".text.boot"]
-#[no_mangle]
-#[naked]
-pub unsafe extern "C" fn ReservedException() {
+interrupt_handler!(ReservedException, reserved_exception, __irq_stack0_start, __irq_stack1_start, {
    stdio::drop_uart();
    println!("ReservedException");
    loop {}
-}
+});

-#[link_section = ".text.boot"]
-#[no_mangle]
-#[naked]
 #[cfg(feature = "dummy_irq_handler")]
-pub unsafe extern "C" fn IRQ() {
+interrupt_handler!(IRQ, irq, __irq_stack0_start, __irq_stack1_start, {
    stdio::drop_uart();
    println!("IRQ");
    loop {}
-}
+});

-#[link_section = ".text.boot"]
-#[no_mangle]
-#[naked]
-pub unsafe extern "C" fn FIQ() {
+interrupt_handler!(FIQ, fiq, __irq_stack0_start, __irq_stack1_start, {
    stdio::drop_uart();
    println!("FIQ");
    loop {}
-}
+});
--- a/libsupport_zynq/src/asm/memcpy.S
+++ b/libsupport_zynq/src/asm/memcpy.S
@ -0,0 +1,626 @@
+/* Copyright (c) 2013, Linaro Limited
+   All rights reserved.
+
+   Redistribution and use in source and binary forms, with or without
+   modification, are permitted provided that the following conditions
+   are met:
+
+      * Redistributions of source code must retain the above copyright
+      notice, this list of conditions and the following disclaimer.
+
+      * Redistributions in binary form must reproduce the above copyright
+      notice, this list of conditions and the following disclaimer in the
+      documentation and/or other materials provided with the distribution.
+
+      * Neither the name of Linaro Limited nor the names of its
+      contributors may be used to endorse or promote products derived
+      from this software without specific prior written permission.
+
+   THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS
+   "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT
+   LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR
+   A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT
+   HOLDER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL,
+   SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT
+   LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE,
+   DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY
+   THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT
+   (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE
+   OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+
+   This memcpy routine is optimised for Cortex-A15 cores and takes advantage
+   of VFP or NEON when built with the appropriate flags.
+
+   Assumptions:
+
+    ARMv6 (ARMv7-a if using Neon)
+    ARM state
+    Unaligned accesses
+    LDRD/STRD support unaligned word accesses
+
+   If compiled with GCC, this file should be enclosed within following
+   pre-processing check:
+   if defined (__ARM_ARCH_7A__) && defined (__ARM_FEATURE_UNALIGNED)
+
+ */
+	.syntax unified
+	/* This implementation requires ARM state.  */
+	.arm
+
+#ifdef __ARM_NEON__
+
+	.fpu	neon
+	.arch	armv7-a
+# define FRAME_SIZE	4
+# define USE_VFP
+# define USE_NEON
+
+#elif !defined (__SOFTFP__)
+
+	.arch	armv6
+	.fpu	vfpv2
+# define FRAME_SIZE	32
+# define USE_VFP
+
+#else
+	.arch	armv6
+# define FRAME_SIZE    32
+
+#endif
+
+/* Old versions of GAS incorrectly implement the NEON align semantics.  */
+#ifdef BROKEN_ASM_NEON_ALIGN
+#define ALIGN(addr, align) addr,:align
+#else
+#define ALIGN(addr, align) addr:align
+#endif
+
+#define PC_OFFSET	8	/* PC pipeline compensation.  */
+#define INSN_SIZE	4
+
+/* Call parameters.  */
+#define dstin	r0
+#define src	r1
+#define count	r2
+
+/* Locals.  */
+#define tmp1	r3
+#define dst	ip
+#define tmp2	r10
+
+#ifndef USE_NEON
+/* For bulk copies using GP registers.  */
+#define	A_l	r2		/* Call-clobbered.  */
+#define	A_h	r3		/* Call-clobbered.  */
+#define	B_l	r4
+#define	B_h	r5
+#define	C_l	r6
+#define	C_h	r7
+#define	D_l	r8
+#define	D_h	r9
+#endif
+
+/* Number of lines ahead to pre-fetch data.  If you change this the code
+   below will need adjustment to compensate.  */
+
+#define prefetch_lines	5
+
+#ifdef USE_VFP
+	.macro	cpy_line_vfp vreg, base
+	vstr	\vreg, [dst, #\base]
+	vldr	\vreg, [src, #\base]
+	vstr	d0, [dst, #\base + 8]
+	vldr	d0, [src, #\base + 8]
+	vstr	d1, [dst, #\base + 16]
+	vldr	d1, [src, #\base + 16]
+	vstr	d2, [dst, #\base + 24]
+	vldr	d2, [src, #\base + 24]
+	vstr	\vreg, [dst, #\base + 32]
+	vldr	\vreg, [src, #\base + prefetch_lines * 64 - 32]
+	vstr	d0, [dst, #\base + 40]
+	vldr	d0, [src, #\base + 40]
+	vstr	d1, [dst, #\base + 48]
+	vldr	d1, [src, #\base + 48]
+	vstr	d2, [dst, #\base + 56]
+	vldr	d2, [src, #\base + 56]
+	.endm
+
+	.macro	cpy_tail_vfp vreg, base
+	vstr	\vreg, [dst, #\base]
+	vldr	\vreg, [src, #\base]
+	vstr	d0, [dst, #\base + 8]
+	vldr	d0, [src, #\base + 8]
+	vstr	d1, [dst, #\base + 16]
+	vldr	d1, [src, #\base + 16]
+	vstr	d2, [dst, #\base + 24]
+	vldr	d2, [src, #\base + 24]
+	vstr	\vreg, [dst, #\base + 32]
+	vstr	d0, [dst, #\base + 40]
+	vldr	d0, [src, #\base + 40]
+	vstr	d1, [dst, #\base + 48]
+	vldr	d1, [src, #\base + 48]
+	vstr	d2, [dst, #\base + 56]
+	vldr	d2, [src, #\base + 56]
+	.endm
+#endif
+
+	.macro def_fn f p2align=0
+	.text
+	.p2align \p2align
+	.global \f
+	.type \f, %function
+\f:
+	.endm
+
+	.global __aeabi_memcpy
+	.global __aeabi_memcpy4
+	.global __aeabi_memcpy8
+	.set __aeabi_memcpy, fast_memcpy
+	.set __aeabi_memcpy4, fast_memcpy
+	.set __aeabi_memcpy8, fast_memcpy
+def_fn fast_memcpy p2align=6
+
+	mov	dst, dstin	/* Preserve dstin, we need to return it.  */
+	cmp	count, #64
+	bge	.Lcpy_not_short
+	/* Deal with small copies quickly by dropping straight into the
+	   exit block.  */
+
+.Ltail63unaligned:
+#ifdef USE_NEON
+	and	tmp1, count, #0x38
+	rsb	tmp1, tmp1, #(56 - PC_OFFSET + INSN_SIZE)
+	add	pc, pc, tmp1
+	vld1.8	{d0}, [src]!	/* 14 words to go.  */
+	vst1.8	{d0}, [dst]!
+	vld1.8	{d0}, [src]!	/* 12 words to go.  */
+	vst1.8	{d0}, [dst]!
+	vld1.8	{d0}, [src]!	/* 10 words to go.  */
+	vst1.8	{d0}, [dst]!
+	vld1.8	{d0}, [src]!	/* 8 words to go.  */
+	vst1.8	{d0}, [dst]!
+	vld1.8	{d0}, [src]!	/* 6 words to go.  */
+	vst1.8	{d0}, [dst]!
+	vld1.8	{d0}, [src]!	/* 4 words to go.  */
+	vst1.8	{d0}, [dst]!
+	vld1.8	{d0}, [src]!	/* 2 words to go.  */
+	vst1.8	{d0}, [dst]!
+
+	tst	count, #4
+	ldrne	tmp1, [src], #4
+	strne	tmp1, [dst], #4
+#else
+	/* Copy up to 15 full words of data.  May not be aligned.  */
+	/* Cannot use VFP for unaligned data.  */
+	and	tmp1, count, #0x3c
+	add	dst, dst, tmp1
+	add	src, src, tmp1
+	rsb	tmp1, tmp1, #(60 - PC_OFFSET/2 + INSN_SIZE/2)
+	/* Jump directly into the sequence below at the correct offset.  */
+	add	pc, pc, tmp1, lsl #1
+
+	ldr	tmp1, [src, #-60]	/* 15 words to go.  */
+	str	tmp1, [dst, #-60]
+
+	ldr	tmp1, [src, #-56]	/* 14 words to go.  */
+	str	tmp1, [dst, #-56]
+	ldr	tmp1, [src, #-52]
+	str	tmp1, [dst, #-52]
+
+	ldr	tmp1, [src, #-48]	/* 12 words to go.  */
+	str	tmp1, [dst, #-48]
+	ldr	tmp1, [src, #-44]
+	str	tmp1, [dst, #-44]
+
+	ldr	tmp1, [src, #-40]	/* 10 words to go.  */
+	str	tmp1, [dst, #-40]
+	ldr	tmp1, [src, #-36]
+	str	tmp1, [dst, #-36]
+
+	ldr	tmp1, [src, #-32]	/* 8 words to go.  */
+	str	tmp1, [dst, #-32]
+	ldr	tmp1, [src, #-28]
+	str	tmp1, [dst, #-28]
+
+	ldr	tmp1, [src, #-24]	/* 6 words to go.  */
+	str	tmp1, [dst, #-24]
+	ldr	tmp1, [src, #-20]
+	str	tmp1, [dst, #-20]
+
+	ldr	tmp1, [src, #-16]	/* 4 words to go.  */
+	str	tmp1, [dst, #-16]
+	ldr	tmp1, [src, #-12]
+	str	tmp1, [dst, #-12]
+
+	ldr	tmp1, [src, #-8]	/* 2 words to go.  */
+	str	tmp1, [dst, #-8]
+	ldr	tmp1, [src, #-4]
+	str	tmp1, [dst, #-4]
+#endif
+
+	lsls	count, count, #31
+	ldrhcs	tmp1, [src], #2
+	ldrbne	src, [src]		/* Src is dead, use as a scratch.  */
+	strhcs	tmp1, [dst], #2
+	strbne	src, [dst]
+	bx	lr
+
+.Lcpy_not_short:
+	/* At least 64 bytes to copy, but don't know the alignment yet.  */
+	str	tmp2, [sp, #-FRAME_SIZE]!
+	and	tmp2, src, #7
+	and	tmp1, dst, #7
+	cmp	tmp1, tmp2
+	bne	.Lcpy_notaligned
+
+#ifdef USE_VFP
+	/* Magic dust alert!  Force VFP on Cortex-A9.  Experiments show
+	   that the FP pipeline is much better at streaming loads and
+	   stores.  This is outside the critical loop.  */
+	vmov.f32	s0, s0
+#endif
+
+	/* SRC and DST have the same mutual 32-bit alignment, but we may
+	   still need to pre-copy some bytes to get to natural alignment.
+	   We bring DST into full 64-bit alignment.  */
+	lsls	tmp2, dst, #29
+	beq	1f
+	rsbs	tmp2, tmp2, #0
+	sub	count, count, tmp2, lsr #29
+	ldrmi	tmp1, [src], #4
+	strmi	tmp1, [dst], #4
+	lsls	tmp2, tmp2, #2
+	ldrhcs	tmp1, [src], #2
+	ldrbne	tmp2, [src], #1
+	strhcs	tmp1, [dst], #2
+	strbne	tmp2, [dst], #1
+
+1:
+	subs	tmp2, count, #64	/* Use tmp2 for count.  */
+	blt	.Ltail63aligned
+
+	cmp	tmp2, #512
+	bge	.Lcpy_body_long
+
+.Lcpy_body_medium:			/* Count in tmp2.  */
+#ifdef USE_VFP
+1:
+	vldr	d0, [src, #0]
+	subs	tmp2, tmp2, #64
+	vldr	d1, [src, #8]
+	vstr	d0, [dst, #0]
+	vldr	d0, [src, #16]
+	vstr	d1, [dst, #8]
+	vldr	d1, [src, #24]
+	vstr	d0, [dst, #16]
+	vldr	d0, [src, #32]
+	vstr	d1, [dst, #24]
+	vldr	d1, [src, #40]
+	vstr	d0, [dst, #32]
+	vldr	d0, [src, #48]
+	vstr	d1, [dst, #40]
+	vldr	d1, [src, #56]
+	vstr	d0, [dst, #48]
+	add	src, src, #64
+	vstr	d1, [dst, #56]
+	add	dst, dst, #64
+	bge	1b
+	tst	tmp2, #0x3f
+	beq	.Ldone
+
+.Ltail63aligned:			/* Count in tmp2.  */
+	and	tmp1, tmp2, #0x38
+	add	dst, dst, tmp1
+	add	src, src, tmp1
+	rsb	tmp1, tmp1, #(56 - PC_OFFSET + INSN_SIZE)
+	add	pc, pc, tmp1
+
+	vldr	d0, [src, #-56]	/* 14 words to go.  */
+	vstr	d0, [dst, #-56]
+	vldr	d0, [src, #-48]	/* 12 words to go.  */
+	vstr	d0, [dst, #-48]
+	vldr	d0, [src, #-40]	/* 10 words to go.  */
+	vstr	d0, [dst, #-40]
+	vldr	d0, [src, #-32]	/* 8 words to go.  */
+	vstr	d0, [dst, #-32]
+	vldr	d0, [src, #-24]	/* 6 words to go.  */
+	vstr	d0, [dst, #-24]
+	vldr	d0, [src, #-16]	/* 4 words to go.  */
+	vstr	d0, [dst, #-16]
+	vldr	d0, [src, #-8]	/* 2 words to go.  */
+	vstr	d0, [dst, #-8]
+#else
+	sub	src, src, #8
+	sub	dst, dst, #8
+1:
+	ldrd	A_l, A_h, [src, #8]
+	strd	A_l, A_h, [dst, #8]
+	ldrd	A_l, A_h, [src, #16]
+	strd	A_l, A_h, [dst, #16]
+	ldrd	A_l, A_h, [src, #24]
+	strd	A_l, A_h, [dst, #24]
+	ldrd	A_l, A_h, [src, #32]
+	strd	A_l, A_h, [dst, #32]
+	ldrd	A_l, A_h, [src, #40]
+	strd	A_l, A_h, [dst, #40]
+	ldrd	A_l, A_h, [src, #48]
+	strd	A_l, A_h, [dst, #48]
+	ldrd	A_l, A_h, [src, #56]
+	strd	A_l, A_h, [dst, #56]
+	ldrd	A_l, A_h, [src, #64]!
+	strd	A_l, A_h, [dst, #64]!
+	subs	tmp2, tmp2, #64
+	bge	1b
+	tst	tmp2, #0x3f
+	bne	1f
+	ldr	tmp2,[sp], #FRAME_SIZE
+	bx	lr
+1:
+	add	src, src, #8
+	add	dst, dst, #8
+
+.Ltail63aligned:			/* Count in tmp2.  */
+	/* Copy up to 7 d-words of data.  Similar to Ltail63unaligned, but
+	   we know that the src and dest are 32-bit aligned so we can use
+	   LDRD/STRD to improve efficiency.  */
+	/* TMP2 is now negative, but we don't care about that.  The bottom
+	   six bits still tell us how many bytes are left to copy.  */
+
+	and	tmp1, tmp2, #0x38
+	add	dst, dst, tmp1
+	add	src, src, tmp1
+	rsb	tmp1, tmp1, #(56 - PC_OFFSET + INSN_SIZE)
+	add	pc, pc, tmp1
+	ldrd	A_l, A_h, [src, #-56]	/* 14 words to go.  */
+	strd	A_l, A_h, [dst, #-56]
+	ldrd	A_l, A_h, [src, #-48]	/* 12 words to go.  */
+	strd	A_l, A_h, [dst, #-48]
+	ldrd	A_l, A_h, [src, #-40]	/* 10 words to go.  */
+	strd	A_l, A_h, [dst, #-40]
+	ldrd	A_l, A_h, [src, #-32]	/* 8 words to go.  */
+	strd	A_l, A_h, [dst, #-32]
+	ldrd	A_l, A_h, [src, #-24]	/* 6 words to go.  */
+	strd	A_l, A_h, [dst, #-24]
+	ldrd	A_l, A_h, [src, #-16]	/* 4 words to go.  */
+	strd	A_l, A_h, [dst, #-16]
+	ldrd	A_l, A_h, [src, #-8]	/* 2 words to go.  */
+	strd	A_l, A_h, [dst, #-8]
+
+#endif
+	tst	tmp2, #4
+	ldrne	tmp1, [src], #4
+	strne	tmp1, [dst], #4
+	lsls	tmp2, tmp2, #31		/* Count (tmp2) now dead. */
+	ldrhcs	tmp1, [src], #2
+	ldrbne	tmp2, [src]
+	strhcs	tmp1, [dst], #2
+	strbne	tmp2, [dst]
+
+.Ldone:
+	ldr	tmp2, [sp], #FRAME_SIZE
+	bx	lr
+
+.Lcpy_body_long:			/* Count in tmp2.  */
+
+	/* Long copy.  We know that there's at least (prefetch_lines * 64)
+	   bytes to go.  */
+#ifdef USE_VFP
+	/* Don't use PLD.  Instead, read some data in advance of the current
+	   copy position into a register.  This should act like a PLD
+	   operation but we won't have to repeat the transfer.  */
+
+	vldr	d3, [src, #0]
+	vldr	d4, [src, #64]
+	vldr	d5, [src, #128]
+	vldr	d6, [src, #192]
+	vldr	d7, [src, #256]
+
+	vldr	d0, [src, #8]
+	vldr	d1, [src, #16]
+	vldr	d2, [src, #24]
+	add	src, src, #32
+
+	subs	tmp2, tmp2, #prefetch_lines * 64 * 2
+	blt	2f
+1:
+	cpy_line_vfp	d3, 0
+	cpy_line_vfp	d4, 64
+	cpy_line_vfp	d5, 128
+	add	dst, dst, #3 * 64
+	add	src, src, #3 * 64
+	cpy_line_vfp	d6, 0
+	cpy_line_vfp	d7, 64
+	add	dst, dst, #2 * 64
+	add	src, src, #2 * 64
+	subs	tmp2, tmp2, #prefetch_lines * 64
+	bge	1b
+
+2:
+	cpy_tail_vfp	d3, 0
+	cpy_tail_vfp	d4, 64
+	cpy_tail_vfp	d5, 128
+	add	src, src, #3 * 64
+	add	dst, dst, #3 * 64
+	cpy_tail_vfp	d6, 0
+	vstr	d7, [dst, #64]
+	vldr	d7, [src, #64]
+	vstr	d0, [dst, #64 + 8]
+	vldr	d0, [src, #64 + 8]
+	vstr	d1, [dst, #64 + 16]
+	vldr	d1, [src, #64 + 16]
+	vstr	d2, [dst, #64 + 24]
+	vldr	d2, [src, #64 + 24]
+	vstr	d7, [dst, #64 + 32]
+	add	src, src, #96
+	vstr	d0, [dst, #64 + 40]
+	vstr	d1, [dst, #64 + 48]
+	vstr	d2, [dst, #64 + 56]
+	add	dst, dst, #128
+	add	tmp2, tmp2, #prefetch_lines * 64
+	b	.Lcpy_body_medium
+#else
+	/* Long copy.  Use an SMS style loop to maximize the I/O
+	   bandwidth of the core.  We don't have enough spare registers
+	   to synthesise prefetching, so use PLD operations.  */
+	/* Pre-bias src and dst.  */
+	sub	src, src, #8
+	sub	dst, dst, #8
+	pld	[src, #8]
+	pld	[src, #72]
+	subs	tmp2, tmp2, #64
+	pld	[src, #136]
+	ldrd	A_l, A_h, [src, #8]
+	strd	B_l, B_h, [sp, #8]
+	ldrd	B_l, B_h, [src, #16]
+	strd	C_l, C_h, [sp, #16]
+	ldrd	C_l, C_h, [src, #24]
+	strd	D_l, D_h, [sp, #24]
+	pld	[src, #200]
+	ldrd	D_l, D_h, [src, #32]!
+	b	1f
+	.p2align	6
+2:
+	pld	[src, #232]
+	strd	A_l, A_h, [dst, #40]
+	ldrd	A_l, A_h, [src, #40]
+	strd	B_l, B_h, [dst, #48]
+	ldrd	B_l, B_h, [src, #48]
+	strd	C_l, C_h, [dst, #56]
+	ldrd	C_l, C_h, [src, #56]
+	strd	D_l, D_h, [dst, #64]!
+	ldrd	D_l, D_h, [src, #64]!
+	subs	tmp2, tmp2, #64
+1:
+	strd	A_l, A_h, [dst, #8]
+	ldrd	A_l, A_h, [src, #8]
+	strd	B_l, B_h, [dst, #16]
+	ldrd	B_l, B_h, [src, #16]
+	strd	C_l, C_h, [dst, #24]
+	ldrd	C_l, C_h, [src, #24]
+	strd	D_l, D_h, [dst, #32]
+	ldrd	D_l, D_h, [src, #32]
+	bcs	2b
+	/* Save the remaining bytes and restore the callee-saved regs.  */
+	strd	A_l, A_h, [dst, #40]
+	add	src, src, #40
+	strd	B_l, B_h, [dst, #48]
+	ldrd	B_l, B_h, [sp, #8]
+	strd	C_l, C_h, [dst, #56]
+	ldrd	C_l, C_h, [sp, #16]
+	strd	D_l, D_h, [dst, #64]
+	ldrd	D_l, D_h, [sp, #24]
+	add	dst, dst, #72
+	tst	tmp2, #0x3f
+	bne	.Ltail63aligned
+	ldr	tmp2, [sp], #FRAME_SIZE
+	bx	lr
+#endif
+
+.Lcpy_notaligned:
+	pld	[src]
+	pld	[src, #64]
+	/* There's at least 64 bytes to copy, but there is no mutual
+	   alignment.  */
+	/* Bring DST to 64-bit alignment.  */
+	lsls	tmp2, dst, #29
+	pld	[src, #(2 * 64)]
+	beq	1f
+	rsbs	tmp2, tmp2, #0
+	sub	count, count, tmp2, lsr #29
+	ldrmi	tmp1, [src], #4
+	strmi	tmp1, [dst], #4
+	lsls	tmp2, tmp2, #2
+	ldrbne	tmp1, [src], #1
+	ldrhcs	tmp2, [src], #2
+	strbne	tmp1, [dst], #1
+	strhcs	tmp2, [dst], #2
+1:
+	pld	[src, #(3 * 64)]
+	subs	count, count, #64
+	ldrmi	tmp2, [sp], #FRAME_SIZE
+	bmi	.Ltail63unaligned
+	pld	[src, #(4 * 64)]
+
+#ifdef USE_NEON
+	vld1.8	{d0-d3}, [src]!
+	vld1.8	{d4-d7}, [src]!
+	subs	count, count, #64
+	bmi	2f
+1:
+	pld	[src, #(4 * 64)]
+	vst1.8	{d0-d3}, [ALIGN (dst, 64)]!
+	vld1.8	{d0-d3}, [src]!
+	vst1.8	{d4-d7}, [ALIGN (dst, 64)]!
+	vld1.8	{d4-d7}, [src]!
+	subs	count, count, #64
+	bpl	1b
+2:
+	vst1.8	{d0-d3}, [ALIGN (dst, 64)]!
+	vst1.8	{d4-d7}, [ALIGN (dst, 64)]!
+	ands	count, count, #0x3f
+#else
+	/* Use an SMS style loop to maximize the I/O bandwidth.  */
+	sub	src, src, #4
+	sub	dst, dst, #8
+	subs	tmp2, count, #64	/* Use tmp2 for count.  */
+	ldr	A_l, [src, #4]
+	ldr	A_h, [src, #8]
+	strd	B_l, B_h, [sp, #8]
+	ldr	B_l, [src, #12]
+	ldr	B_h, [src, #16]
+	strd	C_l, C_h, [sp, #16]
+	ldr	C_l, [src, #20]
+	ldr	C_h, [src, #24]
+	strd	D_l, D_h, [sp, #24]
+	ldr	D_l, [src, #28]
+	ldr	D_h, [src, #32]!
+	b	1f
+	.p2align	6
+2:
+	pld	[src, #(5 * 64) - (32 - 4)]
+	strd	A_l, A_h, [dst, #40]
+	ldr	A_l, [src, #36]
+	ldr	A_h, [src, #40]
+	strd	B_l, B_h, [dst, #48]
+	ldr	B_l, [src, #44]
+	ldr	B_h, [src, #48]
+	strd	C_l, C_h, [dst, #56]
+	ldr	C_l, [src, #52]
+	ldr	C_h, [src, #56]
+	strd	D_l, D_h, [dst, #64]!
+	ldr	D_l, [src, #60]
+	ldr	D_h, [src, #64]!
+	subs	tmp2, tmp2, #64
+1:
+	strd	A_l, A_h, [dst, #8]
+	ldr	A_l, [src, #4]
+	ldr	A_h, [src, #8]
+	strd	B_l, B_h, [dst, #16]
+	ldr	B_l, [src, #12]
+	ldr	B_h, [src, #16]
+	strd	C_l, C_h, [dst, #24]
+	ldr	C_l, [src, #20]
+	ldr	C_h, [src, #24]
+	strd	D_l, D_h, [dst, #32]
+	ldr	D_l, [src, #28]
+	ldr	D_h, [src, #32]
+	bcs	2b
+
+	/* Save the remaining bytes and restore the callee-saved regs.  */
+	strd	A_l, A_h, [dst, #40]
+	add	src, src, #36
+	strd	B_l, B_h, [dst, #48]
+	ldrd	B_l, B_h, [sp, #8]
+	strd	C_l, C_h, [dst, #56]
+	ldrd	C_l, C_h, [sp, #16]
+	strd	D_l, D_h, [dst, #64]
+	ldrd	D_l, D_h, [sp, #24]
+	add	dst, dst, #72
+	ands	count, tmp2, #0x3f
+#endif
+	ldr	tmp2, [sp], #FRAME_SIZE
+	bne	.Ltail63unaligned
+	bx	lr
+
+	.size	memcpy, . - memcpy
+
--- a/libsupport_zynq/src/boot.rs
+++ b/libsupport_zynq/src/boot.rs
@ -2,9 +2,9 @@ use r0::zero_bss;
 use core::ptr::write_volatile;
 use libregister::{
    VolatileCell,
-    RegisterR, RegisterW, RegisterRW,
+    RegisterR, RegisterRW,
 };
-use libcortex_a9::{asm, regs::*, cache, mmu, spin_lock_yield, notify_spin_lock};
+use libcortex_a9::{asm, l2c, regs::*, cache, mmu, spin_lock_yield, notify_spin_lock, enable_fpu, interrupt_handler};
 use libboard_zynq::{slcr, mpcore};

 extern "C" {
@ -18,32 +18,28 @@ extern "C" {

 static mut CORE1_ENABLED: VolatileCell<bool> = VolatileCell::new(false);

-#[link_section = ".text.boot"]
-#[no_mangle]
-#[naked]
-pub unsafe extern "C" fn Reset() -> ! {
+interrupt_handler!(Reset, reset_irq, __stack0_start, __stack1_start, {
+    // no need to setup stack here, as we already did when entering the handler
    match MPIDR.read().cpu_id() {
        0 => {
-            SP.write(&mut __stack0_start as *mut _ as u32);
            boot_core0();
        }
        1 => {
            while !CORE1_ENABLED.get() {
                spin_lock_yield();
            }
-            SP.write(&mut __stack1_start as *mut _ as u32);
            boot_core1();
        }
        _ => unreachable!(),
    }
-}
+});

-#[naked]
 #[inline(never)]
-unsafe fn boot_core0() -> ! {
+unsafe extern "C" fn boot_core0() -> ! {
    l1_cache_init();

-    let mpcore = mpcore::RegisterBlock::new();
+    enable_fpu();
+    let mpcore = mpcore::RegisterBlock::mpcore();
    mpcore.scu_invalidate.invalidate_all_cores();

    zero_bss(&mut __bss_start, &mut __bss_end);
@ -53,6 +49,7 @@ unsafe fn boot_core0() -> ! {
    mmu::with_mmu(mmu_table, || {
        mpcore.scu_control.start();
        ACTLR.enable_smp();
+        ACTLR.enable_prefetch();
        // TODO: Barriers reqd when core1 is not yet starting?
        asm::dmb();
        asm::dsb();
@ -63,17 +60,17 @@ unsafe fn boot_core0() -> ! {
    });
 }

-#[naked]
 #[inline(never)]
-unsafe fn boot_core1() -> ! {
+unsafe extern "C" fn boot_core1() -> ! {
    l1_cache_init();

-    let mpcore = mpcore::RegisterBlock::new();
+    let mpcore = mpcore::RegisterBlock::mpcore();
    mpcore.scu_invalidate.invalidate_core1();

    let mmu_table = mmu::L1Table::get();
    mmu::with_mmu(mmu_table, || {
        ACTLR.enable_smp();
+        ACTLR.enable_prefetch();
        // TODO: Barriers reqd when core1 is not yet starting?
        asm::dmb();
        asm::dsb();
@ -101,7 +98,7 @@ fn l1_cache_init() {
    //       for all of the L1 data cache rather than a (previously
    //       unspecified) combination of one cache set and one cache
    //       way.
-    dciall();
+    dciall_l1();
 }

 pub struct Core1 {
@ -131,12 +128,13 @@ impl Core1 {
        unsafe {
            CORE1_ENABLED.set(true);
        }
-        // Ensure values have been written to cache
-        asm::dmb();
        // Flush cache-line
-        cache::dccmvac(unsafe { &CORE1_ENABLED } as *const _ as usize);
+        cache::dcc(unsafe { &CORE1_ENABLED });
        if sdram {
            cache::dccmvac(0);
+            asm::dsb();
+            l2c::l2_cache_clean(0);
+            l2c::l2_cache_sync();
        }

        // wake up core1
--- a/libsupport_zynq/src/lib.rs
+++ b/libsupport_zynq/src/lib.rs
@ -1,8 +1,9 @@
 #![no_std]

-#![feature(naked_functions)]
 #![feature(alloc_error_handler)]
 #![feature(panic_info_message)]
+#![feature(naked_functions)]
+#![feature(asm)]

 pub extern crate alloc;
 pub extern crate compiler_builtins;
@ -12,3 +13,4 @@ mod abort;
 #[cfg(feature = "panic_handler")]
 mod panic;
 pub mod ram;
+
--- a/libsupport_zynq/src/ram.rs
+++ b/libsupport_zynq/src/ram.rs
@ -34,7 +34,10 @@ unsafe impl GlobalAlloc for CortexA9Alloc {
    }

    unsafe fn dealloc(&self, ptr: *mut u8, layout: Layout) {
-        if cfg!(not(feature = "alloc_core")) || MPIDR.read().cpu_id() == 0 {
+        if cfg!(not(feature = "alloc_core"))
+            || ((&__heap0_start as *const usize as usize <= ptr as usize)
+                && ((ptr as usize) < &__heap0_end as *const usize as usize))
+        {
            &self.0
        } else {
            &self.1
--- a/nix/cargo-xbuild.nix
+++ b/nix/cargo-xbuild.nix
@ -0,0 +1,22 @@
+{ lib, fetchFromGitHub, rustPlatform }:
+
+rustPlatform.buildRustPackage rec {
+  pname = "cargo-xbuild";
+  version = "0.6.5";
+
+  src = fetchFromGitHub {
+    owner = "rust-osdev";
+    repo = pname;
+    rev = "v${version}";
+    sha256 = "18djvygq9v8rmfchvi2hfj0i6fhn36m716vqndqnj56fiqviwxvf";
+  };
+
+  cargoSha256 = "13sj9j9kl6js75h9xq0yidxy63vixxm9q3f8jil6ymarml5wkhx8";
+
+  meta = with lib; {
+    description = "Automatically cross-compiles the sysroot crates core, compiler_builtins, and alloc";
+    homepage = "https://github.com/rust-osdev/cargo-xbuild";
+    license = with licenses; [ mit asl20 ];
+    maintainers = with maintainers; [ johntitor xrelkd ];
+  };
+}
--- a/nix/channel-rust-nightly.toml
+++ b/nix/channel-rust-nightly.toml
--- a/nix/fsbl.nix
+++ b/nix/fsbl.nix
@ -0,0 +1,37 @@
+{ pkgs, board ? "zc706" }:
+let
+  gnutoolchain = import ./gnutoolchain.nix { inherit pkgs; };
+in
+pkgs.stdenv.mkDerivation {
+  name = "${board}-fsbl";
+  src = pkgs.fetchFromGitHub {
+    owner = "Xilinx";
+    repo = "embeddedsw";
+    rev = "65c849ed46c88c67457e1fc742744f96db968ff1";
+    sha256 = "1rvl06ha40dzd6s9aa4sylmksh4xb9dqaxq462lffv1fdk342pda";
+  };
+  patches = [ ./fsbl.patch ];
+  nativeBuildInputs = [
+    pkgs.gnumake
+    gnutoolchain.binutils
+    gnutoolchain.gcc
+  ];
+  patchPhase =
+    ''
+    patch -p1 -i ${./fsbl.patch}
+    patchShebangs lib/sw_apps/zynq_fsbl/misc/copy_bsp.sh
+    echo 'SEARCH_DIR("${gnutoolchain.newlib}/arm-none-eabi/lib");' >> lib/sw_apps/zynq_fsbl/src/lscript.ld
+    '';
+  buildPhase =
+    ''
+    cd lib/sw_apps/zynq_fsbl/src
+    make BOARD=${board} "CFLAGS=-DFSBL_DEBUG_INFO -g"
+    '';
+  installPhase = 
+    ''
+    mkdir $out
+    cp fsbl.elf $out
+    '';
+  doCheck = false;
+  dontFixup = true;
+}
--- a/nix/fsbl.patch
+++ b/nix/fsbl.patch
@ -0,0 +1,31 @@
+diff --git a/lib/sw_apps/zynq_fsbl/src/Makefile b/lib/sw_apps/zynq_fsbl/src/Makefile
+index 0e3ccdf1c5..a5b02f386e 100644
+--- a/lib/sw_apps/zynq_fsbl/src/Makefile
+++ b/lib/sw_apps/zynq_fsbl/src/Makefile
+@@ -71,11 +71,14 @@ endif
+ all: $(EXEC)
+ 
+ $(EXEC): $(LIBS) $(OBJS) $(INCLUDES)
+-	cp $(BSP_DIR)/$(BOARD)/ps7_init.* .
+ 	$(LINKER) $(LD1FLAGS)  -o $@ $(OBJS) $(LDFLAGS)
+ 	rm -rf $(OBJS)
+-	
+-	
+
+.PHONY: ps7_init
+
+ps7_init:
+	cp $(BSP_DIR)/$(BOARD)/ps7_init.* .
+
+ $(LIBS): 
+ 	echo "Copying BSP files"
+ 	$(BSP_DIR)/copy_bsp.sh $(BOARD) $(CC)
+@@ -86,7 +89,7 @@ $(LIBS):
+         make -C $(BSP_DIR) -k all "CC=armcc" "AR=armar" "C_FLAGS= -O2 -c" "EC_FLAGS=--debug --wchar32"; \
+ 	fi;
+ 
+-%.o:%.c
+%.o:%.c ps7_init
+ 	$(CC) $(CC_FLAGS) $(CFLAGS) $(ECFLAGS) -c $< -o $@ $(INCLUDEPATH)
+ 
+ %.o:%.S
--- a/nix/gnutoolchain.nix
+++ b/nix/gnutoolchain.nix
@ -0,0 +1,134 @@
+{ pkgs ? import <nixpkgs> }:
+let 
+
+platform = "arm-none-eabi";
+
+binutils-pkg = { stdenv, lib, buildPackages
+, fetchurl, zlib
+, extraConfigureFlags ? []
+}:
+
+stdenv.mkDerivation rec {
+  basename = "binutils";
+  version = "2.30";
+  name = "${basename}-${platform}-${version}";
+  src = fetchurl {
+    url = "https://ftp.gnu.org/gnu/binutils/binutils-${version}.tar.bz2";
+    sha256 = "028cklfqaab24glva1ks2aqa1zxa6w6xmc8q34zs1sb7h22dxspg";
+  };
+  configureFlags = [
+    "--enable-deterministic-archives"
+    "--target=${platform}"
+    "--with-cpu=cortex-a9"
+    "--with-fpu=vfpv3"
+    "--with-float=hard"
+    "--with-mode=thumb"
+  ] ++ extraConfigureFlags;
+  outputs = [ "out" "info" "man" ];
+  depsBuildBuild = [ buildPackages.stdenv.cc ];
+  buildInputs = [ zlib ];
+  enableParallelBuilding = true;
+  meta = {
+    description = "Tools for manipulating binaries (linker, assembler, etc.)";
+    longDescription = ''
+      The GNU Binutils are a collection of binary tools.  The main
+      ones are `ld' (the GNU linker) and `as' (the GNU assembler).
+      They also include the BFD (Binary File Descriptor) library,
+      `gprof', `nm', `strip', etc.
+    '';
+    homepage = http://www.gnu.org/software/binutils/;
+    license = lib.licenses.gpl3Plus;
+    /* Give binutils a lower priority than gcc-wrapper to prevent a
+       collision due to the ld/as wrappers/symlinks in the latter. */
+    priority = "10";
+  };
+};
+
+
+gcc-pkg = { stdenv, buildPackages
+, fetchurl, gmp, mpfr, libmpc, platform-binutils
+, extraConfigureFlags ? []
+}:
+
+stdenv.mkDerivation rec {
+  basename = "gcc";
+  version = "9.1.0";
+  name = "${basename}-${platform}-${version}";
+  src = fetchurl {
+    url = "https://ftp.gnu.org/gnu/gcc/gcc-${version}/gcc-${version}.tar.xz";
+    sha256 = "1817nc2bqdc251k0lpc51cimna7v68xjrnvqzvc50q3ax4s6i9kr";
+  };
+  preConfigure =
+    ''
+    mkdir build
+    cd build
+    '';
+  configureScript = "../configure";
+  configureFlags =
+    [ "--target=${platform}"
+      "--with-arch=armv7-a"
+      "--with-tune=cortex-a9"
+      "--with-fpu=vfpv3"
+      "--with-float=hard"
+      "--disable-libssp"
+      "--enable-languages=c"
+      "--with-as=${platform-binutils}/bin/${platform}-as"
+      "--with-ld=${platform-binutils}/bin/${platform}-ld" ] ++ extraConfigureFlags;
+  outputs = [ "out" "info" "man" ];
+  hardeningDisable = [ "format" "pie" ];
+  propagatedBuildInputs = [ gmp mpfr libmpc platform-binutils ];
+  enableParallelBuilding = true;
+  dontFixup = true;
+};
+
+
+newlib-pkg = { stdenv, fetchurl, buildPackages, platform-binutils, platform-gcc }:
+
+stdenv.mkDerivation rec {
+  pname = "newlib";
+  version = "3.1.0";
+  src = fetchurl {
+    url = "ftp://sourceware.org/pub/newlib/newlib-${version}.tar.gz";
+    sha256 = "0ahh3n079zjp7d9wynggwrnrs27440aac04340chf1p9476a2kzv";
+  };
+
+  nativeBuildInputs = [ platform-binutils platform-gcc ];
+
+  configureFlags = [
+    "--target=${platform}"
+
+    "--with-cpu=cortex-a9"
+    "--with-fpu=vfpv3"
+    "--with-float=hard"
+    "--with-mode=thumb"
+    "--enable-interwork"
+    "--disable-multilib"
+
+    "--disable-newlib-supplied-syscalls"
+    "--with-gnu-ld"
+    "--with-gnu-as"
+    "--disable-newlib-io-float"
+    "--disable-werror"
+  ];
+  dontFixup = true;
+};
+
+
+in rec {
+  binutils-bootstrap = pkgs.callPackage binutils-pkg { };
+  gcc-bootstrap = pkgs.callPackage gcc-pkg {
+    platform-binutils = binutils-bootstrap;
+    extraConfigureFlags = [ "--disable-libgcc" ];
+  };
+  newlib = pkgs.callPackage newlib-pkg {
+    platform-binutils = binutils-bootstrap;
+    platform-gcc = gcc-bootstrap;
+  };
+  binutils = pkgs.callPackage binutils-pkg {
+    extraConfigureFlags = [ "--with-lib-path=${newlib}/arm-none-eabi/lib" ];
+  };
+  gcc = pkgs.callPackage gcc-pkg {
+    platform-binutils = binutils;
+    extraConfigureFlags = [ "--enable-newlib" "--with-headers=${newlib}/arm-none-eabi/include" ];
+  };
+}
--- a/nix/mkbootimage.nix
+++ b/nix/mkbootimage.nix
@ -0,0 +1,24 @@
+{ pkgs }:
+
+pkgs.stdenv.mkDerivation {
+  pname = "mkbootimage";
+  version = "2.2";
+
+  src = pkgs.fetchFromGitHub {
+    owner = "antmicro";
+    repo = "zynq-mkbootimage";
+    rev = "4ee42d782a9ba65725ed165a4916853224a8edf7";
+    sha256 = "1k1mbsngqadqihzjgvwvsrkvryxy5ladpxd9yh9iqn2s7fxqwqa9";
+  };
+
+  propagatedBuildInputs = [ pkgs.libelf pkgs.pcre ];
+  patchPhase =
+    ''
+    substituteInPlace Makefile --replace "git rev-parse --short HEAD" "echo nix"
+    '';
+  installPhase =
+    ''
+    mkdir -p $out/bin
+    cp mkbootimage $out/bin
+    '';
+}
--- a/nix/mozilla-overlay.nix
+++ b/nix/mozilla-overlay.nix
@ -0,0 +1,10 @@
+let
+  pkgs = import <nixpkgs> {};
+  overlay = pkgs.fetchFromGitHub {
+    owner = "mozilla";
+    repo = "nixpkgs-mozilla";
+    rev = "efda5b357451dbb0431f983cca679ae3cd9b9829";
+    sha256 = "11wqrg86g3qva67vnk81ynvqyfj0zxk83cbrf0p9hsvxiwxs8469";
+  };
+in
+  import overlay
--- a/nix/rust-platform.nix
+++ b/nix/rust-platform.nix
@ -0,0 +1,20 @@
+{ pkgs }:
+
+let
+  rustManifest = ./channel-rust-nightly.toml;
+
+  targets = [];
+  rustChannelOfTargets = _channel: _date: targets:
+    (pkgs.lib.rustLib.fromManifestFile rustManifest {
+      inherit (pkgs) stdenv fetchurl patchelf;
+    }).rust.override {
+      inherit targets;
+      extensions = ["rust-src"];
+    };
+  rust =
+    rustChannelOfTargets "nightly" null targets;
+in
+  pkgs.recurseIntoAttrs (pkgs.makeRustPlatform {
+    rustc = rust;
+    cargo = rust;
+  })
--- a/openocd/cora-z7-10.cfg
+++ b/openocd/cora-z7-10.cfg
@ -5,8 +5,6 @@ set PL_TAPID 0x13722093
 set SMP 1

 source ./zynq-7000.cfg
-source ./xilinx-tcl.cfg
-source ./ps7_init.tcl

 reset_config srst_only srst_push_pull

@ -31,11 +29,10 @@ pld device virtex2 zynq.tap 1
 init
 xc7_program zynq.tap

-xilinx_ps7_init
+reset halt

 # Disable MMU
 targets $_TARGETNAME_1
 arm mcr 15 0 1 0 0 [expr [arm mrc 15 0 1 0 0] & ~0xd]
 targets $_TARGETNAME_0
 arm mcr 15 0 1 0 0 [expr [arm mrc 15 0 1 0 0] & ~0xd]
-
--- a/openocd/digilent-hs2.cfg
+++ b/openocd/digilent-hs2.cfg
@ -0,0 +1,12 @@
+# this is the original file from OpenOCD, but with ftdi_device_desc
+# removed because some cables don't have it programmed.
+
+# this supports JTAG-HS2 (and apparently Nexys4 as well)
+
+interface ftdi
+ftdi_vid_pid 0x0403 0x6014
+
+ftdi_channel 0
+ftdi_layout_init 0x00e8 0x60eb
+
+reset_config none
--- a/openocd/digilent_jtag_smt2_nc.cfg
+++ b/openocd/digilent_jtag_smt2_nc.cfg
@ -1,18 +0,0 @@
-#
-# Digilent JTAG-SMT2-NC
-#
-# http://store.digilentinc.com/jtag-smt2-nc-surface-mount-programming-module/
-# https://reference.digilentinc.com/_media/jtag_smt2nc/jtag-smt2-nc_rm.pdf
-#
-# Based on reference sheet (above) and Xilinx KCU105 schematics
-# https://www.xilinx.com/products/boards-and-kits/kcu105.html#documentation
-#
-# Note that the digilent_jtag_smt2 layout does not work and hangs while
-# the ftdi_device_desc from digilent_hs2 is wrong.
-
-interface ftdi
-ftdi_device_desc "Digilent USB Device"
-ftdi_vid_pid 0x0403 0x6014
-ftdi_channel 0
-ftdi_layout_init 0x00e8 0x60eb
-ftdi_layout_signal nSRST -data 0x2000
--- a/openocd/gdb-zynq-commands
+++ b/openocd/gdb-zynq-commands
@ -1,28 +0,0 @@
-def zynq-connect
-  target remote :3333
-end
-
-def zynq-fsbl-restart
-  mon xilinx_ps7_init
-end
-
-def zynq-restart
-  mon xilinx_ps7_init
-  load
-end
-
-# easily typed shortcuts
-# device connect
-def dc
-  zynq-connect
-end
-# device restart
-def dr
-  zynq-restart
-end
-
-def dfr
-  zynq-fsbl-restart
-end
-
-
--- a/openocd/kasli-soc.cfg
+++ b/openocd/kasli-soc.cfg
@ -0,0 +1,47 @@
+interface ftdi
+ftdi_device_desc "Quad RS232-HS"
+ftdi_vid_pid 0x0403 0x6011
+ftdi_channel 0
+# some GPIOs need to be set, otherwise the FTDI chip craps out for some reason.
+ftdi_layout_init 0x0098 0x008b
+transport select jtag
+adapter_khz 1000
+
+set PL_TAPID 0x1372c093
+set SMP 1
+
+source ./zynq-7000.cfg
+
+ftdi_layout_signal nSRST -oe 0x0004
+reset_config srst_only srst_open_drain
+adapter_nsrst_assert_width 250
+adapter_nsrst_delay 400
+
+set XC7_JSHUTDOWN 0x0d
+set XC7_JPROGRAM 0x0b
+set XC7_JSTART 0x0c
+set XC7_BYPASS 0x3f
+
+proc xc7_program {tap} {
+    global XC7_JSHUTDOWN XC7_JPROGRAM XC7_JSTART XC7_BYPASS
+    irscan $tap $XC7_JSHUTDOWN
+    irscan $tap $XC7_JPROGRAM
+    runtest 60000
+    #JSTART prevents this from working...
+    #irscan $tap $XC7_JSTART
+    runtest 2000
+    irscan $tap $XC7_BYPASS
+    runtest 2000
+}
+
+pld device virtex2 zynq.tap 1
+init
+xc7_program zynq.tap
+
+reset halt
+
+# Disable MMU
+targets $_TARGETNAME_1
+arm mcr 15 0 1 0 0 [expr [arm mrc 15 0 1 0 0] & ~0xd]
+targets $_TARGETNAME_0
+arm mcr 15 0 1 0 0 [expr [arm mrc 15 0 1 0 0] & ~0xd]
--- a/openocd/ps7_init.tcl
+++ b/openocd/ps7_init.tcl
@ -1,771 +0,0 @@
-proc ps7_pll_init_data_3_0 {} {
-    mwr -force 0XF8000008 0x0000DF0D
-    mask_write 0XF8000110 0x003FFFF0 0x000FA220
-    mask_write 0XF8000100 0x0007F000 0x00028000
-    mask_write 0XF8000100 0x00000010 0x00000010
-    mask_write 0XF8000100 0x00000001 0x00000001
-    mask_write 0XF8000100 0x00000001 0x00000000
-    mask_poll 0XF800010C 0x00000001
-    mask_write 0XF8000100 0x00000010 0x00000000
-    mask_write 0XF8000120 0x1F003F30 0x1F000200
-    mask_write 0XF8000114 0x003FFFF0 0x0012C220
-    mask_write 0XF8000104 0x0007F000 0x00020000
-    mask_write 0XF8000104 0x00000010 0x00000010
-    mask_write 0XF8000104 0x00000001 0x00000001
-    mask_write 0XF8000104 0x00000001 0x00000000
-    mask_poll 0XF800010C 0x00000002
-    mask_write 0XF8000104 0x00000010 0x00000000
-    mask_write 0XF8000124 0xFFF00003 0x0C200003
-    mask_write 0XF8000118 0x003FFFF0 0x001452C0
-    mask_write 0XF8000108 0x0007F000 0x0001E000
-    mask_write 0XF8000108 0x00000010 0x00000010
-    mask_write 0XF8000108 0x00000001 0x00000001
-    mask_write 0XF8000108 0x00000001 0x00000000
-    mask_poll 0XF800010C 0x00000004
-    mask_write 0XF8000108 0x00000010 0x00000000
-    mwr -force 0XF8000004 0x0000767B
-}
-proc ps7_clock_init_data_3_0 {} {
-    mwr -force 0XF8000008 0x0000DF0D
-    mask_write 0XF8000128 0x03F03F01 0x00700F01
-    mask_write 0XF8000138 0x00000011 0x00000001
-    mask_write 0XF8000140 0x03F03F71 0x00100801
-    mask_write 0XF800014C 0x00003F31 0x00000501
-    mask_write 0XF8000150 0x00003F33 0x00001401
-    mask_write 0XF8000154 0x00003F33 0x00001402
-    mask_write 0XF8000168 0x00003F31 0x00000501
-    mask_write 0XF8000170 0x03F03F30 0x00200500
-    mask_write 0XF80001C4 0x00000001 0x00000001
-    mask_write 0XF800012C 0x01FFCCCD 0x01EC044D
-    mwr -force 0XF8000004 0x0000767B
-}
-proc ps7_ddr_init_data_3_0 {} {
-    mask_write 0XF8006000 0x0001FFFF 0x00000080
-    mask_write 0XF8006004 0x0007FFFF 0x00001081
-    mask_write 0XF8006008 0x03FFFFFF 0x03C0780F
-    mask_write 0XF800600C 0x03FFFFFF 0x02001001
-    mask_write 0XF8006010 0x03FFFFFF 0x00014001
-    mask_write 0XF8006014 0x001FFFFF 0x0004159B
-    mask_write 0XF8006018 0xF7FFFFFF 0x452460D2
-    mask_write 0XF800601C 0xFFFFFFFF 0x720238E5
-    mask_write 0XF8006020 0x7FDFFFFC 0x270872D0
-    mask_write 0XF8006024 0x0FFFFFC3 0x00000000
-    mask_write 0XF8006028 0x00003FFF 0x00002007
-    mask_write 0XF800602C 0xFFFFFFFF 0x00000008
-    mask_write 0XF8006030 0xFFFFFFFF 0x00040930
-    mask_write 0XF8006034 0x13FF3FFF 0x000116D4
-    mask_write 0XF8006038 0x00000003 0x00000000
-    mask_write 0XF800603C 0x000FFFFF 0x00000777
-    mask_write 0XF8006040 0xFFFFFFFF 0xFFF00000
-    mask_write 0XF8006044 0x0FFFFFFF 0x0FF66666
-    mask_write 0XF8006048 0x0003F03F 0x0003C008
-    mask_write 0XF8006050 0xFF0F8FFF 0x77010800
-    mask_write 0XF8006058 0x00010000 0x00000000
-    mask_write 0XF800605C 0x0000FFFF 0x00005003
-    mask_write 0XF8006060 0x000017FF 0x0000003E
-    mask_write 0XF8006064 0x00021FE0 0x00020000
-    mask_write 0XF8006068 0x03FFFFFF 0x00284141
-    mask_write 0XF800606C 0x0000FFFF 0x00001610
-    mask_write 0XF8006078 0x03FFFFFF 0x00466111
-    mask_write 0XF800607C 0x000FFFFF 0x00032222
-    mask_write 0XF80060A4 0xFFFFFFFF 0x10200802
-    mask_write 0XF80060A8 0x0FFFFFFF 0x0690CB73
-    mask_write 0XF80060AC 0x000001FF 0x000001FE
-    mask_write 0XF80060B0 0x1FFFFFFF 0x1CFFFFFF
-    mask_write 0XF80060B4 0x00000200 0x00000200
-    mask_write 0XF80060B8 0x01FFFFFF 0x00200066
-    mask_write 0XF80060C4 0x00000003 0x00000000
-    mask_write 0XF80060C8 0x000000FF 0x00000000
-    mask_write 0XF80060DC 0x00000001 0x00000000
-    mask_write 0XF80060F0 0x0000FFFF 0x00000000
-    mask_write 0XF80060F4 0x0000000F 0x00000008
-    mask_write 0XF8006114 0x000000FF 0x00000000
-    mask_write 0XF8006118 0x7FFFFFCF 0x40000001
-    mask_write 0XF800611C 0x7FFFFFCF 0x40000001
-    mask_write 0XF8006120 0x7FFFFFCF 0x40000001
-    mask_write 0XF8006124 0x7FFFFFCF 0x40000001
-    mask_write 0XF800612C 0x000FFFFF 0x00033C03
-    mask_write 0XF8006130 0x000FFFFF 0x00034003
-    mask_write 0XF8006134 0x000FFFFF 0x0002F400
-    mask_write 0XF8006138 0x000FFFFF 0x00030400
-    mask_write 0XF8006140 0x000FFFFF 0x00000035
-    mask_write 0XF8006144 0x000FFFFF 0x00000035
-    mask_write 0XF8006148 0x000FFFFF 0x00000035
-    mask_write 0XF800614C 0x000FFFFF 0x00000035
-    mask_write 0XF8006154 0x000FFFFF 0x00000083
-    mask_write 0XF8006158 0x000FFFFF 0x00000083
-    mask_write 0XF800615C 0x000FFFFF 0x00000080
-    mask_write 0XF8006160 0x000FFFFF 0x00000080
-    mask_write 0XF8006168 0x001FFFFF 0x00000124
-    mask_write 0XF800616C 0x001FFFFF 0x00000125
-    mask_write 0XF8006170 0x001FFFFF 0x00000112
-    mask_write 0XF8006174 0x001FFFFF 0x00000116
-    mask_write 0XF800617C 0x000FFFFF 0x000000C3
-    mask_write 0XF8006180 0x000FFFFF 0x000000C3
-    mask_write 0XF8006184 0x000FFFFF 0x000000C0
-    mask_write 0XF8006188 0x000FFFFF 0x000000C0
-    mask_write 0XF8006190 0x6FFFFEFE 0x00040080
-    mask_write 0XF8006194 0x000FFFFF 0x0001FC82
-    mask_write 0XF8006204 0xFFFFFFFF 0x00000000
-    mask_write 0XF8006208 0x000703FF 0x000003FF
-    mask_write 0XF800620C 0x000703FF 0x000003FF
-    mask_write 0XF8006210 0x000703FF 0x000003FF
-    mask_write 0XF8006214 0x000703FF 0x000003FF
-    mask_write 0XF8006218 0x000F03FF 0x000003FF
-    mask_write 0XF800621C 0x000F03FF 0x000003FF
-    mask_write 0XF8006220 0x000F03FF 0x000003FF
-    mask_write 0XF8006224 0x000F03FF 0x000003FF
-    mask_write 0XF80062A8 0x00000FF5 0x00000000
-    mask_write 0XF80062AC 0xFFFFFFFF 0x00000000
-    mask_write 0XF80062B0 0x003FFFFF 0x00005125
-    mask_write 0XF80062B4 0x0003FFFF 0x000012A8
-    mask_poll 0XF8000B74 0x00002000
-    mask_write 0XF8006000 0x0001FFFF 0x00000081
-    mask_poll 0XF8006054 0x00000007
-}
-proc ps7_mio_init_data_3_0 {} {
-    mwr -force 0XF8000008 0x0000DF0D
-    mask_write 0XF8000B40 0x00000FFF 0x00000600
-    mask_write 0XF8000B44 0x00000FFF 0x00000600
-    mask_write 0XF8000B48 0x00000FFF 0x00000672
-    mask_write 0XF8000B4C 0x00000FFF 0x00000672
-    mask_write 0XF8000B50 0x00000FFF 0x00000674
-    mask_write 0XF8000B54 0x00000FFF 0x00000674
-    mask_write 0XF8000B58 0x00000FFF 0x00000600
-    mask_write 0XF8000B5C 0xFFFFFFFF 0x0018C61C
-    mask_write 0XF8000B60 0xFFFFFFFF 0x00F9861C
-    mask_write 0XF8000B64 0xFFFFFFFF 0x00F9861C
-    mask_write 0XF8000B68 0xFFFFFFFF 0x00F9861C
-    mask_write 0XF8000B6C 0x00007FFF 0x00000209
-    mask_write 0XF8000B70 0x00000001 0x00000001
-    mask_write 0XF8000B70 0x00000021 0x00000020
-    mask_write 0XF8000B70 0x07FEFFFF 0x00000823
-    mask_write 0XF8000700 0x00003FFF 0x00000600
-    mask_write 0XF8000704 0x00003FFF 0x00000702
-    mask_write 0XF8000708 0x00003FFF 0x00000702
-    mask_write 0XF800070C 0x00003FFF 0x00000702
-    mask_write 0XF8000710 0x00003FFF 0x00000702
-    mask_write 0XF8000714 0x00003FFF 0x00000702
-    mask_write 0XF8000718 0x00003FFF 0x00000702
-    mask_write 0XF800071C 0x00003FFF 0x00000600
-    mask_write 0XF8000720 0x00003FFF 0x00000700
-    mask_write 0XF8000724 0x00003FFF 0x00000600
-    mask_write 0XF8000728 0x00003FFF 0x00000600
-    mask_write 0XF800072C 0x00003FFF 0x00000600
-    mask_write 0XF8000730 0x00003FFF 0x00000600
-    mask_write 0XF8000734 0x00003FFF 0x00000600
-    mask_write 0XF8000738 0x00003FFF 0x00000600
-    mask_write 0XF800073C 0x00003FFF 0x00000600
-    mask_write 0XF8000740 0x00003FFF 0x00000302
-    mask_write 0XF8000744 0x00003FFF 0x00000302
-    mask_write 0XF8000748 0x00003FFF 0x00000302
-    mask_write 0XF800074C 0x00003FFF 0x00000302
-    mask_write 0XF8000750 0x00003FFF 0x00000302
-    mask_write 0XF8000754 0x00003FFF 0x00000302
-    mask_write 0XF8000758 0x00003FFF 0x00000303
-    mask_write 0XF800075C 0x00003FFF 0x00000303
-    mask_write 0XF8000760 0x00003FFF 0x00000303
-    mask_write 0XF8000764 0x00003FFF 0x00000303
-    mask_write 0XF8000768 0x00003FFF 0x00000303
-    mask_write 0XF800076C 0x00003FFF 0x00000303
-    mask_write 0XF8000770 0x00003FFF 0x00000304
-    mask_write 0XF8000774 0x00003FFF 0x00000305
-    mask_write 0XF8000778 0x00003FFF 0x00000304
-    mask_write 0XF800077C 0x00003FFF 0x00000305
-    mask_write 0XF8000780 0x00003FFF 0x00000304
-    mask_write 0XF8000784 0x00003FFF 0x00000304
-    mask_write 0XF8000788 0x00003FFF 0x00000304
-    mask_write 0XF800078C 0x00003FFF 0x00000304
-    mask_write 0XF8000790 0x00003FFF 0x00000305
-    mask_write 0XF8000794 0x00003FFF 0x00000304
-    mask_write 0XF8000798 0x00003FFF 0x00000304
-    mask_write 0XF800079C 0x00003FFF 0x00000304
-    mask_write 0XF80007A0 0x00003FFF 0x00000380
-    mask_write 0XF80007A4 0x00003FFF 0x00000380
-    mask_write 0XF80007A8 0x00003FFF 0x00000380
-    mask_write 0XF80007AC 0x00003FFF 0x00000380
-    mask_write 0XF80007B0 0x00003FFF 0x00000380
-    mask_write 0XF80007B4 0x00003FFF 0x00000380
-    mask_write 0XF80007B8 0x00003F01 0x00000201
-    mask_write 0XF80007BC 0x00003F01 0x00000201
-    mask_write 0XF80007C0 0x00003FFF 0x000002E0
-    mask_write 0XF80007C4 0x00003FFF 0x000002E1
-    mask_write 0XF80007C8 0x00003FFF 0x00000200
-    mask_write 0XF80007CC 0x00003FFF 0x00000200
-    mask_write 0XF80007D0 0x00003FFF 0x00000280
-    mask_write 0XF80007D4 0x00003FFF 0x00000280
-    mask_write 0XF8000830 0x003F003F 0x002F002E
-    mwr -force 0XF8000004 0x0000767B
-}
-proc ps7_peripherals_init_data_3_0 {} {
-    mwr -force 0XF8000008 0x0000DF0D
-    mask_write 0XF8000B48 0x00000180 0x00000180
-    mask_write 0XF8000B4C 0x00000180 0x00000180
-    mask_write 0XF8000B50 0x00000180 0x00000180
-    mask_write 0XF8000B54 0x00000180 0x00000180
-    mwr -force 0XF8000004 0x0000767B
-    mask_write 0XE0001034 0x000000FF 0x00000006
-    mask_write 0XE0001018 0x0000FFFF 0x0000003E
-    mask_write 0XE0001000 0x000001FF 0x00000017
-    mask_write 0XE0001004 0x000003FF 0x00000020
-    mask_write 0XE000D000 0x00080000 0x00080000
-    mask_write 0XF8007000 0x20000000 0x00000000
-}
-proc ps7_post_config_3_0 {} {
-    mwr -force 0XF8000008 0x0000DF0D
-    mask_write 0XF8000900 0x0000000F 0x0000000F
-    mask_write 0XF8000240 0xFFFFFFFF 0x00000000
-    mwr -force 0XF8000004 0x0000767B
-}
-proc ps7_debug_3_0 {} {
-    mwr -force 0XF8898FB0 0xC5ACCE55
-    mwr -force 0XF8899FB0 0xC5ACCE55
-    mwr -force 0XF8809FB0 0xC5ACCE55
-}
-proc ps7_pll_init_data_2_0 {} {
-    mwr -force 0XF8000008 0x0000DF0D
-    mask_write 0XF8000110 0x003FFFF0 0x000FA220
-    mask_write 0XF8000100 0x0007F000 0x00028000
-    mask_write 0XF8000100 0x00000010 0x00000010
-    mask_write 0XF8000100 0x00000001 0x00000001
-    mask_write 0XF8000100 0x00000001 0x00000000
-    mask_poll 0XF800010C 0x00000001
-    mask_write 0XF8000100 0x00000010 0x00000000
-    mask_write 0XF8000120 0x1F003F30 0x1F000200
-    mask_write 0XF8000114 0x003FFFF0 0x0012C220
-    mask_write 0XF8000104 0x0007F000 0x00020000
-    mask_write 0XF8000104 0x00000010 0x00000010
-    mask_write 0XF8000104 0x00000001 0x00000001
-    mask_write 0XF8000104 0x00000001 0x00000000
-    mask_poll 0XF800010C 0x00000002
-    mask_write 0XF8000104 0x00000010 0x00000000
-    mask_write 0XF8000124 0xFFF00003 0x0C200003
-    mask_write 0XF8000118 0x003FFFF0 0x001452C0
-    mask_write 0XF8000108 0x0007F000 0x0001E000
-    mask_write 0XF8000108 0x00000010 0x00000010
-    mask_write 0XF8000108 0x00000001 0x00000001
-    mask_write 0XF8000108 0x00000001 0x00000000
-    mask_poll 0XF800010C 0x00000004
-    mask_write 0XF8000108 0x00000010 0x00000000
-    mwr -force 0XF8000004 0x0000767B
-}
-proc ps7_clock_init_data_2_0 {} {
-    mwr -force 0XF8000008 0x0000DF0D
-    mask_write 0XF8000128 0x03F03F01 0x00700F01
-    mask_write 0XF8000138 0x00000011 0x00000001
-    mask_write 0XF8000140 0x03F03F71 0x00100801
-    mask_write 0XF800014C 0x00003F31 0x00000501
-    mask_write 0XF8000150 0x00003F33 0x00001401
-    mask_write 0XF8000154 0x00003F33 0x00001402
-    mask_write 0XF8000168 0x00003F31 0x00000501
-    mask_write 0XF8000170 0x03F03F30 0x00200500
-    mask_write 0XF80001C4 0x00000001 0x00000001
-    mask_write 0XF800012C 0x01FFCCCD 0x01EC044D
-    mwr -force 0XF8000004 0x0000767B
-}
-proc ps7_ddr_init_data_2_0 {} {
-    mask_write 0XF8006000 0x0001FFFF 0x00000080
-    mask_write 0XF8006004 0x1FFFFFFF 0x00081081
-    mask_write 0XF8006008 0x03FFFFFF 0x03C0780F
-    mask_write 0XF800600C 0x03FFFFFF 0x02001001
-    mask_write 0XF8006010 0x03FFFFFF 0x00014001
-    mask_write 0XF8006014 0x001FFFFF 0x0004159B
-    mask_write 0XF8006018 0xF7FFFFFF 0x452460D2
-    mask_write 0XF800601C 0xFFFFFFFF 0x720238E5
-    mask_write 0XF8006020 0xFFFFFFFC 0x272872D0
-    mask_write 0XF8006024 0x0FFFFFFF 0x0000003C
-    mask_write 0XF8006028 0x00003FFF 0x00002007
-    mask_write 0XF800602C 0xFFFFFFFF 0x00000008
-    mask_write 0XF8006030 0xFFFFFFFF 0x00040930
-    mask_write 0XF8006034 0x13FF3FFF 0x000116D4
-    mask_write 0XF8006038 0x00001FC3 0x00000000
-    mask_write 0XF800603C 0x000FFFFF 0x00000777
-    mask_write 0XF8006040 0xFFFFFFFF 0xFFF00000
-    mask_write 0XF8006044 0x0FFFFFFF 0x0FF66666
-    mask_write 0XF8006048 0x3FFFFFFF 0x0003C248
-    mask_write 0XF8006050 0xFF0F8FFF 0x77010800
-    mask_write 0XF8006058 0x0001FFFF 0x00000101
-    mask_write 0XF800605C 0x0000FFFF 0x00005003
-    mask_write 0XF8006060 0x000017FF 0x0000003E
-    mask_write 0XF8006064 0x00021FE0 0x00020000
-    mask_write 0XF8006068 0x03FFFFFF 0x00284141
-    mask_write 0XF800606C 0x0000FFFF 0x00001610
-    mask_write 0XF8006078 0x03FFFFFF 0x00466111
-    mask_write 0XF800607C 0x000FFFFF 0x00032222
-    mask_write 0XF80060A0 0x00FFFFFF 0x00008000
-    mask_write 0XF80060A4 0xFFFFFFFF 0x10200802
-    mask_write 0XF80060A8 0x0FFFFFFF 0x0690CB73
-    mask_write 0XF80060AC 0x000001FF 0x000001FE
-    mask_write 0XF80060B0 0x1FFFFFFF 0x1CFFFFFF
-    mask_write 0XF80060B4 0x000007FF 0x00000200
-    mask_write 0XF80060B8 0x01FFFFFF 0x00200066
-    mask_write 0XF80060C4 0x00000003 0x00000000
-    mask_write 0XF80060C8 0x000000FF 0x00000000
-    mask_write 0XF80060DC 0x00000001 0x00000000
-    mask_write 0XF80060F0 0x0000FFFF 0x00000000
-    mask_write 0XF80060F4 0x0000000F 0x00000008
-    mask_write 0XF8006114 0x000000FF 0x00000000
-    mask_write 0XF8006118 0x7FFFFFFF 0x40000001
-    mask_write 0XF800611C 0x7FFFFFFF 0x40000001
-    mask_write 0XF8006120 0x7FFFFFFF 0x40000001
-    mask_write 0XF8006124 0x7FFFFFFF 0x40000001
-    mask_write 0XF800612C 0x000FFFFF 0x00033C03
-    mask_write 0XF8006130 0x000FFFFF 0x00034003
-    mask_write 0XF8006134 0x000FFFFF 0x0002F400
-    mask_write 0XF8006138 0x000FFFFF 0x00030400
-    mask_write 0XF8006140 0x000FFFFF 0x00000035
-    mask_write 0XF8006144 0x000FFFFF 0x00000035
-    mask_write 0XF8006148 0x000FFFFF 0x00000035
-    mask_write 0XF800614C 0x000FFFFF 0x00000035
-    mask_write 0XF8006154 0x000FFFFF 0x00000083
-    mask_write 0XF8006158 0x000FFFFF 0x00000083
-    mask_write 0XF800615C 0x000FFFFF 0x00000080
-    mask_write 0XF8006160 0x000FFFFF 0x00000080
-    mask_write 0XF8006168 0x001FFFFF 0x00000124
-    mask_write 0XF800616C 0x001FFFFF 0x00000125
-    mask_write 0XF8006170 0x001FFFFF 0x00000112
-    mask_write 0XF8006174 0x001FFFFF 0x00000116
-    mask_write 0XF800617C 0x000FFFFF 0x000000C3
-    mask_write 0XF8006180 0x000FFFFF 0x000000C3
-    mask_write 0XF8006184 0x000FFFFF 0x000000C0
-    mask_write 0XF8006188 0x000FFFFF 0x000000C0
-    mask_write 0XF8006190 0xFFFFFFFF 0x10040080
-    mask_write 0XF8006194 0x000FFFFF 0x0001FC82
-    mask_write 0XF8006204 0xFFFFFFFF 0x00000000
-    mask_write 0XF8006208 0x000F03FF 0x000803FF
-    mask_write 0XF800620C 0x000F03FF 0x000803FF
-    mask_write 0XF8006210 0x000F03FF 0x000803FF
-    mask_write 0XF8006214 0x000F03FF 0x000803FF
-    mask_write 0XF8006218 0x000F03FF 0x000003FF
-    mask_write 0XF800621C 0x000F03FF 0x000003FF
-    mask_write 0XF8006220 0x000F03FF 0x000003FF
-    mask_write 0XF8006224 0x000F03FF 0x000003FF
-    mask_write 0XF80062A8 0x00000FF7 0x00000000
-    mask_write 0XF80062AC 0xFFFFFFFF 0x00000000
-    mask_write 0XF80062B0 0x003FFFFF 0x00005125
-    mask_write 0XF80062B4 0x0003FFFF 0x000012A8
-    mask_poll 0XF8000B74 0x00002000
-    mask_write 0XF8006000 0x0001FFFF 0x00000081
-    mask_poll 0XF8006054 0x00000007
-}
-proc ps7_mio_init_data_2_0 {} {
-    mwr -force 0XF8000008 0x0000DF0D
-    mask_write 0XF8000B40 0x00000FFF 0x00000600
-    mask_write 0XF8000B44 0x00000FFF 0x00000600
-    mask_write 0XF8000B48 0x00000FFF 0x00000672
-    mask_write 0XF8000B4C 0x00000FFF 0x00000672
-    mask_write 0XF8000B50 0x00000FFF 0x00000674
-    mask_write 0XF8000B54 0x00000FFF 0x00000674
-    mask_write 0XF8000B58 0x00000FFF 0x00000600
-    mask_write 0XF8000B5C 0xFFFFFFFF 0x0018C61C
-    mask_write 0XF8000B60 0xFFFFFFFF 0x00F9861C
-    mask_write 0XF8000B64 0xFFFFFFFF 0x00F9861C
-    mask_write 0XF8000B68 0xFFFFFFFF 0x00F9861C
-    mask_write 0XF8000B6C 0x00007FFF 0x00000209
-    mask_write 0XF8000B70 0x00000021 0x00000021
-    mask_write 0XF8000B70 0x00000021 0x00000020
-    mask_write 0XF8000B70 0x07FFFFFF 0x00000823
-    mask_write 0XF8000700 0x00003FFF 0x00000600
-    mask_write 0XF8000704 0x00003FFF 0x00000702
-    mask_write 0XF8000708 0x00003FFF 0x00000702
-    mask_write 0XF800070C 0x00003FFF 0x00000702
-    mask_write 0XF8000710 0x00003FFF 0x00000702
-    mask_write 0XF8000714 0x00003FFF 0x00000702
-    mask_write 0XF8000718 0x00003FFF 0x00000702
-    mask_write 0XF800071C 0x00003FFF 0x00000600
-    mask_write 0XF8000720 0x00003FFF 0x00000700
-    mask_write 0XF8000724 0x00003FFF 0x00000600
-    mask_write 0XF8000728 0x00003FFF 0x00000600
-    mask_write 0XF800072C 0x00003FFF 0x00000600
-    mask_write 0XF8000730 0x00003FFF 0x00000600
-    mask_write 0XF8000734 0x00003FFF 0x00000600
-    mask_write 0XF8000738 0x00003FFF 0x00000600
-    mask_write 0XF800073C 0x00003FFF 0x00000600
-    mask_write 0XF8000740 0x00003FFF 0x00000302
-    mask_write 0XF8000744 0x00003FFF 0x00000302
-    mask_write 0XF8000748 0x00003FFF 0x00000302
-    mask_write 0XF800074C 0x00003FFF 0x00000302
-    mask_write 0XF8000750 0x00003FFF 0x00000302
-    mask_write 0XF8000754 0x00003FFF 0x00000302
-    mask_write 0XF8000758 0x00003FFF 0x00000303
-    mask_write 0XF800075C 0x00003FFF 0x00000303
-    mask_write 0XF8000760 0x00003FFF 0x00000303
-    mask_write 0XF8000764 0x00003FFF 0x00000303
-    mask_write 0XF8000768 0x00003FFF 0x00000303
-    mask_write 0XF800076C 0x00003FFF 0x00000303
-    mask_write 0XF8000770 0x00003FFF 0x00000304
-    mask_write 0XF8000774 0x00003FFF 0x00000305
-    mask_write 0XF8000778 0x00003FFF 0x00000304
-    mask_write 0XF800077C 0x00003FFF 0x00000305
-    mask_write 0XF8000780 0x00003FFF 0x00000304
-    mask_write 0XF8000784 0x00003FFF 0x00000304
-    mask_write 0XF8000788 0x00003FFF 0x00000304
-    mask_write 0XF800078C 0x00003FFF 0x00000304
-    mask_write 0XF8000790 0x00003FFF 0x00000305
-    mask_write 0XF8000794 0x00003FFF 0x00000304
-    mask_write 0XF8000798 0x00003FFF 0x00000304
-    mask_write 0XF800079C 0x00003FFF 0x00000304
-    mask_write 0XF80007A0 0x00003FFF 0x00000380
-    mask_write 0XF80007A4 0x00003FFF 0x00000380
-    mask_write 0XF80007A8 0x00003FFF 0x00000380
-    mask_write 0XF80007AC 0x00003FFF 0x00000380
-    mask_write 0XF80007B0 0x00003FFF 0x00000380
-    mask_write 0XF80007B4 0x00003FFF 0x00000380
-    mask_write 0XF80007B8 0x00003F01 0x00000201
-    mask_write 0XF80007BC 0x00003F01 0x00000201
-    mask_write 0XF80007C0 0x00003FFF 0x000002E0
-    mask_write 0XF80007C4 0x00003FFF 0x000002E1
-    mask_write 0XF80007C8 0x00003FFF 0x00000200
-    mask_write 0XF80007CC 0x00003FFF 0x00000200
-    mask_write 0XF80007D0 0x00003FFF 0x00000280
-    mask_write 0XF80007D4 0x00003FFF 0x00000280
-    mask_write 0XF8000830 0x003F003F 0x002F002E
-    mwr -force 0XF8000004 0x0000767B
-}
-proc ps7_peripherals_init_data_2_0 {} {
-    mwr -force 0XF8000008 0x0000DF0D
-    mask_write 0XF8000B48 0x00000180 0x00000180
-    mask_write 0XF8000B4C 0x00000180 0x00000180
-    mask_write 0XF8000B50 0x00000180 0x00000180
-    mask_write 0XF8000B54 0x00000180 0x00000180
-    mwr -force 0XF8000004 0x0000767B
-    mask_write 0XE0001034 0x000000FF 0x00000006
-    mask_write 0XE0001018 0x0000FFFF 0x0000003E
-    mask_write 0XE0001000 0x000001FF 0x00000017
-    mask_write 0XE0001004 0x00000FFF 0x00000020
-    mask_write 0XE000D000 0x00080000 0x00080000
-    mask_write 0XF8007000 0x20000000 0x00000000
-}
-proc ps7_post_config_2_0 {} {
-    mwr -force 0XF8000008 0x0000DF0D
-    mask_write 0XF8000900 0x0000000F 0x0000000F
-    mask_write 0XF8000240 0xFFFFFFFF 0x00000000
-    mwr -force 0XF8000004 0x0000767B
-}
-proc ps7_debug_2_0 {} {
-    mwr -force 0XF8898FB0 0xC5ACCE55
-    mwr -force 0XF8899FB0 0xC5ACCE55
-    mwr -force 0XF8809FB0 0xC5ACCE55
-}
-proc ps7_pll_init_data_1_0 {} {
-    mwr -force 0XF8000008 0x0000DF0D
-    mask_write 0XF8000110 0x003FFFF0 0x000FA220
-    mask_write 0XF8000100 0x0007F000 0x00028000
-    mask_write 0XF8000100 0x00000010 0x00000010
-    mask_write 0XF8000100 0x00000001 0x00000001
-    mask_write 0XF8000100 0x00000001 0x00000000
-    mask_poll 0XF800010C 0x00000001
-    mask_write 0XF8000100 0x00000010 0x00000000
-    mask_write 0XF8000120 0x1F003F30 0x1F000200
-    mask_write 0XF8000114 0x003FFFF0 0x0012C220
-    mask_write 0XF8000104 0x0007F000 0x00020000
-    mask_write 0XF8000104 0x00000010 0x00000010
-    mask_write 0XF8000104 0x00000001 0x00000001
-    mask_write 0XF8000104 0x00000001 0x00000000
-    mask_poll 0XF800010C 0x00000002
-    mask_write 0XF8000104 0x00000010 0x00000000
-    mask_write 0XF8000124 0xFFF00003 0x0C200003
-    mask_write 0XF8000118 0x003FFFF0 0x001452C0
-    mask_write 0XF8000108 0x0007F000 0x0001E000
-    mask_write 0XF8000108 0x00000010 0x00000010
-    mask_write 0XF8000108 0x00000001 0x00000001
-    mask_write 0XF8000108 0x00000001 0x00000000
-    mask_poll 0XF800010C 0x00000004
-    mask_write 0XF8000108 0x00000010 0x00000000
-    mwr -force 0XF8000004 0x0000767B
-}
-proc ps7_clock_init_data_1_0 {} {
-    mwr -force 0XF8000008 0x0000DF0D
-    mask_write 0XF8000128 0x03F03F01 0x00700F01
-    mask_write 0XF8000138 0x00000011 0x00000001
-    mask_write 0XF8000140 0x03F03F71 0x00100801
-    mask_write 0XF800014C 0x00003F31 0x00000501
-    mask_write 0XF8000150 0x00003F33 0x00001401
-    mask_write 0XF8000154 0x00003F33 0x00001402
-    mask_write 0XF8000168 0x00003F31 0x00000501
-    mask_write 0XF8000170 0x03F03F30 0x00200400
-    mask_write 0XF80001C4 0x00000001 0x00000001
-    mask_write 0XF800012C 0x01FFCCCD 0x01EC044D
-    mwr -force 0XF8000004 0x0000767B
-}
-proc ps7_ddr_init_data_1_0 {} {
-    mask_write 0XF8006000 0x0001FFFF 0x00000080
-    mask_write 0XF8006004 0x1FFFFFFF 0x00081081
-    mask_write 0XF8006008 0x03FFFFFF 0x03C0780F
-    mask_write 0XF800600C 0x03FFFFFF 0x02001001
-    mask_write 0XF8006010 0x03FFFFFF 0x00014001
-    mask_write 0XF8006014 0x001FFFFF 0x0004159B
-    mask_write 0XF8006018 0xF7FFFFFF 0x452460D2
-    mask_write 0XF800601C 0xFFFFFFFF 0x720238E5
-    mask_write 0XF8006020 0xFFFFFFFC 0x272872D0
-    mask_write 0XF8006024 0x0FFFFFFF 0x0000003C
-    mask_write 0XF8006028 0x00003FFF 0x00002007
-    mask_write 0XF800602C 0xFFFFFFFF 0x00000008
-    mask_write 0XF8006030 0xFFFFFFFF 0x00040930
-    mask_write 0XF8006034 0x13FF3FFF 0x000116D4
-    mask_write 0XF8006038 0x00001FC3 0x00000000
-    mask_write 0XF800603C 0x000FFFFF 0x00000777
-    mask_write 0XF8006040 0xFFFFFFFF 0xFFF00000
-    mask_write 0XF8006044 0x0FFFFFFF 0x0FF66666
-    mask_write 0XF8006048 0x3FFFFFFF 0x0003C248
-    mask_write 0XF8006050 0xFF0F8FFF 0x77010800
-    mask_write 0XF8006058 0x0001FFFF 0x00000101
-    mask_write 0XF800605C 0x0000FFFF 0x00005003
-    mask_write 0XF8006060 0x000017FF 0x0000003E
-    mask_write 0XF8006064 0x00021FE0 0x00020000
-    mask_write 0XF8006068 0x03FFFFFF 0x00284141
-    mask_write 0XF800606C 0x0000FFFF 0x00001610
-    mask_write 0XF80060A0 0x00FFFFFF 0x00008000
-    mask_write 0XF80060A4 0xFFFFFFFF 0x10200802
-    mask_write 0XF80060A8 0x0FFFFFFF 0x0690CB73
-    mask_write 0XF80060AC 0x000001FF 0x000001FE
-    mask_write 0XF80060B0 0x1FFFFFFF 0x1CFFFFFF
-    mask_write 0XF80060B4 0x000007FF 0x00000200
-    mask_write 0XF80060B8 0x01FFFFFF 0x00200066
-    mask_write 0XF80060C4 0x00000003 0x00000000
-    mask_write 0XF80060C8 0x000000FF 0x00000000
-    mask_write 0XF80060DC 0x00000001 0x00000000
-    mask_write 0XF80060F0 0x0000FFFF 0x00000000
-    mask_write 0XF80060F4 0x0000000F 0x00000008
-    mask_write 0XF8006114 0x000000FF 0x00000000
-    mask_write 0XF8006118 0x7FFFFFFF 0x40000001
-    mask_write 0XF800611C 0x7FFFFFFF 0x40000001
-    mask_write 0XF8006120 0x7FFFFFFF 0x40000001
-    mask_write 0XF8006124 0x7FFFFFFF 0x40000001
-    mask_write 0XF800612C 0x000FFFFF 0x00033C03
-    mask_write 0XF8006130 0x000FFFFF 0x00034003
-    mask_write 0XF8006134 0x000FFFFF 0x0002F400
-    mask_write 0XF8006138 0x000FFFFF 0x00030400
-    mask_write 0XF8006140 0x000FFFFF 0x00000035
-    mask_write 0XF8006144 0x000FFFFF 0x00000035
-    mask_write 0XF8006148 0x000FFFFF 0x00000035
-    mask_write 0XF800614C 0x000FFFFF 0x00000035
-    mask_write 0XF8006154 0x000FFFFF 0x00000083
-    mask_write 0XF8006158 0x000FFFFF 0x00000083
-    mask_write 0XF800615C 0x000FFFFF 0x00000080
-    mask_write 0XF8006160 0x000FFFFF 0x00000080
-    mask_write 0XF8006168 0x001FFFFF 0x00000124
-    mask_write 0XF800616C 0x001FFFFF 0x00000125
-    mask_write 0XF8006170 0x001FFFFF 0x00000112
-    mask_write 0XF8006174 0x001FFFFF 0x00000116
-    mask_write 0XF800617C 0x000FFFFF 0x000000C3
-    mask_write 0XF8006180 0x000FFFFF 0x000000C3
-    mask_write 0XF8006184 0x000FFFFF 0x000000C0
-    mask_write 0XF8006188 0x000FFFFF 0x000000C0
-    mask_write 0XF8006190 0xFFFFFFFF 0x10040080
-    mask_write 0XF8006194 0x000FFFFF 0x0001FC82
-    mask_write 0XF8006204 0xFFFFFFFF 0x00000000
-    mask_write 0XF8006208 0x000F03FF 0x000803FF
-    mask_write 0XF800620C 0x000F03FF 0x000803FF
-    mask_write 0XF8006210 0x000F03FF 0x000803FF
-    mask_write 0XF8006214 0x000F03FF 0x000803FF
-    mask_write 0XF8006218 0x000F03FF 0x000003FF
-    mask_write 0XF800621C 0x000F03FF 0x000003FF
-    mask_write 0XF8006220 0x000F03FF 0x000003FF
-    mask_write 0XF8006224 0x000F03FF 0x000003FF
-    mask_write 0XF80062A8 0x00000FF7 0x00000000
-    mask_write 0XF80062AC 0xFFFFFFFF 0x00000000
-    mask_write 0XF80062B0 0x003FFFFF 0x00005125
-    mask_write 0XF80062B4 0x0003FFFF 0x000012A8
-    mask_poll 0XF8000B74 0x00002000
-    mask_write 0XF8006000 0x0001FFFF 0x00000081
-    mask_poll 0XF8006054 0x00000007
-}
-proc ps7_mio_init_data_1_0 {} {
-    mwr -force 0XF8000008 0x0000DF0D
-    mask_write 0XF8000B40 0x00000FFF 0x00000600
-    mask_write 0XF8000B44 0x00000FFF 0x00000600
-    mask_write 0XF8000B48 0x00000FFF 0x00000672
-    mask_write 0XF8000B4C 0x00000FFF 0x00000672
-    mask_write 0XF8000B50 0x00000FFF 0x00000674
-    mask_write 0XF8000B54 0x00000FFF 0x00000674
-    mask_write 0XF8000B58 0x00000FFF 0x00000600
-    mask_write 0XF8000B5C 0xFFFFFFFF 0x0018C61C
-    mask_write 0XF8000B60 0xFFFFFFFF 0x00F9861C
-    mask_write 0XF8000B64 0xFFFFFFFF 0x00F9861C
-    mask_write 0XF8000B68 0xFFFFFFFF 0x00F9861C
-    mask_write 0XF8000B6C 0x000073FF 0x00000209
-    mask_write 0XF8000B70 0x00000021 0x00000021
-    mask_write 0XF8000B70 0x00000021 0x00000020
-    mask_write 0XF8000B70 0x07FFFFFF 0x00000823
-    mask_write 0XF8000700 0x00003FFF 0x00000600
-    mask_write 0XF8000704 0x00003FFF 0x00000702
-    mask_write 0XF8000708 0x00003FFF 0x00000702
-    mask_write 0XF800070C 0x00003FFF 0x00000702
-    mask_write 0XF8000710 0x00003FFF 0x00000702
-    mask_write 0XF8000714 0x00003FFF 0x00000702
-    mask_write 0XF8000718 0x00003FFF 0x00000702
-    mask_write 0XF800071C 0x00003FFF 0x00000600
-    mask_write 0XF8000720 0x00003FFF 0x00000700
-    mask_write 0XF8000724 0x00003FFF 0x00000600
-    mask_write 0XF8000728 0x00003FFF 0x00000600
-    mask_write 0XF800072C 0x00003FFF 0x00000600
-    mask_write 0XF8000730 0x00003FFF 0x00000600
-    mask_write 0XF8000734 0x00003FFF 0x00000600
-    mask_write 0XF8000738 0x00003FFF 0x00000600
-    mask_write 0XF800073C 0x00003FFF 0x00000600
-    mask_write 0XF8000740 0x00003FFF 0x00000302
-    mask_write 0XF8000744 0x00003FFF 0x00000302
-    mask_write 0XF8000748 0x00003FFF 0x00000302
-    mask_write 0XF800074C 0x00003FFF 0x00000302
-    mask_write 0XF8000750 0x00003FFF 0x00000302
-    mask_write 0XF8000754 0x00003FFF 0x00000302
-    mask_write 0XF8000758 0x00003FFF 0x00000303
-    mask_write 0XF800075C 0x00003FFF 0x00000303
-    mask_write 0XF8000760 0x00003FFF 0x00000303
-    mask_write 0XF8000764 0x00003FFF 0x00000303
-    mask_write 0XF8000768 0x00003FFF 0x00000303
-    mask_write 0XF800076C 0x00003FFF 0x00000303
-    mask_write 0XF8000770 0x00003FFF 0x00000304
-    mask_write 0XF8000774 0x00003FFF 0x00000305
-    mask_write 0XF8000778 0x00003FFF 0x00000304
-    mask_write 0XF800077C 0x00003FFF 0x00000305
-    mask_write 0XF8000780 0x00003FFF 0x00000304
-    mask_write 0XF8000784 0x00003FFF 0x00000304
-    mask_write 0XF8000788 0x00003FFF 0x00000304
-    mask_write 0XF800078C 0x00003FFF 0x00000304
-    mask_write 0XF8000790 0x00003FFF 0x00000305
-    mask_write 0XF8000794 0x00003FFF 0x00000304
-    mask_write 0XF8000798 0x00003FFF 0x00000304
-    mask_write 0XF800079C 0x00003FFF 0x00000304
-    mask_write 0XF80007A0 0x00003FFF 0x00000380
-    mask_write 0XF80007A4 0x00003FFF 0x00000380
-    mask_write 0XF80007A8 0x00003FFF 0x00000380
-    mask_write 0XF80007AC 0x00003FFF 0x00000380
-    mask_write 0XF80007B0 0x00003FFF 0x00000380
-    mask_write 0XF80007B4 0x00003FFF 0x00000380
-    mask_write 0XF80007B8 0x00003F01 0x00000201
-    mask_write 0XF80007BC 0x00003F01 0x00000201
-    mask_write 0XF80007C0 0x00003FFF 0x000002E0
-    mask_write 0XF80007C4 0x00003FFF 0x000002E1
-    mask_write 0XF80007C8 0x00003FFF 0x00000200
-    mask_write 0XF80007CC 0x00003FFF 0x00000200
-    mask_write 0XF80007D0 0x00003FFF 0x00000280
-    mask_write 0XF80007D4 0x00003FFF 0x00000280
-    mask_write 0XF8000830 0x003F003F 0x002F002E
-    mwr -force 0XF8000004 0x0000767B
-}
-proc ps7_peripherals_init_data_1_0 {} {
-    mwr -force 0XF8000008 0x0000DF0D
-    mask_write 0XF8000B48 0x00000180 0x00000180
-    mask_write 0XF8000B4C 0x00000180 0x00000180
-    mask_write 0XF8000B50 0x00000180 0x00000180
-    mask_write 0XF8000B54 0x00000180 0x00000180
-    mwr -force 0XF8000004 0x0000767B
-    mask_write 0XE0001034 0x000000FF 0x00000006
-    mask_write 0XE0001018 0x0000FFFF 0x0000003E
-    mask_write 0XE0001000 0x000001FF 0x00000017
-    mask_write 0XE0001004 0x00000FFF 0x00000020
-    mask_write 0XE000D000 0x00080000 0x00080000
-    mask_write 0XF8007000 0x20000000 0x00000000
-}
-proc ps7_post_config_1_0 {} {
-    mwr -force 0XF8000008 0x0000DF0D
-    mask_write 0XF8000900 0x0000000F 0x0000000F
-    mask_write 0XF8000240 0xFFFFFFFF 0x00000000
-    mwr -force 0XF8000004 0x0000767B
-}
-proc ps7_debug_1_0 {} {
-    mwr -force 0XF8898FB0 0xC5ACCE55
-    mwr -force 0XF8899FB0 0xC5ACCE55
-    mwr -force 0XF8809FB0 0xC5ACCE55
-}
-set PCW_SILICON_VER_1_0 "0x0"
-set PCW_SILICON_VER_2_0 "0x1"
-set PCW_SILICON_VER_3_0 "0x2"
-set APU_FREQ  666666667
-
-
-
-proc mask_poll { addr mask } {
-    set count 1
-    set curval "0x[string range [mrd $addr] end-8 end]"
-    set maskedval [expr {$curval & $mask}]
-    while { $maskedval == 0 } {
-        set curval "0x[string range [mrd $addr] end-8 end]"
-        set maskedval [expr {$curval & $mask}]
-        set count [ expr { $count + 1 } ]
-        if { $count == 100000000 } {
-          puts "Timeout Reached. Mask poll failed at ADDRESS: $addr MASK: $mask"
-          break
-        }
-    }
-}
-
-
-
-proc mask_delay { addr val } {
-    set delay  [ get_number_of_cycles_for_delay $val ]
-    perf_reset_and_start_timer
-    set curval "0x[string range [mrd $addr] end-8 end]"
-    set maskedval [expr {$curval < $delay}]
-    while { $maskedval == 1 } {
-        set curval "0x[string range [mrd $addr] end-8 end]"
-        set maskedval [expr {$curval < $delay}]
-    }
-    perf_reset_clock 
-}
-
-proc ps_version { } {
-    set si_ver "0x[string range [mrd 0xF8007080] end-8 end]"
-    set mask_sil_ver "0x[expr {$si_ver >> 28}]"
-    return $mask_sil_ver;
-}
-
-proc ps7_post_config {} {
-
-        ps7_post_config_1_0   
-
-}
-
-proc ps7_debug {} {
-        ps7_debug_1_0   
-
-}
-proc ps7_init {} {
-
-            ps7_mio_init_data_1_0
-            ps7_pll_init_data_1_0
-            ps7_clock_init_data_1_0
-            ps7_ddr_init_data_1_0
-            ps7_peripherals_init_data_1_0
-}
-
-
-# For delay calculation using global timer 
-
-# start timer 
- proc perf_start_clock { } {
-
-    #writing SCU_GLOBAL_TIMER_CONTROL register
-
-    mask_write 0xF8F00208 0x00000109 0x00000009
-}
-
-# stop timer and reset timer count regs 
- proc perf_reset_clock { } {
-	perf_disable_clock
-    mask_write 0xF8F00200 0xFFFFFFFF 0x00000000
-    mask_write 0xF8F00204 0xFFFFFFFF 0x00000000
-}
-
-# Compute mask for given delay in miliseconds
-proc get_number_of_cycles_for_delay { delay } {
-
-  # GTC is always clocked at 1/2 of the CPU frequency (CPU_3x2x)
-  variable APU_FREQ
-  return [ expr ($delay * $APU_FREQ /(2 * 1000))]
-}
-
-
-# stop timer 
-proc perf_disable_clock {} {
-    mask_write 0xF8F00208 0xFFFFFFFF 0x00000000 
-}
-
-proc perf_reset_and_start_timer {} {
-  	    perf_reset_clock 
-	    perf_start_clock 
-}
-
-
--- a/openocd/redpitaya.cfg
+++ b/openocd/redpitaya.cfg
@ -0,0 +1,38 @@
+source ./digilent-hs2.cfg
+adapter_khz 1000
+
+set PL_TAPID 0x13722093
+set SMP 1
+
+source ./zynq-7000.cfg
+
+reset_config none
+
+set XC7_JSHUTDOWN 0x0d
+set XC7_JPROGRAM 0x0b
+set XC7_JSTART 0x0c
+set XC7_BYPASS 0x3f
+
+proc xc7_program {tap} {
+    global XC7_JSHUTDOWN XC7_JPROGRAM XC7_JSTART XC7_BYPASS
+    irscan $tap $XC7_JSHUTDOWN
+    irscan $tap $XC7_JPROGRAM
+    runtest 60000
+    #JSTART prevents this from working...
+    #irscan $tap $XC7_JSTART
+    runtest 2000
+    irscan $tap $XC7_BYPASS
+    runtest 2000
+}
+
+pld device virtex2 zynq.tap 1
+init
+xc7_program zynq.tap
+
+halt
+
+# Disable MMU
+targets $_TARGETNAME_1
+arm mcr 15 0 1 0 0 [expr [arm mrc 15 0 1 0 0] & ~0xd]
+targets $_TARGETNAME_0
+arm mcr 15 0 1 0 0 [expr [arm mrc 15 0 1 0 0] & ~0xd]
--- a/openocd/xilinx-tcl.cfg
+++ b/openocd/xilinx-tcl.cfg
@ -1,61 +0,0 @@
-#
-# TCL to allow the Xilinx PS7 Init TCL code to run in OpenOCD.
-#
-
-proc mrd { args } {
-    if {[llength $args] == 0} {
-        echo "mrd address \[count \[w|h|b\]\]"
-        echo "    Read <count> memory locations starting at <address>.  Defaults to one word."
-        return
-    }
-    set addr [lindex $args 0]
-    set count  1
-    set bits  32
-    if {[llength $args] > 1} {
-        set count [lindex $args 1]
-        if {[llength $args] > 2} {
-            switch [lindex $args 2] {
-                w       { set bits 32 }
-                h       { set bits 16 }
-                b       { set bits  8 }
-                default { set bits 32 }
-            }
-        }
-    }
-    mem2array x $bits $addr $count
-    set nibbles [expr {$bits / 4}]
-    set bytes   [expr {$bits / 8}]
-    set result  {}
-    foreach {idx elmt} $x {
-        append result [format "%08x:   %0*x\n" [expr {$addr + $idx * $bytes}] $nibbles $elmt]
-    }
-    return $result
-}
-
-proc mwr { args } {
-  set addr [lindex $args 1]
-  set data [lindex $args 2]
-  mww $addr $data
-}
-
-proc mask_write { addr mask value } {
-    set curval "0x[string range [mrd $addr] end-8 end]"
-    set maskedval [expr {$curval & ~$mask}]
-    #echo "curval = [format 0x%08x $curval] maskedval = [format 0x%08x $maskedval]"
-    set writeval(0) [expr {$maskedval | $value}]
-    #echo " $addr <= [format 0x%08x $writeval(0)] ([format 0x%08x $curval]: [format 0x%08x $mask]/[format 0x%08x $value])"
-    array2mem writeval 32 $addr 1
-}
-
-proc xilinx_ps7_init { } {
-   poll off
-   reset init
-   reset halt
-   targets zynq.cpu.0
-   sleep 100
-   halt
-   ps7_debug
-   ps7_init
-   ps7_post_config
-   poll on
-}
--- a/openocd/zc706.cfg
+++ b/openocd/zc706.cfg
@ -1,13 +1,10 @@
 source [find interface/ftdi/olimex-arm-usb-tiny-h.cfg]
-source [find xilinx-tcl.cfg]
 adapter_khz 1000

 set PL_TAPID 0x23731093
 set SMP 1

 source ./zynq-7000.cfg
-source ./xilinx-tcl.cfg
-source ./ps7_init.tcl

 reset_config srst_only srst_open_drain
 adapter_nsrst_assert_width 250
@ -34,7 +31,7 @@ pld device virtex2 zynq.tap 1
 init
 xc7_program zynq.tap

-xilinx_ps7_init
+reset halt

 # Disable MMU
 targets $_TARGETNAME_1
--- a/openocd/zynq-7000.cfg
+++ b/openocd/zynq-7000.cfg
@ -93,119 +93,3 @@ if { $_SMP } {
        -dbgbase 0x80092000
    target smp $_TARGETNAME_0 $_TARGETNAME_1
 }
-
-#
-# Hack to get the registers into a stable state when first booting a zynq in
-# JTAG mode. If r11 is pointing to an invalid address and you use gdb to set a
-# register the write will fail because gdb attempts to scan or unwind the
-# current frame and the bad address seems to lock the bus up. This code puts
-# the registers into the OCM and hopefull safe.
-#
-proc zynq_clear_registers { target } {
-    echo "Zynq-7000 Series setup: $target"
-    set _OCM_END 0x0003FFF0
-    mww phys 0xF8007000 0x4E00E07F
-    reg r0 0
-    reg r1 0
-    reg r2 0
-    reg r3 0
-    reg r4 0
-    reg r5 0
-    reg r6 0
-    reg r7 0
-    reg r8 0
-    reg r9 0
-    reg r10 0
-    reg r11 $_OCM_END
-    reg sp_svc $_OCM_END
-    reg lr_svc $_OCM_END
-    reg sp_abt $_OCM_END
-    reg lr_abt $_OCM_END
-    reg sp_und $_OCM_END
-    reg lr_und $_OCM_END
-}
-
-proc zynq_disable_mmu_and_caches { target } {
-    # arm mcr pX op1 CRn CRm op2 value
-    echo "Disable MMU and caches"
-    # Invalidate caches
-    catch {
-        $target arm mcr 15 0 7 5 0 0
-        $target arm mcr 15 0 7 7 0 0
-        # Invalidate all TLBs
-        $target arm mcr 15 0 8 5 0 0
-        $target arm mcr 15 0 8 6 0 0
-        $target arm mcr 15 0 8 7 0 0
-        $target arm mcr 15 4 8 3 0 0
-        $target arm mcr 15 4 8 7 0 0
-        set cp [$target arm mrc 15 0 1 0 0]
-        echo "SCTRL => [format 0x%x $cp]"
-        set mask [expr 1 << 29 | 1 << 12 | 1 << 11 | 1 << 2 | 1 << 1 | 1 << 0]
-        set cp [expr ($cp & ~$mask)]
-        $target arm mcr 15 0 1 0 0 $cp
-        echo "SCTRL <= [format 0x%x $cp]"
-    }
-}
-
-proc zynq_boot_ocm_setup { } {
-    #
-    # Enable the OCM
-    #
-    echo "Zynq Boot OCM setup"
-    catch {
-      mww phys 0xF8000008 0xDF0D
-      mww phys 0xF8000238 0
-      mww phys 0xF8000910 0xC
-    }
-}
-
-proc zynq_rtems_setup { } {
-    cache_config l2x 0xF8F02000 8
-    cortex_a maskisr on
-}
-
-proc zynq_restart { wait } {
-    global _SMP
-    global _TARGETNAME_0
-    global _TARGETNAME_1
-    set target0 $_TARGETNAME_0
-    set target1 $_TARGETNAME_1
-    echo "Zynq reset, resetting the board ... "
-    poll off
-    #
-    # Issue the reset via the SLCR
-    #
-    catch {
-        mww phys 0xF8000008 0xDF0D
-        mww phys 0xF8000200 1
-    }
-    echo "Zynq reset waiting for $wait msecs ... "
-    sleep $wait
-    #
-    # Reconnect the DAP etc due to the reset.
-    #
-    $target0 cortex_a dbginit
-    $target0 arm core_state arm
-    if { $_SMP } {
-        $target1 arm core_state arm
-        $target1 cortex_a dbginit
-        cortex_a smp_off
-    }
-    poll on
-    #
-    # We can now halt the core.
-    #
-    if { $_SMP } {
-        targets $target1
-        halt
-    }
-    targets $target0
-    halt
-    zynq_rtems_setup
-}
-
-proc zynq_gdb_attach { target } {
-    catch {
-      halt
-    }
-}
--- a/qemu.gdb
+++ b/qemu.gdb
@ -1,6 +0,0 @@
-target remote :1234
-
-# print demangled symbols by default
-set print asm-demangle on
-
-load
--- a/remote_run.sh
+++ b/remote_run.sh
@ -4,7 +4,7 @@ set -e

 target_host="rpi-4.m-labs.hk"

-while getopts "h:i" opt; do
+while getopts "h:" opt; do
    case "$opt" in
    \?) exit 0
        ;;
--- a/runner.sh
+++ b/runner.sh
@ -1,11 +0,0 @@
-#!/usr/bin/env bash
-
-set -e -m
-
-ELF=$1
-IMAGE=$ELF.bin
-arm-none-eabihf-objcopy -O binary $ELF $IMAGE
-qemu-system-arm -M xilinx-zynq-a9 -s -kernel $IMAGE -chardev file,id=uart0,path=/tmp/qemu.serial &
-sleep 1
-gdb -x qemu.gdb $ELF
-kill -KILL %1
--- a/shell.nix
+++ b/shell.nix
@ -1,24 +1,26 @@
 let
-  mozillaOverlay = import (builtins.fetchTarball https://github.com/mozilla/nixpkgs-mozilla/archive/master.tar.gz);
-  pkgs = import <nixpkgs> { overlays = [ mozillaOverlay ]; };
+  pkgs = import <nixpkgs> { overlays = [ (import ./nix/mozilla-overlay.nix) ]; };
+  rustPlatform = (import ./nix/rust-platform.nix { inherit pkgs; });
+  cargo-xbuild = (import ./default.nix).cargo-xbuild;
 in
-with pkgs;
-let
-  project = callPackage ./default.nix {};
-in
-with project;
-stdenv.mkDerivation {
-  name = "zynq-env";
-  buildInputs = (with rustPlatform.rust; [
-    rustc cargo
-    cargo-xbuild rustcSrc
-  ]) ++ (with pkgs; [ openocd gdb ]);
+  pkgs.stdenv.mkDerivation {
+    name = "zynq-env";
+    buildInputs = [
+      rustPlatform.rust.rustc
+      rustPlatform.rust.cargo
+      pkgs.cacert
+      cargo-xbuild

-  # Set Environment Variables
-  RUST_BACKTRACE = 1;
-  XARGO_RUST_SRC = "${rustcSrc}/src";
+      pkgs.openocd pkgs.gdb
+      pkgs.openssh pkgs.rsync
+      pkgs.llvmPackages_9.clang-unwrapped

-  shellHook = ''
-    echo "Run 'cargo xbuild --release -p experiments' to build."
-  '';
-}
+      (import ./nix/mkbootimage.nix { inherit pkgs; })
+    ];
+
+    XARGO_RUST_SRC = "${rustPlatform.rust.rustc}/lib/rustlib/src/rust/library";
+
+    shellHook = ''
+      echo "Run 'cargo xbuild --release -p ...' to build."
+    '';
+  }
--- a/szl/Cargo.toml
+++ b/szl/Cargo.toml
@ -0,0 +1,24 @@
+[package]
+name = "szl"
+description = "Simple Zynq Loader"
+version = "0.1.0"
+authors = ["M-Labs"]
+edition = "2018"
+
+[features]
+target_zc706 = ["libboard_zynq/target_zc706", "libsupport_zynq/target_zc706", "libconfig/target_zc706"]
+target_coraz7 = ["libboard_zynq/target_coraz7", "libsupport_zynq/target_coraz7", "libconfig/target_coraz7"]
+target_redpitaya = ["libboard_zynq/target_redpitaya", "libsupport_zynq/target_redpitaya", "libconfig/target_redpitaya"]
+target_kasli_soc = ["libboard_zynq/target_kasli_soc", "libsupport_zynq/target_kasli_soc", "libconfig/target_kasli_soc"]
+default = ["target_zc706"]
+
+[dependencies]
+log = "0.4"
+byteorder = { version = "1.3", default-features = false }
+core_io = { version = "0.1", features = ["collections"] }
+
+libboard_zynq = { path = "../libboard_zynq" }
+libsupport_zynq = { path = "../libsupport_zynq" }
+libcortex_a9 = { path = "../libcortex_a9" }
+libregister = { path = "../libregister" }
+libconfig = { path = "../libconfig" }
--- a/szl/build.rs
+++ b/szl/build.rs
@ -0,0 +1,22 @@
+use std::env;
+use std::fs::File;
+use std::io::Write;
+use std::path::PathBuf;
+
+fn main() {
+    println!("cargo:rerun-if-changed=build.rs");
+    let out = env::var("OUT_DIR").unwrap();
+    let out_dir = &PathBuf::from(&out);
+
+    // Put the linker script somewhere the linker can find it
+    File::create(out_dir.join("link.x"))
+        .unwrap()
+        .write_all(include_bytes!("link.x"))
+        .unwrap();
+    println!("cargo:rustc-link-search={}", out_dir.display());
+
+    // Only re-run the build script when link.x is changed,
+    // instead of when any part of the source code changes.
+    println!("cargo:rerun-if-changed=link.x");
+}
+
--- a/szl/link.x
+++ b/szl/link.x
@ -0,0 +1,84 @@
+ENTRY(Reset);
+
+MEMORY
+{
+    /* 256 kB On-Chip Memory */
+    OCM : ORIGIN = 0, LENGTH = 0x30000
+    SDRAM : ORIGIN = 0x00100000, LENGTH = 0x1FF00000
+    OCM3 : ORIGIN = 0xFFFF0000, LENGTH = 0x10000
+}
+
+SECTIONS
+{
+    .text :
+    {
+        KEEP(*(.text.exceptions));
+        *(.text.boot);
+        *(.text .text.*);
+    } > OCM
+ 
+    .rodata : ALIGN(4)
+    {
+        *(.rodata .rodata.*);
+    } > OCM
+ 
+    .data : ALIGN(4)
+    {
+        *(.data .data.*);
+    } > OCM
+
+    .heap (NOLOAD) : ALIGN(8)
+    {
+        __runtime_start = .;
+        . += 0x8000000;
+        __runtime_end = .;
+        __heap0_start = .;
+        . += 0x8000000;
+        __heap0_end = .;
+    } > SDRAM
+ 
+    .bss (NOLOAD) : ALIGN(4)
+    {
+        __bss_start = .;
+        *(.bss .bss.*);
+        . = ALIGN(4);
+        __bss_end = .;
+    } > OCM3
+
+    .stack1 (NOLOAD) : ALIGN(8)
+    {
+        __stack1_end = .;
+        . += 0x100;
+        __stack1_start = .;
+    } > OCM3
+
+    .stack0 (NOLOAD) : ALIGN(8)
+    {
+        __stack0_end = .;
+        . += 0x4000;
+        __stack0_start = .;
+    } > OCM3
+
+    .irq_stack1 (NOLOAD) : ALIGN(8)
+    {
+        __irq_stack1_end = .;
+        . += 0x100;
+        __irq_stack1_start = .;
+    } > OCM3
+
+    .irq_stack0 (NOLOAD) : ALIGN(8)
+    {
+        __irq_stack0_end = .;
+        . += 0x100;
+        __irq_stack0_start = .;
+    } > OCM3
+
+
+    /DISCARD/ :
+    {
+        /* Unused exception related info that only wastes space */
+        *(.ARM.exidx);
+        *(.ARM.exidx.*);
+        *(.ARM.extab.*);
+    }
+}
--- a/szl/src/main.rs
+++ b/szl/src/main.rs
@ -0,0 +1,165 @@
+#![no_std]
+#![no_main]
+
+extern crate alloc;
+extern crate log;
+
+mod netboot;
+
+use alloc::rc::Rc;
+use core::mem;
+use core_io::{Read, Seek};
+use libboard_zynq::{
+    self as zynq,
+    clocks::source::{ArmPll, ClockSource, IoPll},
+    clocks::Clocks,
+    logger, println, sdio, slcr,
+    timer::GlobalTimer,
+};
+use libconfig::{bootgen, sd_reader, Config};
+use libcortex_a9::{
+    asm::{dsb, isb},
+    cache::{bpiall, dcciall, iciallu},
+};
+use libregister::RegisterR;
+use libsupport_zynq::ram;
+use log::info;
+
+extern "C" {
+    static mut __runtime_start: usize;
+    static mut __runtime_end: usize;
+}
+
+fn boot_sd<File: Read + Seek>(
+    file: &mut Option<File>,
+    runtime_start: *mut u8,
+    runtime_max: usize,
+) -> Result<(), ()> {
+    if file.is_none() {
+        log::error!("No bootgen file");
+        return Err(());
+    }
+    let mut file = file.as_mut().unwrap();
+    info!("Loading gateware");
+    bootgen::load_bitstream(&mut file).map_err(|e| log::error!("Cannot load gateware: {:?}", e))?;
+
+    info!("Loading runtime");
+    let runtime =
+        bootgen::get_runtime(&mut file).map_err(|e| log::error!("Cannot load runtime: {:?}", e))?;
+
+    if runtime.len() > runtime_max {
+        log::error!(
+            "Runtime binary too large, max {} but got {}",
+            runtime_max,
+            runtime.len()
+        );
+    }
+    unsafe {
+        let target = core::slice::from_raw_parts_mut(runtime_start, runtime.len());
+        target.copy_from_slice(&runtime);
+    }
+    Ok(())
+}
+
+#[no_mangle]
+pub fn main_core0() {
+    GlobalTimer::start();
+    logger::init().unwrap();
+    log::set_max_level(log::LevelFilter::Debug);
+    println!(
+        r#"
+
+                     __________   __
+                    / ___/__  /  / /
+                    \__ \  / /  / /
+                   ___/ / / /__/ /___
+                  /____/ /____/_____/
+
+                 (C) 2020-2021 M-Labs
+"#
+    );
+    info!("Simple Zynq Loader starting...");
+
+    const CPU_FREQ: u32 = 800_000_000;
+
+    ArmPll::setup(2 * CPU_FREQ);
+    Clocks::set_cpu_freq(CPU_FREQ);
+    IoPll::setup(1_000_000_000);
+    libboard_zynq::stdio::drop_uart(); // reinitialize UART after clocking change
+    let mut ddr = zynq::ddr::DdrRam::ddrram();
+    ram::init_alloc_core0();
+
+    let sdio0 = sdio::Sdio::sdio0(true);
+    let fs = if sdio0.is_card_inserted() {
+        info!("Card inserted. Mounting file system.");
+        let sd = sdio::sd_card::SdCard::from_sdio(sdio0).unwrap();
+        let reader = sd_reader::SdReader::new(sd);
+        reader
+            .mount_fatfs(sd_reader::PartitionEntry::Entry1)
+            .map(|v| Rc::new(v))
+            .ok()
+    } else {
+        info!("No SD card inserted.");
+        None
+    };
+    let fs_ref = fs.as_ref();
+    let root_dir = fs_ref.map(|fs| fs.root_dir());
+    let mut bootgen_file = root_dir.and_then(|root_dir| root_dir.open_file("/BOOT.BIN").ok());
+    let config = Config::from_fs(fs.clone());
+
+    unsafe {
+        let max_len =
+            &__runtime_end as *const usize as usize - &__runtime_start as *const usize as usize;
+        match slcr::RegisterBlock::unlocked(|slcr| slcr.boot_mode.read().boot_mode_pins()) {
+            slcr::BootModePins::Jtag => netboot::netboot(
+                &mut bootgen_file,
+                config,
+                &mut __runtime_start as *mut usize as *mut u8,
+                max_len,
+            ),
+            slcr::BootModePins::SdCard => {
+                if boot_sd(
+                    &mut bootgen_file,
+                    &mut __runtime_start as *mut usize as *mut u8,
+                    max_len,
+                )
+                .is_err()
+                {
+                    log::error!("Error booting from SD card");
+                    log::info!("Fall back on netboot");
+                    netboot::netboot(
+                        &mut bootgen_file,
+                        config,
+                        &mut __runtime_start as *mut usize as *mut u8,
+                        max_len,
+                    )
+                }
+            }
+            v => {
+                panic!("Boot mode {:?} not supported", v);
+            }
+        };
+    }
+
+    info!("Preparing for runtime execution");
+    // Flush data cache entries for all of L1 cache, including
+    // Memory/Instruction Synchronization Barriers
+    dcciall();
+    iciallu();
+    bpiall();
+    dsb();
+    isb();
+
+    // Start core0 only, for compatibility with FSBL.
+    info!("executing payload");
+    unsafe {
+        (mem::transmute::<*mut u8, fn()>(ddr.ptr::<u8>()))();
+    }
+
+    loop {}
+}
+
+#[no_mangle]
+pub fn main_core1() {
+    panic!("core1 started but should not have");
+}
--- a/szl/src/netboot.rs
+++ b/szl/src/netboot.rs
@ -0,0 +1,399 @@
+use alloc::vec;
+use alloc::vec::Vec;
+use byteorder::{ByteOrder, NetworkEndian};
+use core_io::{Read, Seek};
+use libboard_zynq::{
+    devc,
+    eth::Eth,
+    smoltcp::{
+        self,
+        iface::{EthernetInterfaceBuilder, NeighborCache},
+        time::Instant,
+        wire::IpCidr,
+    },
+    timer::GlobalTimer,
+};
+use libconfig::{bootgen, net_settings, Config};
+
+enum NetConnState {
+    WaitCommand,
+    FirmwareLength(usize, u8),
+    FirmwareDownload(usize, usize),
+    FirmwareWaitO,
+    FirmwareWaitK,
+    GatewareLength(usize, u8),
+    GatewareDownload(usize, usize),
+    GatewareWaitO,
+    GatewareWaitK,
+}
+
+struct NetConn {
+    state: NetConnState,
+    firmware_downloaded: bool,
+    gateware_downloaded: bool,
+}
+
+impl NetConn {
+    pub fn new() -> NetConn {
+        NetConn {
+            state: NetConnState::WaitCommand,
+            firmware_downloaded: false,
+            gateware_downloaded: false,
+        }
+    }
+
+    pub fn reset(&mut self) {
+        self.state = NetConnState::WaitCommand;
+        self.firmware_downloaded = false;
+        self.gateware_downloaded = false;
+    }
+
+    fn input_partial<File: Read + Seek>(
+        &mut self,
+        bootgen_file: &mut Option<File>,
+        runtime_start: *mut u8,
+        runtime_max_len: usize,
+        buf: &[u8],
+        storage: &mut Vec<u8>,
+        mut boot_callback: impl FnMut(),
+    ) -> Result<usize, ()> {
+        match self.state {
+            NetConnState::WaitCommand => match buf[0] {
+                b'F' => {
+                    log::info!("Received firmware load command");
+                    self.state = NetConnState::FirmwareLength(0, 0);
+                    Ok(1)
+                }
+                b'G' => {
+                    log::info!("Received gateware load command");
+                    self.state = NetConnState::GatewareLength(0, 0);
+                    storage.clear();
+                    Ok(1)
+                }
+                b'B' => {
+                    if !self.gateware_downloaded {
+                        log::info!("Gateware not loaded via netboot");
+                        if bootgen_file.is_none() {
+                            log::error!("No bootgen file to load gateware");
+                            return Err(());
+                        }
+                        log::info!("Attempting to load from SD card");
+                        if let Err(e) = bootgen::load_bitstream(bootgen_file.as_mut().unwrap()) {
+                            log::error!("Gateware load failed: {:?}", e);
+                            return Err(());
+                        }
+                    }
+                    if self.firmware_downloaded {
+                        log::info!("Received boot command");
+                        boot_callback();
+                        self.state = NetConnState::WaitCommand;
+                        Ok(1)
+                    } else {
+                        log::error!("Received boot command, but no firmware downloaded");
+                        Err(())
+                    }
+                }
+                _ => {
+                    log::error!("Received unknown netboot command: 0x{:02x}", buf[0]);
+                    Err(())
+                }
+            },
+            NetConnState::FirmwareLength(firmware_length, recv_bytes) => {
+                let firmware_length = (firmware_length << 8) | (buf[0] as usize);
+                let recv_bytes = recv_bytes + 1;
+                if recv_bytes == 4 {
+                    if firmware_length > runtime_max_len {
+                        log::error!(
+                            "Runtime too large, maximum {} but requested {}",
+                            runtime_max_len,
+                            firmware_length
+                        );
+                        return Err(());
+                    }
+                    self.state = NetConnState::FirmwareDownload(firmware_length, 0);
+                    storage.clear();
+                    storage.reserve(firmware_length);
+                } else {
+                    self.state = NetConnState::FirmwareLength(firmware_length, recv_bytes);
+                }
+                Ok(1)
+            }
+            NetConnState::FirmwareDownload(firmware_length, recv_bytes) => {
+                let max_length = firmware_length - recv_bytes;
+                let buf = if buf.len() > max_length {
+                    &buf[..max_length]
+                } else {
+                    &buf[..]
+                };
+                let length = buf.len();
+
+                storage.extend_from_slice(buf);
+
+                let recv_bytes = recv_bytes + length;
+                if recv_bytes == firmware_length {
+                    self.state = NetConnState::FirmwareWaitO;
+                    Ok(length)
+                } else {
+                    self.state = NetConnState::FirmwareDownload(firmware_length, recv_bytes);
+                    Ok(length)
+                }
+            }
+            NetConnState::FirmwareWaitO => {
+                if buf[0] == b'O' {
+                    self.state = NetConnState::FirmwareWaitK;
+                    Ok(1)
+                } else {
+                    log::error!("End-of-firmware confirmation failed");
+                    Err(())
+                }
+            }
+            NetConnState::FirmwareWaitK => {
+                if buf[0] == b'K' {
+                    log::info!("Firmware successfully downloaded");
+                    self.state = NetConnState::WaitCommand;
+                    self.firmware_downloaded = true;
+                    {
+                        let dest = unsafe {
+                            core::slice::from_raw_parts_mut(runtime_start, storage.len())
+                        };
+                        dest.copy_from_slice(storage);
+                    }
+                    Ok(1)
+                } else {
+                    log::error!("End-of-firmware confirmation failed");
+                    Err(())
+                }
+            }
+
+            NetConnState::GatewareLength(gateware_length, recv_bytes) => {
+                let gateware_length = (gateware_length << 8) | (buf[0] as usize);
+                let recv_bytes = recv_bytes + 1;
+                if recv_bytes == 4 {
+                    self.state = NetConnState::GatewareDownload(gateware_length, 0);
+                    storage.clear();
+                    storage.reserve_exact(gateware_length);
+                } else {
+                    self.state = NetConnState::GatewareLength(gateware_length, recv_bytes);
+                }
+                Ok(1)
+            }
+            NetConnState::GatewareDownload(gateware_length, recv_bytes) => {
+                let max_length = gateware_length - recv_bytes;
+                let buf = if buf.len() > max_length {
+                    &buf[..max_length]
+                } else {
+                    &buf[..]
+                };
+                let length = buf.len();
+
+                storage.extend_from_slice(buf);
+
+                let recv_bytes = recv_bytes + length;
+                if recv_bytes == gateware_length {
+                    self.state = NetConnState::GatewareWaitO;
+                    Ok(length)
+                } else {
+                    self.state = NetConnState::GatewareDownload(gateware_length, recv_bytes);
+                    Ok(length)
+                }
+            }
+            NetConnState::GatewareWaitO => {
+                if buf[0] == b'O' {
+                    self.state = NetConnState::GatewareWaitK;
+                    Ok(1)
+                } else {
+                    log::error!("End-of-gateware confirmation failed");
+                    Err(())
+                }
+            }
+            NetConnState::GatewareWaitK => {
+                if buf[0] == b'K' {
+                    log::info!("Preprocessing bitstream...");
+                    // find sync word 0xFFFFFFFF AA995566
+                    let sync_word: [u8; 8] = [0xFF, 0xFF, 0xFF, 0xFF, 0xAA, 0x99, 0x55, 0x66];
+                    let mut i = 0;
+                    let mut state = 0;
+                    while i < storage.len() {
+                        if storage[i] == sync_word[state] {
+                            state += 1;
+                            if state == sync_word.len() {
+                                break;
+                            }
+                        } else {
+                            // backtrack
+                            // not very efficient but we only have 8 elements
+                            'outer: while state > 0 {
+                                state -= 1;
+                                for j in 0..state {
+                                    if storage[i - j] != sync_word[state - j] {
+                                        continue 'outer;
+                                    }
+                                }
+                                break;
+                            }
+                        }
+                        i += 1;
+                    }
+                    if state != sync_word.len() {
+                        log::error!("Sync word not found in bitstream (corrupted?)");
+                        return Err(());
+                    }
+                    // we need the sync word
+                    // i was pointing to the last element in the sync sequence
+                    i -= sync_word.len() - 1;
+                    // // append no-op
+                    // storage.extend_from_slice(&[0x20, 0, 0, 0]);
+                    let bitstream = &mut storage[i..];
+                    {
+                        // swap endian
+                        let swap = unsafe {
+                            core::slice::from_raw_parts_mut(
+                                bitstream.as_mut_ptr() as usize as *mut u32,
+                                bitstream.len() / 4,
+                            )
+                        };
+                        NetworkEndian::from_slice_u32(swap);
+                    }
+                    unsafe {
+                        // align to 64 bytes
+                        let ptr = alloc::alloc::alloc(
+                            alloc::alloc::Layout::from_size_align(bitstream.len(), 64).unwrap(),
+                        );
+                        let buffer = core::slice::from_raw_parts_mut(ptr, bitstream.len());
+                        buffer.copy_from_slice(bitstream);
+
+                        let mut devcfg = devc::DevC::new();
+                        devcfg.enable();
+                        let result = devcfg.program(&buffer);
+                        core::ptr::drop_in_place(ptr);
+                        if let Err(e) = result {
+                            log::error!("Error during FPGA startup: {}", e);
+                            return Err(());
+                        }
+                    }
+
+                    log::info!("Gateware successfully downloaded");
+                    self.state = NetConnState::WaitCommand;
+                    self.gateware_downloaded = true;
+                    Ok(1)
+                } else {
+                    log::info!("End-of-gateware confirmation failed");
+                    Err(())
+                }
+            }
+        }
+    }
+
+    fn input<File: Read + Seek>(
+        &mut self,
+        bootgen_file: &mut Option<File>,
+        runtime_start: *mut u8,
+        runtime_max_len: usize,
+        buf: &[u8],
+        storage: &mut Vec<u8>,
+        mut boot_callback: impl FnMut(),
+    ) -> Result<(), ()> {
+        let mut remaining = &buf[..];
+        while !remaining.is_empty() {
+            let read_cnt = self.input_partial(
+                bootgen_file,
+                runtime_start,
+                runtime_max_len,
+                remaining,
+                storage,
+                &mut boot_callback,
+            )?;
+            remaining = &remaining[read_cnt..];
+        }
+        Ok(())
+    }
+}
+
+pub fn netboot<File: Read + Seek>(
+    bootgen_file: &mut Option<File>,
+    cfg: Config,
+    runtime_start: *mut u8,
+    runtime_max_len: usize,
+) {
+    log::info!("Preparing network for netboot");
+    let net_addresses = net_settings::get_adresses(&cfg);
+    log::info!("Network addresses: {}", net_addresses);
+    let eth = Eth::eth0(net_addresses.hardware_addr.0.clone());
+    let eth = eth.start_rx(8);
+    let mut eth = eth.start_tx(8);
+
+    let mut neighbor_map = [None; 2];
+    let neighbor_cache = NeighborCache::new(&mut neighbor_map[..]);
+    let mut ip_addrs = [IpCidr::new(net_addresses.ipv4_addr, 0)];
+    let mut interface = EthernetInterfaceBuilder::new(&mut eth)
+        .ethernet_addr(net_addresses.hardware_addr)
+        .ip_addrs(&mut ip_addrs[..])
+        .neighbor_cache(neighbor_cache)
+        .finalize();
+
+    let mut rx_storage = vec![0; 4096];
+    let mut tx_storage = vec![0; 128];
+
+    let mut socket_set_entries: [_; 1] = Default::default();
+    let mut sockets = smoltcp::socket::SocketSet::new(&mut socket_set_entries[..]);
+
+    let tcp_rx_buffer = smoltcp::socket::TcpSocketBuffer::new(&mut rx_storage[..]);
+    let tcp_tx_buffer = smoltcp::socket::TcpSocketBuffer::new(&mut tx_storage[..]);
+    let tcp_socket = smoltcp::socket::TcpSocket::new(tcp_rx_buffer, tcp_tx_buffer);
+    let tcp_handle = sockets.add(tcp_socket);
+
+    let mut net_conn = NetConn::new();
+    let mut storage = Vec::new();
+    let mut boot_flag = false;
+    let timer = unsafe { GlobalTimer::get() };
+
+    log::info!("Waiting for connections...");
+    loop {
+        let timestamp = Instant::from_millis(timer.get_time().0 as i64);
+        {
+            let socket = &mut *sockets.get::<smoltcp::socket::TcpSocket>(tcp_handle);
+
+            if boot_flag {
+                return;
+            }
+            if !socket.is_open() {
+                socket.listen(4269).unwrap() // 0x10ad
+            }
+
+            if socket.may_recv() {
+                if socket
+                    .recv(|data| {
+                        (
+                            data.len(),
+                            net_conn
+                                .input(
+                                    bootgen_file,
+                                    runtime_start,
+                                    runtime_max_len,
+                                    data,
+                                    &mut storage,
+                                    || {
+                                        boot_flag = true;
+                                    },
+                                )
+                                .is_err(),
+                        )
+                    })
+                    .unwrap()
+                {
+                    net_conn.reset();
+                    socket.close();
+                }
+            } else if socket.may_send() {
+                net_conn.reset();
+                socket.close();
+            }
+        }
+
+        match interface.poll(&mut sockets, timestamp) {
+            Ok(_) => (),
+            Err(smoltcp::Error::Unrecognized) => (),
+            Err(err) => log::error!("Network error: {}", err),
+        }
+    }
+}
--- a/tmux.sh
+++ b/tmux.sh
@ -1,36 +0,0 @@
-#! /usr/bin/env nix-shell
-#! nix-shell -i bash -p gdb openocd cgdb tmux
-SESSION=$USER
-
-if [ $1 -eq 0 ]
-then
-  tmux -2 new-session -d -s $SESSION
-  tmux new-window -t $SESSION:1 -n 'ZC706'
-  tmux split-window -h
-  tmux select-pane -t 0
-  tmux send-keys "stty 115200 < /dev/ttyUSB1 && cat /dev/ttyUSB1" C-m
-  tmux select-pane -t 1
-  tmux send-keys "sleep 10 && cgdb zc706.elf -x openocd/gdb-zynq-commands" C-m
-  tmux split-window -v
-  tmux resize-pane -D 20
-  tmux send-keys "cd openocd && openocd -f zc706.cfg -c reset init" C-m
-else
-  tmux -2 new-session -d -s $SESSION
-  tmux new-window -t $SESSION:1 -n 'CORA Z7'
-  tmux split-window -h
-  tmux select-pane -t 0
-  tmux send-keys "stty 115200 < /dev/ttyUSB1 && cat /dev/ttyUSB1" C-m
-  tmux select-pane -t 1
-  tmux send-keys "sleep 10 && cgdb target/armv7-none-eabihf/release/zc706-experiments -x openocd/gdb-zynq-commands" C-m
-  tmux split-window -v
-  tmux resize-pane -D 20
-  tmux send-keys "cd openocd && openocd -f cora-z7-10.cfg -c reset init" C-m
-fi
-# Set default window
-tmux select-window -t $SESSION:1
-
-# Set focus on gdb
-tmux select-pane -t $SESSION:.-
-
-# Attach to session
-tmux -2 attach-session -t $SESSION
Author	SHA1	Message	Date
Harry Ho	88bda0cb7a	i2c: fix comments	2021-07-13 15:41:55 +08:00
Harry Ho	91445620ee	i2c: fix SCL/SDA race conditions & handle slave holding SCL after ack	2021-06-23 17:09:07 +08:00
Sebastien Bourdeauducq	040d41fd76	update cargosha256	2021-06-19 22:47:21 +08:00
Sebastien Bourdeauducq	9180918619	update dependencies	2021-06-19 22:40:09 +08:00
Sebastien Bourdeauducq	8ec7216e9a	update cargo-xbuild	2021-06-19 22:25:07 +08:00
Sebastien Bourdeauducq	0e9d3f146a	remove use of deprecated stdenv.lib	2021-06-19 22:04:14 +08:00
Sebastien Bourdeauducq	411eebd96c	i2c: configure I2C_SW_RESET MIO on Kasli-SoC	2021-06-19 18:49:51 +08:00
sb10q	e31adb722d	README: add Kasli-SoC	2021-05-30 07:37:27 +08:00
Sebastien Bourdeauducq	759bf95a76	add Kasli-SoC POR control program	2021-05-29 17:43:21 +08:00
Sebastien Bourdeauducq	f83ef218de	update cargosha256	2021-05-29 14:13:51 +08:00
Sebastien Bourdeauducq	062b894a4b	use updated upstream core_io	2021-05-29 14:09:11 +08:00
Sebastien Bourdeauducq	2f9019ca0f	szl: update copyright year	2021-05-29 14:01:29 +08:00
Sebastien Bourdeauducq	7b29ab2628	update dependencies Prevent cargo from messing up core_io this time.	2021-05-29 13:10:54 +08:00
Sebastien Bourdeauducq	a9697ec8d8	Revert "update dependencies" This reverts commit `0220cf19eb`.	2021-05-29 13:05:35 +08:00
Sebastien Bourdeauducq	0220cf19eb	update dependencies	2021-05-29 13:03:35 +08:00
Sebastien Bourdeauducq	a11cb852a8	libboard_zynq: work around Kasli-SoC MDIO breakage (#78 )	2021-05-29 12:50:28 +08:00
Sebastien Bourdeauducq	42cdedae91	openocd: fix Kasli-SoC nSRST	2021-05-29 12:17:59 +08:00
Sebastien Bourdeauducq	823ec374ba	kasli-soc: internal JTAG	2021-05-28 18:44:07 +08:00
Sebastien Bourdeauducq	666c077cef	openocd: add Kasli-SoC (with digilent external JTAG)	2021-05-28 18:22:17 +08:00
Sebastien Bourdeauducq	def17829d9	LGPLv3	2021-04-06 16:46:38 +08:00
Astro	ba252e72da	libasync: provide get/set ack_delay (new in smoltcp 0.7.0)	2021-02-08 03:06:51 +01:00
Astro	a2416f26a0	default.nix: update cargoSha256*	2021-02-04 18:29:00 +01:00
Astro	bf9f1e33c8	update smoltcp 0.6.0 -> 0.7.0	2021-02-04 18:29:00 +01:00
Astro	481a0eb25f	Revert "default.nix: update cargoSha256*" This reverts commit `89e4d61dc0`.	2021-02-04 18:27:44 +01:00
Astro	05c30dd52e	Revert "update smoltcp 0.6.0 -> 0.7.0" This reverts commit `ccf758cc85`.	2021-02-04 18:27:42 +01:00
Astro	f816a04cef	Revert "Revert "update smoltcp 0.6.0 -> 0.7.0"" This reverts commit `faa64c2ce8`.	2021-02-04 16:22:39 +01:00
Astro	faa64c2ce8	Revert "update smoltcp 0.6.0 -> 0.7.0" This reverts commit `ccf758cc85`. Blocked by: https://github.com/smoltcp-rs/smoltcp/issues/415	2021-02-04 16:22:16 +01:00
Astro	89e4d61dc0	default.nix: update cargoSha256*	2021-02-04 00:32:57 +01:00
Astro	0b07e9fefc	update Rust the old nightly crashes with smoltcp 0.7.0	2021-02-03 22:42:00 +01:00
Astro	ccf758cc85	update smoltcp 0.6.0 -> 0.7.0	2021-02-03 22:41:32 +01:00
pca006132	78d58d17ec	libsupport_zynq: fix stack pointer problems	2021-01-28 12:33:06 +08:00
pca006132	06c646e61f	libcortex_a9: added interrupt_handler macro closes #73	2021-01-28 11:41:34 +08:00
pca006132	7681745282	experiments: fix broken build	2021-01-26 12:53:26 +08:00
pca006132	6e6612bc3e	szl: move enable l2c to artiq-zynq	2021-01-26 11:19:33 +08:00
pca006132	b50540915d	libcortex_a9: memcpy throughput optimization	2021-01-26 11:16:37 +08:00
pca006132	4aa252546f	experiments: updated experiment	2021-01-15 17:08:20 +08:00
pca006132	b42869e655	libsupport_zynq: removed naked annotation	2021-01-15 17:08:20 +08:00
pca006132	d62c77e6e0	libcortex_a9: fixed usage of deprecated APIs	2021-01-15 17:08:20 +08:00
pca006132	4555afa624	libsupport_zynq: custom memcpy	2021-01-15 17:08:14 +08:00
pca006132	5923a66512	libsupport_zynq/boot: enable FPU on boot	2021-01-15 16:45:27 +08:00
pca006132	2c6cc58c07	updated rust and compiler_builtins	2021-01-15 16:45:11 +08:00
Astro	b4d91e7904	nix/rust-platform: remove rustcSrc which had to be kept in sync	2021-01-15 00:52:22 +01:00
Astro	4c79c797d5	default.nix: filterSource	2021-01-15 00:51:45 +01:00
Astro	966e43e14e	update dependency: linked_list_allocator	2020-12-24 00:52:14 +01:00
Astro	8432ff3e30	default.nix: update cargoSha256*	2020-11-20 17:32:52 +01:00
Astro	1cd4056370	libboard_zynq: remove unused eth phy name information	2020-11-20 17:21:38 +01:00
Astro	ddff295ae1	libboard_zynq: implement eth hot-plugging	2020-11-20 17:12:22 +01:00
Astro	379b6b973a	libboard_zynq: add support for target_kasli_soc's Marvell88E1512 eth phy	2020-11-19 20:38:10 +01:00
Astro	178ab38e35	experiments: delint	2020-11-19 20:27:05 +01:00
Astro	3172aba1a8	libboard_zynq: improve i2c doc	2020-11-19 20:26:48 +01:00
Astro	a62ca507d0	libregister: allow rustdoc for register! macro	2020-11-19 20:26:18 +01:00
Astro	975202a653	libboard_zynq: enable i2c+eeprom for target_kasli_soc	2020-11-19 20:17:36 +01:00
Astro	d76a77b443	libregister: s/libregister::/$crate::/	2020-11-19 20:16:36 +01:00
Astro	500472b2a8	add feature target_kasli_soc to libsupport_zynq, libconfig, experiments, szl, default.nix	2020-11-19 19:41:38 +01:00
Astro	02217f27d1	libcortex_a9: remove useless target_* features	2020-11-19 19:38:57 +01:00
Astro	a3eabf1947	libboard_zynq: prepare target_kasli_soc	2020-11-19 19:28:17 +01:00
Astro	a32d7abb9a	libboard_zynq: rename ddr DCI_FREQ to DCI_MAX_FREQ	2020-11-19 19:21:38 +01:00
Sebastien Bourdeauducq	0e8354faa1	remote_run.sh: clean up getopts	2020-11-18 17:45:43 +08:00
Sebastien Bourdeauducq	07f161d9d8	libconfig: fix ipv6 address configuration key	2020-11-18 10:47:48 +08:00
Sebastien Bourdeauducq	ef160aa841	README: update board support info	2020-11-18 10:36:55 +08:00
Astro	cb50c8d61b	update deps, pin compiler_builtins to 0.1.35	2020-11-13 19:40:38 +01:00
Astro	7bbd16f143	default.nix: build crates for all targets	2020-11-13 18:07:22 +01:00
Astro	0714162113	rename target_cora_z7_10 to target_coraz7 globally	2020-11-13 17:56:47 +01:00
Astro	5b2c779cba	libboard_zynq: delint ps7_init	2020-11-13 00:23:56 +01:00
Astro	0a40d4f36d	libboard_zynq: fix zc706 build	2020-11-13 00:23:38 +01:00
Astro	55f8d02da8	libboard_zynq: remove ddr-only ps7_init for redpitaya	2020-11-13 00:12:43 +01:00
Astro	990fa56d6a	libboard_zynq: complete ddr without ps7_init for redpitaya	2020-11-13 00:10:34 +01:00
Astro	8fd317d580	libboard_zynq: remove ps7_init for cora_z7_10	2020-11-11 14:21:48 +01:00
Astro	07fedddad9	libboard_zynq: doc ddr size limitation, correct target_redpitaya to 512MB	2020-11-11 13:25:55 +01:00
Astro	0fde82a982	szl: add target_cora_z7_10	2020-11-10 20:57:31 +01:00
Astro	dffe3cb251	libboard_zynq: rm superfluous ddr settings for cora_z7_10	2020-11-10 20:53:46 +01:00
Astro	b9323653bb	libboard_zynq: complete ddr without ps7_init for cora_z7_10	2020-11-10 14:33:31 +01:00
Astro	515d3bb381	libboard_zynq: configure ddr while keeping rstb low	2020-11-08 22:47:59 +01:00
Astro	7e22010d7d	libboard_zynq: fix pll_cp/pll_res swap in ClockSource::setup()	2020-11-08 22:46:43 +01:00
Astro	9ee77d8f44	libboard_zynq: indent ps7_init/cora_z7_10	2020-11-08 19:32:31 +01:00
Astro	e508b78b3e	libboard_zynq: add ps7_init for cora_z7_10	2020-11-08 19:28:59 +01:00
Astro	aef010cb14	openocd: remove xilinx-tcl on Cora Z7	2020-11-08 18:44:41 +01:00
pca006132	d623913535	libconfig: fixed szl build. to_lowercase would handle unicode which causes a huge increase in rodata size, we have to use to_ascii_lowercase.	2020-11-04 20:47:40 +08:00
pca006132	0efc7a616f	libconfig: implemented config write Config write and config remove are now implemented. Config keys are now treated case insensitively, which is consistence to the filesystem behavior. BOOT.BIN can be replaced by setting the config key "boot".	2020-10-30 16:11:18 +08:00
pca006132	22833ef0c6	libconfig/sd_reader: added FAT16_LBA ID	2020-10-17 13:37:18 +08:00
Sebastien Bourdeauducq	80d12d5780	libconfig: make default IP/MAC depend on board	2020-10-14 12:53:32 +08:00
Sebastien Bourdeauducq	4dd8c93729	add SZL for Red Pitaya	2020-10-14 12:35:23 +08:00
Sebastien Bourdeauducq	6266d28095	expose patched cargo-xbuild	2020-10-13 18:43:37 +08:00
Sebastien Bourdeauducq	1796d4e236	update some dependencies Older versions do not compile with newer Rust.	2020-10-13 18:28:42 +08:00
Sebastien Bourdeauducq	56c94b0855	patch cargo-xbuild to ensure copied Cargo.lock is writable https://github.com/rust-osdev/cargo-xbuild/issues/96	2020-10-13 18:27:52 +08:00
Sebastien Bourdeauducq	34a63d7732	use new location for libraries in Rust source	2020-10-13 18:27:01 +08:00
Sebastien Bourdeauducq	27d310a937	update Rust Needed for compatibility with recent cargo-xbuild.	2020-10-13 18:25:39 +08:00
pca006132	f60d0589cc	fix ps7_init compilation error and warnings	2020-10-01 00:17:47 +08:00
Sebastien Bourdeauducq	7c9edfdbd5	README: add introduction	2020-09-29 16:27:44 +08:00
pca006132	c336e450b1	libboard_zynq/eth/phy: add PEF7071	2020-09-29 16:01:54 +08:00
pca006132	6af453494b	libboard_zynq/ddr: use ps7_init for redpitaya ddr	2020-09-26 17:01:37 +08:00
Sebastien Bourdeauducq	ac3e6983b0	experiments: fix zc706 build	2020-09-09 21:30:56 +08:00
Sebastien Bourdeauducq	338f918531	experiments: update banner	2020-09-09 21:29:25 +08:00
Sebastien Bourdeauducq	4751fd6011	default.nix: build redpitaya-experiments	2020-09-09 21:28:32 +08:00
Sebastien Bourdeauducq	e601ac9c45	remove flash support PITA to get to work and most boards have SD.	2020-09-09 20:13:13 +08:00
Sebastien Bourdeauducq	a6955edf14	add Red Pitaya support (WIP)	2020-09-09 20:10:05 +08:00
Sebastien Bourdeauducq	c634313d5e	update authors in cargo.toml	2020-09-09 19:36:25 +08:00
Sebastien Bourdeauducq	7360984efb	add libconfig, libcoreio, szl from artiq-zynq a277e89b3ad; update dependencies	2020-09-09 17:56:50 +08:00
Sebastien Bourdeauducq	82794d3abd	default.nix: make naming consistent with artiq-zynq	2020-09-09 17:12:08 +08:00
Sebastien Bourdeauducq	450ccef18e	sync nix files with artiq-zynq c3f9a76f2a; add fsbl	2020-09-09 16:51:50 +08:00
Sebastien Bourdeauducq	4e18368aaf	remove obsolete build.sh	2020-09-09 15:03:17 +08:00
Sebastien Bourdeauducq	75494421c5	cargo: remove unmaintained runner	2020-09-09 15:01:39 +08:00
Sebastien Bourdeauducq	c4fb7b4c41	cargo: remove unmaintained dev profile	2020-09-09 15:01:03 +08:00
Sebastien Bourdeauducq	a51f8f2eea	openocd: remove ps7_init on Cora Z7	2020-09-09 15:00:09 +08:00
Sebastien Bourdeauducq	7680de26f0	openocd: sync with artiq-zynq 8bb1727e64	2020-09-09 14:58:18 +08:00
Sebastien Bourdeauducq	7edd192c3b	remove outdated/unmaintained files	2020-09-09 14:57:03 +08:00
pca006132	4fef8a7192	libasync/executor: reduced reallocation for vector	2020-09-07 16:13:51 +08:00
pca006132	ae244082ed	more cpu options	2020-09-07 16:13:51 +08:00
Sebastien Bourdeauducq	66c66447dd	fix some compilation warnings	2020-09-06 00:17:59 +08:00
pca006132	02c67051e8	CPU options for better performance L2 cache options and prefetch options	2020-09-04 16:38:48 +08:00
pca006132	08fd1391c5	libcortex_a9/mmu: enabled program flow prediction	2020-09-04 13:18:39 +08:00
pca006132	a116142f63	libsupport_zynq/ram: check ptr range for deallocation	2020-09-03 12:56:10 +08:00
pca006132	157439bc88	libcortex_a9/semaphore: mark new as const fn	2020-09-02 09:51:52 +08:00
pca006132	a73df780d0	libboard_zynq/slcr: fixed boot mode pins value Notice that the bits in the table in UG585 are out of order.	2020-08-31 12:35:11 +08:00
pca006132	e73ec731aa	libboard_zynq/smoltcp: default without ipv6 support SZL netboot binary size too large with ipv6. We can enable the ipv6 support in the runtime crate instead.	2020-08-31 12:07:20 +08:00
pca006132	73e4e4fd03	libcortex_a9/sync_channel: fixed memory leak ptr::drop_in_place would not drop the box content properly, the best way is to convert it back to a box and implicitly drop it.	2020-08-27 17:03:26 +08:00
Sebastien Bourdeauducq	273f9ea72b	libboard_zynq/eth: fix comment	2020-08-24 21:47:10 +08:00
pca006132	671968bac3	libboard_zynq/eth: fixed tx lost packet	2020-08-24 15:51:01 +08:00
pca006132	39f672dde8	libasync/smoltcp/mod: prevent duplicated wakers	2020-08-24 15:25:03 +08:00
pca006132	c13ca614ef	libcortex_a9/mutex: use AcqRel for CAS operations	2020-08-24 15:24:20 +08:00
pca006132	bb09d25378	libboard_zynq/ethernet: ethernet fix and config	2020-08-21 13:34:02 +08:00
pca006132	a1f859637a	experiments: enabled L2 cache ...and removed some trailing spaces	2020-08-20 13:02:28 +08:00
pca006132	7cb2669c3b	Updated cargo dependencies	2020-08-20 13:01:49 +08:00
pca006132	511c906d4d	libcortex_a9/uncached: fixed mmu setting	2020-08-20 13:01:49 +08:00
pca006132	1ba0aa450f	libsupport_zynq/boot: fix cache mainteinance opertaions	2020-08-20 13:01:49 +08:00
pca006132	283bc9b810	libcortex_a9: added L2 cache	2020-08-20 13:01:17 +08:00
Astro	b268fe015a	stdio::drop_uart(): add delay	2020-08-17 19:38:41 +02:00
Astro	64db9b0142	Merge pull request 'libboard_zynq: dead code, peripheral & regblock ctor names consistency' (#63 ) from harry/zynq-rs:cleanup into master	2020-08-17 23:38:22 +08:00
Astro	4b258c19f5	libasync: improve scheduling fairness between block_on and spawned tasks in the libasync::smoltcp::Sockets::run() case the block_on iface.poll loop would progress just one task before. now all tasks get to run in each iteration.	2020-08-17 00:58:12 +02:00
Harry Ho	1a96a7550a	libboard_zynq: make RegisterBlock constructors more consistent	2020-08-13 14:49:26 +08:00
Harry Ho	36947104e3	libboard_zynq: make constructor names more consistent	2020-08-13 13:31:53 +08:00
Harry Ho	11089d8a64	i2c: delete dead code	2020-08-12 16:51:25 +08:00
				`@ -1 +0,0 @@`
				`nix-shell --command "cargo xbuild --release -p experiments" && scp -C target/armv7-none-eabihf/release/experiments $1@rpi-4.m-labs.hk:/home/$1/zc706/zc706.elf`