forked from M-Labs/artiq-zynq
runtime: switch to libio/libboard_artiq, add DRTIO mastering support
Reviewed-on: M-Labs/artiq-zynq#137 Co-authored-by: mwojcik <mw@m-labs.hk> Co-committed-by: mwojcik <mw@m-labs.hk>
This commit is contained in:
parent
e6863263b4
commit
827c6c1306
@ -6,10 +6,13 @@ authors = ["M-Labs"]
|
||||
edition = "2018"
|
||||
|
||||
[features]
|
||||
target_zc706 = ["libboard_zynq/target_zc706", "libsupport_zynq/target_zc706", "libconfig/target_zc706"]
|
||||
target_kasli_soc = ["libboard_zynq/target_kasli_soc", "libsupport_zynq/target_kasli_soc", "libconfig/target_kasli_soc"]
|
||||
target_zc706 = ["libboard_zynq/target_zc706", "libsupport_zynq/target_zc706", "libconfig/target_zc706", "libboard_artiq/target_zc706"]
|
||||
target_kasli_soc = ["libboard_zynq/target_kasli_soc", "libsupport_zynq/target_kasli_soc", "libconfig/target_kasli_soc", "libboard_artiq/target_kasli_soc"]
|
||||
default = ["target_zc706"]
|
||||
|
||||
[build-dependencies]
|
||||
build_zynq = { path = "../libbuild_zynq" }
|
||||
|
||||
[dependencies]
|
||||
num-traits = { version = "0.2", default-features = false }
|
||||
num-derive = "0.3"
|
||||
@ -37,3 +40,5 @@ dyld = { path = "../libdyld" }
|
||||
dwarf = { path = "../libdwarf" }
|
||||
unwind = { path = "../libunwind" }
|
||||
libc = { path = "../libc" }
|
||||
io = { path = "../libio" }
|
||||
libboard_artiq = { path = "../libboard_artiq" }
|
||||
@ -1,9 +1,10 @@
|
||||
use std::env;
|
||||
use std::fs::File;
|
||||
use std::io::Write;
|
||||
use std::io::{BufRead, BufReader};
|
||||
use std::path::PathBuf;
|
||||
|
||||
extern crate build_zynq;
|
||||
|
||||
fn main() {
|
||||
// Put the linker script somewhere the linker can find it
|
||||
let out = &PathBuf::from(env::var_os("OUT_DIR").unwrap());
|
||||
@ -16,13 +17,5 @@ fn main() {
|
||||
// Only re-run the build script when link.x is changed,
|
||||
// instead of when any part of the source code changes.
|
||||
println!("cargo:rerun-if-changed=link.x");
|
||||
|
||||
// Handle rustc-cfg file
|
||||
let cfg_path = "../../build/rustc-cfg";
|
||||
println!("cargo:rerun-if-changed={}", cfg_path);
|
||||
|
||||
let f = BufReader::new(File::open(cfg_path).unwrap());
|
||||
for line in f.lines() {
|
||||
println!("cargo:rustc-cfg={}", line.unwrap());
|
||||
}
|
||||
build_zynq::cfg();
|
||||
}
|
||||
|
||||
@ -21,6 +21,7 @@ use libcortex_a9::{semaphore::Semaphore, mutex::Mutex, sync_channel::{Sender, Re
|
||||
use futures::{select_biased, future::FutureExt};
|
||||
use libasync::{smoltcp::{Sockets, TcpStream}, task};
|
||||
use libconfig::{Config, net_settings};
|
||||
use libboard_artiq::drtio_routing;
|
||||
|
||||
use crate::proto_async::*;
|
||||
use crate::kernel;
|
||||
@ -28,7 +29,8 @@ use crate::rpc;
|
||||
use crate::moninj;
|
||||
use crate::mgmt;
|
||||
use crate::analyzer;
|
||||
|
||||
use crate::rtio_mgt;
|
||||
use crate::pl;
|
||||
|
||||
#[derive(Debug, Clone, Copy, PartialEq, Eq)]
|
||||
pub enum Error {
|
||||
@ -387,8 +389,21 @@ pub fn main(timer: GlobalTimer, cfg: Config) {
|
||||
|
||||
Sockets::init(32);
|
||||
|
||||
// before, mutex was on io, but now that io isn't used...?
|
||||
let aux_mutex: Rc<Mutex<bool>> = Rc::new(Mutex::new(false));
|
||||
#[cfg(has_drtio)]
|
||||
let drtio_routing_table = Rc::new(RefCell::new(
|
||||
drtio_routing::config_routing_table(pl::csr::DRTIO.len(), &cfg)));
|
||||
#[cfg(not(has_drtio))]
|
||||
let drtio_routing_table = Rc::new(RefCell::new(drtio_routing::RoutingTable::default_empty()));
|
||||
let up_destinations = Rc::new(RefCell::new([false; drtio_routing::DEST_COUNT]));
|
||||
#[cfg(has_drtio_routing)]
|
||||
drtio_routing::interconnect_disable_all();
|
||||
|
||||
rtio_mgt::startup(&aux_mutex, &drtio_routing_table, &up_destinations, timer);
|
||||
|
||||
analyzer::start();
|
||||
moninj::start(timer);
|
||||
moninj::start(timer, aux_mutex, drtio_routing_table);
|
||||
|
||||
let control: Rc<RefCell<kernel::Control>> = Rc::new(RefCell::new(kernel::Control::start()));
|
||||
let idle_kernel = Rc::new(cfg.read("idle").ok());
|
||||
|
||||
@ -1,123 +0,0 @@
|
||||
use core::cell::Cell;
|
||||
use core::fmt::Write;
|
||||
use log::{Log, LevelFilter};
|
||||
use log_buffer::LogBuffer;
|
||||
use libcortex_a9::mutex::{Mutex, MutexGuard};
|
||||
use libboard_zynq::{println, timer::GlobalTimer};
|
||||
|
||||
pub struct LogBufferRef<'a> {
|
||||
buffer: MutexGuard<'a, LogBuffer<&'static mut [u8]>>,
|
||||
old_log_level: LevelFilter
|
||||
}
|
||||
|
||||
impl<'a> LogBufferRef<'a> {
|
||||
fn new(buffer: MutexGuard<'a, LogBuffer<&'static mut [u8]>>) -> LogBufferRef<'a> {
|
||||
let old_log_level = log::max_level();
|
||||
log::set_max_level(LevelFilter::Off);
|
||||
LogBufferRef { buffer, old_log_level }
|
||||
}
|
||||
|
||||
pub fn is_empty(&self) -> bool {
|
||||
self.buffer.is_empty()
|
||||
}
|
||||
|
||||
pub fn clear(&mut self) {
|
||||
self.buffer.clear()
|
||||
}
|
||||
|
||||
pub fn extract(&mut self) -> &str {
|
||||
self.buffer.extract()
|
||||
}
|
||||
}
|
||||
|
||||
impl<'a> Drop for LogBufferRef<'a> {
|
||||
fn drop(&mut self) {
|
||||
log::set_max_level(self.old_log_level)
|
||||
}
|
||||
}
|
||||
|
||||
pub struct BufferLogger {
|
||||
buffer: Mutex<LogBuffer<&'static mut [u8]>>,
|
||||
uart_filter: Cell<LevelFilter>,
|
||||
buffer_filter: Cell<LevelFilter>,
|
||||
}
|
||||
|
||||
static mut LOGGER: Option<BufferLogger> = None;
|
||||
|
||||
impl BufferLogger {
|
||||
pub fn new(buffer: &'static mut [u8]) -> BufferLogger {
|
||||
BufferLogger {
|
||||
buffer: Mutex::new(LogBuffer::new(buffer)),
|
||||
uart_filter: Cell::new(LevelFilter::Info),
|
||||
buffer_filter: Cell::new(LevelFilter::Trace),
|
||||
}
|
||||
}
|
||||
|
||||
pub fn register(self) {
|
||||
unsafe {
|
||||
LOGGER = Some(self);
|
||||
log::set_logger(LOGGER.as_ref().unwrap())
|
||||
.expect("global logger can only be initialized once");
|
||||
}
|
||||
}
|
||||
|
||||
pub unsafe fn get_logger() -> &'static mut Option<BufferLogger> {
|
||||
&mut LOGGER
|
||||
}
|
||||
|
||||
pub fn buffer<'a>(&'a self) -> Option<LogBufferRef<'a>> {
|
||||
self.buffer
|
||||
.try_lock()
|
||||
.map(LogBufferRef::new)
|
||||
}
|
||||
|
||||
pub fn uart_log_level(&self) -> LevelFilter {
|
||||
self.uart_filter.get()
|
||||
}
|
||||
|
||||
pub fn set_uart_log_level(&self, max_level: LevelFilter) {
|
||||
self.uart_filter.set(max_level)
|
||||
}
|
||||
|
||||
pub fn buffer_log_level(&self) -> LevelFilter {
|
||||
self.buffer_filter.get()
|
||||
}
|
||||
|
||||
/// this should be reserved for mgmt module
|
||||
pub fn set_buffer_log_level(&self, max_level: LevelFilter) {
|
||||
self.buffer_filter.set(max_level)
|
||||
}
|
||||
}
|
||||
|
||||
// required for impl Log
|
||||
unsafe impl Sync for BufferLogger {}
|
||||
|
||||
impl Log for BufferLogger {
|
||||
fn enabled(&self, _metadata: &log::Metadata) -> bool {
|
||||
true
|
||||
}
|
||||
|
||||
fn log(&self, record: &log::Record) {
|
||||
if self.enabled(record.metadata()) {
|
||||
let timestamp = unsafe {
|
||||
GlobalTimer::get()
|
||||
}.get_us().0;
|
||||
let seconds = timestamp / 1_000_000;
|
||||
let micros = timestamp % 1_000_000;
|
||||
|
||||
if record.level() <= self.buffer_log_level() {
|
||||
let mut buffer = self.buffer.lock();
|
||||
writeln!(buffer, "[{:6}.{:06}s] {:>5}({}): {}", seconds, micros,
|
||||
record.level(), record.target(), record.args()).unwrap();
|
||||
}
|
||||
|
||||
if record.level() <= self.uart_log_level() {
|
||||
println!("[{:6}.{:06}s] {:>5}({}): {}", seconds, micros,
|
||||
record.level(), record.target(), record.args());
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
fn flush(&self) {
|
||||
}
|
||||
}
|
||||
@ -11,82 +11,43 @@
|
||||
|
||||
extern crate alloc;
|
||||
|
||||
use core::{cmp, str};
|
||||
use log::{info, warn, error};
|
||||
|
||||
use libboard_zynq::{timer::GlobalTimer, mpcore, gic, slcr};
|
||||
use libboard_zynq::{timer::GlobalTimer, mpcore, gic};
|
||||
use libasync::{task, block_async};
|
||||
use libsupport_zynq::ram;
|
||||
use nb;
|
||||
use void::Void;
|
||||
use embedded_hal::blocking::delay::DelayMs;
|
||||
use libconfig::Config;
|
||||
use libregister::RegisterW;
|
||||
use libcortex_a9::l2c::enable_l2_cache;
|
||||
use libboard_artiq::{logger, identifier_read, init_gateware, pl};
|
||||
#[cfg(has_si5324)]
|
||||
use libboard_artiq::si5324;
|
||||
|
||||
mod proto_core_io;
|
||||
mod proto_async;
|
||||
mod comms;
|
||||
mod rpc;
|
||||
#[path = "../../../build/pl.rs"]
|
||||
mod pl;
|
||||
#[cfg(ki_impl = "csr")]
|
||||
#[path = "rtio_csr.rs"]
|
||||
mod rtio;
|
||||
#[cfg(ki_impl = "acp")]
|
||||
#[path = "rtio_acp.rs"]
|
||||
mod rtio;
|
||||
mod rtio_mgt;
|
||||
mod kernel;
|
||||
mod moninj;
|
||||
mod eh_artiq;
|
||||
mod panic;
|
||||
mod logger;
|
||||
mod mgmt;
|
||||
mod analyzer;
|
||||
mod irq;
|
||||
mod i2c;
|
||||
#[cfg(has_si5324)]
|
||||
mod si5324;
|
||||
|
||||
fn init_gateware() {
|
||||
// Set up PS->PL clocks
|
||||
slcr::RegisterBlock::unlocked(|slcr| {
|
||||
// As we are touching the mux, the clock may glitch, so reset the PL.
|
||||
slcr.fpga_rst_ctrl.write(
|
||||
slcr::FpgaRstCtrl::zeroed()
|
||||
.fpga0_out_rst(true)
|
||||
.fpga1_out_rst(true)
|
||||
.fpga2_out_rst(true)
|
||||
.fpga3_out_rst(true)
|
||||
);
|
||||
slcr.fpga0_clk_ctrl.write(
|
||||
slcr::Fpga0ClkCtrl::zeroed()
|
||||
.src_sel(slcr::PllSource::IoPll)
|
||||
.divisor0(8)
|
||||
.divisor1(1)
|
||||
);
|
||||
slcr.fpga_rst_ctrl.write(
|
||||
slcr::FpgaRstCtrl::zeroed()
|
||||
);
|
||||
});
|
||||
}
|
||||
|
||||
fn identifier_read(buf: &mut [u8]) -> &str {
|
||||
unsafe {
|
||||
pl::csr::identifier::address_write(0);
|
||||
let len = pl::csr::identifier::data_read();
|
||||
let len = cmp::min(len, buf.len() as u8);
|
||||
for i in 0..len {
|
||||
pl::csr::identifier::address_write(1 + i);
|
||||
buf[i as usize] = pl::csr::identifier::data_read();
|
||||
}
|
||||
str::from_utf8_unchecked(&buf[..len as usize])
|
||||
}
|
||||
}
|
||||
|
||||
fn init_rtio(timer: &mut GlobalTimer, cfg: &Config) {
|
||||
fn init_rtio(timer: &mut GlobalTimer, _cfg: &Config) {
|
||||
#[cfg(has_rtio_crg_clock_sel)]
|
||||
let clock_sel =
|
||||
if let Ok(rtioclk) = cfg.read_str("rtioclk") {
|
||||
if let Ok(rtioclk) = _cfg.read_str("rtioclk") {
|
||||
match rtioclk.as_ref() {
|
||||
"internal" => {
|
||||
info!("using internal RTIO clock");
|
||||
@ -130,6 +91,19 @@ fn init_rtio(timer: &mut GlobalTimer, cfg: &Config) {
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(has_drtio)]
|
||||
fn init_drtio(timer: &mut GlobalTimer)
|
||||
{
|
||||
unsafe {
|
||||
pl::csr::drtio_transceiver::stable_clkin_write(1);
|
||||
}
|
||||
timer.delay_ms(2); // wait for CPLL/QPLL lock
|
||||
unsafe {
|
||||
pl::csr::drtio_transceiver::txenable_write(0xffffffffu32 as _);
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
fn wait_for_async_rtio_error() -> nb::Result<(), Void> {
|
||||
unsafe {
|
||||
if pl::csr::rtio_core::async_error_read() != 0 {
|
||||
@ -201,7 +175,7 @@ pub fn main_core0() {
|
||||
i2c::init();
|
||||
#[cfg(has_si5324)]
|
||||
si5324::setup(unsafe { (&mut i2c::I2C_BUS).as_mut().unwrap() },
|
||||
&SI5324_SETTINGS, si5324::Input::Ckin2, timer).expect("cannot initialize Si5324");
|
||||
&SI5324_SETTINGS, si5324::Input::Ckin2, &mut timer).expect("cannot initialize Si5324");
|
||||
|
||||
let cfg = match Config::new() {
|
||||
Ok(cfg) => cfg,
|
||||
@ -211,6 +185,9 @@ pub fn main_core0() {
|
||||
}
|
||||
};
|
||||
|
||||
#[cfg(has_drtio)]
|
||||
init_drtio(&mut timer);
|
||||
|
||||
init_rtio(&mut timer, &cfg);
|
||||
task::spawn(report_async_rtio_errors());
|
||||
|
||||
|
||||
@ -6,7 +6,7 @@ use core::cell::RefCell;
|
||||
use alloc::{rc::Rc, vec::Vec, string::String};
|
||||
use log::{self, info, debug, warn, error, LevelFilter};
|
||||
|
||||
use crate::logger::{BufferLogger, LogBufferRef};
|
||||
use libboard_artiq::logger::{BufferLogger, LogBufferRef};
|
||||
use crate::proto_async::*;
|
||||
use num_derive::FromPrimitive;
|
||||
use num_traits::FromPrimitive;
|
||||
|
||||
@ -1,17 +1,19 @@
|
||||
use core::fmt;
|
||||
use alloc::collections::BTreeMap;
|
||||
use log::{debug, info, warn};
|
||||
use core::{fmt, cell::RefCell};
|
||||
use alloc::{collections::BTreeMap, rc::Rc};
|
||||
use log::{debug, info, warn, error};
|
||||
use void::Void;
|
||||
|
||||
use libboard_artiq::drtio_routing;
|
||||
|
||||
use libboard_zynq::{smoltcp, timer::GlobalTimer, time::Milliseconds};
|
||||
use libasync::{task, smoltcp::TcpStream, block_async, nb};
|
||||
use libcortex_a9::mutex::Mutex;
|
||||
|
||||
use num_derive::{FromPrimitive, ToPrimitive};
|
||||
use num_traits::{FromPrimitive, ToPrimitive};
|
||||
use futures::{pin_mut, select_biased, FutureExt};
|
||||
|
||||
use crate::proto_async::*;
|
||||
use crate::pl::csr;
|
||||
|
||||
|
||||
#[derive(Debug, Clone, Copy, PartialEq, Eq)]
|
||||
@ -19,7 +21,6 @@ pub enum Error {
|
||||
NetworkError(smoltcp::Error),
|
||||
UnexpectedPattern,
|
||||
UnrecognizedPacket,
|
||||
|
||||
}
|
||||
|
||||
pub type Result<T> = core::result::Result<T, Error>;
|
||||
@ -54,32 +55,108 @@ enum DeviceMessage {
|
||||
InjectionStatus = 1
|
||||
}
|
||||
|
||||
fn read_probe(channel: i32, probe: i8) -> i32 {
|
||||
#[cfg(has_drtio)]
|
||||
mod remote_moninj {
|
||||
use super::*;
|
||||
use libboard_artiq::drtioaux;
|
||||
use crate::rtio_mgt::drtio;
|
||||
|
||||
pub fn read_probe(aux_mutex: &Rc<Mutex<bool>>, timer: GlobalTimer, linkno: u8, destination: u8, channel: i32, probe: i8) -> i32 {
|
||||
let reply = task::block_on(drtio::aux_transact(aux_mutex, linkno, &drtioaux::Packet::MonitorRequest {
|
||||
destination: destination,
|
||||
channel: channel as _,
|
||||
probe: probe as _},
|
||||
timer));
|
||||
match reply {
|
||||
Ok(drtioaux::Packet::MonitorReply { value }) => return value as i32,
|
||||
Ok(packet) => error!("received unexpected aux packet: {:?}", packet),
|
||||
Err(e) => error!("aux packet error ({})", e)
|
||||
}
|
||||
0
|
||||
}
|
||||
|
||||
pub fn inject(aux_mutex: &Rc<Mutex<bool>>, _timer: GlobalTimer, linkno: u8, destination: u8, channel: i32, overrd: i8, value: i8) {
|
||||
let _lock = aux_mutex.lock();
|
||||
drtioaux::send(linkno, &drtioaux::Packet::InjectionRequest {
|
||||
destination: destination,
|
||||
channel: channel as _,
|
||||
overrd: overrd as _,
|
||||
value: value as _
|
||||
}).unwrap();
|
||||
}
|
||||
|
||||
pub fn read_injection_status(aux_mutex: &Rc<Mutex<bool>>, timer: GlobalTimer, linkno: u8, destination: u8, channel: i32, overrd: i8) -> i8 {
|
||||
let reply = task::block_on(drtio::aux_transact(aux_mutex,
|
||||
linkno,
|
||||
&drtioaux::Packet::InjectionStatusRequest {
|
||||
destination: destination,
|
||||
channel: channel as _,
|
||||
overrd: overrd as _},
|
||||
timer));
|
||||
match reply {
|
||||
Ok(drtioaux::Packet::InjectionStatusReply { value }) => return value as i8,
|
||||
Ok(packet) => error!("received unexpected aux packet: {:?}", packet),
|
||||
Err(e) => error!("aux packet error ({})", e)
|
||||
}
|
||||
0
|
||||
}
|
||||
}
|
||||
|
||||
mod local_moninj {
|
||||
use libboard_artiq::pl::csr;
|
||||
|
||||
pub fn read_probe(channel: i32, probe: i8) -> i32 {
|
||||
unsafe {
|
||||
csr::rtio_moninj::mon_chan_sel_write(channel as _);
|
||||
csr::rtio_moninj::mon_probe_sel_write(probe as _);
|
||||
csr::rtio_moninj::mon_value_update_write(1);
|
||||
csr::rtio_moninj::mon_value_read() as i32
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
fn inject(channel: i32, overrd: i8, value: i8) {
|
||||
pub fn inject(channel: i32, overrd: i8, value: i8) {
|
||||
unsafe {
|
||||
csr::rtio_moninj::inj_chan_sel_write(channel as _);
|
||||
csr::rtio_moninj::inj_override_sel_write(overrd as _);
|
||||
csr::rtio_moninj::inj_value_write(value as _);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
fn read_injection_status(channel: i32, overrd: i8) -> i8 {
|
||||
pub fn read_injection_status(channel: i32, overrd: i8) -> i8 {
|
||||
unsafe {
|
||||
csr::rtio_moninj::inj_chan_sel_write(channel as _);
|
||||
csr::rtio_moninj::inj_override_sel_write(overrd as _);
|
||||
csr::rtio_moninj::inj_value_read() as i8
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
async fn handle_connection(stream: &TcpStream, timer: GlobalTimer) -> Result<()> {
|
||||
#[cfg(has_drtio)]
|
||||
macro_rules! dispatch {
|
||||
($timer:ident, $aux_mutex:ident, $routing_table:ident, $channel:expr, $func:ident $(, $param:expr)*) => {{
|
||||
let destination = ($channel >> 16) as u8;
|
||||
let channel = $channel;
|
||||
let routing_table = $routing_table.borrow_mut();
|
||||
let hop = routing_table.0[destination as usize][0];
|
||||
if hop == 0 {
|
||||
local_moninj::$func(channel.into(), $($param, )*)
|
||||
} else {
|
||||
let linkno = hop - 1 as u8;
|
||||
remote_moninj::$func($aux_mutex, $timer, linkno, destination, channel, $($param, )*)
|
||||
}
|
||||
}}
|
||||
}
|
||||
|
||||
#[cfg(not(has_drtio))]
|
||||
macro_rules! dispatch {
|
||||
($timer:ident, $aux_mutex:ident, $routing_table:ident, $channel:expr, $func:ident $(, $param:expr)*) => {{
|
||||
let channel = $channel as u16;
|
||||
local_moninj::$func(channel, $($param, )*)
|
||||
}}
|
||||
}
|
||||
|
||||
async fn handle_connection(stream: &TcpStream, timer: GlobalTimer,
|
||||
_aux_mutex: &Rc<Mutex<bool>>, _routing_table: &Rc<RefCell<drtio_routing::RoutingTable>>) -> Result<()> {
|
||||
if !expect(&stream, b"ARTIQ moninj\n").await? {
|
||||
return Err(Error::UnexpectedPattern);
|
||||
}
|
||||
@ -135,13 +212,13 @@ async fn handle_connection(stream: &TcpStream, timer: GlobalTimer) -> Result<()>
|
||||
let channel = read_i32(&stream).await?;
|
||||
let overrd = read_i8(&stream).await?;
|
||||
let value = read_i8(&stream).await?;
|
||||
inject(channel, overrd, value);
|
||||
dispatch!(timer, _aux_mutex, _routing_table, channel, inject, overrd, value);
|
||||
debug!("INJECT channel {}, overrd {}, value {}", channel, overrd, value);
|
||||
},
|
||||
HostMessage::GetInjectionStatus => {
|
||||
let channel = read_i32(&stream).await?;
|
||||
let overrd = read_i8(&stream).await?;
|
||||
let value = read_injection_status(channel, overrd);
|
||||
let value = dispatch!(timer, _aux_mutex, _routing_table, channel, read_injection_status, overrd);
|
||||
write_i8(&stream, DeviceMessage::InjectionStatus.to_i8().unwrap()).await?;
|
||||
write_i32(&stream, channel).await?;
|
||||
write_i8(&stream, overrd).await?;
|
||||
@ -151,7 +228,7 @@ async fn handle_connection(stream: &TcpStream, timer: GlobalTimer) -> Result<()>
|
||||
},
|
||||
_ = timeout_f => {
|
||||
for (&(channel, probe), previous) in probe_watch_list.iter_mut() {
|
||||
let current = read_probe(channel, probe);
|
||||
let current = dispatch!(timer, _aux_mutex, _routing_table, channel, read_probe, probe);
|
||||
if previous.is_none() || previous.unwrap() != current {
|
||||
write_i8(&stream, DeviceMessage::MonitorStatus.to_i8().unwrap()).await?;
|
||||
write_i32(&stream, channel).await?;
|
||||
@ -161,7 +238,7 @@ async fn handle_connection(stream: &TcpStream, timer: GlobalTimer) -> Result<()>
|
||||
}
|
||||
}
|
||||
for (&(channel, overrd), previous) in inject_watch_list.iter_mut() {
|
||||
let current = read_injection_status(channel, overrd);
|
||||
let current = dispatch!(timer, _aux_mutex, _routing_table, channel, read_injection_status, overrd);
|
||||
if previous.is_none() || previous.unwrap() != current {
|
||||
write_i8(&stream, DeviceMessage::InjectionStatus.to_i8().unwrap()).await?;
|
||||
write_i32(&stream, channel).await?;
|
||||
@ -176,13 +253,15 @@ async fn handle_connection(stream: &TcpStream, timer: GlobalTimer) -> Result<()>
|
||||
}
|
||||
}
|
||||
|
||||
pub fn start(timer: GlobalTimer) {
|
||||
pub fn start(timer: GlobalTimer, aux_mutex: Rc<Mutex<bool>>, routing_table: Rc<RefCell<drtio_routing::RoutingTable>>) {
|
||||
task::spawn(async move {
|
||||
loop {
|
||||
let aux_mutex = aux_mutex.clone();
|
||||
let routing_table = routing_table.clone();
|
||||
let stream = TcpStream::accept(1383, 2048, 2048).await.unwrap();
|
||||
task::spawn(async move {
|
||||
info!("received connection");
|
||||
let result = handle_connection(&stream, timer).await;
|
||||
let result = handle_connection(&stream, timer, &aux_mutex, &routing_table).await;
|
||||
match result {
|
||||
Err(Error::NetworkError(smoltcp::Error::Finished)) => info!("peer closed connection"),
|
||||
Err(error) => warn!("connection terminated: {}", error),
|
||||
|
||||
@ -1,158 +0,0 @@
|
||||
use core::str::Utf8Error;
|
||||
use byteorder::{ByteOrder, NativeEndian};
|
||||
use alloc::vec;
|
||||
use alloc::string::String;
|
||||
|
||||
use core_io::{Read, Write, Error as IoError};
|
||||
|
||||
#[allow(dead_code)]
|
||||
#[derive(Debug, Clone, PartialEq)]
|
||||
pub enum ReadStringError<T> {
|
||||
Utf8(Utf8Error),
|
||||
Other(T)
|
||||
}
|
||||
|
||||
pub trait ProtoRead {
|
||||
type ReadError;
|
||||
|
||||
fn read_exact(&mut self, buf: &mut [u8]) -> Result<(), Self::ReadError>;
|
||||
|
||||
#[inline]
|
||||
fn read_u8(&mut self) -> Result<u8, Self::ReadError> {
|
||||
let mut bytes = [0; 1];
|
||||
self.read_exact(&mut bytes)?;
|
||||
Ok(bytes[0])
|
||||
}
|
||||
|
||||
#[inline]
|
||||
fn read_u16(&mut self) -> Result<u16, Self::ReadError> {
|
||||
let mut bytes = [0; 2];
|
||||
self.read_exact(&mut bytes)?;
|
||||
Ok(NativeEndian::read_u16(&bytes))
|
||||
}
|
||||
|
||||
#[inline]
|
||||
fn read_u32(&mut self) -> Result<u32, Self::ReadError> {
|
||||
let mut bytes = [0; 4];
|
||||
self.read_exact(&mut bytes)?;
|
||||
Ok(NativeEndian::read_u32(&bytes))
|
||||
}
|
||||
|
||||
#[inline]
|
||||
fn read_u64(&mut self) -> Result<u64, Self::ReadError> {
|
||||
let mut bytes = [0; 8];
|
||||
self.read_exact(&mut bytes)?;
|
||||
Ok(NativeEndian::read_u64(&bytes))
|
||||
}
|
||||
|
||||
#[inline]
|
||||
fn read_bool(&mut self) -> Result<bool, Self::ReadError> {
|
||||
Ok(self.read_u8()? != 0)
|
||||
}
|
||||
|
||||
#[inline]
|
||||
fn read_bytes(&mut self) -> Result<::alloc::vec::Vec<u8>, Self::ReadError> {
|
||||
let length = self.read_u32()?;
|
||||
let mut value = vec![0; length as usize];
|
||||
self.read_exact(&mut value)?;
|
||||
Ok(value)
|
||||
}
|
||||
|
||||
#[inline]
|
||||
fn read_string(&mut self) -> Result<::alloc::string::String, ReadStringError<Self::ReadError>> {
|
||||
let bytes = self.read_bytes().map_err(ReadStringError::Other)?;
|
||||
String::from_utf8(bytes).map_err(|err| ReadStringError::Utf8(err.utf8_error()))
|
||||
}
|
||||
}
|
||||
|
||||
pub trait ProtoWrite {
|
||||
type WriteError;
|
||||
|
||||
fn write_all(&mut self, buf: &[u8]) -> Result<(), Self::WriteError>;
|
||||
|
||||
#[inline]
|
||||
fn write_u8(&mut self, value: u8) -> Result<(), Self::WriteError> {
|
||||
let bytes = [value; 1];
|
||||
self.write_all(&bytes)
|
||||
}
|
||||
|
||||
#[inline]
|
||||
fn write_i8(&mut self, value: i8) -> Result<(), Self::WriteError> {
|
||||
let bytes = [value as u8; 1];
|
||||
self.write_all(&bytes)
|
||||
}
|
||||
|
||||
#[inline]
|
||||
fn write_u16(&mut self, value: u16) -> Result<(), Self::WriteError> {
|
||||
let mut bytes = [0; 2];
|
||||
NativeEndian::write_u16(&mut bytes, value);
|
||||
self.write_all(&bytes)
|
||||
}
|
||||
|
||||
#[inline]
|
||||
fn write_i16(&mut self, value: i16) -> Result<(), Self::WriteError> {
|
||||
let mut bytes = [0; 2];
|
||||
NativeEndian::write_i16(&mut bytes, value);
|
||||
self.write_all(&bytes)
|
||||
}
|
||||
|
||||
#[inline]
|
||||
fn write_u32(&mut self, value: u32) -> Result<(), Self::WriteError> {
|
||||
let mut bytes = [0; 4];
|
||||
NativeEndian::write_u32(&mut bytes, value);
|
||||
self.write_all(&bytes)
|
||||
}
|
||||
|
||||
#[inline]
|
||||
fn write_i32(&mut self, value: i32) -> Result<(), Self::WriteError> {
|
||||
let mut bytes = [0; 4];
|
||||
NativeEndian::write_i32(&mut bytes, value);
|
||||
self.write_all(&bytes)
|
||||
}
|
||||
|
||||
#[inline]
|
||||
fn write_u64(&mut self, value: u64) -> Result<(), Self::WriteError> {
|
||||
let mut bytes = [0; 8];
|
||||
NativeEndian::write_u64(&mut bytes, value);
|
||||
self.write_all(&bytes)
|
||||
}
|
||||
|
||||
#[inline]
|
||||
fn write_i64(&mut self, value: i64) -> Result<(), Self::WriteError> {
|
||||
let mut bytes = [0; 8];
|
||||
NativeEndian::write_i64(&mut bytes, value);
|
||||
self.write_all(&bytes)
|
||||
}
|
||||
|
||||
#[inline]
|
||||
fn write_bool(&mut self, value: bool) -> Result<(), Self::WriteError> {
|
||||
self.write_u8(value as u8)
|
||||
}
|
||||
|
||||
#[inline]
|
||||
fn write_bytes(&mut self, value: &[u8]) -> Result<(), Self::WriteError> {
|
||||
self.write_u32(value.len() as u32)?;
|
||||
self.write_all(value)
|
||||
}
|
||||
|
||||
#[inline]
|
||||
fn write_string(&mut self, value: &str) -> Result<(), Self::WriteError> {
|
||||
self.write_bytes(value.as_bytes())
|
||||
}
|
||||
}
|
||||
|
||||
impl<T> ProtoRead for T where T: Read + ?Sized {
|
||||
type ReadError = IoError;
|
||||
|
||||
fn read_exact(&mut self, buf: &mut [u8]) -> Result<(), Self::ReadError> {
|
||||
T::read_exact(self, buf)
|
||||
}
|
||||
}
|
||||
|
||||
impl<T> ProtoWrite for T where T: Write + ?Sized {
|
||||
type WriteError = IoError;
|
||||
|
||||
fn write_all(&mut self, buf: &[u8]) -> Result<(), Self::WriteError> {
|
||||
T::write_all(self, buf)
|
||||
}
|
||||
}
|
||||
@ -10,7 +10,7 @@ use libasync::smoltcp::TcpStream;
|
||||
use alloc::boxed::Box;
|
||||
use async_recursion::async_recursion;
|
||||
|
||||
use crate::proto_core_io::ProtoWrite;
|
||||
use io::proto::ProtoWrite;
|
||||
use crate::proto_async;
|
||||
use self::tag::{Tag, TagIterator, split_tag};
|
||||
|
||||
|
||||
351
src/runtime/src/rtio_mgt.rs
Normal file
351
src/runtime/src/rtio_mgt.rs
Normal file
@ -0,0 +1,351 @@
|
||||
use core::cell::RefCell;
|
||||
use alloc::rc::Rc;
|
||||
use libboard_zynq::{timer::GlobalTimer, time::Milliseconds};
|
||||
use libboard_artiq::{pl::csr, drtio_routing};
|
||||
use libcortex_a9::mutex::Mutex;
|
||||
|
||||
|
||||
#[cfg(has_drtio)]
|
||||
pub mod drtio {
|
||||
use super::*;
|
||||
use libboard_artiq::drtioaux_async;
|
||||
use libboard_artiq::drtioaux_async::Packet;
|
||||
use libboard_artiq::drtioaux::Error;
|
||||
use log::{warn, error, info};
|
||||
use embedded_hal::blocking::delay::DelayMs;
|
||||
use libasync::{task, delay};
|
||||
|
||||
pub fn startup(aux_mutex: &Rc<Mutex<bool>>,
|
||||
routing_table: &Rc<RefCell<drtio_routing::RoutingTable>>,
|
||||
up_destinations: &Rc<RefCell<[bool; drtio_routing::DEST_COUNT]>>,
|
||||
timer: GlobalTimer) {
|
||||
let aux_mutex = aux_mutex.clone();
|
||||
let routing_table = routing_table.clone();
|
||||
let up_destinations = up_destinations.clone();
|
||||
task::spawn(async move {
|
||||
let routing_table = routing_table.borrow();
|
||||
link_thread(&aux_mutex, &routing_table, &up_destinations, timer).await;
|
||||
});
|
||||
}
|
||||
|
||||
async fn link_rx_up(linkno: u8) -> bool {
|
||||
let linkno = linkno as usize;
|
||||
unsafe {
|
||||
(csr::DRTIO[linkno].rx_up_read)() == 1
|
||||
}
|
||||
}
|
||||
|
||||
async fn recv_aux_timeout(linkno: u8, timeout: u64, timer: GlobalTimer) -> Result<Packet, &'static str> {
|
||||
if !link_rx_up(linkno).await {
|
||||
return Err("link went down");
|
||||
}
|
||||
match drtioaux_async::recv_timeout(linkno, Some(timeout), timer).await {
|
||||
Ok(packet) => return Ok(packet),
|
||||
Err(Error::TimedOut) => return Err("timed out"),
|
||||
Err(_) => return Err("aux packet error"),
|
||||
}
|
||||
}
|
||||
|
||||
pub async fn aux_transact(aux_mutex: &Mutex<bool>, linkno: u8, request: &Packet,
|
||||
timer: GlobalTimer) -> Result<Packet, &'static str> {
|
||||
let _lock = aux_mutex.lock();
|
||||
drtioaux_async::send(linkno, request).await.unwrap();
|
||||
recv_aux_timeout(linkno, 200, timer).await
|
||||
}
|
||||
|
||||
async fn drain_buffer(linkno: u8, draining_time: Milliseconds, timer: GlobalTimer) {
|
||||
let max_time = timer.get_time() + draining_time;
|
||||
loop {
|
||||
if timer.get_time() > max_time {
|
||||
return;
|
||||
} //could this be cut short?
|
||||
let _ = drtioaux_async::recv(linkno).await;
|
||||
}
|
||||
}
|
||||
|
||||
async fn ping_remote(aux_mutex: &Rc<Mutex<bool>>, linkno: u8, timer: GlobalTimer) -> u32 {
|
||||
let mut count = 0;
|
||||
loop {
|
||||
if !link_rx_up(linkno).await {
|
||||
return 0
|
||||
}
|
||||
count += 1;
|
||||
if count > 100 {
|
||||
return 0;
|
||||
}
|
||||
let reply = aux_transact(aux_mutex, linkno, &Packet::EchoRequest, timer).await;
|
||||
match reply {
|
||||
Ok(Packet::EchoReply) => {
|
||||
// make sure receive buffer is drained
|
||||
let draining_time = Milliseconds(200);
|
||||
drain_buffer(linkno, draining_time, timer).await;
|
||||
return count;
|
||||
}
|
||||
_ => {}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
async fn sync_tsc(aux_mutex: &Rc<Mutex<bool>>, linkno: u8, timer: GlobalTimer) -> Result<(), &'static str> {
|
||||
let _lock = aux_mutex.lock();
|
||||
|
||||
unsafe {
|
||||
(csr::DRTIO[linkno as usize].set_time_write)(1);
|
||||
while (csr::DRTIO[linkno as usize].set_time_read)() == 1 {}
|
||||
}
|
||||
// TSCAck is the only aux packet that is sent spontaneously
|
||||
// by the satellite, in response to a TSC set on the RT link.
|
||||
let reply = recv_aux_timeout(linkno, 10000, timer).await?;
|
||||
if reply == Packet::TSCAck {
|
||||
return Ok(());
|
||||
} else {
|
||||
return Err("unexpected reply");
|
||||
}
|
||||
}
|
||||
|
||||
async fn load_routing_table(aux_mutex: &Rc<Mutex<bool>>, linkno: u8, routing_table: &drtio_routing::RoutingTable,
|
||||
timer: GlobalTimer) -> Result<(), &'static str> {
|
||||
for i in 0..drtio_routing::DEST_COUNT {
|
||||
let reply = aux_transact(aux_mutex, linkno, &Packet::RoutingSetPath {
|
||||
destination: i as u8,
|
||||
hops: routing_table.0[i]
|
||||
}, timer).await?;
|
||||
if reply != Packet::RoutingAck {
|
||||
return Err("unexpected reply");
|
||||
}
|
||||
}
|
||||
Ok(())
|
||||
}
|
||||
|
||||
async fn set_rank(aux_mutex: &Rc<Mutex<bool>>, linkno: u8, rank: u8, timer: GlobalTimer) -> Result<(), &'static str> {
|
||||
let reply = aux_transact(aux_mutex, linkno, &Packet::RoutingSetRank {
|
||||
rank: rank
|
||||
}, timer).await?;
|
||||
if reply != Packet::RoutingAck {
|
||||
return Err("unexpected reply");
|
||||
}
|
||||
Ok(())
|
||||
}
|
||||
|
||||
async fn init_buffer_space(destination: u8, linkno: u8) {
|
||||
let linkno = linkno as usize;
|
||||
unsafe {
|
||||
(csr::DRTIO[linkno].destination_write)(destination);
|
||||
(csr::DRTIO[linkno].force_destination_write)(1);
|
||||
(csr::DRTIO[linkno].o_get_buffer_space_write)(1);
|
||||
while (csr::DRTIO[linkno].o_wait_read)() == 1 {}
|
||||
info!("[DEST#{}] buffer space is {}",
|
||||
destination, (csr::DRTIO[linkno].o_dbg_buffer_space_read)());
|
||||
(csr::DRTIO[linkno].force_destination_write)(0);
|
||||
}
|
||||
}
|
||||
|
||||
async fn process_unsolicited_aux(aux_mutex: &Rc<Mutex<bool>>, linkno: u8) {
|
||||
let _lock = aux_mutex.lock();
|
||||
match drtioaux_async::recv(linkno).await {
|
||||
Ok(Some(packet)) => warn!("[LINK#{}] unsolicited aux packet: {:?}", linkno, packet),
|
||||
Ok(None) => (),
|
||||
Err(_) => warn!("[LINK#{}] aux packet error", linkno)
|
||||
}
|
||||
}
|
||||
|
||||
async fn process_local_errors(linkno: u8) {
|
||||
let errors;
|
||||
let linkidx = linkno as usize;
|
||||
unsafe {
|
||||
errors = (csr::DRTIO[linkidx].protocol_error_read)();
|
||||
(csr::DRTIO[linkidx].protocol_error_write)(errors);
|
||||
}
|
||||
if errors != 0 {
|
||||
error!("[LINK#{}] error(s) found (0x{:02x}):", linkno, errors);
|
||||
if errors & 1 != 0 {
|
||||
error!("[LINK#{}] received packet of an unknown type", linkno);
|
||||
}
|
||||
if errors & 2 != 0 {
|
||||
error!("[LINK#{}] received truncated packet", linkno);
|
||||
}
|
||||
if errors & 4 != 0 {
|
||||
error!("[LINK#{}] timeout attempting to get remote buffer space", linkno);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
async fn destination_set_up(routing_table: &drtio_routing::RoutingTable,
|
||||
up_destinations: &Rc<RefCell<[bool; drtio_routing::DEST_COUNT]>>,
|
||||
destination: u8, up: bool) {
|
||||
let mut up_destinations = up_destinations.borrow_mut();
|
||||
up_destinations[destination as usize] = up;
|
||||
if up {
|
||||
drtio_routing::interconnect_enable(routing_table, 0, destination);
|
||||
info!("[DEST#{}] destination is up", destination);
|
||||
} else {
|
||||
drtio_routing::interconnect_disable(destination);
|
||||
info!("[DEST#{}] destination is down", destination);
|
||||
}
|
||||
}
|
||||
|
||||
async fn destination_up(up_destinations: &Rc<RefCell<[bool; drtio_routing::DEST_COUNT]>>, destination: u8) -> bool {
|
||||
let up_destinations = up_destinations.borrow();
|
||||
up_destinations[destination as usize]
|
||||
}
|
||||
|
||||
async fn destination_survey(aux_mutex: &Rc<Mutex<bool>>, routing_table: &drtio_routing::RoutingTable,
|
||||
up_links: &[bool],
|
||||
up_destinations: &Rc<RefCell<[bool; drtio_routing::DEST_COUNT]>>,
|
||||
timer: GlobalTimer) {
|
||||
for destination in 0..drtio_routing::DEST_COUNT {
|
||||
let hop = routing_table.0[destination][0];
|
||||
let destination = destination as u8;
|
||||
|
||||
if hop == 0 {
|
||||
/* local RTIO */
|
||||
if !destination_up(up_destinations, destination).await {
|
||||
destination_set_up(routing_table, up_destinations, destination, true).await;
|
||||
}
|
||||
} else if hop as usize <= csr::DRTIO.len() {
|
||||
let linkno = hop - 1;
|
||||
if destination_up(up_destinations, destination).await {
|
||||
if up_links[linkno as usize] {
|
||||
let reply = aux_transact(aux_mutex, linkno, &Packet::DestinationStatusRequest {
|
||||
destination: destination
|
||||
}, timer).await;
|
||||
match reply {
|
||||
Ok(Packet::DestinationDownReply) =>
|
||||
destination_set_up(routing_table, up_destinations, destination, false).await,
|
||||
Ok(Packet::DestinationOkReply) => (),
|
||||
Ok(Packet::DestinationSequenceErrorReply { channel }) =>
|
||||
error!("[DEST#{}] RTIO sequence error involving channel 0x{:04x}", destination, channel),
|
||||
Ok(Packet::DestinationCollisionReply { channel }) =>
|
||||
error!("[DEST#{}] RTIO collision involving channel 0x{:04x}", destination, channel),
|
||||
Ok(Packet::DestinationBusyReply { channel }) =>
|
||||
error!("[DEST#{}] RTIO busy error involving channel 0x{:04x}", destination, channel),
|
||||
Ok(packet) => error!("[DEST#{}] received unexpected aux packet: {:?}", destination, packet),
|
||||
Err(e) => error!("[DEST#{}] communication failed ({})", destination, e)
|
||||
}
|
||||
} else {
|
||||
destination_set_up(routing_table, up_destinations, destination, false).await;
|
||||
}
|
||||
} else {
|
||||
if up_links[linkno as usize] {
|
||||
let reply = aux_transact(aux_mutex, linkno, &Packet::DestinationStatusRequest {
|
||||
destination: destination
|
||||
}, timer).await;
|
||||
match reply {
|
||||
Ok(Packet::DestinationDownReply) => (),
|
||||
Ok(Packet::DestinationOkReply) => {
|
||||
destination_set_up(routing_table, up_destinations, destination, true).await;
|
||||
init_buffer_space(destination as u8, linkno).await;
|
||||
},
|
||||
Ok(packet) => error!("[DEST#{}] received unexpected aux packet: {:?}", destination, packet),
|
||||
Err(e) => error!("[DEST#{}] communication failed ({})", destination, e)
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
pub async fn link_thread(aux_mutex: &Rc<Mutex<bool>>,
|
||||
routing_table: &drtio_routing::RoutingTable,
|
||||
up_destinations: &Rc<RefCell<[bool; drtio_routing::DEST_COUNT]>>,
|
||||
timer: GlobalTimer) {
|
||||
let mut up_links = [false; csr::DRTIO.len()];
|
||||
loop {
|
||||
for linkno in 0..csr::DRTIO.len() {
|
||||
let linkno = linkno as u8;
|
||||
if up_links[linkno as usize] {
|
||||
/* link was previously up */
|
||||
if link_rx_up(linkno).await {
|
||||
process_unsolicited_aux(aux_mutex, linkno).await;
|
||||
process_local_errors(linkno).await;
|
||||
} else {
|
||||
info!("[LINK#{}] link is down", linkno);
|
||||
up_links[linkno as usize] = false;
|
||||
}
|
||||
} else {
|
||||
/* link was previously down */
|
||||
if link_rx_up(linkno).await {
|
||||
info!("[LINK#{}] link RX became up, pinging", linkno);
|
||||
let ping_count = ping_remote(aux_mutex, linkno, timer).await;
|
||||
if ping_count > 0 {
|
||||
info!("[LINK#{}] remote replied after {} packets", linkno, ping_count);
|
||||
up_links[linkno as usize] = true;
|
||||
if let Err(e) = sync_tsc(aux_mutex, linkno, timer).await {
|
||||
error!("[LINK#{}] failed to sync TSC ({})", linkno, e);
|
||||
}
|
||||
if let Err(e) = load_routing_table(aux_mutex, linkno, routing_table, timer).await {
|
||||
error!("[LINK#{}] failed to load routing table ({})", linkno, e);
|
||||
}
|
||||
if let Err(e) = set_rank(aux_mutex, linkno, 1 as u8, timer).await {
|
||||
error!("[LINK#{}] failed to set rank ({})", linkno, e);
|
||||
}
|
||||
info!("[LINK#{}] link initialization completed", linkno);
|
||||
} else {
|
||||
error!("[LINK#{}] ping failed", linkno);
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
destination_survey(aux_mutex, routing_table, &up_links, up_destinations, timer).await;
|
||||
let mut countdown = timer.countdown();
|
||||
delay(&mut countdown, Milliseconds(200)).await;
|
||||
}
|
||||
}
|
||||
|
||||
#[allow(dead_code)]
|
||||
pub fn reset(aux_mutex: Rc<Mutex<bool>>, mut timer: GlobalTimer) {
|
||||
for linkno in 0..csr::DRTIO.len() {
|
||||
unsafe {
|
||||
(csr::DRTIO[linkno].reset_write)(1);
|
||||
}
|
||||
}
|
||||
timer.delay_ms(1);
|
||||
for linkno in 0..csr::DRTIO.len() {
|
||||
unsafe {
|
||||
(csr::DRTIO[linkno].reset_write)(0);
|
||||
}
|
||||
}
|
||||
|
||||
for linkno in 0..csr::DRTIO.len() {
|
||||
let linkno = linkno as u8;
|
||||
if task::block_on(link_rx_up(linkno)) {
|
||||
let reply = task::block_on(aux_transact(&aux_mutex, linkno,
|
||||
&Packet::ResetRequest, timer));
|
||||
match reply {
|
||||
Ok(Packet::ResetAck) => (),
|
||||
Ok(_) => error!("[LINK#{}] reset failed, received unexpected aux packet", linkno),
|
||||
Err(e) => error!("[LINK#{}] reset failed, aux packet error ({})", linkno, e)
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(not(has_drtio))]
|
||||
pub mod drtio {
|
||||
use super::*;
|
||||
|
||||
pub fn startup(_aux_mutex: &Rc<Mutex<bool>>, _routing_table: &Rc<RefCell<drtio_routing::RoutingTable>>,
|
||||
_up_destinations: &Rc<RefCell<[bool; drtio_routing::DEST_COUNT]>>, _timer: GlobalTimer) {}
|
||||
|
||||
#[allow(dead_code)]
|
||||
pub fn reset(_aux_mutex: Rc<Mutex<bool>>, mut _timer: GlobalTimer) {}
|
||||
}
|
||||
|
||||
pub fn startup(aux_mutex: &Rc<Mutex<bool>>,
|
||||
routing_table: &Rc<RefCell<drtio_routing::RoutingTable>>,
|
||||
up_destinations: &Rc<RefCell<[bool; drtio_routing::DEST_COUNT]>>,
|
||||
timer: GlobalTimer) {
|
||||
drtio::startup(aux_mutex, routing_table, up_destinations, timer);
|
||||
unsafe {
|
||||
csr::rtio_core::reset_phy_write(1);
|
||||
}
|
||||
}
|
||||
|
||||
#[allow(dead_code)]
|
||||
pub fn reset(aux_mutex: Rc<Mutex<bool>>, timer: GlobalTimer) {
|
||||
unsafe {
|
||||
csr::rtio_core::reset_write(1);
|
||||
}
|
||||
drtio::reset(aux_mutex, timer)
|
||||
}
|
||||
@ -1,273 +0,0 @@
|
||||
use core::result;
|
||||
use log::info;
|
||||
use libboard_zynq::{i2c::I2c, timer::GlobalTimer, time::Milliseconds};
|
||||
use embedded_hal::blocking::delay::DelayUs;
|
||||
#[cfg(not(si5324_soft_reset))]
|
||||
use pl::csr;
|
||||
|
||||
type Result<T> = result::Result<T, &'static str>;
|
||||
|
||||
const ADDRESS: u8 = 0x68;
|
||||
|
||||
#[cfg(not(si5324_soft_reset))]
|
||||
fn hard_reset(timer: GlobalTimer) {
|
||||
unsafe { csr::si5324_rst_n::out_write(0); }
|
||||
timer.delay_us(1_000);
|
||||
unsafe { csr::si5324_rst_n::out_write(1); }
|
||||
timer.delay_us(10_000);
|
||||
}
|
||||
|
||||
// NOTE: the logical parameters DO NOT MAP to physical values written
|
||||
// into registers. They have to be mapped; see the datasheet.
|
||||
// DSPLLsim reports the logical parameters in the design summary, not
|
||||
// the physical register values.
|
||||
pub struct FrequencySettings {
|
||||
pub n1_hs: u8,
|
||||
pub nc1_ls: u32,
|
||||
pub n2_hs: u8,
|
||||
pub n2_ls: u32,
|
||||
pub n31: u32,
|
||||
pub n32: u32,
|
||||
pub bwsel: u8,
|
||||
pub crystal_ref: bool
|
||||
}
|
||||
|
||||
pub enum Input {
|
||||
Ckin1,
|
||||
Ckin2,
|
||||
}
|
||||
|
||||
fn map_frequency_settings(settings: &FrequencySettings) -> Result<FrequencySettings> {
|
||||
if settings.nc1_ls != 0 && (settings.nc1_ls % 2) == 1 {
|
||||
return Err("NC1_LS must be 0 or even")
|
||||
}
|
||||
if settings.nc1_ls > (1 << 20) {
|
||||
return Err("NC1_LS is too high")
|
||||
}
|
||||
if (settings.n2_ls % 2) == 1 {
|
||||
return Err("N2_LS must be even")
|
||||
}
|
||||
if settings.n2_ls > (1 << 20) {
|
||||
return Err("N2_LS is too high")
|
||||
}
|
||||
if settings.n31 > (1 << 19) {
|
||||
return Err("N31 is too high")
|
||||
}
|
||||
if settings.n32 > (1 << 19) {
|
||||
return Err("N32 is too high")
|
||||
}
|
||||
let r = FrequencySettings {
|
||||
n1_hs: match settings.n1_hs {
|
||||
4 => 0b000,
|
||||
5 => 0b001,
|
||||
6 => 0b010,
|
||||
7 => 0b011,
|
||||
8 => 0b100,
|
||||
9 => 0b101,
|
||||
10 => 0b110,
|
||||
11 => 0b111,
|
||||
_ => return Err("N1_HS has an invalid value")
|
||||
},
|
||||
nc1_ls: settings.nc1_ls - 1,
|
||||
n2_hs: match settings.n2_hs {
|
||||
4 => 0b000,
|
||||
5 => 0b001,
|
||||
6 => 0b010,
|
||||
7 => 0b011,
|
||||
8 => 0b100,
|
||||
9 => 0b101,
|
||||
10 => 0b110,
|
||||
11 => 0b111,
|
||||
_ => return Err("N2_HS has an invalid value")
|
||||
},
|
||||
n2_ls: settings.n2_ls - 1,
|
||||
n31: settings.n31 - 1,
|
||||
n32: settings.n32 - 1,
|
||||
bwsel: settings.bwsel,
|
||||
crystal_ref: settings.crystal_ref
|
||||
};
|
||||
Ok(r)
|
||||
}
|
||||
|
||||
fn write(i2c: &mut I2c, reg: u8, val: u8) -> Result<()> {
|
||||
i2c.start().unwrap();
|
||||
if !i2c.write(ADDRESS << 1).unwrap() {
|
||||
return Err("Si5324 failed to ack write address")
|
||||
}
|
||||
if !i2c.write(reg).unwrap() {
|
||||
return Err("Si5324 failed to ack register")
|
||||
}
|
||||
if !i2c.write(val).unwrap() {
|
||||
return Err("Si5324 failed to ack value")
|
||||
}
|
||||
i2c.stop().unwrap();
|
||||
Ok(())
|
||||
}
|
||||
|
||||
fn write_no_ack_value(i2c: &mut I2c, reg: u8, val: u8) -> Result<()> {
|
||||
i2c.start().unwrap();
|
||||
if !i2c.write(ADDRESS << 1).unwrap() {
|
||||
return Err("Si5324 failed to ack write address")
|
||||
}
|
||||
if !i2c.write(reg).unwrap() {
|
||||
return Err("Si5324 failed to ack register")
|
||||
}
|
||||
i2c.write(val).unwrap();
|
||||
i2c.stop().unwrap();
|
||||
Ok(())
|
||||
}
|
||||
|
||||
fn read(i2c: &mut I2c, reg: u8) -> Result<u8> {
|
||||
i2c.start().unwrap();
|
||||
if !i2c.write(ADDRESS << 1).unwrap() {
|
||||
return Err("Si5324 failed to ack write address")
|
||||
}
|
||||
if !i2c.write(reg).unwrap() {
|
||||
return Err("Si5324 failed to ack register")
|
||||
}
|
||||
i2c.restart().unwrap();
|
||||
if !i2c.write((ADDRESS << 1) | 1).unwrap() {
|
||||
return Err("Si5324 failed to ack read address")
|
||||
}
|
||||
let val = i2c.read(false).unwrap();
|
||||
i2c.stop().unwrap();
|
||||
Ok(val)
|
||||
}
|
||||
|
||||
fn rmw<F>(i2c: &mut I2c, reg: u8, f: F) -> Result<()> where
|
||||
F: Fn(u8) -> u8 {
|
||||
let value = read(i2c, reg)?;
|
||||
write(i2c, reg, f(value))?;
|
||||
Ok(())
|
||||
}
|
||||
|
||||
fn ident(i2c: &mut I2c) -> Result<u16> {
|
||||
Ok(((read(i2c, 134)? as u16) << 8) | (read(i2c, 135)? as u16))
|
||||
}
|
||||
|
||||
#[cfg(si5324_soft_reset)]
|
||||
fn soft_reset(i2c: &mut I2c, timer: GlobalTimer) -> Result<()> {
|
||||
write_no_ack_value(i2c, 136, read(i2c, 136)? | 0x80)?;
|
||||
timer.delay_us(10_000);
|
||||
Ok(())
|
||||
}
|
||||
|
||||
fn has_xtal(i2c: &mut I2c) -> Result<bool> {
|
||||
Ok((read(i2c, 129)? & 0x01) == 0) // LOSX_INT=0
|
||||
}
|
||||
|
||||
fn has_ckin(i2c: &mut I2c, input: Input) -> Result<bool> {
|
||||
match input {
|
||||
Input::Ckin1 => Ok((read(i2c, 129)? & 0x02) == 0), // LOS1_INT=0
|
||||
Input::Ckin2 => Ok((read(i2c, 129)? & 0x04) == 0), // LOS2_INT=0
|
||||
}
|
||||
}
|
||||
|
||||
fn locked(i2c: &mut I2c) -> Result<bool> {
|
||||
Ok((read(i2c, 130)? & 0x01) == 0) // LOL_INT=0
|
||||
}
|
||||
|
||||
fn monitor_lock(i2c: &mut I2c, timer: GlobalTimer) -> Result<()> {
|
||||
info!("waiting for Si5324 lock...");
|
||||
let timeout = timer.get_time() + Milliseconds(20_000);
|
||||
while !locked(i2c)? {
|
||||
// Yes, lock can be really slow.
|
||||
if timer.get_time() > timeout {
|
||||
return Err("Si5324 lock timeout");
|
||||
}
|
||||
}
|
||||
info!(" ...locked");
|
||||
Ok(())
|
||||
}
|
||||
|
||||
fn init(i2c: &mut I2c, timer: GlobalTimer) -> Result<()> {
|
||||
#[cfg(not(si5324_soft_reset))]
|
||||
hard_reset(timer);
|
||||
|
||||
#[cfg(feature = "target_kasli_soc")]
|
||||
{
|
||||
i2c.pca9548_select(0x70, 0)?;
|
||||
i2c.pca9548_select(0x71, 1 << 3)?;
|
||||
}
|
||||
|
||||
if ident(i2c)? != 0x0182 {
|
||||
return Err("Si5324 does not have expected product number");
|
||||
}
|
||||
|
||||
#[cfg(si5324_soft_reset)]
|
||||
soft_reset(i2c, timer)?;
|
||||
Ok(())
|
||||
}
|
||||
|
||||
pub fn bypass(i2c: &mut I2c, input: Input, timer: GlobalTimer) -> Result<()> {
|
||||
let cksel_reg = match input {
|
||||
Input::Ckin1 => 0b00,
|
||||
Input::Ckin2 => 0b01,
|
||||
};
|
||||
init(i2c, timer)?;
|
||||
rmw(i2c, 21, |v| v & 0xfe)?; // CKSEL_PIN=0
|
||||
rmw(i2c, 3, |v| (v & 0x3f) | (cksel_reg << 6))?; // CKSEL_REG
|
||||
rmw(i2c, 4, |v| (v & 0x3f) | (0b00 << 6))?; // AUTOSEL_REG=b00
|
||||
rmw(i2c, 6, |v| (v & 0xc0) | 0b111111)?; // SFOUT2_REG=b111 SFOUT1_REG=b111
|
||||
rmw(i2c, 0, |v| (v & 0xfd) | 0x02)?; // BYPASS_REG=1
|
||||
Ok(())
|
||||
}
|
||||
|
||||
pub fn setup(i2c: &mut I2c, settings: &FrequencySettings, input: Input, timer: GlobalTimer) -> Result<()> {
|
||||
let s = map_frequency_settings(settings)?;
|
||||
let cksel_reg = match input {
|
||||
Input::Ckin1 => 0b00,
|
||||
Input::Ckin2 => 0b01,
|
||||
};
|
||||
|
||||
init(i2c, timer)?;
|
||||
if settings.crystal_ref {
|
||||
rmw(i2c, 0, |v| v | 0x40)?; // FREE_RUN=1
|
||||
}
|
||||
rmw(i2c, 2, |v| (v & 0x0f) | (s.bwsel << 4))?;
|
||||
rmw(i2c, 21, |v| v & 0xfe)?; // CKSEL_PIN=0
|
||||
rmw(i2c, 3, |v| (v & 0x2f) | (cksel_reg << 6) | 0x10)?; // CKSEL_REG, SQ_ICAL=1
|
||||
rmw(i2c, 4, |v| (v & 0x3f) | (0b00 << 6))?; // AUTOSEL_REG=b00
|
||||
rmw(i2c, 6, |v| (v & 0xc0) | 0b111111)?; // SFOUT2_REG=b111 SFOUT1_REG=b111
|
||||
write(i2c, 25, (s.n1_hs << 5 ) as u8)?;
|
||||
write(i2c, 31, (s.nc1_ls >> 16) as u8)?;
|
||||
write(i2c, 32, (s.nc1_ls >> 8 ) as u8)?;
|
||||
write(i2c, 33, (s.nc1_ls) as u8)?;
|
||||
write(i2c, 34, (s.nc1_ls >> 16) as u8)?; // write to NC2_LS as well
|
||||
write(i2c, 35, (s.nc1_ls >> 8 ) as u8)?;
|
||||
write(i2c, 36, (s.nc1_ls) as u8)?;
|
||||
write(i2c, 40, (s.n2_hs << 5 ) as u8 | (s.n2_ls >> 16) as u8)?;
|
||||
write(i2c, 41, (s.n2_ls >> 8 ) as u8)?;
|
||||
write(i2c, 42, (s.n2_ls) as u8)?;
|
||||
write(i2c, 43, (s.n31 >> 16) as u8)?;
|
||||
write(i2c, 44, (s.n31 >> 8) as u8)?;
|
||||
write(i2c, 45, (s.n31) as u8)?;
|
||||
write(i2c, 46, (s.n32 >> 16) as u8)?;
|
||||
write(i2c, 47, (s.n32 >> 8) as u8)?;
|
||||
write(i2c, 48, (s.n32) as u8)?;
|
||||
rmw(i2c, 137, |v| v | 0x01)?; // FASTLOCK=1
|
||||
rmw(i2c, 136, |v| v | 0x40)?; // ICAL=1
|
||||
|
||||
if !has_xtal(i2c)? {
|
||||
return Err("Si5324 misses XA/XB signal");
|
||||
}
|
||||
if !has_ckin(i2c, input)? {
|
||||
return Err("Si5324 misses clock input signal");
|
||||
}
|
||||
|
||||
monitor_lock(i2c, timer)?;
|
||||
Ok(())
|
||||
}
|
||||
|
||||
pub fn select_input(i2c: &mut I2c, input: Input, timer: GlobalTimer) -> Result<()> {
|
||||
let cksel_reg = match input {
|
||||
Input::Ckin1 => 0b00,
|
||||
Input::Ckin2 => 0b01,
|
||||
};
|
||||
rmw(i2c, 3, |v| (v & 0x3f) | (cksel_reg << 6))?;
|
||||
if !has_ckin(i2c, input)? {
|
||||
return Err("Si5324 misses clock input signal");
|
||||
}
|
||||
monitor_lock(i2c, timer)?;
|
||||
Ok(())
|
||||
}
|
||||
Loading…
Reference in New Issue
Block a user